Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
sulfites | [no description available] | medium | 183 | 0 | divalent inorganic anion; sulfur oxide; sulfur oxoanion | |
nitrogen dioxide | [no description available] | medium | 1,106 | 10 | nitrogen oxide | |
ozone | [no description available] | medium | 836 | 10 | elemental molecule; gas molecular entity; reactive oxygen species; triatomic oxygen | antiseptic drug; disinfectant; electrophilic reagent; greenhouse gas; mutagen; oxidising agent; tracer |
thiosulfates | [no description available] | medium | 6 | 0 | divalent inorganic anion; sulfur oxide; sulfur oxoanion | human metabolite |
isoproterenol | [no description available] | medium | 11 | 0 | catechols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; sympathomimetic agent |
carbocyanines | [no description available] | medium | 4 | 0 | cyanine dye; organic iodide salt | fluorochrome |
carbon monoxide | [no description available] | medium | 670 | 5 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
urea | [no description available] | medium | 6 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
mercury | [no description available] | medium | 70 | 0 | elemental mercury; zinc group element atom | neurotoxin |
sodium sulfite | [no description available] | medium | 16 | 0 | inorganic sodium salt; sulfite salt | food preservative; reducing agent |
dithionite | [no description available] | medium | 3 | 0 | sulfur oxide; sulfur oxoanion | |
hydrogen | [no description available] | medium | 28 | 1 | elemental hydrogen; elemental molecule; gas molecular entity | antioxidant; electron donor; food packaging gas; fuel; human metabolite |
sulfur | [no description available] | medium | 313 | 0 | chalcogen; nonmetal atom | macronutrient |
hydrogen sulfide | [no description available] | medium | 139 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
benzene | [no description available] | medium | 39 | 0 | aromatic annulene; benzenes; volatile organic compound | carcinogenic agent; environmental contaminant; non-polar solvent |
diphenhydramine hydrochloride | [no description available] | medium | 18 | 0 | hydrochloride; organoammonium salt | anti-allergic agent; antiemetic; antiparkinson drug; antipruritic drug; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; sedative |
acetaldehyde | [no description available] | medium | 25 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
alanylalanine | [no description available] | medium | 1 | 0 | dipeptide | |
cupric sulfide | [no description available] | medium | 3 | 0 | | |
formaldehyde | [no description available] | medium | 66 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
naphthalimides | [no description available] | medium | 1 | 0 | | |
triethylenediamine | [no description available] | medium | 6 | 0 | bridged compound; diamine; saturated organic heterobicyclic parent; tertiary amino compound | antioxidant; catalyst; reagent |
ammonium hydroxide | [no description available] | medium | 155 | 2 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
phencyclidine | [no description available] | medium | 255 | 1 | benzenes; piperidines | anaesthetic; neurotoxin; NMDA receptor antagonist; psychotropic drug |
cobalt | [no description available] | medium | 15 | 0 | cobalt group element atom; metal allergen | micronutrient |
cobalt oxide | [no description available] | medium | 1 | 0 | | |
nitrous oxide | [no description available] | medium | 49 | 0 | gas molecular entity; nitrogen oxide | analgesic; bacterial metabolite; food packaging gas; food propellant; general anaesthetic; greenhouse gas; inhalation anaesthetic; NMDA receptor antagonist; raising agent; refrigerant; vasodilator agent |
manganese | [no description available] | medium | 21 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
betadex | [no description available] | medium | 1 | 0 | cyclodextrin | |
ethylbenzene | [no description available] | medium | 3 | 0 | alkylbenzene | |
toluene | [no description available] | medium | 21 | 0 | methylbenzene; toluenes; volatile organic compound | cholinergic antagonist; fuel additive; neurotoxin; non-polar solvent |
fluorides | [no description available] | medium | 38 | 0 | halide anion; monoatomic fluorine | |
sodium fluoride | [no description available] | medium | 3 | 0 | fluoride salt | mutagen |
peroxynitrous acid | [no description available] | medium | 2 | 1 | nitrogen oxoacid | |
acetic acid | [no description available] | medium | 15 | 0 | monocarboxylic acid | antimicrobial food preservative; Daphnia magna metabolite; food acidity regulator; protic solvent |
hydroxyl radical | [no description available] | medium | 16 | 0 | oxygen hydride; oxygen radical; reactive oxygen species | |
nitrous acid | [no description available] | medium | 10 | 0 | nitrogen oxoacid | |
nitrates | [no description available] | medium | 90 | 1 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | |
methane | [no description available] | medium | 49 | 1 | alkane; gas molecular entity; mononuclear parent hydride; one-carbon compound | bacterial metabolite; fossil fuel; greenhouse gas |
benzo(a)pyrene | [no description available] | medium | 22 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mouse metabolite |
cadmium | [no description available] | medium | 17 | 0 | cadmium molecular entity; zinc group element atom | |
acetylene | [no description available] | medium | 4 | 0 | alkyne; gas molecular entity; terminal acetylenic compound | |
limestone | [no description available] | medium | 27 | 0 | calcium salt; carbonate salt; inorganic calcium salt; one-carbon compound | antacid; fertilizer; food colouring; food firming agent |
aluminum | [no description available] | medium | 32 | 0 | boron group element atom; elemental aluminium; metal atom | |
lactic acid | [no description available] | medium | 12 | 0 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
pyruvic acid | [no description available] | medium | 8 | 0 | 2-oxo monocarboxylic acid | cofactor; fundamental metabolite |
sodium hydroxide | [no description available] | medium | 15 | 0 | alkali metal hydroxide | |
gold | [no description available] | medium | 12 | 0 | copper group element atom; elemental gold | |
acetone | [no description available] | medium | 6 | 0 | ketone body; methyl ketone; propanones; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; human metabolite; polar aprotic solvent |
cerium | [no description available] | medium | 17 | 0 | f-block element atom; lanthanoid atom | |
hydrogen sulfite | [no description available] | medium | 18 | 0 | sulfur oxoanion | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
sodium metabisulfite | [no description available] | medium | 15 | 0 | inorganic sodium salt | food antioxidant |
putrescine | [no description available] | medium | 2 | 0 | alkane-alpha,omega-diamine | antioxidant; fundamental metabolite |
glycine | [no description available] | medium | 4 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
cyclic gmp | [no description available] | medium | 5 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
salicylic acid | [no description available] | medium | 7 | 0 | monohydroxybenzoic acid | algal metabolite; antifungal agent; antiinfective agent; EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor; keratolytic drug; plant hormone; plant metabolite |
4-aminopyridine | [no description available] | medium | 1 | 0 | aminopyridine; aromatic amine | avicide; orphan drug; potassium channel blocker |
metallothionein | [no description available] | medium | 1 | 0 | | |
nicotine | [no description available] | medium | 5 | 1 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
ovalbumin | [no description available] | medium | 17 | 0 | | |
iridium | [no description available] | medium | 2 | 0 | cobalt group element atom; platinum group metal atom | |
lead | [no description available] | medium | 89 | 1 | carbon group element atom; elemental lead; metal atom | neurotoxin |
diacetyl | [no description available] | medium | 3 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
silver | [no description available] | medium | 11 | 1 | copper group element atom; elemental silver | Escherichia coli metabolite |
boron | [no description available] | medium | 1 | 0 | boron group element atom; metalloid atom; nonmetal atom | micronutrient |
iodine | [no description available] | medium | 8 | 0 | diatomic iodine | nutrient |
iodine | [no description available] | medium | 4 | 0 | halide anion; monoatomic iodine | human metabolite |
paclitaxel | [no description available] | medium | 2 | 1 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
tellurium | [no description available] | medium | 3 | 0 | chalcogen; metalloid atom | |
cadmium telluride | [no description available] | medium | 1 | 0 | | |
4-dichlorobenzene | [no description available] | medium | 1 | 0 | dichlorobenzene | insecticide |
radon | [no description available] | medium | 8 | 0 | monoatomic radon; noble gas atom; p-block element atom | |
catechin | [no description available] | medium | 5 | 0 | catechin | antioxidant; plant metabolite |
isobutyl alcohol | [no description available] | medium | 1 | 0 | alkyl alcohol; primary alcohol | Saccharomyces cerevisiae metabolite |
quercetin | [no description available] | medium | 4 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | antibacterial agent; antineoplastic agent; antioxidant; Aurora kinase inhibitor; chelator; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; geroprotector; phytoestrogen; plant metabolite; protein kinase inhibitor; radical scavenger |
octanoic acid | [no description available] | medium | 1 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
1-butanol | [no description available] | medium | 3 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
caprylates | [no description available] | medium | 1 | 0 | fatty acid anion 8:0; straight-chain saturated fatty acid anion | human metabolite; Saccharomyces cerevisiae metabolite |
sulfamerazine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen |
carbene | [no description available] | medium | 1 | 0 | carbene; methanediyl | |
sulfaperine | [no description available] | medium | 1 | 0 | pyrimidines; substituted aniline; sulfonamide antibiotic | antibacterial drug |
methacholine chloride | [no description available] | medium | 12 | 3 | quaternary ammonium salt | |
chlorambucil | [no description available] | medium | 1 | 0 | aromatic amine; monocarboxylic acid; nitrogen mustard; organochlorine compound; tertiary amino compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
naphthalene | [no description available] | medium | 2 | 0 | naphthalenes; ortho-fused bicyclic arene | apoptosis inhibitor; carcinogenic agent; environmental contaminant; mouse metabolite; plant metabolite; volatile oil component |
fullerene c60 | [no description available] | medium | 2 | 0 | fullerene | geroprotector |
lignin | [no description available] | medium | 27 | 0 | | |
urethane | [no description available] | medium | 3 | 0 | carbamate ester | fungal metabolite; mutagen |
titanium | [no description available] | medium | 34 | 1 | titanium group element atom | |
titanium dioxide | [no description available] | medium | 26 | 0 | titanium oxides | food colouring |
sodium bisulfite | [no description available] | medium | 11 | 0 | inorganic sodium salt; sulfite salt | allergen; food antioxidant; food colour retention agent; mutagen; reducing agent |
angiotensin ii | [no description available] | medium | 3 | 0 | amino acid zwitterion; angiotensin II | human metabolite |
tannins | [no description available] | medium | 7 | 0 | | |
levulinic acid | [no description available] | medium | 1 | 0 | oxopentanoic acid; straight-chain saturated fatty acid | plant metabolite |
irinotecan | [no description available] | medium | 3 | 0 | carbamate ester; delta-lactone; N-acylpiperidine; pyranoindolizinoquinoline; ring assembly; tertiary alcohol; tertiary amino compound | antineoplastic agent; apoptosis inducer; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
chlorite | [no description available] | medium | 5 | 0 | chlorine oxoanion; monovalent inorganic anion | |
chlorine | [no description available] | medium | 21 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
5-(4-amino-1-propan-2-yl-3-pyrazolo[3,4-d]pyrimidinyl)-1,3-benzoxazol-2-amine | [no description available] | medium | 1 | 1 | benzoxazole | |
tretinoin | [no description available] | medium | 1 | 1 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
gefitinib | [no description available] | medium | 1 | 1 | aromatic ether; monochlorobenzenes; monofluorobenzenes; morpholines; quinazolines; secondary amino compound; tertiary amino compound | antineoplastic agent; epidermal growth factor receptor antagonist |
carboplatin | [no description available] | medium | 1 | 1 | | |
1,2-epoxyhexane | [no description available] | medium | 1 | 1 | | |
dapoxetine | [no description available] | medium | 1 | 1 | naphthalenes | |
calcium borate | [no description available] | medium | 1 | 1 | | |
acetylcellulose | [no description available] | medium | 1 | 1 | | |
thulium | [no description available] | medium | 1 | 1 | f-block element atom; lanthanoid atom | |
1,n(6)-ethenoadenine | [no description available] | medium | 1 | 1 | imidazo[2,1-i]purine | mutagen |
permanganate | [no description available] | medium | 1 | 1 | manganese oxoacid | |
uranium | [no description available] | medium | 3 | 1 | actinoid atom; f-block element atom; monoatomic uranium | |
piperidines | [no description available] | medium | 1 | 1 | | |
lopinavir | [no description available] | medium | 1 | 1 | amphetamines; dicarboxylic acid diamide | anticoronaviral agent; antiviral drug; HIV protease inhibitor |
caprolactam | [no description available] | medium | 2 | 1 | caprolactams | human blood serum metabolite |
isopropyl myristate | [no description available] | medium | 1 | 1 | fatty acid ester | |
muscone | [no description available] | medium | 1 | 1 | | |
memantine | [no description available] | medium | 1 | 1 | adamantanes; primary aliphatic amine | antidepressant; antiparkinson drug; dopaminergic agent; neuroprotective agent; NMDA receptor antagonist |
