Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
corticosterone | [no description available] | high | 520 | 4 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
corticosterone | [no description available] | high | 520 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
prednisolone | [no description available] | high | 690 | 9 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
prednisolone | [no description available] | high | 690 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
prednisone | [no description available] | high | 748 | 7 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; immunosuppressive agent; prodrug |
prednisone | [no description available] | high | 748 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; immunosuppressive agent; prodrug |
triamcinolone | [no description available] | high | 173 | 0 | 11beta-hydroxy steroid; 16alpha-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
fludrocortisone | [no description available] | high | 107 | 3 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; fluorinated steroid; mineralocorticoid | adrenergic agent; anti-inflammatory drug |
fludrocortisone | [no description available] | high | 107 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; fluorinated steroid; mineralocorticoid | adrenergic agent; anti-inflammatory drug |
11-dehydrocorticosterone | [no description available] | high | 29 | 0 | 11-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
hydrocortisone acetate | [no description available] | medium | 29 | 0 | cortisol ester; tertiary alpha-hydroxy ketone | |
hydrocortisone acetate | [no description available] | medium | 29 | 1 | cortisol ester; tertiary alpha-hydroxy ketone | |
aldosterone | [no description available] | high | 372 | 4 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
aldosterone | [no description available] | high | 372 | 0 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
desoxycorticosterone | [no description available] | high | 810 | 2 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; mineralocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
desoxycorticosterone | [no description available] | high | 810 | 0 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; mineralocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
norethindrone | [no description available] | high | 14 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound; tertiary alcohol | progestin; synthetic oral contraceptive |
triamcinolone acetonide | [no description available] | high | 43 | 1 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; cyclic ketal; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
triamcinolone acetonide | [no description available] | high | 43 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; cyclic ketal; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
betamethasone | [no description available] | high | 94 | 4 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic agent; anti-inflammatory drug; immunosuppressive agent |
betamethasone | [no description available] | high | 94 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic agent; anti-inflammatory drug; immunosuppressive agent |
gestrinone | [no description available] | medium | 2 | 0 | oxo steroid | |
promegestone | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid | antineoplastic agent; progesterone receptor agonist; progestin |
mifepristone | [no description available] | high | 17 | 2 | 3-oxo-Delta(4) steroid; acetylenic compound; tertiary amino compound | abortifacient; contraceptive drug; hormone antagonist; synthetic oral contraceptive |
mifepristone | [no description available] | high | 17 | 0 | 3-oxo-Delta(4) steroid; acetylenic compound; tertiary amino compound | abortifacient; contraceptive drug; hormone antagonist; synthetic oral contraceptive |
epinastine | [no description available] | medium | 6 | 0 | corticosteroid hormone | |
cortodoxone | [no description available] | high | 93 | 3 | deoxycortisol; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
cortodoxone | [no description available] | high | 93 | 0 | deoxycortisol; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
16-methylprogesterone, (16alpha)-isomer | [no description available] | medium | 4 | 0 | | |
4-hydroxybenzaldehyde | [no description available] | medium | 2 | 0 | hydroxybenzaldehyde | EC 1.14.17.1 (dopamine beta-monooxygenase) inhibitor; mouse metabolite; plant metabolite |
4-hydroxybenzoic acid | [no description available] | medium | 5 | 0 | monohydroxybenzoic acid | algal metabolite; plant metabolite |
acetic acid | [no description available] | medium | 3 | 0 | monocarboxylic acid | antimicrobial food preservative; Daphnia magna metabolite; food acidity regulator; protic solvent |
acetone | [no description available] | high | 11 | 0 | ketone body; methyl ketone; propanones; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; human metabolite; polar aprotic solvent |
anthranilic acid | [no description available] | medium | 3 | 0 | aminobenzoic acid | human metabolite; mouse metabolite |
benzoic acid | [no description available] | medium | 7 | 0 | benzoic acids | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
1-butanol | [no description available] | high | 5 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
butyric acid | [no description available] | medium | 2 | 0 | fatty acid 4:0; straight-chain saturated fatty acid | human urinary metabolite; Mycoplasma genitalium metabolite |
chloroacetic acid | [no description available] | medium | 2 | 0 | chlorocarboxylic acid; haloacetic acid | alkylating agent; herbicide |
salicylic acid | [no description available] | medium | 25 | 0 | monohydroxybenzoic acid | algal metabolite; antifungal agent; antiinfective agent; EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor; keratolytic drug; plant hormone; plant metabolite |
guaiacol | [no description available] | medium | 3 | 0 | guaiacols | disinfectant; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; expectorant; plant metabolite |
hydroquinone | [no description available] | medium | 3 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
methanol | [no description available] | high | 12 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
4-aminobenzoic acid | [no description available] | medium | 13 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
4-nitrophenol | [no description available] | medium | 4 | 0 | 4-nitrophenols | human xenobiotic metabolite; mouse metabolite |
phenol | [no description available] | high | 5 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
1-propanol | [no description available] | medium | 7 | 0 | propan-1-ols; short-chain primary fatty alcohol | metabolite; protic solvent |
propionic acid | [no description available] | medium | 2 | 0 | saturated fatty acid; short-chain fatty acid | antifungal drug |
pyridine | [no description available] | medium | 4 | 0 | azaarene; mancude organic heteromonocyclic parent; monocyclic heteroarene; pyridines | environmental contaminant; NMR chemical shift reference compound |
vanillin | [no description available] | medium | 1 | 0 | benzaldehydes; monomethoxybenzene; phenols | anti-inflammatory agent; anticonvulsant; antioxidant; flavouring agent; plant metabolite |
benzamide | [no description available] | medium | 3 | 0 | benzamides | |
pentobarbital | [no description available] | medium | 10 | 0 | barbiturates | GABAA receptor agonist |
phenobarbital | [no description available] | medium | 21 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
aniline | [no description available] | medium | 3 | 0 | anilines; primary arylamine | |
17-alpha-hydroxyprogesterone | [no description available] | high | 57 | 2 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
17-alpha-hydroxyprogesterone | [no description available] | high | 57 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
n-pentanol | [no description available] | high | 4 | 0 | pentanol; short-chain primary fatty alcohol | human metabolite; plant metabolite |
ethylamine | [no description available] | medium | 2 | 0 | primary aliphatic amine | human metabolite |
tert-butylamine | [no description available] | medium | 1 | 0 | primary aliphatic amine | |
trichloroacetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
isobutyl alcohol | [no description available] | medium | 4 | 0 | alkyl alcohol; primary alcohol | Saccharomyces cerevisiae metabolite |
methyl acetate | [no description available] | medium | 3 | 0 | acetate ester; methyl ester; volatile organic compound | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor; fragrance; polar aprotic solvent |
dichloroacetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid; organochlorine compound | astringent; marine metabolite |
2-nitroaniline | [no description available] | medium | 2 | 0 | | |
2-nitrophenol | [no description available] | medium | 2 | 0 | 2-nitrophenols | |
3-nitroaniline | [no description available] | medium | 2 | 0 | | |
4-nitroaniline | [no description available] | medium | 3 | 0 | nitroaniline | bacterial xenobiotic metabolite |
propylamine | [no description available] | medium | 2 | 0 | alkylamines | |
n-pentanoic acid | [no description available] | medium | 1 | 0 | short-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
n-butylamine | [no description available] | medium | 2 | 0 | primary aliphatic amine | |
1-hexanol | [no description available] | medium | 4 | 0 | hexanol; primary alcohol | alarm pheromone; antibacterial agent; fragrance; plant metabolite |
heptanol | [no description available] | medium | 3 | 0 | heptanol; primary alcohol | flavouring agent; fragrance; gap junctional intercellular communication inhibitor; plant metabolite |
3-nitrobenzoic acid | [no description available] | medium | 4 | 0 | | |
2-naphthol | [no description available] | medium | 3 | 0 | naphthol | antinematodal drug; genotoxin; human urinary metabolite; human xenobiotic metabolite; mouse metabolite; radical scavenger |
ethyl acetate | [no description available] | medium | 3 | 0 | acetate ester; ethyl ester; volatile organic compound | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor; metabolite; polar aprotic solvent; Saccharomyces cerevisiae metabolite |
hexanoic acid | [no description available] | medium | 2 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | human metabolite; plant metabolite |
pregnenolone | [no description available] | high | 94 | 0 | 20-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; C21-steroid | human metabolite; mouse metabolite |
2-vanillin | [no description available] | medium | 1 | 0 | benzaldehydes; guaiacols | antimutagen; plant metabolite |
mequinol | [no description available] | medium | 3 | 0 | methoxybenzenes; phenols | metabolite |
3-nitrophenol | [no description available] | medium | 2 | 0 | 3-nitrophenols | |
isovanillin | [no description available] | medium | 1 | 0 | benzaldehydes; monomethoxybenzene; phenols | animal metabolite; antidiarrhoeal drug; antifungal agent; EC 1.2.3.1 (aldehyde oxidase) inhibitor; HIV protease inhibitor; plant metabolite |
3 alpha,17 alpha-dihydroxy-5 beta-pregnan-20-one | [no description available] | medium | 5 | 0 | 17alpha-hydroxy steroid; 20-oxo steroid; 3alpha-hydroxy steroid; C21-steroid; corticosteroid hormone | human urinary metabolite |
cortisone acetate | [no description available] | medium | 3 | 0 | corticosteroid hormone | |
prednisolone acetate | [no description available] | medium | 11 | 0 | corticosteroid hormone | |
paramethasone | [no description available] | medium | 35 | 0 | fluorinated steroid | |
paramethasone | [no description available] | medium | 35 | 1 | fluorinated steroid | |
fluprednisolone | [no description available] | medium | 7 | 0 | fluorinated steroid | |
fluocinolone acetonide | [no description available] | high | 15 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic ketal; fluorinated steroid; glucocorticoid; organic heteropentacyclic compound; primary alpha-hydroxy ketone | anti-inflammatory drug; antipruritic drug |
methylprednisolone | [no description available] | high | 133 | 1 | 6-methylprednisolone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antiemetic; environmental contaminant; neuroprotective agent; xenobiotic |
methylprednisolone | [no description available] | high | 133 | 0 | 6-methylprednisolone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antiemetic; environmental contaminant; neuroprotective agent; xenobiotic |
fluocortolone | [no description available] | high | 2 | 0 | 21-hydroxy steroid | |
fluocinonide | [no description available] | medium | 3 | 0 | organic molecular entity | |
flurandrenolone | [no description available] | high | 7 | 0 | 21-hydroxy steroid | |
flumethasone | [no description available] | high | 10 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
betamethasone valerate | [no description available] | high | 4 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; primary alpha-hydroxy ketone; steroid ester | anti-inflammatory drug |
beclomethasone dipropionate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; corticosteroid; enone; glucocorticoid; propanoate ester; steroid ester | anti-arrhythmia drug; anti-asthmatic drug; anti-inflammatory drug; prodrug |
betamethasone-17,21-dipropionate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; propanoate ester; steroid ester | antipsoriatic |
hydrocortisone-17-butyrate | [no description available] | medium | 3 | 0 | butyrate ester; cortisol ester; primary alpha-hydroxy ketone | dermatologic drug; drug allergen |
clobetasol propionate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; fluorinated steroid; glucocorticoid | anti-inflammatory drug |
beclomethasone 17-monopropionate | [no description available] | medium | 1 | 0 | | |
prednisolone phosphate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; glucocorticoid; steroid phosphate; tertiary alpha-hydroxy ketone | anti-inflammatory agent; antineoplastic agent; glucocorticoid receptor agonist; prodrug |
nisone | [no description available] | medium | 1 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; acetate ester; steroid ester; tertiary alpha-hydroxy ketone | |
fluocinolone | [no description available] | medium | 1 | 0 | fluorinated steroid | |
diflucortolone valerate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
fludrocortisone acetate | [no description available] | medium | 6 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; fluorinated steroid; mineralocorticoid; tertiary alpha-hydroxy ketone | |
medrysone | [no description available] | medium | 2 | 0 | corticosteroid hormone | |
difluprednate | [no description available] | medium | 2 | 0 | butyrate ester; corticosteroid hormone | |
halcinonide | [no description available] | medium | 2 | 0 | organic molecular entity | SMO receptor agonist |
betamethasone acetate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; acetate ester; fluorinated steroid; steroid ester; tertiary alpha-hydroxy ketone | |
flumethasone pivalate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; pivalate ester; tertiary alpha-hydroxy ketone | anti-inflammatory drug; antipruritic drug |
desonide | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; corticosteroid; cyclic ketal; primary alpha-hydroxy ketone | anti-inflammatory drug |
estriol | [no description available] | high | 58 | 1 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
estriol | [no description available] | high | 58 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
estrone | [no description available] | high | 125 | 0 | 17-oxo steroid; 3-hydroxy steroid; phenolic steroid; phenols | antineoplastic agent; bone density conservation agent; estrogen; human metabolite; mouse metabolite |
androsterone | [no description available] | high | 69 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid; C19-steroid | androgen; anticonvulsant; human blood serum metabolite; human metabolite; human urinary metabolite; mouse metabolite; pheromone |
etiocholanolone | [no description available] | high | 46 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid | human metabolite; mouse metabolite |
androstenedione | [no description available] | high | 61 | 1 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
androstenedione | [no description available] | high | 61 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
nandrolone | [no description available] | high | 40 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; anabolic androgenic steroid | human metabolite |
androstenediol | [no description available] | medium | 10 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid | androgen; human metabolite; mouse metabolite; radiation protective agent |
dihydrotestosterone | [no description available] | high | 29 | 0 | 17beta-hydroxy steroid; 17beta-hydroxyandrostan-3-one; 3-oxo-5alpha-steroid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
algestone | [no description available] | medium | 8 | 0 | 16alpha-hydroxy steroid; 17-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; C21-steroid; tertiary alpha-hydroxy ketone | progestin |
17-alpha-hydroxypregnenolone | [no description available] | high | 13 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; hydroxypregnenolone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
11-ketoprogesterone | [no description available] | medium | 10 | 0 | corticosteroid hormone | |
2 alpha-methyl-9 alpha-fluorocortisol | [no description available] | medium | 8 | 0 | | |
5 alpha-androstane-3 beta,17 beta-diol | [no description available] | medium | 9 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy steroid; androstane-3,17-diol | Daphnia magna metabolite; human metabolite |
hydrocortisone acetate, (11beta)-isomer | [no description available] | medium | 3 | 0 | | |
3-chlorobenzoic acid | [no description available] | medium | 2 | 0 | monochlorobenzoic acid | drug metabolite |
1-methyl-4-phenyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | methylpyridines; phenylpyridine; tetrahydropyridine | neurotoxin |
clonidine | [no description available] | medium | 7 | 0 | clonidine; imidazoline | |
dehydroepiandrosterone | [no description available] | high | 124 | 2 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
dehydroepiandrosterone | [no description available] | high | 124 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
4-nitrobenzoic acid | [no description available] | medium | 3 | 0 | nitrobenzoic acid | |
4-chlorobenzoic acid | [no description available] | medium | 2 | 0 | monochlorobenzoic acid | bacterial xenobiotic metabolite |
4-tert-butylbenzoic acid | [no description available] | medium | 2 | 0 | alkylbenzene | |
3-toluic acid | [no description available] | medium | 2 | 0 | methylbenzoic acid | human xenobiotic metabolite |
3-aminobenzoic acid | [no description available] | medium | 3 | 0 | aminobenzoic acid | |
3-hydroxybenzoic acid | [no description available] | medium | 2 | 0 | monohydroxybenzoic acid | bacterial metabolite; plant metabolite |
4-toluic acid | [no description available] | medium | 2 | 0 | methylbenzoic acid | |
4-anisic acid | [no description available] | medium | 3 | 0 | methoxybenzoic acid | plant metabolite |
4-(trifluoromethyl)benzoic acid | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; benzoic acids | |
3-fluorobenzoic acid | [no description available] | medium | 2 | 0 | fluorobenzoic acid | |
4-fluorobenzoic acid | [no description available] | medium | 2 | 0 | fluorobenzoic acid | bacterial xenobiotic metabolite |
3-methoxybenzoic acid | [no description available] | medium | 2 | 0 | methoxybenzoic acid | flavouring agent; human urinary metabolite |
4-bromobenzoic acid | [no description available] | medium | 2 | 0 | bromobenzoic acid | |
3-iodobenzoate | [no description available] | medium | 2 | 0 | iodobenzoic acid | |
4-ethylbenzoic acid | [no description available] | medium | 2 | 0 | benzoic acids | |
4-cyanobenzoic acid | [no description available] | medium | 2 | 0 | | |
st 91 | [no description available] | medium | 1 | 0 | substituted aniline | |
norharman | [no description available] | medium | 3 | 0 | beta-carbolines; mancude organic heterotricyclic parent | fungal metabolite; marine metabolite |
4-(fluorosulfonyl)benzoic acid | [no description available] | medium | 2 | 0 | | |
tiazuril | [no description available] | medium | 1 | 0 | aryl sulfide | |
2-(2-methyl-4-chlorophenylamino)-2-imidazoline | [no description available] | medium | 1 | 0 | | |
xylonidine | [no description available] | medium | 1 | 0 | | |
1-methyl-4-(4-chlorophenyl)-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
4-phenyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
4-(methylthio)benzoic acid | [no description available] | medium | 2 | 0 | | |
1-methyl-4-(2'-methylphenyl)-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
4-mercaptobenzoate | [no description available] | medium | 2 | 0 | | |
2,5-dihydro-2-(4-methoxyphenyl)-3h-pyrazolo(4,3-c)quinolin-3-one | [no description available] | medium | 2 | 0 | | |
beta-carboline-3-carboxylic acid ethyl ester | [no description available] | medium | 3 | 0 | beta-carbolines | |
beta-carboline-3-carboxylic acid methyl ester | [no description available] | medium | 3 | 0 | beta-carbolines | |
2-methyltryptoline | [no description available] | medium | 1 | 0 | beta-carbolines | |
3-ethoxy-beta-carboline | [no description available] | medium | 2 | 0 | | |
tert-butyl beta-carboline-3-carboxylate | [no description available] | medium | 2 | 0 | | |
1-methyl-4-cyclohexyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
1-methyl-4-(2'-ethylphenyl)-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
1-methyl-4-(methylpyrrol-2-yl)-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
4-benzyl-1-methyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
n-propyl-4-phenyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | | |
diclazuril | [no description available] | medium | 1 | 0 | nitrile | |
3-propoxy-beta-carboline | [no description available] | medium | 2 | 0 | | |
harman | [no description available] | medium | 3 | 0 | harmala alkaloid; indole alkaloid fundamental parent; indole alkaloid | anti-HIV agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; plant metabolite |
1-Ethyl-9H-pyrido[3,4-b]indole | [no description available] | medium | 2 | 0 | harmala alkaloid | |
19-norprogesterone | [no description available] | medium | 5 | 0 | corticosteroid hormone | |
imidazole | [no description available] | medium | 3 | 0 | imidazole | |
1-methylimidazole | [no description available] | medium | 2 | 0 | imidazoles | |
azomycin | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles | antitubercular agent |
2-methylimidazole | [no description available] | medium | 1 | 0 | | |
1-methyl-2-nitroimidazole | [no description available] | medium | 1 | 0 | | |
2-ethylimidazole | [no description available] | medium | 1 | 0 | | |
2-phenylimidazole | [no description available] | medium | 1 | 0 | | |
2-aminoimidazole | [no description available] | medium | 1 | 0 | | |
r 79882 | [no description available] | medium | 1 | 0 | | |
r 82150 | [no description available] | medium | 1 | 0 | | |
r 86183 | [no description available] | medium | 1 | 0 | | |
thiorphan | [no description available] | medium | 2 | 0 | N-acyl-amino acid | |
trimethoprim | [no description available] | medium | 9 | 0 | aminopyrimidine; methoxybenzenes | antibacterial drug; diuretic; drug allergen; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; environmental contaminant; xenobiotic |
4,6-diamino-2,2-dimethyl-1,2-dihydro-1-phenyl-s-triazine | [no description available] | medium | 1 | 0 | | |
diaveridine | [no description available] | medium | 1 | 0 | aminopyrimidine | antiparasitic agent; drug allergen |
captopril | [no description available] | medium | 3 | 0 | alkanethiol; L-proline derivative; N-acylpyrrolidine; pyrrolidinemonocarboxylic acid | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
2,4-diamino-5-benzylpyrimidine | [no description available] | medium | 1 | 0 | | |
2,4-diamino-5,6-dihydro-6,6-dimethyl-5-(4'-methoxyphenyl)-s-triazine | [no description available] | medium | 1 | 0 | | |
retrothiorphan | [no description available] | medium | 1 | 0 | | |
a 58365a | [no description available] | medium | 1 | 0 | | |
enalaprilat anhydrous | [no description available] | medium | 2 | 0 | dicarboxylic acid; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
haloperidol | [no description available] | medium | 8 | 0 | aromatic ketone; hydroxypiperidine; monochlorobenzenes; organofluorine compound; tertiary alcohol | antidyskinesia agent; antiemetic; dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
strophanthidin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 19-oxo steroid; 3beta-hydroxy steroid; 5beta-hydroxy steroid; cardenolides; steroid aldehyde | |
chlormadinone acetate | [no description available] | medium | 5 | 0 | corticosteroid hormone | |
digoxigenin | [no description available] | medium | 1 | 0 | 12beta-hydroxy steroid; 14beta-hydroxy steroid; 3beta-hydroxy steroid; 3beta-sterol | hapten; plant metabolite |
gitoxin | [no description available] | medium | 1 | 0 | cardenolide glycoside | |
digoxigenin-bis(digitoxoside) | [no description available] | medium | 1 | 0 | cardenolide glycoside | |
digoxigenin-mono(digitoxoside) | [no description available] | medium | 1 | 0 | cardenolide glycoside; digitoxoside; monosaccharide derivative; steroid saponin | metabolite |
acetylstrophanthidin | [no description available] | medium | 1 | 0 | acetate ester | anti-arrhythmia drug |
gitoxigenin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 16beta-hydroxy steroid; 3beta-hydroxy steroid | |
ouabain | [no description available] | medium | 15 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
digitoxin | [no description available] | medium | 13 | 0 | cardenolide glycoside | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor |
neriifolin | [no description available] | medium | 1 | 0 | cardenolide glycoside | cardiotonic drug; neuroprotective agent; toxin |
lanatoside c | [no description available] | medium | 1 | 0 | | |
prednisolone hemisuccinate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; hemisuccinate; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
digoxin | [no description available] | medium | 8 | 0 | cardenolide glycoside; steroid saponin | anti-arrhythmia drug; cardiotonic drug; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; epitope |
digitoxigenin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 3beta-hydroxy steroid | |
acetyldigitoxin | [no description available] | medium | 1 | 0 | cardenolide glycoside | anti-arrhythmia drug; cardiotonic drug; enzyme inhibitor |
proscillaridin | [no description available] | medium | 3 | 0 | organic molecular entity | |
bufalin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 3beta-hydroxy steroid | animal metabolite; anti-inflammatory agent; antineoplastic agent; cardiotonic drug |
oleandrigenin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 3beta-hydroxy steroid; steroid ester | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; metabolite |
gitaloxin | [no description available] | medium | 1 | 0 | cardenolide glycoside | metabolite |
cinobufagin | [no description available] | medium | 1 | 0 | steroid lactone | |
ouabagenin | [no description available] | medium | 1 | 0 | 1-hydroxy steroid; 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 19-hydroxy steroid; 3beta-hydroxy steroid; 5beta-hydroxy steroid | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor |
acovenoside a | [no description available] | medium | 1 | 0 | | |
ethyl 2-methyl-3-oxobutanoate | [no description available] | medium | 1 | 0 | | |
glycerol | [no description available] | high | 21 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
propylene glycol | [no description available] | high | 3 | 0 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
toluene | [no description available] | medium | 3 | 0 | methylbenzene; toluenes; volatile organic compound | cholinergic antagonist; fuel additive; neurotoxin; non-polar solvent |
verapamil | [no description available] | medium | 9 | 0 | aromatic ether; nitrile; polyether; tertiary amino compound | |
2-propanol | [no description available] | medium | 22 | 0 | secondary alcohol; secondary fatty alcohol | protic solvent |
methoctramine | [no description available] | medium | 2 | 0 | aromatic ether; tetramine | muscarinic antagonist |
methylethyl ketone | [no description available] | medium | 2 | 0 | butanone; dialkyl ketone; methyl ketone; volatile organic compound | bacterial metabolite; polar aprotic solvent |
methylcyclopentane | [no description available] | medium | 1 | 0 | cycloalkane; volatile organic compound | human metabolite; plant metabolite |
styrene | [no description available] | medium | 2 | 0 | styrenes; vinylarene; volatile organic compound | mouse metabolite; mutagen; plant metabolite |
2-ethylhexanol | [no description available] | medium | 1 | 0 | primary alcohol | plant metabolite; volatile oil component |
4-xylene | [no description available] | medium | 2 | 0 | xylene | |
2-methylpentane | [no description available] | medium | 2 | 0 | alkane | |
methyl isobutyl ketone | [no description available] | medium | 1 | 0 | ketone | |
cyclohexanol | [no description available] | medium | 4 | 0 | cyclohexanols; secondary alcohol | solvent |
2-heptanone | [no description available] | medium | 1 | 0 | dialkyl ketone; methyl ketone | mouse metabolite; pheromone |
n-butoxyethanol | [no description available] | medium | 2 | 0 | glycol ether; primary alcohol | protic solvent |
n-dodecane | [no description available] | medium | 1 | 0 | alkane | plant metabolite |
sec-butylbenzene | [no description available] | medium | 1 | 0 | alkylbenzene | |
4-fluoroaniline | [no description available] | medium | 1 | 0 | fluoroaniline; primary arylamine | |
3-methylhexane | [no description available] | medium | 1 | 0 | alkane; volatile organic compound | human metabolite |
2,2-dimethylbutyric acid | [no description available] | medium | 1 | 0 | dimethylbutyric acid | metabolite |
3-ethyltoluene | [no description available] | medium | 1 | 0 | toluenes | |
ethoxyacetic acid | [no description available] | medium | 1 | 0 | carboxylic acid | |
butyl acetate | [no description available] | medium | 1 | 0 | acetate ester | metabolite |
1-nitro-2,4-difluorobenzene | [no description available] | medium | 1 | 0 | | |
w 84 | [no description available] | medium | 1 | 0 | | |
heptane-1,7-bis(dimethyl-3'-phthalimidopropylammonium) | [no description available] | medium | 1 | 0 | | |
17-desoxyestradiol | [no description available] | medium | 2 | 0 | 3-hydroxy steroid; phenolic steroid; phenols | estrogen |
epitestosterone | [no description available] | high | 4 | 0 | 17alpha-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen antagonist; human metabolite |
formestane | [no description available] | medium | 3 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; enol; hydroxy steroid | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
1,4-androstadiene-3,17-dione | [no description available] | medium | 2 | 0 | 17-oxo steroid; 3-oxo-Delta(1) steroid; 3-oxo-Delta(4) steroid | |
5beta-pregnane-3,20-dione | [no description available] | high | 1 | 0 | 20-oxo steroid; 3-oxo-5beta-steroid; C21-steroid | human metabolite; mouse metabolite |
brexanolone | [no description available] | medium | 2 | 0 | 3-hydroxy-5alpha-pregnan-20-one | antidepressant; GABA modulator; human metabolite; intravenous anaesthetic; sedative |
5-alpha-dihydroprogesterone | [no description available] | high | 1 | 0 | 20-oxo steroid; 3-oxo-5alpha-steroid; C21-steroid hormone | human metabolite; progestogen |
androst-16-en-3-ol | [no description available] | medium | 1 | 0 | 3alpha-sterol | pheromone |
6 beta-hydroxycortisol | [no description available] | high | 14 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; 6beta-hydroxy steroid; C21-steroid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mammalian metabolite; probe |
6 beta-hydroxycortisol | [no description available] | high | 14 | 2 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; 6beta-hydroxy steroid; C21-steroid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mammalian metabolite; probe |
benzaldehyde | [no description available] | medium | 2 | 0 | benzaldehydes | EC 3.1.1.3 (triacylglycerol lipase) inhibitor; EC 3.5.5.1 (nitrilase) inhibitor; flavouring agent; fragrance; odorant receptor agonist; plant metabolite |
benzene | [no description available] | medium | 12 | 0 | aromatic annulene; benzenes; volatile organic compound | carcinogenic agent; environmental contaminant; non-polar solvent |
benzyl alcohol | [no description available] | medium | 5 | 0 | benzyl alcohols | antioxidant; fragrance; metabolite; solvent |
2-cresol | [no description available] | medium | 1 | 0 | cresol | human xenobiotic metabolite |
3-cresol | [no description available] | medium | 2 | 0 | cresol | human xenobiotic metabolite |
indole | [no description available] | medium | 2 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
acetanilide | [no description available] | medium | 3 | 0 | acetamides; anilide | analgesic |
n,n-dimethylaniline | [no description available] | medium | 2 | 0 | dimethylaniline; tertiary amine | |
phenylacetic acid | [no description available] | medium | 3 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
dimethyl sulfide | [no description available] | medium | 1 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
thiophane | [no description available] | medium | 1 | 0 | saturated organic heteromonocyclic parent; tetrahydrothiophenes | |
phenytoin | [no description available] | medium | 23 | 0 | imidazolidine-2,4-dione | anticonvulsant; drug allergen; sodium channel blocker; teratogenic agent |
alprenolol | [no description available] | medium | 3 | 0 | secondary alcohol; secondary amino compound | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
theophylline | [no description available] | medium | 34 | 0 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
antipyrine | [no description available] | medium | 9 | 0 | pyrazolone | antipyretic; cyclooxygenase 3 inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
astemizole | [no description available] | medium | 4 | 0 | benzimidazoles; piperidines | anti-allergic agent; anticoronaviral agent; H1-receptor antagonist |
atenolol | [no description available] | medium | 6 | 0 | ethanolamines; monocarboxylic acid amide; propanolamine | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; sympatholytic agent; xenobiotic |
barbital | [no description available] | medium | 5 | 0 | barbiturates | drug allergen |
chlorpheniramine | [no description available] | medium | 8 | 0 | monochlorobenzenes; pyridines; tertiary amino compound | anti-allergic agent; antidepressant; antipruritic drug; H1-receptor antagonist; histamine antagonist; serotonin uptake inhibitor |
chlorpromazine | [no description available] | medium | 74 | 0 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
chlorpromazine | [no description available] | medium | 74 | 1 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
ciprofloxacin | [no description available] | medium | 5 | 0 | aminoquinoline; cyclopropanes; fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone; zwitterion | antibacterial drug; antiinfective agent; antimicrobial agent; DNA synthesis inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; environmental contaminant; topoisomerase IV inhibitor; xenobiotic |
4-cresol | [no description available] | medium | 2 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
desipramine | [no description available] | medium | 5 | 0 | dibenzoazepine; secondary amino compound | adrenergic uptake inhibitor; alpha-adrenergic antagonist; antidepressant; cholinergic antagonist; drug allergen; EC 3.1.4.12 (sphingomyelin phosphodiesterase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; serotonin uptake inhibitor |
nordazepam | [no description available] | medium | 2 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; GABA modulator; human metabolite; sedative |
amphetamine | [no description available] | medium | 12 | 0 | primary amine | |
diazepam | [no description available] | medium | 14 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; environmental contaminant; sedative; xenobiotic |
diphenhydramine | [no description available] | medium | 18 | 0 | ether; tertiary amino compound | anti-allergic agent; antidyskinesia agent; antiemetic; antiparkinson drug; antipruritic drug; antitussive; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; oneirogen; sedative |
epinastine | [no description available] | medium | 2 | 0 | benzazepine; guanidines | anti-allergic agent; H1-receptor antagonist; histamine antagonist; ophthalmology drug |
flumequine | [no description available] | medium | 2 | 0 | 3-oxo monocarboxylic acid; organofluorine compound; pyridoquinoline; quinolone antibiotic | |
fluoxetine | [no description available] | medium | 4 | 0 | (trifluoromethyl)benzenes; aromatic ether; secondary amino compound | |
flurbiprofen | [no description available] | medium | 6 | 0 | fluorobiphenyl; monocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
furosemide | [no description available] | medium | 21 | 0 | chlorobenzoic acid; furans; sulfonamide | environmental contaminant; loop diuretic; xenobiotic |
hexobarbital | [no description available] | medium | 10 | 0 | barbiturates | |
hydroxyzine | [no description available] | medium | 2 | 0 | hydroxyether; monochlorobenzenes; N-alkylpiperazine | anticoronaviral agent; antipruritic drug; anxiolytic drug; dermatologic drug; H1-receptor antagonist |
ibuprofen | [no description available] | medium | 9 | 0 | monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; radical scavenger; xenobiotic |
lidocaine | [no description available] | medium | 26 | 0 | benzenes; monocarboxylic acid amide; tertiary amino compound | anti-arrhythmia drug; drug allergen; environmental contaminant; local anaesthetic; xenobiotic |
lidocaine | [no description available] | medium | 26 | 2 | benzenes; monocarboxylic acid amide; tertiary amino compound | anti-arrhythmia drug; drug allergen; environmental contaminant; local anaesthetic; xenobiotic |
imipramine | [no description available] | medium | 6 | 0 | dibenzoazepine | adrenergic uptake inhibitor; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
indomethacin | [no description available] | medium | 62 | 0 | aromatic ether; indole-3-acetic acids; monochlorobenzenes; N-acylindole | analgesic; drug metabolite; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; gout suppressant; non-steroidal anti-inflammatory drug; xenobiotic metabolite; xenobiotic |
ketoprofen | [no description available] | medium | 8 | 0 | benzophenones; oxo monocarboxylic acid | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
loratadine | [no description available] | medium | 3 | 0 | benzocycloheptapyridine; ethyl ester; N-acylpiperidine; organochlorine compound; tertiary carboxamide | anti-allergic agent; cholinergic antagonist; geroprotector; H1-receptor antagonist |
metolazone | [no description available] | medium | 3 | 0 | organochlorine compound; quinazolines; sulfonamide | antihypertensive agent; diuretic; ion transport inhibitor |
metoprolol | [no description available] | medium | 4 | 0 | aromatic ether; propanolamine; secondary alcohol; secondary amino compound | antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; geroprotector; xenobiotic |
oxazepam | [no description available] | medium | 3 | 0 | 1,4-benzodiazepinone; organochlorine compound | anxiolytic drug; environmental contaminant; xenobiotic |
oxprenolol | [no description available] | medium | 5 | 0 | aromatic ether | |
papaverine | [no description available] | medium | 6 | 0 | benzylisoquinoline alkaloid; dimethoxybenzene; isoquinolines | antispasmodic drug; vasodilator agent |
4-chlorophenol | [no description available] | medium | 2 | 0 | monochlorophenol | |
phenazopyridine | [no description available] | medium | 1 | 0 | diaminopyridine; monoazo compound | anticoronaviral agent; carcinogenic agent; local anaesthetic; non-narcotic analgesic |
pindolol | [no description available] | medium | 5 | 0 | indoles; secondary amine | antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; serotonergic antagonist; vasodilator agent |
pindolol | [no description available] | medium | 5 | 1 | indoles; secondary amine | antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; serotonergic antagonist; vasodilator agent |
practolol | [no description available] | medium | 4 | 0 | acetamides; ethanolamines; propanolamine; secondary alcohol; secondary amino compound | anti-arrhythmia drug; beta-adrenergic antagonist |
procaine | [no description available] | medium | 30 | 0 | benzoate ester; substituted aniline; tertiary amino compound | central nervous system depressant; drug allergen; local anaesthetic; peripheral nervous system drug |
propranolol | [no description available] | medium | 23 | 0 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
propranolol | [no description available] | medium | 23 | 2 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
pyrilamine | [no description available] | medium | 5 | 0 | aromatic ether; ethylenediamine derivative | H1-receptor antagonist |
secobarbital | [no description available] | medium | 2 | 0 | barbiturates | anaesthesia adjuvant; GABA modulator; sedative |
sulfasalazine | [no description available] | medium | 23 | 0 | | |
sulfasalazine | [no description available] | medium | 23 | 1 | | |
sulpiride | [no description available] | medium | 5 | 0 | benzamides; N-alkylpyrrolidine; sulfonamide | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
terfenadine | [no description available] | medium | 4 | 0 | diarylmethane | |
tetracaine | [no description available] | medium | 5 | 0 | benzoate ester; tertiary amino compound | local anaesthetic |
ultram | [no description available] | medium | 1 | 0 | aromatic ether; tertiary alcohol; tertiary amino compound | |
tranexamic acid | [no description available] | medium | 2 | 0 | amino acid | |
physostigmine | [no description available] | medium | 6 | 0 | carbamate ester; indole alkaloid | antidote to curare poisoning; EC 3.1.1.8 (cholinesterase) inhibitor; miotic |
aminopyrine | [no description available] | medium | 36 | 0 | pyrazolone; tertiary amino compound | antipyretic; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
chloroform | [no description available] | medium | 12 | 0 | chloromethanes; one-carbon compound | carcinogenic agent; central nervous system drug; inhalation anaesthetic; non-polar solvent; refrigerant |
mannitol | [no description available] | medium | 16 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
1,1,1-trichloroethane | [no description available] | medium | 1 | 0 | chloroethanes | polar solvent |
tert-butyl alcohol | [no description available] | medium | 2 | 0 | tertiary alcohol | human xenobiotic metabolite |
2,6-dichlorophenol | [no description available] | medium | 1 | 0 | dichlorophenol | |
2-tert-butylphenol | [no description available] | medium | 1 | 0 | alkylbenzene | |
2-isopropylphenol | [no description available] | medium | 1 | 0 | phenols | |
thymol | [no description available] | medium | 4 | 0 | monoterpenoid; phenols | volatile oil component |
1-naphthol | [no description available] | medium | 1 | 0 | naphthol | genotoxin; human xenobiotic metabolite |
quinoline | [no description available] | medium | 2 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; quinolines | |
diphenyl | [no description available] | medium | 2 | 0 | aromatic fungicide; benzenes; biphenyls | antifungal agrochemical; antimicrobial food preservative |
methyl benzoate | [no description available] | medium | 2 | 0 | benzoate ester; methyl ester | insect attractant; metabolite |
2-toluidine | [no description available] | medium | 1 | 0 | aminotoluene | carcinogenic agent |
2-bromophenol | [no description available] | medium | 1 | 0 | bromophenol | marine metabolite |
2-chlorophenol | [no description available] | medium | 1 | 0 | 2-halophenol; monochlorophenol | |
3,4-dimethylphenol | [no description available] | medium | 2 | 0 | phenols | |
2,5-xylenol | [no description available] | medium | 1 | 0 | phenols | animal metabolite; volatile oil component |
butylphen | [no description available] | medium | 2 | 0 | phenols | allergen |
acetophenone | [no description available] | medium | 2 | 0 | acetophenones | animal metabolite; photosensitizing agent; xenobiotic |
nitrobenzene | [no description available] | medium | 4 | 0 | nitroarene; nitrobenzenes | |
benzylamine | [no description available] | medium | 1 | 0 | aralkylamine; primary amine | allergen; EC 3.5.5.1 (nitrilase) inhibitor; plant metabolite |
benzonitrile | [no description available] | medium | 2 | 0 | benzenes; nitrile | |
methylaniline | [no description available] | medium | 2 | 0 | methylaniline; phenylalkylamine; secondary amine | |
anisole | [no description available] | medium | 3 | 0 | monomethoxybenzene | plant metabolite |
methylphenylsulfide | [no description available] | medium | 1 | 0 | aryl sulfide; benzenes | |
2,4-dimethylphenol | [no description available] | medium | 1 | 0 | aromatic fungicide; phenols | disinfectant; volatile oil component |
4-bromophenol | [no description available] | medium | 2 | 0 | bromophenol | human urinary metabolite; human xenobiotic metabolite; marine metabolite; mouse metabolite; persistent organic pollutant; rat metabolite |
4-chloroaniline | [no description available] | medium | 1 | 0 | chloroaniline; monochlorobenzenes | |
4-toluidine | [no description available] | medium | 1 | 0 | aminotoluene | |
2-pentanone | [no description available] | medium | 1 | 0 | methyl ketone; pentanone | plant metabolite |
3-chloroaniline | [no description available] | medium | 1 | 0 | | |
3-chlorophenol | [no description available] | medium | 2 | 0 | monochlorophenol | |
3,5-xylenol | [no description available] | medium | 1 | 0 | phenols | xenobiotic metabolite |
bromobenzene | [no description available] | medium | 2 | 0 | bromoarene; bromobenzenes; volatile organic compound | hepatotoxic agent; mouse metabolite; non-polar solvent |
chlorobenzene | [no description available] | medium | 1 | 0 | monochlorobenzenes | solvent |
propyl acetate | [no description available] | medium | 1 | 0 | acetate ester | fragrance; plant metabolite |
pentane | [no description available] | medium | 1 | 0 | alkane; volatile organic compound | non-polar solvent; refrigerant |
isoquinoline | [no description available] | medium | 2 | 0 | azaarene; isoquinolines; mancude organic heterobicyclic parent; ortho-fused heteroarene | |
3-hydroxyanisole | [no description available] | medium | 2 | 0 | monomethoxybenzene; phenols | |
ephedrine | [no description available] | medium | 17 | 0 | phenethylamine alkaloid; phenylethanolamines | bacterial metabolite; environmental contaminant; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
3-fluorophenol | [no description available] | medium | 2 | 0 | | |
fluorobenzenes | [no description available] | medium | 3 | 0 | monofluorobenzenes | NMR chemical shift reference compound |
methamphetamine | [no description available] | medium | 3 | 0 | amphetamines; secondary amine | central nervous system stimulant; environmental contaminant; neurotoxin; psychotropic drug; xenobiotic |
lactulose | [no description available] | medium | 2 | 0 | glycosylfructose | gastrointestinal drug; laxative |
2,6-xylenol | [no description available] | medium | 1 | 0 | hydroxytoluene | |
2-methoxybenzoic acid | [no description available] | medium | 1 | 0 | methoxybenzoic acid | flavouring agent; non-steroidal anti-inflammatory drug |
3,5-dichlorophenol | [no description available] | medium | 2 | 0 | dichlorophenol | |
iodobenzene | [no description available] | medium | 2 | 0 | | |
methyl n-butyl ketone | [no description available] | medium | 1 | 0 | ketone | |
2-cyanophenol | [no description available] | medium | 1 | 0 | benzenes; nitrile | |
4-cyanophenol | [no description available] | medium | 1 | 0 | phenols | EC 1.4.3.4 (monoamine oxidase) inhibitor |
4-phenylpyridine | [no description available] | medium | 1 | 0 | phenylpyridine | |
diphenyl sulfoxide | [no description available] | medium | 1 | 0 | sulfoxide | |
methyl phenyl sulfoxide | [no description available] | medium | 1 | 0 | benzenes; sulfoxide | |
azatadine | [no description available] | medium | 1 | 0 | benzocycloheptapyridine; tertiary amine | anti-allergic agent; H1-receptor antagonist |
dimethindene | [no description available] | medium | 1 | 0 | indene | |
olsalazine | [no description available] | medium | 3 | 0 | azobenzenes; dicarboxylic acid | non-steroidal anti-inflammatory drug; prodrug |
timolol | [no description available] | medium | 3 | 0 | timolol | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist |
penbutolol | [no description available] | medium | 1 | 0 | ethanolamines | |
diltiazem | [no description available] | medium | 3 | 0 | 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate | antihypertensive agent; calcium channel blocker; vasodilator agent |
foscarnet sodium | [no description available] | medium | 1 | 0 | one-carbon compound; organic sodium salt | antiviral drug |
cicletanine | [no description available] | medium | 1 | 0 | organochlorine compound | |
temelastine | [no description available] | medium | 1 | 0 | pyrimidone | |
4-trifluoromethylphenol | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; phenols | drug metabolite; marine xenobiotic metabolite |
nicotine | [no description available] | medium | 12 | 0 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
nicotine | [no description available] | medium | 12 | 1 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
naproxen | [no description available] | medium | 6 | 0 | methoxynaphthalene; monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
raffinose | [no description available] | medium | 1 | 0 | raffinose family oligosaccharide; trisaccharide | mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
thiopental | [no description available] | medium | 5 | 0 | barbiturates | anticonvulsant; drug allergen; environmental contaminant; intravenous anaesthetic; sedative; xenobiotic |
thiopental | [no description available] | medium | 5 | 1 | barbiturates | anticonvulsant; drug allergen; environmental contaminant; intravenous anaesthetic; sedative; xenobiotic |
quinine | [no description available] | medium | 10 | 0 | cinchona alkaloid | antimalarial; muscle relaxant; non-narcotic analgesic |
diclofenac sodium | [no description available] | medium | 3 | 0 | organic sodium salt | |
guanabenz | [no description available] | medium | 4 | 0 | dichlorobenzene | |
nifuroxime | [no description available] | medium | 1 | 0 | | |
warfarin | [no description available] | medium | 18 | 0 | benzenes; hydroxycoumarin; methyl ketone | |
acetylglycyrrhetinic acid | [no description available] | medium | 1 | 0 | triterpenoid | |
gamma-aminobutyric acid | [no description available] | high | 7 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid | human metabolite; neurotransmitter; Saccharomyces cerevisiae metabolite; signalling molecule |
acetamide | [no description available] | medium | 1 | 0 | acetamides; carboximidic acid; monocarboxylic acid amide; N-acylammonia | |
quinacrine | [no description available] | medium | 11 | 0 | acridines; aromatic ether; organochlorine compound; tertiary amino compound | antimalarial; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor |
catechol | [no description available] | medium | 8 | 0 | catechols | allelochemical; genotoxin; plant metabolite |
taxifolin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-hydroxyflavanones; dihydroflavonols; pentahydroxyflavanone; secondary alpha-hydroxy ketone | |
phosphonoacetic acid | [no description available] | medium | 3 | 0 | monocarboxylic acid; phosphonic acids | antiviral agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor |
3,4-dihydroxyphenylacetic acid | [no description available] | high | 2 | 0 | catechols; dihydroxyphenylacetic acid | human metabolite |
aminocaproic acid | [no description available] | medium | 4 | 0 | amino acid zwitterion; epsilon-amino acid; omega-amino fatty acid | antifibrinolytic drug; hematologic agent; metabolite |
diacetyl | [no description available] | medium | 3 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
melatonin | [no description available] | high | 8 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
n-acetylserotonin | [no description available] | medium | 1 | 0 | acetamides; N-acylserotonin; phenols | antioxidant; human metabolite; mouse metabolite; tropomyosin-related kinase B receptor agonist |
pyrazinamide | [no description available] | medium | 8 | 0 | monocarboxylic acid amide; N-acylammonia; pyrazines | antitubercular agent; prodrug |
quinolinic acid | [no description available] | medium | 1 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
taurine | [no description available] | high | 6 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
2-amino-5-phosphonovalerate | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | NMDA receptor antagonist |
alpha-methyl-4-carboxyphenylglycine | [no description available] | medium | 1 | 0 | | |
3-(2-carboxypiperazin-4-yl)propyl-1-phosphonic acid | [no description available] | medium | 1 | 0 | | |
1-hydroxy-3-amino-2-pyrrolidone | [no description available] | medium | 1 | 0 | | |
ibotenic acid | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | neurotoxin |
n(8)-bromoacetyl-n(1)-3'-(4-indolyloxy)-2'-hydroxypropyl-1,8-diamino-4-menthane | [no description available] | medium | 1 | 0 | | |
sk&f-38393 | [no description available] | medium | 1 | 0 | benzazepine; catechols; secondary amino compound | |
vanilmandelic acid | [no description available] | high | 3 | 0 | 2-hydroxy monocarboxylic acid; aromatic ether; phenols | human metabolite |
1,10-diaminodecane | [no description available] | medium | 1 | 0 | | |
1,3-diethyl-8-phenylxanthine | [no description available] | medium | 1 | 0 | | |
1,3-dipropyl-8-cyclopentylxanthine | [no description available] | medium | 2 | 0 | oxopurine | adenosine A1 receptor antagonist; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
1,3-dipropyl-8-(4-sulfophenyl)xanthine | [no description available] | medium | 1 | 0 | | |
1,5-dihydroxyisoquinoline | [no description available] | medium | 1 | 0 | isoquinolinol | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor |
pk 11195 | [no description available] | medium | 1 | 0 | aromatic amide; isoquinolines; monocarboxylic acid amide; monochlorobenzenes | antineoplastic agent |
1-(2-trifluoromethylphenyl)imidazole | [no description available] | medium | 1 | 0 | imidazoles | |
1-aminobenzotriazole | [no description available] | medium | 1 | 0 | | |
edelfosine | [no description available] | medium | 1 | 0 | glycerophosphocholine | |
1h-(1,2,4)oxadiazolo(4,3-a)quinoxalin-1-one | [no description available] | medium | 1 | 0 | oxadiazoloquinoxaline | EC 4.6.1.2 (guanylate cyclase) inhibitor |
2,2'-dipyridyl | [no description available] | medium | 2 | 0 | bipyridine | chelator; ferroptosis inhibitor |
2-hydroxysaclofen | [no description available] | medium | 1 | 0 | organochlorine compound | |
3,4-dichloroisocoumarin | [no description available] | medium | 1 | 0 | isocoumarins; organochlorine compound | geroprotector; serine protease inhibitor |
phaclofen | [no description available] | medium | 1 | 0 | organophosphate oxoanion; zwitterion | |
3-aminobenzamide | [no description available] | medium | 1 | 0 | benzamides; substituted aniline | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor |
3-bromo-7-nitroindazole | [no description available] | medium | 1 | 0 | | |
enprofylline | [no description available] | medium | 2 | 0 | oxopurine | anti-arrhythmia drug; anti-asthmatic drug; bronchodilator agent; non-steroidal anti-inflammatory drug |
3-nitropropionic acid | [no description available] | medium | 1 | 0 | C-nitro compound | antimycobacterial drug; EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor; mycotoxin; neurotoxin |
4-amino-1,8-naphthalimide | [no description available] | medium | 1 | 0 | benzoisoquinoline; dicarboximide | |
4-aminopyridine | [no description available] | medium | 3 | 0 | aminopyridine; aromatic amine | avicide; orphan drug; potassium channel blocker |
homovanillic acid | [no description available] | high | 2 | 0 | guaiacols; monocarboxylic acid | human metabolite; mouse metabolite |
4-hydroxybenzoic acid hydrazide | [no description available] | medium | 1 | 0 | carbohydrazide; phenols | |
4-phenyl-3-furoxancarbonitrile | [no description available] | medium | 1 | 0 | 1,2,5-oxadiazole; benzenes; N-oxide; nitrile | geroprotector; nitric oxide donor; platelet aggregation inhibitor; soluble guanylate cyclase activator; vasodilator agent |
5,5-dimethyl-1-pyrroline-1-oxide | [no description available] | medium | 1 | 0 | 1-pyrroline nitrones | neuroprotective agent; spin trapping reagent |
5,7-dichlorokynurenic acid | [no description available] | medium | 1 | 0 | quinolines | |
5-(n,n-hexamethylene)amiloride | [no description available] | medium | 1 | 0 | aromatic amine; azepanes; guanidines; monocarboxylic acid amide; organochlorine compound; pyrazines | antineoplastic agent; apoptosis inducer; odorant receptor antagonist; sodium channel blocker |
ethylisopropylamiloride | [no description available] | medium | 1 | 0 | aromatic amine; guanidines; monocarboxylic acid amide; organochlorine compound; pyrazines; tertiary amino compound | anti-arrhythmia drug; neuroprotective agent; sodium channel blocker |
5-fluoroindole-2-carboxylic acid | [no description available] | medium | 2 | 0 | indolyl carboxylic acid | |
hydroxyindoleacetic acid | [no description available] | high | 9 | 0 | indole-3-acetic acids | drug metabolite; human metabolite; mouse metabolite |
phenanthridone | [no description available] | medium | 1 | 0 | lactam; phenanthridines | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; immunosuppressive agent; mutagen |
6-chloromelatonin | [no description available] | medium | 1 | 0 | acetamides | |
6-hydroxymelatonin | [no description available] | medium | 1 | 0 | acetamides; tryptamines | metabolite; mouse metabolite |
6-methoxytryptoline | [no description available] | medium | 1 | 0 | | |
6-nitroso-1,2-benzopyrone | [no description available] | medium | 1 | 0 | | |
7-chlorokynurenic acid | [no description available] | medium | 1 | 0 | organochlorine compound; quinolinemonocarboxylic acid | neuroprotective agent; NMDA receptor antagonist |
7-nitroindazole | [no description available] | medium | 2 | 0 | | |
8-(4-sulfophenyl)theophylline | [no description available] | medium | 1 | 0 | | |
8-cyclopentyl-1,3-dimethylxanthine | [no description available] | medium | 1 | 0 | oxopurine | |
8-phenyltheophylline | [no description available] | medium | 1 | 0 | | |
acetazolamide | [no description available] | medium | 25 | 0 | monocarboxylic acid amide; sulfonamide; thiadiazoles | anticonvulsant; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
acetohexamide | [no description available] | medium | 3 | 0 | acetophenones; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
ag 127 | [no description available] | medium | 1 | 0 | nitrophenol | |
rtki cpd | [no description available] | medium | 1 | 0 | aromatic ether; monochlorobenzenes; quinazolines | antineoplastic agent; antiviral agent; epidermal growth factor receptor antagonist; geroprotector |
tyrphostin a23 | [no description available] | medium | 1 | 0 | catechols | |
tyrphostin 25 | [no description available] | medium | 1 | 0 | benzenetriol | |
tyrphostin a1 | [no description available] | medium | 1 | 0 | methoxybenzenes | geroprotector |
1-aminoindan-1,5-dicarboxylic acid | [no description available] | medium | 1 | 0 | | |
albuterol | [no description available] | medium | 4 | 0 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
albuterol | [no description available] | medium | 4 | 1 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
alpha-methyltyrosine methyl ester | [no description available] | medium | 1 | 0 | | |
altretamine | [no description available] | medium | 3 | 0 | triamino-1,3,5-triazine | |
amfonelic acid | [no description available] | medium | 1 | 0 | | |
amifostine anhydrous | [no description available] | medium | 1 | 0 | diamine; organic thiophosphate | antioxidant; prodrug; radiation protective agent |
amoxapine | [no description available] | medium | 3 | 0 | dibenzooxazepine | adrenergic uptake inhibitor; antidepressant; dopaminergic antagonist; geroprotector; serotonin uptake inhibitor |
