Page last updated: 2024-08-05 14:21:50
Escherichia coli metabolite
Any bacterial metabolite produced during a metabolic reaction in Escherichia coli.
ChEBI ID: 76971
Members (337)
Member | Definition | Class |
---|---|---|
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | A prenol phosphate comprising (2E)-4-hydroxy-3-methylbut-2-en-1-ol having an O-diphosphate substituent. | (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate |
(S)-4,5-dihydroxypentane-2,3-dione | Pentane substituted at the 2- and 3-positions by oxo groups, at the 4- and 5-positions by hydroxy groups and with S stereoconfiguration at C-4. | (S)-4,5-dihydroxypentane-2,3-dione |
1-deoxy-2-pentulose | 1-deoxy-D-xylulose | |
1-deoxy-d-xylulose 5-phosphate | The 5-phospho derivative of 1-deoxy-D-xylulose. | 1-deoxy-D-xylulose 5-phosphate |
1,3,4-butanetriol | A triol that is butane carrying three hydroxy substituents at position 1, 2 and 4. | 1,2,4-butanetriol |
1,4-dihydroxy-2-naphthoic acid | A naphthoic acid that is 2-naphthoic acid substituted by hydroxy groups at positions 1 and 4. | 1,4-dihydroxy-2-naphthoic acid |
1,5-dihydro-fad | FADH2 | |
10-formyltetrahydrofolate | A form of tetrahydrofolate that acts as a donor of formyl groups in anabolism. In these reactions 10-formyltetrahydrofolic acid is used as a substrate in formyltransferase reactions, which is important in purine biosynthesis. | 10-formyltetrahydrofolic acid |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | A 1,3-thiazole that is thiazole substituted by a methyl group at position 4 and a 2-hydroxyethyl group at position 5. | 5-(2-hydroxyethyl)-4-methylthiazole |
2-aminoacetaldehyde | An amino aldehyde that is acetaldehyde in which one of the hydrogens of the methyl group has been replaced by an amino group. | 2-aminoacetaldehyde |
2-c-methylerythritol 4-phosphate | 2-C-methyl-D-erythritol 4-(dihydrogen phosphate) | |
2-deoxyglucose-6-phosphate | A deoxyaldohexose phosphate comprising 2-deoxy-D-glucose having the phosphate group at the 6-position. | 2-deoxy-D-glucose 6-phosphate |
2-keto-3-deoxy-6-phosphogluconate | The 5-phospho derivative of 2-dehydro-D-gluconic acid. | 2-dehydro-3-deoxy-6-phospho-D-gluconic acid |
2-oxo-3-deoxygalactonic acid | The 2-dehydro-3-deoxy derivative of D-galactonic acid. | 2-dehydro-3-deoxy-D-galactonic acid |
2,3-diaminopropionic acid | A diamino acid that is alanine in which one of the hydrogens of the methyl group is replaced by an amino group. | 3-aminoalanine zwitterion; 3-aminoalanine |
2,3-dihydroxybenzoylserine | N-(2,3-dihydroxybenzoyl)-L-serine | |
2,5-diketogluconic acid | 2,5-didehydro-D-gluconic acid | |
2'-deoxyadenosine | A purine 2'-deoxyribonucleoside having adenine as the nucleobase. | 2'-deoxyadenosine |
2'-deoxyadenosine triphosphate | A purine 2'-deoxyribonucleoside 5'-triphosphate having adenine as the nucleobase. | dATP |
2'-deoxyadenosine triphosphate | A purine 2'-deoxyribonucleoside 5'-diphosphate having adenine as the nucleobase. | dADP |
2'-deoxycytidine 5'-triphosphate | A 2'-deoxycytidine phosphate having cytosine as the nucleobase. | dCTP |
2'-deoxycytidine diphosphate | A 2'-deoxycytidine phosphate that is the 2'- deoxy derivative of cytidine 5'-diphosphate (CDP). | dCDP |
2'-deoxyguanosine 5'-phosphate | A purine 2'-deoxyribonucleoside 5'-monophosphate having guanine as the nucleobase. | 2'-deoxyguanosine 5'-monophosphate |
2'-deoxyinosine triphosphate | A deoxyinosine phosphate compound having a triphosphate group at the 5'-position. | dITP |
2'-deoxyuridylic acid | A pyrimidine 2'-deoxyribonucleoside 5'-monophosphate having uracil as the nucleobase. | dUMP |
2',3'-cyclic amp | 2',3'-cyclic AMP | |
2',3'-cyclic gmp | A 2',3'-cyclic purine nucleotide in which guanosine is used as the parent nucleoside. | 2',3'-cyclic GMP |
3-dehydroquinic acid | A 4-oxo monocarboxylic acid derived from quinic acid by oxidation of the hydroxy group at position 3 to the corresponding keto group. | 3-dehydroquinic acid |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | Lipid IVA glycosylated with two 3-deoxy-D-manno-octulosonic acid (KDO) residues. | (KDO)2-lipid IVA |
3-deoxy-d-arabino-heptulosonate-7-phosphate | A ketoaldonic acid phosphate consisting of 2-dehydro-3-deoxy-D-arabino-heptonic acid having a phospho group at the 7-position. | 7-phospho-2-dehydro-3-deoxy-D-arabino-heptonic acid |
3-mercaptopyruvic acid | A 2-oxo monocarboxylic acid that is pyruvic acid substituted by a sulfanyl group at position 3. | 3-mercaptopyruvic acid |
3,3-dimethylallyl pyrophosphate | A prenol phosphate that is a phosphoantigen comprising the O-pyrophosphate of prenol. | prenyl diphosphate |
3,4-dihydroxyphenylacetaldehyde | A phenylacetaldehyde in which the 3 and 4 positions of the phenyl group are substituted by hydroxy groups. | 3,4-dihydroxyphenylacetaldehyde |
3'-cmp | A cytidine 3'-phosphate compound with a monophosphate group at the 3'-position. | 3'-CMP |
3'-guanylic acid | A guanosine 3'-phosphate compound with a monophosphate group at the 3'-position. | guanosine 3'-monophosphate |
3'-uridylic acid | A pyrimidine ribonucleoside 3'-monophosphate having uracil as the nucleobase. | 3'-UMP |
4-aminobenzoic acid | An aminobenzoic acid in which the amino group is para to the carboxy group. | 4-aminobenzoic acid; 4-ammoniobenzoate |
4-aminobenzoic acid | An aromatic amino-acid anion that is the conjugate base of 4-aminobenzoic acid. | 4-aminobenzoate |
4-aminobutyraldehyde | An omega-aminoaldehyde that is butanal in which one of the hydrogens of the terminal methyl group has been replaced by an amino group. | 4-aminobutanal |
4-cresol | A cresol that consists of toluene substituted by a hydroxy group at position 4. It is a metabolite of aromatic amino acid metabolism produced by intestinal microflora in humans and animals. | p-cresol |
4-hydroxyphenylacetaldehyde | (4-hydroxyphenyl)acetaldehyde | |
4-phosphoerythronate | The D-enantiomer of 4-phosphoerythronic acid. | 4-phospho-D-erythronic acid |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | An aminouracil that is D-ribitol in which the hydroxy group at position 1 is substituted by the 6-amino group of 5,6-diaminouracil. Early intermediate in bacterial riboflavin synthesis. | 5-amino-6-(D-ribitylamino)uracil |
5-formamidoimidazole-4-carboxamide ribotide | 5-formamido-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide | |
5-ketogluconic acid | 5-dehydro-D-gluconic acid | |
5,10-methenyltetrahydrofolate | The 5,10-methenyl derivative of tetrahydrofolic acid arising from enzymatic cyclisation of 5-formyltetrahydrofolic acid. | (6R)-5,10-methenyltetrahydrofolic acid |
5,6-dimethylbenzimidazole | A dimethylbenzimidazole carrying methyl substituents at positions 5 and 6. | 5,6-dimethylbenzimidazole |
5,6,7,8-tetrahydropteridine | 5,6,7,8-tetrahydropteridine | |
5'-deoxyadenosine | A 5'-deoxyribonucleoside compound having adenosine as the nucleobase. | 5'-deoxyadenosine |
5'-methylthioadenosine | Adenosine with the hydroxy group at C-5' substituted with a methylthio (methylsulfanyl) group. | 5'-S-methyl-5'-thioadenosine |
6-phosphonoglucono-delta-lactone | An aldonolactone phosphate comprising D-glucono-1,5-lactone having the phosphate group at the 6-position. | 6-O-phosphono-D-glucono-1,5-lactone |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | The pteridine that is lumazine substituted with methyl groups at C-6 and -7 and with a 1-D-ribityl group on N-8. | 6,7-dimethyl-8-(1-D-ribityl)lumazine |
7,8-dihydroneopterin | A neopterin where positions C-7 and C-8 have been hydrogenated. | 7,8-dihydroneopterin |
9-mercaptodethiobiotin | A member of the class of imidazolidinones that is dethiobiotin carrying a mercapto substituent at position 9. An intermediate in the biosynthesis of biotin. | 9-mercaptodethiobiotin |
abrine | A N-methyl-L-alpha-amino acid that is the N(alpha)-methyl derivative of L-tryptophan. | N(alpha)-methyl-L-tryptophan zwitterion; N(alpha)-methyl-L-tryptophan |
acetaldehyde | The aldehyde formed from acetic acid by reduction of the carboxy group. It is the most abundant carcinogen in tobacco smoke. | acetaldehyde |
acetoacetyl coa | A 3-oxoacyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of acetoacetic acid. | acetoacetyl-CoA |
acetol | A propanone that is acetone in which one of the methyl hydrogens is replaced by a hydroxy group. | hydroxyacetone |
acetyl phosphate | An acyl monophosphate in which the acyl group specified is acetyl. | acetyl dihydrogen phosphate |
acetylgalactosamine | The D-enantiomer of N-acetylgalactosamine. | N-acetyl-D-galactosamine |
adenine | The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. | adenine |
adenosine 3'-phosphate-5'-phosphate | An adenosine bisphosphate having two monophosphate groups at the 3'- and 5'-positions. | adenosine 3',5'-bismonophosphate |
adenosine diphosphate ribose | A nucleotide-sugar having ADP as the nucleotide fragment and D-ribofuranos-5-yl as the sugar component. | ADP-D-ribose |
adenosine phosphosulfate | An adenosine 5'-phosphate having a sulfo group attached to one the phosphate OH groups. | 5'-adenylyl sulfate |
aerobactin | aerobactin | |
agmatine | agmatine | |
aica ribonucleotide | A 1-(phosphoribosyl)imidazolecarboxamide that is acadesine in which the hydroxy group at the 5' position has been converted to its monophosphate derivative. | AICA ribonucleotide |
allantoin | An imidazolidine-2,4-dione that is 5-aminohydantoin in which a carbamoyl group is attached to the exocyclic nitrogen. | allantoin |
allolactose | A glycosylglucose consisting of galactose and glucose units linked through a 1-6 glycosidic linkage. | allolactose |
alpha-ribazole | alpha-ribazole | |
aminoacetone | A propanone consisting of acetone having an amino group at the 1-position. | aminoacetone |
aminolevulinic acid | The simplest delta-amino acid in which the hydrogens at the gamma position are replaced by an oxo group. It is metabolised to protoporphyrin IX, a photoactive compound which accumulates in the skin. Used (in the form of the hydrochloride salt)in combination with blue light illumination for the treatment of minimally to moderately thick actinic keratosis of the face or scalp. | 5-aminolevulinic acid; 5-ammoniolevulinate |