sorbitan monooleate | [no description available] | medium | 1 | 1 | fatty acid ester | |
arsenic | [no description available] | medium | 23 | 1 | metalloid atom; pnictogen | micronutrient |
docetaxel anhydrous | [no description available] | medium | 1 | 1 | secondary alpha-hydroxy ketone; tetracyclic diterpenoid | antimalarial; antineoplastic agent; photosensitizing agent |
baicalein | [no description available] | medium | 1 | 1 | trihydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.31 (arachidonate 12-lipoxygenase) inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 4.1.1.17 (ornithine decarboxylase) inhibitor; ferroptosis inhibitor; geroprotector; hormone antagonist; plant metabolite; prostaglandin antagonist; radical scavenger |
heme | [no description available] | medium | 3 | 1 | | |
baicalin | [no description available] | medium | 1 | 1 | dihydroxyflavone; glucosiduronic acid; glycosyloxyflavone; monosaccharide derivative | antiatherosclerotic agent; antibacterial agent; anticoronaviral agent; antineoplastic agent; antioxidant; cardioprotective agent; EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; ferroptosis inhibitor; neuroprotective agent; non-steroidal anti-inflammatory drug; plant metabolite; prodrug |
citric acid, anhydrous | [no description available] | medium | 1 | 1 | tricarboxylic acid | antimicrobial agent; chelator; food acidity regulator; fundamental metabolite |
deoxycytidine | [no description available] | medium | 2 | 1 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cellulose | [no description available] | medium | 25 | 1 | glycoside | |
phosphorus | [no description available] | medium | 4 | 1 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
isoflurane | [no description available] | medium | 1 | 1 | organofluorine compound | inhalation anaesthetic |
adenine | [no description available] | medium | 2 | 1 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ketamine | [no description available] | medium | 1 | 1 | cyclohexanones; monochlorobenzenes; secondary amino compound | analgesic; environmental contaminant; intravenous anaesthetic; neurotoxin; NMDA receptor antagonist; xenobiotic |
histamine | [no description available] | medium | 30 | 2 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
methadone | [no description available] | medium | 1 | 1 | benzenes; diarylmethane; ketone; tertiary amino compound | |
histidine | [no description available] | medium | 2 | 1 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
sirolimus | [no description available] | medium | 1 | 1 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
chitosan | [no description available] | medium | 9 | 1 | | |
ethylene | [no description available] | medium | 7 | 0 | alkene; gas molecular entity | plant hormone; refrigerant |
ethylene | [no description available] | medium | 7 | 1 | alkene; gas molecular entity | plant hormone; refrigerant |
cholecalciferol | [no description available] | medium | 1 | 1 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol; steroid hormone | geroprotector; human metabolite |
voriconazole | [no description available] | medium | 1 | 1 | conazole antifungal drug; difluorobenzene; pyrimidines; tertiary alcohol; triazole antifungal drug | P450 inhibitor |
catalpol | [no description available] | medium | 1 | 1 | | |
glucagon | [no description available] | medium | 1 | 1 | peptide hormone | |
propylene glycol | [no description available] | medium | 2 | 1 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
ritonavir | [no description available] | medium | 1 | 1 | 1,3-thiazoles; carbamate ester; carboxamide; L-valine derivative; ureas | antiviral drug; environmental contaminant; HIV protease inhibitor; xenobiotic |
gemcitabine | [no description available] | medium | 1 | 1 | organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; environmental contaminant; immunosuppressive agent; photosensitizing agent; prodrug; radiosensitizing agent; xenobiotic |
glycerol | [no description available] | medium | 8 | 1 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
imatinib mesylate | [no description available] | medium | 1 | 1 | methanesulfonate salt | anticoronaviral agent; antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
thiamethoxam | [no description available] | medium | 1 | 1 | 1,3-thiazoles; 2-nitroguanidine derivative; organochlorine compound; oxadiazane | antifeedant; carcinogenic agent; environmental contaminant; neonicotinoid insectide; xenobiotic |
axitinib | [no description available] | medium | 1 | 1 | aryl sulfide; benzamides; indazoles; pyridines | antineoplastic agent; tyrosine kinase inhibitor; vascular endothelial growth factor receptor antagonist |
menaquinone 6 | [no description available] | medium | 1 | 1 | | |
menaquinone 7 | [no description available] | medium | 1 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
menaquinone 7 | [no description available] | medium | 1 | 1 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
nitrites | [no description available] | medium | 29 | 2 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | human metabolite |
quinoxalines | [no description available] | medium | 1 | 1 | mancude organic heterobicyclic parent; naphthyridine; ortho-fused heteroarene | |
thiophenes | [no description available] | medium | 7 | 1 | mancude organic heteromonocyclic parent; monocyclic heteroarene; thiophenes; volatile organic compound | non-polar solvent |
thiazoles | [no description available] | medium | 2 | 1 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
benzoxazoles | [no description available] | medium | 1 | 1 | 1,3-benzoxazoles; mancude organic heterobicyclic parent | |
glycolipids | [no description available] | medium | 2 | 1 | | |
pitolisant | [no description available] | medium | 1 | 1 | organochlorine compound | |
interleukin-8 | [no description available] | medium | 6 | 2 | | |
galactose | [no description available] | medium | 3 | 1 | | |
2,3-bis(bromomethyl)quinoxaline-1,4-dioxide | [no description available] | medium | 1 | 1 | | |
cysteine | [no description available] | medium | 23 | 0 | cysteinium | fundamental metabolite |
5-(4-aminophenyl)-10,15,20-triphenylporphyrin | [no description available] | medium | 1 | 0 | | |
ascorbic acid | [no description available] | medium | 36 | 1 | ascorbic acid; vitamin C | coenzyme; cofactor; flour treatment agent; food antioxidant; food colour retention agent; geroprotector; plant metabolite; skin lightening agent |
thyroxine | [no description available] | medium | 2 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
4,4-difluoro-4-bora-3a,4a-diaza-s-indacene | [no description available] | medium | 1 | 0 | BODIPY compound | |
chlorobenzene | [no description available] | medium | 2 | 0 | monochlorobenzenes | solvent |
flavan-3-ol | [no description available] | medium | 2 | 0 | hydroxyflavonoid | |
zithromax | [no description available] | medium | 1 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; xenobiotic |
carbonyl cyanide m-chlorophenyl hydrazone | [no description available] | medium | 1 | 0 | hydrazone; monochlorobenzenes; nitrile | antibacterial agent; geroprotector; ionophore |
malondialdehyde | [no description available] | medium | 12 | 1 | dialdehyde | biomarker |
benzothiazole | [no description available] | medium | 2 | 0 | benzothiazoles | environmental contaminant; plant metabolite; xenobiotic |
cocaine | [no description available] | medium | 17 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
morphine | [no description available] | medium | 4 | 1 | morphinane alkaloid; organic heteropentacyclic compound; tertiary amino compound | anaesthetic; drug allergen; environmental contaminant; geroprotector; mu-opioid receptor agonist; opioid analgesic; plant metabolite; vasodilator agent; xenobiotic |
phosphine | [no description available] | medium | 1 | 0 | mononuclear parent hydride; phosphanes; phosphine | carcinogenic agent; fumigant insecticide |
biotin | [no description available] | medium | 1 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
malvidin-3-glucoside | [no description available] | medium | 1 | 0 | | |
glyoxylic acid | [no description available] | medium | 2 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
tartaric acid | [no description available] | medium | 3 | 0 | tartaric acid | Escherichia coli metabolite |
warfarin | [no description available] | medium | 11 | 0 | benzenes; hydroxycoumarin; methyl ketone | |
hypochlorous acid | [no description available] | medium | 4 | 0 | chlorine oxoacid; reactive oxygen species | EC 2.5.1.18 (glutathione transferase) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite |
nickel | [no description available] | medium | 16 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
benzo-1,2,3-thiadiazole | [no description available] | medium | 1 | 0 | | |
sodium carbonate | [no description available] | medium | 7 | 0 | carbonate salt; organic sodium salt | |
carbonates | [no description available] | medium | 17 | 1 | carbon oxoanion | |
sulfapyridine | [no description available] | medium | 1 | 0 | pyridines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; dermatologic drug; drug allergen; environmental contaminant; xenobiotic |
sulfamethazine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antibacterial drug; antiinfective agent; antimicrobial agent; carcinogenic agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; ligand; xenobiotic |
sulfadimethoxine | [no description available] | medium | 1 | 0 | aromatic ether; pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; drug allergen; environmental contaminant; xenobiotic |
sulfachlorpyridazine | [no description available] | medium | 1 | 0 | organochlorine compound; pyridazines; sulfonamide | antibacterial drug; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
sulfadiazine | [no description available] | medium | 1 | 0 | pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; antiprotozoal drug; coccidiostat; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
sulfuric acid | [no description available] | medium | 65 | 1 | sulfur oxoacid | catalyst |
pectins | [no description available] | medium | 4 | 0 | D-galactopyranuronic acid | |
polygalacturonic acid | [no description available] | medium | 1 | 0 | D-galacturonic acid | |
chlorophyll a | [no description available] | medium | 21 | 0 | chlorophyll; methyl ester | cofactor |
vitamin b 12 | [no description available] | medium | 1 | 0 | | |
cobinamide | [no description available] | medium | 1 | 0 | | |
calcium sulfate | [no description available] | medium | 7 | 0 | calcium salt; inorganic calcium salt | |
glucose, (beta-d)-isomer | [no description available] | medium | 3 | 0 | D-glucopyranose | epitope; mouse metabolite |
malvidin-3-glucoside | [no description available] | medium | 1 | 0 | anthocyanin cation; aromatic ether; beta-D-glucoside | metabolite |
fenton's reagent | [no description available] | medium | 2 | 0 | | |
acrylic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid | metabolite |
methyl parathion | [no description available] | medium | 1 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; antifungal agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; genotoxin |
3-nitrotyrosine | [no description available] | medium | 1 | 0 | 2-nitrophenols; C-nitro compound; nitrotyrosine; non-proteinogenic alpha-amino acid | |
tyrosine | [no description available] | medium | 3 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
gibberellins | [no description available] | medium | 1 | 0 | | |
sodium sulfate | [no description available] | medium | 8 | 0 | inorganic sodium salt | |
mocetinostat | [no description available] | medium | 5 | 0 | aminopyrimidine; benzamides; pyridines; secondary amino compound; secondary carboxamide; substituted aniline | antineoplastic agent; apoptosis inducer; autophagy inducer; cardioprotective agent; EC 3.5.1.98 (histone deacetylase) inhibitor; hepatotoxic agent |
gibberellic acid | [no description available] | medium | 1 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone; organic heteropentacyclic compound | mouse metabolite; plant metabolite |
2-hexenal, z-isomer | [no description available] | medium | 1 | 0 | 2-hexenal | antibacterial agent; flavouring agent; plant metabolite |
methylmercaptan | [no description available] | medium | 8 | 0 | alkanethiol | human metabolite; Saccharomyces cerevisiae metabolite |
hydrochloric acid | [no description available] | medium | 49 | 0 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
flavanone | [no description available] | medium | 1 | 0 | flavanones | |
clinoptilolite | [no description available] | medium | 3 | 0 | | |
zeolites | [no description available] | medium | 7 | 0 | | |
3-hydroxyflavone | [no description available] | medium | 2 | 0 | flavonols; monohydroxyflavone | |
hydroxyproline | [no description available] | medium | 3 | 0 | 4-hydroxyproline; L-alpha-amino acid zwitterion | human metabolite; mouse metabolite; plant metabolite |
losartan | [no description available] | medium | 1 | 0 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
2-mercaptobenzimidazole | [no description available] | medium | 1 | 0 | | |
allyl alcohol | [no description available] | medium | 1 | 0 | primary allylic alcohol; propenol | antibacterial agent; fungicide; herbicide; insecticide; plant metabolite |
alkenes | [no description available] | medium | 20 | 0 | | |
procyanidin | [no description available] | medium | 4 | 0 | proanthocyanidin | |
2-xylene | [no description available] | medium | 1 | 0 | xylene | |
copper sulfate | [no description available] | medium | 2 | 0 | metal sulfate | emetic; fertilizer; sensitiser |
patulin | [no description available] | medium | 3 | 0 | furopyran; gamma-lactone; lactol | antimicrobial agent; Aspergillus metabolite; carcinogenic agent; mutagen; mycotoxin; Penicillium metabolite |
sodium hypochlorite | [no description available] | medium | 2 | 0 | inorganic sodium salt | bleaching agent; disinfectant |
boron nitride | [no description available] | medium | 1 | 0 | nitride | |