aniracetam | [no description available] | medium | 2 | 0 | N-acylpyrrolidine; pyrrolidin-2-ones | |
2-amino-4-phosphonobutyric acid | [no description available] | medium | 1 | 0 | | |
aspirin | [no description available] | medium | 134 | 0 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
aspirin | [no description available] | medium | 134 | 2 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
alpha-amino-3-hydroxy-5-tert-butyl-4-isoxazolepropionate | [no description available] | medium | 1 | 0 | alpha-amino acid | |
aurintricarboxylic acid | [no description available] | medium | 1 | 0 | monohydroxybenzoic acid; quinomethanes; tricarboxylic acid | fluorochrome; histological dye; insulin-like growth factor receptor 1 antagonist |
azathioprine | [no description available] | medium | 103 | 0 | aryl sulfide; C-nitro compound; imidazoles; thiopurine | antimetabolite; antineoplastic agent; carcinogenic agent; DNA synthesis inhibitor; hepatotoxic agent; immunosuppressive agent; prodrug |
azelaic acid | [no description available] | medium | 2 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | antibacterial agent; antineoplastic agent; dermatologic drug; plant metabolite |
baclofen | [no description available] | medium | 3 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid; monochlorobenzenes; primary amino compound | central nervous system depressant; GABA agonist; muscle relaxant |
bay-k-8644 | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; C-nitro compound; dihydropyridine; methyl ester | |
bepridil | [no description available] | medium | 2 | 0 | pyrrolidines; tertiary amine | anti-arrhythmia drug; antihypertensive agent; calcium channel blocker; vasodilator agent |
bml 190 | [no description available] | medium | 1 | 0 | N-acylindole | |
brimonidine | [no description available] | medium | 2 | 0 | imidazoles; quinoxaline derivative; secondary amine | adrenergic agonist; alpha-adrenergic agonist; antihypertensive agent |
bumetanide | [no description available] | medium | 3 | 0 | amino acid; benzoic acids; sulfonamide | diuretic; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor |
caffeine | [no description available] | high | 20 | 1 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
caffeine | [no description available] | high | 20 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
carbamazepine | [no description available] | medium | 7 | 0 | dibenzoazepine; ureas | analgesic; anticonvulsant; antimanic drug; drug allergen; EC 3.5.1.98 (histone deacetylase) inhibitor; environmental contaminant; glutamate transporter activator; mitogen; non-narcotic analgesic; sodium channel blocker; xenobiotic |
carbetapentane | [no description available] | medium | 1 | 0 | benzenes | |
carisoprodol | [no description available] | medium | 2 | 0 | carbamate ester | muscle relaxant |
carmustine | [no description available] | medium | 3 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
cgs 12066 | [no description available] | medium | 1 | 0 | N-arylpiperazine; organofluorine compound; pyrroloquinoxaline | serotonergic agonist |
cgs 15943 | [no description available] | medium | 1 | 0 | aromatic amine; biaryl; furans; organochlorine compound; primary amino compound; quinazolines; triazoloquinazoline | adenosine A1 receptor antagonist; adenosine A2A receptor antagonist; antineoplastic agent; central nervous system stimulant |
chlorambucil | [no description available] | medium | 28 | 0 | aromatic amine; monocarboxylic acid; nitrogen mustard; organochlorine compound; tertiary amino compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
chlormezanone | [no description available] | medium | 1 | 0 | 1,3-thiazine; lactam; monochlorobenzenes; sulfone | antipsychotic agent; anxiolytic drug; muscle relaxant |
chlorothiazide | [no description available] | medium | 14 | 0 | benzothiadiazine | antihypertensive agent; diuretic |
chlorpropamide | [no description available] | medium | 10 | 0 | monochlorobenzenes; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
chlorzoxazone | [no description available] | medium | 2 | 0 | 1,3-benzoxazoles; heteroaryl hydroxy compound; organochlorine compound | muscle relaxant; sedative |
cilostamide | [no description available] | medium | 1 | 0 | quinolines | |
cilostazol | [no description available] | medium | 2 | 0 | lactam; tetrazoles | anticoagulant; bronchodilator agent; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; fibrin modulating drug; neuroprotective agent; platelet aggregation inhibitor; vasodilator agent |
cimetidine | [no description available] | medium | 7 | 0 | aliphatic sulfide; guanidines; imidazoles; nitrile | adjuvant; analgesic; anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
cinoxacin | [no description available] | medium | 2 | 0 | cinnolines; oxacycle; oxo carboxylic acid | antibacterial drug; antiinfective agent |
ciprofibrate | [no description available] | medium | 1 | 0 | cyclopropanes; monocarboxylic acid; organochlorine compound | antilipemic drug |
clofibrate | [no description available] | medium | 4 | 0 | aromatic ether; ethyl ester; monochlorobenzenes | anticholesteremic drug; antilipemic drug; geroprotector; PPARalpha agonist |
clotrimazole | [no description available] | medium | 2 | 0 | conazole antifungal drug; imidazole antifungal drug; imidazoles; monochlorobenzenes | antiinfective agent; environmental contaminant; xenobiotic |
cx546 | [no description available] | medium | 1 | 0 | | |
cyclothiazide | [no description available] | medium | 1 | 0 | benzothiadiazine | antihypertensive agent; diuretic |
dephostatin | [no description available] | medium | 1 | 0 | | |
nonivamide | [no description available] | medium | 1 | 0 | capsaicinoid; phenols | lachrymator |
r 59022 | [no description available] | medium | 1 | 0 | diarylmethane | |
diazoxide | [no description available] | medium | 8 | 0 | benzothiadiazine; organochlorine compound; sulfone | antihypertensive agent; beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; diuretic; K-ATP channel agonist; sodium channel blocker; sympathomimetic agent; vasodilator agent |
pentetic acid | [no description available] | medium | 3 | 0 | pentacarboxylic acid | copper chelator |
diphenyleneiodonium | [no description available] | medium | 2 | 0 | organic cation | |
dipyridamole | [no description available] | medium | 3 | 0 | piperidines; pyrimidopyrimidine; tertiary amino compound; tetrol | adenosine phosphodiesterase inhibitor; EC 3.5.4.4 (adenosine deaminase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
disopyramide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; pyridines; tertiary amino compound | anti-arrhythmia drug |
disulfiram | [no description available] | medium | 5 | 0 | organic disulfide; organosulfur acaricide | angiogenesis inhibitor; antineoplastic agent; apoptosis inducer; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; EC 3.1.1.1 (carboxylesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; ferroptosis inducer; fungicide; NF-kappaB inhibitor |
2-amino-7-phosphonoheptanoic acid | [no description available] | medium | 1 | 0 | | |
2,3-dimethoxy-1,4-naphthoquinone | [no description available] | medium | 1 | 0 | 1,4-naphthoquinones | |
domperidone | [no description available] | medium | 3 | 0 | benzimidazoles; heteroarylpiperidine | antiemetic; dopaminergic antagonist |
droperidol | [no description available] | medium | 4 | 0 | aromatic ketone; benzimidazoles; organofluorine compound | anaesthesia adjuvant; antiemetic; dopaminergic antagonist; first generation antipsychotic |
ebselen | [no description available] | medium | 3 | 0 | benzoselenazole | anti-inflammatory drug; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; EC 3.1.3.25 (inositol-phosphate phosphatase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 3.5.4.1 (cytosine deaminase) inhibitor; EC 5.1.3.2 (UDP-glucose 4-epimerase) inhibitor; enzyme mimic; ferroptosis inhibitor; genotoxin; hepatoprotective agent; neuroprotective agent; radical scavenger |
ellipticine | [no description available] | medium | 2 | 0 | indole alkaloid; organic heterotetracyclic compound; organonitrogen heterocyclic compound; polycyclic heteroarene | antineoplastic agent; plant metabolite |
emodin | [no description available] | medium | 1 | 0 | trihydroxyanthraquinone | antineoplastic agent; laxative; plant metabolite; tyrosine kinase inhibitor |
ethosuximide | [no description available] | medium | 2 | 0 | dicarboximide; pyrrolidinone | anticonvulsant; geroprotector; T-type calcium channel blocker |
etodolac | [no description available] | medium | 2 | 0 | monocarboxylic acid; organic heterotricyclic compound | antipyretic; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
felbamate | [no description available] | medium | 3 | 0 | carbamate ester | anticonvulsant; neuroprotective agent |
felodipine | [no description available] | medium | 4 | 0 | dichlorobenzene; dihydropyridine; ethyl ester; methyl ester | anti-arrhythmia drug; antihypertensive agent; calcium channel blocker; vasodilator agent |
fenofibrate | [no description available] | medium | 3 | 0 | aromatic ether; chlorobenzophenone; isopropyl ester; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
fenofibrate | [no description available] | medium | 3 | 1 | aromatic ether; chlorobenzophenone; isopropyl ester; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
flumazenil | [no description available] | medium | 4 | 0 | ethyl ester; imidazobenzodiazepine; organofluorine compound | antidote to benzodiazepine poisoning; GABA antagonist |
fluorouracil | [no description available] | medium | 28 | 0 | nucleobase analogue; organofluorine compound | antimetabolite; antineoplastic agent; environmental contaminant; immunosuppressive agent; radiosensitizing agent; xenobiotic |
fluspirilene | [no description available] | medium | 1 | 0 | diarylmethane | |
flutamide | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; monocarboxylic acid amide | androgen antagonist; antineoplastic agent |
formoterol fumarate | [no description available] | medium | 1 | 0 | formamides; phenols; phenylethanolamines; secondary alcohol; secondary amino compound | |
fpl 64176 | [no description available] | medium | 1 | 0 | carboxylic ester; pyrroles | calcium channel agonist |
furafylline | [no description available] | medium | 1 | 0 | oxopurine | |
fusaric acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; pyridines | |
gabapentin | [no description available] | medium | 3 | 0 | gamma-amino acid | anticonvulsant; calcium channel blocker; environmental contaminant; xenobiotic |
4-amino-5-hexynoic acid | [no description available] | medium | 1 | 0 | | |
glipizide | [no description available] | medium | 2 | 0 | aromatic amide; monocarboxylic acid amide; N-sulfonylurea; pyrazines | EC 2.7.1.33 (pantothenate kinase) inhibitor; hypoglycemic agent; insulin secretagogue |
glyburide | [no description available] | medium | 3 | 0 | monochlorobenzenes; N-sulfonylurea | anti-arrhythmia drug; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor; hypoglycemic agent |
1-(5-isoquinolinesulfonyl)piperazine | [no description available] | medium | 1 | 0 | isoquinolines | |
hemicholinium 3 | [no description available] | medium | 1 | 0 | morpholines | |
4-fluorohexahydrosiladifenidol | [no description available] | medium | 1 | 0 | | |
hydrochlorothiazide | [no description available] | medium | 15 | 0 | benzothiadiazine; organochlorine compound; sulfonamide | antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
hydroxyurea | [no description available] | medium | 3 | 0 | one-carbon compound; ureas | antimetabolite; antimitotic; antineoplastic agent; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; genotoxin; immunomodulator; radical scavenger; teratogenic agent |
ibudilast | [no description available] | medium | 1 | 0 | pyrazolopyridine | |
ic 261 | [no description available] | medium | 1 | 0 | indoles | |
ifenprodil | [no description available] | medium | 1 | 0 | piperidines | |
indirubin-3'-monoxime | [no description available] | medium | 1 | 0 | | |
iodoacetamide | [no description available] | medium | 1 | 0 | | |
1-methyl-3-isobutylxanthine | [no description available] | medium | 1 | 0 | 3-isobutyl-1-methylxanthine | |
4-piperidinecarboxylic acid | [no description available] | medium | 1 | 0 | | |
4-(4'-hydroxyphenyl)-amino-6,7-dimethoxyquinazoline | [no description available] | medium | 1 | 0 | | |
jl 18 | [no description available] | medium | 1 | 0 | | |
nsc 664704 | [no description available] | medium | 1 | 0 | indolobenzazepine; lactam; organobromine compound | cardioprotective agent; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor; EC 2.7.11.26 (tau-protein kinase) inhibitor; geroprotector |
ketoconazole | [no description available] | medium | 7 | 0 | dichlorobenzene; dioxolane; ether; imidazoles; N-acylpiperazine; N-arylpiperazine | |
ketoconazole | [no description available] | medium | 7 | 1 | dichlorobenzene; dioxolane; ether; imidazoles; N-acylpiperazine; N-arylpiperazine | |
kynurenic acid | [no description available] | high | 4 | 0 | monohydroxyquinoline; quinolinemonocarboxylic acid | G-protein-coupled receptor agonist; human metabolite; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist; Saccharomyces cerevisiae metabolite |
2-amino-3-phosphonopropionic acid | [no description available] | medium | 1 | 0 | alanine derivative; non-proteinogenic alpha-amino acid; phosphonic acids | human metabolite; metabotropic glutamate receptor antagonist |
lamotrigine | [no description available] | medium | 2 | 0 | 1,2,4-triazines; dichlorobenzene; primary arylamine | anticonvulsant; antidepressant; antimanic drug; calcium channel blocker; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; excitatory amino acid antagonist; geroprotector; non-narcotic analgesic; xenobiotic |
lansoprazole | [no description available] | medium | 2 | 0 | benzimidazoles; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor |
beta-lapachone | [no description available] | medium | 1 | 0 | benzochromenone; orthoquinones | anti-inflammatory agent; antineoplastic agent; plant metabolite |
leflunomide | [no description available] | medium | 4 | 0 | (trifluoromethyl)benzenes; isoxazoles; monocarboxylic acid amide | antineoplastic agent; antiparasitic agent; EC 1.3.98.1 [dihydroorotate oxidase (fumarate)] inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; hepatotoxic agent; immunosuppressive agent; non-steroidal anti-inflammatory drug; prodrug; pyrimidine synthesis inhibitor; tyrosine kinase inhibitor |
linopirdine | [no description available] | medium | 1 | 0 | indoles | |
loxoprofen | [no description available] | medium | 2 | 0 | cyclopentanones; monocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
2-(4-morpholinyl)-8-phenyl-4h-1-benzopyran-4-one | [no description available] | medium | 1 | 0 | chromones; morpholines; organochlorine compound | autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector |
meclofenamate sodium anhydrous | [no description available] | medium | 2 | 0 | organic sodium salt | |
methiothepin | [no description available] | medium | 1 | 0 | aryl sulfide; dibenzothiepine; N-alkylpiperazine; tertiary amino compound | antipsychotic agent; dopaminergic antagonist; geroprotector; serotonergic antagonist |
nocodazole | [no description available] | medium | 2 | 0 | aromatic ketone; benzimidazoles; carbamate ester; thiophenes | antimitotic; antineoplastic agent; microtubule-destabilising agent; tubulin modulator |
3-Hydroxy-alpha-methyl-DL-tyrosine | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | |
milrinone | [no description available] | medium | 1 | 0 | bipyridines; nitrile; pyridone | cardiotonic drug; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
minoxidil | [no description available] | medium | 4 | 0 | dialkylarylamine; tertiary amino compound | |
mitotane | [no description available] | medium | 12 | 0 | diarylmethane | |
mitoxantrone | [no description available] | medium | 3 | 0 | dihydroxyanthraquinone | analgesic; antineoplastic agent |
ml 7 | [no description available] | medium | 1 | 0 | N-sulfonyldiazepane; organoiodine compound | EC 2.7.11.18 (myosin-light-chain kinase) inhibitor |
n-(4-aminobutyl)-5-chloro-2-naphthalenesulfonamide | [no description available] | medium | 1 | 0 | naphthalenes; organochlorine compound; primary amino compound; sulfonamide | |
n-bromoacetamide | [no description available] | medium | 1 | 0 | | |
ethylmaleimide | [no description available] | medium | 5 | 0 | maleimides | anticoronaviral agent; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.1.1 (hexokinase) inhibitor |
fg 7142 | [no description available] | medium | 1 | 0 | beta-carbolines | |
fenamic acid | [no description available] | medium | 2 | 0 | aminobenzoic acid; secondary amino compound | membrane transport modulator |
n 0840 | [no description available] | medium | 1 | 0 | | |
nialamide | [no description available] | medium | 4 | 0 | organonitrogen compound; organooxygen compound | |
niclosamide | [no description available] | medium | 1 | 0 | benzamides; C-nitro compound; monochlorobenzenes; salicylanilides; secondary carboxamide | anthelminthic drug; anticoronaviral agent; antiparasitic agent; apoptosis inducer; molluscicide; piscicide; STAT3 inhibitor |
nifedipine | [no description available] | high | 6 | 0 | C-nitro compound; dihydropyridine; methyl ester | calcium channel blocker; human metabolite; tocolytic agent; vasodilator agent |
niflumic acid | [no description available] | medium | 3 | 0 | aromatic carboxylic acid; pyridines | |
nilutamide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; imidazolidinone | androgen antagonist; antineoplastic agent |
nimesulide | [no description available] | medium | 2 | 0 | aromatic ether; C-nitro compound; sulfonamide | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
nimodipine | [no description available] | medium | 2 | 0 | 2-methoxyethyl ester; C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; isopropyl ester | antihypertensive agent; calcium channel blocker; cardiovascular drug; vasodilator agent |
nipecotic acid | [no description available] | medium | 1 | 0 | beta-amino acid; piperidinemonocarboxylic acid | |
nitrendipine | [no description available] | medium | 4 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; ethyl ester; methyl ester | antihypertensive agent; calcium channel blocker; geroprotector; vasodilator agent |
masoprocol | [no description available] | medium | 1 | 0 | catechols; lignan; tetrol | antioxidant; ferroptosis inhibitor; geroprotector; plant metabolite |
5-nitro-2-(3-phenylpropylamino)benzoic acid | [no description available] | medium | 1 | 0 | nitrobenzoic acid | |
ns 2028 | [no description available] | medium | 1 | 0 | | |
ns 1619 | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; benzimidazoles; phenols | potassium channel opener |
o(6)-benzylguanine | [no description available] | medium | 1 | 0 | | |
ofloxacin | [no description available] | medium | 4 | 0 | 3-oxo monocarboxylic acid; N-arylpiperazine; N-methylpiperazine; organofluorine compound; oxazinoquinoline | |
olomoucine | [no description available] | medium | 1 | 0 | 2,6-diaminopurines; ethanolamines | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
oxaprozin | [no description available] | medium | 1 | 0 | 1,3-oxazoles; monocarboxylic acid | analgesic; non-steroidal anti-inflammatory drug |
oxatomide | [no description available] | medium | 1 | 0 | benzimidazoles; diarylmethane; N-alkylpiperazine | anti-allergic agent; anti-inflammatory agent; geroprotector; H1-receptor antagonist; serotonergic antagonist |
oxiracetam | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
oxolinic acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; organic heterotricyclic compound; oxacycle; quinolinemonocarboxylic acid; quinolone antibiotic | antibacterial drug; antifungal agent; antiinfective agent; antimicrobial agent; enzyme inhibitor |
quinone | [no description available] | medium | 2 | 0 | 1,4-benzoquinones | cofactor; human xenobiotic metabolite; mouse metabolite |
fenclonine | [no description available] | medium | 4 | 0 | phenylalanine derivative | |
palmidrol | [no description available] | medium | 1 | 0 | endocannabinoid; N-(long-chain-acyl)ethanolamine; N-(saturated fatty acyl)ethanolamine | anti-inflammatory drug; anticonvulsant; antihypertensive agent; neuroprotective agent |
1,7-dimethylxanthine | [no description available] | medium | 1 | 0 | dimethylxanthine | central nervous system stimulant; human blood serum metabolite; human xenobiotic metabolite; mouse metabolite |
pd 98059 | [no description available] | medium | 2 | 0 | aromatic amine; monomethoxyflavone | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; geroprotector |
pentamidine | [no description available] | medium | 4 | 0 | aromatic ether; carboxamidine; diether | anti-inflammatory agent; antifungal agent; calmodulin antagonist; chemokine receptor 5 antagonist; EC 2.3.1.48 (histone acetyltransferase) inhibitor; NMDA receptor antagonist; S100 calcium-binding protein B inhibitor; trypanocidal drug; xenobiotic |
pentoxifylline | [no description available] | medium | 9 | 0 | oxopurine | |
pentoxifylline | [no description available] | medium | 9 | 1 | oxopurine | |
perphenazine | [no description available] | medium | 5 | 0 | N-(2-hydroxyethyl)piperazine; N-alkylpiperazine; organochlorine compound; phenothiazines | antiemetic; dopaminergic antagonist; phenothiazine antipsychotic drug |
phenyl biguanide | [no description available] | medium | 1 | 0 | guanidines | central nervous system drug |
phenylbutazone | [no description available] | medium | 139 | 0 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
phenylbutazone | [no description available] | medium | 139 | 1 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
phloretin | [no description available] | medium | 2 | 0 | dihydrochalcones | antineoplastic agent; plant metabolite |
picotamide | [no description available] | medium | 1 | 0 | benzamides | |
pinacidil | [no description available] | medium | 3 | 0 | pyridines | |
piperidine-4-sulfonic acid | [no description available] | medium | 1 | 0 | | |
piracetam | [no description available] | medium | 3 | 0 | organonitrogen compound; organooxygen compound | |
pirenperone | [no description available] | medium | 2 | 0 | aromatic ketone | |
praziquantel | [no description available] | medium | 4 | 0 | isoquinolines | |
primidone | [no description available] | medium | 3 | 0 | pyrimidone | anticonvulsant; environmental contaminant; xenobiotic |
proglumide | [no description available] | medium | 1 | 0 | benzamides; dicarboxylic acid monoamide; glutamine derivative; racemate | anti-ulcer drug; cholecystokinin antagonist; cholinergic antagonist; delta-opioid receptor agonist; drug metabolite; gastrointestinal drug; opioid analgesic; xenobiotic metabolite |
propentofylline | [no description available] | medium | 1 | 0 | oxopurine | |
propofol | [no description available] | medium | 1 | 0 | phenols | anticonvulsant; antiemetic; intravenous anaesthetic; radical scavenger; sedative |
pf 5901 | [no description available] | medium | 2 | 0 | quinolines | |
riluzole | [no description available] | medium | 3 | 0 | benzothiazoles | |
risperidone | [no description available] | medium | 3 | 0 | 1,2-benzoxazoles; heteroarylpiperidine; organofluorine compound; pyridopyrimidine | alpha-adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; psychotropic drug; second generation antipsychotic; serotonergic antagonist |
ritanserin | [no description available] | medium | 2 | 0 | organofluorine compound; piperidines; thiazolopyrimidine | antidepressant; antipsychotic agent; anxiolytic drug; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; serotonergic antagonist |
4-(3-butoxy-4-methoxybenzyl)-2-imidazolidinone | [no description available] | medium | 1 | 0 | methoxybenzenes | |
rolipram | [no description available] | medium | 2 | 0 | pyrrolidin-2-ones | antidepressant; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
salmeterol xinafoate | [no description available] | medium | 1 | 0 | ether; phenols; primary alcohol; secondary alcohol; secondary amino compound | |
sb 202190 | [no description available] | medium | 1 | 0 | imidazoles; organofluorine compound; phenols; pyridines | apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor |
sobuzoxane | [no description available] | medium | 1 | 0 | organic molecular entity | |
spiroxatrine | [no description available] | medium | 1 | 0 | imidazolidines | |
sq 22536 | [no description available] | medium | 1 | 0 | nucleoside analogue; oxolanes | EC 4.6.1.1 (adenylate cyclase) inhibitor |
sulfaphenazole | [no description available] | medium | 2 | 0 | primary amino compound; pyrazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial drug; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 1.14.13.67 (quinine 3-monooxygenase) inhibitor; P450 inhibitor |
t0156 | [no description available] | medium | 1 | 0 | naphthyridine derivative | |
1,4-bis(2-(3,5-dichloropyridyloxy))benzene | [no description available] | medium | 1 | 0 | | |
tetraisopropylpyrophosphamide | [no description available] | medium | 1 | 0 | phosphoramide | |
thalidomide | [no description available] | medium | 28 | 0 | phthalimides; piperidones | |
theobromine | [no description available] | high | 3 | 0 | dimethylxanthine | adenosine receptor antagonist; bronchodilator agent; food component; human blood serum metabolite; mouse metabolite; plant metabolite; vasodilator agent |
8-(n,n-diethylamino)octyl-3,4,5-trimethoxybenzoate | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | |
tolazamide | [no description available] | medium | 3 | 0 | N-sulfonylurea | hypoglycemic agent; potassium channel blocker |
tolbutamide | [no description available] | high | 59 | 2 | N-sulfonylurea | human metabolite; hypoglycemic agent; insulin secretagogue; potassium channel blocker |
tolbutamide | [no description available] | high | 59 | 0 | N-sulfonylurea | human metabolite; hypoglycemic agent; insulin secretagogue; potassium channel blocker |
(1,2,5,6-tetrahydropyridin-4-yl)methylphosphinic acid | [no description available] | medium | 1 | 0 | | |
ici 136,753 | [no description available] | medium | 1 | 0 | pyrazolopyridine | |
triamterene | [no description available] | medium | 4 | 0 | pteridines | diuretic; sodium channel blocker |
tropicamide | [no description available] | medium | 2 | 0 | acetamides | |
tyrphostin a9 | [no description available] | medium | 1 | 0 | alkylbenzene | geroprotector |
vigabatrin | [no description available] | medium | 1 | 0 | gamma-amino acid | anticonvulsant; EC 2.6.1.19 (4-aminobutyrate--2-oxoglutarate transaminase) inhibitor |
8-(4-((2-aminoethyl)aminocarbonylmethyloxy)phenyl)-1,3-dipropylxanthine | [no description available] | medium | 1 | 0 | | |
3-(5'-hydroxymethyl-2'-furyl)-1-benzylindazole | [no description available] | medium | 1 | 0 | aromatic primary alcohol; furans; indazoles | antineoplastic agent; apoptosis inducer; platelet aggregation inhibitor; soluble guanylate cyclase activator; vasodilator agent |
zardaverine | [no description available] | medium | 1 | 0 | organofluorine compound; pyridazinone | anti-asthmatic drug; bronchodilator agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; peripheral nervous system drug |
reserpine | [no description available] | medium | 58 | 0 | alkaloid ester; methyl ester; yohimban alkaloid | adrenergic uptake inhibitor; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; first generation antipsychotic; plant metabolite; xenobiotic |
procaine hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
isoproterenol hydrochloride | [no description available] | medium | 1 | 0 | catechols | |
histamine dihydrochloride | [no description available] | medium | 1 | 0 | | |
carbachol | [no description available] | medium | 2 | 0 | ammonium salt; carbamate ester | cardiotonic drug; miotic; muscarinic agonist; nicotinic acetylcholine receptor agonist; non-narcotic analgesic |
spironolactone | [no description available] | high | 35 | 0 | 3-oxo-Delta(4) steroid; oxaspiro compound; steroid lactone; thioester | aldosterone antagonist; antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
promazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
pilocarpine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
dimethylphenylpiperazinium iodide | [no description available] | medium | 2 | 0 | N-arylpiperazine; organic iodide salt; piperazinium salt; quaternary ammonium salt | nicotinic acetylcholine receptor agonist |
pentylenetetrazole | [no description available] | medium | 8 | 0 | organic heterobicyclic compound; organonitrogen heterocyclic compound | |
racepinephrine hydrochloride | [no description available] | medium | 1 | 0 | | |
(4-(m-chlorophenylcarbamoyloxy)-2-butynyl)trimethylammonium chloride | [no description available] | medium | 1 | 0 | | |
hexamethonium bromide | [no description available] | medium | 1 | 0 | | |
cystamine dihydrochloride | [no description available] | medium | 1 | 0 | | |
cantharidin | [no description available] | medium | 2 | 0 | cyclic dicarboxylic anhydride; monoterpenoid | EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; herbicide |
tetraethylammonium chloride | [no description available] | medium | 1 | 0 | organic chloride salt; quaternary ammonium salt | potassium channel blocker |
aspartic acid | [no description available] | high | 6 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
glutamine | [no description available] | high | 9 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
vincristine | [no description available] | medium | 1 | 0 | acetate ester; formamides; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; tertiary alcohol; tertiary amino compound; vinca alkaloid | antineoplastic agent; drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
apomorphine | [no description available] | medium | 3 | 0 | aporphine alkaloid | alpha-adrenergic drug; antidyskinesia agent; antiparkinson drug; dopamine agonist; emetic; serotonergic drug |
promethazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; geroprotector; H1-receptor antagonist; local anaesthetic; sedative |
bromodeoxyuridine | [no description available] | medium | 9 | 0 | pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent |
levodopa | [no description available] | medium | 3 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
methoxamine hydrochloride | [no description available] | medium | 2 | 0 | dimethoxybenzene | |
papaverine hydrochloride | [no description available] | medium | 2 | 0 | | |
bretylium tosylate | [no description available] | medium | 2 | 0 | organosulfonate salt; quaternary ammonium salt | adrenergic antagonist; anti-arrhythmia drug; antihypertensive agent |
berlition | [no description available] | medium | 2 | 0 | dithiolanes; heterocyclic fatty acid; lipoic acid; thia fatty acid | cofactor; nutraceutical; prosthetic group |
methacholine chloride | [no description available] | medium | 3 | 0 | quaternary ammonium salt | |
colchicine | [no description available] | medium | 36 | 0 | alkaloid; colchicine | anti-inflammatory agent; gout suppressant; mutagen |
yohimbine hydrochloride | [no description available] | medium | 1 | 0 | | |
gallamine triethiodide | [no description available] | medium | 1 | 0 | | |
cycloheximide | [no description available] | medium | 31 | 0 | antibiotic fungicide; cyclic ketone; dicarboximide; piperidine antibiotic; piperidones; secondary alcohol | anticoronaviral agent; bacterial metabolite; ferroptosis inhibitor; neuroprotective agent; protein synthesis inhibitor |
egtazic acid | [no description available] | medium | 3 | 0 | diether; tertiary amino compound; tetracarboxylic acid | chelator |
cycloserine | [no description available] | medium | 3 | 0 | 4-amino-1,2-oxazolidin-3-one; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic; zwitterion | antiinfective agent; antimetabolite; antitubercular agent; metabolite; NMDA receptor agonist |
quinacrine monohydrochloride | [no description available] | medium | 1 | 0 | | |
chlorpromazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride; phenothiazines | anticoronaviral agent; phenothiazine antipsychotic drug |
cytarabine hydrochloride | [no description available] | medium | 2 | 0 | | |
tryptophan | [no description available] | high | 75 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
lidocaine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-arrhythmia drug; local anaesthetic |
arginine | [no description available] | high | 18 | 1 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
arginine | [no description available] | high | 18 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
rotenone | [no description available] | medium | 2 | 0 | organic heteropentacyclic compound; rotenones | antineoplastic agent; metabolite; mitochondrial NADH:ubiquinone reductase inhibitor; phytogenic insecticide; piscicide; toxin |
synephrine | [no description available] | medium | 2 | 0 | ethanolamines; phenethylamine alkaloid; phenols | alpha-adrenergic agonist; plant metabolite |
pyridostigmine bromide | [no description available] | medium | 7 | 0 | pyridinium salt | |
imipramine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antidepressant |
neostigmine bromide | [no description available] | medium | 2 | 0 | bromide salt | |
edrophonium chloride | [no description available] | medium | 2 | 0 | chloride salt; quaternary ammonium salt | antidote; diagnostic agent; EC 3.1.1.8 (cholinesterase) inhibitor |
suramin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
pyrazolanthrone | [no description available] | medium | 1 | 0 | anthrapyrazole; aromatic ketone; cyclic ketone | antineoplastic agent; c-Jun N-terminal kinase inhibitor; geroprotector |
methapyrilene hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-allergic agent; carcinogenic agent; H1-receptor antagonist; sedative |
tetrracaine hydrochloride | [no description available] | medium | 2 | 0 | benzoate ester | |
chelidamic acid | [no description available] | medium | 1 | 0 | | |
2-chloroadenosine | [no description available] | medium | 2 | 0 | purine nucleoside | |
diphenhydramine hydrochloride | [no description available] | medium | 5 | 0 | hydrochloride; organoammonium salt | anti-allergic agent; antiemetic; antiparkinson drug; antipruritic drug; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; sedative |
cysteamine hydrochloride | [no description available] | medium | 1 | 0 | | |
propantheline bromide | [no description available] | medium | 3 | 0 | xanthenes | |
hydralazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antihypertensive agent; vasodilator agent |
ethamivan | [no description available] | medium | 2 | 0 | methoxybenzenes; phenols | |
pargyline hydrochloride | [no description available] | medium | 2 | 0 | | |
aminophylline | [no description available] | medium | 11 | 0 | mixture | bronchodilator agent; cardiotonic drug |
azacitidine | [no description available] | medium | 5 | 0 | N-glycosyl-1,3,5-triazine; nucleoside analogue | antineoplastic agent |
orphenadrine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antiparkinson drug; H1-receptor antagonist; muscarinic antagonist; muscle relaxant; NMDA receptor antagonist; parasympatholytic |
benzenaminium, 4,4'-(3-oxo-1,5-pentanediyl)bis(n,n-dimethyl-n-2-propenyl-), dibromide | [no description available] | medium | 1 | 0 | | |
cyproterone acetate | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; chlorinated steroid; steroid ester | androgen antagonist; geroprotector; progestin |
bicuculline | [no description available] | medium | 1 | 0 | benzylisoquinoline alkaloid; isoquinoline alkaloid; isoquinolines | agrochemical; central nervous system stimulant; GABA-gated chloride channel antagonist; GABAA receptor antagonist; neurotoxin |
kainic acid | [no description available] | medium | 2 | 0 | dicarboxylic acid; L-proline derivative; non-proteinogenic L-alpha-amino acid; pyrrolidinecarboxylic acid | antinematodal drug; excitatory amino acid agonist |
podophyllotoxin | [no description available] | medium | 2 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antimitotic; antineoplastic agent; keratolytic drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
tetrahydrozoline hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | nasal decongestant; sympathomimetic agent; vasoconstrictor agent |
dequalinium chloride | [no description available] | medium | 1 | 0 | organic chloride salt | antifungal agent; antineoplastic agent; antiseptic drug; mitochondrial NADH:ubiquinone reductase inhibitor |
decamethonium dibromide | [no description available] | medium | 1 | 0 | | |
amitriptyline hydrochloride | [no description available] | medium | 2 | 0 | organic tricyclic compound | |
naphazoline hydrochloride | [no description available] | medium | 2 | 0 | organic molecular entity | |
doxylamine succinate | [no description available] | medium | 2 | 0 | organic molecular entity | |
carbamylhydrazine monohydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
debrisoquin sulfate | [no description available] | medium | 1 | 0 | organic sulfate salt | |
betaine hydrochloride | [no description available] | medium | 1 | 0 | | |
bethanechol chloride | [no description available] | medium | 2 | 0 | carbamate ester; chloride salt; quaternary ammonium salt | muscarinic agonist |
acetylcysteine | [no description available] | high | 5 | 0 | acetylcysteine; L-cysteine derivative; N-acetyl-L-amino acid | antidote to paracetamol poisoning; antiinfective agent; antioxidant; antiviral drug; ferroptosis inhibitor; geroprotector; human metabolite; mucolytic; radical scavenger; vulnerary |
Mecamylamine hydrochloride | [no description available] | medium | 1 | 0 | monoterpenoid | |
vinblastine | [no description available] | medium | 1 | 0 | | |
cyproheptadine hydrochloride (anhydrous) | [no description available] | medium | 2 | 0 | hydrochloride | |
5 alpha-androstane-3 alpha,17 beta-diol | [no description available] | medium | 3 | 0 | androstane-3alpha,17beta-diol | Daphnia magna metabolite; human metabolite |
pimozide | [no description available] | medium | 4 | 0 | benzimidazoles; heteroarylpiperidine; organofluorine compound | antidyskinesia agent; dopaminergic antagonist; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
azetidyl-2-carboxylic acid | [no description available] | medium | 1 | 0 | azetidine-2-carboxylic acid | |
muscarine | [no description available] | medium | 1 | 0 | | |
antazoline hydrochloride | [no description available] | medium | 2 | 0 | | |
doxifluridine | [no description available] | medium | 1 | 0 | organofluorine compound; pyrimidine 5'-deoxyribonucleoside | antimetabolite; antineoplastic agent; prodrug |
meclofenoxate hydrochloride | [no description available] | medium | 1 | 0 | | |
clonidine hydrochloride | [no description available] | medium | 1 | 0 | dichlorobenzene | |
beclomethasone | [no description available] | medium | 3 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; corticosteroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic drug; anti-inflammatory drug |
buthionine sulfoximine | [no description available] | medium | 1 | 0 | diastereoisomeric mixture; homocysteines; non-proteinogenic alpha-amino acid; sulfoximide | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
mexiletine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug |
cyclophosphamide | [no description available] | medium | 1 | 0 | hydrate | alkylating agent; antineoplastic agent; carcinogenic agent; immunosuppressive agent |
suxamethonium chloride | [no description available] | medium | 1 | 0 | chloride salt | muscle relaxant |
cyclobenzaprine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; muscle relaxant |
n-methylaspartate | [no description available] | medium | 1 | 0 | amino dicarboxylic acid; D-alpha-amino acid; D-aspartic acid derivative; secondary amino compound | neurotransmitter agent |
3-deazaadenosine | [no description available] | medium | 1 | 0 | | |
metoclopramide hydrochloride | [no description available] | medium | 2 | 0 | | |
isoetharine mesylate | [no description available] | medium | 2 | 0 | | |
zalcitabine | [no description available] | medium | 1 | 0 | pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
propionylpromazine hydrochloride | [no description available] | medium | 1 | 0 | | |
camptothecin | [no description available] | medium | 1 | 0 | delta-lactone; pyranoindolizinoquinoline; quinoline alkaloid; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; genotoxin; plant metabolite |
nsc-145,668 | [no description available] | medium | 1 | 0 | hydrochloride | antimetabolite; antineoplastic agent |
clodronic acid | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid); one-carbon compound; organochlorine compound | antineoplastic agent; bone density conservation agent |
benserazide hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
pancuronium bromide | [no description available] | medium | 1 | 0 | bromide salt | cholinergic antagonist; muscle relaxant; nicotinic antagonist |
tetradecanoylphorbol acetate | [no description available] | high | 8 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
danazol | [no description available] | medium | 5 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | anti-estrogen; estrogen antagonist; geroprotector |
metergoline | [no description available] | medium | 4 | 0 | carbamate ester; ergoline alkaloid | dopamine agonist; geroprotector; serotonergic antagonist |
metergoline | [no description available] | medium | 4 | 1 | carbamate ester; ergoline alkaloid | dopamine agonist; geroprotector; serotonergic antagonist |
lisuride | [no description available] | medium | 1 | 0 | monocarboxylic acid amide | antidyskinesia agent; antiparkinson drug; dopamine agonist; serotonergic agonist |
disopyramide phosphate | [no description available] | medium | 1 | 0 | organoammonium phosphate | |
bromocriptine | [no description available] | medium | 5 | 0 | indole alkaloid | antidyskinesia agent; antiparkinson drug; dopamine agonist; hormone antagonist |
ergocristine | [no description available] | medium | 1 | 0 | ergot alkaloid | |
zidovudine | [no description available] | medium | 4 | 0 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
paclitaxel | [no description available] | high | 3 | 1 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
paclitaxel | [no description available] | high | 3 | 0 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
buspirone hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
etoposide | [no description available] | medium | 2 | 0 | beta-D-glucoside; furonaphthodioxole; organic heterotetracyclic compound | antineoplastic agent; DNA synthesis inhibitor |
propafenone hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-arrhythmia drug |
etazolate hydrochloride | [no description available] | medium | 1 | 0 | | |
butaclamol | [no description available] | medium | 1 | 0 | amino alcohol; organic heteropentacyclic compound; tertiary alcohol; tertiary amino compound | dopaminergic antagonist |
ribavirin | [no description available] | medium | 2 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide | anticoronaviral agent; antiinfective agent; antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
carbidopa | [no description available] | medium | 1 | 0 | catechols; hydrate; hydrazines; monocarboxylic acid | antidyskinesia agent; antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
cephradine | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; cephalosporin | antibacterial drug |
methyldopa | [no description available] | medium | 9 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | alpha-adrenergic agonist; antihypertensive agent; hapten; peripheral nervous system drug; sympatholytic agent |
lonidamine | [no description available] | medium | 1 | 0 | dichlorobenzene; indazoles; monocarboxylic acid | antineoplastic agent; antispermatogenic agent; EC 2.7.1.1 (hexokinase) inhibitor; geroprotector |
dexibuprofen | [no description available] | medium | 1 | 0 | ibuprofen | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
quisqualic acid | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | |
pirfenidone | [no description available] | medium | 1 | 0 | pyridone | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
flecainide acetate | [no description available] | medium | 2 | 0 | acetate salt | anti-arrhythmia drug |
nicardipine hydrochloride | [no description available] | medium | 2 | 0 | dihydropyridine | geroprotector |
idarubicin | [no description available] | medium | 1 | 0 | anthracycline antibiotic; deoxy hexoside; monosaccharide derivative | |
terazosin hydrochloride anhydrous | [no description available] | medium | 2 | 0 | | |
pergolide mesylate | [no description available] | medium | 2 | 0 | methanesulfonate salt | antiparkinson drug; dopamine agonist; geroprotector |
ranitidine hydrochloride | [no description available] | medium | 1 | 0 | | |
colforsin | [no description available] | high | 2 | 0 | acetate ester; cyclic ketone; labdane diterpenoid; organic heterotricyclic compound; tertiary alpha-hydroxy ketone; triol | adenylate cyclase agonist; anti-HIV agent; antihypertensive agent; plant metabolite; platelet aggregation inhibitor; protein kinase A agonist |
cefaclor anhydrous | [no description available] | medium | 3 | 0 | cephalosporin | antibacterial drug; drug allergen |
alo 2145 | [no description available] | medium | 1 | 0 | hydrochloride | alpha-adrenergic agonist; antiglaucoma drug |
enoximone | [no description available] | medium | 1 | 0 | aromatic ketone | |
atomoxetine | [no description available] | medium | 1 | 0 | aromatic ether; secondary amino compound; toluenes | adrenergic uptake inhibitor; antidepressant; environmental contaminant; xenobiotic |
raloxifene hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
quinpirole hydrochloride | [no description available] | medium | 1 | 0 | | |
imazodan | [no description available] | medium | 1 | 0 | | |
mibefradil dihydrochloride | [no description available] | medium | 1 | 0 | | |
aptiganel hydrochloride | [no description available] | medium | 1 | 0 | | |
adenosine | [no description available] | high | 7 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
phenelzine sulfate | [no description available] | medium | 1 | 0 | organic molecular entity | |
fluoxetine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride; N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine | |
propranolol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
bupropion hydrochloride | [no description available] | medium | 1 | 0 | aromatic ketone | |
diltiazem hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antihypertensive agent; calcium channel blocker; vasodilator agent |
trazodone hydrochloride | [no description available] | medium | 4 | 0 | hydrochloride | adrenergic antagonist; antidepressant; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
verapamil hydrochloride | [no description available] | medium | 3 | 0 | | |
doxazosin mesylate | [no description available] | medium | 2 | 0 | methanesulfonate salt | geroprotector |
terfenadine | [no description available] | medium | 1 | 0 | diarylmethane | |
amantadine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antiviral agent; dopamine agonist; NMDA receptor antagonist |
mevastatin | [no description available] | medium | 1 | 0 | 2-pyranones; carboxylic ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | antifungal agent; apoptosis inducer; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; fungal metabolite; Penicillium metabolite |
chloroquine diphosphate | [no description available] | medium | 2 | 0 | | |
dobutamine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | beta-adrenergic agonist; cardiotonic drug; sympathomimetic agent |
desipramine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | drug allergen |
dopamine hydrochloride | [no description available] | medium | 2 | 0 | catecholamine | |
proadifen hydrochloride | [no description available] | medium | 1 | 0 | | |
4-nitrobenzylthioinosine | [no description available] | medium | 1 | 0 | purine nucleoside | |
metrifudil | [no description available] | medium | 1 | 0 | | |
rutecarpine | [no description available] | medium | 1 | 0 | beta-carbolines | |
trihexyphenidyl hydrochloride | [no description available] | medium | 2 | 0 | aralkylamine | |
thioridazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | first generation antipsychotic; geroprotector |
procainamide hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-arrhythmia drug |
siquil | [no description available] | medium | 2 | 0 | hydrochloride | anticoronaviral agent |
sotalol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug; beta-adrenergic antagonist |
oxymetazoline hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | alpha-adrenergic agonist; nasal decongestant; sympathomimetic agent; vasoconstrictor agent |
alprenolol hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
2-methoxyestradiol | [no description available] | medium | 3 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
fluphenazine hydrochloride | [no description available] | medium | 1 | 0 | phenothiazines | anticoronaviral agent |
tryptamine monohydrochloride | [no description available] | medium | 1 | 0 | | |
clomipramine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anticoronaviral agent; antidepressant; serotonergic antagonist; serotonergic drug |
amiloride hydrochloride | [no description available] | medium | 1 | 0 | hydrate | diuretic; sodium channel blocker |
prazosin hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
mianserin hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | geroprotector |
lomefloxacin hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antimicrobial agent; antitubercular agent; photosensitizing agent |
fenspiride hydrochloride | [no description available] | medium | 1 | 0 | | |
nilverm | [no description available] | medium | 1 | 0 | organic molecular entity | |
sanguinarine chloride | [no description available] | medium | 1 | 0 | | |
ropinirole hydrochloride | [no description available] | medium | 1 | 0 | indoles | |
plasmenylserine | [no description available] | medium | 1 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5-aminovaleric acid hydrochloride | [no description available] | medium | 1 | 0 | | |
n-acetyltryptamine | [no description available] | medium | 1 | 0 | acetamides; indoles | |
D-serine | [no description available] | medium | 1 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
dihydroergotamine mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | non-narcotic analgesic; serotonergic agonist; vasoconstrictor agent |
ranolazine hydrochloride | [no description available] | medium | 1 | 0 | | |
loxapine succinate | [no description available] | medium | 2 | 0 | succinate salt | geroprotector |
guanfacine hydrochloride | [no description available] | medium | 2 | 0 | acetamides | geroprotector |
pirenzepine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
labetalol hydrochloride | [no description available] | medium | 2 | 0 | salicylamides | |
acecainide hydrochloride | [no description available] | medium | 2 | 0 | | |
loperamide hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anticoronaviral agent; antidiarrhoeal drug; mu-opioid receptor agonist |
maprotiline hydrochloride | [no description available] | medium | 2 | 0 | anthracenes | |
protoporphyrin ix, disodium salt | [no description available] | medium | 1 | 0 | | |
siguazodan | [no description available] | medium | 1 | 0 | pyridazinone | |
3-octadecanamido-2-ethoxypropylphosphocholine | [no description available] | medium | 1 | 0 | | |
chelerythrine chloride | [no description available] | medium | 1 | 0 | | |
tosyllysine chloromethyl ketone | [no description available] | medium | 1 | 0 | | |
5-(n-methyl-n-isobutyl)amiloride | [no description available] | medium | 1 | 0 | | |
1-(5-isoquinolinesulfonyl)-2-methylpiperazine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | EC 2.7.11.13 (protein kinase C) inhibitor |
amperozide hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anxiolytic drug; dopamine uptake inhibitor; geroprotector; second generation antipsychotic; serotonergic antagonist |
pyrrolidine dithiocarbamic acid | [no description available] | medium | 1 | 0 | | |
agroclavine | [no description available] | medium | 1 | 0 | ergot alkaloid | |
s-methylisothiourea sulfate | [no description available] | medium | 1 | 0 | | |
p-Aminobenzamidine dihydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
benzamidine hydrochloride | [no description available] | medium | 1 | 0 | | |
ketorolac tromethamine | [no description available] | medium | 1 | 0 | organoammonium salt | analgesic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor |
methionine sulfoximine | [no description available] | medium | 1 | 0 | L-alpha-amino acid zwitterion; L-methionine derivative; methionine sulfoximine; non-proteinogenic L-alpha-amino acid | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor; geroprotector |
tretazicar | [no description available] | medium | 1 | 0 | | |
carbetapentane citrate | [no description available] | medium | 1 | 0 | carbonyl compound | |
phentolamine mesylate | [no description available] | medium | 2 | 0 | | |
mephentermine | [no description available] | medium | 1 | 0 | 2-aminooctadecane-1,3-diol | EC 2.7.11.13 (protein kinase C) inhibitor; human metabolite; mouse metabolite |
oxybutynin hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
nimustine | [no description available] | medium | 1 | 0 | hydrochloride | antineoplastic agent |
cordium | [no description available] | medium | 1 | 0 | hydrate; hydrochloride | |
L-2-aminoadipic acid | [no description available] | medium | 1 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
prilocaine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | local anaesthetic |
mor-14 | [no description available] | medium | 1 | 0 | hydroxypiperidine; piperidine alkaloid; tertiary amino compound | anti-HIV agent; cardioprotective agent; EC 3.2.1.20 (alpha-glucosidase) inhibitor; plant metabolite |
phenylisopropyladenosine | [no description available] | medium | 1 | 0 | aromatic amine; benzenes; hydrocarbyladenosine; purine nucleoside; secondary amino compound | adenosine A1 receptor agonist; neuroprotective agent |
hexamethonium chloride | [no description available] | medium | 1 | 0 | | |
6-(4-nitrobenzylthio)guanosine | [no description available] | medium | 1 | 0 | | |
3-aminopropylphosphonic acid | [no description available] | medium | 1 | 0 | phosphonic acids; primary amino compound; zwitterion | GABAB receptor agonist |
5'-n-methylcarboxamideadenosine | [no description available] | medium | 1 | 0 | | |
3,7-dimethyl-1-propargylxanthine | [no description available] | medium | 1 | 0 | | |
zpck | [no description available] | medium | 1 | 0 | | |
n(6)-phenyladenosine | [no description available] | medium | 2 | 0 | purine nucleoside | |
tetrahydrodeoxycorticosterone | [no description available] | medium | 1 | 0 | 21-hydroxy steroid | |
n-methyladenosine | [no description available] | medium | 1 | 0 | methyladenosine | |
mizoribine | [no description available] | medium | 2 | 0 | imidazoles | anticoronaviral agent |
1-amino-1,3-dicarboxycyclopentane | [no description available] | medium | 1 | 0 | | |
u 73122 | [no description available] | medium | 1 | 0 | aromatic ether; aza-steroid; maleimides | EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor |
alphaxalone | [no description available] | medium | 2 | 0 | corticosteroid hormone | |
s-nitrosoglutathione | [no description available] | medium | 1 | 0 | glutathione derivative; nitrosothio compound | bronchodilator agent; nitric oxide donor; platelet aggregation inhibitor; signalling molecule |
cp-55,940 | [no description available] | medium | 1 | 0 | | |
vanoxerine | [no description available] | medium | 1 | 0 | hydrochloride | dopamine uptake inhibitor |
methyl 6,7-dimethoxy-4-ethyl-beta-carboline-3-carboxylate | [no description available] | medium | 1 | 0 | beta-carbolines | |
u 69593 | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; N-alkylpyrrolidine; organic heterobicyclic compound; oxaspiro compound | anti-inflammatory agent; diuretic; kappa-opioid receptor agonist |
cv 3988 | [no description available] | medium | 1 | 0 | | |
methoctramine | [no description available] | medium | 1 | 0 | hydrochloride | muscarinic antagonist |
hypotaurine | [no description available] | medium | 1 | 0 | aminosulfinic acid; zwitterion | human metabolite; metabolite; mouse metabolite |
dihydrokainate | [no description available] | medium | 1 | 0 | dicarboxylic acid | |
gabazine | [no description available] | medium | 1 | 0 | | |
cl 218872 | [no description available] | medium | 1 | 0 | pyridazines; ring assembly | |
betaxolol hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antihypertensive agent; beta-adrenergic antagonist |
catechin | [no description available] | medium | 1 | 0 | hydrate | geroprotector |
1-(2-methoxyphenyl)-4-(4-(2-phthalimido)butyl)piperazine | [no description available] | medium | 1 | 0 | hydrobromide | serotonergic antagonist |
s-methylthiocitrulline | [no description available] | medium | 1 | 0 | imidothiocarbamic ester; L-arginine derivative; L-ornithine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; neuroprotective agent |
dihydrocapsaicin | [no description available] | medium | 1 | 0 | capsaicinoid | |
ml 9 | [no description available] | medium | 1 | 0 | | |
parthenolide | [no description available] | medium | 1 | 0 | germacranolide | |
3',4'-dichlorobenzamil | [no description available] | medium | 1 | 0 | guanidines; pyrazines | |
1-(carboxymethylthio)tetradecane | [no description available] | medium | 1 | 0 | straight-chain fatty acid | |
2-iodomelatonin | [no description available] | medium | 1 | 0 | acetamides | |
arcaine, sulfate | [no description available] | medium | 1 | 0 | | |
gr 113808 | [no description available] | medium | 1 | 0 | indolyl carboxylate ester; piperidines; sulfonamide | serotonergic antagonist |
gallopamil hydrochloride | [no description available] | medium | 2 | 0 | | |
gamma-glutamylaminomethylsulfonic acid | [no description available] | medium | 1 | 0 | | |
buthionine sulfoximine | [no description available] | medium | 1 | 0 | 2-amino-4-(S-butylsulfonimidoyl)butanoic acid | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
sb 204070a | [no description available] | medium | 1 | 0 | | |
1-(2-(4-aminophenyl)ethyl)-4-(3-trifluoromethylphenyl)piperazine | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; N-alkylpiperazine; N-arylpiperazine; primary arylamine; substituted aniline | geroprotector; serotonergic agonist |
l 655240 | [no description available] | medium | 1 | 0 | methylindole | |
san 58035 | [no description available] | medium | 1 | 0 | | |
nnc 711 | [no description available] | medium | 1 | 0 | | |
4-(alpha-(4-allyl-2,5-dimethyl-1-piperazinyl)-3-methoxybenzyl)-n,n-diethylbenzamide | [no description available] | medium | 1 | 0 | diarylmethane | |
e 64 | [no description available] | medium | 1 | 0 | dicarboxylic acid monoamide; epoxy monocarboxylic acid; guanidines; L-leucine derivative; zwitterion | antimalarial; antiparasitic agent; protease inhibitor |
azetidine-2,4-dicarboxylic acid | [no description available] | medium | 1 | 0 | | |
pre 084 | [no description available] | medium | 1 | 0 | morpholines | |
methotrexate | [no description available] | medium | 78 | 0 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
methotrexate | [no description available] | medium | 78 | 1 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
1-(2-allylphenoxy)-3-((8-bromoacetylamino-4-menthane-1-yl)amino)-1-propanol | [no description available] | medium | 1 | 0 | | |
sr 2640 | [no description available] | medium | 1 | 0 | quinolines | |
ici 204448 | [no description available] | medium | 1 | 0 | | |
4-amino-1-(6-chloro-2-pyridyl)piperidine hydrochloride | [no description available] | medium | 1 | 0 | | |
n,n-di-n-hexyl-2-(4-fluorophenyl)indole-3-acetamide | [no description available] | medium | 1 | 0 | phenylindole | |
3,5-bis(trifluoromethyl)benzyl n-acetyltryptophan | [no description available] | medium | 1 | 0 | | |
8-cyclopentyl-3-(3-((4-(fluorosulfonyl)benzoyl)oxy)propyl)-1-propylxanthine | [no description available] | medium | 1 | 0 | | |
l 741626 | [no description available] | medium | 1 | 0 | piperidines | |
nisoxetine hydrochloride | [no description available] | medium | 1 | 0 | | |