arabinose | The six-membered ring form of L-arabinose. | L-arabinopyranose |
arbutin | A monosaccharide derivative that is hydroquinone attached to a beta-D-glucopyranosyl residue at position 4 via a glycosidic linkage. | hydroquinone O-beta-D-glucopyranoside |
arginine | An L-alpha-amino acid that is the L-isomer of arginine. | L-arginine |
arsenic acid | An arsenic oxoacid comprising one oxo group and three hydroxy groups attached to a central arsenic atom. | arsenic acid |
asparagine | An optically active form of asparagine having L-configuration. | L-asparagine zwitterion; L-asparagine |
aspartic acid | The L-enantiomer of aspartic acid. | L-aspartic acid |
beta-aspartyl phosphate | The 4-phospho derivative of L-aspartic acid. | 4-phospho-L-aspartic acid |
beta-glycerophosphoric acid | A glycerol monophosphate having the phosphate group at the 2-position. | glycerol 2-phosphate |
betaine aldehyde | A quaternary ammonium ion that is nitrogen substituted by three methyl groups and a 2-oxoethyl group. It is an intermediate in the metabolism of amino acids like glycine, serine and threonine. | betaine aldehyde |
biotin | An organic heterobicyclic compound that consists of 2-oxohexahydro-1H-thieno[3,4-d]imidazole having a valeric acid substituent attached to the tetrahydrothiophene ring. The parent of the class of biotins. | biotin |
butyraldehyde | A member of the class of butanals that consists of propane bearing a formyl substituent at the 1-position. The parent of the class of butanals. | butanal |
butyryl-coenzyme a | A short-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of butyric acid. | butyryl-CoA |
c(alpha)-formylglycine | The L-enantiomer of 3-oxoalanine. | L-3-oxoalanine zwitterion; L-3-oxoalanine |
cadaverine | An alkane-alpha,omega-diamine comprising a straight-chain pentane core with amino substitutents at positions 1 and 5. A colourless syrupy liquid diamine with a distinctive unpleasant odour, it is a homologue of putresceine and is formed by the bacterial decarboxylation of lysine that occurs during protein hydrolysis during putrefaction of animal tissue. It is also found in plants such as soyabean. | cadaverine |
canthaxanthin | A carotenone that consists of beta,beta-carotene bearing two oxo substituents at positions 4 and 4'. | canthaxanthin |
carbamic acid | A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. | carbamic acid |
carbamyl phosphate | carbamoyl phosphate | |
carboxyaminoimidazole ribotide | 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylic acid | |
chloramphenicol | An organochlorine compound that is dichloro-substituted acetamide containing a nitrobenzene ring, an amide bond and two alcohol functions. | chloramphenicol |
chlorine | A halide anion formed when chlorine picks up an electron to form an an anion. | chloride |
choline | A choline that is the parent compound of the cholines class, consisting of ethanolamine having three methyl substituents attached to the amino function. | choline |
chorismic acid | The (3R,4R)-stereoisomer of 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid. | chorismic acid |
cifostodine | A 2',3'-cyclic pyrimidine nucleotide in which cytidine is the parent nucleoside. | 2',3'-cyclic CMP |
citrulline | The L-enantiomer of citrulline. | L-citrulline zwitterion; L-citrulline |
citrulline | Zwitterionic form of L-citrulline having an anionic carboxy group and a protonated amino group; major species at pH 7.3. | L-citrulline zwitterion; L-citrulline |
coenzyme a | A thiol comprising a panthothenate unit in phosphoric anhydride linkage with a 3',5'-adenosine diphosphate unit; and an aminoethanethiol unit. | coenzyme A |
colibactin | A member of the class of 1,3-thiazoles that comprises of two units of 2-[(2-{6-[(2S)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl}acetamido)methyl]-1,3-thiazole-4-carboxylic acid linked together via the formal condensation of the carboxy groups. It is a secondary metabolite produced by certain strains of bacteria found in the human gut such as Escherichia coli. It has the ability to bind covalently to DNA and is strongly associated with colorectal cancer. | colibactin |
coproporphyrinogen iii | coproporphyrinogen III | |
cyclic gmp | A 3',5'-cyclic purine nucleotide in which the purine nucleobase is specified as guanidine. | 3',5'-cyclic GMP |
cysteine sulfinic acid | The organosulfinic acid arising from oxidation of the sulfhydryl group of L-cysteine. | 3-sulfino-L-alanine |
cysteinylglycine | A dipeptide consisting of glycine having an L-cysteinyl attached to its alpha-amino group. It is an intermediate metabolite in glutathione metabolism. | L-cysteinylglycine zwitterion; L-cysteinylglycine |
cysteinylglycine | The zwitterion of L-cysteinylglycine resulting from the transfer of a proton from the hydroxy group of glycine to the amino group of cysteine. Major microspecies at pH 7.3. | L-cysteinylglycine zwitterion; L-cysteinylglycine |
cytidine | A pyrimidine nucleoside in which cytosine is attached to ribofuranose via a beta-N(1)-glycosidic bond. | cytidine |
cytidine diphosphate | A pyrimidine ribonucleoside 5'-diphosphate having cytosine as the nucleobase. | CDP |
cytidine monophosphate | A pyrimidine ribonucleoside 5'-monophosphate having cytosine as the nucleobase. | cytidine 5'-monophosphate |
cytidine triphosphate | CTP | |
cytosine | An aminopyrimidine that is pyrimidin-2-one having the amino group located at position 4. | cytosine |
D-alanine | The D-enantiomer of alanine. | D-alanine zwitterion; D-alanine |
d-glutamate | An optically active form of glutamic acid having D-configuration. | D-glutamic acid |
d-lactic acid | An optically active form of lactic acid having (R)-configuration. | (R)-lactic acid |
D-serine | The R-enantiomer of serine. | D-serine zwitterion; D-serine |
D-tyrosine | An optically active form of tyrosine having D-configuration. | D-tyrosine zwitterion; D-tyrosine |
deoxycytidine | A pyrimidine 2'-deoxyribonucleoside having cytosine as the nucleobase. | 2'-deoxycytidine |
deoxycytidine monophosphate | A pyrimidine 2'-deoxyribonucleoside 5'-monophosphate having cytosine as the nucleobase. | 2'-deoxycytosine 5'-monophosphate |
deoxyguanosine | A purine 2'-deoxyribonucleoside having guanine as the nucleobase. | 2'-deoxyguanosine |
deoxyguanosine triphosphate | A purine 2'-deoxyribonucleoside 5'-triphosphate having guanine as the nucleobase. | dGTP |
deoxyinosine | A purine 2'-deoxyribonucleoside that is inosine in which the hydroxy group at position 2' is replaced by a hydrogen. | 2'-deoxyinosine |
deoxyinosine monophosphate | A deoxyinosine phosphate that is 5'-inosinic acid in which the hydroxy group at position 2' by a hydrogen atom. | 2'-deoxyinosine-5'-monophosphate |
deoxyuridine | A pyrimidine 2'-deoxyribonucleoside having uracil as the nucleobase. | 2'-deoxyuridine |
deoxyuridine triphosphate | A deoxyuridine phosphate having a triphosphate group at the 5'-position. | dUTP |
dephosphocoenzyme a | An adenosine 5'-phosphate that is coenzyme A in which the phosphate group at position 3' has been replaced by a hydrogen atom. It is an intermediate metabolite in pantothenate and CoA biosynthesis. | 3'-dephospho-CoA |
diacetyl | An alpha-diketone that is butane substituted by oxo groups at positions 2 and 3. It is a metabolite produced during the malolactic fermentation. | butane-2,3-dione |
diadenosine tetraphosphate | A diadenosyl tetraphosphate compound having the two 5'-adenosyl residues attached at the P(1)- and P(4)-positions. | P(1),P(4)-bis(5'-adenosyl) tetraphosphate |
diaminopimelic acid | A 2,6-diaminopimelic acid in which both chiral centres have S configuration. It is a component of bacterial cell wall. | (2S,6S)-2,6-diaminopimelic acid dizwitterion; LL-2,6-diaminopimelic acid |
diaminopimelic acid | A zwitterion that is derived from LL-2,6-diaminopimelic acid by deprotonation of both carboxylic acid groups and protonation of both amino groups. | (2S,6S)-2,6-diaminopimelic acid dizwitterion; LL-2,6-diaminopimelic acid |
diguanosine tetraphosphate | A purine ribonucleoside 5'-tetraphosphate compound having 5'-guanosyl residues at the P(1)- and P(4)-positions. | P(1),P(4)-bis(5'-guanosyl) tetraphosphate |
dihydro-3-coumaric acid | A monocarboxylic acid that is propionic acid carrying a 3-hydroxyphenyl substituent at C-3. | 3-(3-hydroxyphenyl)propanoic acid |
dihydrofolate | A folic acid derivative acted upon by dihydrofolate reductase to produce tetrahydrofolic acid. It interacts with bacteria during cell division and is targeted by various drugs to prevent nucleic acid synthesis. | dihydrofolic acid |
dihydroneopterin triphosphate | 7,8-dihydroneopterin 3'-triphosphate | |
dihydrouracil | A pyrimidine obtained by formal addition of hydrogen across the 5,6-position of uracil. | 5,6-dihydrouracil |
dihydroxyacetone | A ketotriose consisting of acetone bearing hydroxy substituents at positions 1 and 3. The simplest member of the class of ketoses and the parent of the class of glycerones. | dihydroxyacetone |
dihydroxyacetone phosphate | A member of the class of glycerone phosphates that consists of glycerone bearing a single phospho substituent. | dihydroxyacetone phosphate |
dimethyl sulfide | A methyl sulfide in which the sulfur atom is substituted by two methyl groups. It is produced naturally by some marine algae. | dimethyl sulfide |
dimethyl sulfoxide | A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. | dimethyl sulfoxide |
diphosphoric acid | An acyclic phosphorus acid anhydride obtained by condensation of two molecules of phosphoric acid. | diphosphoric acid |
erythrose 4-phosphate | An erythrose phosphate that is D-erythrose carrying a phosphate group at position 4. It is an intermediate in the pentose phosphate pathway and Calvin cycle. | D-erythrose 4-phosphate |