coumarin | [no description available] | medium | 4 | 0 | coumarins | fluorescent dye; human metabolite; plant metabolite |
dihydroxyacetone | [no description available] | medium | 1 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxymethanesulfonate, sodium salt | [no description available] | medium | 1 | 0 | organosulfonic acid | |
tetraglyme | [no description available] | medium | 1 | 0 | polyether | |
ferulic acid | [no description available] | medium | 1 | 0 | ferulic acids | anti-inflammatory agent; antioxidant; apoptosis inhibitor; cardioprotective agent; MALDI matrix material; plant metabolite |
benzimidazole | [no description available] | medium | 1 | 0 | benzimidazole; polycyclic heteroarene | |
sulfur trioxide | [no description available] | medium | 11 | 0 | sulfur oxide | |
cyanidin-3-o-beta-glucopyranoside | [no description available] | medium | 1 | 0 | | |
beta carotene | [no description available] | medium | 3 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
sulfur monoxide | [no description available] | medium | 4 | 0 | sulfur oxide | |
phenyl acetate | [no description available] | medium | 17 | 1 | benzenes; phenyl acetates | |
cyanoacetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | |
methionine | [no description available] | medium | 6 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
riboflavin | [no description available] | medium | 2 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
dimethyl disulfide | [no description available] | medium | 4 | 0 | organic disulfide | xenobiotic metabolite |
cotinine | [no description available] | medium | 1 | 0 | N-alkylpyrrolidine; pyridines; pyrrolidin-2-ones; pyrrolidine alkaloid | antidepressant; biomarker; human xenobiotic metabolite; plant metabolite |
cyanides | [no description available] | medium | 15 | 0 | pseudohalide anion | EC 1.9.3.1 (cytochrome c oxidase) inhibitor |
chlorine | [no description available] | medium | 37 | 0 | diatomic chlorine; gas molecular entity | bleaching agent |
cyanogen chloride | [no description available] | medium | 1 | 0 | | |
octane | [no description available] | medium | 1 | 0 | alkane | xenobiotic |
zinc chloride | [no description available] | medium | 1 | 0 | inorganic chloride; zinc molecular entity | astringent; disinfectant; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; Lewis acid |
ammonium sulfite | [no description available] | medium | 2 | 0 | p-block molecular entity; sulfite salt | |
gamma-aminobutyric acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid | human metabolite; neurotransmitter; Saccharomyces cerevisiae metabolite; signalling molecule |
glutamic acid | [no description available] | medium | 1 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
ruthenium | [no description available] | medium | 4 | 0 | iron group element atom; platinum group metal atom | |
ceric oxide | [no description available] | medium | 13 | 0 | cerium molecular entity; metal oxide | |
aluminum oxide | [no description available] | medium | 19 | 0 | | |
2-(4-morpholinyl)-8-phenyl-4h-1-benzopyran-4-one | [no description available] | medium | 1 | 0 | chromones; morpholines; organochlorine compound | autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector |
formic acid | [no description available] | medium | 3 | 0 | monocarboxylic acid | antibacterial agent; astringent; metabolite; protic solvent; solvent |
lanthanum | [no description available] | medium | 3 | 0 | f-block element atom; lanthanoid atom; scandium group element atom | |
chromium | [no description available] | medium | 7 | 0 | chromium group element atom; metal allergen | micronutrient |
benzyl chloride | [no description available] | medium | 1 | 0 | benzyl chlorides | |
palladium | [no description available] | medium | 8 | 0 | metal allergen; nickel group element atom; platinum group metal atom | |
2,4-dinitrophenylhydrazine | [no description available] | medium | 2 | 0 | C-nitro compound; phenylhydrazines | reagent |
tin | [no description available] | medium | 1 | 0 | carbon group element atom; elemental tin; metal atom | micronutrient |
triethylene glycol | [no description available] | medium | 1 | 0 | diol; poly(ethylene glycol); primary alcohol | plasticiser |
carbon disulfide | [no description available] | medium | 12 | 0 | one-carbon compound; organosulfur compound | |
cytochrome c-t | [no description available] | medium | 1 | 0 | | |
cellulase | [no description available] | medium | 17 | 0 | cellotriose | |
phosphoric acid | [no description available] | medium | 1 | 0 | phosphoric acids | algal metabolite; fertilizer; human metabolite; NMR chemical shift reference compound; solvent |
isoascorbic acid | [no description available] | medium | 1 | 0 | ascorbic acid | |
manganese dioxide | [no description available] | medium | 2 | 0 | manganese molecular entity; metal oxide | |
platinum | [no description available] | medium | 5 | 0 | elemental platinum; nickel group element atom; platinum group metal atom | |
zinc hematoporphyrin | [no description available] | medium | 1 | 0 | | |
fructans | [no description available] | medium | 1 | 0 | | |
nitric acid | [no description available] | medium | 28 | 0 | nitrogen oxoacid | protic solvent; reagent |
zirconium | [no description available] | medium | 2 | 0 | titanium group element atom | |
vanadium | [no description available] | medium | 9 | 0 | elemental vanadium; vanadium group element atom | micronutrient |
metabisulfite | [no description available] | medium | 5 | 0 | sulfur oxide; sulfur oxoanion | |
molybdenum trioxide | [no description available] | medium | 1 | 0 | molybdenum oxide | |
molybdenum | [no description available] | medium | 10 | 0 | chromium group element atom | micronutrient |
helium | [no description available] | medium | 4 | 0 | monoatomic helium; noble gas atom; s-block element atom | food packaging gas |
2-diethylaminoethanol | [no description available] | medium | 1 | 0 | ethanolamines; primary alcohol; tertiary amino compound | |
dimethylamine | [no description available] | medium | 1 | 0 | methylamines; secondary aliphatic amine | metabolite |
lithium | [no description available] | medium | 7 | 0 | alkali metal atom | |
furaldehyde | [no description available] | medium | 2 | 0 | aldehyde; furans | Maillard reaction product; metabolite |
5-hydroxymethylfurfural | [no description available] | medium | 1 | 0 | arenecarbaldehyde; furans; primary alcohol | indicator; Maillard reaction product |
dimethyl sulfide | [no description available] | medium | 8 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
4-chloro-7-nitrobenzofurazan | [no description available] | medium | 1 | 0 | benzoxadiazole; C-nitro compound; organochlorine compound | EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.6.1.3 (adenosinetriphosphatase) inhibitor; fluorescent probe; fluorochrome |
deoxyglucose | [no description available] | medium | 1 | 0 | | |
2-(n-(7-nitrobenz-2-oxa-1,3-diazol-4-yl)amino)-2-deoxyglucose | [no description available] | medium | 1 | 0 | | |
pd 98059 | [no description available] | medium | 1 | 0 | aromatic amine; monomethoxyflavone | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; geroprotector |
2-butanol | [no description available] | medium | 1 | 0 | secondary alcohol | |
4-ethylphenol | [no description available] | medium | 3 | 0 | phenols | fungal xenobiotic metabolite |
beta-pinene | [no description available] | medium | 3 | 0 | pinene | plant metabolite |
hydrazine | [no description available] | medium | 5 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
vanadium pentoxide | [no description available] | medium | 5 | 0 | vanadium oxide | |
silicon | [no description available] | medium | 6 | 0 | carbon group element atom; metalloid atom; nonmetal atom | |
ethanolamine | [no description available] | medium | 2 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
n-vinyl-2-pyrrolidinone | [no description available] | medium | 2 | 0 | pyrrolidin-2-ones | |
ammonium sulfate | [no description available] | medium | 13 | 1 | ammonium salt; inorganic sulfate salt | fertilizer |
ammonium nitrate | [no description available] | medium | 3 | 0 | ammonium salt; inorganic molecular entity; inorganic nitrate salt | explosive; fertilizer; oxidising agent |
beryllium | [no description available] | medium | 5 | 0 | alkaline earth metal atom; elemental beryllium; metal allergen | adjuvant; carcinogenic agent; epitope |
clay | [no description available] | medium | 2 | 0 | | |
fluorine | [no description available] | medium | 2 | 0 | diatomic fluorine; gas molecular entity | NMR chemical shift reference compound |
bromine | [no description available] | medium | 3 | 0 | diatomic bromine | |
hydrogen cyanide | [no description available] | medium | 10 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
1,4-dioxane | [no description available] | medium | 1 | 0 | dioxane; volatile organic compound | carcinogenic agent; metabolite; NMR chemical shift reference compound; non-polar solvent |
selenic acid | [no description available] | medium | 2 | 0 | selenium oxoacid | |
tenax | [no description available] | medium | 1 | 0 | | |
selenium | [no description available] | medium | 7 | 0 | chalcogen; nonmetal atom | micronutrient |
azides | [no description available] | medium | 1 | 0 | pseudohalide anion | mitochondrial respiratory-chain inhibitor |
ferrous sulfate | [no description available] | medium | 3 | 0 | iron molecular entity; metal sulfate | reducing agent |
proline | [no description available] | medium | 2 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
benzofurans | [no description available] | medium | 16 | 0 | | |
peracetic acid | [no description available] | medium | 2 | 0 | a peroxy acid | disinfectant; oxidising agent |
homocysteine | [no description available] | medium | 1 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
rubidium | [no description available] | medium | 1 | 0 | alkali metal atom | |
ammonium peroxydisulfate | [no description available] | medium | 1 | 0 | | |
1,4-dioxin | [no description available] | medium | 1 | 0 | oxacycle | |
quinic acid | [no description available] | medium | 1 | 0 | | |
chlorogenic acid | [no description available] | medium | 1 | 0 | cinnamate ester; tannin | food component; plant metabolite |
potassium chloride | [no description available] | medium | 4 | 0 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
dibenzo(1,4)dioxin | [no description available] | medium | 2 | 0 | dibenzodioxine; heteranthrene; mancude organic heterotricyclic parent; oxacycle; polycyclic heteroarene | |
cupric chloride | [no description available] | medium | 3 | 0 | copper molecular entity; inorganic chloride | EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor |
cupric bromide | [no description available] | medium | 1 | 0 | | |
fluoroboric acid | [no description available] | medium | 2 | 0 | boron fluoride | |
bromide | [no description available] | medium | 8 | 0 | halide anion; monoatomic bromine | |
benzothiophene | [no description available] | medium | 1 | 0 | 1-benzothiophenes; benzothiophene | |
sulfonyl chloride | [no description available] | medium | 1 | 0 | sulfuryl halide | |
nitroxyl | [no description available] | medium | 1 | 0 | nitrogen oxoacid | |
hydrofluoric acid | [no description available] | medium | 13 | 0 | hydrogen halide; mononuclear parent hydride | NMR chemical shift reference compound |
dolomite | [no description available] | medium | 2 | 0 | | |
sodium chlorate | [no description available] | medium | 1 | 0 | chlorate salt; inorganic sodium salt | herbicide |
chlorates | [no description available] | medium | 1 | 0 | chlorine oxoanion; monovalent inorganic anion | |
caftaric acid | [no description available] | medium | 1 | 0 | hydroxycinnamic acid | |
1,1-diphenyl-2-picrylhydrazyl | [no description available] | medium | 1 | 0 | | |
isoprene | [no description available] | medium | 4 | 0 | alkadiene; hemiterpene; volatile organic compound | plant metabolite |
1-hydroxypyrene | [no description available] | medium | 2 | 0 | pyrenes | |
3-cyano-n-(1,3-diphenyl-1h-pyrazol-5-yl)benzamide | [no description available] | medium | 1 | 0 | | |
anorthite | [no description available] | medium | 1 | 0 | | |
acetylcysteine | [no description available] | medium | 2 | 0 | acetylcysteine; L-cysteine derivative; N-acetyl-L-amino acid | antidote to paracetamol poisoning; antiinfective agent; antioxidant; antiviral drug; ferroptosis inhibitor; geroprotector; human metabolite; mucolytic; radical scavenger; vulnerary |
asparagine | [no description available] | medium | 1 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
oleic acid | [no description available] | medium | 3 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
aspartate-beta-hydroxamate | [no description available] | medium | 1 | 0 | | |
acetoin | [no description available] | medium | 1 | 0 | methyl ketone; secondary alpha-hydroxy ketone | metabolite |
difluoromethane | [no description available] | medium | 1 | 0 | fluoromethanes | refrigerant |
dibenzothiophene | [no description available] | medium | 2 | 0 | dibenzothiophenes; mancude organic heterotricyclic parent | keratolytic drug |
flavin mononucleotide | [no description available] | medium | 2 | 0 | | |
fe(iii)-edta | [no description available] | medium | 1 | 0 | iron coordination entity | |
fe(ii)-edta | [no description available] | medium | 2 | 0 | iron coordination entity | |
edetic acid | [no description available] | medium | 4 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
peoniflorin | [no description available] | medium | 1 | 0 | | |
oxytetracycline, anhydrous | [no description available] | medium | 1 | 0 | | |
2-chloro-5-hydroxyphenylglycine | [no description available] | medium | 1 | 0 | | |
goethite | [no description available] | medium | 2 | 0 | | |
guanidine | [no description available] | medium | 2 | 0 | carboxamidine; guanidines; one-carbon compound | |
diethyl sulfate | [no description available] | medium | 1 | 0 | alkyl sulfate | alkylating agent; apoptosis inducer; carcinogenic agent; mutagen |