ng-nitroarginine methyl ester | [no description available] | medium | 1 | 0 | hydrochloride | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
tilarginine acetate | [no description available] | medium | 1 | 0 | | |
alpha-guanidinoglutaric acid | [no description available] | medium | 1 | 0 | L-glutamic acid derivative | |
3,4-dichloro-n-methyl-n-(2-(1-pyrrolidinyl)cyclohexyl)-benzeneacetamide, (trans)-(+-)-isomer | [no description available] | medium | 2 | 0 | | |
imidazole-4-acetic acid hydrochloride | [no description available] | medium | 1 | 0 | | |
nsc-141549 | [no description available] | medium | 1 | 0 | | |
2-chloro-2-deoxyglucose | [no description available] | medium | 1 | 0 | | |
idazoxan hydrochloride | [no description available] | medium | 2 | 0 | | |
isoguvacine hydrochloride | [no description available] | medium | 1 | 0 | | |
8-methoxymethyl-3-isobutyl-1-methylxanthine | [no description available] | medium | 1 | 0 | oxopurine | |
cyc 202 | [no description available] | medium | 1 | 0 | 2,6-diaminopurines | antiviral drug; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
Serotonin hydrochloride | [no description available] | medium | 1 | 0 | tryptamines | |
n-phthaloylglutamic acid | [no description available] | medium | 1 | 0 | L-glutamic acid derivative; phthalimides | |
1,3-dipropyl-7-methylxanthine | [no description available] | medium | 1 | 0 | | |
ag 3-5 | [no description available] | medium | 1 | 0 | C-nitro compound | |
n-n-propylnorapomorphine | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
urapidil monohydrochloride | [no description available] | medium | 1 | 0 | | |
aminopterin | [no description available] | medium | 24 | 0 | dicarboxylic acid | EC 1.5.1.3 (dihydrofolate reductase) inhibitor; mutagen |
azepexole, dihydrochloride | [no description available] | medium | 1 | 0 | | |
2,5-dimethoxy-4-iodoamphetamine hydrochloride | [no description available] | medium | 1 | 0 | | |
abt 980 | [no description available] | medium | 1 | 0 | | |
sk&f 75670 | [no description available] | medium | 1 | 0 | | |
esatenolol | [no description available] | medium | 1 | 0 | atenolol | beta-adrenergic antagonist |
nbi 27914 | [no description available] | medium | 1 | 0 | dialkylarylamine; tertiary amino compound | |
sb 216763 | [no description available] | medium | 1 | 0 | indoles; maleimides | |
(R)-atenolol | [no description available] | medium | 1 | 0 | atenolol | |
memantine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; antiparkinson drug; dopaminergic agent; neuroprotective agent; NMDA receptor antagonist |
pefabloc | [no description available] | medium | 1 | 0 | | |
pongidae | [no description available] | medium | 1 | 0 | | |
succinylproline | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
sb 205384 | [no description available] | medium | 1 | 0 | thienopyridine | |
hydrastine | [no description available] | medium | 1 | 0 | isoquinolines | metabolite |
gabaculine hydrochloride | [no description available] | medium | 1 | 0 | | |
etiron monohydrobromide | [no description available] | medium | 1 | 0 | | |
bmy 7378 | [no description available] | medium | 1 | 0 | | |
vesamicol | [no description available] | medium | 1 | 0 | | |
vincristine sulfate | [no description available] | medium | 1 | 0 | organic sulfate salt | antineoplastic agent; geroprotector |
n-methylserotonin oxalate salt | [no description available] | medium | 1 | 0 | | |
nsc 95397 | [no description available] | medium | 1 | 0 | 1,4-naphthoquinones | |
wortmannin | [no description available] | medium | 1 | 0 | acetate ester; cyclic ketone; delta-lactone; organic heteropentacyclic compound | anticoronaviral agent; antineoplastic agent; autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector; Penicillium metabolite; radiosensitizing agent |
lithium chloride | [no description available] | medium | 2 | 0 | inorganic chloride; lithium salt | antimanic drug; geroprotector |
canavanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid | phytogenic insecticide; plant metabolite |
5-hydroxytryptophan | [no description available] | medium | 1 | 0 | 5-hydroxytryptophan; amino acid zwitterion; hydroxy-L-tryptophan; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; plant metabolite |
tosylphenylalanyl chloromethyl ketone | [no description available] | medium | 2 | 0 | alpha-chloroketone; sulfonamide | alkylating agent; serine proteinase inhibitor |
monoiodotyrosine | [no description available] | high | 2 | 0 | amino acid zwitterion; L-tyrosine derivative; monoiodotyrosine; non-proteinogenic L-alpha-amino acid | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; human metabolite; mouse metabolite |
nitroarginine | [no description available] | medium | 1 | 0 | guanidines; L-arginine derivative; N-nitro compound; non-proteinogenic L-alpha-amino acid | |
willardiine | [no description available] | medium | 1 | 0 | amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | |
amiodarone hydrochloride | [no description available] | medium | 2 | 0 | aromatic ketone | |
dicyclomine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antispasmodic drug; muscarinic antagonist |
metyrosine | [no description available] | medium | 1 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | antihypertensive agent; EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor |
nortriptyline hydrochloride | [no description available] | medium | 2 | 0 | organic tricyclic compound | geroprotector |
paromomycin sulfate | [no description available] | medium | 1 | 0 | | |
Dubinidine | [no description available] | medium | 1 | 0 | organic heterotricyclic compound; organonitrogen heterocyclic compound; oxacycle | |
cyclopamine | [no description available] | medium | 1 | 0 | piperidines | glioma-associated oncogene inhibitor |
s-(4-azidophenacyl)glutathione | [no description available] | medium | 1 | 0 | peptide | |
hydroxylamine hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
sb 228357 | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
3,5-dihydroxyphenylglycine | [no description available] | medium | 1 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid; resorcinols | |
actinonin | [no description available] | medium | 1 | 0 | | |
vinpocetine | [no description available] | medium | 2 | 0 | alkaloid | geroprotector |
dihydroergocristine monomesylate | [no description available] | medium | 2 | 0 | methanesulfonate salt | alpha-adrenergic antagonist; geroprotector; vasodilator agent |
tretinoin | [no description available] | high | 7 | 0 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
resveratrol | [no description available] | medium | 4 | 0 | resveratrol | antioxidant; phytoalexin; plant metabolite; quorum sensing inhibitor; radical scavenger |
oleic acid | [no description available] | high | 2 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
thapsigargin | [no description available] | medium | 1 | 0 | butyrate ester; organic heterotricyclic compound; sesquiterpene lactone | calcium channel blocker; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor |
brivudine | [no description available] | medium | 1 | 0 | | |
5,11-diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol | [no description available] | medium | 1 | 0 | carbotetracyclic compound; polyphenol | estrogen receptor agonist; estrogen receptor antagonist; geroprotector; neuroprotective agent |
2-amino-3-(5-tert-butyl-3-(phosphonomethoxy)-4-isoxazolyl)propionic acid | [no description available] | medium | 1 | 0 | | |
adenosine-5'-(n-ethylcarboxamide) | [no description available] | medium | 2 | 0 | adenosines; monocarboxylic acid amide | adenosine A1 receptor agonist; adenosine A2A receptor agonist; antineoplastic agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; vasodilator agent |
L-cycloserine | [no description available] | medium | 1 | 0 | 4-amino-1,2-oxazolidin-3-one | anti-HIV agent; anticonvulsant; EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor |
1,4-dideoxy-1,4-imino-d-arabinitol | [no description available] | medium | 1 | 0 | | |
purvalanol a | [no description available] | medium | 1 | 0 | purvalanol | |
melphalan | [no description available] | medium | 8 | 0 | L-phenylalanine derivative; nitrogen mustard; non-proteinogenic L-alpha-amino acid; organochlorine compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
isoliquiritigenin | [no description available] | medium | 1 | 0 | chalcones | antineoplastic agent; biological pigment; EC 1.14.18.1 (tyrosinase) inhibitor; GABA modulator; geroprotector; metabolite; NMDA receptor antagonist |
rauwolscine | [no description available] | medium | 1 | 0 | methyl 17-hydroxy-20xi-yohimban-16-carboxylate | |
gw9662 | [no description available] | medium | 1 | 0 | benzamides | |
calmidazolium | [no description available] | medium | 1 | 0 | organic chloride salt | apoptosis inducer; calmodulin antagonist |
tropisetron hydrochloride | [no description available] | medium | 1 | 0 | | |
Reactive blue 2 | [no description available] | medium | 1 | 0 | anthraquinone | |
5,6-dichloro-1-ethyl-1,3-dihydro-2h-benzimidazol-2-one | [no description available] | medium | 1 | 0 | dichlorobenzene | |
quinidine sulfate | [no description available] | medium | 1 | 0 | | |
ipratropium bromide anhydrous | [no description available] | medium | 2 | 0 | | |
methamilane methiodide | [no description available] | medium | 2 | 0 | | |
pilocarpine nitrate | [no description available] | medium | 2 | 0 | | |
r 59949 | [no description available] | medium | 1 | 0 | diarylmethane | |
n(6)-cyclopentyladenosine | [no description available] | medium | 2 | 0 | | |
methylatropine nitrate | [no description available] | medium | 2 | 0 | | |
sb 366791 | [no description available] | medium | 1 | 0 | | |
ag-213 | [no description available] | medium | 1 | 0 | | |
3,3',4,5'-tetrahydroxystilbene | [no description available] | medium | 1 | 0 | catechols; polyphenol; resorcinols; stilbenol | antineoplastic agent; apoptosis inducer; geroprotector; hypoglycemic agent; plant metabolite; protein kinase inhibitor; tyrosine kinase inhibitor |
bemesetron | [no description available] | medium | 1 | 0 | | |
(S)-(-)-pindolol | [no description available] | medium | 1 | 0 | pindolol | |
levosulpiride | [no description available] | medium | 1 | 0 | sulpiride | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
caffeic acid | [no description available] | medium | 2 | 0 | caffeic acid | geroprotector; mouse metabolite |
4-fluorophenyl-L-alanine | [no description available] | medium | 1 | 0 | 4-fluorophenylalanine; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid | |
urocanic acid | [no description available] | medium | 2 | 0 | urocanic acid | human metabolite |
cotinine | [no description available] | medium | 2 | 0 | N-alkylpyrrolidine; pyridines; pyrrolidin-2-ones; pyrrolidine alkaloid | antidepressant; biomarker; human xenobiotic metabolite; plant metabolite |
cinnarizine | [no description available] | medium | 3 | 0 | diarylmethane; N-alkylpiperazine; olefinic compound | anti-allergic agent; antiemetic; calcium channel blocker; geroprotector; H1-receptor antagonist; histamine antagonist; muscarinic antagonist |
sulindac | [no description available] | medium | 4 | 0 | monocarboxylic acid; organofluorine compound; sulfoxide | analgesic; antineoplastic agent; antipyretic; apoptosis inducer; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug; tocolytic agent |
cysteine sulfinic acid | [no description available] | medium | 1 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
d-ap7 | [no description available] | medium | 1 | 0 | | |
(1R,2S)-tranylcypromine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
tacrine hydrochloride | [no description available] | medium | 2 | 0 | | |
4-bromotetramisole, oxalate (1:1), salt(s)-isomer | [no description available] | medium | 1 | 0 | | |
3-hydroxybenzylhydrazine hydrochloride | [no description available] | medium | 1 | 0 | | |
1-(3-chlorophenyl)biguanide hydrochloride | [no description available] | medium | 1 | 0 | | |
4-chlorophenylalanine methyl ester, hydrochloride, (dl)-isomer | [no description available] | medium | 1 | 0 | | |
capsazepine | [no description available] | medium | 1 | 0 | benzazepine; catechols; monochlorobenzenes; thioureas | capsaicin receptor antagonist |
diphenyleneiodium chloride | [no description available] | medium | 1 | 0 | organic chloride salt | EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor; G-protein-coupled receptor agonist |
azetidine-2,4-dicarboxylic acid, (cis)-isomer | [no description available] | medium | 1 | 0 | | |
tamoxifen citrate | [no description available] | medium | 1 | 0 | citrate salt | angiogenesis inhibitor; anticoronaviral agent |
pimagedine hydrochloride | [no description available] | medium | 1 | 0 | | |
Betaine Aldehyde Chloride | [no description available] | medium | 1 | 0 | quaternary ammonium salt | |
eskazine | [no description available] | medium | 2 | 0 | | |
monastrol | [no description available] | medium | 1 | 0 | enoate ester; ethyl ester; phenols; racemate; thioureas | antileishmanial agent; antimitotic; antineoplastic agent; EC 3.5.1.5 (urease) inhibitor |
u 0126 | [no description available] | medium | 1 | 0 | aryl sulfide; dinitrile; enamine; substituted aniline | antineoplastic agent; antioxidant; apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; osteogenesis regulator; vasoconstrictor agent |
4-diphenylacetoxy-n-methylpiperidine methiodide | [no description available] | medium | 1 | 0 | iodide salt; quaternary ammonium salt | cholinergic antagonist; muscarinic antagonist |
1-(4-hydroxybenzyl)imidazole-2-thiol | [no description available] | medium | 1 | 0 | | |
2-chloro-n(6)-(3-iodobenzyl)adenosine-5'-n-methyluronamide | [no description available] | medium | 1 | 0 | | |
bp 897 | [no description available] | medium | 1 | 0 | naphthalenecarboxamide | |
trequinsin hydrochloride | [no description available] | medium | 1 | 0 | | |
neboglamine | [no description available] | medium | 1 | 0 | | |
benzatropine methanesulfonate | [no description available] | medium | 1 | 0 | | |
sb 203186 | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
n-(1-methyl-5-indolyl)-n'-(3-methyl-5-isothiazolyl)urea | [no description available] | medium | 1 | 0 | 1,2-thiazoles; indoles; ureas | receptor modulator; serotonergic antagonist |
gw 7647 | [no description available] | medium | 1 | 0 | aryl sulfide; monocarboxylic acid; ureas | PPARalpha agonist |
ro 41-0960 | [no description available] | medium | 1 | 0 | | |
cgp 13501 | [no description available] | medium | 1 | 0 | alkylbenzene | |
n-(2-(4-(4-chlorophenyl)piperazin-1-yl)ethyl)-3-methoxybenzamide | [no description available] | medium | 1 | 0 | | |
brl 15572 | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; secondary alcohol | geroprotector; serotonergic antagonist |
mrs 1523 | [no description available] | medium | 1 | 0 | | |
or486 | [no description available] | medium | 1 | 0 | | |
fg 9041 | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
iik7 | [no description available] | medium | 1 | 0 | | |
sb 415286 | [no description available] | medium | 1 | 0 | C-nitro compound; maleimides; monochlorobenzenes; phenols; secondary amino compound; substituted aniline | antioxidant; apoptosis inducer; EC 2.7.11.26 (tau-protein kinase) inhibitor; neuroprotective agent |
dm 235 | [no description available] | medium | 1 | 0 | | |
jhw 015 | [no description available] | medium | 1 | 0 | indolecarboxamide | |
bw 723c86 | [no description available] | medium | 1 | 0 | tryptamines | |
sc 560 | [no description available] | medium | 1 | 0 | aromatic ether; monochlorobenzenes; organofluorine compound; pyrazoles | angiogenesis modulating agent; antineoplastic agent; apoptosis inducer; cyclooxygenase 1 inhibitor; non-steroidal anti-inflammatory drug |
sc-19220 | [no description available] | medium | 1 | 0 | aromatic ether | |
le 300 | [no description available] | medium | 1 | 0 | indoles | |
ly 367265 | [no description available] | medium | 1 | 0 | dihydropyridine; fluoroindole; tertiary amino compound; thiadiazoloquinoline | antidepressant; geroprotector; serotonergic antagonist; serotonin uptake inhibitor |
cgp 7930 | [no description available] | medium | 1 | 0 | alkylbenzene | |
1,3,5-tris(4-hydroxyphenyl)-4-propyl-1h-pyrazole | [no description available] | medium | 1 | 0 | phenols; pyrazoles | estrogen receptor agonist |
sib 1757 | [no description available] | medium | 1 | 0 | | |
sphingosine | [no description available] | high | 2 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
apigenin | [no description available] | medium | 1 | 0 | trihydroxyflavone | antineoplastic agent; metabolite |
luteolin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavonoid; tetrahydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; apoptosis inducer; c-Jun N-terminal kinase inhibitor; EC 2.3.1.85 (fatty acid synthase) inhibitor; immunomodulator; nephroprotective agent; plant metabolite; radical scavenger; vascular endothelial growth factor receptor antagonist |
daphnetin | [no description available] | medium | 1 | 0 | hydroxycoumarin | |
genistein | [no description available] | medium | 2 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; human urinary metabolite; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
pulmicort | [no description available] | high | 5 | 1 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic acetal; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; bronchodilator agent; drug allergen |
pulmicort | [no description available] | high | 5 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic acetal; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; bronchodilator agent; drug allergen |
timolol maleate | [no description available] | medium | 2 | 0 | maleate salt | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist |
brompheniramine maleate | [no description available] | medium | 2 | 0 | maleate salt | anti-allergic agent |
chlorpheniramine maleate | [no description available] | medium | 1 | 0 | organic molecular entity | |
clemastine fumarate | [no description available] | medium | 1 | 0 | fumarate salt | anti-allergic agent; antipruritic drug; H1-receptor antagonist; muscarinic antagonist |
methylergonovine maleate | [no description available] | medium | 1 | 0 | ergoline alkaloid | geroprotector |
astaxanthine | [no description available] | medium | 1 | 0 | carotenol; carotenone | animal metabolite; anticoagulant; antioxidant; food colouring; plant metabolite |
morin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | angiogenesis modulating agent; anti-inflammatory agent; antibacterial agent; antihypertensive agent; antineoplastic agent; antioxidant; EC 5.99.1.2 (DNA topoisomerase) inhibitor; hepatoprotective agent; metabolite; neuroprotective agent |
myricetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; hexahydroxyflavone | antineoplastic agent; antioxidant; cyclooxygenase 1 inhibitor; food component; geroprotector; hypoglycemic agent; plant metabolite |
daidzein | [no description available] | medium | 1 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; phytoestrogen; plant metabolite |
caffeic acid phenethyl ester | [no description available] | medium | 2 | 0 | alkyl caffeate ester | anti-inflammatory agent; antibacterial agent; antineoplastic agent; antioxidant; antiviral agent; immunomodulator; metabolite; neuroprotective agent |
rottlerin | [no description available] | medium | 1 | 0 | aromatic ketone; benzenetriol; chromenol; enone; methyl ketone | anti-allergic agent; antihypertensive agent; antineoplastic agent; apoptosis inducer; K-ATP channel agonist; metabolite |
flupenthixol | [no description available] | medium | 1 | 0 | flupenthixol | dopaminergic antagonist |
n-oleoyldopamine | [no description available] | medium | 1 | 0 | catechols; fatty amide; N-(fatty acyl)-dopamine; secondary carboxamide | TRPV1 agonist |
pheniramine maleate | [no description available] | medium | 2 | 0 | organic molecular entity | |
tranilast | [no description available] | medium | 3 | 0 | amidobenzoic acid; cinnamamides; dimethoxybenzene; secondary carboxamide | anti-allergic agent; anti-asthmatic drug; antineoplastic agent; aryl hydrocarbon receptor agonist; calcium channel blocker; hepatoprotective agent; nephroprotective agent |
trimipramine maleate | [no description available] | medium | 1 | 0 | maleate salt | antidepressant |
isotretinoin | [no description available] | medium | 2 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; teratogenic agent |
xylometazoline hydrochloride | [no description available] | medium | 2 | 0 | | |
flunarizine hydrochloride | [no description available] | medium | 1 | 0 | diarylmethane | |
ketotifen fumarate | [no description available] | medium | 2 | 0 | organoammonium salt | anti-asthmatic drug; H1-receptor antagonist |
cis-flupenthixol dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | geroprotector |
n-arachidonylglycine | [no description available] | medium | 1 | 0 | fatty amide; N-acylglycine | |
n-oleoylethanolamine | [no description available] | medium | 1 | 0 | endocannabinoid; N-(long-chain-acyl)ethanolamine; N-acylethanolamine 18:1 | EC 3.5.1.23 (ceramidase) inhibitor; geroprotector; PPARalpha agonist |
cyclosporine | [no description available] | medium | 3 | 0 | homodetic cyclic peptide | anti-asthmatic drug; anticoronaviral agent; antifungal agent; antirheumatic drug; carcinogenic agent; dermatologic drug; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; geroprotector; immunosuppressive agent; metabolite |
phenoxybenzamine hydrochloride | [no description available] | medium | 2 | 0 | organic molecular entity | |
phenylephrine hydrochloride | [no description available] | medium | 25 | 0 | hydrochloride | |
phenylephrine hydrochloride | [no description available] | medium | 25 | 1 | hydrochloride | |
mepyramine maleate | [no description available] | medium | 2 | 0 | | |
brefeldin a | [no description available] | medium | 2 | 0 | macrolide antibiotic | Penicillium metabolite |
fenretinide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; retinoid | antineoplastic agent; antioxidant |
4-(2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1-propenyl)benzoic acid | [no description available] | medium | 1 | 0 | benzoic acids; naphthalenes; retinoid | antineoplastic agent; retinoic acid receptor agonist; teratogenic agent |
l-2-(carboxypropyl)glycine | [no description available] | medium | 1 | 0 | | |
4-aminocrotonic acid | [no description available] | medium | 1 | 0 | | |
denopamine | [no description available] | medium | 1 | 0 | dimethoxybenzene | |
l 655,708 | [no description available] | medium | 1 | 0 | | |
ro 41-1049 | [no description available] | medium | 1 | 0 | | |
sb 200646a | [no description available] | medium | 1 | 0 | | |
seglitide | [no description available] | medium | 1 | 0 | | |
sib 1893 | [no description available] | medium | 1 | 0 | | |
su 6656 | [no description available] | medium | 1 | 0 | | |
tyrphostin ag 555 | [no description available] | medium | 2 | 0 | | |
tyrphostin ag-494 | [no description available] | medium | 1 | 0 | | |
tyrphostin b44 | [no description available] | medium | 1 | 0 | | |
ag-490 | [no description available] | medium | 1 | 0 | catechols; enamide; monocarboxylic acid amide; nitrile; secondary carboxamide | anti-inflammatory agent; antioxidant; apoptosis inducer; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; geroprotector; STAT3 inhibitor |
ag 112 | [no description available] | medium | 1 | 0 | | |
ag 183 | [no description available] | medium | 1 | 0 | | |
semaxinib | [no description available] | medium | 1 | 0 | olefinic compound; oxindoles; pyrroles | angiogenesis modulating agent; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; vascular endothelial growth factor receptor antagonist |
8-(3-chlorostyryl)caffeine | [no description available] | medium | 1 | 0 | monochlorobenzenes; trimethylxanthine | adenosine A2A receptor antagonist; EC 1.4.3.4 (monoamine oxidase) inhibitor |
bay 11-7085 | [no description available] | medium | 1 | 0 | benzenes; nitrile; sulfone | anti-inflammatory agent; antibacterial agent; antineoplastic agent; apoptosis inducer; autophagy inducer; EC 2.7.11.10 (IkappaB kinase) inhibitor; ferroptosis inducer; NF-kappaB inhibitor |
molsidomine | [no description available] | medium | 2 | 0 | ethyl ester; morpholines; oxadiazole; zwitterion | antioxidant; apoptosis inhibitor; cardioprotective agent; nitric oxide donor; vasodilator agent |
diamide | [no description available] | medium | 1 | 0 | 1,1'-azobis(N,N-dimethylformamide) | |
nomifensine maleate | [no description available] | medium | 1 | 0 | | |
nalbuphine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
isoalloxazine | [no description available] | medium | 1 | 0 | benzo[g]pteridine-2,4-dione | |
vinblastine sulfate | [no description available] | medium | 2 | 0 | | |
n-methylscopolamine bromide | [no description available] | medium | 2 | 0 | | |
dextromethorphan hydrobromide | [no description available] | medium | 1 | 0 | hydrate; hydrobromide | |
naloxone hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
s-trans,trans-farnesylthiosalicylic acid | [no description available] | medium | 1 | 0 | sesquiterpenoid | |
sulindac sulfone | [no description available] | medium | 1 | 0 | monocarboxylic acid; organofluorine compound; sulfone | apoptosis inducer; cyclooxygenase 2 inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor |
naltrexone hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
guanabenz acetate | [no description available] | medium | 2 | 0 | dichlorobenzene | geroprotector |
nylidrin hydrochloride | [no description available] | medium | 2 | 0 | alkylbenzene | |
triprolidine hydrochloride anhydrous | [no description available] | medium | 2 | 0 | hydrochloride | H1-receptor antagonist |
famotidine | [no description available] | medium | 2 | 0 | 1,3-thiazoles; guanidines; sulfonamide | anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
fenoterol | [no description available] | medium | 1 | 0 | hydrobromide | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
tiapridex | [no description available] | medium | 2 | 0 | benzamides | |
quipazine maleate | [no description available] | medium | 1 | 0 | | |
n-(2-aminoethyl)-4-chlorobenzamide hydrochloride | [no description available] | medium | 1 | 0 | | |
tulobuterol hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
hp 029 | [no description available] | medium | 1 | 0 | | |
n,n,n-trimethyl-1-(4-stilbenoxy)-2-propylammonium iodide | [no description available] | medium | 1 | 0 | | |
6-(bromomethylene)tetrahydro-3-(1-naphthaleneyl)-2h-pyran-2-one | [no description available] | medium | 1 | 0 | naphthalenes | |
nf023 | [no description available] | medium | 1 | 0 | | |
nf 449 | [no description available] | medium | 1 | 0 | | |
7-chloro-4-hydroxy-2-phenyl-1,8-naphthyridine | [no description available] | medium | 1 | 0 | | |
gr 46611 | [no description available] | medium | 1 | 0 | | |
diacetylmonoxime | [no description available] | medium | 1 | 0 | | |
homatropine hydrobromide, (endo-(+-)-isomer) | [no description available] | medium | 1 | 0 | | |
vancomycin hydrochloride | [no description available] | medium | 1 | 0 | | |
moxisylyte hydrochloride | [no description available] | medium | 2 | 0 | monoterpenoid | |
dizocilpine maleate | [no description available] | medium | 1 | 0 | maleate salt; tetracyclic antidepressant | anaesthetic; anticonvulsant; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist |
beta-aminopropionitrile fumarate | [no description available] | medium | 1 | 0 | | |
flupirtine | [no description available] | medium | 1 | 0 | | |
zimelidine hydrochloride | [no description available] | medium | 1 | 0 | | |
pregna-4,17-diene-3,16-dione, (17z)-isomer | [no description available] | medium | 1 | 0 | | |
su 4312 | [no description available] | medium | 1 | 0 | | |
gw 1929 | [no description available] | medium | 1 | 0 | benzophenones | |
protriptyline hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antidepressant |
n(4)-chloroacetylcytosine arabinoside | [no description available] | medium | 1 | 0 | | |
n-(3-(cyclohexylidene-(1h-imidazol-4-ylmethyl))phenyl)ethanesulfonamide | [no description available] | medium | 1 | 0 | | |
n-(4-amino-2-chlorophenyl)phthalimide | [no description available] | medium | 1 | 0 | | |
cb 34 | [no description available] | medium | 1 | 0 | | |
b 43 | [no description available] | medium | 1 | 0 | aromatic amine; aromatic ether; cyclopentanes; primary amino compound; pyrrolopyrimidine | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; geroprotector |
(8R)-7-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,13,14-triol | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
(8R)-7-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,13,14-triol | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
3-(6-chloro-3-pyridazinyl)-3,8-diazabicyclo(3.2.1)octane | [no description available] | medium | 1 | 0 | | |
2-(3,3-diphenylpropylamino)acetamide | [no description available] | medium | 1 | 0 | diarylmethane | |
4-(2-(phenylsulfonylamino)ethylthio)-2,6-difluorophenoxyacetamide | [no description available] | medium | 1 | 0 | | |
gw2974 | [no description available] | medium | 1 | 0 | pyridopyrimidine | |
l 162313 | [no description available] | medium | 1 | 0 | | |
l-165041 | [no description available] | medium | 1 | 0 | aromatic ketone | |
mrs 1754 | [no description available] | medium | 1 | 0 | oxopurine | |
s-nitroso-n-acetylpenicillamine | [no description available] | medium | 1 | 0 | nitroso compound; nitrosothio compound | nitric oxide donor; vasodilator agent |
pd 404182 | [no description available] | medium | 1 | 0 | | |
sb 222200 | [no description available] | medium | 1 | 0 | quinolines | |
dantrolene sodium | [no description available] | medium | 1 | 0 | | |
cr 2945 | [no description available] | medium | 1 | 0 | | |
sb 218795 | [no description available] | medium | 1 | 0 | quinolines | |
dihydroceramide | [no description available] | medium | 1 | 0 | N-acylsphinganine | |
epinephrine bitartrate | [no description available] | medium | 2 | 0 | | |
bicuculline methobromide | [no description available] | medium | 2 | 0 | | |
butylscopolammonium bromide | [no description available] | medium | 2 | 0 | | |
butaclamol hydrochloride | [no description available] | medium | 2 | 0 | | |
a 38503 | [no description available] | medium | 1 | 0 | | |
8-hydroxy-2-(di-n-propylamino)tetralin hydrobromide | [no description available] | medium | 1 | 0 | | |
sk&f 89976-a | [no description available] | medium | 1 | 0 | | |
cv 1808 | [no description available] | medium | 1 | 0 | purine nucleoside | |
fluvoxamine maleate | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes | |
naloxone benzoylhydrazone | [no description available] | medium | 1 | 0 | | |
2-methyl-6-(phenylethynyl)pyridine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anxiolytic drug; metabotropic glutamate receptor antagonist |
amiprilose | [no description available] | medium | 1 | 0 | | |
(R)-fluoxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; serotonin uptake inhibitor |
desmethylselegiline hydrochloride | [no description available] | medium | 1 | 0 | | |
3-morpholino-sydnonimine monohydrochloride | [no description available] | medium | 2 | 0 | | |
t 1032 | [no description available] | medium | 1 | 0 | | |
qx-314 bromide | [no description available] | medium | 1 | 0 | | |
(S)-fluoxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; serotonin uptake inhibitor |
sr 59230a | [no description available] | medium | 1 | 0 | | |
u 74389g | [no description available] | medium | 1 | 0 | | |
1-(2-methoxyphenyl)piperazine hydrochloride | [no description available] | medium | 1 | 0 | | |
y 27632, dihydrochloride, (4(r)-trans)-isomer | [no description available] | medium | 1 | 0 | | |
noscapine hydrochloride | [no description available] | medium | 1 | 0 | | |
a 77636 | [no description available] | medium | 1 | 0 | hydrochloride | antiparkinson drug; dopamine agonist |
cgp 20712a | [no description available] | medium | 1 | 0 | | |
levodopa methyl ester hydrochloride | [no description available] | medium | 1 | 0 | | |
benalfocin hydrochloride | [no description available] | medium | 1 | 0 | | |
lu 19005 | [no description available] | medium | 1 | 0 | | |
benoxathian hydrochloride | [no description available] | medium | 1 | 0 | | |
((2-n-butyl-6,7-dichloro-2-cyclopentyl-2,3-dihydro-1-oxo-1h-inden-5-yl)oxy)acetic acid, (+)-isomer | [no description available] | medium | 1 | 0 | | |
n-cyclopropyl adenosine-5'-carboxamide | [no description available] | medium | 1 | 0 | | |
cefotaxime sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
calpain inhibitor iii | [no description available] | medium | 1 | 0 | | |
GR 127935 hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | serotonergic antagonist |
mrs 1845 | [no description available] | medium | 1 | 0 | | |
1-aminocyclopropane-1-carboxylic acid hydrochloride | [no description available] | medium | 1 | 0 | | |
alaproclate hydrochloride | [no description available] | medium | 1 | 0 | | |
ubenimex | [no description available] | medium | 1 | 0 | peptide | |
3-chloroalanine hydrochloride, (l-ala)-isomer | [no description available] | medium | 1 | 0 | | |
dsp 4 hydrochloride | [no description available] | medium | 1 | 0 | | |
calcimycin | [no description available] | medium | 2 | 0 | benzoxazole | |
(2-(2',6'-dimethoxy)phenoxyethylamino)methylbenzodioxan hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | alpha-adrenergic antagonist |
2-cyclooctyl-2-hydroxyethylamine hydrochloride | [no description available] | medium | 1 | 0 | | |
cirazoline monohydrochloride | [no description available] | medium | 1 | 0 | | |
adtn | [no description available] | medium | 1 | 0 | | |
apocodeine hydrochloride, (r)-isomer | [no description available] | medium | 1 | 0 | | |
Dihydro-beta-erythroidine hydrobromide | [no description available] | medium | 1 | 0 | indoles | |
lilly 78335 | [no description available] | medium | 1 | 0 | | |
efaroxan hydrochloride | [no description available] | medium | 1 | 0 | | |
fenoldopam hydrobromide | [no description available] | medium | 1 | 0 | | |
1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | dopamine uptake inhibitor |
guvacine hydrochloride | [no description available] | medium | 1 | 0 | | |
7-hydroxy-2-n,n-dipropylaminotetralin hydrobromide | [no description available] | medium | 1 | 0 | | |
8-hydroxy-2-(di-n-propylamino)tetralin hydrobromide, (r)-isomer, | [no description available] | medium | 1 | 0 | organic molecular entity | |
1-(2-(4-(4-fluoro-benzoyl)-piperidin-1-yl)-ethyl)-3,3-dimethyl-1,2-dihydro-indol-2-one | [no description available] | medium | 1 | 0 | hydrochloride | receptor modulator; serotonergic antagonist |
4-iodoclonidine | [no description available] | medium | 1 | 0 | | |
4-methylpyrazole monohydrochloride | [no description available] | medium | 1 | 0 | | |
tele-methylhistamine | [no description available] | medium | 1 | 0 | | |
alpha-methyltyrosine methyl ester, monohydrochloride | [no description available] | medium | 1 | 0 | | |
octoclothepine maleate | [no description available] | medium | 1 | 0 | | |
2-(n-phenethyl-n-propyl)amino-5-hydroxytetralin hydrochloride | [no description available] | medium | 1 | 0 | | |
du 24565 | [no description available] | medium | 1 | 0 | | |
2-methoxyidazoxan hydrochloride | [no description available] | medium | 1 | 0 | | |
ro 25-6981 | [no description available] | medium | 1 | 0 | | |
sk&f 77434 | [no description available] | medium | 1 | 0 | hydrobromide | dopamine agonist; prodrug |
3-[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-yl]-1,1-diethylurea | [no description available] | medium | 1 | 0 | organic heterotetracyclic compound; organonitrogen heterocyclic compound | |
demethylcantharidin | [no description available] | medium | 1 | 0 | | |
atropine sulfate | [no description available] | medium | 1 | 0 | | |
1-deoxynojirimycin hydrochloride | [no description available] | medium | 1 | 0 | | |
win 62577 | [no description available] | medium | 1 | 0 | | |
quinine sulfate | [no description available] | medium | 1 | 0 | hydrate | |
quercetin | [no description available] | medium | 1 | 0 | | |
rv 538, (r-(r*,r*))-isomer | [no description available] | medium | 1 | 0 | | |
3,4-dichloro-n-methyl-n-(2-(1-pyrrolidinyl)cyclohexyl)-benzeneacetamide, (1s-cis)-isomer | [no description available] | medium | 1 | 0 | | |
valproate sodium | [no description available] | medium | 1 | 0 | organic sodium salt | geroprotector |
u 63557a | [no description available] | medium | 1 | 0 | | |
taurocholic acid, monosodium salt | [no description available] | medium | 1 | 0 | bile salt | |
cefmetazole sodium | [no description available] | medium | 1 | 0 | organic sodium salt | antimicrobial agent |
fusidate sodium | [no description available] | medium | 1 | 0 | | |
cephapirin sodium | [no description available] | medium | 1 | 0 | cephalosporin; organic sodium salt | antibacterial drug |
sodium cephalothin | [no description available] | medium | 1 | 0 | organic sodium salt | |
cefazolin sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
5-hydroxydecanoic acid, monosodium salt | [no description available] | medium | 1 | 0 | | |
ro13-9904 | [no description available] | medium | 5 | 0 | | |
phenytoin sodium | [no description available] | medium | 1 | 0 | | |
cr 1409 | [no description available] | medium | 1 | 0 | | |
cortisol succinate, sodium salt | [no description available] | medium | 9 | 0 | organic molecular entity | |
piroxicam | [no description available] | medium | 5 | 0 | benzothiazine; monocarboxylic acid amide; pyridines | analgesic; antirheumatic drug; cyclooxygenase 1 inhibitor; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
lfm a13 | [no description available] | medium | 1 | 0 | aromatic amide; dibromobenzene; enamide; enol; nitrile; secondary carboxamide | antineoplastic agent; apoptosis inducer; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; EC 2.7.11.21 (polo kinase) inhibitor; geroprotector; platelet aggregation inhibitor |
l 701324 | [no description available] | medium | 1 | 0 | quinolines | |
hispidin | [no description available] | medium | 1 | 0 | 2-pyranones; catechols | antioxidant; EC 2.7.11.13 (protein kinase C) inhibitor; fungal metabolite |
minocycline hydrochloride | [no description available] | medium | 1 | 0 | | |
demeclocycline hydrochloride | [no description available] | medium | 2 | 0 | | |
acyclovir | [no description available] | medium | 9 | 0 | 2-aminopurines; oxopurine | antimetabolite; antiviral drug |
acyclovir | [no description available] | medium | 9 | 1 | 2-aminopurines; oxopurine | antimetabolite; antiviral drug |
sepiapterin | [no description available] | medium | 1 | 0 | sepiapterin | |
isoxanthopterin | [no description available] | medium | 1 | 0 | dihydroxypteridine | |
clozapine | [no description available] | medium | 3 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine; organochlorine compound | adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; GABA antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; xenobiotic |
ganciclovir | [no description available] | medium | 4 | 0 | 2-aminopurines; oxopurine | antiinfective agent; antiviral drug |
zaprinast | [no description available] | medium | 1 | 0 | triazolopyrimidines | |
allopurinol | [no description available] | medium | 12 | 0 | nucleobase analogue; organic heterobicyclic compound | antimetabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor; gout suppressant; radical scavenger |
thiolactomycin | [no description available] | medium | 1 | 0 | | |
2,4-diaminohypoxanthine | [no description available] | medium | 1 | 0 | hydroxypyrimidine | |
quazinone | [no description available] | medium | 1 | 0 | | |
8-bromocyclic gmp, sodium salt | [no description available] | medium | 1 | 0 | organic sodium salt | muscle relaxant; protein kinase G agonist |
ag-879 | [no description available] | medium | 1 | 0 | | |
coumarin | [no description available] | medium | 7 | 0 | coumarins | fluorescent dye; human metabolite; plant metabolite |
glycolic acid | [no description available] | medium | 1 | 0 | 2-hydroxy monocarboxylic acid; primary alcohol | keratolytic drug; metabolite |
niacin | [no description available] | high | 36 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
urea | [no description available] | high | 25 | 1 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
urea | [no description available] | high | 25 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
acetaminophen | [no description available] | medium | 5 | 0 | acetamides; phenols | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; cyclooxygenase 3 inhibitor; environmental contaminant; ferroptosis inducer; geroprotector; hepatotoxic agent; human blood serum metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
amobarbital | [no description available] | medium | 6 | 0 | barbiturates | |
amobarbital | [no description available] | medium | 6 | 1 | barbiturates | |
chloroxylenol | [no description available] | medium | 2 | 0 | monochlorobenzenes; phenols | antiseptic drug; disinfectant; molluscicide |
diclofenac | [no description available] | medium | 8 | 0 | amino acid; aromatic amine; dichlorobenzene; monocarboxylic acid; secondary amino compound | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
diethylcarbamazine | [no description available] | medium | 7 | 0 | N-carbamoylpiperazine; N-methylpiperazine | |
ethacrynic acid | [no description available] | medium | 6 | 0 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid | EC 2.5.1.18 (glutathione transferase) inhibitor; ion transport inhibitor; loop diuretic |
ethacrynic acid | [no description available] | medium | 6 | 1 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid | EC 2.5.1.18 (glutathione transferase) inhibitor; ion transport inhibitor; loop diuretic |
fentanyl | [no description available] | medium | 4 | 0 | anilide; monocarboxylic acid amide; piperidines | adjuvant; anaesthesia adjuvant; anaesthetic; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic |
isoproterenol | [no description available] | medium | 19 | 0 | catechols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; sympathomimetic agent |
ketorolac | [no description available] | medium | 2 | 0 | amino acid; aromatic ketone; monocarboxylic acid; pyrrolizines; racemate | analgesic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
meperidine | [no description available] | medium | 5 | 0 | ethyl ester; piperidinecarboxylate ester; tertiary amino compound | antispasmodic drug; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
nitroglycerin | [no description available] | medium | 3 | 0 | nitroglycerol | explosive; muscle relaxant; nitric oxide donor; prodrug; tocolytic agent; vasodilator agent; xenobiotic |
resorcinol | [no description available] | medium | 2 | 0 | benzenediol; phenolic donor; resorcinols | erythropoietin inhibitor; sensitiser |
salicylamide | [no description available] | medium | 3 | 0 | phenols; salicylamides | antirheumatic drug; non-narcotic analgesic |
cyclobarbital | [no description available] | medium | 2 | 0 | barbiturates | |
lysine | [no description available] | high | 9 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
sucrose | [no description available] | high | 16 | 1 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
sucrose | [no description available] | high | 16 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
histidine | [no description available] | high | 16 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
butobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
isosorbide dinitrate | [no description available] | medium | 1 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
2,4,6-trichlorophenol | [no description available] | medium | 1 | 0 | trichlorophenol | carcinogenic agent |
nicotinic acid benzyl ester | [no description available] | medium | 1 | 0 | benzyl ester | vasodilator agent |
4-phenylenediamine | [no description available] | medium | 2 | 0 | phenylenediamine | allergen; dye; hapten; reagent |
morpholine | [no description available] | medium | 1 | 0 | morpholines; saturated organic heteromonocyclic parent | NMR chemical shift reference compound |
n-nitrosodiethanolamine | [no description available] | medium | 1 | 0 | nitroso compound | |
sufentanil | [no description available] | medium | 1 | 0 | anilide; ether; piperidines; thiophenes | anaesthesia adjuvant; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic |
nicorandil | [no description available] | medium | 1 | 0 | nitrate ester; pyridinecarboxamide | potassium channel opener; vasodilator agent |
cortisol octanoate | [no description available] | medium | 2 | 0 | corticosteroid hormone | |
atropine | [no description available] | medium | 41 | 0 | | |
griseofulvin | [no description available] | medium | 9 | 0 | 1-benzofurans; antibiotic antifungal drug; benzofuran antifungal drug; organochlorine compound; oxaspiro compound | antibacterial agent; Penicillium metabolite |
etorphine | [no description available] | medium | 1 | 0 | alcohol; morphinane alkaloid | opioid analgesic; opioid receptor agonist; sedative |
codeine | [no description available] | medium | 7 | 0 | morphinane alkaloid; organic heteropentacyclic compound | antitussive; drug allergen; environmental contaminant; opioid analgesic; opioid receptor agonist; prodrug; xenobiotic |
hydromorphone | [no description available] | medium | 3 | 0 | morphinane alkaloid; organic heteropentacyclic compound | mu-opioid receptor agonist; opioid analgesic |
morphine | [no description available] | medium | 30 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary amino compound | anaesthetic; drug allergen; environmental contaminant; geroprotector; mu-opioid receptor agonist; opioid analgesic; plant metabolite; vasodilator agent; xenobiotic |
dihydromorphine | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
dextromethorphan | [no description available] | medium | 1 | 0 | 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene | antitussive; environmental contaminant; neurotoxin; NMDA receptor antagonist; oneirogen; prodrug; xenobiotic |
scopolamine hydrobromide | [no description available] | medium | 8 | 0 | | |
4-nonylphenol | [no description available] | medium | 1 | 0 | phenols | environmental contaminant |
ethinyl estradiol | [no description available] | medium | 19 | 0 | 17-hydroxy steroid; 3-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
methyltestosterone | [no description available] | high | 37 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; enone | anabolic agent; androgen; antineoplastic agent |
medroxyprogesterone acetate | [no description available] | high | 5 | 1 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; corticosteroid; steroid ester | adjuvant; androgen; antineoplastic agent; antioxidant; female contraceptive drug; inhibitor; progestin; synthetic oral contraceptive |
medroxyprogesterone acetate | [no description available] | high | 5 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; corticosteroid; steroid ester | adjuvant; androgen; antineoplastic agent; antioxidant; female contraceptive drug; inhibitor; progestin; synthetic oral contraceptive |
4-tert-octylphenol | [no description available] | medium | 1 | 0 | alkylbenzene | |
mestanolone | [no description available] | medium | 1 | 0 | 3-oxo-5alpha-steroid | |
levonorgestrel | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound | contraceptive drug; female contraceptive drug; progestin; synthetic oral contraceptive |
mesterolone | [no description available] | medium | 1 | 0 | 3-oxo-5alpha-steroid | |
desogestrel | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | contraceptive drug; progestin; synthetic oral contraceptive |
16-hydroxytestosterone | [no description available] | medium | 1 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid; C19-steroid; diol; secondary alcohol | androgen |
2-iodoestradiol | [no description available] | medium | 1 | 0 | | |
bolasterone | [no description available] | medium | 1 | 0 | 3-hydroxy steroid | androgen |
matairesinol | [no description available] | medium | 1 | 0 | gamma-lactone; lignan; polyphenol | angiogenesis inhibitor; anti-asthmatic agent; phytoestrogen; plant metabolite |
4-androstene-3,17-diol | [no description available] | medium | 1 | 0 | 3-hydroxy steroid | androgen |
3,4-divanillyltetrahydrofuran | [no description available] | medium | 1 | 0 | | |
estradiol 3-benzoate | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; benzoate ester | estrogen receptor agonist; xenoestrogen |
equilin | [no description available] | medium | 3 | 0 | 17-oxo steroid; 3-hydroxy steroid | |
naringenin | [no description available] | medium | 2 | 0 | (2S)-flavan-4-one; naringenin | expectorant; plant metabolite |
equilenin | [no description available] | medium | 2 | 0 | 17-oxo steroid; 3-hydroxy steroid | antioxidant; mammalian metabolite |
ethisterone | [no description available] | high | 4 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound; tertiary alcohol | drug metabolite; progestin |
etonogestrel | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound | contraceptive drug; female contraceptive drug; progestin |
4-hydroxybenzyl alcohol | [no description available] | medium | 1 | 0 | benzyl alcohols; phenols | plant metabolite |
ethylene glycol | [no description available] | medium | 1 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
acetaldehyde | [no description available] | high | 3 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
dibenzofuran | [no description available] | medium | 1 | 0 | dibenzofurans; mancude organic heterotricyclic parent; polycyclic heteroarene | xenobiotic |
1-octanol | [no description available] | medium | 1 | 0 | octanol; primary alcohol | antifungal agent; bacterial metabolite; fuel additive; kairomone; plant metabolite |
bendroflumethiazide | [no description available] | medium | 4 | 0 | benzothiadiazine; sulfonamide | antihypertensive agent; diuretic |
benzocaine | [no description available] | medium | 2 | 0 | benzoate ester; substituted aniline | allergen; antipruritic drug; sensitiser; topical anaesthetic |
butamben | [no description available] | medium | 3 | 0 | amino acid ester; benzoate ester; primary amino compound; substituted aniline | local anaesthetic |
dibenzothiophene | [no description available] | medium | 2 | 0 | dibenzothiophenes; mancude organic heterotricyclic parent | keratolytic drug |
fenbufen | [no description available] | medium | 2 | 0 | 4-oxo monocarboxylic acid; biphenyls | non-steroidal anti-inflammatory drug |
fludiazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; organochlorine compound; organofluorine compound | anxiolytic drug |
flufenamic acid | [no description available] | medium | 11 | 0 | aromatic amino acid; organofluorine compound | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
meclofenamic acid | [no description available] | medium | 2 | 0 | aminobenzoic acid; organochlorine compound; secondary amino compound | analgesic; anticonvulsant; antineoplastic agent; antipyretic; antirheumatic drug; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
medazepam | [no description available] | medium | 1 | 0 | organic molecular entity | |
mefenamic acid | [no description available] | medium | 8 | 0 | aminobenzoic acid; secondary amino compound | analgesic; antipyretic; antirheumatic drug; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
vitamin k 3 | [no description available] | medium | 2 | 0 | 1,4-naphthoquinones; vitamin K | angiogenesis inhibitor; antineoplastic agent; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; human urinary metabolite; nutraceutical |
nimetazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; C-nitro compound | anticonvulsant; antispasmodic drug; GABA modulator; sedative |
nitrazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; C-nitro compound | anticonvulsant; antispasmodic drug; drug metabolite; GABA modulator; sedative |
phenazine | [no description available] | medium | 1 | 0 | azaarene; heteranthrene; mancude organic heterotricyclic parent; phenazines; polycyclic heteroarene | |
sulfadiazine | [no description available] | medium | 12 | 0 | pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; antiprotozoal drug; coccidiostat; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
sulfadimethoxine | [no description available] | medium | 3 | 0 | aromatic ether; pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; drug allergen; environmental contaminant; xenobiotic |
sulfamerazine | [no description available] | medium | 3 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen |
sulfamonomethoxine | [no description available] | medium | 1 | 0 | benzenes; sulfonamide | |
sulfanilamide | [no description available] | medium | 23 | 0 | substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; drug allergen; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
sulfapyridine | [no description available] | medium | 1 | 0 | pyridines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; dermatologic drug; drug allergen; environmental contaminant; xenobiotic |
sulfisomidine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent |
sulfisoxazole | [no description available] | medium | 4 | 0 | isoxazoles; sulfonamide antibiotic; sulfonamide | antibacterial drug; drug allergen |
tolnaftate | [no description available] | medium | 3 | 0 | monothiocarbamic ester | antifungal drug |
allobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
carbon tetrachloride | [no description available] | medium | 24 | 0 | chlorocarbon; chloromethanes | hepatotoxic agent; refrigerant |
phenylethyl alcohol | [no description available] | medium | 2 | 0 | benzenes; primary alcohol | Aspergillus metabolite; fragrance; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite |
4-hydroxypropiophenone | [no description available] | medium | 2 | 0 | acetophenones | |
acetonitrile | [no description available] | medium | 4 | 0 | aliphatic nitrile; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; NMR chemical shift reference compound; polar aprotic solvent |
tert-amyl alcohol | [no description available] | medium | 1 | 0 | aliphatic alcohol; tertiary alcohol | protic solvent |
2-butanol | [no description available] | medium | 1 | 0 | secondary alcohol | |
p-tert-amylphenol | [no description available] | medium | 1 | 0 | alkylbenzene | |
dehydrocholic acid | [no description available] | medium | 4 | 0 | 12-oxo steroid; 3-oxo-5beta-steroid; 7-oxo steroid; oxo-5beta-cholanic acid | gastrointestinal drug |
carbazole | [no description available] | medium | 1 | 0 | carbazole | |
xanthenes | [no description available] | medium | 1 | 0 | xanthene | |
phenothiazine | [no description available] | medium | 8 | 0 | phenothiazine | ferroptosis inhibitor; plant metabolite; radical scavenger |
thianthrene | [no description available] | medium | 1 | 0 | mancude organic heterotricyclic parent; organosulfur heterocyclic compound; thianthrenes | |
benzidine | [no description available] | medium | 1 | 0 | biphenyls; substituted aniline | carcinogenic agent |
ethyl benzoate | [no description available] | medium | 1 | 0 | benzoate ester; ethyl ester | flavouring agent; fragrance; volatile oil component |
butylparaben | [no description available] | medium | 1 | 0 | organic molecular entity | |
benzothiophene | [no description available] | medium | 1 | 0 | 1-benzothiophenes; benzothiophene | |
benzothiazole | [no description available] | medium | 1 | 0 | benzothiazoles | environmental contaminant; plant metabolite; xenobiotic |
cyclopentanol | [no description available] | medium | 1 | 0 | cyclopentanols | |
4-isopropylphenol | [no description available] | medium | 1 | 0 | phenols | flavouring agent |
4-hydroxyacetophenone | [no description available] | medium | 1 | 0 | monohydroxyacetophenone | fungal metabolite; mouse metabolite; plant metabolite |
4-chloronitrobenzene | [no description available] | medium | 1 | 0 | C-nitro compound | |
ethylbenzene | [no description available] | medium | 1 | 0 | alkylbenzene | |
benzyl chloride | [no description available] | medium | 1 | 0 | benzyl chlorides | |
phenetole | [no description available] | medium | 1 | 0 | aromatic ether | |
1,4-dibromobenzene | [no description available] | medium | 1 | 0 | dibromobenzene | |
isobutylmethylcarbinol | [no description available] | medium | 1 | 0 | | |
methyl cellosolve | [no description available] | medium | 1 | 0 | glycol ether | protic solvent; solvent |
diethylamine | [no description available] | medium | 1 | 0 | secondary aliphatic amine | |
tetrahydrofuran | [no description available] | medium | 2 | 0 | cyclic ether; oxolanes; saturated organic heteromonocyclic parent; volatile organic compound | polar aprotic solvent |
1,4-butanediol | [no description available] | medium | 1 | 0 | butanediol; glycol | neurotoxin; prodrug; protic solvent |
1,5-pentanediol | [no description available] | medium | 1 | 0 | primary alcohol | |
mephobarbital | [no description available] | medium | 2 | 0 | barbiturates | anticonvulsant |
ethyl-p-hydroxybenzoate | [no description available] | medium | 1 | 0 | ethyl ester; paraben | antifungal agent; antimicrobial food preservative; phytoestrogen; plant metabolite |
2-methylbutanol | [no description available] | medium | 1 | 0 | alkyl alcohol; primary alcohol | Saccharomyces cerevisiae metabolite |
p-cresyl acetate | [no description available] | medium | 1 | 0 | benzoate ester; phenols | |
phenanthridine | [no description available] | medium | 1 | 0 | azaarene; mancude organic heterotricyclic parent; phenanthridines; polycyclic heteroarene | |
acridines | [no description available] | medium | 6 | 0 | acridines; mancude organic heterotricyclic parent; polycyclic heteroarene | genotoxin |
carbutamide | [no description available] | medium | 5 | 0 | benzenes; sulfonamide | |
4-fluorophenol | [no description available] | medium | 1 | 0 | fluorophenol; monofluorobenzenes | |
3,3-dimethyl-2-butanol | [no description available] | medium | 1 | 0 | | |
chenodeoxycholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
phloroglucinol dimethyl ether | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | |
1,3-propanediol | [no description available] | medium | 1 | 0 | propane-1,3-diols | metabolite; protic solvent |
phenylacetylene | [no description available] | medium | 1 | 0 | benzenes | |
4-iodophenol | [no description available] | medium | 1 | 0 | iodophenol | |
3-bromophenol | [no description available] | medium | 1 | 0 | | |
3-isopropylphenol | [no description available] | medium | 1 | 0 | | |
3-ethylphenol | [no description available] | medium | 1 | 0 | phenols | |
4-Ethoxyphenol | [no description available] | medium | 1 | 0 | aromatic ether; phenols | |
2-hexanol | [no description available] | medium | 1 | 0 | hexanol; secondary alcohol | human metabolite; plant metabolite; semiochemical |
hexamethylene glycol | [no description available] | medium | 1 | 0 | diol; primary alcohol | |
4-propylphenol | [no description available] | medium | 1 | 0 | alkylbenzene | |
4-nitrophenyl acetate | [no description available] | medium | 1 | 0 | C-nitro compound; phenyl acetates | |
4-n-Butylphenol | [no description available] | medium | 1 | 0 | phenols | |
sulfamethomidine | [no description available] | medium | 1 | 0 | organic molecular entity | |
2-octanol | [no description available] | medium | 1 | 0 | octanol; secondary alcohol | plant metabolite; volatile oil component |
4-n-Pentylphenol | [no description available] | medium | 1 | 0 | phenols | |
4-ethylphenol | [no description available] | medium | 1 | 0 | phenols | fungal xenobiotic metabolite |
isopentyl alcohol | [no description available] | medium | 1 | 0 | alkyl alcohol; primary alcohol; volatile organic compound | antifungal agent; Saccharomyces cerevisiae metabolite; xenobiotic metabolite |
ursodeoxycholic acid | [no description available] | medium | 2 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
progabide | [no description available] | medium | 1 | 0 | diarylmethane | |
1-n-butylimidazole | [no description available] | medium | 1 | 0 | | |
phenoxazine | [no description available] | medium | 1 | 0 | phenoxazine | ferroptosis inhibitor; radical scavenger |
cresatin | [no description available] | medium | 1 | 0 | benzoate ester; phenols | |
3-propylphenol | [no description available] | medium | 1 | 0 | | |
cyclobutanol | [no description available] | medium | 1 | 0 | | |
1-benzylimidazole | [no description available] | medium | 2 | 0 | | |