ethanolamine | A member of the class of ethanolamines that is ethane with an amino substituent at C-1 and a hydroxy substituent at C-2, making it both a primary amine and a primary alcohol. | ethanolamine |
farnesyl pyrophosphate | The trans,trans-stereoisomer of farnesyl diphosphate. | 2-trans,6-trans-farnesyl diphosphate |
flavin-adenine dinucleotide | A flavin adenine dinucleotide in which the substituent at position 10 of the flavin nucleus is a 5'-adenosyldiphosphoribityl group. | FAD |
formaldehyde | An aldehyde resulting from the formal oxidation of methanol. | formaldehyde |
formyl-coenzyme a | An acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of formic acid. | formyl-CoA |
framycetin | A tetracyclic antibacterial agent derived from neomycin, being a glycoside ester of neamine and neobiosamine B. | framycetin |
fructosyl-lysine | A glyco-amino acid consisting of a D-fructosyl residue attached to the epsilon-amino group of L-lysine. | fructosyllysine |
fucose | The pyranose form of L-fucose. | L-fucopyranose |
fuculose | A a deoxyketohexose comprising L-tagatose with the hydroxy group at position 6 replaced by hydrogen. | L-fuculose |
fusidic acid | A steroid antibiotic that is isolated from the fermentation broth of Fusidium coccineum. | fusidic acid |
galactitol | An optically inactive hexitol having meso-configuration. | galactitol |
galactose | A galactopyranose having D-configuration. | D-galactopyranose |
galactose-1-phosphate | A D-galactopyranose 1-phosphate having alpha-configuration at the anomeric centre. | alpha-D-galactose 1-phosphate |
gamma-butyrobetaine | An amino-acid betaine gamma-aminobutyric acid zwitterion in which all of the hydrogens attached to the nitrogen are replaced by methyl groups. | 4-(trimethylammonio)butanoate |
gamma-glutamyl phosphate | L-gamma-glutamyl phosphate | |
gamma-glutamylcysteine | A molecular entity formed when L-cysteine amino group binds to the gamma-carbonyl of L-glutamic acid. | L-gamma-glutamyl-L-cysteine |
gdp-4-keto-6-deoxymannose | A GDP-sugar having 4-dehydro-6-deoxy-alpha-D-mannose as the sugar portion. | GDP-4-dehydro-6-deoxy-alpha-D-mannose |
geranyl pyrophosphate | The diphosphate of the polyprenol compound geraniol. | geranyl diphosphate |
glucosamine | A D-glucosamine whose structure comprises D-glucopyranose having an amino substituent at position 2. | 2-amino-2-deoxy-D-glucopyranose |
glucosamine 1-phosphate | alpha-D-glucosamine 1-phosphate | |
glucose-1,6-bisphosphate | A D-glucose 1,6-bisphosphate in which both phosphate groups are monophosphates. | alpha-D-glucose 1,6-bisphosphate |
glutamate-1-semialdehyde | A 5-oxo monocarboxylic acid that is 5-oxopentanoic acid substituted by an amino group at position 4 (the 4S-stereoisomer). | (S)-4-amino-5-oxopentanoic acid zwitterion; (S)-4-amino-5-oxopentanoic acid |
glutamic acid | An optically active form of glutamic acid having L-configuration. | L-glutamic acid |
glutamine | An optically active form of glutamine having L-configuration. | L-glutamine zwitterion; L-glutamine |
glutathione disulfide | glutathione disulfide | |
glutathionylspermidine | The spermidine amide of glutathione. | glutathionylspermidine |
glycerate 1,3-biphosphate | The (R)-enantiomer of 3-phosphoglyceroyl dihydrogen phosphate. | 3-phospho-D-glyceroyl dihydrogen phosphate |
glycerol | A triol with a structure of propane substituted at positions 1, 2 and 3 by hydroxy groups. | glycerol |
glycerylphosphorylcholine | A member of the class of phosphocholines that is the choline ester of sn-glycero-3-phosphate. It is one of the major osmolyte in the renal medullary cells. | choline alfoscerate |
glyoxylic acid | A 2-oxo monocarboxylic acid that is acetic acid bearing an oxo group at the alpha carbon atom. | glyoxylic acid |
guanine | A 2-aminopurine carrying a 6-oxo substituent. | guanine |
guanosine diphosphate | A purine ribonucleoside 5'-diphosphate resulting from the formal condensation of the hydroxy group at the 5' position of guanosine with pyrophosphoric acid. | GDP |
guanosine diphosphate mannose | The alpha-anomer of GDP-D-mannose. | GDP-alpha-D-mannose |
guanosine monophosphate | A purine ribonucleoside 5'-monophosphate having guanine as the nucleobase. | guanosine 5'-monophosphate |
guanosine pentaphosphate | A guanosine bisphosphate having a diphosphate at the 3'-position and a triphosphate at the 5'-position. | guanosine 3'-diphosphate 5'-triphosphate |
guanosine tetraphosphate | A guanosine bisphosphate having diphosphate groups at both the 3' and 5'-positions. | guanosine 3',5'-bis(diphosphate) |
guanosine triphosphate | GTP | |
hexanoyl-coenzyme a | A medium-chain fatty acyl-CoA having hexanoyl as the S-acyl group. | hexanoyl-CoA |
histidine | The L-enantiomer of the amino acid histidine. | L-histidine zwitterion; L-histidine |
histidinol | An amino alcohol that is propanol substituted by 1H-imidazol-4-yl group at position 3 and an amino group at position 2 (the 2S stereoisomer). | L-histidinol |
homoserine | The L-enantiomer of homoserine. | L-homoserine zwitterion; L-homoserine |
hydracrylic acid | A 3-hydroxy monocarboxylic acid that is propionic acid in which one of the hydrogens attached to the terminal carbon is replaced by a hydroxy group. | 3-hydroxypropionic acid |
hydrogen carbonate | The carbon oxoanion resulting from the removal of a proton from carbonic acid. | hydrogencarbonate |
hydrogen cyanide | A one-carbon compound consisting of a methine group triple bonded to a nitrogen atom | hydrogen cyanide |
hydrogen selenide | selane | |
hydrogen sulfide | A sulfur hydride consisting of a single sulfur atom bonded to two hydrogen atoms. A highly poisonous, flammable gas with a characteristic odour of rotten eggs, it is often produced by bacterial decomposition of organic matter in the absence of oxygen. | hydrogen sulfide |
hydroquinone | A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. | hydroquinone |
hydroxymethylbilane | preuroporphyrinogen | |
hydroxypyruvic acid | A 2-oxo monocarboxylic acid that is pyruvic acid in which one of the methyl hydrogens is substituted by a hydroxy group. It is an intermediate involved in the glycine and serine metabolism. | 3-hydroxypyruvic acid |
hydroxythreonine | A hydroxy-amino acid consisting of L-threonine having a hydroxy substituent at the 4-position. | 4-hydroxy-L-threonine zwitterion; 4-hydroxy-L-threonine |
idonic acid | The L-enantiomer of idonic acid. | L-idonic acid |
iminoaspartic acid | A succinic acid derivative having an imino group at the 2-position. | iminoaspartic acid |
iminoglycine | A dehydroamino acid derived from glycine. | dehydroglycine zwitterion; dehydroglycine |
indole | 1H-indole | |
inosine | A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. | inosine |
inosine triphosphate | The inosine phosphate that has a triphosphate group at the 5'-position. It is an intermediate in the metabolism of purine. | ITP |
inosinic acid | A purine ribonucleoside 5'-monophosphate having hypoxanthine as the nucleobase. | IMP |
isoleucine | The L-enantiomer of isoleucine. | L-isoleucine zwitterion; L-isoleucine |
isopentenyl pyrophosphate | A prenol phosphate comprising 3-methylbut-3-en-1-ol having an O-diphosphate substituent. | isopentenyl diphosphate |
kdo2-lipid a | (Kdo)2-lipid A (E. coli) | |
L-2-aminoadipic acid | The L-enantiomer of 2-aminoadipic acid. | L-2-aminoadipic acid |
l-lactic acid | An optically active form of lactic acid having (S)-configuration. | (S)-lactic acid |
lauroyl-coenzyme a | A medium-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of lauric (dodecanoic) acid. | lauroyl-CoA |
leucine | The L-enantiomer of leucine. | L-leucine zwitterion; L-leucine |
leucovorin | A formyltetrahydrofolic acid in which the formyl group is located at position 5. | 5-formyltetrahydrofolic acid |
lipid a | The glycolipid moiety of the lipopolysaccharide produced by E. coli. | lipid A (E. coli) |
lipid x | An N-acyl-D-glucosamine 1-phosphate where the N-acyl group is (R)-3-hydroxytetradecanoyl and carrying an additional (R)-3-hydroxytetradecanoyl group at the 3-position. | lipid X |
lipoamide | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of lipoic acid with ammonia. | lipoamide |
lysine | An L-alpha-amino acid; the L-isomer of lysine. | L-Lysine zwitterion; L-lysine |
maleamic acid | A dicarboxylic acid monoamide of maleamic acid. | maleamic acid |
malonyl coenzyme a | The S-malonyl derivative of coenzyme A. | malonyl-CoA |
manganese | manganese atom; manganese(0) | |
mannitol | The D-enantiomer of mannitol. | D-mannitol |
mannitol-1-phosphate | An alditol 1-phosphate that is the 1-O-phospho derivative of mannitol with D-configuration. | D-mannitol 1-phosphate |
menaquinone 7 | A menaquinone whose side-chain contains seven isoprene units in an all-trans-configutation. | menaquinone-7 |
menaquinone 9 | A menaquinone whose side-chain contains 9 isoprene units in an all-trans-configuration. | menaquinone-9 |
methanesulfonic acid | An alkanesulfonic acid in which the alkyl group directly linked to the sulfo functionality is methyl. | methanesulfonic acid |
methanol | The primary alcohol that is the simplest aliphatic alcohol, comprising a methyl and an alcohol group. | methanol |
methionine sulfoxide | The (R)-oxido diastereomer of L-methionine S-oxide. | L-methionine (R)-S-oxide zwitterion; L-methionine (R)-S-oxide |
molybdate ion | A divalent inorganic anion obtained by removal of both protons from molybdic acid | molybdate |
monoisopropanolamine | Any amino alcohol that is propan-2-ol substituted by an amino group at position 1. | 1-aminopropan-2-ol |
myrmicacin | A medium-chain fatty acid that is decanoic acid substituted at position 3 by a hydroxy group. | 3-hydroxydecanoic acid |
n-(3-aminopropyl)cadaverine | A polyazaalkane that is the 1,4,11-triaza derivative of undecane. | aminopropylcadaverine |
n-acetylglucosamine-1-phosphate | A N-acetyl-D-glucosamine 1-phosphate that is 2-deoxy-D-glucopyranose 1-(dihydrogen phosphate) substituted by an acetamido group at position 2. | 2-acetamido-2-deoxy-D-glucopyranose 1-phosphate |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | alpha-ribazole 5'-phosphate | |