pyruvaldehyde | [no description available] | medium | 1 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pentane | [no description available] | medium | 3 | 0 | alkane; volatile organic compound | non-polar solvent; refrigerant |
ammonium chloride | [no description available] | medium | 2 | 0 | ammonium salt; inorganic chloride | ferroptosis inhibitor |
glucosamine | [no description available] | medium | 2 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
dimethyl sulfone | [no description available] | medium | 1 | 0 | sulfone | |
dimethyl sulfoxide | [no description available] | medium | 6 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
1,8-dinitropyrene | [no description available] | medium | 1 | 0 | pyrenes | |
pheophytin a | [no description available] | medium | 2 | 0 | | |
chlorophyll b | [no description available] | medium | 2 | 0 | chlorophyll | cofactor |
coumarin-3-carboxylic acid | [no description available] | medium | 1 | 0 | coumarins | |
glyceryl 2-arachidonate | [no description available] | medium | 2 | 0 | 2-acylglycerol 20:4; endocannabinoid | human metabolite |
dinoprostone | [no description available] | medium | 2 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
phenylethyl alcohol | [no description available] | medium | 1 | 0 | benzenes; primary alcohol | Aspergillus metabolite; fragrance; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite |
3,4-dihydroxyphenylethanol | [no description available] | medium | 1 | 0 | catechols; primary alcohol | antineoplastic agent; antioxidant; metabolite |
xylose | [no description available] | medium | 5 | 0 | D-xylose | |
ethylene dibromide | [no description available] | medium | 2 | 0 | bromoalkane; bromohydrocarbon | algal metabolite; carcinogenic agent; fumigant; marine metabolite; mouse metabolite; mutagen |
sesquiterpenes | [no description available] | medium | 1 | 0 | | |
xiamycin | [no description available] | medium | 1 | 0 | | |
muramidase | [no description available] | medium | 5 | 0 | | |
dimethyl pyrocarbonate | [no description available] | medium | 2 | 0 | organooxygen compound | |
diethyl pyrocarbonate | [no description available] | medium | 4 | 0 | acyclic carboxylic anhydride | |
pyridine | [no description available] | medium | 2 | 0 | azaarene; mancude organic heteromonocyclic parent; monocyclic heteroarene; pyridines | environmental contaminant; NMR chemical shift reference compound |
choline | [no description available] | medium | 1 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
dithiothreitol | [no description available] | medium | 2 | 0 | 1,4-dimercaptobutane-2,3-diol; butanediols; dithiol; glycol; thiol | chelator; human metabolite; reducing agent |
methanesulfonic acid | [no description available] | medium | 1 | 0 | alkanesulfonic acid; one-carbon compound | Escherichia coli metabolite |
deoxyguanosine | [no description available] | medium | 4 | 1 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
8-hydroxy-2'-deoxyguanosine | [no description available] | medium | 3 | 1 | guanosines | biomarker |
beta-damascenone | [no description available] | medium | 3 | 0 | apo carotenoid monoterpenoid; cyclic monoterpene ketone; enone | fragrance; plant metabolite; volatile oil component |
diphenyl sulfoxide | [no description available] | medium | 1 | 0 | sulfoxide | |
diphenyl sulfide | [no description available] | medium | 1 | 0 | aryl sulfide | |
cyclohexane | [no description available] | medium | 1 | 0 | cycloalkane; volatile organic compound | non-polar solvent |
indole-3-lactic acid | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid; indol-3-yl carboxylic acid | human metabolite |
alpha-pinene | [no description available] | medium | 3 | 0 | pinene | plant metabolite |
transforming growth factor beta | [no description available] | medium | 4 | 0 | | |
malic acid | [no description available] | medium | 10 | 0 | 2-hydroxydicarboxylic acid; C4-dicarboxylic acid | food acidity regulator; fundamental metabolite |
di-2-ethylhexyl sebacate | [no description available] | medium | 1 | 0 | | |
cardiovascular agents | [no description available] | medium | 1 | 0 | | |
paraquat | [no description available] | medium | 7 | 0 | organic cation | geroprotector; herbicide |
perovskite | [no description available] | medium | 1 | 0 | | |
cordierite | [no description available] | medium | 1 | 0 | | |
menthol | [no description available] | medium | 1 | 0 | p-menthane monoterpenoid; secondary alcohol | volatile oil component |
eucalyptol | [no description available] | medium | 1 | 0 | | |
lactulose | [no description available] | medium | 1 | 0 | | |
cyclohexanol | [no description available] | medium | 1 | 0 | cyclohexanols; secondary alcohol | solvent |
bay 11-7082 | [no description available] | medium | 1 | 0 | nitrile; sulfone | apoptosis inducer; EC 2.7.11.10 (IkappaB kinase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor; non-steroidal anti-inflammatory drug; platelet aggregation inhibitor |
prolinedithiocarbamate | [no description available] | medium | 1 | 0 | | |
dialuminum magnesium tetraoxide | [no description available] | medium | 1 | 0 | | |
stannic oxide | [no description available] | medium | 2 | 0 | tin oxide | |
sulfur hexafluoride | [no description available] | medium | 4 | 0 | sulfur coordination entity | greenhouse gas; NMR chemical shift reference compound; ultrasound contrast agent |
caffeic acid | [no description available] | medium | 1 | 0 | caffeic acid | geroprotector; mouse metabolite |
monocrotaline | [no description available] | medium | 2 | 0 | pyrrolizidine alkaloid | |
8-epi-prostaglandin f2alpha | [no description available] | medium | 1 | 1 | F2-isoprostane | biomarker; bronchoconstrictor agent; vasoconstrictor agent |
dinoprost | [no description available] | medium | 3 | 1 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
phenanthrenes | [no description available] | medium | 1 | 0 | | |
brine | [no description available] | medium | 1 | 0 | | |
silicon carbide | [no description available] | medium | 4 | 0 | organosilicon compound | |
ditiocarb | [no description available] | medium | 1 | 0 | dithiocarbamic acids | chelator; copper chelator |
ferric sulfate | [no description available] | medium | 1 | 0 | iron molecular entity; metal sulfate | astringent; catalyst; mordant |
endothelin-1 | [no description available] | medium | 4 | 0 | | |
ethylene sulfide | [no description available] | medium | 1 | 0 | organosulfur heterocyclic compound; saturated organic heteromonocyclic parent | |
trichloroethylene | [no description available] | medium | 3 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
D-fructopyranose | [no description available] | medium | 4 | 0 | cyclic hemiketal; D-fructose; fructopyranose | sweetening agent |
5-ketofructose | [no description available] | medium | 1 | 0 | hexose | |
nicardipine | [no description available] | medium | 2 | 0 | benzenes; C-nitro compound; diester; dihydropyridine; methyl ester; tertiary amino compound | |
theobromine | [no description available] | medium | 1 | 0 | dimethylxanthine | adenosine receptor antagonist; bronchodilator agent; food component; human blood serum metabolite; mouse metabolite; plant metabolite; vasodilator agent |
calcium acetate | [no description available] | medium | 1 | 0 | calcium salt | chelator |
methenamine | [no description available] | medium | 1 | 0 | polyazaalkane; polycyclic cage; tetramine | antibacterial drug |
salmeterol xinafoate | [no description available] | medium | 3 | 2 | naphthoic acid | |
triamcinolone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 16alpha-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
albuterol | [no description available] | medium | 12 | 4 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
2'-deoxy-2'-methylenecytidine | [no description available] | medium | 1 | 0 | | |
tetraethylammonium | [no description available] | medium | 2 | 0 | quaternary ammonium ion | |
glyburide | [no description available] | medium | 2 | 0 | monochlorobenzenes; N-sulfonylurea | anti-arrhythmia drug; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor; hypoglycemic agent |
ethyl acetate | [no description available] | medium | 3 | 0 | acetate ester; ethyl ester; volatile organic compound | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor; metabolite; polar aprotic solvent; Saccharomyces cerevisiae metabolite |
isopentyl alcohol | [no description available] | medium | 1 | 0 | alkyl alcohol; primary alcohol; volatile organic compound | antifungal agent; Saccharomyces cerevisiae metabolite; xenobiotic metabolite |
n-pentanol | [no description available] | medium | 1 | 0 | pentanol; short-chain primary fatty alcohol | human metabolite; plant metabolite |
ficusin | [no description available] | medium | 1 | 0 | psoralens | plant metabolite |
malachite green | [no description available] | medium | 2 | 0 | organic chloride salt | antibacterial agent; antifungal drug; carcinogenic agent; environmental contaminant; fluorochrome; histological dye; teratogenic agent |
c.i. 42510 | [no description available] | medium | 21 | 0 | | |
chloroform | [no description available] | medium | 5 | 0 | chloromethanes; one-carbon compound | carcinogenic agent; central nervous system drug; inhalation anaesthetic; non-polar solvent; refrigerant |
silver nitrate | [no description available] | medium | 1 | 0 | inorganic nitrate salt; silver salt | astringent |
argon | [no description available] | medium | 3 | 0 | monoatomic argon; noble gas atom; p-block element atom | food packaging gas; neuroprotective agent |
neon | [no description available] | medium | 1 | 0 | monoatomic neon; noble gas atom; p-block element atom | |
tungsten | [no description available] | medium | 6 | 0 | chromium group element atom | micronutrient |
cumene hydroperoxide | [no description available] | medium | 1 | 0 | peroxol | environmental contaminant; Mycoplasma genitalium metabolite; oxidising agent |
methylene blue | [no description available] | medium | 3 | 0 | organic chloride salt | acid-base indicator; antidepressant; antimalarial; antimicrobial agent; antioxidant; cardioprotective agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 4.6.1.2 (guanylate cyclase) inhibitor; fluorochrome; histological dye; neuroprotective agent; physical tracer |
carbonic acid | [no description available] | medium | 1 | 0 | carbon oxoacid; chalcocarbonic acid | mouse metabolite |
codeine | [no description available] | medium | 6 | 0 | morphinane alkaloid; organic heteropentacyclic compound | antitussive; drug allergen; environmental contaminant; opioid analgesic; opioid receptor agonist; prodrug; xenobiotic |
4-ethylguaiacol | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | |
guaiacol | [no description available] | medium | 1 | 0 | guaiacols | disinfectant; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; expectorant; plant metabolite |
rhodium | [no description available] | medium | 2 | 0 | cobalt group element atom | |
propane | [no description available] | medium | 3 | 0 | alkane; gas molecular entity | food propellant |
trichlorofluoromethane | [no description available] | medium | 1 | 0 | chlorofluorocarbon; halomethane | environmental contaminant; NMR chemical shift reference compound; NMR solvent; refrigerant |
dehydroascorbic acid | [no description available] | medium | 2 | 0 | dehydroascorbic acid; vitamin C | coenzyme; mouse metabolite |
monodehydroascorbate | [no description available] | medium | 1 | 0 | organic radical | mouse metabolite |
trimellitic anhydride | [no description available] | medium | 1 | 0 | 2-benzofurans; cyclic dicarboxylic anhydride; dioxo monocarboxylic acid | allergen; epitope; hapten |
hydroxylamine | [no description available] | medium | 2 | 0 | hydroxylamines | algal metabolite; bacterial xenobiotic metabolite; EC 1.1.3.13 (alcohol oxidase) inhibitor; EC 4.2.1.22 (cystathionine beta-synthase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; nitric oxide donor; nucleophilic reagent |
cesium | [no description available] | medium | 1 | 0 | alkali metal atom | |
ferric ferrocyanide | [no description available] | medium | 1 | 0 | | |
boranes | [no description available] | medium | 3 | 0 | boranes; mononuclear parent hydride | |
boron trichloride | [no description available] | medium | 1 | 0 | | |
ethylene diurea | [no description available] | medium | 1 | 0 | | |
ethane | [no description available] | medium | 2 | 0 | alkane; gas molecular entity | plant metabolite; refrigerant |
mannose | [no description available] | medium | 1 | 0 | D-aldohexose; D-mannose; mannopyranose | metabolite |
strontium | [no description available] | medium | 2 | 0 | alkaline earth metal atom | |
barium | [no description available] | medium | 1 | 0 | alkaline earth metal atom; elemental barium | |
molybdate ion | [no description available] | medium | 1 | 0 | divalent inorganic anion; molybdenum oxoanion | Escherichia coli metabolite |
substance p | [no description available] | medium | 2 | 0 | peptide | neurokinin-1 receptor agonist; neurotransmitter; vasodilator agent |
boric acid | [no description available] | medium | 1 | 0 | boric acids | astringent |
imidazole | [no description available] | medium | 1 | 0 | imidazole | |
stilbenes | [no description available] | medium | 2 | 0 | stilbene | |
phthalocyanine | [no description available] | medium | 1 | 0 | phthalocyanines; tetrapyrrole fundamental parent | |
9,9-bis(4-hydroxyphenyl)fluorene | [no description available] | medium | 1 | 0 | fluorenes; polyphenol | anti-estrogen |
4-phenylbutyric acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | antineoplastic agent; apoptosis inducer; EC 3.5.1.98 (histone deacetylase) inhibitor; prodrug |
tyramine | [no description available] | medium | 1 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
ruthenium dioxide | [no description available] | medium | 1 | 0 | | |
methyl jasmonate | [no description available] | medium | 1 | 0 | | |
cyclopentane | [no description available] | medium | 2 | 0 | cycloalkane; cyclopentanes; volatile organic compound | non-polar solvent |
kaolinite | [no description available] | medium | 1 | 0 | aluminosilicate mineral; mixture | antidiarrhoeal drug; excipient |