triflumizol | [no description available] | medium | 1 | 0 | | |
1-adamantaneacetic acid | [no description available] | medium | 1 | 0 | | |
cholic acid | [no description available] | high | 3 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
3-coumaric acid | [no description available] | medium | 1 | 0 | 3-coumaric acid | |
trans-4-coumaric acid | [no description available] | medium | 1 | 0 | 4-coumaric acid | food component; mouse metabolite; plant metabolite |
dinoprostone | [no description available] | high | 11 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
epoprostenol | [no description available] | medium | 1 | 0 | prostaglandins I | mouse metabolite |
alanine | [no description available] | medium | 1 | 0 | alpha-amino acid; amino acid zwitterion | fundamental metabolite |
uracil | [no description available] | high | 8 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
bremazocine | [no description available] | medium | 2 | 0 | | |
acebutolol | [no description available] | medium | 2 | 0 | aromatic amide; ethanolamines; ether; monocarboxylic acid amide; propanolamine; secondary amino compound | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympathomimetic agent |
fleroxacin | [no description available] | medium | 2 | 0 | difluorobenzene; fluoroquinolone antibiotic; monocarboxylic acid; N-alkylpiperazine; quinolines | antibacterial drug; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; topoisomerase IV inhibitor |
labetalol | [no description available] | medium | 3 | 0 | benzamides; benzenes; phenols; primary carboxamide; salicylamides; secondary alcohol; secondary amino compound | |
midazolam | [no description available] | medium | 2 | 0 | imidazobenzodiazepine; monofluorobenzenes; organochlorine compound | anticonvulsant; antineoplastic agent; anxiolytic drug; apoptosis inducer; central nervous system depressant; GABAA receptor agonist; general anaesthetic; muscle relaxant; sedative |
midazolam | [no description available] | medium | 2 | 1 | imidazobenzodiazepine; monofluorobenzenes; organochlorine compound | anticonvulsant; antineoplastic agent; anxiolytic drug; apoptosis inducer; central nervous system depressant; GABAA receptor agonist; general anaesthetic; muscle relaxant; sedative |
nevirapine | [no description available] | medium | 4 | 0 | cyclopropanes; dipyridodiazepine | antiviral drug; HIV-1 reverse transcriptase inhibitor |
pirenzepine | [no description available] | medium | 3 | 0 | pyridobenzodiazepine | anti-ulcer drug; antispasmodic drug; muscarinic antagonist |
prazosin | [no description available] | medium | 4 | 0 | aromatic ether; furans; monocarboxylic acid amide; piperazines; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
ranitidine | [no description available] | medium | 3 | 0 | aralkylamine | |
imatinib | [no description available] | medium | 3 | 0 | aromatic amine; benzamides; N-methylpiperazine; pyridines; pyrimidines | antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
terbutaline | [no description available] | medium | 2 | 0 | phenylethanolamines; resorcinols | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; hypoglycemic agent; sympathomimetic agent; tocolytic agent |
chloramphenicol | [no description available] | medium | 86 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
phencyclidine | [no description available] | medium | 4 | 0 | benzenes; piperidines | anaesthetic; neurotoxin; NMDA receptor antagonist; psychotropic drug |
erythromycin | [no description available] | medium | 14 | 0 | cyclic ketone; erythromycin | |
erythromycin | [no description available] | medium | 14 | 1 | cyclic ketone; erythromycin | |
amiloride | [no description available] | medium | 4 | 0 | aromatic amine; guanidines; organochlorine compound; pyrazines | diuretic; sodium channel blocker |
guanoxan | [no description available] | medium | 2 | 0 | benzodioxine | |
amoxicillin | [no description available] | medium | 4 | 0 | penicillin allergen; penicillin | antibacterial drug |
sq-11725 | [no description available] | medium | 3 | 0 | | |
mibefradil | [no description available] | medium | 2 | 0 | tetralins | T-type calcium channel blocker |
telmisartan | [no description available] | medium | 3 | 0 | benzimidazoles; biphenyls; carboxybiphenyl | angiotensin receptor antagonist; antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; environmental contaminant; xenobiotic |
n-methylscopolamine | [no description available] | medium | 2 | 0 | | |
bosentan anhydrous | [no description available] | medium | 4 | 0 | primary alcohol; pyrimidines; sulfonamide | antihypertensive agent; endothelin receptor antagonist |
erlotinib | [no description available] | medium | 2 | 0 | aromatic ether; quinazolines; secondary amino compound; terminal acetylenic compound | antineoplastic agent; epidermal growth factor receptor antagonist; protein kinase inhibitor |
quinidine | [no description available] | medium | 7 | 0 | cinchona alkaloid | alpha-adrenergic antagonist; anti-arrhythmia drug; antimalarial; drug allergen; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor; muscarinic antagonist; P450 inhibitor; potassium channel blocker; sodium channel blocker |
saquinavir | [no description available] | medium | 2 | 0 | L-asparagine derivative; quinolines | antiviral drug; HIV protease inhibitor |
dasatinib | [no description available] | medium | 2 | 0 | 1,3-thiazoles; aminopyrimidine; monocarboxylic acid amide; N-(2-hydroxyethyl)piperazine; N-arylpiperazine; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antineoplastic agent; tyrosine kinase inhibitor |
enalapril | [no description available] | medium | 4 | 0 | dicarboxylic acid monoester; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; geroprotector; prodrug |
ceftriaxone | [no description available] | medium | 2 | 0 | 1,2,4-triazines; 1,3-thiazoles; cephalosporin; oxime O-ether | antibacterial drug; drug allergen; EC 3.5.2.6 (beta-lactamase) inhibitor |
ro 42-5892 | [no description available] | medium | 2 | 0 | cyclopropanes; diol; L-histidine derivative; secondary carboxamide; sulfone | antihypertensive agent; EC 3.4.23.15 (renin) inhibitor; peptidomimetic; vasodilator agent |
tiacrilast | [no description available] | medium | 2 | 0 | | |
artesunate | [no description available] | medium | 1 | 0 | artemisinin derivative; cyclic acetal; dicarboxylic acid monoester; hemisuccinate; semisynthetic derivative; sesquiterpenoid | antimalarial; antineoplastic agent; ferroptosis inducer |
pht 427 | [no description available] | medium | 2 | 0 | | |
mobic | [no description available] | medium | 3 | 0 | 1,3-thiazoles; benzothiazine; monocarboxylic acid amide | analgesic; antirheumatic drug; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
bupropion | [no description available] | medium | 3 | 0 | aromatic ketone; monochlorobenzenes; secondary amino compound | antidepressant; environmental contaminant; xenobiotic |
alminoprofen | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; secondary amino compound; substituted aniline | antipyretic; antirheumatic drug; cyclooxygenase 2 inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 3.1.1.4 (phospholipase A2) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
amfenac | [no description available] | medium | 1 | 0 | amino acid; benzophenones; oxo monocarboxylic acid; primary amino compound; substituted aniline | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
amiodarone | [no description available] | medium | 5 | 0 | 1-benzofurans; aromatic ketone; organoiodine compound; tertiary amino compound | cardiovascular drug |
cisapride | [no description available] | medium | 1 | 0 | benzamides | |
fenoprofen | [no description available] | medium | 1 | 0 | monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
fexofenadine | [no description available] | medium | 1 | 0 | piperidines; tertiary amine | anti-allergic agent; H1-receptor antagonist |
fluconazole | [no description available] | medium | 8 | 0 | conazole antifungal drug; difluorobenzene; tertiary alcohol; triazole antifungal drug | environmental contaminant; P450 inhibitor; xenobiotic |
metronidazole | [no description available] | medium | 3 | 0 | C-nitro compound; imidazoles; primary alcohol | antiamoebic agent; antibacterial drug; antimicrobial agent; antiparasitic agent; antitrichomonal drug; environmental contaminant; prodrug; radiosensitizing agent; xenobiotic |
ondansetron | [no description available] | medium | 2 | 0 | carbazoles | |
phenacetin | [no description available] | medium | 4 | 0 | acetamides; aromatic ether | cyclooxygenase 3 inhibitor; non-narcotic analgesic; peripheral nervous system drug |
pyranoprofen | [no description available] | medium | 1 | 0 | pyridochromene | |
probenecid | [no description available] | medium | 14 | 0 | benzoic acids; sulfonamide | uricosuric drug |
propantheline | [no description available] | medium | 3 | 0 | xanthenes | |
sotalol | [no description available] | medium | 2 | 0 | ethanolamines; secondary alcohol; secondary amino compound; sulfonamide | anti-arrhythmia drug; beta-adrenergic antagonist; environmental contaminant; xenobiotic |
sumatriptan | [no description available] | medium | 2 | 0 | sulfonamide; tryptamines | serotonergic agonist; vasoconstrictor agent |
tiaprofenic acid | [no description available] | medium | 1 | 0 | aromatic ketone; monocarboxylic acid; thiophenes | drug allergen; non-steroidal anti-inflammatory drug |
cn 100 | [no description available] | medium | 1 | 0 | organic molecular entity | |
penicillin g | [no description available] | medium | 21 | 0 | penicillin allergen; penicillin | antibacterial drug; drug allergen; epitope |
taurocholic acid | [no description available] | medium | 1 | 0 | amino sulfonic acid; bile acid taurine conjugate | human metabolite |
penicillin v | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | |
cephalexin | [no description available] | medium | 3 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
tiotidine | [no description available] | medium | 1 | 0 | thiazoles | |
alfentanil | [no description available] | medium | 2 | 0 | monocarboxylic acid amide; piperidines | central nervous system depressant; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic; peripheral nervous system drug |
pravastatin | [no description available] | medium | 1 | 0 | 3-hydroxy carboxylic acid; carbobicyclic compound; carboxylic ester; hydroxy monocarboxylic acid; secondary alcohol; statin (semi-synthetic) | anticholesteremic drug; environmental contaminant; metabolite; xenobiotic |
5-propynylarabinofuranosyluracil | [no description available] | medium | 1 | 0 | | |
tenidap | [no description available] | medium | 1 | 0 | | |
befloxatone | [no description available] | medium | 1 | 0 | | |
ziprasidone | [no description available] | medium | 1 | 0 | 1,2-benzisothiazole; indolones; organochlorine compound; piperazines | antipsychotic agent; dopaminergic antagonist; histamine antagonist; muscarinic antagonist; psychotropic drug; serotonergic antagonist |
trovafloxacin | [no description available] | medium | 1 | 0 | | |
ibuproxam | [no description available] | medium | 1 | 0 | hydroxamic acid | iron chelator; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
aceclofenac | [no description available] | medium | 1 | 0 | amino acid; carboxylic ester; dichlorobenzene; monocarboxylic acid; secondary amino compound | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
fluparoxan | [no description available] | medium | 1 | 0 | | |
glycylsarcosine | [no description available] | medium | 1 | 0 | dipeptide zwitterion; dipeptide | |
indobufen | [no description available] | medium | 1 | 0 | isoindoles | |
arginine vasopressin | [no description available] | medium | 27 | 0 | vasopressin | cardiovascular drug; hematologic agent; mitogen |
propylthiouracil | [no description available] | medium | 18 | 0 | pyrimidinethione | antidote to paracetamol poisoning; antimetabolite; antioxidant; antithyroid drug; carcinogenic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; hormone antagonist |
tamoxifen | [no description available] | medium | 10 | 0 | stilbenoid; tertiary amino compound | angiogenesis inhibitor; antineoplastic agent; bone density conservation agent; EC 1.2.3.1 (aldehyde oxidase) inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; estrogen antagonist; estrogen receptor antagonist; estrogen receptor modulator |
raclopride | [no description available] | medium | 1 | 0 | salicylamides | |
olopatadine | [no description available] | medium | 1 | 0 | | |
acrivastine | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; N-alkylpyrrolidine; olefinic compound; pyridines | H1-receptor antagonist |
ly 163892 | [no description available] | medium | 1 | 0 | carbacephem; zwitterion | antibacterial drug; antimicrobial agent |
naloxone | [no description available] | medium | 4 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary alcohol | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
(6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | [no description available] | medium | 1 | 0 | dihydroxy monocarboxylic acid; indoles; organofluorine compound | |
lisinopril | [no description available] | medium | 1 | 0 | dipeptide | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
cefuroxime | [no description available] | medium | 1 | 0 | 3-(carbamoyloxymethyl)cephalosporin; furans; oxime O-ether | drug allergen |
cefatrizine | [no description available] | medium | 1 | 0 | amino acid amide; carboxylic acid; cephalosporin; phenols; semisynthetic derivative; triazoles | antibacterial drug; EC 2.7.11.20 (elongation factor 2 kinase) inhibitor |
valacyclovir | [no description available] | medium | 1 | 0 | L-valyl ester | antiviral drug |
sildenafil | [no description available] | medium | 2 | 0 | piperazines; pyrazolopyrimidine; sulfonamide | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
adenine | [no description available] | high | 7 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
betaine | [no description available] | medium | 2 | 0 | amino-acid betaine; glycine derivative | fundamental metabolite |
carnitine | [no description available] | high | 5 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
histamine | [no description available] | high | 138 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
pyridoxine | [no description available] | high | 17 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
oxyquinoline | [no description available] | medium | 1 | 0 | monohydroxyquinoline | antibacterial agent; antifungal agrochemical; antiseptic drug; iron chelator |
tacrine | [no description available] | medium | 2 | 0 | acridines; aromatic amine | EC 3.1.1.7 (acetylcholinesterase) inhibitor |
acetarsol | [no description available] | medium | 2 | 0 | acetamides; anilide | |
ethacridine | [no description available] | medium | 1 | 0 | acridines | |
4-(acetylamino)benzeneacetic acid | [no description available] | medium | 1 | 0 | acetamides; anilide | |
adiphenine | [no description available] | medium | 1 | 0 | diarylmethane | |
aklomide | [no description available] | medium | 1 | 0 | carbonyl compound; organohalogen compound | |
aminoglutethimide | [no description available] | medium | 22 | 0 | dicarboximide; piperidones; substituted aniline | adrenergic agent; anticonvulsant; antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
aminoglutethimide | [no description available] | medium | 22 | 1 | dicarboximide; piperidones; substituted aniline | adrenergic agent; anticonvulsant; antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
p-aminohippuric acid | [no description available] | medium | 2 | 0 | N-acylglycine | Daphnia magna metabolite |
amlodipine | [no description available] | medium | 1 | 0 | dihydropyridine; ethyl ester; methyl ester; monochlorobenzenes; primary amino compound | antihypertensive agent; calcium channel blocker; vasodilator agent |
amodiaquine | [no description available] | medium | 2 | 0 | aminoquinoline; organochlorine compound; phenols; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; drug allergen; EC 2.1.1.8 (histamine N-methyltransferase) inhibitor; non-steroidal anti-inflammatory drug; prodrug |
amprolium | [no description available] | medium | 1 | 0 | pyridinium ion | coccidiostat |
antazoline | [no description available] | medium | 2 | 0 | aromatic amine; imidazolines; tertiary amino compound | cholinergic antagonist; H1-receptor antagonist; xenobiotic |
6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
arecoline | [no description available] | medium | 1 | 0 | enoate ester; methyl ester; pyridine alkaloid; tetrahydropyridine | metabolite; muscarinic agonist |
benserazide | [no description available] | medium | 1 | 0 | carbohydrazide; catechols; primary alcohol; primary amino compound | antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
benzothiazide | [no description available] | medium | 2 | 0 | benzothiadiazine; sulfonamide | antihypertensive agent; diuretic |
betaxolol | [no description available] | medium | 1 | 0 | propanolamine | antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
bethanechol | [no description available] | medium | 1 | 0 | carbamate ester; quaternary ammonium ion | muscarinic agonist |
bisacodyl | [no description available] | medium | 2 | 0 | diarylmethane | |
bretylium | [no description available] | medium | 1 | 0 | quaternary ammonium ion | adrenergic antagonist; anti-arrhythmia drug; antihypertensive agent |
bromhexine | [no description available] | medium | 1 | 0 | organobromine compound; substituted aniline; tertiary amino compound | mucolytic |
seratrodast | [no description available] | medium | 1 | 0 | organic molecular entity | |
buspirone | [no description available] | medium | 3 | 0 | azaspiro compound; N-alkylpiperazine; N-arylpiperazine; organic heteropolycyclic compound; piperidones; pyrimidines | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
buspirone | [no description available] | medium | 3 | 1 | azaspiro compound; N-alkylpiperazine; N-arylpiperazine; organic heteropolycyclic compound; piperidones; pyrimidines | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
busulfan | [no description available] | medium | 14 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; insect sterilant; teratogenic agent |
butacaine | [no description available] | medium | 2 | 0 | benzoate ester | |
carbamylcholine | [no description available] | medium | 1 | 0 | | |
carbinoxamine | [no description available] | medium | 1 | 0 | monochlorobenzenes; pyridines; tertiary amino compound | anti-allergic agent; antiparkinson drug; H1-receptor antagonist; muscarinic antagonist |
carteolol | [no description available] | medium | 1 | 0 | quinolone; secondary alcohol | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
aricine | [no description available] | medium | 1 | 0 | cinchona alkaloid | |
clomiphene | [no description available] | medium | 1 | 0 | tertiary amine | estrogen antagonist; estrogen receptor modulator |
clomipramine | [no description available] | medium | 1 | 0 | dibenzoazepine | anticoronaviral agent; antidepressant; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; serotonergic antagonist; serotonergic drug; serotonin uptake inhibitor |
cloxyquin | [no description available] | medium | 1 | 0 | organochlorine compound; quinolines | |
cromolyn | [no description available] | medium | 1 | 0 | chromones; dicarboxylic acid | anti-asthmatic drug; calcium channel blocker |
cyclandelate | [no description available] | medium | 1 | 0 | carboxylic ester; secondary alcohol | vasodilator agent |
cyclobenzaprine | [no description available] | medium | 1 | 0 | carbotricyclic compound | antidepressant; muscle relaxant; tranquilizing drug |
dapsone | [no description available] | medium | 3 | 0 | substituted aniline; sulfone | anti-inflammatory drug; antiinfective agent; antimalarial; leprostatic drug |
debrisoquin | [no description available] | medium | 1 | 0 | carboxamidine; isoquinolines | adrenergic agent; antihypertensive agent; human metabolite; sympatholytic agent |
dibucaine | [no description available] | medium | 3 | 0 | aromatic ether; monocarboxylic acid amide; tertiary amino compound | topical anaesthetic |
dichlorphenamide | [no description available] | medium | 2 | 0 | dichlorobenzene; sulfonamide | antiglaucoma drug; EC 4.2.1.1 (carbonic anhydrase) inhibitor; ophthalmology drug |
dicyclomine | [no description available] | medium | 1 | 0 | carboxylic ester; tertiary amine | antispasmodic drug; muscarinic antagonist; parasympatholytic |
dilacor xr | [no description available] | medium | 1 | 0 | acetate ester; aromatic ether; benzothiazepine; lactam; tertiary amino compound | |
dimethadione | [no description available] | medium | 1 | 0 | oxazolidinone | |
diphenylpyraline | [no description available] | medium | 1 | 0 | piperidines; tertiary amine | cholinergic antagonist; H1-receptor antagonist |
valproic acid | [no description available] | medium | 2 | 0 | branched-chain fatty acid; branched-chain saturated fatty acid | anticonvulsant; antimanic drug; EC 3.5.1.98 (histone deacetylase) inhibitor; GABA agent; neuroprotective agent; psychotropic drug; teratogenic agent |
donepezil | [no description available] | medium | 2 | 0 | aromatic ether; indanones; piperidines; racemate | EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; nootropic agent |
doxylamine | [no description available] | medium | 1 | 0 | pyridines; tertiary amine | anti-allergic agent; antiemetic; antitussive; cholinergic antagonist; H1-receptor antagonist; histamine antagonist; sedative |
dyclonine | [no description available] | medium | 1 | 0 | aromatic ketone; piperidines | topical anaesthetic |
dyphylline | [no description available] | medium | 2 | 0 | oxopurine; propane-1,2-diols | bronchodilator agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; muscle relaxant; vasodilator agent |
econazole | [no description available] | medium | 1 | 0 | dichlorobenzene; ether; imidazoles; monochlorobenzenes | |
profenamine | [no description available] | medium | 1 | 0 | phenothiazines; tertiary amino compound | adrenergic antagonist; antidyskinesia agent; antiparkinson drug; histamine antagonist; muscarinic antagonist |
ethotoin | [no description available] | medium | 1 | 0 | imidazolidine-2,4-dione | anticonvulsant |
etidronate | [no description available] | medium | 4 | 0 | 1,1-bis(phosphonic acid) | antineoplastic agent; bone density conservation agent; chelator |
fenoldopam | [no description available] | medium | 1 | 0 | benzazepine | alpha-adrenergic agonist; antihypertensive agent; dopamine agonist; dopaminergic antagonist; vasodilator agent |
berotek | [no description available] | medium | 1 | 0 | resorcinols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent; tocolytic agent |
flecainide | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid amide; organofluorine compound; piperidines | anti-arrhythmia drug |
fluphenazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; organofluorine compound; phenothiazines | anticoronaviral agent; dopaminergic antagonist; phenothiazine antipsychotic drug |
glafenine | [no description available] | medium | 1 | 0 | aminoquinoline; carboxylic ester; glycol; organochlorine compound; secondary amino compound | inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
gliclazide | [no description available] | medium | 1 | 0 | N-sulfonylurea | hypoglycemic agent; insulin secretagogue; radical scavenger |
glimepiride | [no description available] | medium | 1 | 0 | sulfonamide | |
guaifenesin | [no description available] | medium | 12 | 0 | methoxybenzenes | |
guanethidine | [no description available] | medium | 11 | 0 | azocanes; guanidines | adrenergic antagonist; antihypertensive agent; sympatholytic agent |
hexoprenaline | [no description available] | medium | 1 | 0 | | |
hexamethylene bisacetamide | [no description available] | medium | 2 | 0 | acetamides | |
hycanthone | [no description available] | medium | 2 | 0 | thioxanthenes | mutagen; schistosomicide drug |
hydralazine | [no description available] | medium | 5 | 0 | azaarene; hydrazines; ortho-fused heteroarene; phthalazines | antihypertensive agent; vasodilator agent |
hydroflumethiazide | [no description available] | medium | 2 | 0 | benzothiadiazine; thiazide | antihypertensive agent; diuretic |
phenelzine | [no description available] | medium | 2 | 0 | primary amine | |
amrinone | [no description available] | medium | 2 | 0 | bipyridines | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
indapamide | [no description available] | medium | 2 | 0 | indoles; organochlorine compound; sulfonamide | antihypertensive agent; diuretic |
iodoquinol | [no description available] | medium | 1 | 0 | monohydroxyquinoline; organoiodine compound | antiamoebic agent; antibacterial agent; antiprotozoal drug; antiseptic drug |
iproniazid | [no description available] | medium | 5 | 0 | carbohydrazide; pyridines | |
isoetharine | [no description available] | medium | 1 | 0 | catecholamine | |
isoniazid | [no description available] | medium | 84 | 0 | carbohydrazide | antitubercular agent; drug allergen |
isoxsuprine | [no description available] | medium | 1 | 0 | alkylbenzene | |
ketotifen | [no description available] | medium | 2 | 0 | cyclic ketone; olefinic compound; organic heterotricyclic compound; organosulfur heterocyclic compound; piperidines; tertiary amino compound | anti-asthmatic drug; H1-receptor antagonist |
letrozole | [no description available] | medium | 1 | 0 | nitrile; triazoles | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
losartan | [no description available] | medium | 3 | 0 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
losartan | [no description available] | medium | 3 | 1 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
ly 171883 | [no description available] | medium | 2 | 0 | acetophenones; aromatic ether; phenols; tetrazoles | anti-asthmatic drug; leukotriene antagonist |
memantine | [no description available] | medium | 1 | 0 | adamantanes; primary aliphatic amine | antidepressant; antiparkinson drug; dopaminergic agent; neuroprotective agent; NMDA receptor antagonist |
mephenesin | [no description available] | medium | 5 | 0 | aromatic ether; glycerol ether | |
mephenytoin | [no description available] | medium | 1 | 0 | imidazolidine-2,4-dione | anticonvulsant |
benzoic acid [2-methyl-2-(propylamino)propyl] ester | [no description available] | medium | 1 | 0 | benzoate ester | |
mesalamine | [no description available] | medium | 3 | 0 | amino acid; aromatic amine; monocarboxylic acid; monohydroxybenzoic acid; phenols | non-steroidal anti-inflammatory drug |
metaproterenol | [no description available] | medium | 1 | 0 | aralkylamino compound; phenylethanolamines; resorcinols; secondary alcohol; secondary amino compound | |
metformin | [no description available] | medium | 4 | 0 | guanidines | environmental contaminant; geroprotector; hypoglycemic agent; xenobiotic |
methapyrilene | [no description available] | medium | 1 | 0 | ethylenediamine derivative | anti-allergic agent; carcinogenic agent; H1-receptor antagonist; sedative |
methocarbamol | [no description available] | medium | 2 | 0 | aromatic ether; carbamate ester; secondary alcohol | |
metyrapone | [no description available] | medium | 69 | 0 | aromatic ketone | antimetabolite; diagnostic agent; EC 1.14.15.4 (steroid 11beta-monooxygenase) inhibitor |
metyrapone | [no description available] | medium | 69 | 1 | aromatic ketone | antimetabolite; diagnostic agent; EC 1.14.15.4 (steroid 11beta-monooxygenase) inhibitor |
mianserin | [no description available] | medium | 3 | 0 | dibenzoazepine | adrenergic uptake inhibitor; alpha-adrenergic antagonist; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; geroprotector; H1-receptor antagonist; histamine agonist; sedative; serotonergic antagonist |
miconazole | [no description available] | medium | 2 | 0 | dichlorobenzene; ether; imidazoles | |
acecainide | [no description available] | medium | 2 | 0 | acetamides; benzamides | anti-arrhythmia drug |
nadolol | [no description available] | medium | 1 | 0 | tetralins | |
nafronyl | [no description available] | medium | 2 | 0 | naphthalenes | |
nafronyl | [no description available] | medium | 2 | 1 | naphthalenes | |
naftopidil | [no description available] | medium | 1 | 0 | piperazines | |
naphazoline | [no description available] | medium | 3 | 0 | naphthalenes | |
nefazodone | [no description available] | medium | 1 | 0 | aromatic ether; monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; triazoles | alpha-adrenergic antagonist; analgesic; antidepressant; serotonergic antagonist; serotonin uptake inhibitor |
neostigmine | [no description available] | medium | 6 | 0 | quaternary ammonium ion | antidote to curare poisoning; EC 3.1.1.7 (acetylcholinesterase) inhibitor |
nicardipine | [no description available] | medium | 1 | 0 | benzenes; C-nitro compound; diester; dihydropyridine; methyl ester; tertiary amino compound | |
nilvadipine | [no description available] | medium | 1 | 0 | dihydropyridine; isopropyl ester; methyl ester; nitrile | |
nitromide | [no description available] | medium | 1 | 0 | | |
nomifensine | [no description available] | medium | 1 | 0 | isoquinolines | dopamine uptake inhibitor |
6,7-dimethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-isobenzofuran-1-one | [no description available] | medium | 1 | 0 | isoquinolines | |
nylidrin | [no description available] | medium | 1 | 0 | alkylbenzene | |
orphenadrine | [no description available] | medium | 1 | 0 | ether; tertiary amino compound | antidyskinesia agent; antiparkinson drug; H1-receptor antagonist; muscarinic antagonist; muscle relaxant; NMDA receptor antagonist; parasympatholytic |
oxethazaine | [no description available] | medium | 1 | 0 | amino acid amide | |
oxibendazole | [no description available] | medium | 1 | 0 | benzimidazoles; carbamate ester | |
benoxinate | [no description available] | medium | 1 | 0 | amino acid ester; benzoate ester; substituted aniline; tertiary amino compound | drug allergen; local anaesthetic; topical anaesthetic |
pargyline | [no description available] | medium | 3 | 0 | aromatic amine | |
perhexiline | [no description available] | medium | 1 | 0 | piperidines | cardiovascular drug |
phenacemide | [no description available] | medium | 1 | 0 | acetamides | |
1,3a,8-Trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-yl methylcarbamate | [no description available] | medium | 1 | 0 | pyrroloindole | |
pioglitazone | [no description available] | medium | 1 | 0 | aromatic ether; pyridines; thiazolidinediones | antidepressant; cardioprotective agent; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; geroprotector; hypoglycemic agent; insulin-sensitizing drug; PPARgamma agonist; xenobiotic |
piretanide | [no description available] | medium | 1 | 0 | aromatic ether | |
duodote | [no description available] | medium | 1 | 0 | pyridinium ion | antidote to organophosphate poisoning; antidote to sarin poisoning; cholinergic drug; cholinesterase reactivator |
primaquine | [no description available] | medium | 3 | 0 | aminoquinoline; aromatic ether; N-substituted diamine | antimalarial |
proadifen | [no description available] | medium | 2 | 0 | diarylmethane | |
probucol | [no description available] | medium | 2 | 0 | dithioketal; polyphenol | anti-inflammatory drug; anticholesteremic drug; antilipemic drug; antioxidant; cardiovascular drug |
prochlorperazine | [no description available] | medium | 3 | 0 | N-alkylpiperazine; N-methylpiperazine; organochlorine compound; phenothiazines | alpha-adrenergic antagonist; antiemetic; cholinergic antagonist; dopamine receptor D2 antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; first generation antipsychotic |
propafenone | [no description available] | medium | 1 | 0 | aromatic ketone; secondary alcohol; secondary amino compound | anti-arrhythmia drug |
protriptyline | [no description available] | medium | 1 | 0 | carbotricyclic compound | antidepressant |
pyrimethamine | [no description available] | medium | 7 | 0 | aminopyrimidine; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
rofecoxib | [no description available] | medium | 1 | 0 | butenolide; sulfone | analgesic; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
roxarsone | [no description available] | medium | 1 | 0 | 2-nitrophenols; organoarsonic acid | agrochemical; animal growth promotant; antibacterial drug; coccidiostat |
salicylsalicylic acid | [no description available] | medium | 1 | 0 | benzoate ester; benzoic acids; phenols; salicylates | antineoplastic agent; antirheumatic drug; EC 3.5.2.6 (beta-lactamase) inhibitor; hypoglycemic agent; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
spiperone | [no description available] | medium | 2 | 0 | aromatic ketone; azaspiro compound; organofluorine compound; piperidines; tertiary amino compound | alpha-adrenergic antagonist; antipsychotic agent; dopaminergic antagonist; psychotropic drug; serotonergic antagonist |
succinylsulfathiazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles | |
sulfacetamide | [no description available] | medium | 6 | 0 | N-sulfonylcarboxamide; substituted aniline | antibacterial drug; antiinfective agent; antimicrobial agent; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
sulfamethazine | [no description available] | medium | 5 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antibacterial drug; antiinfective agent; antimicrobial agent; carcinogenic agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; ligand; xenobiotic |
sulfamethizole | [no description available] | medium | 2 | 0 | sulfonamide antibiotic; sulfonamide; thiadiazoles | antiinfective agent; antimicrobial agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
sulfamethoxazole | [no description available] | medium | 4 | 0 | isoxazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; antiinfective agent; antimicrobial agent; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; epitope; P450 inhibitor; xenobiotic |
telenzepine | [no description available] | medium | 1 | 0 | benzodiazepine | |
tetrahydroxy-1,4-quinone | [no description available] | medium | 1 | 0 | hydroxybenzoquinone | keratolytic drug |
thiabendazole | [no description available] | medium | 6 | 0 | 1,3-thiazoles; benzimidazole fungicide; benzimidazoles | antifungal agrochemical; antinematodal drug |
2-thiosalicylic acid | [no description available] | medium | 1 | 0 | sulfanylbenzoic acid | antipyretic; non-narcotic analgesic |
thioridazine | [no description available] | medium | 2 | 0 | phenothiazines; piperidines | alpha-adrenergic antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
thiotepa | [no description available] | medium | 14 | 0 | aziridines | |
ticlopidine | [no description available] | medium | 1 | 0 | monochlorobenzenes; thienopyridine | anticoagulant; fibrin modulating drug; hematologic agent; P2Y12 receptor antagonist; platelet aggregation inhibitor |
tolazoline | [no description available] | medium | 2 | 0 | imidazoles | alpha-adrenergic antagonist; antihypertensive agent; vasodilator agent |
trapidil | [no description available] | medium | 2 | 0 | triazolopyrimidines | |
trifluoperazine | [no description available] | medium | 2 | 0 | N-alkylpiperazine; N-methylpiperazine; organofluorine compound; phenothiazines | antiemetic; calmodulin antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; phenothiazine antipsychotic drug |
trifluperidol | [no description available] | medium | 1 | 0 | aromatic ketone | |
triflupromazine | [no description available] | medium | 1 | 0 | organofluorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; first generation antipsychotic |
trimebutine | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | |
trimeprazine | [no description available] | medium | 1 | 0 | phenothiazines | |
trioxsalen | [no description available] | medium | 1 | 0 | psoralens | dermatologic drug; photosensitizing agent |
troglitazone | [no description available] | medium | 2 | 0 | chromanes; thiazolidinone | anticoagulant; anticonvulsant; antineoplastic agent; antioxidant; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; hypoglycemic agent; platelet aggregation inhibitor; vasodilator agent |
tulobuterol | [no description available] | medium | 1 | 0 | organochlorine compound | |
urapidil | [no description available] | medium | 1 | 0 | piperazines | |
urethane | [no description available] | medium | 21 | 0 | carbamate ester | fungal metabolite; mutagen |
venlafaxine | [no description available] | medium | 1 | 0 | cyclohexanols; monomethoxybenzene; tertiary alcohol; tertiary amino compound | adrenergic uptake inhibitor; analgesic; antidepressant; dopamine uptake inhibitor; environmental contaminant; serotonin uptake inhibitor; xenobiotic |
xylazine | [no description available] | medium | 2 | 0 | 1,3-thiazine; methylbenzene; secondary amino compound | alpha-adrenergic agonist; analgesic; emetic; muscle relaxant; sedative |
xylometazoline | [no description available] | medium | 1 | 0 | alkylbenzene | |
phentolamine | [no description available] | medium | 11 | 0 | imidazoles; phenols; substituted aniline; tertiary amino compound | alpha-adrenergic antagonist; vasodilator agent |
piperonyl butoxide | [no description available] | medium | 1 | 0 | benzodioxoles | pesticide synergist |
metaraminol | [no description available] | medium | 3 | 0 | phenylethanolamines | alpha-adrenergic agonist; sympathomimetic agent; vasoconstrictor agent |
ethopabate | [no description available] | medium | 1 | 0 | amidobenzoic acid | |
cysteamine | [no description available] | high | 3 | 0 | amine; thiol | geroprotector; human metabolite; mouse metabolite; radiation protective agent |
acepromazine | [no description available] | medium | 1 | 0 | aromatic ketone; methyl ketone; phenothiazines; tertiary amino compound | phenothiazine antipsychotic drug |
methoxamine | [no description available] | medium | 1 | 0 | amphetamines | alpha-adrenergic agonist; antihypotensive agent |
cloxacillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin; semisynthetic derivative | antibacterial agent; antibacterial drug |
zoxazolamine | [no description available] | medium | 3 | 0 | benzoxazole | |
trifluridine | [no description available] | medium | 3 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; EC 2.1.1.45 (thymidylate synthase) inhibitor |
trifluridine | [no description available] | medium | 3 | 1 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; EC 2.1.1.45 (thymidylate synthase) inhibitor |
mepenzolate bromide | [no description available] | medium | 1 | 0 | diarylmethane | |
pantothenic acid | [no description available] | medium | 14 | 0 | pantothenic acid; vitamin B5 | antidote to curare poisoning; geroprotector; human blood serum metabolite |
sulfachlorpyridazine | [no description available] | medium | 1 | 0 | organochlorine compound; pyridazines; sulfonamide | antibacterial drug; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
phensuximide | [no description available] | medium | 1 | 0 | pyrrolidines | |
dimethisoquin | [no description available] | medium | 1 | 0 | isoquinolines | |
benzonatate | [no description available] | medium | 1 | 0 | benzoate ester; secondary amino compound; substituted aniline | anaesthetic; antitussive |
phenformin | [no description available] | medium | 8 | 0 | biguanides | antineoplastic agent; geroprotector; hypoglycemic agent |
phenformin | [no description available] | medium | 8 | 1 | biguanides | antineoplastic agent; geroprotector; hypoglycemic agent |
cinchophen | [no description available] | medium | 2 | 0 | quinolines | |
chloroprocaine | [no description available] | medium | 1 | 0 | benzoate ester; monochlorobenzenes | central nervous system depressant; local anaesthetic; peripheral nervous system drug |
yohimbine | [no description available] | medium | 4 | 0 | methyl 17-hydroxy-20xi-yohimban-16-carboxylate | alpha-adrenergic antagonist; dopamine receptor D2 antagonist; serotonergic antagonist |
ditiocarb | [no description available] | medium | 1 | 0 | dithiocarbamic acids | chelator; copper chelator |
fluorometholone | [no description available] | high | 6 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
dihydralazine | [no description available] | medium | 1 | 0 | phthalazines | |
dimenhydrinate | [no description available] | medium | 3 | 0 | diarylmethane | |
4-(benzoylamino)-2-hydroxybenzoic acid | [no description available] | medium | 1 | 0 | benzamides | |
megestrol acetate | [no description available] | medium | 2 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; steroid ester | antineoplastic agent; appetite enhancer; contraceptive drug; progestin; synthetic oral contraceptive |
trimetozine | [no description available] | medium | 1 | 0 | morpholines | |
docosanol | [no description available] | medium | 1 | 0 | docosanol; long-chain primary fatty alcohol | antiviral drug; plant metabolite |
tetramethylpyrazine | [no description available] | medium | 2 | 0 | alkaloid; pyrazines | antineoplastic agent; apoptosis inhibitor; bacterial metabolite; neuroprotective agent; platelet aggregation inhibitor; vasodilator agent |
sulfadoxine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide | antibacterial drug; antimalarial |
dicloxacillin | [no description available] | medium | 2 | 0 | dichlorobenzene; penicillin | antibacterial drug |
tranylcypromine | [no description available] | medium | 1 | 0 | 2-phenylcyclopropan-1-amine | |
floxacillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
(1S,2R)-tranylcypromine | [no description available] | medium | 1 | 0 | 2-phenylcyclopropan-1-amine | |
parbendazole | [no description available] | medium | 1 | 0 | benzimidazoles; carbamate ester | |
levamisole | [no description available] | medium | 5 | 0 | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | antinematodal drug; antirheumatic drug; EC 3.1.3.1 (alkaline phosphatase) inhibitor; immunological adjuvant; immunomodulator |
levamisole | [no description available] | medium | 5 | 1 | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | antinematodal drug; antirheumatic drug; EC 3.1.3.1 (alkaline phosphatase) inhibitor; immunological adjuvant; immunomodulator |
fenclozic acid | [no description available] | medium | 1 | 0 | | |
capobenic acid | [no description available] | medium | 2 | 0 | benzamides | |
diftalone | [no description available] | medium | 1 | 0 | | |
carbimazole | [no description available] | medium | 4 | 0 | 1,3-dihydroimidazole-2-thiones; carbamate ester | antithyroid drug; prodrug |
rose bengal b disodium salt | [no description available] | medium | 1 | 0 | | |
indoramin | [no description available] | medium | 1 | 0 | tryptamines | |
carbidopa | [no description available] | medium | 1 | 0 | catechols; hydrazines; monocarboxylic acid | antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
dobutamine | [no description available] | medium | 1 | 0 | catecholamine; secondary amine | beta-adrenergic agonist; cardiotonic drug; sympathomimetic agent |
bezafibrate | [no description available] | medium | 2 | 0 | aromatic ether; monocarboxylic acid amide; monocarboxylic acid; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
benoxaprofen | [no description available] | medium | 1 | 0 | 1,3-benzoxazoles; monocarboxylic acid; monochlorobenzenes | antipsoriatic; antipyretic; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; hepatotoxic agent; nephrotoxin; non-narcotic analgesic; non-steroidal anti-inflammatory drug; protein kinase C agonist |
torsemide | [no description available] | medium | 1 | 0 | aminopyridine; N-sulfonylurea; secondary amino compound | antihypertensive agent; loop diuretic |
piperacillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
indalpine | [no description available] | medium | 1 | 0 | indoles | |
lidamidine | [no description available] | medium | 1 | 0 | ureas | |
talniflumate | [no description available] | medium | 1 | 0 | benzofurans | |
nedocromil | [no description available] | medium | 1 | 0 | dicarboxylic acid; organic heterotricyclic compound | anti-allergic agent; anti-asthmatic drug; non-steroidal anti-inflammatory drug |
dazoxiben | [no description available] | medium | 1 | 0 | | |
tolrestat | [no description available] | medium | 1 | 0 | naphthalenes | EC 1.1.1.21 (aldehyde reductase) inhibitor |
simvastatin | [no description available] | medium | 2 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; statin (semi-synthetic) | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; ferroptosis inducer; geroprotector; prodrug |
simvastatin | [no description available] | medium | 2 | 1 | delta-lactone; fatty acid ester; hexahydronaphthalenes; statin (semi-synthetic) | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; ferroptosis inducer; geroprotector; prodrug |
remoxipride | [no description available] | medium | 1 | 0 | dimethoxybenzene | |
quinapril | [no description available] | medium | 1 | 0 | dicarboxylic acid monoester; ethyl ester; isoquinolines; tertiary carboxamide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
alpidem | [no description available] | medium | 1 | 0 | imidazoles | |
dopexamine | [no description available] | medium | 1 | 0 | catecholamine | |
lonapalene | [no description available] | medium | 1 | 0 | naphthalenes; organochlorine compound | |
ipsapirone | [no description available] | medium | 1 | 0 | N-arylpiperazine | |
sematilide | [no description available] | medium | 1 | 0 | | |
zileuton | [no description available] | medium | 1 | 0 | 1-benzothiophenes; ureas | anti-asthmatic drug; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; ferroptosis inhibitor; leukotriene antagonist; non-steroidal anti-inflammatory drug |
remacemide | [no description available] | medium | 1 | 0 | stilbenoid | |
valsartan | [no description available] | medium | 1 | 0 | biphenylyltetrazole; monocarboxylic acid amide; monocarboxylic acid | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
paroxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; anxiolytic drug; hepatotoxic agent; P450 inhibitor; serotonin uptake inhibitor |
fenclofenac | [no description available] | medium | 1 | 0 | aromatic ether | |
proxicromil | [no description available] | medium | 1 | 0 | | |
torbafylline | [no description available] | medium | 1 | 0 | | |
sertraline | [no description available] | medium | 1 | 0 | dichlorobenzene; secondary amino compound; tetralins | antidepressant; serotonin uptake inhibitor |
enrofloxacin | [no description available] | medium | 2 | 0 | cyclopropanes; N-alkylpiperazine; N-arylpiperazine; organofluorine compound; quinolinemonocarboxylic acid; quinolone | antibacterial agent; antimicrobial agent; antineoplastic agent |
uk 68798 | [no description available] | medium | 1 | 0 | aromatic ether; sulfonamide; tertiary amino compound | anti-arrhythmia drug; potassium channel blocker |
mepindolol | [no description available] | medium | 1 | 0 | indoles | |
fpl 52791 | [no description available] | medium | 1 | 0 | | |
epanolol | [no description available] | medium | 1 | 0 | acetamides | |
methotrimeprazine | [no description available] | medium | 2 | 0 | phenothiazines; tertiary amine | anticoronaviral agent; cholinergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; non-narcotic analgesic; phenothiazine antipsychotic drug; serotonergic antagonist |
rosiglitazone | [no description available] | medium | 3 | 0 | aminopyridine; thiazolidinediones | EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; insulin-sensitizing drug |
rosiglitazone | [no description available] | medium | 3 | 1 | aminopyridine; thiazolidinediones | EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; insulin-sensitizing drug |
levcromakalim | [no description available] | medium | 2 | 0 | 1-benzopyran | |
hexylcaine hydrochloride | [no description available] | medium | 1 | 0 | | |
imipenem, anhydrous | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; carbapenems; zwitterion | antibacterial drug |
sr141716 | [no description available] | medium | 1 | 0 | amidopiperidine; carbohydrazide; dichlorobenzene; monochlorobenzenes; pyrazoles | anti-obesity agent; appetite depressant; CB1 receptor antagonist |
fpl 55712 | [no description available] | medium | 1 | 0 | aromatic ketone | |
sivelestat | [no description available] | medium | 1 | 0 | N-acylglycine; pivalate ester | |
fpl-52694 | [no description available] | medium | 1 | 0 | | |
ramatroban | [no description available] | medium | 1 | 0 | organic molecular entity | |
xaliproden | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; naphthalenes; tertiary amino compound; tetrahydropyridine | serotonergic agonist |
n-isobutyrylcysteine | [no description available] | medium | 1 | 0 | | |
dexpanthenol | [no description available] | medium | 1 | 0 | amino alcohol; monocarboxylic acid amide | cholinergic drug; provitamin |
quilostigmine | [no description available] | medium | 1 | 0 | pyrroloindole | |
imiloxan | [no description available] | medium | 1 | 0 | benzodioxine | |
aspartame | [no description available] | medium | 2 | 0 | carboxylic acid; dipeptide zwitterion; dipeptide; methyl ester | apoptosis inhibitor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; environmental contaminant; micronutrient; nutraceutical; sweetening agent; xenobiotic |
tempol | [no description available] | medium | 1 | 0 | aminoxyls; hydroxypiperidine | anti-inflammatory agent; antineoplastic agent; apoptosis inducer; catalyst; hepatoprotective agent; nephroprotective agent; neuroprotective agent; radical scavenger |
levofloxacin | [no description available] | medium | 2 | 0 | 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid; fluoroquinolone antibiotic; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; topoisomerase IV inhibitor |
vatalanib | [no description available] | medium | 1 | 0 | monochlorobenzenes; phthalazines; pyridines; secondary amino compound | angiogenesis inhibitor; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; vascular endothelial growth factor receptor antagonist |
moxifloxacin | [no description available] | medium | 1 | 0 | aromatic ether; cyclopropanes; fluoroquinolone antibiotic; pyrrolidinopiperidine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antibacterial drug |
clevidipine | [no description available] | medium | 1 | 0 | dihydropyridine | |
hyoscyamine | [no description available] | medium | 1 | 0 | tropane alkaloid | |
lactitol | [no description available] | medium | 1 | 0 | glycosyl alditol | cathartic; excipient; laxative |
fpl 52757 | [no description available] | medium | 1 | 0 | | |
paromomycin | [no description available] | medium | 1 | 0 | amino cyclitol glycoside; aminoglycoside antibiotic | anthelminthic drug; antibacterial drug; antiparasitic agent; antiprotozoal drug |
fpl 59257 | [no description available] | medium | 1 | 0 | | |
ropivacaine | [no description available] | medium | 1 | 0 | piperidinecarboxamide; ropivacaine | local anaesthetic |
zeneca zd 6169 | [no description available] | medium | 1 | 0 | | |
sibenadet | [no description available] | medium | 1 | 0 | | |
latrepirdine | [no description available] | medium | 1 | 0 | methylpyridines; pyridoindole | geroprotector |
ramelteon | [no description available] | medium | 1 | 0 | indanes | |
lapatinib | [no description available] | medium | 1 | 0 | furans; organochlorine compound; organofluorine compound; quinazolines | antineoplastic agent; tyrosine kinase inhibitor |
sorafenib | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; aromatic ether; monochlorobenzenes; phenylureas; pyridinecarboxamide | angiogenesis inhibitor; anticoronaviral agent; antineoplastic agent; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; ferroptosis inducer; tyrosine kinase inhibitor |
phenethicillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | |
salicin | [no description available] | medium | 1 | 0 | aromatic primary alcohol; aryl beta-D-glucoside; benzyl alcohols | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
linezolid | [no description available] | medium | 1 | 0 | acetamides; morpholines; organofluorine compound; oxazolidinone | antibacterial drug; protein synthesis inhibitor |
(S)-bicalutamide | [no description available] | medium | 1 | 0 | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide | |
devazepide | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; indolecarboxamide | antineoplastic agent; apoptosis inducer; cholecystokinin antagonist; gastrointestinal drug |
metrizamide | [no description available] | medium | 1 | 0 | amino sugar | |
chlorprothixene | [no description available] | medium | 1 | 0 | chlorprothixene | |
etomidate | [no description available] | medium | 3 | 0 | ethyl ester; imidazoles | intravenous anaesthetic; sedative |
etomidate | [no description available] | medium | 3 | 1 | ethyl ester; imidazoles | intravenous anaesthetic; sedative |
methylthiouracil | [no description available] | medium | 16 | 0 | pyrimidone | |
crotamiton | [no description available] | medium | 1 | 0 | | |
flunarizine | [no description available] | medium | 1 | 0 | diarylmethane | |
thiothixene | [no description available] | medium | 2 | 0 | N-methylpiperazine | anticoronaviral agent |
benztropine | [no description available] | medium | 1 | 0 | diarylmethane | |
methimazole | [no description available] | medium | 6 | 0 | 1,3-dihydroimidazole-2-thiones | antithyroid drug |
capsaicin | [no description available] | medium | 1 | 0 | capsaicinoid | non-narcotic analgesic; TRPV1 agonist; voltage-gated sodium channel blocker |
ethionamide | [no description available] | medium | 6 | 0 | pyridines; thiocarboxamide | antilipemic drug; antitubercular agent; fatty acid synthesis inhibitor; leprostatic drug; prodrug |
scopolamine | [no description available] | medium | 1 | 0 | 3-hydroxy carboxylic acid | |
ranitidine | [no description available] | medium | 2 | 0 | C-nitro compound; furans; organic sulfide; tertiary amino compound | anti-ulcer drug; drug allergen; environmental contaminant; H2-receptor antagonist; xenobiotic |
almokalant | [no description available] | medium | 1 | 0 | | |
vx-745 | [no description available] | medium | 1 | 0 | aryl sulfide; dichlorobenzene; difluorobenzene; pyrimidopyridazine | anti-inflammatory drug; apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor |
deracoxib | [no description available] | medium | 1 | 0 | organofluorine compound; pyrazoles; sulfonamide | cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
2-aminohippuric acid | [no description available] | medium | 1 | 0 | N-acylglycine | |
rs-130830 | [no description available] | medium | 1 | 0 | | |
sitagliptin | [no description available] | medium | 1 | 0 | triazolopyrazine; trifluorobenzene | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor; environmental contaminant; hypoglycemic agent; serine proteinase inhibitor; xenobiotic |
tolcapone | [no description available] | medium | 1 | 0 | 2-nitrophenols; benzophenones; catechols | antiparkinson drug; EC 2.1.1.6 (catechol O-methyltransferase) inhibitor |
vitamin k semiquinone radical | [no description available] | medium | 25 | 0 | | |
beta carotene | [no description available] | high | 2 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
triprolidine | [no description available] | medium | 3 | 0 | N-alkylpyrrolidine; olefinic compound; pyridines | H1-receptor antagonist |
homatropine | [no description available] | medium | 1 | 0 | tropane alkaloid | |
levetiracetam | [no description available] | medium | 1 | 0 | pyrrolidin-2-ones | anticonvulsant; environmental contaminant; xenobiotic |
sirolimus | [no description available] | medium | 4 | 0 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
sirolimus | [no description available] | medium | 4 | 1 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
topiramate | [no description available] | medium | 1 | 0 | cyclic ketal; ketohexose derivative; sulfamate ester | anticonvulsant; sodium channel blocker |
ar c67085mx | [no description available] | medium | 1 | 0 | | |
desoximetasone | [no description available] | high | 3 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; antipruritic drug |
sb 223412 | [no description available] | medium | 1 | 0 | | |
su 11248 | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; pyrroles | angiogenesis inhibitor; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; immunomodulator; neuroprotective agent; vascular endothelial growth factor receptor antagonist |
naltrexone | [no description available] | medium | 1 | 0 | cyclopropanes; morphinane-like compound; organic heteropentacyclic compound | antidote to opioid poisoning; central nervous system depressant; environmental contaminant; mu-opioid receptor antagonist; xenobiotic |
cefixime | [no description available] | medium | 1 | 0 | cephalosporin | antibacterial drug; drug allergen |
zimeldine | [no description available] | medium | 1 | 0 | styrenes | |
tiotropium | [no description available] | medium | 1 | 0 | | |
nw 1029 | [no description available] | medium | 1 | 0 | | |
ici d1542 | [no description available] | medium | 1 | 0 | | |
gavestinel | [no description available] | medium | 1 | 0 | | |
1-methyl-d-lysergic acid butanolamide | [no description available] | medium | 1 | 0 | ergot alkaloid; monocarboxylic acid amide | serotonergic antagonist; sympatholytic agent; vasoconstrictor agent |
nitrofurantoin | [no description available] | medium | 4 | 0 | imidazolidine-2,4-dione; nitrofuran antibiotic; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic | antibacterial drug; antiinfective agent; hepatotoxic agent |
dantrolene | [no description available] | medium | 1 | 0 | | |
tipredane | [no description available] | medium | 1 | 0 | 3-hydroxy steroid | androgen |
bentiromide | [no description available] | medium | 1 | 0 | dipeptide | diagnostic agent; indicator; reagent |
gemifloxacin | [no description available] | medium | 1 | 0 | 1,8-naphthyridine derivative; fluoroquinolone antibiotic; monocarboxylic acid; quinolone antibiotic | antibacterial drug; antimicrobial agent; topoisomerase IV inhibitor |
utibapril | [no description available] | medium | 1 | 0 | | |
zd 9379 | [no description available] | medium | 1 | 0 | | |
ly 450139 | [no description available] | medium | 1 | 0 | peptide | |
cangrelor | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate; aryl sulfide; nucleoside triphosphate analogue; organochlorine compound; organofluorine compound; secondary amino compound | P2Y12 receptor antagonist; platelet aggregation inhibitor |
sch 527123 | [no description available] | medium | 1 | 0 | | |
linaprazan | [no description available] | medium | 1 | 0 | | |
lecozotan | [no description available] | medium | 1 | 0 | | |
ar c155858 | [no description available] | medium | 1 | 0 | | |
6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)-4-pyrimidinyl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one | [no description available] | medium | 1 | 0 | methoxybenzenes; substituted aniline | |
azd 7545 | [no description available] | medium | 1 | 0 | benzamides; monochlorobenzenes; organofluorine compound; secondary carboxamide; sulfone; tertiary alcohol; tertiary carboxamide | EC 2.7.11.2 - [pyruvate dehydrogenase (acetyl-transferring)] kinase inhibitor; hypoglycemic agent |
clavulanate potassium | [no description available] | medium | 1 | 0 | potassium salt | antibacterial drug; antimicrobial agent; EC 3.5.2.6 (beta-lactamase) inhibitor |
cytomel | [no description available] | medium | 1 | 0 | organic sodium salt | |
a 967079 | [no description available] | medium | 1 | 0 | | |
dicumarol | [no description available] | medium | 5 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; Hsp90 inhibitor; vitamin K antagonist |
folic acid | [no description available] | high | 24 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
dacarbazine | [no description available] | medium | 2 | 0 | dacarbazine | |
olanzapine | [no description available] | medium | 1 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine | antiemetic; dopaminergic antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; serotonin uptake inhibitor |
leucovorin | [no description available] | medium | 1 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
carbadox | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
fenobam | [no description available] | medium | 1 | 0 | ureas | |
amantadine | [no description available] | medium | 5 | 0 | adamantanes; primary aliphatic amine | analgesic; antiparkinson drug; antiviral drug; dopaminergic agent; NMDA receptor antagonist; non-narcotic analgesic |