n(1)-acetylspermidine | An acetylspermidine having the acetyl group at the N1-position. | N(1)-acetylspermidine |
n(6)-(n-threonylcarbonyl)adenosine | An N-(adenosin-N(6)-ylcarbonyl)threonine in which the threonine portion has L-configuration. | N-[(9-beta-D-ribofuranosylpurin-6-yl)carbamoyl]threonine |
n(8)-acetylspermidine | An acetylspermidine that is 1,8-diamino-4-azaoctane in which one of the hydrogens of the amino group attached to C-8 is replaced by an acetyl group. | N(8)-acetylspermidine |
niacin | A pyridinemonocarboxylic acid that is pyridine in which the hydrogen at position 3 is replaced by a carboxy group. | nicotinic acid |
niacinamide | A pyridinecarboxamide that is pyridine in which the hydrogen at position 3 is replaced by a carboxamide group. | nicotinamide |
nicotinamide mononucleotide | NMN zwitterion | |
nicotinic acid adenine dinucleotide | deamido-NAD(+) | |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | A diadenosyl pentaphosphate having the two 5'-adenosyl residues attached at the P(1)- and P(5)-positions. | P(1),P(5)-bis(5'-adenosyl) pentaphosphate |
novobiocin | A coumarin-derived antibiotic obtained from Streptomyces niveus. | novobiocin |
o-phosphohomoserine | The L-enantiomer of O-phosphohomoserine. | O-phospho-L-homoserine |
o-succinylhomoserine | The O-succinyl derivative of L-homoserine. | O-succinyl-L-homoserine |
octanoic acid | A straight-chain saturated fatty acid that is heptane in which one of the hydrogens of a terminal methyl group has been replaced by a carboxy group. Octanoic acid is also known as caprylic acid. | octanoic acid |
oleic acid | An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. | oleic acid |
oleoyl-coenzyme a | An octadecenoyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of oleic acid. | oleoyl-CoA |
orotic acid | A pyrimidinemonocarboxylic acid that is uracil bearing a carboxy substituent at position C-6. | orotic acid |
orotidylic acid | A pyrimidine ribonucleoside 5'-monophosphate having 6-carboxyuracil as the nucleobase. | orotidine 5'-phosphate |
oxaluric acid | A 2-oxo monocarboxylic acid that is amino(oxo)acetic acid substituted by a carbamoylamino group at the nitrogen atom. | oxaluric acid |
oxalyl-coenzyme a | An omega-carboxyacyl-CoA that results from the formal condensation of the thiol group of coenzyme A with one of the carboxy groups of oxalic acid. | oxalyl-CoA |
oxamic acid | A dicarboxylic acid monoamide resulting from the formal condensation of one of the carboxy groups of oxalic acid with ammonia. | oxamic acid |
palmitoleic acid | A hexadec-9-enoic acid in which the double bond at position C-9 has cis configuration. | palmitoleic acid |
palmitoyl coenzyme a | A long-chain fatty acyl-CoA resulting from the formal condensation of the carboxy group of hexadecanoic acid with the thiol group of coenzyme A. | palmitoyl-CoA |
pantothenylcysteine 4'-phosphate | The N-[(R)-4-phosphopantothenoyl] derivative of L-cysteine. | N-[(R)-4-phosphopantothenoyl]-L-cysteine |
phenethylamine | A phenylethylamine having the phenyl substituent at the 2-position. | 2-phenylethylamine |
phenylacetaldehyde | An aldehyde that consists of acetaldehyde bearing a methyl substituent; the parent member of the phenylacetaldehyde class of compounds. | phenylacetaldehyde |
phenylacetic acid | A monocarboxylic acid that is toluene in which one of the hydrogens of the methyl group has been replaced by a carboxy group. | phenylacetic acid |
phenylacetyl-coenzyme a | An acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of phenylacetic acid. | phenylacetyl-CoA |
phenylalanine | The L-enantiomer of phenylalanine. | L-phenylalanine zwitterion; L-phenylalanine |
phosphoadenosine phosphosulfate | An adenosine bisphosphate having monophosphate groups at the 3'- and 5'-positions and a sulfo group attached to the phosphate at position 5'. | 3'-phospho-5'-adenylyl sulfate |
phosphoglycolate | The O-phospho derivative of glycolic acid. | 2-phosphoglycolic acid |
phosphopantothenic acid | An amidoalkyl phosphate that is the 4-phosphate derivative of (R)-pantothenic acid. | (R)-4'-phosphopantothenic acid |
phosphoribosyl pyrophosphate | A derivative of alpha-D-ribose having a phosphate group at the 5-position and a diphosphate at the 1-position. | 5-O-phosphono-alpha-D-ribofuranosyl diphosphate |
phosphothreonine | A L-threonine derivative phosphorylated at the side-chain hydroxy function. | O-phospho-L-threonine |
phosphotyrosine | A non-proteinogenic L-alpha-amino acid that is L-tyrosine phosphorylated at the phenolic hydroxy group. | O(4)-phospho-L-tyrosine |
plasmenylserine | The L-enantiomer of O-phosphoserine. | O-phospho-L-serine |
porphobilinogen | A dicarboxylic acid that is pyrole bearing aminomethyl, carboxymethyl and 2-carboxyethyl substituents at positions 2, 3 and 4 respectively. | porphobilinogen |
prephenic acid | An oxo dicarboxylic acid that consists of 4-hydroxycyclohexa-2,5-diene-1-carboxylic acid substituted by a 2-carboxy-2-oxoethyl group at position 1. | prephenic acid |
proline | Pyrrolidine in which the pro-S hydrogen at position 2 is substituted by a carboxylic acid group. L-Proline is the only one of the twenty DNA-encoded amino acids which has a secondary amino group alpha to the carboxyl group. It is an essential component of collagen and is important for proper functioning of joints and tendons. It also helps maintain and strengthen heart muscles. | L-proline zwitterion; L-proline |
propionaldehyde | An aldehyde that consists of ethane bearing a formyl substituent. The parent of the class of propanals. | propanal |
propionyl-coenzyme a | An acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of propionic acid. | propionyl-CoA |
protoporphyrinogen | protoporphyrinogen | |
pyridoxal | A pyridinecarbaldehyde that is pyridine-4-carbaldehyde bearing methyl, hydroxy and hydroxymethyl substituents at positions 2, 3 and 5 respectively. The 4-carboxyaldehyde form of vitamin B6, it is converted into pyridoxal phosphate, a coenzyme for the synthesis of amino acids, neurotransmitters, sphingolipids and aminolevulinic acid. | pyridoxal |
pyridoxal phosphate | The monophosphate ester obtained by condensation of phosphoric acid with the primary hydroxy group of pyridoxal. | pyridoxal 5'-phosphate |
pyridoxamine | A monohydroxypyridine that is pyridine substituted by a hydroxy group at position 3, an aminomethyl group at position 4, a hydroxymethyl group at position 5 and a methyl group at position 2. The 4-aminomethyl form of vitamin B6, it is used (in the form of the hydrochloride salt) for treatment of diabetic nephropathy. | pyridoxamine |
pyridoxamine dihydrochloride | A hydrochloride obtained by combining pyridoxamine with two molar equivalents of hydrochloric acid. Used for treatment of diabetic nephropathy. | pyridoxamine dihydrochloride |
pyridoxamine phosphate | A vitamin B6 phosphate that is the phosphoric ester derivative of pyridoxamine. | pyridoxamine 5'-phosphate |
pyridoxine | A hydroxymethylpyridine with hydroxymethyl groups at positions 4 and 5, a hydroxy group at position 3 and a methyl group at position 2. The 4-methanol form of vitamin B6, it is converted intoto pyridoxal phosphate which is a coenzyme for synthesis of amino acids, neurotransmitters, sphingolipids and aminolevulinic acid. | pyridoxine |
pyridoxine 5-phosphate | pyridoxine 5'-phosphate | |
pyruvaldehyde | A 2-oxo aldehyde derived from propanal. | methylglyoxal |
queuine | queuine | |
quinolinic acid | A pyridinedicarboxylic acid that is pyridine substituted by carboxy groups at positions 2 and 3. It is a metabolite of tryptophan. | quinolinic acid |
racemethionine | A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. | methionine zwitterion; methionine |
retinol palmitate | An all-trans-retinyl ester obtained by formal condensation of the carboxy group of palmitic (hexadecanoic acid) with the hydroxy group of all-trans-retinol. It is used in cosmetic products to treat various skin disorders such as acne, skin aging, wrinkles, dark spots, and also protect against psoriasis. | all-trans-retinyl palmitate |
riboflavin | D-Ribitol in which the hydroxy group at position 5 is substituted by a 7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl moiety. It is a nutritional factor found in milk, eggs, malted barley, liver, kidney, heart, and leafy vegetables, but the richest natural source is yeast. The free form occurs only in the retina of the eye, in whey, and in urine; its principal forms in tissues and cells are as flavin mononucleotide and flavin-adenine dinucleotide. | riboflavin |
ribose 1-phosphate | The 1-phospho derivative of alpha-D-ribose. | alpha-D-ribose 1-phosphate |
ribothymidine | A methyluridine having a single methyl substituent at the 5-position on the uracil ring. | ribothymidine |
ribulose | The D-stereoisomer of ribulose. | D-ribulose |
ribulose-1,5 diphosphate | A ribulose phosphate that is D-ribulose attached to phosphate groups at positions 1 and 5. It is an intermediate in photosynthesis. | D-ribulose 1,5-bisphosphate |
rifampin | A member of the class of rifamycins that is a a semisynthetic antibiotic derived from Amycolatopsis rifamycinica (previously known as Amycolatopsis mediterranei and Streptomyces mediterranei). | rifampicin zwitterion; rifampicin |
s-adenosyl-3-methylthiopropylamine | The S-adenosyl derivative of methioninamine. It acts as the aminopropyl donor in the biosynthesis of the polyamines, spermidine and spermine. | S-adenosylmethioninamine |
s-hydroxymethylglutathione | An S-substituted glutathione that is glutathione in which the mercapto hydrogen has been replaced by a hydroxymethyl group. | S-(hydroxymethyl)glutathione |
s-ribosyl-l-homocysteine | An S-(5-deoxy-D-ribos-5-yl)-L-homocysteine in which the anomeric centre has beta-configuration. | S-(5-deoxy-beta-D-ribos-5-yl)-L-homocysteine |