1-butyl-2,3-dimethylimidazolium | [no description available] | medium | 1 | 0 | | |
ammonium bromide | [no description available] | medium | 2 | 0 | ammonium salt; bromide salt | NMR chemical shift reference compound |
ochratoxin a | [no description available] | medium | 1 | 0 | isochromanes; monocarboxylic acid amide; N-acyl-L-phenylalanine; organochlorine compound; phenylalanine derivative | Aspergillus metabolite; calcium channel blocker; carcinogenic agent; mycotoxin; nephrotoxin; Penicillium metabolite; teratogenic agent |
zinc oxide | [no description available] | medium | 9 | 0 | zinc molecular entity | |
ether | [no description available] | medium | 1 | 0 | ether; volatile organic compound | inhalation anaesthetic; non-polar solvent; refrigerant |
pentachlorobenzene | [no description available] | medium | 1 | 0 | pentachlorobenzenes | persistent organic pollutant |
dibenzofuran | [no description available] | medium | 1 | 0 | dibenzofurans; mancude organic heterotricyclic parent; polycyclic heteroarene | xenobiotic |
chlorine dioxide | [no description available] | medium | 5 | 0 | chlorine dioxide | |
aluminum hydroxide, magnesium hydroxide, drug combination | [no description available] | medium | 1 | 0 | | |
acrolein | [no description available] | medium | 4 | 0 | enal | herbicide; human xenobiotic metabolite; toxin |
5,5-dimethyl-1-pyrroline-1-oxide | [no description available] | medium | 2 | 0 | 1-pyrroline nitrones | neuroprotective agent; spin trapping reagent |
aluminum nitride | [no description available] | medium | 1 | 0 | nitride | |
cyclohexene | [no description available] | medium | 1 | 0 | cycloalkene | |
4-methyl-4-sulfanylpentan-2-one | [no description available] | medium | 1 | 0 | alkanethiol; methyl ketone | plant metabolite; Saccharomyces cerevisiae metabolite |
3-mercaptohexanol | [no description available] | medium | 1 | 0 | alkanethiol; primary alcohol | flavouring agent; plant metabolite; Saccharomyces cerevisiae metabolite |
2-methyl-3-furanthiol | [no description available] | medium | 1 | 0 | heteroarene | |
phenylalanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
1-hexanol | [no description available] | medium | 1 | 0 | hexanol; primary alcohol | alarm pheromone; antibacterial agent; fragrance; plant metabolite |
singlet oxygen | [no description available] | medium | 2 | 0 | chalcogen; monoatomic oxygen; nonmetal atom | macronutrient |
potassium iodide | [no description available] | medium | 3 | 0 | potassium salt | expectorant; radical scavenger |
ketene | [no description available] | medium | 1 | 0 | ketene | |
potassium metabisulfite | [no description available] | medium | 3 | 0 | | |
2-butene | [no description available] | medium | 1 | 0 | but-2-ene | |
hydroxide ion | [no description available] | medium | 2 | 0 | oxygen hydride | mouse metabolite |
nickel monoxide | [no description available] | medium | 1 | 0 | | |
ferric hydroxide | [no description available] | medium | 1 | 0 | | |
calcium sulfide | [no description available] | medium | 1 | 0 | organic molecular entity | |
methanol | [no description available] | medium | 33 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
copper gluconate | [no description available] | medium | 1 | 0 | organic molecular entity | |
gluconic acid | [no description available] | medium | 1 | 0 | gluconic acid | chelator; Penicillium metabolite |
phenol | [no description available] | medium | 2 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
glutathione disulfide | [no description available] | medium | 2 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
saccharin | [no description available] | medium | 2 | 0 | 1,2-benzisothiazole; N-sulfonylcarboxamide | environmental contaminant; sweetening agent; xenobiotic |
thiamine | [no description available] | medium | 7 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
tryptophan | [no description available] | medium | 1 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
nystatin a1 | [no description available] | medium | 2 | 0 | nystatins | |
phloroglucinol | [no description available] | medium | 1 | 0 | benzenetriol; phenolic donor | algal metabolite |
resorcinol | [no description available] | medium | 1 | 0 | benzenediol; phenolic donor; resorcinols | erythropoietin inhibitor; sensitiser |
cyclopropane | [no description available] | medium | 1 | 0 | cycloalkane; cyclopropanes | inhalation anaesthetic |
sucrose | [no description available] | medium | 7 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
methyl chloride | [no description available] | medium | 4 | 0 | chloromethanes; methyl halides | marine metabolite; mutagen; refrigerant |
atropine | [no description available] | medium | 11 | 1 | | |
lead chloride | [no description available] | medium | 1 | 0 | inorganic chloride; lead coordination entity | |
ammonium sulfate | [no description available] | medium | 3 | 1 | | |
uric acid | [no description available] | medium | 1 | 1 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
carbonyl sulfide | [no description available] | medium | 4 | 0 | one-carbon compound; organosulfur compound | |
2,3,4,6-tetrachlorophenol | [no description available] | medium | 1 | 0 | tetrachlorophenol | xenobiotic metabolite |
2-chlorophenol | [no description available] | medium | 1 | 0 | 2-halophenol; monochlorophenol | |
benzaldehyde | [no description available] | medium | 1 | 0 | benzaldehydes | EC 3.1.1.3 (triacylglycerol lipase) inhibitor; EC 3.5.5.1 (nitrilase) inhibitor; flavouring agent; fragrance; odorant receptor agonist; plant metabolite |
tetrodotoxin | [no description available] | medium | 1 | 0 | azatetracycloalkane; oxatetracycloalkane; quinazoline alkaloid | animal metabolite; bacterial metabolite; marine metabolite; neurotoxin; voltage-gated sodium channel blocker |
carbocysteine | [no description available] | medium | 9 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid | mucolytic |
chenodeoxycholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
laccase | [no description available] | medium | 1 | 0 | | |
baconipyrone c | [no description available] | medium | 1 | 0 | | |
barium sulfate | [no description available] | medium | 4 | 0 | barium salt; inorganic barium salt; metal sulfate | radioopaque medium |
phosphoric acid, trisodium salt | [no description available] | medium | 1 | 0 | sodium phosphate | |
fibrinogen | [no description available] | medium | 2 | 0 | iditol | fungal metabolite |
rifamycin s | [no description available] | medium | 1 | 0 | | |
rifamycins | [no description available] | medium | 1 | 0 | | |
sorbic acid | [no description available] | medium | 6 | 0 | alpha,beta-unsaturated monocarboxylic acid; sorbic acid | |
sodium azide | [no description available] | medium | 1 | 0 | inorganic sodium salt | antibacterial agent; explosive; mitochondrial respiratory-chain inhibitor; mutagen |
triethanolamine | [no description available] | medium | 3 | 0 | amino alcohol; tertiary amino compound; triol | buffer; surfactant |
hexaamminecobalt(ii) | [no description available] | medium | 1 | 0 | | |
p-dimethylaminoazobenzene | [no description available] | medium | 1 | 0 | azobenzenes | |
apoptolidin | [no description available] | medium | 1 | 0 | | |
mustard gas | [no description available] | medium | 1 | 0 | ethyl sulfide; organochlorine compound | alkylating agent; carcinogenic agent; vesicant |
2-chloroethyl ethyl sulfide | [no description available] | medium | 1 | 0 | | |
glyoxal | [no description available] | medium | 1 | 0 | dialdehyde | agrochemical; allergen; pesticide; plant growth regulator |
diphenyl | [no description available] | medium | 1 | 0 | aromatic fungicide; benzenes; biphenyls | antifungal agrochemical; antimicrobial food preservative |
ethanethiol | [no description available] | medium | 1 | 0 | alkanethiol | rodenticide |
vitisin a | [no description available] | medium | 1 | 0 | benzofurans | |
sulfuryl fluoride | [no description available] | medium | 1 | 0 | sulfuryl halide | fumigant insecticide |
tamarixetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | antioxidant; metabolite |
3-methylquercetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | anticoagulant; EC 1.14.18.1 (tyrosinase) inhibitor; metabolite |
isoquercitrin | [no description available] | medium | 1 | 0 | | |
hypobromous acid | [no description available] | medium | 2 | 0 | bromine oxoacid | |
bromates | [no description available] | medium | 2 | 0 | bromine oxoanion; monovalent inorganic anion | |
iodine monochloride | [no description available] | medium | 1 | 0 | | |
iloprost | [no description available] | medium | 1 | 0 | carbobicyclic compound; monocarboxylic acid; secondary alcohol | platelet aggregation inhibitor; vasodilator agent |
pipemidic acid | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; N-arylpiperazine; pyridopyrimidine; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor |
acid phosphatase | [no description available] | medium | 7 | 0 | | |
allyl isothiocyanate | [no description available] | medium | 1 | 0 | alkenyl isothiocyanate; isothiocyanate | antimicrobial agent; antineoplastic agent; apoptosis inducer; lachrymator; metabolite |
carvacrol | [no description available] | medium | 1 | 0 | botanical anti-fungal agent; p-menthane monoterpenoid; phenols | agrochemical; antimicrobial agent; flavouring agent; TRPA1 channel agonist; volatile oil component |
cinnamaldehyde | [no description available] | medium | 1 | 0 | 3-phenylprop-2-enal; cinnamaldehydes | antifungal agent; EC 4.3.1.24 (phenylalanine ammonia-lyase) inhibitor; flavouring agent; hypoglycemic agent; plant metabolite; sensitiser; vasodilator agent |
ferrihydrite | [no description available] | medium | 1 | 0 | | |
n-(9-acridinyl)maleimide | [no description available] | medium | 1 | 0 | | |
capsaicin | [no description available] | medium | 9 | 0 | capsaicinoid | non-narcotic analgesic; TRPV1 agonist; voltage-gated sodium channel blocker |
diethyl malonate | [no description available] | medium | 1 | 0 | dicarboxylic acid | |
triazoles | [no description available] | medium | 1 | 0 | 1,2,3-triazole | |
afdx 116 | [no description available] | medium | 1 | 0 | benzodiazepine | |
pirenzepine | [no description available] | medium | 2 | 1 | pyridobenzodiazepine | anti-ulcer drug; antispasmodic drug; muscarinic antagonist |
glycyl-glycyl-glycyl-glycine | [no description available] | medium | 1 | 0 | | |
ouabain | [no description available] | medium | 1 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
nifedipine | [no description available] | medium | 1 | 0 | C-nitro compound; dihydropyridine; methyl ester | calcium channel blocker; human metabolite; tocolytic agent; vasodilator agent |
1-butyl-3-methylimidazolium chloride | [no description available] | medium | 1 | 0 | | |
1-anilino-8-naphthalenesulfonate | [no description available] | medium | 3 | 0 | aminonaphthalene; naphthalenesulfonic acid | fluorescent probe |
d-alpha tocopherol | [no description available] | medium | 7 | 0 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
sodium dodecyl sulfate | [no description available] | medium | 1 | 0 | organic sodium salt | detergent; protein denaturant |
allicin | [no description available] | medium | 2 | 0 | botanical anti-fungal agent; sulfoxide | antibacterial agent |
potassium bromide | [no description available] | medium | 1 | 0 | potassium salt | |
epidermal growth factor | [no description available] | medium | 2 | 0 | | |
resveratrol | [no description available] | medium | 1 | 0 | resveratrol | antioxidant; phytoalexin; plant metabolite; quorum sensing inhibitor; radical scavenger |
rutin | [no description available] | medium | 1 | 0 | disaccharide derivative; quercetin O-glucoside; rutinoside; tetrahydroxyflavone | antioxidant; metabolite |
cantharidin | [no description available] | medium | 1 | 0 | cyclic dicarboxylic anhydride; monoterpenoid | EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; herbicide |
jasmonic acid | [no description available] | medium | 1 | 0 | oxo monocarboxylic acid | jasmonates; plant metabolite |
abscisic acid | [no description available] | medium | 2 | 0 | 2-trans-abscisic acid | |
cycloheximide | [no description available] | medium | 3 | 0 | antibiotic fungicide; cyclic ketone; dicarboximide; piperidine antibiotic; piperidones; secondary alcohol | anticoronaviral agent; bacterial metabolite; ferroptosis inhibitor; neuroprotective agent; protein synthesis inhibitor |
okadaic acid | [no description available] | medium | 1 | 0 | ketal | |
ethephon | [no description available] | medium | 1 | 0 | phosphonic acids | plant growth regulator |
usnic acid | [no description available] | medium | 1 | 0 | benzofurans | |
toluene 2,4-diisocyanate | [no description available] | medium | 2 | 0 | toluene meta-diisocyanate | allergen; hapten |
aspartic acid | [no description available] | medium | 1 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
homoserine | [no description available] | medium | 1 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
4,5-dimethyl-3-hydroxy-2(5h)-furanone | [no description available] | medium | 1 | 0 | butenolide | metabolite |
agar | [no description available] | medium | 2 | 0 | | |
cromolyn sodium | [no description available] | medium | 19 | 8 | organic sodium salt | anti-asthmatic drug; drug allergen |
acriflavine | [no description available] | medium | 1 | 0 | | |
theophylline | [no description available] | medium | 4 | 2 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
oxatomide | [no description available] | medium | 1 | 0 | benzimidazoles; diarylmethane; N-alkylpiperazine | anti-allergic agent; anti-inflammatory agent; geroprotector; H1-receptor antagonist; serotonergic antagonist |
lodoxamide ethyl | [no description available] | medium | 1 | 0 | | |
oxamic acid | [no description available] | medium | 2 | 0 | dicarboxylic acid monoamide | Escherichia coli metabolite |
aspirin | [no description available] | medium | 2 | 0 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