bithionol | [no description available] | medium | 1 | 0 | aryl sulfide; bridged diphenyl antifungal drug; bridged diphenyl fungicide; dichlorobenzene; organochlorine pesticide; polyphenol | antifungal agrochemical; antiplatyhelmintic drug |
camostat | [no description available] | medium | 1 | 0 | benzoate ester; carboxylic ester; diester; guanidines; tertiary carboxamide | anti-inflammatory agent; anticoronaviral agent; antifibrinolytic drug; antihypertensive agent; antineoplastic agent; antiviral agent; serine protease inhibitor |
carvedilol | [no description available] | medium | 1 | 0 | carbazoles; secondary alcohol; secondary amino compound | alpha-adrenergic antagonist; antihypertensive agent; beta-adrenergic antagonist; cardiovascular drug; vasodilator agent |
cetirizine | [no description available] | medium | 1 | 0 | ether; monocarboxylic acid; monochlorobenzenes; piperazines | anti-allergic agent; environmental contaminant; H1-receptor antagonist; xenobiotic |
ciclopirox | [no description available] | medium | 1 | 0 | cyclic hydroxamic acid; hydroxypyridone antifungal drug; pyridone | antibacterial agent; antiseborrheic |
gabexate | [no description available] | medium | 1 | 0 | benzoate ester | |
granisetron | [no description available] | medium | 1 | 0 | aromatic amide; indazoles | |
avapro | [no description available] | medium | 1 | 0 | azaspiro compound; biphenylyltetrazole | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
nifekalant | [no description available] | medium | 1 | 0 | amine | |
pantoprazole | [no description available] | medium | 1 | 0 | aromatic ether; benzimidazoles; organofluorine compound; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; environmental contaminant; xenobiotic |
rimantadine | [no description available] | medium | 1 | 0 | alkylamine | |
ici 204,219 | [no description available] | medium | 1 | 0 | carbamate ester; indoles; N-sulfonylcarboxamide | anti-asthmatic agent; leukotriene antagonist |
tubocurarine | [no description available] | medium | 6 | 0 | bisbenzylisoquinoline alkaloid | drug allergen; muscle relaxant; nicotinic antagonist |
methylergonovine | [no description available] | medium | 1 | 0 | ergoline alkaloid | |
dihydroergotamine | [no description available] | medium | 2 | 0 | ergot alkaloid; semisynthetic derivative | dopamine agonist; non-narcotic analgesic; serotonergic agonist; sympatholytic agent; vasoconstrictor agent |
vecuronium bromide | [no description available] | medium | 1 | 0 | organic bromide salt; quaternary ammonium salt | muscle relaxant; neuromuscular agent; nicotinic antagonist |
topotecan | [no description available] | medium | 1 | 0 | pyranoindolizinoquinoline | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor |
aripiprazole | [no description available] | medium | 1 | 0 | aromatic ether; delta-lactam; dichlorobenzene; N-alkylpiperazine; N-arylpiperazine; quinolone | drug metabolite; H1-receptor antagonist; second generation antipsychotic; serotonergic agonist |
irinotecan | [no description available] | medium | 1 | 0 | carbamate ester; delta-lactone; N-acylpiperidine; pyranoindolizinoquinoline; ring assembly; tertiary alcohol; tertiary amino compound | antineoplastic agent; apoptosis inducer; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
dabigatran | [no description available] | medium | 1 | 0 | aromatic amide; benzimidazoles; beta-alanine derivative; carboxamidine; pyridines | anticoagulant; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; EC 3.4.21.5 (thrombin) inhibitor |
noscapine | [no description available] | medium | 1 | 0 | aromatic ether; benzylisoquinoline alkaloid; cyclic acetal; isobenzofuranone; organic heterobicyclic compound; organic heterotricyclic compound; tertiary amino compound | antineoplastic agent; antitussive; apoptosis inducer; plant metabolite |
ritonavir | [no description available] | medium | 1 | 0 | 1,3-thiazoles; carbamate ester; carboxamide; L-valine derivative; ureas | antiviral drug; environmental contaminant; HIV protease inhibitor; xenobiotic |
maraviroc | [no description available] | medium | 1 | 0 | tropane alkaloid | |
indinavir sulfate | [no description available] | medium | 1 | 0 | dicarboxylic acid diamide; N-(2-hydroxyethyl)piperazine; piperazinecarboxamide | HIV protease inhibitor |
chlorhexidine | [no description available] | medium | 1 | 0 | biguanides; monochlorobenzenes | antibacterial agent; antiinfective agent |
9-xylosyladenine | [no description available] | medium | 1 | 0 | purine nucleoside | |
malic acid | [no description available] | medium | 1 | 0 | 2-hydroxydicarboxylic acid; C4-dicarboxylic acid | food acidity regulator; fundamental metabolite |
naringenin | [no description available] | medium | 1 | 0 | 4'-hydroxyflavanones; trihydroxyflavanone | |
niacinamide | [no description available] | high | 16 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
pyrazinoic acid | [no description available] | medium | 1 | 0 | pyrazinecarboxylic acid | antitubercular agent; drug metabolite |
1,10-phenanthroline | [no description available] | medium | 1 | 0 | phenanthroline | EC 2.7.1.1 (hexokinase) inhibitor; EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor |
ro 5-4864 | [no description available] | medium | 2 | 0 | | |
5,8,11,14-eicosatetraynoic acid | [no description available] | medium | 1 | 0 | long-chain fatty acid | |
etofylline | [no description available] | medium | 1 | 0 | oxopurine | |
aa 861 | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; acetylenic compound; primary alcohol | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; ferroptosis inhibitor |
anisindione | [no description available] | medium | 1 | 0 | aromatic ketone; beta-diketone | anticoagulant; vitamin K antagonist |
benzbromarone | [no description available] | medium | 1 | 0 | 1-benzofurans; aromatic ketone | uricosuric drug |
bay h 4502 | [no description available] | medium | 1 | 0 | biphenyls; imidazoles | |
bufexamac | [no description available] | medium | 1 | 0 | aromatic ether; hydroxamic acid | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
chlorthalidone | [no description available] | medium | 3 | 0 | isoindoles; monochlorobenzenes; sulfonamide | |
chlorthalidone | [no description available] | medium | 3 | 1 | isoindoles; monochlorobenzenes; sulfonamide | |
4-chloro-N-(2,6-dimethyl-1-piperidinyl)-3-sulfamoylbenzamide | [no description available] | medium | 1 | 0 | sulfonamide | |
deferiprone | [no description available] | medium | 1 | 0 | 4-pyridones | iron chelator; protective agent |
dichlorophen | [no description available] | medium | 1 | 0 | bridged diphenyl fungicide; diarylmethane | |
diflunisal | [no description available] | medium | 2 | 0 | monohydroxybenzoic acid; organofluorine compound | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
dipropizine | [no description available] | medium | 1 | 0 | piperazines | |
epirizole | [no description available] | medium | 1 | 0 | aromatic ether | |
myambutol | [no description available] | medium | 1 | 0 | amino alcohol | |
ethoxzolamide | [no description available] | medium | 1 | 0 | aromatic ether; benzothiazoles; sulfonamide | antiglaucoma drug; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
4-biphenylylacetic acid | [no description available] | medium | 1 | 0 | biphenyls; monocarboxylic acid | non-steroidal anti-inflammatory drug |
flucytosine | [no description available] | medium | 2 | 0 | aminopyrimidine; nucleoside analogue; organofluorine compound; pyrimidine antifungal drug; pyrimidone | prodrug |
gemfibrozil | [no description available] | medium | 1 | 0 | aromatic ether | antilipemic drug |
fluorometholone | [no description available] | medium | 1 | 0 | | |
1-(5-isoquinolinesulfonyl)-2-methylpiperazine | [no description available] | medium | 1 | 0 | isoquinolines; N-sulfonylpiperazine | EC 2.7.11.13 (protein kinase C) inhibitor |
harmaline | [no description available] | medium | 1 | 0 | harmala alkaloid | oneirogen |
hexachlorophene | [no description available] | medium | 1 | 0 | bridged diphenyl fungicide; polyphenol; trichlorobenzene | acaricide; antibacterial agent; antifungal agrochemical; antiseptic drug |
indoprofen | [no description available] | medium | 1 | 0 | gamma-lactam; isoindoles; monocarboxylic acid | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
ipriflavone | [no description available] | medium | 1 | 0 | aromatic ether; isoflavones | bone density conservation agent |
itraconazole | [no description available] | medium | 1 | 0 | piperazines | |
khellin | [no description available] | medium | 17 | 0 | furanochromone; organic heterotricyclic compound; oxacycle | anti-asthmatic agent; bronchodilator agent; cardiovascular drug; vasodilator agent |
edaravone | [no description available] | medium | 1 | 0 | pyrazolone | antioxidant; radical scavenger |
methazolamide | [no description available] | medium | 1 | 0 | sulfonamide; thiadiazoles | |
moclobemide | [no description available] | medium | 1 | 0 | benzamides; monochlorobenzenes; morpholines | antidepressant; environmental contaminant; xenobiotic |
nabumetone | [no description available] | medium | 2 | 0 | methoxynaphthalene; methyl ketone | cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
nalidixic acid | [no description available] | medium | 1 | 0 | 1,8-naphthyridine derivative; monocarboxylic acid; quinolone antibiotic | antibacterial drug; antimicrobial agent; DNA synthesis inhibitor |
norfloxacin | [no description available] | medium | 2 | 0 | fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antibacterial drug; DNA synthesis inhibitor; environmental contaminant; xenobiotic |
cm 7116 | [no description available] | medium | 1 | 0 | benzodiazepine | |
omeprazole | [no description available] | medium | 2 | 0 | aromatic ether; benzimidazoles; pyridines; sulfoxide | |
aminosalicylic acid | [no description available] | medium | 25 | 0 | aminobenzoic acid; phenols | antitubercular agent |
phenindione | [no description available] | medium | 4 | 0 | aromatic ketone; beta-diketone | anticoagulant |
phenolphthalein | [no description available] | medium | 1 | 0 | phenols | |
4-phenylbutyric acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | antineoplastic agent; apoptosis inducer; EC 3.5.1.98 (histone deacetylase) inhibitor; prodrug |
pipemidic acid | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; N-arylpiperazine; pyridopyrimidine; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor |
proxyphylline | [no description available] | medium | 1 | 0 | oxopurine | |
ronidazole | [no description available] | medium | 1 | 0 | C-nitro compound; carbamate ester; imidazoles | antiparasitic agent; antiprotozoal drug |
aldactazide | [no description available] | medium | 1 | 0 | steroid lactone | |
streptonigrin | [no description available] | medium | 3 | 0 | pyridines; quinolone | antimicrobial agent; antineoplastic agent |
sulfabenzamide | [no description available] | medium | 1 | 0 | benzenes; sulfonamide antibiotic; sulfonamide | antibacterial drug; antimicrobial drug |
sulfamethoxypyridazine | [no description available] | medium | 2 | 0 | pyridazines; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
tegafur | [no description available] | medium | 1 | 0 | organohalogen compound; pyrimidines | |
terazosin | [no description available] | medium | 1 | 0 | furans; piperazines; primary amino compound; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; antineoplastic agent |
tinidazole | [no description available] | medium | 2 | 0 | imidazoles | antiamoebic agent; antibacterial drug; antiparasitic agent; antiprotozoal drug |
trichlormethiazide | [no description available] | medium | 1 | 0 | benzothiadiazine; sulfonamide antibiotic | antihypertensive agent; diuretic |
tyramine | [no description available] | high | 3 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
vesamicol | [no description available] | medium | 1 | 0 | piperidines | |
zopiclone | [no description available] | medium | 1 | 0 | monochloropyridine; pyrrolopyrazine | central nervous system depressant; sedative |
oxyphenonium bromide | [no description available] | medium | 1 | 0 | | |
floxuridine | [no description available] | medium | 2 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; radiosensitizing agent |
neostigmine methylsulfate | [no description available] | medium | 1 | 0 | arylammonium sulfate salt | EC 3.1.1.8 (cholinesterase) inhibitor |
trichlorfon | [no description available] | medium | 1 | 0 | organic phosphonate; organochlorine compound; phosphonic ester | agrochemical; anthelminthic drug; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; insecticide |
azauridine | [no description available] | medium | 3 | 0 | N-glycosyl-1,2,4-triazine | antimetabolite; antineoplastic agent; drug metabolite |
desoxycorticosterone acetate | [no description available] | medium | 77 | 0 | corticosteroid hormone | |
benzyltrimethylammonium chloride | [no description available] | medium | 1 | 0 | | |
uridine | [no description available] | high | 17 | 0 | uridines | drug metabolite; fundamental metabolite; human metabolite |
tolazoline hydrochloride | [no description available] | medium | 1 | 0 | benzenes | |
acetylcholine chloride | [no description available] | medium | 1 | 0 | quaternary ammonium salt | |
norethynodrel | [no description available] | medium | 9 | 0 | oxo steroid | |
ampicillin | [no description available] | medium | 12 | 0 | beta-lactam antibiotic; penicillin allergen; penicillin | antibacterial drug |
isopropamide iodide | [no description available] | medium | 1 | 0 | diarylmethane | |
mestranol | [no description available] | medium | 8 | 0 | 17beta-hydroxy steroid; aromatic ether; terminal acetylenic compound | prodrug; xenoestrogen |
9,10-phenanthrenequinone | [no description available] | medium | 1 | 0 | phenanthrenes | |
mecoprop | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid; monochlorobenzenes | |
2-methyl-4-chlorophenoxyacetic acid | [no description available] | medium | 1 | 0 | chlorophenoxyacetic acid; monochlorobenzenes | environmental contaminant; phenoxy herbicide; synthetic auxin |
arsanilic acid | [no description available] | medium | 1 | 0 | organoarsonic acid | |
thiodipropionic acid | [no description available] | medium | 1 | 0 | dicarboxylic acid | |
maltol | [no description available] | medium | 1 | 0 | 4-pyranones | metabolite |
phenazopyridine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | carcinogenic agent; local anaesthetic; non-narcotic analgesic |
protocatechualdehyde | [no description available] | medium | 1 | 0 | dihydroxybenzaldehyde | |
20-alpha-dihydroprogesterone | [no description available] | high | 6 | 0 | 20-hydroxypregn-4-en-3-one | human metabolite; mouse metabolite |
quinestrol | [no description available] | medium | 1 | 0 | 17-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
tripelennamine hydrochloride | [no description available] | medium | 1 | 0 | | |
xanthinol niacinate | [no description available] | medium | 1 | 0 | | |
glycyrrhetinic acid | [no description available] | medium | 1 | 0 | cyclic terpene ketone; hydroxy monocarboxylic acid; pentacyclic triterpenoid | immunomodulator; plant metabolite |
medroxyprogesterone | [no description available] | high | 15 | 1 | 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; tertiary alpha-hydroxy ketone | contraceptive drug; progestin; synthetic oral contraceptive |
medroxyprogesterone | [no description available] | high | 15 | 0 | 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; tertiary alpha-hydroxy ketone | contraceptive drug; progestin; synthetic oral contraceptive |
1,2-naphthoquinone | [no description available] | medium | 1 | 0 | 1,2-naphthoquinones | aryl hydrocarbon receptor agonist; carcinogenic agent |
4,4'-bipyridyl | [no description available] | medium | 1 | 0 | bipyridine | |
monoacetyldapsone | [no description available] | medium | 1 | 0 | acetamides; anilide; secondary carboxamide; sulfone | |
chlorotrianisene | [no description available] | medium | 3 | 0 | chloroalkene | antineoplastic agent; estrogen receptor modulator; xenoestrogen |
aminacrine | [no description available] | medium | 1 | 0 | | |
isoxsuprine hydrochloride | [no description available] | medium | 1 | 0 | alkylbenzene | |
2-hydroxyacetanilide | [no description available] | medium | 1 | 0 | acetamides; phenols | anti-inflammatory agent; antineoplastic agent; antirheumatic drug; apoptosis inducer; platelet aggregation inhibitor; xenobiotic metabolite |
clopamide | [no description available] | medium | 1 | 0 | sulfonamide | |
phosmet | [no description available] | medium | 1 | 0 | organic thiophosphate; organothiophosphate insecticide; phthalimides | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor |
malononitrile dimer | [no description available] | medium | 1 | 0 | | |
diphenyl disulfide | [no description available] | medium | 1 | 0 | benzenes | |
estradiol valerate | [no description available] | medium | 1 | 0 | steroid ester | |
2,2'-dipyridylamine | [no description available] | medium | 1 | 0 | | |
pregnenolone carbonitrile | [no description available] | medium | 2 | 0 | aliphatic nitrile | |
diethylcarbamazine citrate | [no description available] | medium | 1 | 0 | piperazinecarboxamide | |
azacyclonol | [no description available] | medium | 1 | 0 | diarylmethane | |
guaiacoxyacetic acid | [no description available] | medium | 1 | 0 | | |
methylene diphosphonate | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid) | bone density conservation agent; chelator |
amiloride hydrochloride, anhydrous | [no description available] | medium | 1 | 0 | hydrochloride | diuretic; sodium channel blocker |
azaribine | [no description available] | medium | 1 | 0 | acetate ester; N-glycosyl-1,2,4-triazine | antipsoriatic; prodrug |
hydrocortisone hemisuccinate | [no description available] | medium | 1 | 0 | dicarboxylic acid monoester; hemisuccinate; tertiary alpha-hydroxy ketone | |
mebeverine hydrochloride | [no description available] | medium | 1 | 0 | | |
stavudine | [no description available] | medium | 1 | 0 | dihydrofuran; nucleoside analogue; organic molecular entity | antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
clidinium bromide | [no description available] | medium | 1 | 0 | | |
diloxanide furoate | [no description available] | medium | 1 | 0 | carboxylic ester; furans; organochlorine compound; tertiary carboxamide | antiamoebic agent; prodrug |
nitroxoline | [no description available] | medium | 1 | 0 | C-nitro compound; monohydroxyquinoline | antifungal agent; antiinfective agent; antimicrobial agent; renal agent |
cladribine | [no description available] | medium | 2 | 0 | organochlorine compound; purine 2'-deoxyribonucleoside | antineoplastic agent; immunosuppressive agent |
alverine citrate | [no description available] | medium | 1 | 0 | citrate salt; organoammonium salt | antispasmodic drug; cholinergic antagonist |
cyclogyl | [no description available] | medium | 1 | 0 | | |
6-nitroindazole | [no description available] | medium | 1 | 0 | | |
pentamethylmelamine | [no description available] | medium | 1 | 0 | | |
eedq | [no description available] | medium | 1 | 0 | | |
ornidazole | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles; organochlorine compound; secondary alcohol | antiamoebic agent; antibacterial drug; antiinfective agent; antiprotozoal drug; antitrichomonal drug; epitope |
tetridamin | [no description available] | medium | 1 | 0 | | |
thymolphthalein | [no description available] | medium | 1 | 0 | terpene lactone | |
frentizole | [no description available] | medium | 1 | 0 | | |
eterobarb | [no description available] | medium | 1 | 0 | barbiturates | |
oxcarbazepine | [no description available] | medium | 1 | 0 | cyclic ketone; dibenzoazepine | anticonvulsant; drug allergen |
moricizine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug |
proroxan hydrochloride | [no description available] | medium | 1 | 0 | | |
etomidate | [no description available] | medium | 1 | 0 | imidazoles | |
picobenzide | [no description available] | medium | 1 | 0 | | |
triadimenol | [no description available] | medium | 1 | 0 | aromatic ether; conazole fungicide; hemiaminal ether; monochlorobenzenes; secondary alcohol; triazole fungicide | antifungal agrochemical; EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor; xenobiotic metabolite |
cerm-1978 | [no description available] | medium | 1 | 0 | hydrochloride | |
dazoxiben hydrochloride | [no description available] | medium | 1 | 0 | | |
lovastatin | [no description available] | medium | 1 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | anticholesteremic drug; antineoplastic agent; Aspergillus metabolite; prodrug |
tobramycin sulfate | [no description available] | medium | 1 | 0 | | |
benzylaminopurine | [no description available] | medium | 1 | 0 | 6-aminopurines | cytokinin; plant metabolite |
ticlopidine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
sulconazole, mononitrate, (+-)-isomer | [no description available] | medium | 1 | 0 | conazole antifungal drug; imidazole antifungal drug; organic nitrate salt | |
acetylcholine bromide | [no description available] | medium | 1 | 0 | bromide salt; quaternary ammonium salt | |
aloxistatin | [no description available] | medium | 1 | 0 | epoxide; ethyl ester; L-leucine derivative; monocarboxylic acid amide | anticoronaviral agent; cathepsin B inhibitor |
tryptamide | [no description available] | medium | 1 | 0 | | |
oxyphencyclimine hydrochloride | [no description available] | medium | 1 | 0 | pyrimidines | |
diphenylpyraline hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | cholinergic antagonist; H1-receptor antagonist |
mepivacaine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride; piperidinecarboxamide | local anaesthetic |
diphenidol hydrochloride | [no description available] | medium | 1 | 0 | diarylmethane | |
edoxudin | [no description available] | medium | 1 | 0 | pyrimidine 2'-deoxyribonucleoside | |
6-ketoestradiol | [no description available] | medium | 1 | 0 | | |
17 beta-estradiol hemisuccinate | [no description available] | medium | 1 | 0 | | |
amizyl | [no description available] | medium | 1 | 0 | | |
salicylhydroxamic acid | [no description available] | medium | 1 | 0 | hydroxamic acid; phenols | antibacterial drug; EC 1.11.2.2 (myeloperoxidase) inhibitor; EC 3.5.1.5 (urease) inhibitor; trypanocidal drug |
1,7-phenanthroline | [no description available] | medium | 1 | 0 | phenanthroline | |
3-fluoro-4-hydroxyphenylacetic acid | [no description available] | medium | 1 | 0 | | |
dyclonine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | topical anaesthetic |
miconazole nitrate | [no description available] | medium | 1 | 0 | | |
econazole nitrate | [no description available] | medium | 1 | 0 | | |
2,4-dimethoxybenzaldehyde | [no description available] | medium | 1 | 0 | | |
clobetasone butyrate | [no description available] | medium | 1 | 0 | organic molecular entity | |
diflorasone diacetate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; acetate ester; fluorinated steroid; glucocorticoid | anti-inflammatory drug; antipruritic drug |
hydroxyzine dihydrochloride | [no description available] | medium | 1 | 0 | | |
betamipron | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
secnidazole | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles; secondary alcohol | epitope |
ergocornine | [no description available] | medium | 1 | 0 | ergot alkaloid | |
pramoxine hydrochloride | [no description available] | medium | 1 | 0 | aromatic ether | |
butyrylcholine chloride | [no description available] | medium | 1 | 0 | | |
chloropyramine hydrochloride | [no description available] | medium | 1 | 0 | | |
6-aminoindazole | [no description available] | medium | 1 | 0 | indazoles | |
5-aminoindazole | [no description available] | medium | 1 | 0 | | |
2-methylhippuric acid | [no description available] | medium | 1 | 0 | N-acylglycine | metabolite |
meclizine hydrochloride | [no description available] | medium | 1 | 0 | | |
11-hydroxyprogesterone, (11alpha)-isomer | [no description available] | medium | 1 | 0 | 11alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid | |
malic acid, (r)-isomer | [no description available] | medium | 1 | 0 | malic acid | |
21-deoxycortisol | [no description available] | high | 6 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy-C21-steroid; deoxycortisol; tertiary alpha-hydroxy ketone | human blood serum metabolite; mouse metabolite |
estrone 3-methyl ether | [no description available] | medium | 1 | 0 | | |
e-250 | [no description available] | medium | 1 | 0 | | |
rac-glycerol 1-monodecanoate | [no description available] | medium | 1 | 0 | rac-1-monoacylglycerol | |
nipecotic acid amide | [no description available] | medium | 1 | 0 | piperidinecarboxamide | |
tachistin | [no description available] | medium | 1 | 0 | | |
armepavine | [no description available] | medium | 1 | 0 | | |
bicuculline methiodide | [no description available] | medium | 1 | 0 | | |
tryptoline | [no description available] | medium | 1 | 0 | beta-carbolines | |
gamma-fagarine | [no description available] | medium | 1 | 0 | organic heterotricyclic compound; organonitrogen heterocyclic compound; oxacycle | |
Zearalanone | [no description available] | medium | 1 | 0 | macrolide; resorcinols | |
butethamate citrate | [no description available] | medium | 1 | 0 | | |
4-(4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl)-1-(4-fluorophenyl)-1-butanol | [no description available] | medium | 1 | 0 | piperidines | |
1,3-dimethylbenzimidazoline-2-thione | [no description available] | medium | 1 | 0 | | |
n-(n-(3-carboxyoxirane-2-carbonyl)leucyl)isoamylamine | [no description available] | medium | 1 | 0 | leucine derivative | |
desloratadine | [no description available] | medium | 1 | 0 | benzocycloheptapyridine | anti-allergic agent; cholinergic antagonist; drug metabolite; H1-receptor antagonist |
dichloro-1,2-diaminocyclohexane platinum complex | [no description available] | medium | 1 | 0 | | |
1,4-di(2'-thienyl)-1,4-butadione | [no description available] | medium | 1 | 0 | | |
methyl 5-aminolevulinate hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antineoplastic agent; dermatologic drug; photosensitizing agent; prodrug |
antazoline phosphate | [no description available] | medium | 1 | 0 | | |
pridinol mesylate | [no description available] | medium | 1 | 0 | | |
17 alpha-hydroxyprogesterone caproate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
5-fluorotryptamine monohydrochloride | [no description available] | medium | 1 | 0 | | |
piribedil mesylate | [no description available] | medium | 1 | 0 | | |
serc | [no description available] | medium | 1 | 0 | | |
procyclidine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
(7R)-7,15,17-trihydroxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one | [no description available] | medium | 1 | 0 | macrolide | |
adrenosterone | [no description available] | medium | 3 | 0 | 11-oxo steroid; 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; human urinary metabolite; marine metabolite |
gossypol acetic acid | [no description available] | medium | 1 | 0 | | |
4',6-dihydroxy-5,7-dimethoxyflavone | [no description available] | medium | 1 | 0 | dihydroxyflavone; dimethoxyflavone | |
2-hydroxyestradiol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 2-hydroxy steroid | carcinogenic agent; human metabolite; metabolite; mouse metabolite; prodrug |
artisone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
chondocurine (1beta)-(+-)-isomer | [no description available] | medium | 1 | 0 | aromatic ether | |
4-methoxyxanthone | [no description available] | medium | 1 | 0 | | |
2-methyl-N-[4-(propan-2-ylamino)phenyl]-2-propenamide | [no description available] | medium | 1 | 0 | amine | |
mandelic acid, (s)-isomer | [no description available] | medium | 1 | 0 | (2S)-2-hydroxy monocarboxylic acid; mandelic acid | |
acebutolol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympathomimetic agent |
dironyl | [no description available] | medium | 1 | 0 | organic molecular entity | |
amcinonide | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; acetate ester; corticosteroid; fluorinated steroid; spiroketal | anti-inflammatory drug |
histidyl-proline diketopiperazine | [no description available] | medium | 1 | 0 | dipeptide; homodetic cyclic peptide; imidazoles; pyrrolopyrazine | anti-inflammatory agent; dopamine uptake inhibitor; human blood serum metabolite |
afimoxifene | [no description available] | medium | 1 | 0 | phenols; tertiary amino compound | antineoplastic agent; estrogen receptor antagonist; metabolite |
ketoconazole | [no description available] | medium | 1 | 0 | cis-1-acetyl-4-(4-{[2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazine | |
aphidicolin | [no description available] | medium | 1 | 0 | tetracyclic diterpenoid | antimicrobial agent; antimitotic; antineoplastic agent; antiviral drug; apoptosis inducer; Aspergillus metabolite; DNA synthesis inhibitor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; fungal metabolite |
azaserine | [no description available] | medium | 2 | 0 | carboxylic ester; diazo compound; L-serine derivative; non-proteinogenic L-alpha-amino acid | antifungal agent; antimetabolite; antimicrobial agent; antineoplastic agent; glutamine antagonist; immunosuppressive agent; metabolite |
maltitol | [no description available] | medium | 1 | 0 | alpha-D-glucoside; glycosyl alditol | laxative; metabolite; sweetening agent |
chalcone | [no description available] | medium | 3 | 0 | chalcone | EC 3.2.1.1 (alpha-amylase) inhibitor |
thermospine | [no description available] | medium | 1 | 0 | | |
dibenzylidene acetone | [no description available] | medium | 1 | 0 | | |
4-methoxy-1,3-dimethyl-6-thiophen-2-yl-8-cyclohepta[c]furanone | [no description available] | medium | 1 | 0 | cycloheptafuran | |
5-[(5-methoxycarbonyl-2-methyl-3-furanyl)methoxy]-2-methyl-3-benzofurancarboxylic acid 2-methoxyethyl ester | [no description available] | medium | 1 | 0 | 2-methoxyethyl ester; benzofurans | |
5,6,7-trimethoxy-1-methyl-2-indolecarboxylic acid | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
haplamine | [no description available] | medium | 1 | 0 | organic heterotricyclic compound; organonitrogen heterocyclic compound; oxacycle | |
octotropine methylbromide | [no description available] | medium | 1 | 0 | | |
diethylstilbestrol dipropionate | [no description available] | medium | 1 | 0 | | |
(1S,2R)-2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol | [no description available] | medium | 1 | 0 | alkylbenzene | |
glycerylphosphorylcholine | [no description available] | medium | 1 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
n-methylscopolamine nitrate | [no description available] | medium | 1 | 0 | | |
nsc 4347 | [no description available] | medium | 1 | 0 | | |
4-methoxy-N1,N3-bis(3-pyridinyl)benzene-1,3-dicarboxamide | [no description available] | medium | 1 | 0 | benzamides | |
physostigmine salicylate | [no description available] | medium | 1 | 0 | azaheterocycle salicylate salt; salicylates | |
1-[1-oxo-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c][1]benzopyran-7-yl)oxy]ethyl]-4-piperidinecarboxylic acid | [no description available] | medium | 1 | 0 | coumarins | |
prothionamide | [no description available] | medium | 1 | 0 | pyridines | |
2-(2,3,4-trimethoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one | [no description available] | medium | 1 | 0 | benzoxazine | |
dienestrol | [no description available] | medium | 2 | 0 | | |
4-methoxy-N-(3-pyridinylmethyl)benzamide | [no description available] | medium | 1 | 0 | benzamides | |
5-methyl-4-[(2-oxo-1-benzopyran-7-yl)oxymethyl]-2-furancarboxylic acid methyl ester | [no description available] | medium | 1 | 0 | coumarins | |
2-(1,3-dioxo-2-isoindolyl)-N-(3-nitrophenyl)acetamide | [no description available] | medium | 1 | 0 | phthalimides | |
2-(3,4-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone | [no description available] | medium | 1 | 0 | stilbenoid | |
3-(4-methoxyphenyl)-5-(2-phenylethyl)-1,2,4-oxadiazole | [no description available] | medium | 1 | 0 | oxadiazole; ring assembly | |
3-(3,5-dimethyl-7-oxo-6-furo[3,2-g][1]benzopyranyl)propanoic acid | [no description available] | medium | 1 | 0 | psoralens | |
1,6-dimethyl-3-(2-pyridinyl)pyrimido[5,4-e][1,2,4]triazine-5,7-dione | [no description available] | medium | 1 | 0 | pyrimidotriazine | |
curcumin | [no description available] | medium | 2 | 0 | aromatic ether; beta-diketone; diarylheptanoid; enone; polyphenol | anti-inflammatory agent; antifungal agent; antineoplastic agent; biological pigment; contraceptive drug; dye; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; EC 1.8.1.9 (thioredoxin reductase) inhibitor; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; flavouring agent; food colouring; geroprotector; hepatoprotective agent; immunomodulator; iron chelator; ligand; lipoxygenase inhibitor; metabolite; neuroprotective agent; nutraceutical; radical scavenger |
9-hydroxy-4-[1-oxo-2-[4-(phenylmethyl)-1-piperazinyl]ethyl]-2,3-dihydro-1H-[1]benzopyrano[3,4-b]pyridin-5-one | [no description available] | medium | 1 | 0 | pyridochromene | |
5-bromo-3-pyridinecarboxylic acid [3-(3-methylphenoxy)-4-oxo-1-benzopyran-7-yl] ester | [no description available] | medium | 1 | 0 | chromones | |
5-methyl-4-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c][1]benzopyran-1-yl)oxymethyl]-2-furancarboxylic acid | [no description available] | medium | 1 | 0 | coumarins | |
4-methyl-3-(phenylmethyl)-7-[(3,4,5-trimethoxyphenyl)methoxy]-1-benzopyran-2-one | [no description available] | medium | 1 | 0 | coumarins | |
[2-(4-methoxyphenyl)-6-methyl-4-quinolinyl]-(4-morpholinyl)methanone | [no description available] | medium | 1 | 0 | quinolines | |
5-(3,3-dimethyl-2-oxobutoxy)-3,4,7-trimethyl-1-benzopyran-2-one | [no description available] | medium | 1 | 0 | coumarins | |
N-[4-(4-morpholinyl)phenyl]-5-(2-nitrophenyl)-2-furancarboxamide | [no description available] | medium | 1 | 0 | aromatic amide; furans | |
2-(8-methoxy-2-methyl-4-oxo-1-quinolinyl)-N-(2-methoxyphenyl)acetamide | [no description available] | medium | 1 | 0 | quinolines | |
N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-propan-2-yl-2-furancarboxamide | [no description available] | medium | 1 | 0 | quinolines | |
2-(4-bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone | [no description available] | medium | 1 | 0 | stilbenoid | |
1-cyclohexyl-3-(6-ethoxy-1,3-benzothiazol-2-yl)urea | [no description available] | medium | 1 | 0 | benzothiazoles | |
N-[(3,5-dimethoxyphenyl)methyl]-1-(2,3,4-trimethoxyphenyl)methanamine | [no description available] | medium | 1 | 0 | dimethoxybenzene | |
2-[[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-4-oxo-2-phenyl-1-benzopyran-7-yl]oxy]acetic acid tert-butyl ester | [no description available] | medium | 1 | 0 | flavones; tert-butyl ester | |
ethylenethiourea | [no description available] | medium | 1 | 0 | imidazolidines | |
p-aminosalicylic acid monosodium salt | [no description available] | medium | 1 | 0 | organic molecular entity | |
mecysteine hydrochloride | [no description available] | medium | 1 | 0 | alpha-amino acid ester | |
2-(2-furanyl)-4-thiazolidinecarboxylic acid | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
dihydrosamidine | [no description available] | medium | 1 | 0 | | |
N-(2-methoxycyclohexyl)-3,4-dimethylaniline | [no description available] | medium | 1 | 0 | methylbenzene | |
2-(3,4-dimethylphenyl)-5-ethyl-5-phenyl-1,2,4-triazolidine-3-thione | [no description available] | medium | 1 | 0 | methylbenzene | |
2-[3-oxo-1-[[[oxo(thiophen-2-yl)methyl]amino]-sulfanylidenemethyl]-2-piperazinyl]acetic acid propan-2-yl ester | [no description available] | medium | 1 | 0 | isopropyl ester; piperazines | |
zeranol | [no description available] | medium | 1 | 0 | macrolide | |
monooctanoin | [no description available] | medium | 1 | 0 | 1-monoglyceride; octanoate ester; rac-1-monoacylglycerol | |
trimethoprim | [no description available] | medium | 1 | 0 | | |
4-hydroxy-1-[1-oxo-2-(phenylmethoxycarbonylamino)propyl]-2-pyrrolidinecarboxylic acid | [no description available] | medium | 1 | 0 | peptide | |
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(2,3-dimethoxyphenyl)acetamide | [no description available] | medium | 1 | 0 | dimethoxybenzene | |
3-acetyl-6-methyl-1H-quinolin-4-one | [no description available] | medium | 1 | 0 | quinolines | |
3-(phenylthio)-1-(1-pyrrolidinyl)-1-propanone | [no description available] | medium | 1 | 0 | aryl sulfide | |
N-(3-chlorophenyl)-5-oxo-9b-phenyl-2,3-dihydroimidazo[2,1-a]isoindole-1-carboxamide | [no description available] | medium | 1 | 0 | imidazolidines | |
Anthraniloyllycoctonine | [no description available] | medium | 1 | 0 | diterpene alkaloid | |
N-[4-[(cyclohexylamino)-oxomethyl]phenyl]-3-pyridinecarboxamide | [no description available] | medium | 1 | 0 | aromatic amide | |
1-[3-[[4-(4-fluorophenyl)-1-piperazinyl]methyl]-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid | [no description available] | medium | 1 | 0 | harmala alkaloid | |
biochanin a | [no description available] | medium | 1 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones | antineoplastic agent; EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
prostaglandin b1 | [no description available] | medium | 1 | 0 | prostaglandins B | human metabolite |
prostaglandin f1 | [no description available] | medium | 1 | 0 | prostaglandins Falpha | human metabolite |
zearalenone | [no description available] | medium | 1 | 0 | macrolide; resorcinols | fungal metabolite; mycoestrogen |
estriol 17-glucuronide | [no description available] | medium | 1 | 0 | steroid saponin | |
4-hydroxyestradiol | [no description available] | medium | 1 | 0 | 4-hydroxy steroid | metabolite |
menatetrenone | [no description available] | medium | 1 | 0 | menaquinone | anti-inflammatory agent; antioxidant; bone density conservation agent; human metabolite; neuroprotective agent |
dinoprost tromethamine | [no description available] | medium | 1 | 0 | organic molecular entity | |
hydrocortisone valerate | [no description available] | medium | 2 | 0 | cortisol ester; glucocorticoid; primary alpha-hydroxy ketone; valerate ester | |
prostaglandin f2 methyl ester | [no description available] | medium | 1 | 0 | prostanoid | |
2-bromoergocryptine mesylate | [no description available] | medium | 1 | 0 | | |
perhexiline maleate | [no description available] | medium | 1 | 0 | | |
nalmefene | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
6alpha-hydroxy-17beta-estradiol | [no description available] | medium | 1 | 0 | 6alpha-hydroxy steroid | |
cytochalasin b | [no description available] | medium | 4 | 0 | cytochalasin; lactam; lactone; organic heterotricyclic compound | actin polymerisation inhibitor; metabolite; mycotoxin; platelet aggregation inhibitor |
u-44619 | [no description available] | medium | 1 | 0 | | |
furazolidone | [no description available] | medium | 1 | 0 | | |
nifuroxazide | [no description available] | medium | 1 | 0 | benzoic acids | |
rg 13022 | [no description available] | medium | 1 | 0 | | |
styrylquinoline | [no description available] | medium | 1 | 0 | 2-styrylquinoline | |
kavain | [no description available] | medium | 1 | 0 | racemate | glycine receptor antagonist |
enalapril maleate | [no description available] | medium | 1 | 0 | maleate salt | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
trimebutine maleate salt | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | |
vincristine sulfate | [no description available] | medium | 1 | 0 | | |
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5,7-dihydroxy-2-methyl-1-benzopyran-4-one | [no description available] | medium | 1 | 0 | isoflavones | |
(2R)-2-[[(2R,3R,4R)-2-amino-4-hydroxy-4-(5-hydroxy-2-pyridinyl)-3-methyl-1-oxobutyl]amino]-2-[(2S,3R,4S,5S)-5-(2,4-dioxo-1-pyrimidinyl)-3,4-dihydroxy-2-oxolanyl]acetic acid | [no description available] | medium | 1 | 0 | peptide | |
phentolamine | [no description available] | medium | 1 | 0 | | |
fendiline hydrochloride | [no description available] | medium | 1 | 0 | | |
nab-365 | [no description available] | medium | 1 | 0 | hydrochloride | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
dithiazanine iodide | [no description available] | medium | 1 | 0 | benzothiazoles; organic iodide salt | anthelminthic drug; fluorochrome |
sinequan | [no description available] | medium | 1 | 0 | dibenzooxazepine | |
buflomedil hydrochloride | [no description available] | medium | 1 | 0 | aromatic ketone | |
dirithromycin | [no description available] | medium | 1 | 0 | macrolide antibiotic | prodrug |
fluphenazine | [no description available] | medium | 1 | 0 | | |
homochlorocyclizine monohydrochloride | [no description available] | medium | 1 | 0 | | |
butoxamine hydrochloride | [no description available] | medium | 1 | 0 | | |
scopolamine hydrobromide | [no description available] | medium | 1 | 0 | | |
emetine hydrochloride | [no description available] | medium | 1 | 0 | | |
androst-16-en-3-one | [no description available] | medium | 1 | 0 | 3-oxo steroid; androstanoid | mammalian metabolite; pheromone |
dihydroouabain | [no description available] | medium | 1 | 0 | cardenolide glycoside | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; radiosensitizing agent |
LSM-6455 | [no description available] | medium | 1 | 0 | peptide ergot alkaloid | |
estradiol 17-acetate | [no description available] | medium | 1 | 0 | steroid ester | |
(3aR,6aR)-5-(3-methoxyphenyl)-3-[oxo(2-pyrazinyl)methyl]-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione | [no description available] | medium | 1 | 0 | pyrrolidines | |
N-[[3-(2-chlorophenyl)-1-(4-fluorophenyl)-4-pyrazolyl]methyl]-2-(2-pyridinyl)ethanamine | [no description available] | medium | 1 | 0 | pyrazoles; ring assembly | |
bucladesine | [no description available] | medium | 12 | 0 | 3',5'-cyclic purine nucleotide | |
ampicillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
penicillin g potassium | [no description available] | medium | 1 | 0 | organic potassium salt | |
piperacillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
cefoxitin sodium | [no description available] | medium | 1 | 0 | organic molecular entity | |
nafcillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
cefamandole nafate | [no description available] | medium | 1 | 0 | organic sodium salt | antibacterial drug |
sodium diatrizoate | [no description available] | medium | 1 | 0 | organic sodium salt; organoiodine compound | radioopaque medium |
estrone sulfate, potassium salt | [no description available] | medium | 1 | 0 | | |
naproxen sodium | [no description available] | medium | 1 | 0 | organic sodium salt | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
oxytetracycline, anhydrous | [no description available] | medium | 38 | 0 | | |
acenocoumarol | [no description available] | medium | 1 | 0 | C-nitro compound; hydroxycoumarin; methyl ketone | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
mobiflex | [no description available] | medium | 1 | 0 | heteroaryl hydroxy compound; monocarboxylic acid amide; pyridines; thienothiazine | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
inosine | [no description available] | high | 2 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
kf38789 | [no description available] | medium | 1 | 0 | | |
pralidoxime iodide | [no description available] | medium | 1 | 0 | organic iodide salt; pyridinium salt | cholinergic drug; cholinesterase reactivator |
pralidoxime chloride | [no description available] | medium | 1 | 0 | organic chloride salt; pyridinium salt | cholinergic drug; cholinesterase reactivator |
cocaine | [no description available] | medium | 9 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
tacrolimus | [no description available] | medium | 6 | 0 | macrolide lactam | bacterial metabolite; immunosuppressive agent |
20-hydroxycortisol | [no description available] | medium | 7 | 1 | | |
kynurenine | [no description available] | medium | 13 | 1 | aromatic ketone; non-proteinogenic alpha-amino acid; substituted aniline | human metabolite |
phenylalanine | [no description available] | medium | 11 | 1 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
lysophosphatidylcholines | [no description available] | medium | 2 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine | |
glucose, (beta-d)-isomer | [no description available] | medium | 20 | 0 | D-glucopyranose | epitope; mouse metabolite |
oxytocin | [no description available] | medium | 31 | 0 | heterodetic cyclic peptide; peptide hormone | oxytocic; vasodilator agent |
dehydroepiandrosterone sulfate | [no description available] | medium | 16 | 0 | 17-oxo steroid; steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite; mouse metabolite |
gold | [no description available] | medium | 61 | 0 | copper group element atom; elemental gold | |
arachidonic acid | [no description available] | medium | 6 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
mono-(2-ethylhexyl)phthalate | [no description available] | medium | 1 | 0 | phthalic acid monoester | |
phthalic acid | [no description available] | medium | 1 | 0 | benzenedicarboxylic acid | human xenobiotic metabolite |
fructosamine | [no description available] | medium | 1 | 0 | | |
tetrahydrocortisol | [no description available] | medium | 82 | 6 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3alpha-hydroxy steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
safranal | [no description available] | medium | 1 | 1 | monoterpenoid | |
n-methyl-3,4-methylenedioxyamphetamine | [no description available] | medium | 1 | 0 | amphetamines; benzodioxoles | neurotoxin |
thyroxine | [no description available] | medium | 295 | 1 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
triiodothyronine | [no description available] | medium | 75 | 2 | 2-halophenol; amino acid zwitterion; iodophenol; iodothyronine | human metabolite; mouse metabolite; thyroid hormone |
citric acid, anhydrous | [no description available] | medium | 5 | 0 | tricarboxylic acid | antimicrobial agent; chelator; food acidity regulator; fundamental metabolite |
tetrahydrocortisone | [no description available] | medium | 87 | 6 | 21-hydroxy steroid | |
oxidopamine | [no description available] | medium | 1 | 0 | benzenetriol; catecholamine; primary amino compound | drug metabolite; human metabolite; neurotoxin |
mitomycin | [no description available] | medium | 5 | 0 | mitomycin | alkylating agent; antineoplastic agent |
ergosterol | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | fungal metabolite; Saccharomyces cerevisiae metabolite |
11-ketotestosterone | [no description available] | high | 4 | 0 | 11-oxo steroid; 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; human metabolite; marine xenobiotic metabolite |
pituitrin | [no description available] | medium | 76 | 1 | | |
cortolone | [no description available] | medium | 4 | 0 | 21-hydroxy steroid | |
cortolone | [no description available] | medium | 4 | 1 | 21-hydroxy steroid | |
cortol | [no description available] | medium | 3 | 0 | 21-hydroxy steroid | |
cortol | [no description available] | medium | 3 | 1 | 21-hydroxy steroid | |
cosyntropin | [no description available] | medium | 11 | 1 | | |
phytosterols | [no description available] | medium | 1 | 0 | | |
artenimol | [no description available] | medium | 1 | 0 | | |
c-peptide | [no description available] | medium | 5 | 1 | | |
pregnanolone | [no description available] | medium | 5 | 0 | 3-hydroxy-5beta-pregnan-20-one; 3alpha-hydroxy steroid | human metabolite; intravenous anaesthetic; sedative |
androstane-3,17-diol | [no description available] | medium | 1 | 0 | 17-hydroxy steroid; 3-hydroxy steroid; androstanoid | |
flag peptide | [no description available] | medium | 1 | 0 | peptide | |
posaconazole | [no description available] | medium | 2 | 0 | aromatic ether; conazole antifungal drug; N-arylpiperazine; organofluorine compound; oxolanes; triazole antifungal drug; triazoles | trypanocidal drug |
triazoles | [no description available] | medium | 11 | 0 | 1,2,3-triazole | |
epalrestat | [no description available] | medium | 1 | 0 | monocarboxylic acid; thiazolidines | EC 1.1.1.21 (aldehyde reductase) inhibitor |
rhodanine | [no description available] | medium | 1 | 0 | thiazolidinone | |
thiazolidines | [no description available] | medium | 2 | 0 | thiazolidine | |
gliclazide | [no description available] | medium | 1 | 0 | | |
imidacloprid | [no description available] | medium | 1 | 0 | imidacloprid; imidazolidines; monochloropyridine | environmental contaminant; genotoxin; neonicotinoid insectide; nicotinic acetylcholine receptor agonist; xenobiotic |
nervonic acid | [no description available] | medium | 1 | 0 | tetracosenoic acid | |
adrenocorticotropin zinc | [no description available] | medium | 3 | 1 | | |
iohexol | [no description available] | medium | 2 | 0 | benzenedicarboxamide; organoiodine compound | environmental contaminant; radioopaque medium; xenobiotic |
minocycline | [no description available] | medium | 2 | 0 | | |
thiophenes | [no description available] | medium | 1 | 0 | mancude organic heteromonocyclic parent; monocyclic heteroarene; thiophenes; volatile organic compound | non-polar solvent |
betadex | [no description available] | medium | 6 | 0 | cyclodextrin | |
natriuretic peptide, brain | [no description available] | medium | 1 | 0 | polypeptide | |
zd 6474 | [no description available] | medium | 1 | 0 | aromatic ether; organobromine compound; organofluorine compound; piperidines; quinazolines; secondary amine | antineoplastic agent; tyrosine kinase inhibitor |
piperidines | [no description available] | medium | 9 | 0 | | |
quinazolines | [no description available] | medium | 1 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; quinazolines | |
lenvatinib | [no description available] | medium | 1 | 0 | aromatic amide; aromatic ether; cyclopropanes; monocarboxylic acid amide; monochlorobenzenes; phenylureas; quinolines | antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; fibroblast growth factor receptor antagonist; orphan drug; vascular endothelial growth factor receptor antagonist |
catechin | [no description available] | medium | 3 | 0 | catechin | antioxidant; plant metabolite |
epigallocatechin gallate | [no description available] | medium | 2 | 0 | flavans; gallate ester; polyphenol | antineoplastic agent; antioxidant; apoptosis inducer; geroprotector; Hsp90 inhibitor; neuroprotective agent; plant metabolite |
indican | [no description available] | medium | 1 | 0 | beta-D-glucoside; exopolysaccharide; indolyl carbohydrate | |
osteoprotegerin | [no description available] | medium | 1 | 0 | long-chain fatty acid | |
triadimefon | [no description available] | medium | 2 | 0 | aromatic ether; hemiaminal ether; ketone; monochlorobenzenes; triazoles | |
mocetinostat | [no description available] | medium | 8 | 0 | aminopyrimidine; benzamides; pyridines; secondary amino compound; secondary carboxamide; substituted aniline | antineoplastic agent; apoptosis inducer; autophagy inducer; cardioprotective agent; EC 3.5.1.98 (histone deacetylase) inhibitor; hepatotoxic agent |
malondialdehyde | [no description available] | medium | 2 | 0 | dialdehyde | biomarker |
nadp | [no description available] | medium | 64 | 0 | | |
8-bromo cyclic adenosine monophosphate | [no description available] | medium | 2 | 0 | 3',5'-cyclic purine nucleotide; adenyl ribonucleotide; organobromine compound | antidepressant; protein kinase agonist |
phenyl acetate | [no description available] | medium | 161 | 2 | benzenes; phenyl acetates | |
ammonium acetate | [no description available] | medium | 1 | 0 | acetate salt; ammonium salt | buffer; food acidity regulator |
acrylic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid | metabolite |
iopamidol | [no description available] | medium | 2 | 0 | benzenedicarboxamide; organoiodine compound; pentol | environmental contaminant; radioopaque medium; xenobiotic |
amphotericin b | [no description available] | medium | 17 | 0 | antibiotic antifungal drug; macrolide antibiotic; polyene antibiotic | antiamoebic agent; antiprotozoal drug; bacterial metabolite |
rifampin | [no description available] | medium | 14 | 1 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
cholest-5-ene-3,4-diol | [no description available] | medium | 2 | 1 | | |
glycyrrhizic acid | [no description available] | medium | 17 | 0 | enone; glucosiduronic acid; pentacyclic triterpenoid; tricarboxylic acid; triterpenoid saponin | EC 3.4.21.5 (thrombin) inhibitor; plant metabolite |
glycyrrhetyl 3-monoglucuronide | [no description available] | medium | 1 | 0 | beta-D-glucosiduronic acid; enone; monosaccharide derivative; oxo dicarboxylic acid; pentacyclic triterpenoid; triterpenoid saponin | anti-allergic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; human xenobiotic metabolite; plant metabolite; sweetening agent |
fucose | [no description available] | medium | 9 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
fluticasone | [no description available] | medium | 4 | 1 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; fluorinated steroid; thioester | anti-allergic agent; anti-asthmatic drug |
glyceryl 2-arachidonate | [no description available] | medium | 2 | 0 | 2-acylglycerol 20:4; endocannabinoid | human metabolite |
anandamide | [no description available] | medium | 2 | 0 | endocannabinoid; N-acylethanolamine 20:4 | human blood serum metabolite; neurotransmitter; vasodilator agent |
rutin | [no description available] | medium | 8 | 1 | disaccharide derivative; quercetin O-glucoside; rutinoside; tetrahydroxyflavone | antioxidant; metabolite |
fluorodeoxyglucose f18 | [no description available] | medium | 2 | 0 | 2-deoxy-2-((18)F)fluoro-D-glucose; 2-deoxy-2-fluoro-aldehydo-D-glucose | |
agent orange | [no description available] | medium | 1 | 0 | | |
2,4-dichlorophenoxyacetic acid | [no description available] | medium | 1 | 0 | chlorophenoxyacetic acid; dichlorobenzene | agrochemical; defoliant; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; environmental contaminant; phenoxy herbicide; synthetic auxin |
2,4,5-trichlorophenoxyacetic acid | [no description available] | medium | 1 | 0 | chlorophenoxyacetic acid; trichlorobenzene | defoliant; phenoxy herbicide; synthetic auxin |
canrenoic acid | [no description available] | medium | 1 | 1 | 3-oxo-Delta(4) steroid; monocarboxylic acid; steroid acid | |
tadalafil | [no description available] | medium | 1 | 1 | benzodioxoles; pyrazinopyridoindole | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
streptomycin | [no description available] | medium | 111 | 0 | antibiotic antifungal drug; antibiotic fungicide; streptomycins | antibacterial drug; antifungal agrochemical; antimicrobial agent; antimicrobial drug; bacterial metabolite; protein synthesis inhibitor |
chlortetracycline | [no description available] | medium | 40 | 0 | | |
promethazine | [no description available] | medium | 33 | 1 | phenothiazines; tertiary amine | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; H1-receptor antagonist; local anaesthetic; sedative |
coenzyme a | [no description available] | medium | 7 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
vitamin b 6 | [no description available] | medium | 6 | 0 | | |
alloxan | [no description available] | medium | 22 | 0 | pyrimidone | hyperglycemic agent; metabolite |
rebaudioside a | [no description available] | medium | 1 | 0 | beta-D-glucoside; rebaudioside; tetracyclic diterpenoid | sweetening agent |
mirtazapine | [no description available] | medium | 2 | 0 | benzazepine; tetracyclic antidepressant | alpha-adrenergic antagonist; anxiolytic drug; H1-receptor antagonist; histamine antagonist; oneirogen; serotonergic antagonist |
fluticasone propionate, salmeterol xinafoate drug combination | [no description available] | medium | 1 | 0 | | |
metanephrine | [no description available] | medium | 2 | 0 | catecholamine | |
ici 118551 | [no description available] | medium | 1 | 0 | aromatic ether; indanes; secondary alcohol; secondary amino compound | beta-adrenergic antagonist |
titanium | [no description available] | medium | 3 | 0 | titanium group element atom | |
sodium persulfate | [no description available] | medium | 1 | 0 | | |
titanium dioxide | [no description available] | medium | 2 | 0 | titanium oxides | food colouring |
zinc oxide | [no description available] | medium | 2 | 0 | zinc molecular entity | |
stilbenes | [no description available] | medium | 7 | 0 | stilbene | |
3-iodobenzylguanidine | [no description available] | medium | 1 | 0 | organoiodine compound | |
methadone | [no description available] | medium | 4 | 0 | benzenes; diarylmethane; ketone; tertiary amino compound | |
aminoimidazole carboxamide | [no description available] | medium | 1 | 0 | aminoimidazole; monocarboxylic acid amide | mouse metabolite |
aica ribonucleotide | [no description available] | medium | 1 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
acadesine | [no description available] | medium | 1 | 0 | 1-ribosylimidazolecarboxamide; aminoimidazole; nucleoside analogue | antineoplastic agent; platelet aggregation inhibitor |
palladium | [no description available] | medium | 1 | 0 | metal allergen; nickel group element atom; platinum group metal atom | |
6-sulfatoxymelatonin | [no description available] | medium | 1 | 0 | acetamides | |
remifentanil | [no description available] | medium | 1 | 0 | alpha-amino acid ester; anilide; monocarboxylic acid amide; piperidinecarboxylate ester | intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic; sedative |
allotetrahydrocortisol | [no description available] | medium | 11 | 0 | corticosteroid hormone | |
boldenone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; anabolic androgenic steroid | |
cyclosporine | [no description available] | medium | 7 | 0 | | |
carbenoxolone sodium | [no description available] | medium | 30 | 5 | triterpenoid | |
potassium bicarbonate | [no description available] | medium | 1 | 1 | organic salt; potassium salt | antifungal agrochemical; buffer; food acidity regulator; raising agent |
hydrogen carbonate | [no description available] | medium | 14 | 2 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
retinaldehyde | [no description available] | medium | 1 | 0 | retinal; vitamin A | gap junctional intercellular communication inhibitor; human metabolite; mouse metabolite |
homocysteine | [no description available] | medium | 1 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
1-palmitoyl-2-oleoylphosphatidylcholine | [no description available] | medium | 2 | 0 | | |
phosphatidylcholines | [no description available] | medium | 21 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
ginsenosides | [no description available] | medium | 1 | 0 | | |
11-hydroxyprogesterone | [no description available] | medium | 2 | 0 | | |
ecdysterone | [no description available] | medium | 1 | 0 | 14alpha-hydroxy steroid; 20-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; ecdysteroid; phytoecdysteroid | animal metabolite; plant metabolite |
cortistatin 14 | [no description available] | medium | 1 | 0 | | |
trilostane | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid; androstanoid; epoxy steroid; nitrile | abortifacient; antineoplastic agent; EC 1.1.1.210 [3beta(or 20alpha)-hydroxysteroid dehydrogenase] inhibitor |
imatinib mesylate | [no description available] | medium | 1 | 1 | methanesulfonate salt | anticoronaviral agent; antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
tetrahydro-11-deoxycortisol | [no description available] | medium | 7 | 0 | 21-hydroxy steroid | |
tetrahydro-11-deoxycortisol | [no description available] | medium | 7 | 1 | 21-hydroxy steroid | |
palmitic acid | [no description available] | medium | 2 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 1.1.1.189 (prostaglandin-E2 9-reductase) inhibitor; plant metabolite |
caroverine | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
quinoxalines | [no description available] | medium | 2 | 0 | mancude organic heterobicyclic parent; naphthyridine; ortho-fused heteroarene | |
glutamic acid | [no description available] | medium | 12 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
ru 28318 | [no description available] | medium | 2 | 0 | | |
venlafaxine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
uric acid | [no description available] | medium | 22 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
oxalates | [no description available] | medium | 4 | 0 | | |