s-tetradecanoyl-coenzyme a | A long-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of myristic acid. | myristoyl-CoA |
saicar | A 1-(phosphoribosyl)imidazolecarboxamide resulting from the formal condesation of the darboxy group of 5-amino-1-(5-O-phosphono-beta-D-ribofuranosyl)-1H-imidazole-4-carboxylic acid with the amino group of L-aspartic acid. | SAICAR |
sarcosine | A N-alkylglycine that is the N-methyl derivative of glycine. It is an intermediate in the metabolic pathway of glycine. | sarcosine zwitterion; sarcosine |
sedoheptulose 1,7-bisphosphate | sedoheptulose 1,7-bisphosphate | |
sedoheptulose 7-phosphate | A ketoheptose phosphate consisting of sedoheptulose having a phosphate group at the 7-position. It is an intermediate metabolite in the pentose phosphate pathway. | sedoheptulose 7-phosphate |
selenodiglutathione | A thioselenide in which a selenium atom is attached to the sulfur atoms of two molecules of glutathione. It is an initial metabolite of selenite, SeO3(2-). | selenodiglutathione |
serine | The L-enantiomer of serine. | L-serine zwitterion; L-serine |
shikimic acid | A cyclohexenecarboxylic acid that is cyclohex-1-ene-1-carboxylic acid substituted by hydroxy groups at positions 3, 4 and 5 (the 3R,4S,5R stereoisomer). It is an intermediate metabolite in plants and microorganisms. | shikimic acid |
silver | silver atom; silver(0) | |
sorbitol | The D-enantiomer of glucitol (also known as D-sorbitol). | D-glucitol |
sorbitol 6-phosphate | The 6-O-phospho derivative of D-glucitol. | D-glucitol 6-phosphate |
stearoyl-coenzyme a | A long-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of stearic acid. | stearoyl-CoA |
succinic semialdehyde | succinic semialdehyde | |
succinyl-coenzyme a | An omega-carboxyacyl-CoA having succinoyl as the S-acyl component. | succinyl-CoA |
sucrose | A glycosyl glycoside formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose. | sucrose |
sucrose-6-phosphate | A disaccharide phosphate that is sucrose carrying a single monophosphate substituent at position 6 on the glucose ring. | sucrose 6(G)-phosphate |
sulfur dioxide | sulfur dioxide | |
tartaric acid | The D-enantiomer of tartaric acid. | D-tartaric acid |
tartronate semialdehyde | 2-hydroxy-3-oxopropanoic acid | |
taurine | An amino sulfonic acid that is the 2-amino derivative of ethanesulfonic acid. It is a naturally occurring amino acid derived from methionine and cysteine metabolism. An abundant component of fish- and meat-based foods, it has been used as an oral supplement in the treatment of disorders such as cystic fibrosis and hypertension. | taurine zwitterion; taurine |
thiamine | A primary alcohol that is 1,3-thiazol-3-ium substituted by (4-amino-2-methylpyrimidin-5-yl)methyl, methyl and 2-hydroxyethyl groups at positions 3, 4 and 5, respectively. | thiamine(1+) |
thiocyanic acid | A hydracid that is cyanic acid in which the oxygen is replaced by a sulfur atom. | thiocyanic acid |
threonine | An optically active form of threonine having L-configuration. | L-threonine zwitterion; L-threonine |
thymidine | A pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. | thymidine |
thymidine 5'-diphosphate | A thymidine phosphate having a diphosphate group at the 5'-position. | dTDP |
thymidine 5'-triphosphate | A thymidine phosphate having a triphosphate group at the 5'-position. | dTTP |
thymidine diphosphate-l-rhamnose | The beta-anomer of dTDP-L-rhamnose. | dTDP-beta-L-rhamnose |
thymine | A pyrimidine nucleobase that is uracil in which the hydrogen at position 5 is replaced by a methyl group. | thymine |
toxopyrimidine | An aminopyrimidine that is pyrimidine in which the hydrogens at positions 2, 4, and 5 are replaced by methyl, amino, and hydroxymethyl substituents, respectively. | 4-amino-5-hydroxymethyl-2-methylpyrimidine |
trehalose | A trehalose in which both glucose residues have alpha-configuration at the anomeric carbon. | alpha,alpha-trehalose |
trehalose-6-phosphate | alpha,alpha-trehalose 6-phosphate | |
trimethylamine | A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. | trimethylamine |
trimethyloxamine | A tertiary amine oxide resulting from the oxidation of the amino group of trimethylamine. | trimethylamine N-oxide |
tryptophan | The L-enantiomer of tryptophan. | L-tryptophan zwitterion; L-tryptophan |
tyramine | A primary amino compound obtained by formal decarboxylation of the amino acid tyrosine. | tyramine |
ubiquinone-o | A derivative of benzoquinone carrying a 5-methyl substituent; and methoxy substituents at positions 2 and 3. The core structure of the ubiquinone group of compounds. | ubiquinone-0 |
uracil | A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. | uracil |
urea | A carbonyl group with two C-bound amine groups. The commercially available fertilizer has an analysis of 46-0-0 (N-P2O5-K2O). | carbamimidic acid; urea |
ureidosuccinic acid | An N-carbamoylamino acid that is aspartic acid with one of its amino hydrogens replaced by a carbamoyl group. | N-carbamoylaspartic acid |
uric acid | An oxopurine in which the purine ring is substituted by oxo groups at positions 2, 6, and 8. | 1H-purine-2,6,8-triol; 2,6-dihydroxy-7,9-dihydro-8H-purin-8-one; 6-hydroxy-1H-purine-2,8(7H,9H)-dione; 7,9-dihydro-1H-purine-2,6,8(3H)-trione; 7H-purine-2,6,8-triol; 9H-purine-2,6,8-triol |
uridine diphosphate | UDP | |
uridine diphosphate glucuronic acid | A UDP-sugar having alpha-D-glucuronic acid as the sugar component. | UDP-alpha-D-glucuronic acid |
uridine monophosphate | A pyrimidine ribonucleoside 5'-monophosphate having uracil as the nucleobase. | uridine 5'-monophosphate |
uridine triphosphate | A pyrimidine ribonucleoside 5'-triphosphate having uracil as the nucleobase. | UTP |
uroporphyrinogen iii | uroporphyrinogen III | |
valine | The L-enantiomer of valine. | L-valine zwitterion; L-valine |
vitamin mk 8 | A menaquinone whose side-chain contains 8 isoprene units in an all-trans-configuration. | menaquinone-8 |
xanthosine | A purine nucleoside in which xanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. | xanthosine |
xanthosine 5'-triphosphate | A purine ribonucleoside 5'-monophosphate having xanthine as the nucleobase. | 5'-xanthylic acid |
xanthosine 5'-triphosphate | The xanthosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. | XTP |
xylulose | The D-enantiomer of xylulose. | D-xylulose |
xylulose-5-phosphate, (d)-isomer | The D-enantiomer of xylulose 5-phosphate. | D-xylulose 5-phosphate |
Research
Studies (1,001,617)
Timeframe | Studies, Drugs with This Role(%) | All Drugs % |
---|---|---|
pre-1990 | 347,852 (34.73) | 18.7374 |
1990's | 150,435 (15.02) | 18.2507 |
2000's | 197,911 (19.76) | 29.6817 |
2010's | 229,192 (22.88) | 24.3611 |
2020's | 76,227 (7.61) | 2.80 |
Study Types
Publication Type | Studies, Drugs with this Role (%) | All Drugs (%) |
---|---|---|
Trials | 36,729 (2.96%) | 5.53% |
Reviews | 59,806 (4.83%) | 6.00% |
Case Studies | 30,361 (2.45%) | 4.05% |
Observational | 1,813 (0.15%) | 0.25% |
Other | 1,110,619 (89.61%) | 84.16% |
Protein Targets (1,077)
Potency Measurements
Protein | Taxonomy | Measurement | Average (mM) | Bioassay(s) | Drugs |
---|---|---|---|---|---|
15-hydroxyprostaglandin dehydrogenase [NAD(+)] isoform 1 | Homo sapiens (human) | Potency | 10.5063 | 1 | 6 |
15-lipoxygenase, partial | Homo sapiens (human) | Potency | 30.1594 | 1 | 7 |
67.9K protein | Vaccinia virus | Potency | 22.1400 | 2 | 3 |
acetylcholinesterase | Homo sapiens (human) | Potency | 44.3474 | 3 | 10 |
activating transcription factor 6 | Homo sapiens (human) | Potency | 24.4978 | 2 | 16 |
aldehyde dehydrogenase 1 family, member A1 | Homo sapiens (human) | Potency | 26.4092 | 1 | 23 |
alpha-galactosidase | Homo sapiens (human) | Potency | 5.0119 | 1 | 1 |
Alpha-synuclein | Homo sapiens (human) | Potency | 5.6234 | 1 | 1 |
apical membrane antigen 1, AMA1 | Plasmodium falciparum 3D7 | Potency | 0.3162 | 1 | 1 |
AR protein | Homo sapiens (human) | Potency | 24.2027 | 12 | 93 |
aryl hydrocarbon receptor | Homo sapiens (human) | Potency | 29.3631 | 3 | 27 |
arylsulfatase A | Homo sapiens (human) | Potency | 6.8574 | 1 | 8 |
ATAD5 protein, partial | Homo sapiens (human) | Potency | 13.8911 | 2 | 3 |
Ataxin-2 | Homo sapiens (human) | Potency | 26.0661 | 2 | 5 |
ATP-dependent phosphofructokinase | Trypanosoma brucei brucei TREU927 | Potency | 9.6878 | 3 | 10 |
ATPase family AAA domain-containing protein 5 | Homo sapiens (human) | Potency | 22.6300 | 1 | 4 |
beta-2 adrenergic receptor | Homo sapiens (human) | Potency | 20.5962 | 1 | 1 |
Bloom syndrome protein isoform 1 | Homo sapiens (human) | Potency | 18.1423 | 2 | 20 |
bromodomain adjacent to zinc finger domain 2B | Homo sapiens (human) | Potency | 27.4554 | 1 | 5 |
caspase 7, apoptosis-related cysteine protease | Homo sapiens (human) | Potency | 52.1285 | 1 | 2 |
caspase-1 isoform alpha precursor | Homo sapiens (human) | Potency | 31.6228 | 1 | 1 |
caspase-3 | Cricetulus griseus (Chinese hamster) | Potency | 60.1596 | 1 | 3 |
caspase-3 | Homo sapiens (human) | Potency | 52.1285 | 1 | 2 |
Caspase-7 | Cricetulus griseus (Chinese hamster) | Potency | 60.1596 | 1 | 3 |
Caspase-7 | Homo sapiens (human) | Potency | 31.6228 | 1 | 1 |
Cellular tumor antigen p53 | Homo sapiens (human) | Potency | 38.9257 | 2 | 23 |
Chain A, 2-oxoglutarate Oxygenase | Homo sapiens (human) | Potency | 23.1438 | 1 | 13 |
Chain A, ATP-DEPENDENT DNA HELICASE Q1 | Homo sapiens (human) | Potency | 37.6460 | 1 | 2 |
Chain A, Beta-lactamase | Escherichia coli K-12 | Potency | 40.9832 | 1 | 3 |
Chain A, Breast cancer type 1 susceptibility protein | Homo sapiens (human) | Potency | 7.9433 | 1 | 1 |
Chain A, Cruzipain | Trypanosoma cruzi | Potency | 25.3992 | 1 | 5 |
Chain A, Ferritin light chain | Equus caballus (horse) | Potency | 31.4273 | 2 | 4 |
Chain A, HADH2 protein | Homo sapiens (human) | Potency | 10.0593 | 2 | 7 |
Chain A, JmjC domain-containing histone demethylation protein 3A | Homo sapiens (human) | Potency | 55.8290 | 1 | 5 |
Chain A, MAJOR APURINIC/APYRIMIDINIC ENDONUCLEASE | Homo sapiens (human) | Potency | 18.8933 | 2 | 23 |