ketotifen | [no description available] | medium | 1 | 0 | cyclic ketone; olefinic compound; organic heterotricyclic compound; organosulfur heterocyclic compound; piperidines; tertiary amino compound | anti-asthmatic drug; H1-receptor antagonist |
clemastine | [no description available] | medium | 1 | 1 | monochlorobenzenes; N-alkylpyrrolidine | anti-allergic agent; antipruritic drug; H1-receptor antagonist; muscarinic antagonist |
oxalates | [no description available] | medium | 1 | 0 | | |
peroxyacetyl nitrate | [no description available] | medium | 1 | 0 | | |
adenosine diphosphate | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
nitrogenase | [no description available] | medium | 2 | 0 | | |
cytosine | [no description available] | medium | 2 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phosphorus radioisotopes | [no description available] | medium | 1 | 0 | | |
bismuth | [no description available] | medium | 3 | 0 | metal atom; pnictogen | |
chloramphenicol | [no description available] | medium | 1 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
verapamil | [no description available] | medium | 1 | 0 | aromatic ether; nitrile; polyether; tertiary amino compound | |
(2-cyano-3-(methylamino)phenyl)oxoacetic acid sodium salt | [no description available] | medium | 1 | 0 | | |
cortisone | [no description available] | medium | 1 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
isoetharine | [no description available] | medium | 1 | 0 | catecholamine | |
metaproterenol | [no description available] | medium | 6 | 0 | aralkylamino compound; phenylethanolamines; resorcinols; secondary alcohol; secondary amino compound | |
phenobarbital | [no description available] | medium | 1 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
aminopyrine | [no description available] | medium | 1 | 0 | pyrazolone; tertiary amino compound | antipyretic; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
1-propanol | [no description available] | medium | 5 | 0 | propan-1-ols; short-chain primary fatty alcohol | metabolite; protic solvent |
procaine | [no description available] | medium | 1 | 0 | benzoate ester; substituted aniline; tertiary amino compound | central nervous system depressant; drug allergen; local anaesthetic; peripheral nervous system drug |
serine | [no description available] | medium | 1 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
propranolol | [no description available] | medium | 5 | 0 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
methylatropine | [no description available] | medium | 1 | 0 | | |
methyl bromide | [no description available] | medium | 2 | 0 | bromohydrocarbon; bromomethanes; methyl halides | algal metabolite; fumigant insecticide; marine metabolite |
aluminum phosphide | [no description available] | medium | 1 | 0 | | |
carbon tetrachloride | [no description available] | medium | 2 | 0 | chlorocarbon; chloromethanes | hepatotoxic agent; refrigerant |
carbachol | [no description available] | medium | 3 | 0 | ammonium salt; carbamate ester | cardiotonic drug; miotic; muscarinic agonist; nicotinic acetylcholine receptor agonist; non-narcotic analgesic |
sodium nitrite | [no description available] | medium | 1 | 0 | inorganic sodium salt; nitrite salt | antidote to cyanide poisoning; antihypertensive agent; antimicrobial food preservative; food antioxidant; poison |
phosgene | [no description available] | medium | 4 | 0 | acyl chloride | |
2,3-diphosphoglycerate | [no description available] | medium | 1 | 0 | bisphosphoglyceric acid; tetronic acid derivative | human metabolite |
dimethylnitrosamine | [no description available] | medium | 4 | 0 | nitrosamine | geroprotector; mutagen |
bismark brown | [no description available] | medium | 1 | 0 | | |
neutral red | [no description available] | medium | 1 | 0 | hydrochloride | acid-base indicator; dye; two-colour indicator |
clenbuterol | [no description available] | medium | 1 | 0 | amino alcohol; dichlorobenzene; ethanolamines; primary arylamine; secondary amino compound; substituted aniline | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
methacetin | [no description available] | medium | 2 | 0 | acetamides; aromatic ether | |
tetrafluoromethane | [no description available] | medium | 1 | 0 | fluorocarbon; fluoromethanes | refrigerant |
hydrobromic acid | [no description available] | medium | 1 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
diazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; environmental contaminant; sedative; xenobiotic |
azelastine | [no description available] | medium | 1 | 0 | monochlorobenzenes; phthalazines; tertiary amino compound | anti-allergic agent; anti-asthmatic drug; bronchodilator agent; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; H1-receptor antagonist; platelet aggregation inhibitor |
chrysotile | [no description available] | medium | 2 | 0 | | |
bradykinin | [no description available] | medium | 2 | 0 | oligopeptide | human blood serum metabolite; vasodilator agent |
nedocromil | [no description available] | medium | 4 | 2 | dicarboxylic acid; organic heterotricyclic compound | anti-allergic agent; anti-asthmatic drug; non-steroidal anti-inflammatory drug |
carbostyril | [no description available] | medium | 3 | 1 | monohydroxyquinoline; quinolone | bacterial xenobiotic metabolite |
thioacetic acid | [no description available] | medium | 1 | 0 | thioacetic acid | |
allopurinol | [no description available] | medium | 2 | 0 | nucleobase analogue; organic heterobicyclic compound | antimetabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor; gout suppressant; radical scavenger |
xanthine | [no description available] | medium | 1 | 0 | xanthine | Saccharomyces cerevisiae metabolite |
hexamethyldisiloxane | [no description available] | medium | 1 | 0 | organosiloxane | |
indomethacin | [no description available] | medium | 1 | 1 | aromatic ether; indole-3-acetic acids; monochlorobenzenes; N-acylindole | analgesic; drug metabolite; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; gout suppressant; non-steroidal anti-inflammatory drug; xenobiotic metabolite; xenobiotic |
strontium nitrate | [no description available] | medium | 1 | 0 | | |
adenosine | [no description available] | medium | 2 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
dalteparin | [no description available] | medium | 1 | 0 | | |
cyanogen | [no description available] | medium | 1 | 0 | dinitrile; pseudohalogen | |
sodium lactate | [no description available] | medium | 1 | 0 | lactate salt; organic sodium salt | food acidity regulator; food preservative |
sodium citrate, anhydrous | [no description available] | medium | 1 | 0 | organic sodium salt | anticoagulant; flavouring agent |
neurokinin a | [no description available] | medium | 1 | 0 | | |
ici 204,219 | [no description available] | medium | 1 | 1 | carbamate ester; indoles; N-sulfonylcarboxamide | anti-asthmatic agent; leukotriene antagonist |
peroxynitric acid | [no description available] | medium | 1 | 0 | nitrogen oxoacid | |
clozapine | [no description available] | medium | 1 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine; organochlorine compound | adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; GABA antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; xenobiotic |
cetylpyridinium | [no description available] | medium | 1 | 0 | pyridinium ion | |
betaine | [no description available] | medium | 1 | 0 | amino-acid betaine; glycine derivative | fundamental metabolite |
berotek | [no description available] | medium | 1 | 0 | resorcinols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent; tocolytic agent |
fumonisin b1 | [no description available] | medium | 1 | 0 | diester; fumonisin; primary amino compound; triol | carcinogenic agent; metabolite |
vanadates | [no description available] | medium | 1 | 0 | trivalent inorganic anion; vanadium oxoanion | EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor |
alloxan | [no description available] | medium | 1 | 0 | pyrimidone | hyperglycemic agent; metabolite |
benzoic acid | [no description available] | medium | 3 | 0 | benzoic acids | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
fucose | [no description available] | medium | 3 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
adenosine monophosphate | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | adenosine A1 receptor agonist; cofactor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.11 (fructose-bisphosphatase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
phosphatidylcholines | [no description available] | medium | 3 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
montelukast | [no description available] | medium | 1 | 1 | aliphatic sulfide; monocarboxylic acid; quinolines | anti-arrhythmia drug; anti-asthmatic drug; leukotriene antagonist |
glutaral | [no description available] | medium | 2 | 0 | dialdehyde | cross-linking reagent; disinfectant; fixative |
nad | [no description available] | medium | 4 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
nadp | [no description available] | medium | 3 | 0 | | |
ambroxol | [no description available] | medium | 2 | 0 | aromatic amine | |
tricalcium phosphate | [no description available] | medium | 1 | 0 | calcium phosphate | |
calcium phosphate, dibasic, anhydrous | [no description available] | medium | 1 | 0 | calcium phosphate | |
calcium phosphate, monobasic, anhydrous | [no description available] | medium | 1 | 0 | calcium phosphate | fertilizer |
calcium pyrophosphate | [no description available] | medium | 1 | 0 | | |
triflusulfuron-methyl | [no description available] | medium | 1 | 0 | 1,3,5-triazines; aromatic ether; benzoate ester; methyl ester; N-sulfonylurea; organofluorine compound; tertiary amino compound | agrochemical; EC 2.2.1.6 (acetolactate synthase) inhibitor; proherbicide |
potassium permanganate | [no description available] | medium | 1 | 0 | | |
thymolphthalein | [no description available] | medium | 1 | 0 | terpene lactone | |
thymol blue | [no description available] | medium | 1 | 0 | | |
deuterium | [no description available] | medium | 5 | 0 | dihydrogen | |
barium nitrate | [no description available] | medium | 1 | 0 | inorganic barium salt; inorganic nitrate salt | |
trichloroacetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
potassium hydroxide | [no description available] | medium | 2 | 0 | alkali metal hydroxide | |
furfuryl alcohol | [no description available] | medium | 1 | 0 | furans; primary alcohol | Maillard reaction product |
mitomycin | [no description available] | medium | 1 | 0 | mitomycin | alkylating agent; antineoplastic agent |
metaperiodate | [no description available] | medium | 1 | 0 | iodine oxoacid | |
acridines | [no description available] | medium | 5 | 0 | acridines; mancude organic heterotricyclic parent; polycyclic heteroarene | genotoxin |
dichlorvos | [no description available] | medium | 1 | 0 | alkenyl phosphate; dialkyl phosphate; organochlorine acaricide; organophosphate insecticide | anthelminthic drug; antibacterial agent; antifungal agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor |
ethylene oxide | [no description available] | medium | 2 | 0 | gas molecular entity; oxacycle; saturated organic heteromonocyclic parent | allergen; mouse metabolite; mutagen |
etidocaine | [no description available] | medium | 1 | 1 | amino acid amide | local anaesthetic |
enbucrilate | [no description available] | medium | 2 | 1 | alpha,beta-unsaturated monocarboxylic acid; nitrile | |
tartrazine | [no description available] | medium | 3 | 1 | | |
thymidine | [no description available] | medium | 2 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
kanamycin a | [no description available] | medium | 1 | 0 | kanamycins | bacterial metabolite |
oxyquinoline | [no description available] | medium | 1 | 0 | monohydroxyquinoline | antibacterial agent; antifungal agrochemical; antiseptic drug; iron chelator |
meprobamate | [no description available] | medium | 1 | 0 | organic molecular entity | |
thallium | [no description available] | medium | 1 | 0 | boron group element atom | |
methaqualone | [no description available] | medium | 1 | 0 | quinazolines | GABA agonist; sedative |
hydralazine | [no description available] | medium | 1 | 0 | azaarene; hydrazines; ortho-fused heteroarene; phthalazines | antihypertensive agent; vasodilator agent |
disulfiram | [no description available] | medium | 1 | 0 | organic disulfide; organosulfur acaricide | angiogenesis inhibitor; antineoplastic agent; apoptosis inducer; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; EC 3.1.1.1 (carboxylesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; ferroptosis inducer; fungicide; NF-kappaB inhibitor |
ddt | [no description available] | medium | 4 | 0 | benzenoid aromatic compound; chlorophenylethane; monochlorobenzenes; organochlorine insecticide | bridged diphenyl acaricide; carcinogenic agent; endocrine disruptor; persistent organic pollutant |
thalidomide | [no description available] | medium | 1 | 0 | phthalimides; piperidones | |
isoniazid | [no description available] | medium | 2 | 0 | carbohydrazide | antitubercular agent; drug allergen |
galactose | [no description available] | medium | 2 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
hydrogen carbonate | [no description available] | medium | 3 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
normorphine hydrochloride | [no description available] | medium | 1 | 0 | amino alcohol | |
technetium | [no description available] | medium | 3 | 0 | manganese group element atom | |
thromboxane a2 | [no description available] | medium | 1 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
folic acid | [no description available] | medium | 1 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
polonium | [no description available] | medium | 2 | 0 | chalcogen; metal atom | |
vanillin | [no description available] | medium | 1 | 0 | benzaldehydes; monomethoxybenzene; phenols | anti-inflammatory agent; anticonvulsant; antioxidant; flavouring agent; plant metabolite |
sodium oxybate | [no description available] | medium | 1 | 0 | | |