creatine | [no description available] | medium | 16 | 0 | glycine derivative; guanidines; zwitterion | geroprotector; human metabolite; mouse metabolite; neuroprotective agent; nutraceutical |
17-ketosteroids | [no description available] | medium | 198 | 1 | | |
mepivacaine | [no description available] | medium | 2 | 0 | piperidinecarboxamide | drug allergen; local anaesthetic |
bupivacaine | [no description available] | medium | 1 | 0 | aromatic amide; piperidinecarboxamide; tertiary amino compound | |
chloroquine | [no description available] | medium | 61 | 1 | aminoquinoline; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; antirheumatic drug; autophagy inhibitor; dermatologic drug |
fructose-6-phosphate | [no description available] | medium | 2 | 0 | D-fructose 6-phosphate | |
mycophenolic acid | [no description available] | medium | 1 | 0 | 2-benzofurans; gamma-lactone; monocarboxylic acid; phenols | anticoronaviral agent; antimicrobial agent; antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; environmental contaminant; immunosuppressive agent; mycotoxin; Penicillium metabolite; xenobiotic |
ramipril | [no description available] | medium | 1 | 0 | azabicycloalkane; cyclopentapyrrole; dicarboxylic acid monoester; dipeptide; ethyl ester | bradykinin receptor B2 agonist; cardioprotective agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; matrix metalloproteinase inhibitor; prodrug |
leptin | [no description available] | medium | 6 | 0 | | |
rifapentine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-iminopiperazine; rifamycins | antitubercular agent; leprostatic drug |
bisphenol a | [no description available] | medium | 1 | 0 | bisphenol | endocrine disruptor; environmental contaminant; xenobiotic; xenoestrogen |
lithocholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; monohydroxy-5beta-cholanic acid | geroprotector; human metabolite; mouse metabolite |
7-ketolithocholic acid | [no description available] | medium | 1 | 0 | 3alpha-hydroxy steroid; bile acid; monohydroxy-5beta-cholanic acid; oxo-5beta-cholanic acid | human metabolite |
itraconazole | [no description available] | medium | 5 | 0 | aromatic ether; conazole antifungal drug; cyclic ketal; dichlorobenzene; dioxolane; N-arylpiperazine; triazole antifungal drug; triazoles | EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor; Hedgehog signaling pathway inhibitor; P450 inhibitor |
arsenic | [no description available] | medium | 13 | 0 | metalloid atom; pnictogen | micronutrient |
cytarabine | [no description available] | medium | 13 | 0 | beta-D-arabinoside; monosaccharide derivative; pyrimidine nucleoside | antimetabolite; antineoplastic agent; antiviral agent; immunosuppressive agent |
(9R)-9-chloro-11,17-dihydroxy-17-(2-hydroxy-1-oxoethyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | [no description available] | medium | 5 | 0 | 21-hydroxy steroid | |
selenomethionine | [no description available] | medium | 2 | 0 | selenoamino acid; selenomethionines | plant metabolite |
glycogen | [no description available] | medium | 87 | 0 | | |
butyl methacrylate | [no description available] | medium | 1 | 0 | enoate ester | |
voriconazole | [no description available] | medium | 2 | 0 | conazole antifungal drug; difluorobenzene; pyrimidines; tertiary alcohol; triazole antifungal drug | P450 inhibitor |
dinoprost | [no description available] | medium | 3 | 1 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
15-keto-13,14-dihydroprostaglandin f2alpha | [no description available] | medium | 1 | 1 | ketone; prostaglandins Falpha | metabolite |
girard's reagent t | [no description available] | medium | 1 | 0 | | |
galactose | [no description available] | medium | 15 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
galactomannan | [no description available] | medium | 1 | 0 | oligosaccharide | |
mannans | [no description available] | medium | 2 | 0 | | |
glycosides | [no description available] | medium | 6 | 0 | | |
onapristone | [no description available] | medium | 1 | 0 | | |
deflazacort | [no description available] | medium | 5 | 0 | corticosteroid hormone | |
myelin basic protein | [no description available] | medium | 1 | 0 | | |
buserelin | [no description available] | medium | 4 | 0 | oligopeptide | |
menotropins | [no description available] | medium | 5 | 0 | | |
levoleucovorin | [no description available] | medium | 5 | 0 | 5-formyltetrahydrofolic acid | antineoplastic agent; metabolite |
antimycin a | [no description available] | medium | 1 | 0 | amidobenzoic acid | |
methylmethacrylate | [no description available] | medium | 1 | 0 | enoate ester; methyl ester | allergen; polymerisation monomer |
xylose | [no description available] | medium | 5 | 1 | D-xylose | |
angiotensinogen | [no description available] | medium | 5 | 0 | | |
deuterium | [no description available] | medium | 13 | 2 | dihydrogen | |
oleyl alcohol | [no description available] | medium | 1 | 0 | fatty alcohol 18:1; long-chain primary fatty alcohol | metabolite; nonionic surfactant |
pyrrolidonecarboxylic acid | [no description available] | medium | 1 | 0 | 5-oxoproline; L-proline derivative; non-proteinogenic L-alpha-amino acid | algal metabolite |
sodium salicylate | [no description available] | medium | 52 | 0 | organic molecular entity | |
salicylates | [no description available] | medium | 127 | 0 | monohydroxybenzoate | plant metabolite |
formaldehyde | [no description available] | medium | 39 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
suramin | [no description available] | medium | 6 | 0 | naphthalenesulfonic acid; phenylureas; secondary carboxamide | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
methionine | [no description available] | medium | 31 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
tyrosine | [no description available] | medium | 26 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
ascorbic acid | [no description available] | medium | 142 | 0 | ascorbic acid; vitamin C | coenzyme; cofactor; flour treatment agent; food antioxidant; food colour retention agent; geroprotector; plant metabolite; skin lightening agent |
phosphorus | [no description available] | medium | 83 | 0 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
sulfur | [no description available] | medium | 18 | 0 | chalcogen; nonmetal atom | macronutrient |
dinitrochlorobenzene | [no description available] | medium | 5 | 0 | C-nitro compound; monochlorobenzenes | allergen; epitope; sensitiser |
fibrin | [no description available] | medium | 8 | 0 | peptide | |
fibrinogen | [no description available] | medium | 23 | 0 | iditol | fungal metabolite |
mechlorethamine | [no description available] | medium | 61 | 0 | nitrogen mustard; organochlorine compound | alkylating agent |
iodine | [no description available] | medium | 57 | 0 | diatomic iodine | nutrient |
iodine | [no description available] | medium | 23 | 0 | halide anion; monoatomic iodine | human metabolite |
glycolipids | [no description available] | medium | 10 | 0 | | |
sodium hydroxide | [no description available] | medium | 7 | 0 | alkali metal hydroxide | |
benz(a)anthracene | [no description available] | medium | 10 | 0 | ortho-fused polycyclic arene; tetraphenes | |
galactose | [no description available] | medium | 14 | 0 | | |
dihydrostreptomycin sulfate | [no description available] | medium | 4 | 0 | | |
beryllium | [no description available] | medium | 9 | 0 | alkaline earth metal atom; elemental beryllium; metal allergen | adjuvant; carcinogenic agent; epitope |
nitrogen chloride | [no description available] | medium | 1 | 0 | nitrogen halide | |
chlorine | [no description available] | medium | 28 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
barbituric acid | [no description available] | medium | 2 | 0 | barbiturates | allergen; xenobiotic |
2,4-dinitrophenol | [no description available] | medium | 3 | 0 | dinitrophenol | allergen; antiseptic drug; bacterial xenobiotic metabolite; geroprotector; oxidative phosphorylation inhibitor |
nitrophenols | [no description available] | medium | 8 | 0 | | |
thiocyanate | [no description available] | medium | 1 | 0 | pseudohalide anion; sulfur molecular entity | human metabolite |
cysteine | [no description available] | medium | 13 | 0 | cysteinium | fundamental metabolite |
hydantoins | [no description available] | medium | 10 | 0 | imidazolidine-2,4-dione | |
hyaluronoglucosaminidase | [no description available] | medium | 82 | 0 | | |
1-anilino-8-naphthalenesulfonate | [no description available] | medium | 14 | 0 | aminonaphthalene; naphthalenesulfonic acid | fluorescent probe |
diethylstilbestrol | [no description available] | medium | 69 | 1 | olefinic compound; polyphenol | antifungal agent; antineoplastic agent; autophagy inducer; calcium channel blocker; carcinogenic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; endocrine disruptor; xenoestrogen |
dehydroascorbic acid | [no description available] | medium | 3 | 0 | dehydroascorbic acid; vitamin C | coenzyme; mouse metabolite |
phenylhydrazine | [no description available] | medium | 4 | 0 | phenylhydrazines | xenobiotic |
pregnanediol | [no description available] | medium | 31 | 1 | | |
croton oil | [no description available] | medium | 10 | 0 | N-acyl-hexosamine | |
trypan blue | [no description available] | medium | 16 | 0 | | |
vitamin b 12 | [no description available] | medium | 58 | 0 | | |
riboflavin | [no description available] | medium | 9 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
triethylenemelamine | [no description available] | medium | 12 | 0 | 1,3,5-triazines | alkylating agent; insect sterilant |
metsulfuron methyl | [no description available] | medium | 6 | 0 | 1,3,5-triazines; benzoate ester; N-sulfonylurea | environmental contaminant; herbicide; xenobiotic |
3-methylcholanthrene | [no description available] | medium | 36 | 0 | ortho- and peri-fused polycyclic arene | aryl hydrocarbon receptor agonist; carcinogenic agent |
hematoporphyrin | [no description available] | medium | 1 | 0 | | |
methandriol | [no description available] | medium | 5 | 0 | 3-hydroxy steroid | androgen |
thiouracil | [no description available] | medium | 22 | 0 | nucleobase analogue; thiocarbonyl compound | antithyroid drug; metabolite |
deoxycortone pivalate | [no description available] | medium | 1 | 0 | mineralocorticoid; pivalate ester | |
pyruvic acid | [no description available] | medium | 4 | 0 | 2-oxo monocarboxylic acid | cofactor; fundamental metabolite |
proline | [no description available] | medium | 19 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
retinol | [no description available] | medium | 85 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
methylamine | [no description available] | medium | 1 | 0 | methylamines; one-carbon compound; primary aliphatic amine | mouse metabolite |
methane | [no description available] | medium | 4 | 0 | alkane; gas molecular entity; mononuclear parent hydride; one-carbon compound | bacterial metabolite; fossil fuel; greenhouse gas |
hexamethonium | [no description available] | medium | 4 | 0 | quaternary ammonium salt | |
cardiovascular agents | [no description available] | medium | 15 | 0 | | |
mustard gas | [no description available] | medium | 3 | 0 | ethyl sulfide; organochlorine compound | alkylating agent; carcinogenic agent; vesicant |
muramidase | [no description available] | medium | 10 | 0 | | |
testosterone propionate | [no description available] | medium | 7 | 0 | steroid ester | |
potassium acetate | [no description available] | medium | 1 | 0 | potassium salt | food acidity regulator |
triethylenephosphoramide | [no description available] | medium | 1 | 0 | phosphoramide | |
mercaptopurine | [no description available] | medium | 77 | 1 | aryl thiol; purines; thiocarbonyl compound | anticoronaviral agent; antimetabolite; antineoplastic agent |
purine | [no description available] | medium | 12 | 0 | purine | |
d-alpha tocopherol | [no description available] | medium | 27 | 0 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
caseins | [no description available] | medium | 23 | 0 | | |
glycine | [no description available] | medium | 23 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
thiamine | [no description available] | medium | 16 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dibenzylchlorethamine | [no description available] | medium | 3 | 0 | | |
methantheline | [no description available] | medium | 4 | 0 | xanthenes | |
thallium | [no description available] | medium | 5 | 0 | boron group element atom | |
factor a | [no description available] | medium | 1 | 0 | | |
chlorine | [no description available] | medium | 6 | 0 | diatomic chlorine; gas molecular entity | bleaching agent |
2,3-dihydroxybenzoic acid | [no description available] | medium | 3 | 0 | dihydroxybenzoic acid | human xenobiotic metabolite; plant metabolite |
lactic acid | [no description available] | medium | 8 | 0 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
dimercaprol | [no description available] | medium | 7 | 0 | dithiol; primary alcohol | chelator |
glucagon | [no description available] | medium | 66 | 0 | peptide hormone | |
hydrogen sulfide | [no description available] | medium | 1 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
phosphorus radioisotopes | [no description available] | medium | 6 | 0 | | |
vitamin d 2 | [no description available] | medium | 17 | 1 | hydroxy seco-steroid; seco-ergostane; vitamin D | bone density conservation agent; nutraceutical; plant metabolite; rodenticide |
D-fructopyranose | [no description available] | medium | 17 | 0 | cyclic hemiketal; D-fructose; fructopyranose | sweetening agent |
thiamine pyrophosphate | [no description available] | medium | 3 | 0 | organic chloride salt; vitamin B1 | |
alanine | [no description available] | medium | 12 | 0 | alanine zwitterion; alanine; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; fundamental metabolite |
acid phosphatase | [no description available] | medium | 65 | 0 | | |
mandelic acid | [no description available] | medium | 2 | 0 | 2-hydroxy monocarboxylic acid; benzenes | antibacterial agent; human xenobiotic metabolite |
n-vinyl-2-pyrrolidinone | [no description available] | medium | 10 | 0 | pyrrolidin-2-ones | |
sulfathiazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
chondroitin sulfates | [no description available] | medium | 4 | 0 | | |
chondroitin | [no description available] | medium | 24 | 0 | | |
oxophenarsine | [no description available] | medium | 2 | 0 | substituted aniline | |
chlorophyll a | [no description available] | medium | 3 | 0 | chlorophyll; methyl ester | cofactor |
ethyl biscoumacetate | [no description available] | medium | 1 | 0 | hydroxycoumarin | |
cystine | [no description available] | medium | 6 | 0 | | |
framycetin | [no description available] | medium | 28 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
ethionine | [no description available] | medium | 22 | 0 | S-ethylhomocysteine | antimetabolite; carcinogenic agent |
cyclopentane | [no description available] | medium | 3 | 0 | cycloalkane; cyclopentanes; volatile organic compound | non-polar solvent |
echinacin | [no description available] | medium | 1 | 0 | | |
cobalt | [no description available] | medium | 7 | 0 | cobalt group element atom; metal allergen | micronutrient |
maleic acid | [no description available] | medium | 1 | 0 | butenedioic acid | algal metabolite; mouse metabolite; plant metabolite |
biotin | [no description available] | medium | 3 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
pteropterin | [no description available] | medium | 1 | 0 | | |
glucosamine | [no description available] | medium | 14 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
potassium cyanide | [no description available] | medium | 1 | 0 | cyanide salt; one-carbon compound; potassium salt | EC 1.15.1.1 (superoxide dismutase) inhibitor; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; neurotoxin |
cyanides | [no description available] | medium | 12 | 0 | pseudohalide anion | EC 1.9.3.1 (cytochrome c oxidase) inhibitor |
methylene blue | [no description available] | medium | 3 | 0 | organic chloride salt | acid-base indicator; antidepressant; antimalarial; antimicrobial agent; antioxidant; cardioprotective agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 4.6.1.2 (guanylate cyclase) inhibitor; fluorochrome; histological dye; neuroprotective agent; physical tracer |
tetraethyl lead | [no description available] | medium | 1 | 0 | organolead compound | |
bilirubin | [no description available] | medium | 23 | 1 | biladienes; dicarboxylic acid | antioxidant; human metabolite; mouse metabolite |
antimony | [no description available] | medium | 4 | 0 | metalloid atom; pnictogen | |
corticosterone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
tetracycline | [no description available] | medium | 72 | 1 | | |
copper gluconate | [no description available] | medium | 11 | 0 | organic molecular entity | |
calcium gluconate | [no description available] | medium | 2 | 0 | calcium salt | nutraceutical |
dihydroxyphenylalanine | [no description available] | medium | 13 | 0 | hydroxyphenylalanine; non-proteinogenic alpha-amino acid; tyrosine derivative | human metabolite |
thromboplastin | [no description available] | medium | 5 | 0 | | |
linoleic acid | [no description available] | medium | 2 | 0 | octadecadienoic acid; omega-6 fatty acid | algal metabolite; Daphnia galeata metabolite; plant metabolite |
phlorhizin | [no description available] | medium | 4 | 0 | aryl beta-D-glucoside; dihydrochalcones; monosaccharide derivative | antioxidant; plant metabolite |
cesium | [no description available] | medium | 3 | 0 | alkali metal atom | |
dienestrol diacetate | [no description available] | medium | 1 | 0 | | |
emetine | [no description available] | medium | 1 | 0 | isoquinoline alkaloid; pyridoisoquinoline | antiamoebic agent; anticoronaviral agent; antiinfective agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; expectorant; plant metabolite; protein synthesis inhibitor |
phytic acid | [no description available] | medium | 1 | 0 | inositol phosphate | |
inositol | [no description available] | medium | 7 | 0 | cyclitol; hexol | |
strontium | [no description available] | medium | 7 | 0 | alkaline earth metal atom | |
bismuth | [no description available] | medium | 10 | 0 | metal atom; pnictogen | |
17-hydroxypregnanolone | [no description available] | medium | 1 | 0 | | |
hydrazine | [no description available] | medium | 12 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
mercuric chloride | [no description available] | medium | 2 | 0 | mercury coordination entity | sensitiser |
mercury | [no description available] | medium | 9 | 0 | elemental mercury; zinc group element atom | neurotoxin |
lysergic acid diethylamide | [no description available] | medium | 10 | 0 | ergoline alkaloid; monocarboxylic acid amide; organic heterotetracyclic compound | dopamine agonist; hallucinogen; serotonergic agonist |
yttrium | [no description available] | medium | 4 | 0 | d-block element atom; rare earth metal atom; scandium group element atom | |
ddt | [no description available] | medium | 3 | 0 | benzenoid aromatic compound; chlorophenylethane; monochlorobenzenes; organochlorine insecticide | bridged diphenyl acaricide; carcinogenic agent; endocrine disruptor; persistent organic pollutant |
glucose-1-phosphate | [no description available] | medium | 1 | 0 | D-glucopyranose 1-phosphate | |
turinabol | [no description available] | medium | 2 | 0 | steroid ester | |
triphosphoric acid | [no description available] | medium | 1 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | |
puromycin aminonucleoside | [no description available] | medium | 6 | 0 | 3'-deoxyribonucleoside; adenosines | |
dihydrotachysterol | [no description available] | medium | 5 | 0 | | |
cholecalciferol | [no description available] | medium | 9 | 0 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol; steroid hormone | geroprotector; human metabolite |
hydrofluoric acid | [no description available] | medium | 1 | 0 | hydrogen halide; mononuclear parent hydride | NMR chemical shift reference compound |
fluorides | [no description available] | medium | 10 | 0 | halide anion; monoatomic fluorine | |
potassium dichromate | [no description available] | medium | 1 | 0 | potassium salt | allergen; oxidising agent; sensitiser |
chromates | [no description available] | medium | 3 | 0 | chromium oxoanion; divalent inorganic anion | oxidising agent |
methylcellulose | [no description available] | medium | 5 | 0 | | |
pyrimidine | [no description available] | medium | 1 | 0 | diazine; pyrimidines | Daphnia magna metabolite |
norethandrolone | [no description available] | medium | 15 | 0 | corticosteroid hormone | |
hydroxyproline | [no description available] | medium | 39 | 0 | 4-hydroxyproline; L-alpha-amino acid zwitterion | human metabolite; mouse metabolite; plant metabolite |
flavone | [no description available] | medium | 1 | 0 | flavones | metabolite; nematicide |
quercetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | antibacterial agent; antineoplastic agent; antioxidant; Aurora kinase inhibitor; chelator; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; geroprotector; phytoestrogen; plant metabolite; protein kinase inhibitor; radical scavenger |
acetoacetic acid | [no description available] | medium | 1 | 0 | 3-oxo fatty acid; ketone body | metabolite |
salicylanilide | [no description available] | medium | 2 | 0 | benzanilide fungicide; salicylamides; salicylanilides | |
boric acid | [no description available] | medium | 1 | 0 | boric acids | astringent |
hydrocortisone sodium phosphate | [no description available] | medium | 1 | 0 | steroid phosphate oxoanion | |
promethium | [no description available] | medium | 2 | 0 | f-block element atom; lanthanoid atom | |
edetic acid | [no description available] | medium | 30 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
bromide | [no description available] | medium | 2 | 0 | halide anion; monoatomic bromine | |
camphor, (+-)-isomer | [no description available] | medium | 2 | 0 | bornane monoterpenoid; cyclic monoterpene ketone | plant metabolite |
9-fluoroprednisolone | [no description available] | medium | 2 | 0 | 21-hydroxy steroid | |
intrinsic factor | [no description available] | medium | 5 | 0 | | |
ammonium hydroxide | [no description available] | medium | 8 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
tetraiodothyroacetic acid | [no description available] | medium | 1 | 0 | 2-halophenol; aromatic ether; iodophenol; monocarboxylic acid | apoptosis inducer; human metabolite; thyroid hormone |
thyronines | [no description available] | medium | 3 | 0 | thyronine | |
tripelennamine | [no description available] | medium | 4 | 0 | aromatic amine | |
strontium radioisotopes | [no description available] | medium | 6 | 0 | | |
yttrium radioisotopes | [no description available] | medium | 1 | 0 | | |
diazoline | [no description available] | medium | 1 | 0 | polymer | |
uranium | [no description available] | medium | 1 | 0 | actinoid atom; f-block element atom; monoatomic uranium | |
azo rubin s | [no description available] | medium | 1 | 0 | | |
thiourea | [no description available] | medium | 5 | 0 | one-carbon compound; thioureas; ureas | antioxidant; chromophore |
parathion | [no description available] | medium | 1 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; avicide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; mouse metabolite |
thioctic acid | [no description available] | medium | 2 | 0 | dithiolanes; heterocyclic fatty acid; thia fatty acid | fundamental metabolite; geroprotector |
nandrolone phenpropionate | [no description available] | medium | 1 | 0 | 3-phenylpropionate ester | anabolic agent; androgen |
naphthalene | [no description available] | medium | 1 | 0 | naphthalenes; ortho-fused bicyclic arene | apoptosis inhibitor; carcinogenic agent; environmental contaminant; mouse metabolite; plant metabolite; volatile oil component |
fluorene | [no description available] | medium | 1 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon | |
octopamine | [no description available] | medium | 1 | 0 | phenylethanolamines; tyramines | neurotransmitter |
nitrates | [no description available] | medium | 4 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | |
orotic acid | [no description available] | medium | 29 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
4-butyrolactone | [no description available] | medium | 1 | 0 | butan-4-olide | metabolite; neurotoxin |
butenolide | [no description available] | medium | 1 | 0 | butenolide | |
acetic anhydride | [no description available] | medium | 1 | 0 | acyclic carboxylic anhydride | metabolite; reagent |
choline | [no description available] | medium | 13 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
oxyphenbutazone | [no description available] | medium | 19 | 0 | phenols; pyrazolidines | antimicrobial agent; antineoplastic agent; antipyretic; drug metabolite; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic metabolite |
diiodotyrosine | [no description available] | medium | 2 | 0 | diiodotyrosine; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite |
imazapyr, (+-)-isomer | [no description available] | medium | 1 | 0 | imidazolines; imidazolone; pyridinemonocarboxylic acid; pyridines | |
etridiazol | [no description available] | medium | 1 | 0 | aromatic ether; organochlorine compound; thiadiazole antifungal agent; thiadiazoles | antifungal agrochemical; nitrification inhibitor |
methylphenidate | [no description available] | medium | 2 | 0 | beta-amino acid ester; methyl ester; piperidines | |
anserine | [no description available] | medium | 2 | 0 | beta-alanine derivative; dipeptide; zwitterion | animal metabolite; mouse metabolite |
asparagine | [no description available] | medium | 2 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
carnosine | [no description available] | medium | 2 | 0 | amino acid zwitterion; dipeptide | anticonvulsant; antineoplastic agent; antioxidant; Daphnia magna metabolite; geroprotector; human metabolite; mouse metabolite; neuroprotective agent |
dimethylmyleran | [no description available] | medium | 1 | 0 | methanesulfonate ester | alkylating agent; mutagen |
methandrostenolone | [no description available] | medium | 10 | 0 | organic molecular entity | |
hydrochloric acid | [no description available] | medium | 8 | 1 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
furaltadon | [no description available] | medium | 1 | 0 | | |
oxazolidin-2-one | [no description available] | medium | 1 | 0 | carbamate ester; oxazolidinone | metabolite |
leucine | [no description available] | medium | 46 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
valine | [no description available] | medium | 4 | 1 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
thymidine | [no description available] | medium | 92 | 1 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
pyridoxal phosphate | [no description available] | medium | 7 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenoxybenzamine | [no description available] | medium | 11 | 0 | aromatic amine | |
hydroxydione | [no description available] | medium | 2 | 0 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-5beta-steroid; primary alpha-hydroxy ketone | human xenobiotic metabolite |
azaguanine | [no description available] | medium | 6 | 0 | nucleobase analogue; triazolopyrimidines | antimetabolite; antineoplastic agent; EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor |
dinitrofluorobenzene | [no description available] | medium | 1 | 0 | C-nitro compound; organofluorine compound | agrochemical; allergen; chromatographic reagent; EC 2.7.3.2 (creatine kinase) inhibitor; protein-sequencing agent; spectrophotometric reagent |
florisil | [no description available] | medium | 3 | 0 | | |
dactinomycin | [no description available] | medium | 97 | 0 | actinomycin | mutagen |
pseudomorphine | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
benactyzine | [no description available] | medium | 2 | 0 | diarylmethane | |
puromycin | [no description available] | medium | 31 | 0 | puromycins | antiinfective agent; antimicrobial agent; antineoplastic agent; EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor; EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor; nucleoside antibiotic; protein synthesis inhibitor |
triclosan | [no description available] | medium | 2 | 0 | aromatic ether; dichlorobenzene; monochlorobenzenes; phenols | antibacterial agent; antimalarial; drug allergen; EC 1.3.1.9 [enoyl-[acyl-carrier-protein] reductase (NADH)] inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; fungicide; persistent organic pollutant; xenobiotic |
aluminum | [no description available] | medium | 4 | 0 | boron group element atom; elemental aluminium; metal atom | |
erythromycin ethylsuccinate | [no description available] | medium | 3 | 0 | cyclic ketone; erythromycin derivative; ethyl ester; succinate ester | |
ergotamine | [no description available] | medium | 10 | 0 | peptide ergot alkaloid | alpha-adrenergic agonist; mycotoxin; non-narcotic analgesic; oxytocic; serotonergic agonist; vasoconstrictor agent |
p-methoxy-n-methylphenethylamine | [no description available] | medium | 14 | 0 | aromatic ether; secondary amino compound | metabolite |
k-strophanthin-beta | [no description available] | medium | 1 | 0 | cardenolide glycoside; steroid aldehyde | |
viomycin | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide; peptide antibiotic | antitubercular agent |
trichloroethylene | [no description available] | medium | 2 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
trimethadione | [no description available] | medium | 2 | 0 | oxazolidinone | anticonvulsant; geroprotector |
n-(1-oxyl-2,2,5,5-tetramethyl-3-pyrrolidinyl)maleimide | [no description available] | medium | 1 | 0 | aminoxyls; dicarboximide; maleimides; pyrrolidines | |
ovalbumin | [no description available] | medium | 14 | 0 | | |
bromochloroacetic acid | [no description available] | medium | 1 | 0 | 2-bromocarboxylic acid; monocarboxylic acid; organochlorine compound | |
demeclocycline | [no description available] | medium | 3 | 0 | | |
triaziquone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; aziridines | alkylating agent; antineoplastic agent |
methysergide | [no description available] | medium | 10 | 0 | ergoline alkaloid | |
l 35 | [no description available] | medium | 1 | 0 | | |
nystatin a1 | [no description available] | medium | 3 | 0 | nystatins | |
ubiquinone | [no description available] | medium | 6 | 0 | | |
nad | [no description available] | medium | 57 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
beta-escin | [no description available] | medium | 9 | 0 | | |
pregnanetriol | [no description available] | medium | 34 | 1 | corticosteroid hormone | |
rubidium | [no description available] | medium | 3 | 0 | alkali metal atom | |
dihydroergotoxine | [no description available] | medium | 3 | 0 | | |
gastrins | [no description available] | medium | 14 | 0 | | |
ammonium chloride | [no description available] | medium | 5 | 0 | ammonium salt; inorganic chloride | ferroptosis inhibitor |
paraldehyde | [no description available] | medium | 1 | 0 | trioxane | sedative |
benzathine | [no description available] | medium | 5 | 0 | diamine | |
phenylephrine | [no description available] | medium | 6 | 0 | phenols; phenylethanolamines; secondary amino compound | alpha-adrenergic agonist; cardiotonic drug; mydriatic agent; nasal decongestant; protective agent; sympathomimetic agent; vasoconstrictor agent |
hydroxychloroquine | [no description available] | medium | 7 | 0 | aminoquinoline; organochlorine compound; primary alcohol; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; antirheumatic drug; dermatologic drug |
metaperiodate | [no description available] | medium | 10 | 0 | iodine oxoacid | |
methicillin | [no description available] | medium | 5 | 0 | penicillin allergen; penicillin | antibacterial drug |
pyrophosphate | [no description available] | medium | 2 | 0 | diphosphate ion | |
octadecyl palmitate | [no description available] | medium | 3 | 0 | hexadecanoate ester; wax ester | coral metabolite; cosmetic |
peptones | [no description available] | medium | 2 | 0 | | |
bromine | [no description available] | medium | 6 | 0 | diatomic bromine | |
thymine | [no description available] | medium | 2 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
sulfuric acid | [no description available] | medium | 1 | 0 | sulfur oxoacid | catalyst |
procainamide | [no description available] | medium | 5 | 0 | benzamides | anti-arrhythmia drug; platelet aggregation inhibitor; sodium channel blocker |
glucosamine 6-phosphate | [no description available] | medium | 1 | 0 | 2-amino-2-deoxy-D-glucopyranose 6-phosphate | human metabolite; Saccharomyces cerevisiae metabolite |
angiotensin ii | [no description available] | medium | 16 | 0 | amino acid zwitterion; angiotensin II | human metabolite |
alpha-chymotrypsin | [no description available] | medium | 21 | 0 | | |
phosphoenolpyruvate | [no description available] | medium | 2 | 0 | carboxyalkyl phosphate; monocarboxylic acid | fundamental metabolite |
stigmasterol | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; phytosterols; stigmastane sterol | plant metabolite |
poriferasterol monoglucoside | [no description available] | medium | 1 | 0 | | |
18-hydroxydeoxycorticosterone | [no description available] | medium | 4 | 0 | 18-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid | |
carbene | [no description available] | medium | 2 | 0 | carbene; methanediyl | |
sulfinpyrazone | [no description available] | medium | 4 | 0 | pyrazolidines; sulfoxide | uricosuric drug |
bradykinin | [no description available] | medium | 10 | 0 | oligopeptide | human blood serum metabolite; vasodilator agent |
triparanol | [no description available] | medium | 2 | 0 | stilbenoid | anticoronaviral agent |
cerium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
thorium | [no description available] | medium | 4 | 0 | actinoid atom; f-block element atom | |
methoxyflurane | [no description available] | medium | 1 | 0 | ether; organochlorine compound; organofluorine compound | hepatotoxic agent; inhalation anaesthetic; nephrotoxic agent; non-narcotic analgesic |
succinylcholine | [no description available] | medium | 6 | 0 | quaternary ammonium ion; succinate ester | drug allergen; muscle relaxant; neuromuscular agent |
halothane | [no description available] | medium | 6 | 0 | haloalkane; organobromine compound; organochlorine compound; organofluorine compound | inhalation anaesthetic |
methenamine | [no description available] | medium | 1 | 0 | polyazaalkane; polycyclic cage; tetramine | antibacterial drug |
thioguanine anhydrous | [no description available] | medium | 7 | 0 | 2-aminopurines | anticoronaviral agent; antimetabolite; antineoplastic agent |
hexestrol | [no description available] | medium | 8 | 0 | stilbenoid | |
6-aminonicotinamide | [no description available] | medium | 8 | 0 | aminopyridine; monocarboxylic acid amide; primary amino compound | antimetabolite; EC 1.1.1.44 (NADP(+)-dependent decarboxylating phosphogluconate dehydrogenase) inhibitor; teratogenic agent |
bemegride | [no description available] | medium | 2 | 0 | piperidones | |
glutethimide | [no description available] | medium | 3 | 0 | piperidines | |
indoleacetic acid | [no description available] | medium | 2 | 0 | indole-3-acetic acids; monocarboxylic acid | auxin; human metabolite; mouse metabolite; plant hormone; plant metabolite |
p-dimethylaminoazobenzene | [no description available] | medium | 5 | 0 | azobenzenes | |
novobiocin | [no description available] | medium | 1 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
nikethamide | [no description available] | medium | 4 | 0 | pyridinecarboxamide | |
dextroamphetamine | [no description available] | medium | 3 | 0 | 1-phenylpropan-2-amine | adrenergic agent; adrenergic uptake inhibitor; dopamine uptake inhibitor; dopaminergic agent; neurotoxin; sympathomimetic agent |
thorium dioxide | [no description available] | medium | 10 | 0 | thorium molecular entity | |
idoxuridine | [no description available] | medium | 11 | 0 | organoiodine compound; pyrimidine 2'-deoxyribonucleoside | antiviral drug; DNA synthesis inhibitor |
pilocarpine | [no description available] | medium | 16 | 0 | pilocarpine | antiglaucoma drug |
dextropropoxyphene | [no description available] | medium | 2 | 0 | 1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propanoate | mu-opioid receptor agonist; opioid analgesic |
thioproperazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-methylpiperazine; phenothiazines; sulfonamide | phenothiazine antipsychotic drug |
radon | [no description available] | medium | 1 | 0 | monoatomic radon; noble gas atom; p-block element atom | |
clioquinol | [no description available] | medium | 1 | 0 | monohydroxyquinoline; organochlorine compound; organoiodine compound | antibacterial agent; antifungal agent; antimicrobial agent; antineoplastic agent; antiprotozoal drug; chelator; copper chelator |
potassium permanganate | [no description available] | medium | 1 | 0 | | |
mecamylamine | [no description available] | medium | 3 | 0 | primary aliphatic amine | |
kanamycin a | [no description available] | medium | 4 | 0 | kanamycins | bacterial metabolite |
chlorisondamine | [no description available] | medium | 4 | 0 | isoindoles | |
serine | [no description available] | medium | 12 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
osmium | [no description available] | medium | 3 | 0 | iron group element atom; platinum group metal atom | |
magnesium sulfate | [no description available] | medium | 2 | 0 | magnesium salt; metal sulfate; organic magnesium salt | anaesthetic; analgesic; anti-arrhythmia drug; anticonvulsant; calcium channel blocker; cardiovascular drug; fertilizer; tocolytic agent |
meclizine | [no description available] | medium | 2 | 0 | diarylmethane | |
adrenochrome | [no description available] | medium | 2 | 0 | indoles | |
cyclizine | [no description available] | medium | 2 | 0 | N-alkylpiperazine | antiemetic; central nervous system depressant; cholinergic antagonist; H1-receptor antagonist; local anaesthetic |
uracil mustard | [no description available] | medium | 2 | 0 | aminouracil; nitrogen mustard | |
radium | [no description available] | medium | 2 | 0 | alkaline earth metal atom | |
aziridine | [no description available] | medium | 1 | 0 | azacycloalkane; aziridines; saturated organic heteromonocyclic parent | alkylating agent |
deferoxamine | [no description available] | medium | 3 | 0 | acyclic desferrioxamine | bacterial metabolite; ferroptosis inhibitor; iron chelator; siderophore |
barium sulfate | [no description available] | medium | 2 | 0 | barium salt; inorganic barium salt; metal sulfate | radioopaque medium |
2,6-diaminopurine | [no description available] | medium | 2 | 0 | 2,6-diaminopurines; primary amino compound | antineoplastic agent |
2-aminopurine | [no description available] | medium | 2 | 0 | 2-aminopurines; nucleobase analogue | antimetabolite |
erythrosine | [no description available] | medium | 12 | 0 | | |
eosine yellowish-(ys) | [no description available] | medium | 1 | 0 | organic sodium salt; organobromine compound | fluorochrome; histological dye |
isoprene | [no description available] | medium | 1 | 0 | alkadiene; hemiterpene; volatile organic compound | plant metabolite |
heme | [no description available] | medium | 6 | 0 | | |
fumarates | [no description available] | medium | 1 | 0 | butenedioate; C4-dicarboxylate | human metabolite; metabolite; Saccharomyces cerevisiae metabolite |
losartan potassium | [no description available] | medium | 9 | 0 | | |
epoetin alfa | [no description available] | medium | 1 | 0 | | |
threonine | [no description available] | medium | 5 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
hydroxocobalamin | [no description available] | medium | 2 | 0 | | |
colistin | [no description available] | medium | 1 | 0 | | |
sorbose | [no description available] | medium | 1 | 0 | L-sorbose; sorbopyranose | |
fluoxymesterone | [no description available] | medium | 4 | 0 | 11beta-hydroxy steroid; 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; anabolic androgenic steroid; fluorinated steroid | anabolic agent; antineoplastic agent |
promazine | [no description available] | medium | 1 | 0 | phenothiazines; tertiary amine | antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; muscarinic antagonist; phenothiazine antipsychotic drug; serotonergic antagonist |
phosphocreatine | [no description available] | medium | 5 | 0 | phosphagen; phosphoamino acid | human metabolite; mouse metabolite |
strychnine | [no description available] | medium | 5 | 0 | monoterpenoid indole alkaloid; organic heteroheptacyclic compound | avicide; cholinergic antagonist; glycine receptor antagonist; neurotransmitter agent; rodenticide |
cytosine | [no description available] | medium | 2 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dimethylnitrosamine | [no description available] | medium | 1 | 0 | nitrosamine | geroprotector; mutagen |
tyloxapol | [no description available] | medium | 1 | 0 | | |
9,10-dimethyl-1,2-benzanthracene | [no description available] | medium | 6 | 0 | ortho-fused polycyclic arene; tetraphenes | carcinogenic agent |
2-acetylaminofluorene | [no description available] | medium | 1 | 0 | 2-acetamidofluorenes | antimitotic; carcinogenic agent; epitope; mutagen |
demecolcine | [no description available] | medium | 1 | 0 | alkaloid; secondary amino compound | antineoplastic agent; microtubule-destabilising agent |
zirconium | [no description available] | medium | 2 | 0 | titanium group element atom | |
vitamin k 1 | [no description available] | medium | 2 | 0 | phylloquinones; vitamin K | cofactor; human metabolite; plant metabolite |
enclomiphene | [no description available] | medium | 12 | 0 | | |
tromethamine | [no description available] | medium | 1 | 0 | primary amino compound; triol | buffer |
thiophosphoric acid | [no description available] | medium | 1 | 0 | phosphorothioic acid | |
hydroxide ion | [no description available] | medium | 1 | 0 | oxygen hydride | mouse metabolite |
cellulose | [no description available] | medium | 5 | 0 | glycoside | |
penicillamine | [no description available] | medium | 16 | 0 | non-proteinogenic alpha-amino acid; penicillamine | antirheumatic drug; chelator; copper chelator; drug allergen |
edetic acid | [no description available] | medium | 1 | 0 | | |
iodohippuric acid | [no description available] | medium | 1 | 0 | benzamides; N-acylglycine; organoiodine compound | |
phosphoric acid, trisodium salt | [no description available] | medium | 1 | 0 | sodium phosphate | |
glutaminase | [no description available] | medium | 1 | 0 | | |
isoflurophate | [no description available] | medium | 2 | 0 | dialkyl phosphate | |
pregnanetriolone | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
uridine diphosphate glucose | [no description available] | medium | 1 | 0 | UDP-D-glucose | fundamental metabolite |
oxymetholone | [no description available] | medium | 4 | 0 | | |
isothiocyanic acid | [no description available] | medium | 1 | 0 | hydracid; one-carbon compound | |
cyanates | [no description available] | medium | 1 | 0 | | |
psilocybin | [no description available] | medium | 1 | 0 | organic phosphate; tertiary amino compound; tryptamine alkaloid | fungal metabolite; hallucinogen; prodrug; serotonergic agonist |
tetrabenazine | [no description available] | medium | 1 | 0 | benzoquinolizine; cyclic ketone; tertiary amino compound | |
adenosine diphosphate | [no description available] | medium | 2 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
cystamine | [no description available] | medium | 2 | 0 | organic disulfide; primary amino compound | EC 2.3.2.13 (protein-glutamine gamma-glutamyltransferase) inhibitor |
chlorcyclizine | [no description available] | medium | 1 | 0 | diarylmethane | |
triolein | [no description available] | medium | 4 | 0 | triglyceride | Caenorhabditis elegans metabolite; plant metabolite |
stanozolol | [no description available] | medium | 4 | 0 | 17beta-hydroxy steroid; anabolic androgenic steroid; organic heteropentacyclic compound; tertiary alcohol | anabolic agent; androgen |
monodehydroascorbate | [no description available] | medium | 1 | 0 | organic radical | mouse metabolite |
dimethyl sulfoxide | [no description available] | medium | 14 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
guanosine | [no description available] | medium | 1 | 0 | guanosines; purines D-ribonucleoside | fundamental metabolite |
xanthosine | [no description available] | medium | 1 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
guanine | [no description available] | medium | 4 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glucuronic acid | [no description available] | medium | 1 | 0 | D-glucuronic acid | algal metabolite |
lead | [no description available] | medium | 6 | 0 | carbon group element atom; elemental lead; metal atom | neurotoxin |
allantoin | [no description available] | medium | 4 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
cadmium sulfate | [no description available] | medium | 1 | 0 | cadmium salt | |
cadmium | [no description available] | medium | 1 | 0 | cadmium molecular entity; zinc group element atom | |
caloreen | [no description available] | medium | 1 | 0 | | |
acebutolol | [no description available] | medium | 1 | 0 | alpha-D-glucosyl-(1->4)-D-mannopyranose | |
ferryl iron | [no description available] | medium | 1 | 0 | | |
dithiazanine | [no description available] | medium | 1 | 0 | benzothiazoles; benzothiazolium ion | anthelminthic drug; fluorochrome |
piperazine adipate | [no description available] | medium | 1 | 0 | piperazinium salt | anthelminthic drug; antinematodal drug |
oxalic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid | algal metabolite; human metabolite; plant metabolite |
methyl orange | [no description available] | medium | 1 | 0 | | |
hoe 777 | [no description available] | medium | 2 | 0 | corticosteroid hormone | |
mometasone furoate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 2-furoate ester; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; organochlorine compound; steroid ester | anti-allergic agent; anti-inflammatory drug |
9-fluorocortisone | [no description available] | medium | 19 | 0 | | |
mercaptomerin | [no description available] | medium | 1 | 0 | | |
tetraethylammonium | [no description available] | medium | 1 | 0 | quaternary ammonium ion | |
veratrine | [no description available] | medium | 1 | 0 | alkaloid | |
ether | [no description available] | medium | 3 | 0 | ether; volatile organic compound | inhalation anaesthetic; non-polar solvent; refrigerant |
2'-5'-oligoadenylate trimer | [no description available] | medium | 1 | 0 | | |
pyrazole | [no description available] | medium | 1 | 0 | pyrazole | |
pentaquine | [no description available] | medium | 2 | 0 | | |
amphenone b | [no description available] | medium | 1 | 0 | diarylmethane | |
melamine | [no description available] | medium | 1 | 0 | triamino-1,3,5-triazine | xenobiotic metabolite |
thioacetazone | [no description available] | medium | 1 | 0 | | |
fluorescein | [no description available] | medium | 1 | 0 | 2-benzofurans; gamma-lactone; organic heteropentacyclic compound; oxaspiro compound; polyphenol; xanthene dye | fluorescent dye; radioopaque medium |
potassium chloride | [no description available] | medium | 12 | 1 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
diosgenin | [no description available] | medium | 2 | 0 | 3beta-sterol; hexacyclic triterpenoid; sapogenin; spiroketal | antineoplastic agent; antiviral agent; apoptosis inducer; metabolite |
pentol | [no description available] | medium | 1 | 0 | | |
quinoline-4-carboxylic acid | [no description available] | medium | 2 | 0 | quinolinemonocarboxylic acid | |
evans blue | [no description available] | medium | 1 | 0 | organic sodium salt | fluorochrome; histological dye; sodium channel blocker; teratogenic agent |
toltrazuril | [no description available] | medium | 1 | 0 | aromatic ether | |
ponazuril | [no description available] | medium | 1 | 0 | | |
thymic factor, circulating | [no description available] | medium | 3 | 0 | | |
beta-alanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; beta-amino acid | agonist; fundamental metabolite; human metabolite; inhibitor; neurotransmitter |
angiotensin i | [no description available] | medium | 2 | 0 | angiotensin; peptide zwitterion | human metabolite; neurotransmitter agent |
7-ketocholesterol | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; 7-oxo steroid; cholestanoid | neuroprotective agent |
nitrites | [no description available] | medium | 2 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | human metabolite |
gadolinium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
interleukin-1beta (163-171) | [no description available] | medium | 1 | 0 | | |
18-hydroxycortisol | [no description available] | medium | 3 | 0 | | |
18-oxocortisol | [no description available] | medium | 1 | 0 | | |
trimethyltin | [no description available] | medium | 1 | 0 | | |
coriolin | [no description available] | medium | 1 | 0 | | |
dendrobine | [no description available] | medium | 1 | 0 | indoles | |
sesquiterpenes | [no description available] | medium | 3 | 0 | | |
hirsutene | [no description available] | medium | 1 | 0 | | |
methylene chloride | [no description available] | medium | 1 | 0 | chloromethanes; volatile organic compound | carcinogenic agent; polar aprotic solvent; refrigerant |
interleukin-8 | [no description available] | medium | 1 | 0 | | |
isoleucine | [no description available] | medium | 2 | 1 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
methylmalonic acid | [no description available] | medium | 1 | 0 | C4-dicarboxylic acid | human metabolite |
calcitriol | [no description available] | medium | 8 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
sodium dodecyl sulfate | [no description available] | medium | 5 | 0 | organic sodium salt | detergent; protein denaturant |
nickel carbonyl | [no description available] | medium | 1 | 0 | metal carbonyl; nickel coordination entity | |
carbon monoxide | [no description available] | medium | 5 | 0 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
sodium taurodeoxycholate | [no description available] | medium | 1 | 0 | bile acid taurine conjugate | human metabolite |
adamantane | [no description available] | medium | 3 | 0 | adamantanes; polycyclic alkane | |
cephalosporin c | [no description available] | medium | 4 | 0 | cephalosporin | fungal metabolite |
erbium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
methylprednisolone acetate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; acetate ester; glucocorticoid; steroid ester; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
mebendazole | [no description available] | medium | 1 | 0 | aromatic ketone; benzimidazoles; carbamate ester | antinematodal drug; microtubule-destabilising agent; tubulin modulator |
albendazole | [no description available] | medium | 1 | 0 | aryl sulfide; benzimidazoles; benzimidazolylcarbamate fungicide; carbamate ester | anthelminthic drug; microtubule-destabilising agent; tubulin modulator |
dextrothyroxine | [no description available] | medium | 1 | 0 | | |
am 251 | [no description available] | medium | 1 | 0 | amidopiperidine; carbohydrazide; dichlorobenzene; organoiodine compound; pyrazoles | antidepressant; antineoplastic agent; apoptosis inducer; CB1 receptor antagonist |
n,n-dimethylarginine | [no description available] | medium | 1 | 0 | dimethylarginine; guanidines; L-arginine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
n(g),n(g')-dimethyl-l-arginine | [no description available] | medium | 1 | 0 | alpha-amino acid | |
laurdan | [no description available] | medium | 1 | 0 | | |
2-naphthylamine | [no description available] | medium | 1 | 0 | naphthylamine | carcinogenic agent |
methylprednisolone hemisuccinate | [no description available] | medium | 3 | 0 | corticosteroid hormone; hemisuccinate | |
zoledronic acid | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid); imidazoles | bone density conservation agent |
docetaxel anhydrous | [no description available] | medium | 1 | 0 | secondary alpha-hydroxy ketone; tetracyclic diterpenoid | antimalarial; antineoplastic agent; photosensitizing agent |
toremifene | [no description available] | medium | 1 | 0 | aromatic ether; organochlorine compound; tertiary amine | antineoplastic agent; bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
aromasil | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor; environmental contaminant; xenobiotic |
7-hydroxydehydroepiandrosterone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid; androstanoid | anti-inflammatory agent; antioxidant; estrogen; human xenobiotic metabolite; rat metabolite |
7-oxodehydroepiandrosterone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; 7-oxo steroid; androstanoid | human blood serum metabolite; nutraceutical; prohormone |
deamino arginine vasopressin | [no description available] | medium | 4 | 0 | heterodetic cyclic peptide | diagnostic agent; renal agent; vasopressin receptor agonist |
thiazoles | [no description available] | medium | 6 | 0 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
oxazoles | [no description available] | medium | 4 | 0 | 1,3-oxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
sodium morrhuate | [no description available] | medium | 2 | 0 | | |
alprostadil | [no description available] | medium | 3 | 0 | prostaglandins E | anticoagulant; human metabolite; platelet aggregation inhibitor; vasodilator agent |
butaprost | [no description available] | medium | 1 | 0 | | |
ah 6809 | [no description available] | medium | 1 | 0 | xanthones | |
dibenz(b,f)(1,4)oxazepine-10(11h)-carboxylic acid, 8-chloro-, 2-acetylhydrazide | [no description available] | medium | 1 | 0 | | |
diethyl tartrate | [no description available] | medium | 1 | 0 | 3-hydroxy carboxylic acid | |
alpha-aminopyridine | [no description available] | medium | 2 | 1 | | |
beta-endorphin | [no description available] | medium | 2 | 0 | | |
dalteparin | [no description available] | medium | 1 | 0 | | |
fondaparinux | [no description available] | medium | 1 | 0 | amino sugar; oligosaccharide sulfate; pentasaccharide derivative | anticoagulant |
ezetimibe | [no description available] | medium | 1 | 0 | azetidines; beta-lactam; organofluorine compound | anticholesteremic drug; antilipemic drug; antimetabolite |
isoxazoles | [no description available] | medium | 1 | 0 | isoxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
methenolone | [no description available] | medium | 3 | 0 | 3-hydroxy steroid | androgen |
pentolinium tartrate | [no description available] | medium | 1 | 0 | tartrate salt | antihypertensive agent |
organophosphonates | [no description available] | medium | 2 | 0 | divalent inorganic anion; phosphite ion | |
agar | [no description available] | medium | 3 | 0 | | |
ornithine | [no description available] | medium | 6 | 0 | non-proteinogenic L-alpha-amino acid; ornithine | algal metabolite; hepatoprotective agent; mouse metabolite |
nickel | [no description available] | medium | 2 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
cephaloridine | [no description available] | medium | 1 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
carbogen | [no description available] | medium | 1 | 0 | | |
cromolyn sodium | [no description available] | medium | 8 | 0 | organic sodium salt | anti-asthmatic drug; drug allergen |
5-hydroxytryptophan | [no description available] | medium | 6 | 0 | hydroxytryptophan | human metabolite; neurotransmitter |
furazolidone | [no description available] | medium | 2 | 0 | nitrofuran antibiotic; oxazolidines | antibacterial drug; antiinfective agent; antitrichomonal drug; EC 1.4.3.4 (monoamine oxidase) inhibitor |
metallothionein | [no description available] | medium | 4 | 0 | | |
technetium | [no description available] | medium | 7 | 0 | manganese group element atom | |
technetium tc 99m medronate | [no description available] | medium | 3 | 0 | | |
tilorone | [no description available] | medium | 1 | 0 | aromatic ether; diether; fluoren-9-ones; tertiary amino compound | anti-inflammatory agent; antineoplastic agent; antiviral agent; interferon inducer; nicotinic acetylcholine receptor agonist |
lithium | [no description available] | medium | 4 | 0 | alkali metal atom | |
dihydroalprenolol | [no description available] | medium | 1 | 0 | | |
triiodothyronine, reverse | [no description available] | medium | 1 | 0 | 3,3',5'-triiodothyronine; amino acid zwitterion | |
3-hydroxybutyric acid | [no description available] | medium | 2 | 0 | (omega-1)-hydroxy fatty acid; 3-hydroxy monocarboxylic acid; hydroxybutyric acid | human metabolite |
dicyclohexylcarbodiimide | [no description available] | medium | 1 | 0 | carbodiimide | ATP synthase inhibitor; cross-linking reagent; peptide coupling reagent |
metribolone | [no description available] | medium | 3 | 0 | 17beta-hydroxy steroid; 3-oxo steroid; anabolic androgenic steroid | androgen |
epidermal growth factor | [no description available] | medium | 11 | 0 | | |
nisoldipine | [no description available] | medium | 1 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; methyl ester | |
arabitol | [no description available] | medium | 2 | 0 | arabinitol | |
mannose | [no description available] | medium | 5 | 0 | D-aldohexose; D-mannose; mannopyranose | metabolite |
t-2 toxin | [no description available] | medium | 1 | 0 | | |
technetium tc 99m sulfur colloid | [no description available] | medium | 1 | 0 | | |
fluorescein-5-isothiocyanate | [no description available] | medium | 3 | 0 | fluorescein isothiocyanate | |
sulfur dioxide | [no description available] | medium | 1 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
16-hydroxydehydroepiandrosterone | [no description available] | medium | 1 | 0 | 16alpha-hydroxy steroid; 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid; secondary alpha-hydroxy ketone | human metabolite; mouse metabolite |
fluorine | [no description available] | medium | 8 | 0 | diatomic fluorine; gas molecular entity | NMR chemical shift reference compound |
cinnamyl anthranilate | [no description available] | medium | 1 | 0 | benzoate ester | |
versalide | [no description available] | medium | 1 | 0 | | |
romurtide | [no description available] | medium | 1 | 0 | organic molecular entity | |
6-o-stearoyl-n-acetylmuramyl-alanylisoglutamine | [no description available] | medium | 1 | 0 | | |
zinc phosphate | [no description available] | medium | 1 | 0 | | |
phorbols | [no description available] | medium | 1 | 0 | diterpene; terpenoid fundamental parent | |
pentostatin | [no description available] | medium | 1 | 0 | coformycins | antimetabolite; antineoplastic agent; Aspergillus metabolite; bacterial metabolite; EC 3.5.4.4 (adenosine deaminase) inhibitor |
coformycin | [no description available] | medium | 1 | 0 | coformycins | EC 3.5.4.4 (adenosine deaminase) inhibitor |
sym-trinitrobenzene | [no description available] | medium | 2 | 0 | trinitrobenzene | explosive |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine | [no description available] | medium | 2 | 0 | 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine | antihypertensive agent; beta-adrenergic antagonist; bronchoconstrictor agent; hematologic agent; vasodilator agent |
11-hydroxyandrostenedione | [no description available] | medium | 3 | 1 | 3-hydroxy steroid | androgen |
dexamethasone 21-phosphate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17-hydroxy steroid; 3-oxo-Delta(4) steroid; fluorinated steroid; steroid phosphate; tertiary alpha-hydroxy ketone | glucocorticoid receptor agonist |
lithium carbonate | [no description available] | medium | 1 | 0 | carbonate salt; lithium salt | antimanic drug |
thromboxane a2 | [no description available] | medium | 1 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
15-hydroxy-11 alpha,9 alpha-(epoxymethano)prosta-5,13-dienoic acid | [no description available] | medium | 1 | 0 | | |
2-methyl-3-(4-(3-pyridinylmethyl)phenyl)-2-propenoic acid | [no description available] | medium | 1 | 0 | | |
thromboxanes | [no description available] | medium | 1 | 0 | | |
sq 26536 | [no description available] | medium | 1 | 0 | | |