Chain A, Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | 14.5370 | 1 | 4 |
Chain A, TYROSYL-DNA PHOSPHODIESTERASE | Homo sapiens (human) | Potency | 46.5535 | 1 | 8 |
Chain B, HADH2 protein | Homo sapiens (human) | Potency | 10.0593 | 2 | 7 |
chromobox protein homolog 1 | Homo sapiens (human) | Potency | 47.2572 | 2 | 12 |
core-binding factor subunit beta isoform 2 | Homo sapiens (human) | Potency | 24.8033 | 2 | 2 |
cytochrome P450 2C19 precursor | Homo sapiens (human) | Potency | 29.2726 | 1 | 5 |
cytochrome P450 2C9, partial | Homo sapiens (human) | Potency | 42.2424 | 1 | 3 |
cytochrome P450 2D6 | Homo sapiens (human) | Potency | 33.9721 | 1 | 5 |
cytochrome P450 2D6 isoform 1 | Homo sapiens (human) | Potency | 10.0000 | 1 | 1 |
cytochrome P450 3A4 isoform 1 | Homo sapiens (human) | Potency | 8.1698 | 2 | 14 |
cytochrome P450 family 3 subfamily A polypeptide 4 | Homo sapiens (human) | Potency | 16.9437 | 2 | 13 |
cytochrome P450, family 19, subfamily A, polypeptide 1, isoform CRA_a | Homo sapiens (human) | Potency | 20.8605 | 1 | 10 |
D(3) dopamine receptor isoform e | Homo sapiens (human) | Potency | 28.1838 | 1 | 1 |
DNA polymerase III, partial | Bacillus subtilis | Potency | 5.3233 | 1 | 1 |
DNA polymerase iota isoform a (long) | Homo sapiens (human) | Potency | 48.1953 | 1 | 7 |
DNA polymerase kappa isoform 1 | Homo sapiens (human) | Potency | 26.3605 | 1 | 7 |
dopamine D1 receptor | Homo sapiens (human) | Potency | 8.8617 | 1 | 3 |
endonuclease IV | Escherichia coli | Potency | 8.1556 | 1 | 3 |
estrogen nuclear receptor alpha | Homo sapiens (human) | Potency | 26.3143 | 12 | 110 |
estrogen receptor 2 (ER beta) | Homo sapiens (human) | Potency | 48.0300 | 2 | 17 |
estrogen-related nuclear receptor alpha | Homo sapiens (human) | Potency | 23.4388 | 10 | 79 |
euchromatic histone-lysine N-methyltransferase 2 | Homo sapiens (human) | Potency | 14.1649 | 1 | 33 |
EWS/FLI fusion protein | Homo sapiens (human) | Potency | 0.1616 | 4 | 7 |
farnesoid X nuclear receptor | Homo sapiens (human) | Potency | 38.6022 | 5 | 16 |
flap endonuclease 1 | Homo sapiens (human) | Potency | 25.4223 | 1 | 8 |
G | Vesicular stomatitis virus | Potency | 42.2424 | 1 | 3 |
GABA theta subunit | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
GALC protein | Homo sapiens (human) | Potency | 0.5966 | 1 | 2 |
Gamma-aminobutyric acid receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit beta-1 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit beta-2 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit beta-3 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit delta | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit epsilon | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit gamma-1 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit gamma-2 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit gamma-3 | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
Gamma-aminobutyric acid receptor subunit pi | Rattus norvegicus (Norway rat) | Potency | 8.1698 | 1 | 7 |
geminin | Homo sapiens (human) | Potency | 6.8241 | 3 | 25 |
GLI family zinc finger 3 | Homo sapiens (human) | Potency | 16.0437 | 2 | 39 |
glp-1 receptor, partial | Homo sapiens (human) | Potency | 9.0562 | 2 | 2 |
GLS protein | Homo sapiens (human) | Potency | 11.9611 | 2 | 12 |
glucocerebrosidase | Homo sapiens (human) | Potency | 35.4813 | 1 | 1 |
glucocorticoid receptor [Homo sapiens] | Homo sapiens (human) | Potency | 28.3954 | 5 | 37 |
Glutamate receptor 2 | Rattus norvegicus (Norway rat) | Potency | 34.4840 | 1 | 7 |
GTP-binding nuclear protein Ran isoform 1 | Homo sapiens (human) | Potency | 56.2341 | 1 | 1 |
Guanine nucleotide-binding protein G | Homo sapiens (human) | Potency | 42.8000 | 2 | 2 |
heat shock protein beta-1 | Homo sapiens (human) | Potency | 39.0255 | 2 | 19 |
hemoglobin subunit beta | Homo sapiens (human) | Potency | 26.2000 | 2 | 2 |
Histamine H2 receptor | Cavia porcellus (domestic guinea pig) | Potency | 31.6228 | 1 | 2 |
histone acetyltransferase KAT2A isoform 1 | Homo sapiens (human) | Potency | 27.6504 | 1 | 10 |
histone deacetylase 9 isoform 3 | Homo sapiens (human) | Potency | 31.5456 | 2 | 2 |
Histone H2A.x | Cricetulus griseus (Chinese hamster) | Potency | 54.2343 | 2 | 15 |
histone-lysine N-methyltransferase 2A isoform 2 precursor | Homo sapiens (human) | Potency | 52.0561 | 1 | 4 |
HLA class I histocompatibility antigen, B alpha chain | Homo sapiens (human) | Potency | 42.2424 | 1 | 3 |
hypoxia-inducible factor 1 alpha subunit | Homo sapiens (human) | Potency | 43.7199 | 2 | 12 |
hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor) | Homo sapiens (human) | Potency | 7.2923 | 2 | 4 |
IDH1 | Homo sapiens (human) | Potency | 19.7050 | 1 | 5 |
importin subunit beta-1 isoform 1 | Homo sapiens (human) | Potency | 84.2180 | 2 | 2 |
Inositol hexakisphosphate kinase 1 | Homo sapiens (human) | Potency | 42.2424 | 1 | 6 |
Inositol monophosphatase 1 | Rattus norvegicus (Norway rat) | Potency | 20.2879 | 2 | 5 |
Interferon beta | Homo sapiens (human) | Potency | 31.8479 | 2 | 4 |
interleukin 8 | Homo sapiens (human) | Potency | 69.1282 | 1 | 6 |
lamin isoform A-delta10 | Homo sapiens (human) | Potency | 12.5370 | 2 | 16 |
lethal factor (plasmid) | Bacillus anthracis str. A2012 | Potency | 15.1681 | 1 | 12 |
lethal(3)malignant brain tumor-like protein 1 isoform I | Homo sapiens (human) | Potency | 23.4859 | 1 | 3 |
Luciferase | Photinus pyralis (common eastern firefly) | Potency | 52.3280 | 3 | 8 |
lysosomal alpha-glucosidase preproprotein | Homo sapiens (human) | Potency | 3.5481 | 2 | 2 |
M-phase phosphoprotein 8 | Homo sapiens (human) | Potency | 44.9597 | 1 | 2 |
Microtubule-associated protein tau | Homo sapiens (human) | Potency | 21.7802 | 2 | 12 |
mitogen-activated protein kinase 1 | Homo sapiens (human) | Potency | 12.4822 | 1 | 2 |
muscarinic acetylcholine receptor M1 | Rattus norvegicus (Norway rat) | Potency | 9.7509 | 2 | 9 |
muscleblind-like protein 1 isoform 1 | Homo sapiens (human) | Potency | 0.1585 | 1 | 1 |
Neuronal acetylcholine receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | Potency | 3.5481 | 1 | 1 |
Neuronal acetylcholine receptor subunit beta-2 | Rattus norvegicus (Norway rat) | Potency | 3.5481 | 1 | 1 |
neuropeptide S receptor isoform A | Homo sapiens (human) | Potency | 1.0000 | 1 | 1 |
NFKB1 protein, partial | Homo sapiens (human) | Potency | 3.5353 | 2 | 6 |
NPC intracellular cholesterol transporter 1 precursor | Homo sapiens (human) | Potency | 91.9997 | 1 | 1 |
Nrf2 | Homo sapiens (human) | Potency | 18.3564 | 1 | 1 |
nuclear factor erythroid 2-related factor 2 isoform 1 | Homo sapiens (human) | Potency | 30.8533 | 4 | 44 |
nuclear factor erythroid 2-related factor 2 isoform 2 | Homo sapiens (human) | Potency | 28.0383 | 1 | 3 |
nuclear factor NF-kappa-B p105 subunit isoform 1 | Homo sapiens (human) | Potency | 38.1456 | 1 | 2 |
nuclear factor of kappa light polypeptide gene enhancer in B-cells 1 (p105), isoform CRA_a | Homo sapiens (human) | Potency | 42.9426 | 1 | 10 |
Nuclear receptor ROR-gamma | Homo sapiens (human) | Potency | 23.0628 | 1 | 4 |
nuclear receptor ROR-gamma isoform 1 | Mus musculus (house mouse) | Potency | 19.9442 | 2 | 6 |
nuclear receptor subfamily 1, group I, member 3 | Homo sapiens (human) | Potency | 27.8370 | 3 | 30 |
Ornithine decarboxylase | Rattus norvegicus (Norway rat) | Potency | 0.0050 | 1 | 1 |
parathyroid hormone/parathyroid hormone-related peptide receptor precursor | Homo sapiens (human) | Potency | 5.6234 | 1 | 1 |
Parkin | Homo sapiens (human) | Potency | 29.0929 | 1 | 1 |
peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Homo sapiens (human) | Potency | 38.9947 | 2 | 3 |
peripheral myelin protein 22 | Rattus norvegicus (Norway rat) | Potency | 11.2208 | 2 | 8 |
peripheral myelin protein 22 isoform 1 | Homo sapiens (human) | Potency | 63.7247 | 1 | 3 |
peroxisome proliferator activated receptor gamma | Homo sapiens (human) | Potency | 34.0136 | 5 | 30 |
Peroxisome proliferator-activated receptor alpha | Homo sapiens (human) | Potency | 35.4813 | 1 | 2 |
peroxisome proliferator-activated receptor delta | Homo sapiens (human) | Potency | 32.0173 | 5 | 21 |
phosphopantetheinyl transferase | Bacillus subtilis | Potency | 55.1647 | 1 | 20 |
plasminogen precursor | Mus musculus (house mouse) | Potency | 1.9953 | 1 | 1 |
Polyunsaturated fatty acid lipoxygenase ALOX15B | Homo sapiens (human) | Potency | 31.6228 | 1 | 1 |
potassium voltage-gated channel subfamily H member 2 isoform d | Homo sapiens (human) | Potency | 27.0652 | 1 | 5 |
pregnane X nuclear receptor | Homo sapiens (human) | Potency | 27.5549 | 2 | 17 |
pregnane X receptor | Rattus norvegicus (Norway rat) | Potency | 25.1189 | 1 | 1 |
progesterone receptor | Homo sapiens (human) | Potency | 49.6416 | 2 | 13 |
pyruvate kinase PKM isoform b | Homo sapiens (human) | Potency | 0.0050 | 2 | 2 |
Rap guanine nucleotide exchange factor 3 | Homo sapiens (human) | Potency | 56.9049 | 1 | 3 |
Rap guanine nucleotide exchange factor 4 | Homo sapiens (human) | Potency | 19.9526 | 1 | 1 |
RAR-related orphan receptor gamma | Mus musculus (house mouse) | Potency | 14.8019 | 2 | 31 |
ras-related protein Rab-9A | Homo sapiens (human) | Potency | 58.0479 | 1 | 1 |
regulator of G-protein signaling 4 | Homo sapiens (human) | Potency | 8.9129 | 1 | 15 |
retinoic acid nuclear receptor alpha variant 1 | Homo sapiens (human) | Potency | 36.8823 | 3 | 48 |
retinoid X nuclear receptor alpha | Homo sapiens (human) | Potency | 584.7227 | 4 | 36 |
RGS12 | Homo sapiens (human) | Potency | 12.5893 | 1 | 1 |
runt-related transcription factor 1 isoform AML1b | Homo sapiens (human) | Potency | 24.8033 | 2 | 2 |
serine-protein kinase ATM isoform a | Homo sapiens (human) | Potency | 15.8489 | 1 | 1 |
serine/threonine-protein kinase mTOR isoform 1 | Homo sapiens (human) | Potency | 17.5531 | 3 | 3 |
serine/threonine-protein kinase PLK1 | Homo sapiens (human) | Potency | 10.6213 | 1 | 1 |
SMAD family member 2 | Homo sapiens (human) | Potency | 30.2139 | 3 | 10 |