methylprednisolone | [no description available] | medium | 2 | 0 | 6-methylprednisolone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antiemetic; environmental contaminant; neuroprotective agent; xenobiotic |
arachidonic acid | [no description available] | medium | 1 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
p-aminoazobenzene | [no description available] | medium | 1 | 0 | | |
arsine | [no description available] | medium | 1 | 0 | arsanes; arsine; mononuclear parent hydride | |
7,8-dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide | [no description available] | medium | 1 | 0 | epoxide | intercalator |
parathion | [no description available] | medium | 1 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; avicide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; mouse metabolite |
n-acetylneuraminic acid | [no description available] | medium | 1 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
(9R)-9-chloro-11,17-dihydroxy-17-(2-hydroxy-1-oxoethyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | [no description available] | medium | 1 | 1 | 21-hydroxy steroid | |
sodium sulfide | [no description available] | medium | 1 | 0 | | |
n-nitrosopyrrolidine | [no description available] | medium | 1 | 0 | pyrrolidines | |
n-nitrosomorpholine | [no description available] | medium | 1 | 0 | nitrosamine | carcinogenic agent; mutagen |
n-nitrosopiperidine | [no description available] | medium | 1 | 0 | nitrosamine; piperidine | apoptosis inducer; carcinogenic agent; environmental contaminant; mutagen |
diethylnitrosamine | [no description available] | medium | 1 | 0 | nitrosamine | carcinogenic agent; hepatotoxic agent; mutagen |
24,25-dihydroxyvitamin d 3 | [no description available] | medium | 1 | 0 | | |
pilocarpine | [no description available] | medium | 1 | 0 | pilocarpine | antiglaucoma drug |
pentetic acid | [no description available] | medium | 1 | 0 | pentacarboxylic acid | copper chelator |
technetium tc 99m pentetate | [no description available] | medium | 1 | 0 | | |
carbazole | [no description available] | medium | 1 | 0 | carbazole | |
leucine | [no description available] | medium | 1 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
gallium | [no description available] | medium | 2 | 0 | boron group element atom | |
1-nitropyrene | [no description available] | medium | 1 | 0 | nitroarene | carcinogenic agent |
ibuprofen | [no description available] | medium | 1 | 0 | monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; radical scavenger; xenobiotic |
magnesium sulfate | [no description available] | medium | 1 | 0 | magnesium salt; metal sulfate; organic magnesium salt | anaesthetic; analgesic; anti-arrhythmia drug; anticonvulsant; calcium channel blocker; cardiovascular drug; fertilizer; tocolytic agent |
methyl(acetoxymethyl)nitrosamine | [no description available] | medium | 1 | 0 | | |
muscarine | [no description available] | medium | 1 | 1 | monosaccharide | |
2,6-diisocyanatotoluene | [no description available] | medium | 1 | 0 | toluene meta-diisocyanate | allergen; hapten |
methylnitronitrosoguanidine | [no description available] | medium | 2 | 0 | nitroso compound | alkylating agent |
bupivacaine | [no description available] | medium | 1 | 0 | aromatic amide; piperidinecarboxamide; tertiary amino compound | |
bromhexine | [no description available] | medium | 1 | 0 | organobromine compound; substituted aniline; tertiary amino compound | mucolytic |
phenyl biguanide | [no description available] | medium | 2 | 0 | guanidines | central nervous system drug |
biguanides | [no description available] | medium | 3 | 0 | guanidines | |
luminol | [no description available] | medium | 1 | 0 | | |
methyl isobutyl ketone | [no description available] | medium | 1 | 0 | ketone | |
methyl n-butyl ketone | [no description available] | medium | 1 | 0 | ketone | |
thionyl chloride | [no description available] | medium | 1 | 0 | chlorine molecular entity; sulfinyl halide | |
cupric hydroxide | [no description available] | medium | 1 | 0 | organic molecular entity | |
retinol | [no description available] | medium | 3 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
glucuronic acid | [no description available] | medium | 1 | 0 | D-glucuronic acid | algal metabolite |
strontium radioisotopes | [no description available] | medium | 1 | 0 | | |
amygdalin | [no description available] | medium | 1 | 0 | | |
ephedrine | [no description available] | medium | 1 | 0 | phenethylamine alkaloid; phenylethanolamines | bacterial metabolite; environmental contaminant; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
glutathione sulfonate | [no description available] | medium | 2 | 0 | L-cysteine derivative; S-substituted glutathione; tripeptide | |
salicylates | [no description available] | medium | 1 | 0 | monohydroxybenzoate | plant metabolite |
acrylamide | [no description available] | medium | 1 | 0 | acrylamides; N-acylammonia; primary carboxamide | alkylating agent; carcinogenic agent; Maillard reaction product; mutagen; neurotoxin |
tetradecanoylphorbol acetate | [no description available] | medium | 1 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
gallium oxide | [no description available] | medium | 1 | 0 | | |
glycogen | [no description available] | medium | 2 | 0 | | |
trypan blue | [no description available] | medium | 1 | 0 | | |
ergothioneine | [no description available] | medium | 1 | 0 | 1,3-dihydroimidazole-2-thiones; amino-acid betaine; L-histidine derivative; sulfur-containing amino acid | antioxidant; chelator; fungal metabolite; plant metabolite; xenobiotic metabolite |
1,7-phenanthroline | [no description available] | medium | 1 | 0 | phenanthroline | |
hyaluronoglucosaminidase | [no description available] | medium | 1 | 0 | | |
guanine | [no description available] | medium | 1 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
heparitin sulfate | [no description available] | medium | 1 | 0 | | |
chondroitin | [no description available] | medium | 1 | 0 | | |
lysine | [no description available] | medium | 2 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
cytidine | [no description available] | medium | 1 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thiamine pyrophosphate | [no description available] | medium | 1 | 0 | organic chloride salt; vitamin B1 | |
vitamin k semiquinone radical | [no description available] | medium | 1 | 0 | | |
prednisolone | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
promethazine | [no description available] | medium | 1 | 0 | phenothiazines; tertiary amine | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; H1-receptor antagonist; local anaesthetic; sedative |
niacinamide | [no description available] | medium | 1 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
ethidium | [no description available] | medium | 1 | 0 | phenanthridines | fluorochrome; intercalator |
cyclamic acid | [no description available] | medium | 2 | 0 | sulfamic acids | environmental contaminant; human xenobiotic metabolite |
diethylcarbamazine | [no description available] | medium | 1 | 0 | N-carbamoylpiperazine; N-methylpiperazine | |
cyanates | [no description available] | medium | 1 | 0 | | |
thorium | [no description available] | medium | 1 | 0 | actinoid atom; f-block element atom | |
radium | [no description available] | medium | 1 | 0 | alkaline earth metal atom | |
cystine | [no description available] | medium | 2 | 0 | | |
glutamine | [no description available] | medium | 1 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
gossypol | [no description available] | medium | 1 | 0 | | |
dieldrin | [no description available] | medium | 1 | 0 | epoxide; organochlorine compound; organochlorine insecticide | carcinogenic agent; xenobiotic |
thiourea | [no description available] | medium | 1 | 0 | one-carbon compound; thioureas; ureas | antioxidant; chromophore |
alanine | [no description available] | medium | 1 | 0 | alanine zwitterion; alanine; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; fundamental metabolite |
uracil | [no description available] | medium | 1 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
scopolamine hydrobromide | [no description available] | medium | 2 | 0 | | |
meperidine | [no description available] | medium | 1 | 0 | ethyl ester; piperidinecarboxylate ester; tertiary amino compound | antispasmodic drug; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
chlorpromazine | [no description available] | medium | 1 | 0 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
brompheniramine | [no description available] | medium | 1 | 0 | organobromine compound; pyridines | anti-allergic agent; H1-receptor antagonist |
promazine | [no description available] | medium | 1 | 0 | phenothiazines; tertiary amine | antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; muscarinic antagonist; phenothiazine antipsychotic drug; serotonergic antagonist |
benzphetamine | [no description available] | medium | 1 | 0 | amphetamines; tertiary amine | adrenergic uptake inhibitor; appetite depressant; dopamine uptake inhibitor; sympathomimetic agent |
nitrophenols | [no description available] | medium | 1 | 0 | | |
thiopental | [no description available] | medium | 1 | 0 | barbiturates | anticonvulsant; drug allergen; environmental contaminant; intravenous anaesthetic; sedative; xenobiotic |
glycosides | [no description available] | medium | 1 | 0 | | |
tolbutamide | [no description available] | medium | 1 | 0 | N-sulfonylurea | human metabolite; hypoglycemic agent; insulin secretagogue; potassium channel blocker |
fenoxycarb | [no description available] | medium | 1 | 0 | aromatic ether; carbamate ester | environmental contaminant; insecticide; juvenile hormone mimic; xenobiotic |
fomesafen | [no description available] | medium | 28 | 0 | aromatic ether; C-nitro compound; monochlorobenzenes; N-sulfonylcarboxamide; organofluorine compound; phenols | agrochemical; EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor; herbicide |
apnea | [no description available] | medium | 2 | 0 | purine nucleoside | |
nicosulfuron | [no description available] | medium | 1 | 0 | N-sulfonylurea; pyridines; pyrimidines | environmental contaminant; herbicide; xenobiotic |
trazodone hydrochloride | [no description available] | medium | 25 | 0 | hydrochloride | adrenergic antagonist; antidepressant; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
methyl salicylate | [no description available] | medium | 3 | 1 | benzoate ester; methyl ester; salicylates | flavouring agent; insect attractant; metabolite |
benzothiazide | [no description available] | medium | 1 | 1 | benzothiadiazine; sulfonamide | antihypertensive agent; diuretic |
exudates | [no description available] | medium | 7 | 0 | | |
s,n,n'-tripropylthiocarbamate | [no description available] | medium | 1 | 0 | tertiary amine | |
4-methoxyamphetamine | [no description available] | medium | 1 | 0 | | |
cetylpyridinium chloride anhydrous | [no description available] | medium | 19 | 0 | chloride salt; organic chloride salt | antiseptic drug; surfactant |
furosemide | [no description available] | medium | 2 | 0 | chlorobenzoic acid; furans; sulfonamide | environmental contaminant; loop diuretic; xenobiotic |
clove | [no description available] | medium | 1 | 0 | | |
eye | [no description available] | medium | 2 | 0 | | |
guaifenesin | [no description available] | medium | 46 | 0 | methoxybenzenes | |
phenylephrine hydrochloride | [no description available] | medium | 12 | 0 | hydrochloride | |
rome | [no description available] | medium | 3 | 0 | 2-amino-2-(methoxymethyl)-4-(4-octylphenyl)butan-1-ol | EC 2.7.1.91 (sphingosine kinase) inhibitor |
sabinene | [no description available] | medium | 3 | 1 | thujene | plant metabolite |
isomethyleugenol | [no description available] | medium | 1 | 0 | isomethyleugenol | |
chlorpyrifos | [no description available] | medium | 1 | 0 | chloropyridine; organic thiophosphate | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; insecticide; xenobiotic |
hexachloroethane | [no description available] | low | 0 | 0 | chlorocarbon; chloroethanes | carcinogenic agent; refrigerant |
bromoethane | [no description available] | low | 0 | 0 | bromoalkane; bromohydrocarbon; volatile organic compound | alkylating agent; carcinogenic agent; local anaesthetic; refrigerant; solvent |
methylene chloride | [no description available] | low | 0 | 0 | chloromethanes; volatile organic compound | carcinogenic agent; polar aprotic solvent; refrigerant |
fluoroform | [no description available] | low | 0 | 0 | fluoromethanes | refrigerant |
1,1,2-trichloro-1,2,2-trifluoroethane | [no description available] | low | 0 | 0 | chlorofluorocarbon; haloalkane | NMR solvent; refrigerant |
perfluoroethane | [no description available] | low | 0 | 0 | fluoroalkane; fluorocarbon | refrigerant |
isopentane | [no description available] | low | 0 | 0 | alkane | refrigerant |
butane | [no description available] | low | 0 | 0 | alkane; gas molecular entity | food propellant; refrigerant |
methyl formate | [no description available] | low | 0 | 0 | formate ester; methyl ester; volatile organic compound | fumigant; insecticide; polar aprotic solvent; refrigerant |
propylene | [no description available] | low | 0 | 0 | alkene; gas molecular entity | refrigerant; xenobiotic |
fluoromethane | [no description available] | low | 0 | 0 | fluorohydrocarbon; fluoromethanes; methyl halides | refrigerant |
monoisopropanolamine | [no description available] | low | 0 | 0 | amino alcohol; secondary alcohol | Escherichia coli metabolite |
dihydro-3-coumaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid | Escherichia coli metabolite; human xenobiotic metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
5,6,7,8-tetrahydropteridine | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
allantoin | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
arsenic acid | [no description available] | low | 0 | 0 | arsenic oxoacid | Escherichia coli metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
carbamic acid | [no description available] | low | 0 | 0 | carbon oxoacid; one-carbon compound; organonitrogen compound | Escherichia coli metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