3,5-dimethyl-3'-isopropyl-l-thyronine | [no description available] | medium | 1 | 0 | | |
mercaptoethanol | [no description available] | medium | 7 | 0 | alkanethiol; primary alcohol | geroprotector |
tetrahydrocorticosterone | [no description available] | medium | 1 | 0 | 21-hydroxy steroid | |
concanavalin a | [no description available] | medium | 39 | 0 | | |
1-naphthylamine | [no description available] | medium | 1 | 0 | naphthylamine | human xenobiotic metabolite |
mitoclomine | [no description available] | medium | 1 | 0 | | |
triamcinolone hexacetonide | [no description available] | medium | 2 | 1 | corticosteroid hormone | |
fosfomycin | [no description available] | medium | 1 | 0 | epoxide; phosphonic acids | antimicrobial agent; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor |
diethylnitrosamine | [no description available] | medium | 1 | 0 | nitrosamine | carcinogenic agent; hepatotoxic agent; mutagen |
glycylleucine | [no description available] | medium | 1 | 0 | | |
leucyl-glycyl-glycine | [no description available] | medium | 1 | 0 | tripeptide | metabolite |
acemetacin | [no description available] | medium | 1 | 0 | carboxylic ester; indol-3-yl carboxylic acid; monocarboxylic acid; monochlorobenzenes; N-acylindole | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
cytellin | [no description available] | medium | 1 | 0 | | |
estetrol | [no description available] | medium | 2 | 0 | 15alpha-hydroxy steroid; 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid; steroid hormone | estrogen receptor agonist; estrogen; human metabolite; human xenobiotic metabolite; oral contraceptive |
diphenoxylate | [no description available] | medium | 1 | 0 | ethyl ester; nitrile; piperidinecarboxylate ester; tertiary amine | antidiarrhoeal drug |
atropine sulfate-diphenoxylate hydrochloride drug combination | [no description available] | medium | 1 | 0 | | |
sodium hypochlorite | [no description available] | medium | 1 | 0 | inorganic sodium salt | bleaching agent; disinfectant |
betamethasone sodium phosphate | [no description available] | medium | 1 | 0 | organic sodium salt; tertiary alpha-hydroxy ketone | |
corticosterone sulfate | [no description available] | medium | 2 | 0 | | |
cortisol 21-sulfate | [no description available] | high | 3 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; cortisol ester; steroid sulfate; tertiary alpha-hydroxy ketone | human metabolite |
beta-escin | [no description available] | medium | 2 | 0 | triterpenoid saponin | |
p-chloromercuribenzoic acid | [no description available] | medium | 2 | 0 | chlorine molecular entity; mercuribenzoic acid | |
muramylnac-ala-isogln-lys-tripeptide | [no description available] | medium | 1 | 0 | | |
iopromide | [no description available] | medium | 1 | 0 | dicarboxylic acid diamide; organoiodine compound | environmental contaminant; nephrotoxic agent; radioopaque medium; xenobiotic |
obidoxime chloride | [no description available] | medium | 1 | 0 | | |
asoxime chloride | [no description available] | medium | 1 | 0 | | |
soman | [no description available] | medium | 1 | 0 | phosphonic ester | |
masoprocol | [no description available] | medium | 1 | 0 | nordihydroguaiaretic acid | antineoplastic agent; hypoglycemic agent; lipoxygenase inhibitor; metabolite |
phosphotyrosine | [no description available] | medium | 1 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid; O(4)-phosphotyrosine | Escherichia coli metabolite; immunogen |
tricalcium phosphate | [no description available] | medium | 2 | 0 | calcium phosphate | |
povidone-iodine | [no description available] | medium | 1 | 0 | | |
artemether | [no description available] | medium | 1 | 0 | artemisinin derivative; cyclic acetal; organic peroxide; semisynthetic derivative; sesquiterpenoid | antimalarial |
dt 5061 | [no description available] | medium | 1 | 0 | | |
21-deacetyldeflazacort | [no description available] | medium | 1 | 0 | | |
spermidine | [no description available] | medium | 2 | 0 | polyazaalkane; triamine | autophagy inducer; fundamental metabolite; geroprotector |
lignans | [no description available] | medium | 2 | 0 | | |
honokiol | [no description available] | medium | 1 | 0 | biphenyls | |
magnolol | [no description available] | medium | 1 | 0 | biphenyls | |
carboplatin | [no description available] | medium | 3 | 0 | | |
calpastatin | [no description available] | medium | 1 | 0 | polypeptide | EC 3.4.22.52 (calpain-1) inhibitor; EC 3.4.22.53 (calpain-2) inhibitor |
calpain | [no description available] | medium | 1 | 0 | | |
inosine triphosphate | [no description available] | medium | 1 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
1,2-dimethylhydrazine | [no description available] | medium | 1 | 0 | hydrazines | alkylating agent; carcinogenic agent |
dimethylhydrazines | [no description available] | medium | 1 | 0 | | |
singlet oxygen | [no description available] | medium | 1 | 0 | chalcogen; monoatomic oxygen; nonmetal atom | macronutrient |
n,n'-bis(2-pyridylmethylene)-1,4-butanediamine (n,n',n'',n''')-cu(ii)diperchlorate | [no description available] | medium | 1 | 0 | | |
6-ketoprostaglandin f1 alpha | [no description available] | medium | 1 | 0 | prostaglandins Falpha | human metabolite; mouse metabolite |
adenosine monophosphate | [no description available] | medium | 4 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | adenosine A1 receptor agonist; cofactor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.11 (fructose-bisphosphatase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
hypoxanthine | [no description available] | medium | 2 | 0 | nucleobase analogue; oxopurine; purine nucleobase | fundamental metabolite |
mezlocillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
flavone acetic acid | [no description available] | medium | 1 | 0 | | |
citrinin | [no description available] | medium | 1 | 0 | | |
manganese | [no description available] | medium | 1 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
isoflurane | [no description available] | medium | 1 | 0 | organofluorine compound | inhalation anaesthetic |
18-hydroxycorticosterone | [no description available] | high | 2 | 0 | 11beta-hydroxy steroid; 18-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo steroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
atrial natriuretic factor | [no description available] | medium | 2 | 1 | polypeptide | |
cytochalasin d | [no description available] | medium | 1 | 0 | | |
bafilomycin a1 | [no description available] | medium | 1 | 0 | cyclic hemiketal; macrolide antibiotic; oxanes | apoptosis inducer; autophagy inhibitor; bacterial metabolite; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.14 (H(+)-transporting two-sector ATPase) inhibitor; ferroptosis inhibitor; fungicide; potassium ionophore; toxin |
gadolinium dtpa | [no description available] | medium | 1 | 0 | gadolinium coordination entity | MRI contrast agent |
ici 195739 | [no description available] | medium | 1 | 0 | | |
nitroblue tetrazolium | [no description available] | medium | 2 | 0 | organic cation | |
daunorubicin | [no description available] | medium | 9 | 1 | aminoglycoside antibiotic; anthracycline; p-quinones; tetracenequinones | antineoplastic agent; bacterial metabolite |
quinuclidines | [no description available] | medium | 1 | 0 | quinuclidines; saturated organic heterobicyclic parent | |
calcium oxalate | [no description available] | medium | 1 | 0 | organic calcium salt | |
trimecaine | [no description available] | medium | 1 | 0 | amino acid amide | |
4-(n-methyl-n-nitrosamino)-1-(3-pyridyl)-1-butanone | [no description available] | medium | 2 | 0 | nitrosamine; pyridines | |
neuropeptide y | [no description available] | medium | 3 | 0 | | |
3-hydroxybenzylhydrazine | [no description available] | medium | 1 | 0 | phenols | |
evernimicin | [no description available] | medium | 1 | 0 | | |
zithromax | [no description available] | medium | 1 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; xenobiotic |
vanillic acid | [no description available] | medium | 1 | 0 | methoxybenzoic acid; monohydroxybenzoic acid | plant metabolite |
tetrahydroaldosterone | [no description available] | medium | 1 | 0 | steroid lactone | |
menthol | [no description available] | medium | 2 | 0 | p-menthane monoterpenoid; secondary alcohol | volatile oil component |
eucalyptol | [no description available] | medium | 1 | 0 | | |
bisbenzimidazole | [no description available] | medium | 1 | 0 | bibenzimidazole; N-methylpiperazine | anthelminthic drug; fluorochrome |
epirubicin | [no description available] | medium | 1 | 0 | aminoglycoside; anthracycline antibiotic; anthracycline; deoxy hexoside; monosaccharide derivative; p-quinones; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | antimicrobial agent; antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
helium | [no description available] | medium | 2 | 0 | monoatomic helium; noble gas atom; s-block element atom | food packaging gas |
n-acetylneuraminic acid | [no description available] | medium | 3 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
risedronic acid | [no description available] | medium | 1 | 0 | pyridines | |
testolactone | [no description available] | medium | 1 | 0 | 3-oxo-Delta(1),Delta(4)-steroid; seco-androstane | |
substance p | [no description available] | medium | 1 | 0 | peptide | neurokinin-1 receptor agonist; neurotransmitter; vasodilator agent |
cyanoketone | [no description available] | medium | 1 | 0 | | |
dydrogesterone | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid | progestin |
cyclic gmp | [no description available] | medium | 5 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
amanitins | [no description available] | medium | 2 | 0 | | |
pentagastrin | [no description available] | medium | 2 | 0 | organic molecular entity | |
sorbitol | [no description available] | medium | 3 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
gallium | [no description available] | medium | 2 | 0 | boron group element atom | |
dithiothreitol | [no description available] | medium | 2 | 0 | 1,4-dimercaptobutane-2,3-diol; butanediols; dithiol; glycol; thiol | chelator; human metabolite; reducing agent |
pizotyline | [no description available] | medium | 1 | 0 | benzocycloheptathiophene | histamine antagonist; muscarinic antagonist; serotonergic antagonist |
normetanephrine | [no description available] | medium | 3 | 0 | catecholamine | |
cyproheptadine | [no description available] | medium | 6 | 0 | piperidines; tertiary amine | anti-allergic agent; antipruritic drug; gastrointestinal drug; H1-receptor antagonist; serotonergic antagonist |
retinol acetate | [no description available] | medium | 2 | 0 | acetate ester | |
dinitrobenzenes | [no description available] | medium | 1 | 0 | | |
gallic acid | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | antineoplastic agent; antioxidant; apoptosis inducer; astringent; cyclooxygenase 2 inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; geroprotector; human xenobiotic metabolite; plant metabolite |
aminopropionitrile | [no description available] | medium | 4 | 0 | aminopropionitrile | antineoplastic agent; antirheumatic drug; collagen cross-linking inhibitor; plant metabolite |
hydroxylysine | [no description available] | medium | 1 | 0 | 5-hydroxylysine; hydroxy-L-lysine | human metabolite |
pyrantel pamoate | [no description available] | medium | 1 | 0 | organic molecular entity | |
sepharose | [no description available] | medium | 1 | 0 | | |
carbodiimides | [no description available] | medium | 1 | 0 | carbodiimide | |
carbon disulfide | [no description available] | medium | 1 | 0 | one-carbon compound; organosulfur compound | |
azides | [no description available] | medium | 2 | 0 | pseudohalide anion | mitochondrial respiratory-chain inhibitor |
naphthoquinones | [no description available] | medium | 2 | 0 | | |
benzydamine | [no description available] | medium | 2 | 0 | aromatic ether; indazoles; tertiary amino compound | analgesic; central nervous system stimulant; hallucinogen; local anaesthetic; non-steroidal anti-inflammatory drug |
xenon radioisotopes | [no description available] | medium | 1 | 0 | | |
methoxsalen | [no description available] | medium | 2 | 0 | aromatic ether; psoralens | antineoplastic agent; cross-linking reagent; dermatologic drug; photosensitizing agent; plant metabolite |
cholecystokinin | [no description available] | medium | 4 | 0 | | |
lynestrenol | [no description available] | medium | 1 | 0 | steroid | |
gentamicin | [no description available] | medium | 3 | 0 | | |
lactose | [no description available] | medium | 1 | 0 | lactose | |
isopropyl thiogalactoside | [no description available] | medium | 1 | 0 | S-glycosyl compound | |
sodium fluoride | [no description available] | medium | 2 | 0 | fluoride salt | mutagen |
oxacillin | [no description available] | medium | 2 | 0 | penicillin | antibacterial agent; antibacterial drug |
cyproterone | [no description available] | medium | 3 | 0 | 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; chlorinated steroid; tertiary alpha-hydroxy ketone | androgen antagonist |
selenium | [no description available] | medium | 4 | 0 | chalcogen; nonmetal atom | micronutrient |
americium | [no description available] | medium | 1 | 0 | actinoid atom; f-block element atom | |
cephacetrile | [no description available] | medium | 1 | 0 | cephalosporin | |
clindamycin | [no description available] | medium | 2 | 0 | | |
indium | [no description available] | medium | 1 | 0 | boron group element atom | |
lanosterol | [no description available] | medium | 1 | 0 | 14alpha-methyl steroid; 3beta-sterol; tetracyclic triterpenoid | bacterial metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
3,4,5,3',4',5'-hexachlorobiphenyl | [no description available] | medium | 1 | 0 | hexachlorobiphenyl; trichlorobenzene | |
indacrinone | [no description available] | medium | 1 | 0 | | |
sq-23377 | [no description available] | medium | 2 | 0 | cyclic ether; enol; polyunsaturated fatty acid; very long-chain fatty acid | calcium ionophore; metabolite |
cefazolin | [no description available] | medium | 1 | 0 | beta-lactam antibiotic allergen; cephalosporin; tetrazoles; thiadiazoles | antibacterial drug |
pentazocine | [no description available] | medium | 2 | 0 | benzazocine | |
stilbene oxide | [no description available] | medium | 1 | 0 | epoxide | |
goserelin | [no description available] | medium | 1 | 0 | organic molecular entity | |
trelstar | [no description available] | medium | 1 | 0 | | |
methoxyhydroxyphenylglycol | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | |
g(m1) ganglioside | [no description available] | medium | 2 | 0 | alpha-N-acetylneuraminosyl-(2->3)-[beta-D-galactosyl-(1->3)-N-acetyl-beta-D-galactosaminyl-(1->4)]-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-N-acylsphingosine; sialotetraosylceramide | |
asialo gm1 ganglioside | [no description available] | medium | 1 | 0 | | |
glutaral | [no description available] | medium | 1 | 0 | dialdehyde | cross-linking reagent; disinfectant; fixative |
sulotroban | [no description available] | medium | 1 | 0 | | |
alphaxalone | [no description available] | medium | 1 | 0 | 11-oxo steroid | |
picrotoxin | [no description available] | medium | 1 | 0 | | |
picrotoxinin | [no description available] | medium | 1 | 0 | | |
19-nordeoxycorticosterone | [no description available] | medium | 1 | 0 | | |
plomestane | [no description available] | medium | 1 | 0 | | |
amikacin | [no description available] | medium | 1 | 0 | alpha-D-glucoside; amino cyclitol glycoside; aminoglycoside; carboxamide | antibacterial drug; antimicrobial agent; nephrotoxin |
ecdysone | [no description available] | medium | 3 | 0 | 14alpha-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; 6-oxo steroid; ecdysteroid | prohormone |
cilofungin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; echinocandin | antiinfective agent |
methylnitrosourea | [no description available] | medium | 1 | 0 | N-nitrosoureas | alkylating agent; carcinogenic agent; mutagen; teratogenic agent |
merocyanine dye | [no description available] | medium | 1 | 0 | | |
pyrimidinones | [no description available] | medium | 2 | 0 | | |
transferrin | [no description available] | medium | 3 | 0 | | |
argon | [no description available] | medium | 1 | 0 | monoatomic argon; noble gas atom; p-block element atom | food packaging gas; neuroprotective agent |
glycidyl nitrate | [no description available] | medium | 1 | 0 | | |
maltose tetrapalmitate | [no description available] | medium | 3 | 0 | | |
trimethoprim, sulfamethoxazole drug combination | [no description available] | medium | 1 | 0 | | |
leukotriene b4 | [no description available] | medium | 1 | 0 | dihydroxy monocarboxylic acid; hydroxy polyunsaturated fatty acid; leukotriene; long-chain fatty acid | human metabolite; mouse metabolite; plant metabolite; vasoconstrictor agent |
tetrachlorodecaoxide | [no description available] | medium | 1 | 0 | | |
3-methylhistidine | [no description available] | medium | 1 | 0 | L-histidine derivative; non-proteinogenic L-alpha-amino acid; zwitterion | human metabolite; Saccharomyces cerevisiae metabolite |
procarbazine | [no description available] | medium | 6 | 0 | benzamides; hydrazines | antineoplastic agent |
deoxycorticosterone sulfate | [no description available] | medium | 1 | 0 | | |
saikosaponin d | [no description available] | medium | 1 | 0 | | |
oleanolic acid | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | plant metabolite |
sapogenins | [no description available] | medium | 1 | 0 | | |
methylmercuric chloride | [no description available] | medium | 1 | 0 | chlorine molecular entity; mercury coordination entity; one-carbon compound | |
dehydroepiandrosterone acetate | [no description available] | medium | 1 | 0 | steroid ester | |
foscarnet | [no description available] | medium | 1 | 0 | carboxylic acid; one-carbon compound; phosphonic acids | antiviral drug; geroprotector; HIV-1 reverse transcriptase inhibitor; sodium-dependent Pi-transporter inhibitor |
phosgene | [no description available] | medium | 1 | 0 | acyl chloride | |
sodium bicarbonate | [no description available] | medium | 1 | 0 | one-carbon compound; organic sodium salt | antacid; food anticaking agent |
schizandrin | [no description available] | medium | 1 | 0 | | |
17-hydroxypregnenolone sulfate | [no description available] | medium | 1 | 0 | | |
neopterin | [no description available] | medium | 1 | 0 | | |
pteridines | [no description available] | medium | 1 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; pteridines | |
ethamoxytriphetol | [no description available] | medium | 1 | 0 | stilbenoid | |
cefoxitin | [no description available] | medium | 1 | 0 | beta-lactam antibiotic allergen; cephalosporin; cephamycin; semisynthetic derivative | antibacterial drug |
19-oxo-delta(4) androstene-3,17-dione | [no description available] | high | 1 | 0 | 17-oxo steroid; 19-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid; steroid aldehyde | human metabolite |
19-hydroxy-4-androstene-3,17-dione | [no description available] | medium | 1 | 0 | 17-oxo steroid; 19-hydroxy steroid; 3-oxo steroid; androstanoid | mouse metabolite |
5-dihydrocortisol | [no description available] | medium | 1 | 0 | 21-hydroxy steroid | |
benzo(a)pyrene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mouse metabolite |
sincalide | [no description available] | medium | 1 | 0 | oligopeptide | |
formic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | antibacterial agent; astringent; metabolite; protic solvent; solvent |
insulin, isophane | [no description available] | medium | 1 | 0 | | |
pridinol | [no description available] | medium | 1 | 0 | piperidines; tertiary alcohol | antiparkinson drug; muscle relaxant |
bendazac | [no description available] | medium | 1 | 0 | indazoles; monocarboxylic acid | non-steroidal anti-inflammatory drug; radical scavenger |
indazoles | [no description available] | medium | 1 | 0 | indazole | |
hydrogen | [no description available] | medium | 2 | 0 | elemental hydrogen; elemental molecule; gas molecular entity | antioxidant; electron donor; food packaging gas; fuel; human metabolite |
diazooxonorleucine | [no description available] | medium | 1 | 0 | amino acid zwitterion; diazo compound; ketone; non-proteinogenic L-alpha-amino acid | analgesic; antibacterial agent; antimetabolite; antineoplastic agent; antiviral agent; apoptosis inducer; bacterial metabolite; EC 2.4.2.14 (amidophosphoribosyltransferase) inhibitor; EC 3.5.1.2 (glutaminase) inhibitor; EC 6.3.4.2 [CTP synthase (glutamine hydrolyzing)] inhibitor; EC 6.3.5.1 [NAD(+) synthase (glutamine-hydrolysing)] inhibitor; EC 6.3.5.2 [GMP synthase (glutamine-hydrolysing)] inhibitor; EC 6.3.5.3 (phosphoribosylformylglycinamidine synthase) inhibitor; EC 6.3.5.4 [asparagine synthase (glutamine-hydrolysing)] inhibitor; EC 6.3.5.5 [carbamoyl-phosphate synthase (glutamine-hydrolysing)] inhibitor; glutamine antagonist |
ozone | [no description available] | medium | 1 | 0 | elemental molecule; gas molecular entity; reactive oxygen species; triatomic oxygen | antiseptic drug; disinfectant; electrophilic reagent; greenhouse gas; mutagen; oxidising agent; tracer |
heparitin sulfate | [no description available] | medium | 1 | 0 | | |
silver | [no description available] | medium | 3 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
deoxycholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human blood serum metabolite |
cytidine | [no description available] | medium | 4 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
morphinans | [no description available] | medium | 5 | 0 | isoquinoline alkaloid fundamental parent; morphinane alkaloid | |
dichlorodiphenyldichloroethane | [no description available] | medium | 7 | 1 | chlorophenylethane; monochlorobenzenes; organochlorine insecticide | xenobiotic metabolite |
sulfaguanidine | [no description available] | medium | 1 | 0 | sulfonamide antibiotic | antiinfective agent |
nalorphine | [no description available] | medium | 2 | 0 | morphinane alkaloid | |
potassium iodide | [no description available] | medium | 2 | 1 | potassium salt | expectorant; radical scavenger |
ethynodiol diacetate | [no description available] | medium | 1 | 0 | steroid ester; terminal acetylenic compound | contraceptive drug; estrogen receptor modulator; synthetic oral contraceptive |
oligomycins | [no description available] | medium | 2 | 0 | | |
meprobamate | [no description available] | medium | 4 | 0 | organic molecular entity | |
oxandrolone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo steroid; anabolic androgenic steroid; oxa-steroid | anabolic agent; androgen |
mevalonic acid | [no description available] | medium | 2 | 0 | 3,5-dihydroxy-3-methylpentanoic acid | |
algestone acetophenide | [no description available] | medium | 2 | 0 | | |
ethyl chloride | [no description available] | medium | 1 | 0 | chloroethanes | antipruritic drug; inhalation anaesthetic; local anaesthetic |
levallorphan | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
boron | [no description available] | medium | 1 | 0 | boron group element atom; metalloid atom; nonmetal atom | micronutrient |
chlordiazepoxide | [no description available] | medium | 1 | 0 | benzodiazepine | |
galantamine | [no description available] | medium | 1 | 0 | benzazepine alkaloid fundamental parent; benzazepine alkaloid; organic heterotetracyclic compound; tertiary amino compound | antidote to curare poisoning; cholinergic drug; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; plant metabolite |
methohexital | [no description available] | medium | 1 | 0 | acetylenic compound; barbiturates | drug allergen; intravenous anaesthetic |
xylitol | [no description available] | medium | 2 | 0 | | |
biguanides | [no description available] | medium | 2 | 0 | guanidines | |
chloral hydrate | [no description available] | medium | 1 | 0 | aldehyde hydrate; ethanediol; organochlorine compound | general anaesthetic; mouse metabolite; sedative; xenobiotic |
lypressin | [no description available] | medium | 1 | 0 | cyclic peptide | |
sarcosine | [no description available] | medium | 1 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
troleandomycin | [no description available] | medium | 1 | 0 | acetate ester; epoxide; macrolide antibiotic; monosaccharide derivative; polyketide; semisynthetic derivative | EC 1.14.13.97 (taurochenodeoxycholate 6alpha-hydroxylase) inhibitor; xenobiotic |
galactosamine | [no description available] | medium | 1 | 0 | D-galactosamine; primary amino compound | toxin |
ribose | [no description available] | medium | 1 | 0 | D-ribose; ribopyranose | |
deoxyuridine | [no description available] | medium | 1 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nafcillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
medrogestone | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
canrenone | [no description available] | medium | 1 | 0 | steroid lactone | |
apazone | [no description available] | medium | 1 | 0 | benzotriazines | non-steroidal anti-inflammatory drug; uricosuric drug |
limestone | [no description available] | medium | 1 | 0 | calcium salt; carbonate salt; inorganic calcium salt; one-carbon compound | antacid; fertilizer; food colouring; food firming agent |
nitrous oxide | [no description available] | medium | 4 | 0 | gas molecular entity; nitrogen oxide | analgesic; bacterial metabolite; food packaging gas; food propellant; general anaesthetic; greenhouse gas; inhalation anaesthetic; NMDA receptor antagonist; raising agent; refrigerant; vasodilator agent |
propanidid | [no description available] | medium | 1 | 1 | methoxybenzenes | |
sulfobromophthalein | [no description available] | medium | 4 | 0 | 2-benzofurans; organobromine compound; organosulfonic acid; phenols | dye |
carbonates | [no description available] | medium | 1 | 0 | carbon oxoanion | |
niridazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; C-nitro compound | |
ammonium sulfate | [no description available] | medium | 2 | 0 | ammonium salt; inorganic sulfate salt | fertilizer |
diatrizoic acid | [no description available] | medium | 1 | 0 | acetamides; benzoic acids; organoiodine compound | environmental contaminant; radioopaque medium; xenobiotic |
s-adenosylmethionine | [no description available] | medium | 1 | 0 | organic cation; sulfonium compound | coenzyme; cofactor; human metabolite; micronutrient; Mycoplasma genitalium metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
11 alpha-bromoacetoxyprogesterone | [no description available] | medium | 1 | 0 | | |
carbamates | [no description available] | medium | 1 | 0 | amino-acid anion | |
cholestyramine resin | [no description available] | medium | 1 | 0 | | |
ethambutol | [no description available] | medium | 3 | 0 | ethanolamines; ethylenediamine derivative | antitubercular agent; environmental contaminant; xenobiotic |
silicon | [no description available] | medium | 3 | 0 | carbon group element atom; metalloid atom; nonmetal atom | |
xenon | [no description available] | medium | 1 | 1 | monoatomic xenon; noble gas atom; p-block element atom | |
cholestanol | [no description available] | medium | 1 | 0 | cholestanoid | |
caprylates | [no description available] | medium | 1 | 0 | fatty acid anion 8:0; straight-chain saturated fatty acid anion | human metabolite; Saccharomyces cerevisiae metabolite |
podophyllin | [no description available] | medium | 1 | 0 | | |
spermine | [no description available] | medium | 1 | 0 | polyazaalkane; tetramine | antioxidant; fundamental metabolite; immunosuppressive agent |
niobium | [no description available] | medium | 1 | 0 | vanadium group element atom | |
adamantanone | [no description available] | medium | 1 | 0 | adamantanones | |
chromium | [no description available] | medium | 1 | 0 | chromium group element atom; metal allergen | micronutrient |
barium | [no description available] | medium | 1 | 0 | alkaline earth metal atom; elemental barium | |
guanosine triphosphate | [no description available] | medium | 1 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
silver nitrate | [no description available] | medium | 5 | 0 | inorganic nitrate salt; silver salt | astringent |
arsphenamine | [no description available] | medium | 1 | 0 | | |
tungsten | [no description available] | medium | 1 | 0 | chromium group element atom | micronutrient |
erythritol | [no description available] | medium | 1 | 0 | butane-1,2,3,4-tetrol | antioxidant; human metabolite; plant metabolite |
ambenonium chloride | [no description available] | medium | 1 | 0 | organic chloride salt; quaternary ammonium salt | EC 3.1.1.8 (cholinesterase) inhibitor; neurotransmitter agent |
delphinidin | [no description available] | medium | 1 | 0 | anthocyanidin chloride | |
nortriptyline | [no description available] | medium | 1 | 0 | organic tricyclic compound; secondary amine | adrenergic uptake inhibitor; analgesic; antidepressant; antineoplastic agent; apoptosis inducer; drug metabolite |
cephalothin | [no description available] | medium | 1 | 0 | azabicycloalkene; beta-lactam antibiotic allergen; carboxylic acid; cephalosporin; semisynthetic derivative; thiophenes | antibacterial drug; antimicrobial agent |
pempidine | [no description available] | medium | 1 | 0 | piperidines | |
lanatosides | [no description available] | medium | 1 | 0 | | |
thiosulfates | [no description available] | medium | 1 | 0 | divalent inorganic anion; sulfur oxide; sulfur oxoanion | human metabolite |
beta-aminoethyl isothiourea | [no description available] | medium | 1 | 0 | | |
phenanthrenes | [no description available] | medium | 1 | 0 | | |
solanine | [no description available] | medium | 1 | 0 | | |
benzofurans | [no description available] | medium | 1 | 0 | | |
congo red | [no description available] | medium | 1 | 0 | bis(azo) compound | |
isomethyleugenol | [no description available] | medium | 8 | 0 | isomethyleugenol | |
trolamine salicylate | [no description available] | medium | 670 | 0 | | |
eye | [no description available] | medium | 124 | 0 | | |
cetylpyridinium chloride anhydrous | [no description available] | medium | 6 | 3 | chloride salt; organic chloride salt | antiseptic drug; surfactant |
iodinated glycerol | [no description available] | medium | 31 | 2 | dioxolane | |
oxybutynin | [no description available] | medium | 1 | 0 | acetylenic compound; carboxylic ester; racemate; tertiary alcohol; tertiary amino compound | antispasmodic drug; calcium channel blocker; local anaesthetic; muscarinic antagonist; muscle relaxant; parasympatholytic |
4-methoxyamphetamine | [no description available] | medium | 14 | 0 | | |
egg white | [no description available] | medium | 5 | 0 | | |
fomesafen | [no description available] | medium | 5 | 0 | aromatic ether; C-nitro compound; monochlorobenzenes; N-sulfonylcarboxamide; organofluorine compound; phenols | agrochemical; EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor; herbicide |
jaw | [no description available] | medium | 4 | 0 | indolecarboxamide | |
enerbol | [no description available] | medium | 2 | 0 | | |
propiconazole | [no description available] | medium | 8 | 0 | conazole fungicide; cyclic ketal; dichlorobenzene; triazole fungicide; triazoles | antifungal agrochemical; EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor; environmental contaminant; xenobiotic |
exudates | [no description available] | medium | 3 | 0 | | |
sodium ethylxanthate | [no description available] | medium | 12 | 0 | | |
zinc oxide | [no description available] | medium | 2 | 0 | | |
methyl salicylate | [no description available] | medium | 1 | 0 | benzoate ester; methyl ester; salicylates | flavouring agent; insect attractant; metabolite |
glyphosate | [no description available] | medium | 1 | 0 | glycine derivative; phosphonic acid | agrochemical; EC 2.5.1.19 (3-phosphoshikimate 1-carboxyvinyltransferase) inhibitor; herbicide |
torpedo | [no description available] | medium | 1 | 0 | | |
clove | [no description available] | medium | 1 | 0 | | |
sabinene | [no description available] | medium | 1 | 0 | thujene | plant metabolite |
foxes | [no description available] | medium | 1 | 0 | | |
inositol 3-phosphate | [no description available] | medium | 1 | 0 | | |
fenoxycarb | [no description available] | medium | 1 | 0 | aromatic ether; carbamate ester | environmental contaminant; insecticide; juvenile hormone mimic; xenobiotic |
acetylcarnitine | [no description available] | low | 0 | 0 | O-acylcarnitine | human metabolite |
2-oxo-3-methylvalerate | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; branched-chain keto acid | human metabolite |
alpha-ketoisovalerate | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; branched-chain keto acid | human metabolite; Saccharomyces cerevisiae metabolite |
2,3-diphosphoglycerate | [no description available] | low | 0 | 0 | bisphosphoglyceric acid; tetronic acid derivative | human metabolite |
2-keto-4-methylvalerate | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; branched-chain keto acid | algal metabolite; human metabolite |
3-hydroxyanthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; monohydroxybenzoic acid | human metabolite; mouse metabolite |
3-hydroxykynurenine | [no description available] | low | 0 | 0 | hydroxykynurenine | human metabolite |
3-oxoadipic acid | [no description available] | low | 0 | 0 | dicarboxylic fatty acid; oxo dicarboxylic acid | bacterial xenobiotic metabolite; human metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphoserine | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid; O-phosphoamino acid; serine derivative | human metabolite |
3-phenylpropionic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid | antifungal agent; human metabolite; plant metabolite |
4-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols | fungal metabolite; human metabolite; mouse metabolite; plant metabolite |
isocaproaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde | human metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
5-aminovaleric acid | [no description available] | low | 0 | 0 | amino acid zwitterion; delta-amino acid; omega-amino fatty acid | human metabolite |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
aminoethylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; primary amino compound; zwitterion | human metabolite; metabolite; mouse metabolite |
octanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
dihydrolipoic acid | [no description available] | low | 0 | 0 | thio-fatty acid | antioxidant; human metabolite; neuroprotective agent |
trimethylenediamine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | human metabolite; mouse metabolite; reagent |
pyrrolidonecarboxylic acid | [no description available] | low | 0 | 0 | oxoproline; pyrrolidin-2-ones; pyrrolidinemonocarboxylic acid | human metabolite |
alpha-keto-delta-guanidinovaleric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
dihydrolipoamide | [no description available] | low | 0 | 0 | dithiol; monocarboxylic acid amide | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone phosphate | [no description available] | medium | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | medium | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dimethylglycine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-methyl-amino acid; N-methylglycines | Daphnia magna metabolite; human metabolite; mouse metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
glutaric acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | Daphnia magna metabolite; human metabolite |
alpha-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | algal metabolite; human metabolite |
glycolaldehyde | [no description available] | low | 0 | 0 | glycolaldehydes | fundamental metabolite; human metabolite |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glycocyamine | [no description available] | low | 0 | 0 | guanidinoacetic acids; zwitterion | bacterial metabolite; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
hydrogen cyanide | [no description available] | low | 0 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
homogentisic acid | [no description available] | low | 0 | 0 | dihydroxyphenylacetic acid; hydroquinones | human metabolite; plant metabolite |
indole-3-acetaldehyde | [no description available] | low | 0 | 0 | indoleacetaldehyde | bacterial metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
itaconic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid; olefinic compound | fungal metabolite; human metabolite |
potassium | [no description available] | low | 0 | 0 | alkali metal cation; elemental potassium; monoatomic monocation; monovalent inorganic cation | cofactor; human metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
malonic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid | human metabolite |
methylmercaptan | [no description available] | low | 0 | 0 | alkanethiol | human metabolite; Saccharomyces cerevisiae metabolite |
pyruvaldehyde | [no description available] | low | 0 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
n-methylphenylethanolamine | [no description available] | low | 0 | 0 | alkaloid; phenylethanolamines | human metabolite; plant metabolite |
n'-acetylspermine | [no description available] | low | 0 | 0 | acetamides; acetylspermine | human metabolite |
hydroxypyruvic acid | [no description available] | medium | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
4-hydroxyphenylpyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; phenols | human metabolite |
hexadecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-hydroxyphenethylamine | [no description available] | low | 0 | 0 | phenylethanolamines | human metabolite |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphoric acid | [no description available] | low | 0 | 0 | phosphoric acids | algal metabolite; fertilizer; human metabolite; NMR chemical shift reference compound; solvent |
phosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines | allergen; epitope; hapten; human metabolite; mouse metabolite |
phosphorylethanolamine | [no description available] | low | 0 | 0 | phosphoethanolamine; primary amino compound | algal metabolite; human metabolite; mouse metabolite |
picolinic acid | [no description available] | low | 0 | 0 | pyridinemonocarboxylic acid | human metabolite; MALDI matrix material |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
tryptamine | [no description available] | low | 0 | 0 | aminoalkylindole; aralkylamino compound; indole alkaloid; tryptamines | human metabolite; mouse metabolite; plant metabolite |
perillic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | antineoplastic agent; human metabolite; mouse metabolite |
meglutol | [no description available] | low | 0 | 0 | 3-hydroxy carboxylic acid; dicarboxylic acid; tertiary alcohol | anticholesteremic drug; antimetabolite; EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; human metabolite; plant metabolite |
3-hydroxy-4-methoxyphenethylamine | [no description available] | low | 0 | 0 | monomethoxybenzene; phenols; phenylethylamine; primary amino compound | human metabolite; rat metabolite |
5-methoxytryptamine | [no description available] | low | 0 | 0 | aromatic ether; primary amino compound; tryptamines | 5-hydroxytryptamine 2A receptor agonist; 5-hydroxytryptamine 2B receptor agonist; 5-hydroxytryptamine 2C receptor agonist; antioxidant; cardioprotective agent; human metabolite; mouse metabolite; neuroprotective agent; radiation protective agent; serotonergic agonist |
cetyl alcohol | [no description available] | low | 0 | 0 | hexadecanol; long-chain primary fatty alcohol | algal metabolite; flavouring agent; human metabolite; plant metabolite |
decanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; anti-inflammatory agent; antibacterial agent; human metabolite; plant metabolite; volatile oil component |
2,5-dihydroxybenzoic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; fungal metabolite; human metabolite; MALDI matrix material; mouse metabolite |
tele-methylhistamine | [no description available] | low | 0 | 0 | imidazoles; primary amino compound | human metabolite; mouse metabolite |
indolepropionic acid | [no description available] | low | 0 | 0 | indol-3-yl carboxylic acid | auxin; human metabolite; plant metabolite |
3-phenyllactic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid | human metabolite |
2-phenylglycine | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid | human metabolite |
sebacic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite; plant metabolite |
stearic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; saturated fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; human metabolite; plant metabolite |
succinylacetone | [no description available] | low | 0 | 0 | beta-diketone; dioxo monocarboxylic acid | human metabolite |
retinoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; retinoid | human metabolite |
cysteine | [no description available] | low | 0 | 0 | cysteine zwitterion; cysteine; L-alpha-amino acid; proteinogenic amino acid; serine family amino acid | EC 4.3.1.3 (histidine ammonia-lyase) inhibitor; flour treatment agent; human metabolite |
isonicotinic acid | [no description available] | low | 0 | 0 | pyridinemonocarboxylic acid | algal metabolite; human metabolite |
uridine monophosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine monophosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
skatole | [no description available] | low | 0 | 0 | methylindole | human metabolite; mammalian metabolite |
quinaldic acid | [no description available] | low | 0 | 0 | quinolinemonocarboxylic acid | human metabolite; Saccharomyces cerevisiae metabolite |
3-methylpentane | [no description available] | low | 0 | 0 | alkane; volatile organic compound | allelochemical; human metabolite; non-polar solvent |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
1-phenethylamine | [no description available] | low | 0 | 0 | phenylethylamine | human metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
isethionic acid | [no description available] | low | 0 | 0 | alkanesulfonic acid | human metabolite |
methylcyclohexane | [no description available] | low | 0 | 0 | cycloalkane; volatile organic compound | aprotic solvent; human metabolite; plant metabolite |
piperidine | [no description available] | low | 0 | 0 | azacycloalkane; piperidines; saturated organic heteromonocyclic parent; secondary amine | base; catalyst; human metabolite; non-polar solvent; plant metabolite; protic solvent; reagent |
undecanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antifungal agent; human metabolite |
1-tridecanol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; tridecanol | bacterial metabolite; human metabolite; plant metabolite |
stearyl alcohol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; octadecanol | algal metabolite; human metabolite; plant metabolite |
acetol | [no description available] | medium | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-methylbutanoic acid | [no description available] | low | 0 | 0 | methylbutyric acid | bacterial metabolite; human metabolite |
isopropyl palmitate | [no description available] | low | 0 | 0 | fatty acid ester; isopropyl ester | human metabolite |
homoarginine | [no description available] | low | 0 | 0 | homoarginine; L-lysine derivative; non-proteinogenic L-alpha-amino acid | biomarker; EC 3.1.3.1 (alkaline phosphatase) inhibitor; human metabolite; rat metabolite; xenobiotic metabolite |
dibenzo(a,l)pyrene | [no description available] | low | 0 | 0 | ortho- and peri-fused polycyclic arene | human metabolite; mutagen |
3-methoxytyrosine | [no description available] | low | 0 | 0 | aromatic L-alpha-amino acid zwitterion; L-tyrosine derivative; monomethoxybenzene; non-proteinogenic L-alpha-amino acid | human metabolite |
4-hydroxyphenyllactic acid | [no description available] | low | 0 | 0 | 2-hydroxy carboxylic acid; phenols | bacterial metabolite; human metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
4-methylcatechol | [no description available] | low | 0 | 0 | methylcatechol | antioxidant; carcinogenic agent; hapten; human metabolite; plant metabolite |
homocystine | [no description available] | low | 0 | 0 | amino acid zwitterion; homocystines | human metabolite |
glycocholic acid | [no description available] | low | 0 | 0 | bile acid glycine conjugate | human metabolite |
ninhydrin | [no description available] | low | 0 | 0 | aromatic ketone; beta-diketone; indanones; ketone hydrate | colour indicator; human metabolite |
indican | [no description available] | low | 0 | 0 | aryl sulfate; indoles | human metabolite |
suberic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
hexadecanedioic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
aceturic acid | [no description available] | low | 0 | 0 | N-acetyl-amino acid; N-acylglycine | human metabolite |
myristic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite |
glycylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | human metabolite |
lignoceric acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; very long-chain fatty acid | Daphnia tenebrosa metabolite; human metabolite; plant metabolite; volatile oil component |
2-hydroxybutyric acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; hydroxybutyric acid | algal metabolite; human metabolite |
ethylmalonic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
2-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; phenols | human metabolite; mouse metabolite |
5-methyl-2-furfural | [no description available] | low | 0 | 0 | aldehyde; furans | EC 2.2.1.6 (acetolactate synthase) inhibitor; flavouring agent; human metabolite; Maillard reaction product |
1,1,3,3-tetramethylurea | [no description available] | low | 0 | 0 | ureas | human metabolite |
glycochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid glycine conjugate | human metabolite |
isocaproic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; medium-chain fatty acid; methyl-branched fatty acid | human metabolite |
homoserine | [no description available] | low | 0 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
dodecanedioic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | EC 1.1.1.1 (alcohol dehydrogenase) inhibitor; human metabolite |
deoxycytidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cytidine diphosphate choline | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphocholines | human metabolite; mouse metabolite; neuroprotective agent; psychotropic drug; Saccharomyces cerevisiae metabolite |
1-pentene-3-one | [no description available] | low | 0 | 0 | enone | flavouring agent; genotoxin; human metabolite; plant metabolite |
9,10-epoxystearic acid | [no description available] | low | 0 | 0 | epoxystearic acid | human metabolite |
5-hydroxyindole | [no description available] | low | 0 | 0 | hydroxyindoles | human metabolite |
beta-hydroxymyristic acid | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; 3-hydroxy monocarboxylic acid; long-chain fatty acid | bacterial metabolite; human metabolite |
perillaldehyde | [no description available] | low | 0 | 0 | aldehyde; olefinic compound | human metabolite; mouse metabolite; volatile oil component |
tricosanoic acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; very long-chain fatty acid | Daphnia magna metabolite; human metabolite; plant metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
tetrahydropapaveroline | [no description available] | low | 0 | 0 | benzylisoquinoline alkaloid; benzyltetrahydroisoquinoline; isoquinolinol | human metabolite |
cyclic cmp | [no description available] | low | 0 | 0 | 3',5'-cyclic pyrimidine nucleotide | human metabolite |
furoylglycine | [no description available] | low | 0 | 0 | furans; N-acylglycine | human metabolite |
3,3',5'-triiodothyronine | [no description available] | low | 0 | 0 | iodothyronine | human metabolite |
limonene | [no description available] | low | 0 | 0 | cycloalkene; p-menthadiene | human metabolite |
hypochlorous acid | [no description available] | low | 0 | 0 | chlorine oxoacid; reactive oxygen species | EC 2.5.1.18 (glutathione transferase) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite |
urobilinogen | [no description available] | low | 0 | 0 | bilanes | human metabolite |
iron | [no description available] | low | 0 | 0 | divalent metal cation; iron cation; monoatomic dication | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1-methyladenosine | [no description available] | low | 0 | 0 | methyladenosine | human metabolite |
nonanal | [no description available] | low | 0 | 0 | medium-chain fatty aldehyde; n-alkanal; saturated fatty aldehyde | human metabolite; plant metabolite |
dimethylacetamide | [no description available] | low | 0 | 0 | acetamides; monocarboxylic acid amide | human metabolite |
s-adenosylmethionine | [no description available] | low | 0 | 0 | sulfonium betaine | human metabolite |
acetylgalactosamine | [no description available] | low | 0 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
norsalsolinol | [no description available] | low | 0 | 0 | isoquinolinol | animal metabolite; apoptosis inducer; human metabolite; marine metabolite |
2-methyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline | [no description available] | low | 0 | 0 | isoquinolinol; tertiary amino compound | human metabolite; neurotoxin; rat metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
1,5-anhydroglucitol | [no description available] | low | 0 | 0 | anhydro sugar | human metabolite |
5-methylcytosine | [no description available] | low | 0 | 0 | methylcytosine; pyrimidines | human metabolite |
n-acetylaspartic acid | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N-acyl-L-aspartic acid | antioxidant; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
homocitrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; L-lysine derivative; non-proteinogenic L-alpha-amino acid; ureas | human metabolite; mouse metabolite |
cholesteryl sulfate | [no description available] | low | 0 | 0 | steroid sulfate | human metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
25-hydroxycholesterol | [no description available] | low | 0 | 0 | 25-hydroxy steroid; oxysterol | human metabolite |
n-acetylserine | [no description available] | low | 0 | 0 | acetyl-L-serine; N-acetyl-L-amino acid | human metabolite |
o-4-methylthymine | [no description available] | low | 0 | 0 | aromatic ether; methylthymine | human metabolite |
lathosterol | [no description available] | low | 0 | 0 | 3beta-sterol; C27-steroid; cholestanoid; Delta(7)-sterol | human metabolite; mouse metabolite |
omega-aminocaprylic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; omega-amino fatty acid | human metabolite |
parabanic acid | [no description available] | low | 0 | 0 | hydracid; imidazolidinone | human metabolite |
n-acetyl-l-arginine | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid | human metabolite |
cystine | [no description available] | low | 0 | 0 | cystine zwitterion; cystine; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
6-methyladenine | [no description available] | low | 0 | 0 | 6-alkylaminopurine; methyladenine | human metabolite |
phenylacetylglycine | [no description available] | low | 0 | 0 | monocarboxylic acid amide; monocarboxylic acid; N-acylglycine | human metabolite; mouse metabolite |
hydracrylic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
hordenine | [no description available] | low | 0 | 0 | phenethylamine alkaloid | human metabolite; mouse metabolite |
4-methoxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid; aromatic ether; phenols | estrogen; human metabolite; rat metabolite |
glutaurine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; L-glutamine derivative; sulfonic acid | anticonvulsant; anxiolytic drug; hormone; human metabolite; mammalian metabolite; mouse metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
beta-hydroxyisovaleric acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid | human metabolite |
n-acetylhistamine | [no description available] | low | 0 | 0 | acetamides; imidazoles | human metabolite |
indole-3-carboxylic acid | [no description available] | low | 0 | 0 | indol-3-yl carboxylic acid | bacterial metabolite; human metabolite |
5-hydroxymethylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol; nucleobase analogue; pyrimidone | human metabolite; mouse metabolite |
n-acetylglutamic acid | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N-acyl-L-glutamic acid | human metabolite; Saccharomyces cerevisiae metabolite |
2,5-dihydroxybenzaldehyde | [no description available] | low | 0 | 0 | dihydroxybenzaldehyde | human metabolite; mouse metabolite; Penicillium metabolite |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
2-ketopentanoic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; oxopentanoic acid | human metabolite |
hydroxyindoleacetaldehyde | [no description available] | low | 0 | 0 | hydroxyindoles; indoleacetaldehyde | human metabolite; mouse metabolite |
leucylleucine | [no description available] | low | 0 | 0 | dipeptide; L-aminoacyl-L-amino acid zwitterion | human metabolite; Mycoplasma genitalium metabolite |
5-hydroxymethyluracil | [no description available] | low | 0 | 0 | primary alcohol; pyrimidone | human metabolite |
12-hydroxydodecanoic acid | [no description available] | low | 0 | 0 | omega-hydroxy-medium-chain fatty acid | human metabolite |
decane-1,2-diol | [no description available] | low | 0 | 0 | glycol; volatile organic compound | anti-inflammatory agent; antioxidant; human metabolite |
4-nitrophenyl sulfate | [no description available] | low | 0 | 0 | aryl sulfate; C-nitro compound | human metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
biotinamide | [no description available] | low | 0 | 0 | biotins; monocarboxylic acid amide | human metabolite |
3,4-dihydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; catechols | antioxidant; drug metabolite; human metabolite; mouse metabolite |
3-hydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; phenols | human metabolite |
n-acetylalanine | [no description available] | low | 0 | 0 | L-alanine derivative; N-acetyl-L-amino acid | human metabolite; Saccharomyces cerevisiae metabolite |
cholest-4-en-3-one | [no description available] | medium | 0 | 0 | 3-oxo-Delta(4) steroid; cholestanoid | human metabolite; plant metabolite |
2-pinene oxide | [no description available] | low | 0 | 0 | epoxide; pinane monoterpenoid | bacterial xenobiotic metabolite; fragrance; human metabolite |
1-methylhistidine | [no description available] | low | 0 | 0 | L-histidine derivative; non-proteinogenic L-alpha-amino acid; zwitterion | human metabolite |
3-hydroxybutyric acid | [no description available] | low | 0 | 0 | 3-hydroxybutyric acid; ketone body | fungal metabolite; human metabolite; pheromone |
testosterone acetate | [no description available] | medium | 0 | 0 | 3-oxo-Delta(4) steroid; androstanoid; sterol ester | human metabolite |
phenylacetylglutamine | [no description available] | low | 0 | 0 | N(2)-phenylacetylglutamine | human metabolite |
zymosterol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
n-epsilon-acetyllysine | [no description available] | low | 0 | 0 | acetyl-L-lysine; amino acid zwitterion; N(6)-acyl-L-lysine | human metabolite |
2-hydroxyhexadecanoic acid | [no description available] | low | 0 | 0 | 2-hydroxy fatty acid; hydroxypalmitic acid | human metabolite |
gamma-glutamylglutamate | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
indole-3-lactic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; indol-3-yl carboxylic acid | human metabolite |
n(alpha)-acetyllysine | [no description available] | low | 0 | 0 | acetyl-L-lysine; amino acid zwitterion | human metabolite |
glycyl-l-phenylalanine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | human metabolite; metabolite |
5,6-dihydrothymine | [no description available] | low | 0 | 0 | pyrimidone | human metabolite; metabolite; mouse metabolite |
gamma-glutamyltyrosine | [no description available] | low | 0 | 0 | dicarboxylic acid; dipeptide; phenols; primary amino compound; secondary carboxamide | human metabolite |
cholest-5-ene-3 beta,26-diol | [no description available] | low | 0 | 0 | 26-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite |
2-hydroxyisovaleric acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid | human metabolite |
aminomalonic acid | [no description available] | low | 0 | 0 | amino dicarboxylic acid | Daphnia magna metabolite; human metabolite |
zymostenol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite |
1,2-distearoylphosphatidylethanolamine | [no description available] | low | 0 | 0 | phosphatidylethanolamine zwitterion; phosphatidylethanolamine | human metabolite |
hydrogen sulfite | [no description available] | low | 0 | 0 | sulfur oxoanion | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
aflatoxin b1-2,3-oxide | [no description available] | low | 0 | 0 | aflatoxin | human metabolite |
fructose 2,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 2,6-bisphosphate | human metabolite; mouse metabolite |
pregnenolone sulfate | [no description available] | low | 0 | 0 | steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite |
3,3'-diiodothyronine | [no description available] | low | 0 | 0 | 3,3'-diiodothyronine; amino acid zwitterion | human metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
propionylcarnitine | [no description available] | low | 0 | 0 | O-acylcarnitine | analgesic; antirheumatic drug; cardiotonic drug; human metabolite; peripheral nervous system drug |
testosterone 17-glucosiduronate | [no description available] | low | 0 | 0 | 3-oxo steroid; beta-D-glucosiduronic acid; enone; steroid glucosiduronic acid | human metabolite |
3-chloro-L-tyrosine | [no description available] | low | 0 | 0 | chloroamino acid; L-alpha-amino acid zwitterion; L-tyrosine derivative; monochlorobenzenes; non-proteinogenic L-alpha-amino acid | biomarker; human metabolite |
androsterone glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; metabolite; mouse metabolite |
selenomethylselenocysteine | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid; selenocysteines | antineoplastic agent; human metabolite |
1,5(10)-estradiene-3,4,17-trione | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(1) steroid; orthoquinones | human metabolite |
s-sulphocysteine | [no description available] | low | 0 | 0 | organic thiosulfate; S-substituted L-cysteine | human metabolite; plant metabolite |
estrone-3-glucuronide | [no description available] | low | 0 | 0 | 17-oxo steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
1-hydroxyethyl radical | [no description available] | low | 0 | 0 | organic anion | human metabolite; Saccharomyces cerevisiae metabolite |
(20s)-20-hydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | human metabolite; mouse metabolite |
deoxyhypusine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | human metabolite |
3,7,12-trihydroxycoprostanic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; cholestanoic acid; hydroxy monocarboxylic acid | human metabolite |
triiodothyronine sulfate | [no description available] | low | 0 | 0 | aryl sulfate; O-sulfoamino acid | human metabolite |
3,7,12-trihydroxycholestan-26-oic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; hydroxy monocarboxylic acid; steroid acid | human metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
7 alpha-hydroxy-4-cholesten-3-one | [no description available] | medium | 0 | 0 | 3-oxo-Delta(4) steroid; 7alpha-hydroxy steroid; cholestanoid | human metabolite; mouse metabolite |
pristanic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; long-chain fatty acid; methyl-branched fatty acid | human metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
27-hydroxycholesterol | [no description available] | low | 0 | 0 | 26-hydroxycholesterol | apoptosis inducer; human metabolite; mouse metabolite; neuroprotective agent |
3-carboxy-4-methyl-5-propyl-2-furanpropionic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; furoic acid | human metabolite; uremic toxin |
dehydroalanine | [no description available] | low | 0 | 0 | 2,3-dehydroamino acid; alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion; enamine; non-proteinogenic alpha-amino acid | alkylating agent; human metabolite; mouse metabolite |
hypothiocyanite ion | [no description available] | low | 0 | 0 | one-carbon compound; sulfur oxoacid | antibacterial agent; antifungal agent; antiviral agent; human metabolite; oxidising agent; rat metabolite |