SMAD family member 3 | Homo sapiens (human) | Potency | 30.2139 | 3 | 10 |
Smad3 | Homo sapiens (human) | Potency | 0.1061 | 1 | 2 |
snurportin-1 | Homo sapiens (human) | Potency | 84.2180 | 2 | 2 |
Spike glycoprotein | Severe acute respiratory syndrome-related coronavirus | Potency | 29.9467 | 1 | 4 |
survival motor neuron protein isoform d | Homo sapiens (human) | Potency | 16.2478 | 1 | 4 |
TAR DNA-binding protein 43 | Homo sapiens (human) | Potency | 30.1423 | 1 | 4 |
TDP1 protein | Homo sapiens (human) | Potency | 15.0241 | 2 | 40 |
thioredoxin glutathione reductase | Schistosoma mansoni | Potency | 38.1209 | 1 | 3 |
thioredoxin reductase | Rattus norvegicus (Norway rat) | Potency | 15.4398 | 3 | 18 |
Thrombopoietin | Homo sapiens (human) | Potency | 11.2947 | 2 | 4 |
thyroid hormone receptor beta isoform 2 | Rattus norvegicus (Norway rat) | Potency | 29.4479 | 3 | 29 |
thyroid hormone receptor beta isoform a | Homo sapiens (human) | Potency | 40.8769 | 4 | 11 |
thyroid stimulating hormone receptor | Homo sapiens (human) | Potency | 26.2860 | 6 | 44 |
thyrotropin-releasing hormone receptor | Homo sapiens (human) | Potency | 27.1573 | 2 | 9 |
transcriptional regulator ERG isoform 3 | Homo sapiens (human) | Potency | 5.6234 | 1 | 1 |
tumor necrosis factor | Homo sapiens (human) | Potency | 53.0804 | 1 | 1 |
tumor susceptibility gene 101 protein | Homo sapiens (human) | Potency | 89.1251 | 1 | 1 |
urokinase plasminogen activator surface receptor precursor | Mus musculus (house mouse) | Potency | 1.9953 | 1 | 1 |
urokinase-type plasminogen activator precursor | Mus musculus (house mouse) | Potency | 1.9953 | 1 | 1 |
USP1 protein, partial | Homo sapiens (human) | Potency | 43.0247 | 2 | 9 |
v-jun sarcoma virus 17 oncogene homolog (avian) | Homo sapiens (human) | Potency | 24.2609 | 2 | 17 |
vitamin D (1,25- dihydroxyvitamin D3) receptor | Homo sapiens (human) | Potency | 19.3600 | 5 | 28 |
vitamin D3 receptor isoform VDRA | Homo sapiens (human) | Potency | 67.8767 | 1 | 5 |
Voltage-dependent calcium channel gamma-2 subunit | Mus musculus (house mouse) | Potency | 34.4840 | 1 | 7 |
Inhibition Measurements
Protein | Taxonomy | Measurement | Average (mM) | Bioassay(s) | Drugs |
---|---|---|---|---|---|
10 kDa chaperonin | Escherichia coli | IC50 | 79.5000 | 4 | 4 |
10 kDa heat shock protein, mitochondrial | Homo sapiens (human) | IC50 | 100.0000 | 2 | 2 |
2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | Escherichia coli K-12 | IC50 | 768.0000 | 1 | 1 |
30S ribosomal protein S1 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S10 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S11 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S12 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S13 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S14 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S15 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S16 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S17 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S18 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S19 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S2 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S20 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S21 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S3 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S4 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S5 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S6 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S7 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S8 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
30S ribosomal protein S9 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
4-aminobutyrate aminotransferase, mitochondrial | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 1 |
4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 | Homo sapiens (human) | IC50 | 76.5000 | 1 | 2 |
4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 | Homo sapiens (human) | Ki | 79.3000 | 1 | 2 |
4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase FUT5 | Homo sapiens (human) | IC50 | 67.0000 | 1 | 1 |
4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase FUT6 | Homo sapiens (human) | IC50 | 125.2600 | 1 | 5 |
4-hydroxy-tetrahydrodipicolinate synthase | Escherichia coli K-12 | Ki | 16.0000 | 1 | 1 |
5-hydroxytryptamine receptor 2A | Homo sapiens (human) | Ki | 16.8000 | 2 | 2 |
5-hydroxytryptamine receptor 2A | Rattus norvegicus (Norway rat) | Ki | 13.4100 | 2 | 2 |
5-hydroxytryptamine receptor 7 | Cavia porcellus (domestic guinea pig) | IC50 | 1,237.0000 | 2 | 5 |
5'-nucleotidase | Rattus norvegicus (Norway rat) | IC50 | 80.2000 | 1 | 1 |
50S ribosomal protein L1 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L10 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L11 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L13 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L14 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L15 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L16 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L17 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L18 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L19 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L2 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L20 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L21 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L22 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L23 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L24 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L25 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L27 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L28 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L29 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L3 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L30 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L31 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L31 type B | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L32 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L33 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L34 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L35 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L36 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L36 2 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L4 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L5 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L6 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
50S ribosomal protein L7/L12 | Escherichia coli K-12 | IC50 | 0.2310 | 2 | 2 |
6-phosphogluconate dehydrogenase, decarboxylating | Homo sapiens (human) | Ki | 5.4150 | 2 | 2 |
6-phosphogluconate dehydrogenase, decarboxylating | Ovis aries (sheep) | Ki | 10.7900 | 1 | 1 |
60 kDa chaperonin | Escherichia coli K-12 | IC50 | 250.0000 | 1 | 1 |
60 kDa chaperonin | Escherichia coli | IC50 | 79.5000 | 4 | 4 |
60 kDa heat shock protein, mitochondrial | Homo sapiens (human) | IC50 | 100.0000 | 2 | 2 |
72 kDa type IV collagenase | Homo sapiens (human) | IC50 | 125.2600 | 1 | 5 |
Acetylcholinesterase | Electrophorus electricus (electric eel) | IC50 | 0.0150 | 1 | 1 |
Acetylcholinesterase | Homo sapiens (human) | IC50 | 771.2280 | 4 | 4 |
Acetylcholinesterase | Electrophorus electricus (electric eel) | Ki | 3,735.2002 | 5 | 5 |
Acetylcholinesterase | Homo sapiens (human) | Ki | 100.0000 | 3 | 8 |
Adenosine deaminase | Bos taurus (cattle) | Ki | 325.0000 | 1 | 2 |
Adenosine receptor A1 | Rattus norvegicus (Norway rat) | IC50 | 5.4867 | 2 | 3 |
Adenosine receptor A1 | Rattus norvegicus (Norway rat) | Ki | 6.3033 | 5 | 6 |
Adenosine receptor A2a | Rattus norvegicus (Norway rat) | Ki | 1.1633 | 2 | 3 |
Adenosine receptor A2b | Homo sapiens (human) | Ki | 11.0500 | 2 | 2 |
Adenosine receptor A3 | Homo sapiens (human) | IC50 | 71.0000 | 1 | 1 |
Adenosine receptor A3 | Homo sapiens (human) | Ki | 0.6800 | 1 | 1 |
Adenosine receptor A3 | Rattus norvegicus (Norway rat) | Ki | 2.8300 | 1 | 1 |
Adenosylhomocysteinase | Homo sapiens (human) | Ki | 925.0000 | 1 | 1 |
Adenylate kinase 2, mitochondrial | Rattus norvegicus (Norway rat) | Ki | 0.2900 | 2 | 2 |
Alcohol dehydrogenase E chain | Equus caballus (horse) | Ki | 10,000.0000 | 1 | 1 |
Alcohol dehydrogenase S chain | Equus caballus (horse) | Ki | 10,000.0000 | 1 | 1 |
Aldehyde oxidase | Homo sapiens (human) | Ki | 30.0000 | 1 | 1 |
Aldo-keto reductase family 1 member B1 | Homo sapiens (human) | IC50 | 96.0000 | 1 | 1 |
Aldo-keto reductase family 1 member B1 | Homo sapiens (human) | Ki | 211.2500 | 1 | 4 |
Alkaline phosphatase, tissue-nonspecific isozyme | Homo sapiens (human) | IC50 | 63.0200 | 3 | 5 |
Alkaline phosphatase, tissue-nonspecific isozyme | Bos taurus (cattle) | IC50 | 80.2033 | 3 | 3 |
Alpha-(1,3)-fucosyltransferase 7 | Homo sapiens (human) | IC50 | 125.2600 | 1 | 5 |
Alpha-2A adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 31.7000 | 1 | 1 |
Alpha-2B adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 31.7000 | 1 | 1 |
Alpha-2C adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 31.7000 | 1 | 1 |
Alpha-ketoglutarate-dependent dioxygenase FTO | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 3 |
Alpha-synuclein | Homo sapiens (human) | IC50 | 26.6500 | 2 | 2 |
Amino acid transporter | Rattus norvegicus (Norway rat) | IC50 | 1,361.5385 | 6 | 13 |
Amyloid-beta precursor protein | Homo sapiens (human) | IC50 | 28.4000 | 2 | 2 |
Angiotensin-converting enzyme | Homo sapiens (human) | Ki | 126.5000 | 1 | 2 |
Aromatase | Homo sapiens (human) | IC50 | 32.7000 | 1 | 1 |
Arylacetamide deacetylase | Homo sapiens (human) | Ki | 300.0000 | 1 | 1 |
Asc-type amino acid transporter 1 | Rattus norvegicus (Norway rat) | IC50 | 41.0000 | 1 | 1 |
ATP-binding cassette sub-family C member 3 | Homo sapiens (human) | IC50 | 111.6667 | 1 | 3 |
ATP-citrate synthase | Rattus norvegicus (Norway rat) | Ki | 300.0000 | 1 | 1 |