2-aminoacetaldehyde | [no description available] | low | 0 | 0 | amino aldehyde; omega-aminoaldehyde | Escherichia coli metabolite |
2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; amino acid zwitterion; beta-amino acid; diamino acid; non-proteinogenic alpha-amino acid | Escherichia coli metabolite |
oxaluric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; ureas | Escherichia coli metabolite |
n(1)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; metabolite |
propionaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; propanals | Escherichia coli metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1,4-dihydroxy-2-naphthoic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; naphthalenediols; naphthohydroquinone; naphthoic acid | Escherichia coli metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
toxopyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
thiocyanic acid | [no description available] | low | 0 | 0 | hydracid; one-carbon compound; organosulfur compound | Escherichia coli metabolite |
hydroquinone | [no description available] | low | 0 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
iminoaspartic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; ketimine | Escherichia coli metabolite |
indole | [no description available] | low | 0 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
niacin | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
hydroxypyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
orotic acid | [no description available] | low | 0 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
diphosphoric acid | [no description available] | low | 0 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | Escherichia coli metabolite |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxal phosphate | [no description available] | low | 0 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
quinolinic acid | [no description available] | low | 0 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
sarcosine | [no description available] | low | 0 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
taurine | [no description available] | low | 0 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
thymine | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
trimethyloxamine | [no description available] | low | 0 | 0 | tertiary amine oxide | Escherichia coli metabolite; metabolite; osmolyte |
trimethylamine | [no description available] | low | 0 | 0 | methylamines; tertiary amine | Escherichia coli metabolite; human xenobiotic metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
beta-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
4-cresol | [no description available] | low | 0 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
sorbitol | [no description available] | low | 0 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
uridine monophosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine monophosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
uridine triphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine triphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
mannitol | [no description available] | low | 0 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
valine | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
threonine | [no description available] | low | 0 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
isoleucine | [no description available] | low | 0 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
arginine | [no description available] | low | 0 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
framycetin | [no description available] | low | 0 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
shikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
1,3,4-butanetriol | [no description available] | low | 0 | 0 | triol | bacterial xenobiotic metabolite; Escherichia coli metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
myrmicacin | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; medium-chain fatty acid | antimitotic; Escherichia coli metabolite |
phosphotyrosine | [no description available] | low | 0 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid; O(4)-phosphotyrosine | Escherichia coli metabolite; immunogen |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
acetylgalactosamine | [no description available] | low | 0 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
aica ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
n-(3-aminopropyl)cadaverine | [no description available] | low | 0 | 0 | polyazaalkane; triamine | Escherichia coli metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
hydracrylic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
D-serine | [no description available] | low | 0 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
D-tyrosine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; tyrosine | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
coenzyme a | [no description available] | low | 0 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
L-2-aminoadipic acid | [no description available] | low | 0 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
3'-uridylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 3'-monophosphate; uridine phosphate | Escherichia coli metabolite |
2',3'-cyclic amp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
2,5-diketogluconic acid | [no description available] | low | 0 | 0 | diketoaldonic acid | Escherichia coli metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
selenodiglutathione | [no description available] | low | 0 | 0 | glutathione derivative; thioselenide | Escherichia coli metabolite; metabolite |
2-deoxyglucose-6-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | Escherichia coli metabolite; Mycoplasma genitalium metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
thymidine diphosphate-l-rhamnose | [no description available] | low | 0 | 0 | dTDP-L-rhamnose | Escherichia coli metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
trehalose-6-phosphate | [no description available] | low | 0 | 0 | trehalose phosphate | Escherichia coli metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
aerobactin | [no description available] | low | 0 | 0 | L-lysine derivative | Escherichia coli metabolite; siderophore; virulence factor |
lipid x | [no description available] | low | 0 | 0 | N-acyl-D-glucosamine 1-phosphate | Escherichia coli metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glutamate-1-semialdehyde | [no description available] | low | 0 | 0 | 5-oxo monocarboxylic acid; amino acid zwitterion; gamma-amino acid; glutamic semialdehyde | Escherichia coli metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
o-phosphohomoserine | [no description available] | low | 0 | 0 | O-phosphorylhomoserine | Escherichia coli metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
2,3-dihydroxybenzoylserine | [no description available] | low | 0 | 0 | L-serine derivative | Escherichia coli metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
beta-aspartyl phosphate | [no description available] | low | 0 | 0 | aminoacyl phosphate; L-aspartic acid derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
abrine | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-methyl-L-alpha-amino acid zwitterion; N-methyl-L-alpha-amino acid | Escherichia coli metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-deoxy-d-arabino-heptulosonate-7-phosphate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
glucosamine 1-phosphate | [no description available] | low | 0 | 0 | glucosamine phosphate | Escherichia coli metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
9-mercaptodethiobiotin | [no description available] | low | 0 | 0 | imidazolidinone; monocarboxylic acid; thiol; ureas | Escherichia coli metabolite |
idonic acid | [no description available] | low | 0 | 0 | idonic acid | Escherichia coli metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxythreonine | [no description available] | low | 0 | 0 | amino acid zwitterion; hydroxy-amino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite |
2-oxo-3-deoxygalactonic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
arabinose | [no description available] | low | 0 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
ribose 1-phosphate | [no description available] | low | 0 | 0 | D-ribose 1-phosphate | Escherichia coli metabolite |
diaminopimelic acid | [no description available] | low | 0 | 0 | 2,6-diaminopimelic acid; amino acid zwitterion | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
3-dehydroquinic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 4-hydroxy monocarboxylic acid; 4-oxo monocarboxylic acid; 5-hydroxy monocarboxylic acid; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
o-succinylhomoserine | [no description available] | low | 0 | 0 | hemisuccinate; o-succinylhomoserine | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
cysteinylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
s-ribosyl-l-homocysteine | [no description available] | low | 0 | 0 | S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | Escherichia coli metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | [no description available] | low | 0 | 0 | diadenosyl pentaphosphate | Escherichia coli metabolite; vasoconstrictor agent |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
glutathionylspermidine | [no description available] | low | 0 | 0 | glutathione derivative | Escherichia coli metabolite |
arbutin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
2-c-methylerythritol 4-phosphate | [no description available] | low | 0 | 0 | tetritol phosphate | Escherichia coli metabolite |
1-deoxy-d-xylulose 5-phosphate | [no description available] | low | 0 | 0 | xylulose phosphate | Escherichia coli metabolite |
c(alpha)-formylglycine | [no description available] | low | 0 | 0 | 3-oxoalanine; amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
palmitoleic acid | [no description available] | low | 0 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
sucrose-6-phosphate | [no description available] | low | 0 | 0 | disaccharide phosphate | Escherichia coli metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
fusidic acid | [no description available] | low | 0 | 0 | 11alpha-hydroxy steroid; 3alpha-hydroxy steroid; alpha,beta-unsaturated monocarboxylic acid; steroid acid; steroid antibiotic; sterol ester | EC 2.7.1.33 (pantothenate kinase) inhibitor; Escherichia coli metabolite; protein synthesis inhibitor |
iminoglycine | [no description available] | low | 0 | 0 | dehydroamino acid; imine; zwitterion | Escherichia coli metabolite |
2-keto-3-deoxy-6-phosphogluconate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
formyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | [no description available] | low | 0 | 0 | lipid As | Escherichia coli metabolite |
phosphothreonine | [no description available] | low | 0 | 0 | L-threonine derivative; non-proteinogenic L-alpha-amino acid; O-phosphoamino acid | Escherichia coli metabolite |
maleamic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dicarboxylic acid monoamide | bacterial xenobiotic metabolite; Escherichia coli metabolite |
retinol palmitate | [no description available] | low | 0 | 0 | all-trans-retinyl ester; retinyl palmitate | antioxidant; Escherichia coli metabolite; human xenobiotic metabolite |
canthaxanthin | [no description available] | low | 0 | 0 | carotenone | biological pigment; Escherichia coli metabolite; food colouring; fungal metabolite |
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; phosphoantigen |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
5-ketogluconic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
menaquinone 9 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite |
allolactose | [no description available] | low | 0 | 0 | glycosylglucose | Escherichia coli metabolite |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
1-deoxy-2-pentulose | [no description available] | low | 0 | 0 | deoxypentose | Escherichia coli metabolite |
fructosyl-lysine | [no description available] | low | 0 | 0 | fructosamine; glyco-amino acid | Escherichia coli metabolite |
lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid A; tetradecanoate ester | Escherichia coli metabolite |
methionine sulfoxide | [no description available] | low | 0 | 0 | amino acid zwitterion; L-methionine S-oxide | Escherichia coli metabolite |
(S)-4,5-dihydroxypentane-2,3-dione | [no description available] | low | 0 | 0 | alpha-diketone; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
kdo2-lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid As; tetradecanoate ester | Escherichia coli metabolite |
oxalyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
novobiocin | [no description available] | low | 0 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine monophosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
guanosine triphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
guanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
inosine | [no description available] | low | 0 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inosine triphosphate | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
queuine | [no description available] | low | 0 | 0 | pyrrolopyrimidine | Escherichia coli metabolite |
3'-guanylic acid | [no description available] | low | 0 | 0 | guanosine 3'-phosphate; purine ribonucleoside 3'-monophosphate | Escherichia coli metabolite |
2',3'-cyclic gmp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
rifampin | [no description available] | low | 0 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
leucovorin | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
colibactin | [no description available] | low | 0 | 0 | 1,3-thiazoles; azaspiro compound; polyketide; pyrroline; secondary carboxamide | alkylating agent; carcinogenic agent; Escherichia coli metabolite; genotoxin |
peroxymonosulfate | [no description available] | low | 0 | 0 | sulfur oxide; sulfur oxoanion | |