3-c-methylerythritol | [no description available] | low | 0 | 0 | tetritol | human metabolite |
succinylacetoacetate | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; beta-diketone | human metabolite |
isoursodeoxycholic acid | [no description available] | low | 0 | 0 | dihydroxy-5beta-cholanic acid | human metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
triiodothyronine | [no description available] | low | 0 | 0 | tetrahydrothiophenes; thiolactone | human metabolite |
kinetensin | [no description available] | low | 0 | 0 | oligopeptide | histamine releasing agent; human metabolite |
estra-1(10),4-diene-2,3,17-trione | [no description available] | medium | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; orthoquinones | human metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
n-methylserotonin | [no description available] | low | 0 | 0 | phenols; tryptamines | human metabolite; plant metabolite |
gamma-glutamylglutamine | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
3,4-dihydroxybutanoic acid | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; omega-hydroxy-short-chain fatty acid | human metabolite |
n-palmitoylglycine | [no description available] | low | 0 | 0 | fatty amide; N-acylglycine 16:0 | human metabolite; marine metabolite |
gamma-glutamyl-leucine | [no description available] | low | 0 | 0 | glutamyl-L-amino acid | human metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
3,4-dihydroxyphenylglycolaldehyde | [no description available] | low | 0 | 0 | catechols; hydroxyaldehyde | human metabolite; mouse metabolite; neurotoxin |
androsterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; androstanoid; steroid sulfate | human metabolite; mouse metabolite |
3,7,12-trihydroxycoprostane | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
saccharopine | [no description available] | low | 0 | 0 | amino acid opine; L-lysine derivative | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allysine | [no description available] | low | 0 | 0 | allysine; amino acid zwitterion; aminoadipate semialdehyde; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
allocholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; allo-bile acid; C24-steroid | human metabolite; marine metabolite; rat metabolite |
beta-ureidoisobutyric acid | [no description available] | low | 0 | 0 | ureidocarboxylic acid | human metabolite; mouse metabolite |
kynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; kynurenine; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nicotinate ribonucleoside | [no description available] | low | 0 | 0 | ammonium betaine | human metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
thiocysteine | [no description available] | low | 0 | 0 | amino acid zwitterion; S-substituted L-cysteine | human metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4,4-dimethyl-5-alpha-cholesta-(8,24)-dien-3-beta-ol | [no description available] | low | 0 | 0 | 3beta-sterol | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
bradykinin, des-phe(8)-des-arg(9)- | [no description available] | low | 0 | 0 | oligopeptide | human metabolite; rat metabolite |
isobutyryl-1-carnitine | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-L-carnitine; O-isobutyrylcarnitine; saturated fatty acyl-L-carnitine | human metabolite |
threitol | [no description available] | low | 0 | 0 | threitol | human metabolite |
aceglutamide | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N(2)-acetylglutamine; N(2)-acyl-L-glutamine | human metabolite |
aflatoxin b1 | [no description available] | low | 0 | 0 | aflatoxin; aromatic ether; aromatic ketone | carcinogenic agent; human metabolite |
isospaglumic acid | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-ethylhydracrylic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; hydroxy fatty acid; short-chain fatty acid | human metabolite |
2-methyl-3-oxovaleric acid | [no description available] | low | 0 | 0 | 3-oxo monocarboxylic acid | human metabolite |
monoacetylcadaverine | [no description available] | low | 0 | 0 | acetamides; N-substituted cadaverine; primary amino compound; secondary carboxamide | human metabolite |
beta-citrylglutamic acid | [no description available] | low | 0 | 0 | N-acyl-L-glutamic acid; tetracarboxylic acid | human metabolite; iron chelator |
maltotriose | [no description available] | low | 0 | 0 | maltotriose trisaccharide | human metabolite |
cholestane-3,7,12,26-tetrol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 26-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
beta-leucine | [no description available] | low | 0 | 0 | beta-amino acid | human metabolite |
2-methylbutyrylglycine | [no description available] | low | 0 | 0 | N-acylglycine | human metabolite |
neurotensin (1-8) | [no description available] | low | 0 | 0 | peptide zwitterion; peptide | human metabolite |
cholesteryl palmitate | [no description available] | low | 0 | 0 | cholesteryl ester | human metabolite; mouse metabolite |
5-hydroxyisourate | [no description available] | low | 0 | 0 | oxopurine | human metabolite; mouse metabolite |
5-formyluracil | [no description available] | low | 0 | 0 | aldehyde; nucleobase analogue; pyrimidone | human metabolite; mutagen |
taurochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid taurine conjugate | human metabolite; mouse metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
isomaltose | [no description available] | low | 0 | 0 | glycosylglucose | human metabolite; metabolite; mouse metabolite |
dopaquinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; amino acid zwitterion; L-phenylalanine derivative | human metabolite; mouse metabolite |
pantetheine | [no description available] | low | 0 | 0 | pantetheines; thiol | human metabolite; metabolite; mouse metabolite |
tryptophanamide | [no description available] | low | 0 | 0 | amino acid amide; tryptophan derivative | human metabolite |
5-diphosphomevalonic acid | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | human metabolite; mouse metabolite |
7-dehydrocholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; Delta(5),Delta(7)-sterol | human metabolite; mouse metabolite |
cysteinylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
desmosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C27-steroid; cholestanoid | human metabolite; mouse metabolite |
taurolithocholic acid | [no description available] | low | 0 | 0 | bile acid taurine conjugate; monocarboxylic acid amide | human metabolite |
n'-formylkynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-formylkynurenine; non-proteinogenic amino acid derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
fuculose 1-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | human metabolite |
nicotinamide-beta-riboside | [no description available] | low | 0 | 0 | N-glycosylnicotinamide; pyridine nucleoside | geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
trimethyllysine | [no description available] | low | 0 | 0 | alpha-amino-acid cation | human metabolite; mouse metabolite |
inositol 3,4-bisphosphate | [no description available] | low | 0 | 0 | myo-inositol bisphosphate | human metabolite; mouse metabolite |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
24,25-dihydrolanosterol | [no description available] | low | 0 | 0 | 3beta-sterol; tetracyclic triterpenoid | human metabolite; mouse metabolite |
2-hydroxyestrone | [no description available] | low | 0 | 0 | 2-hydroxy steroid; catechols | human metabolite |
2-methoxyestrone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-hydroxy steroid; alicyclic ketone; aromatic ether; phenolic steroid; phenols | human metabolite; mouse metabolite |
estradiol-3-glucuronide | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
acetyl adenylate | [no description available] | low | 0 | 0 | 5'-acylphosphoadenosin | human metabolite; mouse metabolite |
epiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; human metabolite |
4,4-dimethylcholesta-8,14,24-trienol | [no description available] | low | 0 | 0 | 3beta-sterol; Delta(14) steroid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
enkephalin, methionine | [no description available] | low | 0 | 0 | pentapeptide; peptide zwitterion | analgesic; antineoplastic agent; delta-opioid receptor agonist; human metabolite; mu-opioid receptor agonist |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-hydroxy-3-methylglutaryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxy-3-methylglutaryl-CoA; 3-hydroxy fatty acyl-CoA | human metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
docosahexaenoate | [no description available] | low | 0 | 0 | docosahexaenoic acid; omega-3 fatty acid | algal metabolite; antineoplastic agent; Daphnia tenebrosa metabolite; human metabolite; mouse metabolite; nutraceutical |
tetragastrin | [no description available] | low | 0 | 0 | peptidyl amide; tetrapeptide | anxiogenic; human metabolite |
prostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins D | human metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
enkephalin, leucine | [no description available] | low | 0 | 0 | pentapeptide; peptide zwitterion | analgesic; delta-opioid receptor agonist; human metabolite; mu-opioid receptor agonist; neurotransmitter; rat metabolite |
tyrosine o-sulfate | [no description available] | low | 0 | 0 | aryl sulfate; L-tyrosine derivative; O-sulfoamino acid | human metabolite |
squalene | [no description available] | low | 0 | 0 | triterpene | human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
thyrotropin-releasing hormone | [no description available] | low | 0 | 0 | peptide hormone; tripeptide | human metabolite |
n-methylproline | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-proline derivative; tertiary amino compound | human metabolite; plant metabolite |
citraconic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
flavin mononucleotide | [no description available] | low | 0 | 0 | flavin mononucleotide; vitamin B2 | bacterial metabolite; coenzyme; cofactor; human metabolite; mouse metabolite |
mannose 1-phosphate | [no description available] | low | 0 | 0 | mannose phosphate | fundamental metabolite; human metabolite |
cholesterol acetate | [no description available] | low | 0 | 0 | acetate ester; cholesteryl ester | human metabolite |
1,6-anhydro-beta-glucopyranose | [no description available] | low | 0 | 0 | anhydrohexose | Arabidopsis thaliana metabolite; biomarker; human metabolite |
glycylvaline | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
estrone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | human metabolite; mouse metabolite |
glycodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid glycine conjugate | human metabolite |
isobutyryl-coenzyme a | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-CoA; short-chain fatty acyl-CoA | human metabolite; mouse metabolite |
galactaric acid | [no description available] | low | 0 | 0 | hexaric acid | human metabolite |
dihydroxycoprostane | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
angiotensin i, ile(5)- | [no description available] | low | 0 | 0 | angiotensin; peptide zwitterion | human metabolite; neurotransmitter agent |
fructosyl-glycine | [no description available] | low | 0 | 0 | fructosamine; glycine derivative; glyco-amino acid | human metabolite |
arachidoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | human metabolite |
lignoceroyl-coenzyme a | [no description available] | low | 0 | 0 | very long-chain fatty acyl-CoA | human metabolite; Saccharomyces cerevisiae metabolite |
5-hydroxybenzimidazole | [no description available] | low | 0 | 0 | benzimidazoles; phenols | bacterial metabolite; human metabolite; rat metabolite |
n-carbamylglutamate | [no description available] | low | 0 | 0 | glutamic acid derivative; ureas | human metabolite |
citramalate | [no description available] | low | 0 | 0 | dicarboxylic acid dianion | human metabolite; plant metabolite |
4-cresol sulfate | [no description available] | low | 0 | 0 | aryl sulfate | gut flora metabolite; human metabolite; uremic toxin |
leukotriene a4 | [no description available] | low | 0 | 0 | epoxy fatty acid; leukotriene; long-chain fatty acid; oxylipin; polyunsaturated fatty acid | human metabolite; mouse metabolite; plant metabolite |
psychosine | [no description available] | low | 0 | 0 | glycosylsphingoid | human metabolite |
ubiquinone 9 | [no description available] | low | 0 | 0 | ubiquinones | antioxidant; human metabolite |
11-cis-retinal | [no description available] | low | 0 | 0 | retinal | chromophore; human metabolite; mouse metabolite |
leukotriene c4 | [no description available] | low | 0 | 0 | leukotriene | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin f2beta | [no description available] | low | 0 | 0 | prostaglandins Fbeta | human metabolite |
8,11,14-eicosatrienoic acid | [no description available] | low | 0 | 0 | fatty acid 20:3; long-chain fatty acid | fungal metabolite; human metabolite; nutraceutical |
15-keto-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,11Z,13E)-15-HETE | human metabolite; mouse metabolite |
5-hydroxy-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE | human metabolite; mouse metabolite |
leukotriene d4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin a2 | [no description available] | low | 0 | 0 | prostaglandins A | human metabolite |
prostaglandin b2 | [no description available] | low | 0 | 0 | prostaglandins B | human metabolite |
prostaglandin g2 | [no description available] | low | 0 | 0 | prostaglandins G | human metabolite; mouse metabolite |
9-deoxy-delta-9-prostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins J | human metabolite |
11-dehydro-thromboxane b2 | [no description available] | low | 0 | 0 | thromboxane | human metabolite |
lipoxin a4 | [no description available] | low | 0 | 0 | hydroxy polyunsaturated fatty acid; lipoxin; long-chain fatty acid | human metabolite; metabolite |
gamma-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-6 fatty acid | human metabolite; mouse metabolite; plant metabolite |
prostaglandin e3 | [no description available] | low | 0 | 0 | prostaglandins E | human metabolite |
leukotriene f-4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | human metabolite |
previtamin d(3) | [no description available] | low | 0 | 0 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol | human metabolite |
brassicasterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | algal metabolite; animal metabolite; biomarker; EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor; human metabolite; marine metabolite; plant metabolite; sterol biosynthesis inhibitor |
retinoyl beta-glucuronide | [no description available] | low | 0 | 0 | glucuronic acids; retinoid | human metabolite |
coenzyme q10 | [no description available] | low | 0 | 0 | ubiquinones | antioxidant; ferroptosis inhibitor; human metabolite |
prostaglandin d3 | [no description available] | low | 0 | 0 | prostaglandins D | human metabolite |
tocotrienol, alpha | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | ferroptosis inhibitor; human metabolite; neuroprotective agent; plant metabolite |
phthioic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; fatty acid 26:0; methyl-branched fatty acid; very long-chain fatty acid | Aspergillus metabolite; human metabolite |
2-decenoic acid | [no description available] | low | 0 | 0 | 2-decenoic acid | human metabolite |
9,11-linoleic acid | [no description available] | low | 0 | 0 | octadeca-9,11-dienoic acid | anti-inflammatory agent; antiatherogenic agent; antineoplastic agent; apoptosis inducer; bacterial xenobiotic metabolite; human metabolite |
9-hydroxy-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | HODE; octadecadienoic acid | human metabolite; metabolite; mouse metabolite; plant metabolite |
17-phenyltrinorprostaglandin e2 | [no description available] | low | 0 | 0 | alicyclic ketone; beta-hydroxy ketone; hydroxy monocarboxylic acid; olefinic compound; oxo monocarboxylic acid; prostanoid; secondary alcohol | human metabolite; prostaglandin receptor agonist |
thromboxane b2 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
thromboxane b3 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
12-hydroxy-5,8,10,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,10E,14Z)-12-hydroxyicosatetraenoic acid; HETE | human metabolite; pro-angiogenic agent |
20-hydroxy-5,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE; hydroxy monocarboxylic acid | human metabolite; mouse metabolite |
5-oxo-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite; immunomodulator; mouse metabolite |
8-isoprostaglandin e2 | [no description available] | low | 0 | 0 | cyclic ketone; diol; prostanoid; secondary alcohol | bronchoconstrictor agent; human metabolite; rat metabolite; vasoconstrictor agent |
oleylamide | [no description available] | low | 0 | 0 | primary fatty amide | human metabolite; plant metabolite |
monolinolein | [no description available] | low | 0 | 0 | 1-acylglycerol 18:2; rac-1-monoacylglycerol | antiviral agent; human metabolite; plant metabolite |
1,25-dihydroxy-24-oxo-vitamin d3 | [no description available] | medium | 0 | 0 | hydroxycalciol; oxocalciol; tertiary alpha-hydroxy ketone | human metabolite |
calcifediol | [no description available] | low | 0 | 0 | D3 vitamins; diol; hydroxycalciol | bone density conservation agent; human metabolite; metabolite; mouse metabolite; nutraceutical |
hyodeoxycholic acid | [no description available] | low | 0 | 0 | 5beta-cholanic acids; 6alpha,20xi-murideoxycholic acid; bile acid; C24-steroid | human metabolite; mouse metabolite |
cerium | [no description available] | low | 0 | 0 | CE(18:2); cholesteryl octadeca-9,12-dienoate | human metabolite; mouse metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1-butyl oleate | [no description available] | low | 0 | 0 | fatty acid ester | human metabolite |
8-hydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; heteroaryl hydroxy compound; nucleobase analogue; oxopurine | bacterial metabolite; human metabolite |
erucyl amide | [no description available] | low | 0 | 0 | 13-docosenamide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite; mammalian metabolite; plant metabolite; rat metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
2,3-oxidosqualene | [no description available] | low | 0 | 0 | 2,3-epoxysqualene | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-keto-4-hydroxyglutarate | [no description available] | low | 0 | 0 | oxo dicarboxylate | human metabolite; Saccharomyces cerevisiae metabolite |
deoxyribose | [no description available] | low | 0 | 0 | deoxypentose | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
iditol | [no description available] | low | 0 | 0 | iditol | fungal metabolite; human metabolite |
glutamate | [no description available] | low | 0 | 0 | glutamate(1-); polar amino acid zwitterion | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor; human metabolite; Saccharomyces cerevisiae metabolite |
cerotate | [no description available] | low | 0 | 0 | fatty acid anion 26:0; omega-methyl fatty acid anion; very long-chain fatty acid anion | human metabolite; Saccharomyces cerevisiae metabolite |
adenosine triphosphate | [no description available] | low | 0 | 0 | nucleoside 5'-triphoshate(4-) | cofactor; fundamental metabolite; human metabolite |
docosapentaenoic acid | [no description available] | low | 0 | 0 | docosapentaenoic acid; omega-3 fatty acid | algal metabolite; human metabolite |
3-methylbutyrylcarnitine | [no description available] | low | 0 | 0 | C5-acylcarnitine | human metabolite |
hexanoylcarnitine | [no description available] | low | 0 | 0 | hexanoate ester; O-acylcarnitine | human metabolite |
linoleamide | [no description available] | low | 0 | 0 | primary fatty amide | human metabolite |
13-cis-retinal | [no description available] | low | 0 | 0 | retinal | human metabolite |
4-hydroxyretinoic acid | [no description available] | low | 0 | 0 | retinoid; secondary allylic alcohol | human metabolite |
4-oxo-2-nonenal | [no description available] | low | 0 | 0 | enal; enone | human metabolite |
20,22-dihydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 22-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; oxysterol | human metabolite; mouse metabolite |
biotinate | [no description available] | low | 0 | 0 | monocarboxylic acid anion; vitamin B7 | cofactor; human metabolite; Saccharomyces cerevisiae metabolite |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
gamma-glutamylvaline | [no description available] | low | 0 | 0 | glutamyl-L-amino acid | human metabolite |
ophthalmic acid | [no description available] | low | 0 | 0 | L-glutamine derivative | biomarker; human metabolite |
acetylcarnitine | [no description available] | low | 0 | 0 | O-acetylcarnitine; saturated fatty acyl-L-carnitine | human metabolite; Saccharomyces cerevisiae metabolite |
adenosine diphosphate | [no description available] | low | 0 | 0 | nucleoside 5'-diphosphate(3-) | fundamental metabolite; human metabolite |
cyclic amp | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
1,23,25-trihydroxyvitamin d3 | [no description available] | low | 0 | 0 | D3 vitamins; hydroxy seco-steroid; hydroxycalciol; tetrol | human metabolite |
ursodoxicoltaurine | [no description available] | low | 0 | 0 | bile acid taurine conjugate | anti-inflammatory agent; apoptosis inhibitor; bone density conservation agent; cardioprotective agent; human metabolite; neuroprotective agent |
arachidonoylserotonin | [no description available] | low | 0 | 0 | N-acylserotonin; phenols | anti-inflammatory agent; anticonvulsant; antioxidant; capsaicin receptor antagonist; EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor; human metabolite; signalling molecule |
homocarnosine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; homocarnosine; L-histidine derivative; N-acyl-L-alpha-amino acid anion; N-acyl-L-alpha-amino acid | human metabolite |
3-hydroxyproline | [no description available] | low | 0 | 0 | 3-hydroxyproline; amino acid zwitterion; D-proline derivative | bacterial metabolite; human metabolite |
octanoylcarnitine | [no description available] | low | 0 | 0 | O-octanoylcarnitine; saturated fatty acyl-L-carnitine | human metabolite |
palmitoylcarnitine | [no description available] | low | 0 | 0 | O-palmitoylcarnitine; saturated fatty acyl-L-carnitine | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; human metabolite; mouse metabolite |
cyclic 3',5'-thymidine monophosphate | [no description available] | low | 0 | 0 | 3',5'-cyclic pyrimidine nucleotide | human metabolite |
pristanal | [no description available] | low | 0 | 0 | 2-methyl-branched fatty aldehyde; saturated fatty aldehyde | human metabolite |
lanosten-3-ol-32-al | [no description available] | low | 0 | 0 | 14alpha-formyl steroid; 3beta-sterol; tetracyclic triterpenoid | human metabolite |
thiamine pyrophosphate | [no description available] | low | 0 | 0 | organophosphate oxoanion; vitamin B1 | human metabolite; Saccharomyces cerevisiae metabolite |
adenosine monophosphate | [no description available] | low | 0 | 0 | nucleoside 5'-monophosphate(2-) | cofactor; fundamental metabolite; human metabolite |
cob(ii)alamin | [no description available] | low | 0 | 0 | cobalamin | cofactor; human metabolite |
nociceptin | [no description available] | low | 0 | 0 | organic molecular entity; polypeptide | human metabolite; rat metabolite |
3-hydroxy-3-methyl-hexanoic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; volatile organic compound | human metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | nucleoside 5'-diphosphate(3-) | human metabolite; Saccharomyces cerevisiae metabolite |
n-acetylgalactosamine-1-phosphate | [no description available] | low | 0 | 0 | D-galactosamine 1-phosphate | human metabolite |
1-phospho-5-s-methylthioribulose | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
10-nitro-oleic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; monounsaturated fatty acid; nitro fatty acid | human metabolite |
ticrynafen | [no description available] | low | 0 | 0 | monocarboxylic acid anion; organophosphate oxoanion | human metabolite |
s-(1,2-dicarboxyethyl)cysteine | [no description available] | low | 0 | 0 | L-cysteine thioether; tricarboxylic acid | human metabolite; Maillard reaction product |
neurotensin | [no description available] | low | 0 | 0 | peptide hormone | human metabolite; mitogen; neurotransmitter; vulnerary |
apelin-13 peptide | [no description available] | low | 0 | 0 | oligopeptide | antihypertensive agent; autophagy inhibitor; biomarker; human metabolite; neuroprotective agent |
p-Glu-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-Phe | [no description available] | low | 0 | 0 | polypeptide | apoptosis inhibitor; human metabolite; neuroprotective agent |
taurolithocholic acid 3-sulfate | [no description available] | low | 0 | 0 | steroid sulfate oxoanion | human metabolite |
inositol 1,3,4-trisphosphate | [no description available] | low | 0 | 0 | inositol phosphate oxoanion | human metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
2-ketoarginine | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
adenosine diphosphate glucose | [no description available] | low | 0 | 0 | NDP-alpha-D-glucose(2-); ribonucleoside 5'-diphosphate-alpha-D-glucose(2-) | human metabolite |
nicotinate mononucleotide | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
oleoylcarnitine | [no description available] | low | 0 | 0 | monounsaturated fatty acyl-L-carnitine | glycine transporter 2 inhibitor; human metabolite |
uridine diphosphate n-acetylgalactosamine | [no description available] | low | 0 | 0 | nucleotide-sugar oxoanion | human metabolite |
6-phosphogluconolactone | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
3-hydroxyisovalerylcarnitine | [no description available] | low | 0 | 0 | O-acylcarnitine | human metabolite |
angiotensin i | [no description available] | low | 0 | 0 | angiotensin; peptide zwitterion | antihypertensive agent; cardioprotective agent; human metabolite; rat metabolite |
9-PAHSA | [no description available] | low | 0 | 0 | FAHFA; long-chain fatty acid | anti-inflammatory agent; human metabolite; hypoglycemic agent |
lugdunin | [no description available] | low | 0 | 0 | homodetic cyclic peptide; indoles; macrocycle; peptide antibiotic; thiazolidines | human metabolite; rat metabolite |
deoxyguanosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
sapropterin | [no description available] | low | 0 | 0 | 5,6,7,8-tetrahydrobiopterin | coenzyme; cofactor; diagnostic agent; human metabolite |
dyspropterin | [no description available] | low | 0 | 0 | biopterins; tetrahydropterin | human metabolite; metabolite; mouse metabolite |
8-nitroguanosine 3',5'-cyclic monophosphate | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide; C-nitro compound | biomarker; Brassica napus metabolite; human metabolite; signalling molecule |
n(2),n(2)-dimethylguanosine | [no description available] | low | 0 | 0 | methylguanosine | human metabolite |
creatinine | [no description available] | low | 0 | 0 | imidazolidinone; lactam | diagnostic agent; human metabolite |
apelin-12 peptide | [no description available] | low | 0 | 0 | oligopeptide | biomarker; human blood serum metabolite; human metabolite; neuroprotective agent |
alpha-hydroxyglutarate | [no description available] | low | 0 | 0 | 2-hydroxydicarboxylic acid; dicarboxylic fatty acid | metabolite; mouse metabolite |
alpha-ketoadipic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | human urinary metabolite; mouse metabolite |
n-carbamoyl-beta-alanine | [no description available] | low | 0 | 0 | beta-alanine derivative | metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
allantoic acid | [no description available] | low | 0 | 0 | ureas | mouse metabolite; plant metabolite |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
hydrobromic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
1,2-dihydroxy-1,2-dihydronaphthalene | [no description available] | low | 0 | 0 | dihydronaphthalenes; naphthalenediols | bacterial xenobiotic metabolite; mouse metabolite |
4-nitrophenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
n(1)-methylnicotinamide | [no description available] | low | 0 | 0 | pyridinium ion | algal metabolite; anti-inflammatory agent; human urinary metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
phosphonoacetaldehyde | [no description available] | low | 0 | 0 | phosphonic acids | mouse metabolite |
gamma-guanidinobutyric acid | [no description available] | low | 0 | 0 | guanidines; monocarboxylic acid; zwitterion | fungal metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
diethyl phosphate | [no description available] | low | 0 | 0 | dialkyl phosphate | human xenobiotic metabolite; mouse metabolite |
o,o-diethyl phosphorothionate | [no description available] | low | 0 | 0 | organic thiophosphate | human xenobiotic metabolite; mouse metabolite |
carbonic acid | [no description available] | low | 0 | 0 | carbon oxoacid; chalcocarbonic acid | mouse metabolite |
hydantoin-5-propionic acid | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; monocarboxylic acid | metabolite; mouse metabolite |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
lactaldehyde | [no description available] | low | 0 | 0 | hydroxyaldehyde; propanals | mouse metabolite |
phenanthrene | [no description available] | low | 0 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon; phenanthrenes | environmental contaminant; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
adrenic acid | [no description available] | low | 0 | 0 | docosatetraenoic acid | mouse metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
uridine triphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine triphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
1-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
2-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
ethylene oxide | [no description available] | low | 0 | 0 | gas molecular entity; oxacycle; saturated organic heteromonocyclic parent | allergen; mouse metabolite; mutagen |
vinylidene chloride | [no description available] | low | 0 | 0 | chloroethenes | carcinogenic agent; mouse metabolite; mutagen |
trichloroacetaldehyde | [no description available] | low | 0 | 0 | aldehyde; organochlorine compound | mouse metabolite |
gibberellic acid | [no description available] | low | 0 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone; organic heteropentacyclic compound | mouse metabolite; plant metabolite |
pyridoxic acid | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | human urinary metabolite; mouse metabolite |
1-nitronaphthalene | [no description available] | low | 0 | 0 | mononitronaphthalene | environmental contaminant; mouse metabolite |
beta-glucono-1,5-lactone | [no description available] | low | 0 | 0 | aldono-1,5-lactone; gluconolactone | animal metabolite; mouse metabolite |
2-naphthoic acid | [no description available] | low | 0 | 0 | naphthoic acid | mouse metabolite; xenobiotic metabolite |
methylphenyl carbinol | [no description available] | low | 0 | 0 | aromatic alcohol | mouse metabolite |
2-phenylacetamide | [no description available] | low | 0 | 0 | monocarboxylic acid amide | mouse metabolite |
ethylene dibromide | [no description available] | low | 0 | 0 | bromoalkane; bromohydrocarbon | algal metabolite; carcinogenic agent; fumigant; marine metabolite; mouse metabolite; mutagen |
2,2,2-trichloroethanol | [no description available] | low | 0 | 0 | chloroethanol | mouse metabolite |
D-proline | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; proline | mouse metabolite |
paraoxon | [no description available] | low | 0 | 0 | aryl dialkyl phosphate; organophosphate insecticide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; mouse metabolite |
methyl-4-tyramine | [no description available] | low | 0 | 0 | tyramines | mouse metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
fructose-1,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 1,6-bisphosphate | mouse metabolite |
hydroxyhydroquinone | [no description available] | low | 0 | 0 | benzenetriol | mouse metabolite |
1,2-dihydroxynaphthalene | [no description available] | low | 0 | 0 | naphthalenediol | mouse metabolite |
propiolaldehyde | [no description available] | low | 0 | 0 | terminal acetylenic compound; ynal | mouse metabolite |
phenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
n-cyclohexylformamide | [no description available] | low | 0 | 0 | alicyclic compound; formamides | mouse metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
dihydroferulic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid; phenylpropanoid | antioxidant; human xenobiotic metabolite; mouse metabolite; plant metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate galactose | [no description available] | low | 0 | 0 | UDP-D-galactose | mouse metabolite |
1-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
hydroiodic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
trichloroepoxyethane | [no description available] | low | 0 | 0 | epoxide | mouse metabolite |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cyromazine | [no description available] | low | 0 | 0 | triamino-1,3,5-triazine | mouse metabolite; triazine insecticide |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
obtusifoliol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol | mouse metabolite; plant metabolite |
glutathione disulfide | [no description available] | low | 0 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
7-methylxanthine | [no description available] | low | 0 | 0 | oxopurine; purine alkaloid | human xenobiotic metabolite; mouse metabolite; plant metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
n'-methyl-2-pyridone-5-carboxamide | [no description available] | low | 0 | 0 | methylpyridines; pyridinecarboxamide; pyridone | metabolite; mouse metabolite |
1-methyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
cyclopropylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | mouse metabolite |
6-hydroxynicotinic acid | [no description available] | low | 0 | 0 | monohydroxypyridine | Arabidopsis thaliana metabolite; human urinary metabolite; mouse metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
2-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite; xenobiotic metabolite |
xanthurenic acid 8-methyl ether | [no description available] | low | 0 | 0 | aromatic ether; monohydroxyquinoline; quinolinemonocarboxylic acid | carcinogenic agent; metabolite; mouse metabolite |
glucose | [no description available] | low | 0 | 0 | D-glucopyranose | mouse metabolite |
1,3,7-trimethylurate | [no description available] | low | 0 | 0 | oxopurine | human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; mouse metabolite |
1-methylxanthine | [no description available] | low | 0 | 0 | 1-methylxanthine | mouse metabolite |
3,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | metabolite; mouse metabolite |
biocytin | [no description available] | low | 0 | 0 | azabicycloalkane; L-alpha-amino acid zwitterion; L-lysine derivative; monocarboxylic acid amide; non-proteinogenic L-alpha-amino acid; thiabicycloalkane; ureas | mouse metabolite |
d-aspartic acid | [no description available] | low | 0 | 0 | aspartic acid; D-alpha-amino acid | mouse metabolite |
3,4-dihydroxyphenylglycol | [no description available] | low | 0 | 0 | catechols; tetrol | metabolite; mouse metabolite |
1,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
24-methylenecholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol | mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
2,8-dihydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; diol; heteroaryl hydroxy compound; oxopurine | human urinary metabolite; mammalian metabolite; mouse metabolite; nephrotoxic agent |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
imidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | metabolite; mouse metabolite |
1-hydroxyphenanthrene | [no description available] | low | 0 | 0 | phenanthrol | mouse metabolite |
2,5-dihydroxypyridine | [no description available] | low | 0 | 0 | dihydroxypyridine | mouse metabolite |
cerium | [no description available] | low | 0 | 0 | cholesteryl ester | mouse metabolite |
6,6-dimethyl-2-methylenebicyclo(3.1.1)heptan-3-ol | [no description available] | low | 0 | 0 | carbobicyclic compound; pinane monoterpenoid; secondary alcohol | GABA modulator; mouse metabolite; plant metabolite; volatile oil component |
ecgonine methyl ester | [no description available] | low | 0 | 0 | methyl ester; tertiary amino compound; tropane alkaloid | analgesic; central nervous system depressant; metabolite; mouse metabolite; opioid analgesic; peripheral nervous system drug |
2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | low | 0 | 0 | hydroxylamine; imidazopyridine | carcinogenic agent; genotoxin; human xenobiotic metabolite; mouse metabolite; mutagen; neurotoxin; rat metabolite |
cholest-5-en-3 beta,7 alpha-diol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid; oxysterol | mouse metabolite |
s-chloromethylglutathione | [no description available] | low | 0 | 0 | organochlorine compound; S-substituted glutathione | alkylating agent; bacterial xenobiotic metabolite; mouse metabolite |
5-acetylamino-6-formylamino-3-methyluracil | [no description available] | low | 0 | 0 | formamidopyrimidine | mouse metabolite |
5,6-dihydroxyindole | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
5,6-dihydroxy-2-indolylcarboxylic acid | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
inositol-3,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
24-hydroxycholesterol | [no description available] | low | 0 | 0 | 24-hydroxycholesterol | biomarker; human blood serum metabolite; mouse metabolite |
phytosphingosine | [no description available] | low | 0 | 0 | amino alcohol; sphingoid; triol | mouse metabolite; Saccharomyces cerevisiae metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
n-acetylputrescine | [no description available] | low | 0 | 0 | N-monoacetylalkane-alpha,omega-diamine; N-substituted putrescine | metabolite; mouse metabolite |
cdp ethanolamine | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphoethanolamine | mouse metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 30:0; tetradecanoate ester | mouse metabolite |
d-glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; D-alpha-amino acid; glutamine | mouse metabolite |
diquafosol | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-tetraphosphate; uridine 5'-phosphate | mouse metabolite; P2Y2 receptor agonist |
19-hydroxytestosterone | [no description available] | medium | 0 | 0 | 17beta-hydroxy steroid; 19-hydroxy steroid; 3-oxo-Delta(4) steroid | mouse metabolite |
2-hydroxy-1,4-benzoquinone | [no description available] | low | 0 | 0 | monohydroxy-1,4-benzoquinones | mouse metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
hydromethylthionine | [no description available] | low | 0 | 0 | aromatic amine; phenothiazines; tertiary amino compound | bacterial xenobiotic metabolite; fluorochrome; mouse metabolite; rat metabolite |
5-hydroxykynuramine | [no description available] | low | 0 | 0 | hydroxykynurenamine; primary amino compound | mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
diadenosine triphosphate | [no description available] | low | 0 | 0 | diadenosyl triphosphate | mouse metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
isovaleryl-coenzyme a | [no description available] | low | 0 | 0 | methylbutanoyl-CoA; short-chain fatty acyl-CoA | mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
campesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C28-steroid; phytosterols | mouse metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
sitosterol, (3beta)-isomer | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C29-steroid; phytosterols; stigmastane sterol | anticholesteremic drug; antioxidant; mouse metabolite; plant metabolite; sterol methyltransferase inhibitor |
androstane-3,17-dione, (5alpha)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5alpha-steroid; androstane-3,17-dione | mouse metabolite |
21-hydroxypregnenolone | [no description available] | medium | 0 | 0 | 21-hydroxy steroid; hydroxypregnenolone; primary alpha-hydroxy ketone | mouse metabolite |
epietiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; animal metabolite; human blood serum metabolite; mouse metabolite; rat metabolite |
glyceraldehyde 3-phosphate | [no description available] | low | 0 | 0 | glyceraldehyde 3-phosphate | mouse metabolite |
ribulose 5-phosphate | [no description available] | low | 0 | 0 | ribulose 5-phosphate | mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
arabinose | [no description available] | low | 0 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | epitope; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | mouse metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
inositol 1,4,5-trisphosphate | [no description available] | low | 0 | 0 | myo-inositol trisphosphate | mouse metabolite |
stachyose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; tetrasaccharide | mouse metabolite; plant metabolite |
ketodihydrosphingosine | [no description available] | low | 0 | 0 | 2-amino-1-hydroxyoctadecan-3-one | mouse metabolite |
androstane-3,17-dione, (5beta)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5beta-steroid; androstane-3,17-dione | mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
beta-sulfopyruvic acid | [no description available] | low | 0 | 0 | carboxyalkanesulfonic acid | mouse metabolite |
2-hydroxypropylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; secondary alcohol | mouse metabolite |
inositol-1,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
prostaglandin h2 | [no description available] | low | 0 | 0 | olefinic compound; oxylipin; prostaglandins H; secondary alcohol | mouse metabolite |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
eicosapentaenoic acid | [no description available] | low | 0 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
geranylgeranyl pyrophosphate | [no description available] | low | 0 | 0 | geranylgeranyl diphosphate | mouse metabolite |
cytidine monophosphate n-acetylneuraminic acid | [no description available] | low | 0 | 0 | CMP-N-acyl-beta-neuraminic acid | mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
colfosceril palmitate | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:0 | mouse metabolite; surfactant |
lyso-pc | [no description available] | low | 0 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine; lysophosphatidylcholine 16:0 | mouse metabolite |
3-hydroxybutyryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxyacyl-CoA; hydroxybutanoyl-CoA | mouse metabolite |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
dihydrosphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite |
coniferyl alcohol | [no description available] | low | 0 | 0 | guaiacols; phenylpropanoid | animal metabolite; monolignol; mouse metabolite; pheromone; plant metabolite; volatile oil component |
raphanusamic acid | [no description available] | low | 0 | 0 | thiazolidinemonocarboxylic acid | Arabidopsis thaliana metabolite; mouse metabolite; xenobiotic metabolite |
glutaryl-coenzyme a | [no description available] | low | 0 | 0 | glutaryl-CoAs | mouse metabolite |
arachidonic acid 5-hydroperoxide | [no description available] | low | 0 | 0 | 5-HPETE | mouse metabolite |
arachidonic acid omega-9 hydroperoxide | [no description available] | low | 0 | 0 | HPETE | mouse metabolite |
15-hydroperoxy-5,8,11,13-eicosatetraenoic acid, (s)-(e,z,z,z)-isomer | [no description available] | low | 0 | 0 | 15-HPETE | mouse metabolite |
alpha-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-3 fatty acid | micronutrient; mouse metabolite; nutraceutical |
1-palmitoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-palmitoyl-2-oleoylglycerol | mouse metabolite |
11,12-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET | mouse metabolite |
14,15-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET; diol; secondary allylic alcohol | mouse metabolite |
5,6-epoxy-8,11,14-eicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
8,9-epoxyeicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
1-palmitoyl-2-oleoylphosphatidylethanolamine, (z & r)-isomer | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphoethanolamine; phosphatidylethanolamine 34:1 zwitterion; phosphatidylethanolamine | mouse metabolite |
sphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
cholesteryl oleate | [no description available] | low | 0 | 0 | CE(18:1); cholesteryl octadec-9-enoate | mouse metabolite |
stearidonic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; octadecatetraenoic acid; omega-3 fatty acid | Daphnia galeata metabolite; mouse metabolite; plant metabolite |
trilinolein | [no description available] | low | 0 | 0 | 1,2-diacyl-3-linoleoylglycerol; 1,3-diacyl-2-linoleoylglycerol; linoleoyl containing 1,2,3-triacyl-sn-glycerol; TG(18:2/18:2/18:2); triglyceride | mouse metabolite |
dimyristoylphosphatidylcholine | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine; phosphatidylcholine 28:0; tetradecanoate ester | antigen; mouse metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
vitamin a2 | [no description available] | low | 0 | 0 | retinoid; vitamin A | human xenobiotic metabolite; marine xenobiotic metabolite; mouse metabolite |
1,2-dioleoylphosphatidylserine | [no description available] | low | 0 | 0 | phosphatidylserine(18:1/18:1) | mouse metabolite |
5-hydroxy-6,8,11,14,17-eicosapentaenoic acid | [no description available] | low | 0 | 0 | HEPE | mouse metabolite |
1-stearoyl-2-linoleoylphosphatidylcholine | [no description available] | low | 0 | 0 | phosphatidylcholine 36:2 | mouse metabolite |
1-stearoyl-2-linoleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; diacylglycerol 36:2 | mouse metabolite |
1-palmitoyl-2-docosahexaenoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | phosphatidylcholine 38:6 | mouse metabolite |
13(S)-HODE | [no description available] | low | 0 | 0 | HODE | antineoplastic agent; human xenobiotic metabolite; mouse metabolite |
1-stearoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-stearoyl-2-oleoylglycerol; diacylglycerol 36:1 | mouse metabolite |
1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-palmitoleoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:1 | mouse metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid | metabolite; mouse metabolite |
n-stearoylsphingomyelin | [no description available] | low | 0 | 0 | sphingomyelin 36:1; sphingomyelin d18:1 | mouse metabolite |
cholesteryl arachidonate | [no description available] | low | 0 | 0 | cholesteryl icosatetraenoate | antibacterial agent; mouse metabolite |
acryloyl-coenzyme a | [no description available] | low | 0 | 0 | 2-enoyl-CoA; monounsaturated fatty acyl-CoA | mouse metabolite |
samarium | [no description available] | low | 0 | 0 | sphingomyelin d18:1/16:0 | mouse metabolite |
n-palmitoylgalactosylsphingosine | [no description available] | low | 0 | 0 | HexCer(d18:1/16:0); N-acyl-beta-D-galactosylsphingosine | mouse metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
prosomatostatin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone | fungal metabolite; mouse metabolite; rat metabolite |
phosphatidylcholines | [no description available] | low | 0 | 0 | phosphatidylcholine 40:6 | mouse metabolite |
cyclosporine | [no description available] | low | 0 | 0 | keto-disaccharide | mouse metabolite |
g(m3) ganglioside | [no description available] | low | 0 | 0 | alpha-N-acetylneuraminyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-ceramide; sialodiosylceramide; sialotriaosylceramide | mouse metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine monophosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
guanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
diflorasone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
hydrocortamate | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 3-oxo-Delta(4) steroid; glucocorticoid; glycinyl ester; tertiary alpha-hydroxy ketone | anti-inflammatory drug; immunosuppressive agent |
sch 22219 | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; glucocorticoid; propanoate ester; steroid ester | anti-inflammatory drug |
clocortolone pivalate | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; fluorinated steroid; glucocorticoid; pivalate ester | anti-inflammatory drug; antipruritic drug |
clobetasol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; fluorinated steroid; glucocorticoid; tertiary alpha-hydroxy ketone | anti-inflammatory drug; SMO receptor agonist |
megestrol | [no description available] | low | 0 | 0 | 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; tertiary alpha-hydroxy ketone | antineoplastic agent; appetite enhancer; contraceptive drug; progestin; synthetic oral contraceptive |
alfatradiol | [no description available] | low | 0 | 0 | 17alpha-hydroxy steroid; 3-hydroxy steroid; estradiol | estrogen; geroprotector |
betamethasone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
11,17-dihydroxy-17-(2-hydroxy-1-oxoethyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
dexamethasone 17-valerate | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
flunisolide | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic ketal; fluorinated steroid; primary alpha-hydroxy ketone | anti-asthmatic drug; anti-inflammatory drug; immunosuppressive agent |
cyasterone | [no description available] | low | 0 | 0 | 14alpha-hydroxy steroid; 20-hydroxy steroid; 21-hydroxy steroid; 2beta-hydroxy steroid; 3beta-hydroxy steroid; 6-oxo steroid; phytoecdysteroid; steroid lactone | |
19-noraldosterone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
19-hydroxydeoxycorticosterone | [no description available] | low | 0 | 0 | 19-hydroxydeoxycorticosterone; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid | |
19-oxo-deoxycorticosterone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
cortodoxone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
betamethasone benzoate | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
cloprednol | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
meprednisone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
MLS001332652 | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
anecortave | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
halometasone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
diflucortolone | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
flucloronide | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
prednylidene | [no description available] | low | 0 | 0 | 21-hydroxy steroid | |
cucurbitacins | [no description available] | low | 0 | 0 | 11-oxo steroid | |
4alpha-methylergosta-8,24(28)-dien-3,7,11-trione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 3-oxo steroid; 7-oxo steroid; ergostanoid; monocarboxylic acid; steroid acid | anti-inflammatory agent; antineoplastic agent; plant metabolite |
3alpha,12alpha-dihydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7-oxo steroid; monocarboxylic acid; secondary alpha-hydroxy ketone; steroid acid | antineoplastic agent; metabolite |
3alpha-hydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 3alpha-hydroxy steroid; 7-oxo steroid; monocarboxylic acid; steroid acid | antineoplastic agent; cholinergic antagonist; metabolite; serotonergic antagonist |
trimegestone | [no description available] | low | 0 | 0 | 20-oxo steroid | |
16-dehydropregnenolone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; enone | |
demegestone | [no description available] | low | 0 | 0 | 20-oxo steroid | |
16-dehydroprogesterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; enone | |
osaterone acetate | [no description available] | low | 0 | 0 | 20-oxo steroid | |
ulipristal acetate | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; steroid ester; tertiary amino compound | contraceptive drug; progesterone receptor modulator; progestin |
1-dehydroprogesterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid | |
progesterone 11-hemisuccinate, (11alpha)-isomer | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; dicarboxylic acid monoester; hemisuccinate; steroid ester | |
rimexolone | [no description available] | low | 0 | 0 | 20-oxo steroid | |
ulipristal | [no description available] | low | 0 | 0 | 20-oxo steroid | |
20 beta-dihydroprogesterone | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid | |
norethindrone acetate | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; acetate ester; terminal acetylenic compound | progestin; synthetic oral contraceptive |
6-dehydrotestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; enone | |
dienogest | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; aliphatic nitrile; steroid hormone | progesterone receptor agonist; progestin; synthetic oral contraceptive |
drospirenone | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; steroid lactone | aldosterone antagonist; contraceptive drug; progestin |
11-hydroxytestosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid; C19-steroid | bacterial xenobiotic metabolite; human xenobiotic metabolite; marine metabolite |
testosterone-17-sulfate | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; androstanoid; steroid sulfate | human urinary metabolite |
testololactone | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; seco-androstane; steroid lactone | |
15-hydroxytestosterone | [no description available] | low | 0 | 0 | 15alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite |
mibolerone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid | anabolic agent; androgen |
eplerenone | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; epoxy steroid; gamma-lactone; methyl ester; organic heteropentacyclic compound; oxaspiro compound; steroid acid ester | aldosterone antagonist; antihypertensive agent |
4,6-cholestadien-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; cholestanoid | |
ergosta-4,6,8(14),22-tetraen-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; ergostanoid | fungal metabolite |
9-hydroxy-4-androstene-3,17-dione | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; 9-hydroxy steroid | |
delta4-dafachronic acid | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; C27-steroid; dafachronic acids | |
5-dihydrocortisone | [no description available] | low | 0 | 0 | 3-oxo-5beta-steroid; 4,5-dihydrocortisone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
methoxy-morpholinyl-doxorubicin | [no description available] | low | 0 | 0 | anthracycline antibiotic; morpholines; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
4'-deoxy-4'-iododoxorubicin | [no description available] | low | 0 | 0 | organoiodine compound; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
erythrulose | [no description available] | low | 0 | 0 | ketotetrose; primary alpha-hydroxy ketone; secondary alpha-hydroxy ketone | |
phorbol 12,13-dibutyrate | [no description available] | low | 0 | 0 | butyrate ester; phorbol ester; tertiary alpha-hydroxy ketone | |
tetracenomycin c | [no description available] | low | 0 | 0 | methyl ester; tertiary alpha-hydroxy ketone; tetracenomycin | |
terreic acid | [no description available] | low | 0 | 0 | arene epoxide; diketone; monohydroxy-1,4-benzoquinones; tertiary alpha-hydroxy ketone | antibacterial agent; antineoplastic agent; Aspergillus metabolite; EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; mycotoxin |
sapintoxin d | [no description available] | low | 0 | 0 | phorbol ester; tertiary alpha-hydroxy ketone | fluorescent probe; metabolite |
tabtoxinine beta-lactam | [no description available] | low | 0 | 0 | beta-lactam antibiotic; monobactam; non-proteinogenic L-alpha-amino acid; tertiary alpha-hydroxy ketone | apoptosis inducer; bacterial metabolite; EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor |
daphnetoxin | [no description available] | low | 0 | 0 | diterpene alkaloid; epoxide; ortho ester; tertiary alpha-hydroxy ketone | |
cucurbitacin r | [no description available] | low | 0 | 0 | 23,24-dihydrocucurbitacin; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
23,24-dihydrocucurbitacin b | [no description available] | low | 0 | 0 | 23,24-dihydrocucurbitacin; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
croton factor f1 | [no description available] | low | 0 | 0 | phorbol ester; tertiary alpha-hydroxy ketone | |
glaucarubinone | [no description available] | low | 0 | 0 | carboxylic ester; organic heteropentacyclic compound; quassinoid; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone; tetrol | antimalarial; antineoplastic agent; geroprotector; plant metabolite |
phorbol | [no description available] | low | 0 | 0 | cyclic ketone; enone; tertiary alcohol; tertiary alpha-hydroxy ketone; tetracyclic diterpenoid | |
alpha bitter acid | [no description available] | low | 0 | 0 | aromatic ketone; cyclic ketone; diketone; tertiary alpha-hydroxy ketone; triol | antibacterial drug; antioxidant; cyclooxygenase 2 inhibitor; metabolite |
carubicin | [no description available] | low | 0 | 0 | aminoglycoside antibiotic; anthracycline antibiotic; p-quinones; tertiary alpha-hydroxy ketone; tetracenequinones | antineoplastic agent; apoptosis inducer |
phorbol-12,13-didecanoate, (1ar-(1aalpha,1bbeta,4aalpha,7aalpha,7balpha,8alpha,9beta,9aalpha))-isomer | [no description available] | low | 0 | 0 | decanoate ester; diester; phorbol ester; primary allylic alcohol; tertiary alpha-hydroxy ketone | TRPV4 agonist |
blister | [no description available] | low | 0 | 0 | cyclic ketone; pyrroloquinoline; tertiary alcohol; tertiary alpha-hydroxy ketone | inhibitor |
cucurbitacin b | [no description available] | low | 0 | 0 | cucurbitacin; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
cucurbitacin d | [no description available] | low | 0 | 0 | cucurbitacin; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
nsc 106399 | [no description available] | low | 0 | 0 | cucurbitacin; tertiary alpha-hydroxy ketone | |
cucurbitacin i | [no description available] | low | 0 | 0 | cucurbitacin; tertiary alpha-hydroxy ketone | antineoplastic agent; plant metabolite |
25-hydroxy-24-oxocholecalciferol | [no description available] | low | 0 | 0 | hydroxycalciol; oxocalciol; tertiary alpha-hydroxy ketone | |
blebbistatin | [no description available] | low | 0 | 0 | blebbistatin; tertiary alpha-hydroxy ketone | |
resiniferatoxin | [no description available] | low | 0 | 0 | carboxylic ester; diterpenoid; enone; monomethoxybenzene; organic heteropentacyclic compound; ortho ester; phenols; tertiary alpha-hydroxy ketone | analgesic; neurotoxin; plant metabolite; TRPV1 agonist |
cucurbitacin I 2-O-beta-D-glucopyranoside | [no description available] | low | 0 | 0 | beta-D-glucoside; cucurbitacin; monosaccharide derivative; tertiary alpha-hydroxy ketone; triterpenoid saponin | plant metabolite |
elloramycin | [no description available] | low | 0 | 0 | alpha-L-rhamnoside; carboxylic ester; enol ether; enone; methyl ester; monosaccharide derivative; phenols; tertiary alpha-hydroxy ketone; tetracenomycin | antimicrobial agent; bacterial metabolite |
tixocortol pivalate | [no description available] | low | 0 | 0 | corticosteroid; pivalate ester; tertiary alpha-hydroxy ketone; thioester | allergen; anti-allergic agent; glucocorticoid receptor agonist |
avilamycin a | [no description available] | low | 0 | 0 | benzoate ester; cyclic acetal; dichlorobenzene; oligosaccharide derivative; ortho ester; oxaspiro compound; phenols; tertiary alpha-hydroxy ketone | antimicrobial agent; bacterial metabolite |
berkeleydione | [no description available] | low | 0 | 0 | beta-diketone; cyclic terpene ketone; meroterpenoid; methyl ester; organic heterotetracyclic compound; terpene lactone; tertiary alcohol; tertiary alpha-hydroxy ketone | antineoplastic agent; cysteine protease inhibitor; Penicillium metabolite |
berkeleytrione | [no description available] | low | 0 | 0 | beta-diketone; carbopolycyclic compound; cyclic terpene ketone; meroterpenoid; methyl ester; tertiary alcohol; tertiary alpha-hydroxy ketone | cysteine protease inhibitor; Penicillium metabolite |
asperfuranone | [no description available] | low | 0 | 0 | 2-benzofurans; cyclic ketone; diol; polyketide; secondary alcohol; tertiary alcohol; tertiary alpha-hydroxy ketone | antineoplastic agent; fungal metabolite |