Bcl-2-like protein 1 | Homo sapiens (human) | IC50 | 1,243.1000 | 1 | 5 |
Beta-galactosidase | Homo sapiens (human) | Ki | 4,886.6667 | 1 | 3 |
Beta-galactoside alpha-2,6-sialyltransferase 1 | Rattus norvegicus (Norway rat) | Ki | 64.0000 | 1 | 1 |
Beta-lactamase | Aeromonas hydrophila | Ki | 200.0000 | 1 | 1 |
Bifunctional aspartokinase/homoserine dehydrogenase 1 | Escherichia coli K-12 | Ki | 38,000.0000 | 1 | 2 |
Bifunctional purine biosynthesis protein ATIC | Homo sapiens (human) | IC50 | 25.0000 | 1 | 1 |
Bifunctional purine biosynthesis protein ATIC | Homo sapiens (human) | Ki | 0.4000 | 1 | 1 |
Bile salt export pump | Homo sapiens (human) | IC50 | 364.8800 | 5 | 15 |
Bile salt export pump | Rattus norvegicus (Norway rat) | IC50 | 350.7000 | 1 | 3 |
Bile salt export pump | Rattus norvegicus (Norway rat) | Ki | 7.0500 | 2 | 2 |
Broad substrate specificity ATP-binding cassette transporter ABCG2 | Homo sapiens (human) | IC50 | 59.2813 | 7 | 7 |
Butyrophilin subfamily 3 member A1 | Homo sapiens (human) | IC50 | 104.1667 | 10 | 12 |
Calcium-dependent protein kinase 1 | Plasmodium falciparum 3D7 | IC50 | 1.0000 | 1 | 1 |
Calcium-dependent protein kinase 4 | Plasmodium falciparum 3D7 | IC50 | 1.0000 | 1 | 1 |
Canalicular multispecific organic anion transporter 1 | Homo sapiens (human) | IC50 | 93.0000 | 1 | 2 |
Canalicular multispecific organic anion transporter 1 | Rattus norvegicus (Norway rat) | Ki | 39.5250 | 4 | 4 |
Cannabinoid receptor 1 | Rattus norvegicus (Norway rat) | Ki | 0.6300 | 1 | 1 |
Carbonic anhydrase | Dicentrarchus labrax (European seabass) | Ki | 5.9300 | 1 | 1 |
Carbonic anhydrase | Methanosarcina thermophila | Ki | 3,906.0000 | 2 | 5 |
Carbonic anhydrase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 9,673.3333 | 1 | 3 |
Carbonic anhydrase | Stylophora pistillata | Ki | 1,770.0000 | 1 | 3 |
Carbonic anhydrase | Stylophora pistillata | Ki | 613.3333 | 1 | 3 |
Carbonic anhydrase 1 | Homo sapiens (human) | Ki | 6,716.3091 | 17 | 57 |
Carbonic anhydrase 12 | Homo sapiens (human) | Ki | 109.1827 | 3 | 15 |
Carbonic anhydrase 13 | Mus musculus (house mouse) | Ki | 428.0233 | 4 | 18 |
Carbonic anhydrase 14 | Homo sapiens (human) | Ki | 111.4660 | 3 | 15 |
Carbonic anhydrase 15 | Mus musculus (house mouse) | Ki | 30,979.4750 | 3 | 10 |
Carbonic anhydrase 2 | Homo sapiens (human) | Ki | 11,741.7616 | 20 | 60 |
Carbonic anhydrase 3 | Bos taurus (cattle) | Ki | 17.6000 | 1 | 1 |
Carbonic anhydrase 3 | Homo sapiens (human) | Ki | 109.2127 | 3 | 15 |
Carbonic anhydrase 4 | Homo sapiens (human) | Ki | 10,906.4173 | 8 | 33 |
Carbonic anhydrase 5A, mitochondrial | Homo sapiens (human) | Ki | 159.9379 | 6 | 22 |
Carbonic anhydrase 5B, mitochondrial | Homo sapiens (human) | Ki | 150.3586 | 5 | 21 |
Carbonic anhydrase 6 | Homo sapiens (human) | Ki | 168.1187 | 7 | 26 |
Carbonic anhydrase 7 | Homo sapiens (human) | Ki | 729.0506 | 4 | 18 |
Carbonic anhydrase 9 | Homo sapiens (human) | Ki | 137.1685 | 6 | 20 |
Carbonic anhydrase, alpha family | Hydrogenovibrio crunogenus XCL-2 | Ki | 1.1000 | 1 | 1 |
Carnitine O-palmitoyltransferase 1, muscle isoform | Rattus norvegicus (Norway rat) | IC50 | 1.2000 | 1 | 1 |
Caspase-1 | Homo sapiens (human) | IC50 | 8.3190 | 1 | 1 |
Catechol O-methyltransferase | Homo sapiens (human) | Ki | 5,400.0000 | 1 | 1 |
Cationic amino acid transporter 3 | Homo sapiens (human) | IC50 | 220.5000 | 1 | 2 |
Cationic trypsin | Bos taurus (cattle) | Ki | 11.0000 | 1 | 1 |
CD209 antigen | Homo sapiens (human) | IC50 | 2,950.0000 | 1 | 1 |
CD209 antigen | Homo sapiens (human) | Ki | 6,700.0000 | 1 | 1 |
Cdk-related protein kinase 6 | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1.0000 | 1 | 1 |
Cereblon isoform 4 | Magnetospirillum gryphiswaldense | IC50 | 20.8000 | 1 | 1 |
Cereblon isoform 4 | Magnetospirillum gryphiswaldense | Ki | 5,570.2333 | 3 | 3 |
cGMP-inhibited 3',5'-cyclic phosphodiesterase A | Homo sapiens (human) | IC50 | 2.4000 | 1 | 1 |
cGMP-inhibited 3',5'-cyclic phosphodiesterase B | Homo sapiens (human) | IC50 | 2.4000 | 1 | 1 |
Chain A, 2-ENOYL-COA HYDRATASE | Rattus norvegicus (Norway rat) | Ki | 1.6000 | 1 | 1 |
Chain A, 3-phosphoshikimate 1-carboxyvinyltransferase | Escherichia coli | IC50 | 1,200.0000 | 1 | 4 |
Chain A, ADENOSINE DEAMINASE | Mus musculus (house mouse) | Ki | 0.0000 | 1 | 2 |
Chain A, Aicar Transformylase-imp Cyclohydrolase | Gallus gallus (chicken) | Ki | 0.1200 | 1 | 1 |
Chain A, AMINOPEPTIDASE | Streptomyces griseus | Ki | 12,550.0000 | 1 | 4 |
Chain A, Arginase 1 | Rattus norvegicus (Norway rat) | Ki | 3,600.0000 | 1 | 1 |
Chain A, Beta-phosphoglucomutase | Lactococcus lactis | Ki | 30.0000 | 1 | 4 |
Chain A, Bifunctional purine biosynthesis protein PURH | Homo sapiens (human) | Ki | 0.1200 | 1 | 1 |
Chain A, Carbonic anhydrase 2 | Homo sapiens (human) | Ki | 0.0900 | 1 | 3 |
Chain A, Deoxynucleoside kinase | Drosophila melanogaster (fruit fly) | IC50 | 1,000.0000 | 1 | 1 |
Chain A, Enolase | Homarus gammarus (European lobster) | Ki | 200.0000 | 1 | 1 |
Chain A, EOSINOPHIL-DERIVED NEUROTOXIN | Homo sapiens (human) | Ki | 32.0000 | 1 | 3 |
Chain A, Glucosamine--fructose-6-phosphate aminotransferase [isomerizing] | Escherichia coli | Ki | 15.0000 | 1 | 1 |
Chain A, Glucose-1-phosphate cytidylyltransferase | Salmonella enterica subsp. enterica serovar Typhi str. CT18 | Ki | 35.0000 | 1 | 1 |
Chain A, GLUTAMATE RECEPTOR SUBUNIT 2 | Rattus norvegicus (Norway rat) | IC50 | 0.8210 | 1 | 2 |
Chain A, HYPOXANTHINE PHOSPHORIBOSYLTRANSFERASE | Escherichia coli | Ki | 386.5000 | 1 | 4 |
Chain A, Hypoxanthine-guanine phosphoribosyltransferase | Caldanaerobacter subterraneus subsp. tengcongensis MB4 | Ki | 45.0000 | 1 | 1 |
Chain A, Isopentenyl-diphosphate delta-isomerase | Escherichia coli | IC50 | 50.0000 | 1 | 1 |
Chain A, Leucine Aminopeptidase | Bos taurus (cattle) | Ki | 0.0600 | 1 | 1 |
Chain A, METHYLGLYOXAL SYNTHASE | Escherichia coli | Ki | 3.9000 | 1 | 2 |
Chain A, MTA/SAH nucleosidase | Escherichia coli | Ki | 300.0000 | 1 | 1 |
Chain A, N-methyl-D-aspartate Receptor Subunit 1 | Rattus norvegicus (Norway rat) | Ki | 7.0200 | 1 | 3 |
Chain A, NAD-dependent deacetylase | Thermotoga maritima | IC50 | 1,000.0000 | 1 | 1 |
Chain A, orotidine 5'-monophosphate decarboxylase | Archaea | Ki | 100.2050 | 1 | 2 |
Chain A, orotidine 5'-monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
Chain A, orotidine monophosphate decarboxylase | Methanothermobacter thermautotrophicus | Ki | 100.2050 | 1 | 2 |
Chain A, orotidine monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
Chain A, Prostatic Acid Phosphatase | Rattus norvegicus (Norway rat) | Ki | 1.0000 | 1 | 1 |
Chain A, Ribonuclease pancreatic | Bos taurus (cattle) | Ki | 802.9167 | 1 | 12 |
Chain A, Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplast | Pisum sativum (garden pea) | Ki | 36,600.0000 | 1 | 2 |
Chain A, Toluene-4-monooxygenase system protein A | Pseudomonas mendocina | Ki | 5.0000 | 1 | 1 |
Chain A, TRIOSEPHOSPHATE ISOMERASE | Homo sapiens (human) | Ki | 7.4000 | 1 | 1 |
Chain A, TRIOSEPHOSPHATE ISOMERASE | Moritella marina | Ki | 89,000.0000 | 1 | 1 |
Chain A, Triosephosphate Isomerase | Plasmodium falciparum (malaria parasite P. falciparum) | Ki | 29.0000 | 1 | 2 |
Chain A, Triosephosphate Isomerase | Saccharomyces cerevisiae (brewer's yeast) | Ki | 15.0000 | 1 | 1 |
Chain A, Triosephosphate Isomerase | Trypanosoma brucei brucei | Ki | 52.0000 | 1 | 1 |
Chain A, triosephosphate isomerase, glycosomal | Trypanosoma brucei brucei | Ki | 60.0000 | 1 | 1 |
Chain A, TRYPSIN | Bos taurus (cattle) | Ki | 11,000.0000 | 1 | 6 |
Chain A, Type Iii Chloramphenicol Acetyltransferase | Shigella flexneri | Ki | 5.4000 | 1 | 1 |
Chain A, Uracil-DNA Glycosylase | Thermus thermophilus | Ki | 0.0880 | 1 | 1 |
Chain A, X-ray structure of the sucrose-phosphatase (SPP) from Synechocystis sp.PCC6803 in complex with cellobiose | Synechocystis sp. PCC 6803 | Ki | 26,000.0000 | 1 | 1 |
Chain A, X-ray structure of the sucrose-phosphatase (SPP) from Synechocystis sp.PCC6803 in complex with maltose | Synechocystis sp. PCC 6803 | Ki | 26,000.0000 | 1 | 1 |
Chain A, X-ray structure of the sucrose-phosphatase (SPP) from Synechocystis sp.PCC6803 in complex with trehalose | Synechocystis sp. PCC 6803 | Ki | 26,000.0000 | 1 | 1 |
Chain B, 2-ENOYL-COA HYDRATASE | Rattus norvegicus (Norway rat) | Ki | 1.6000 | 1 | 1 |
Chain B, Aicar Transformylase-imp Cyclohydrolase | Gallus gallus (chicken) | Ki | 0.1200 | 1 | 1 |
Chain B, Bifunctional purine biosynthesis protein PURH | Homo sapiens (human) | Ki | 0.1200 | 1 | 1 |
Chain B, CTP synthase | Escherichia coli K-12 | Ki | 110.0000 | 1 | 1 |
Chain B, Glutamate Receptor Subunit 2 | Rattus norvegicus (Norway rat) | IC50 | 0.8210 | 1 | 1 |
Chain B, orotidine 5'-monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
Chain B, orotidine monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
Chain B, TRIOSEPHOSPHATE ISOMERASE | Homo sapiens (human) | Ki | 7.4000 | 1 | 1 |
Chain B, Triosephosphate Isomerase | Plasmodium falciparum (malaria parasite P. falciparum) | Ki | 29.0000 | 1 | 2 |
Chain F, METHYLGLYOXAL SYNTHASE | Escherichia coli | Ki | 3.9000 | 1 | 2 |
Cholesteryl ester transfer protein | Homo sapiens (human) | IC50 | 0.1400 | 1 | 1 |
Choline O-acetyltransferase | Homo sapiens (human) | IC50 | 1,800,000,000.0000 | 1 | 1 |
Choline O-acetyltransferase | Homo sapiens (human) | Ki | 75.0000 | 1 | 1 |
Choline O-acetyltransferase | Rattus norvegicus (Norway rat) | Ki | 25,000.0000 | 1 | 1 |
Choline trimethylamine-lyase | Oleidesulfovibrio alaskensis G20 | IC50 | 26.0000 | 1 | 1 |
Cholinesterase | Equus caballus (horse) | IC50 | 0.0160 | 1 | 1 |
Cholinesterase | Homo sapiens (human) | Ki | 100.0000 | 3 | 8 |
CMP-N-acetylneuraminate-beta-1,4-galactoside alpha-2,3-sialyltransferase | Rattus norvegicus (Norway rat) | Ki | 65.0000 | 1 | 1 |
CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 | Homo sapiens (human) | IC50 | 125.2600 | 1 | 5 |
Coagulation factor VII | Homo sapiens (human) | IC50 | 100.0000 | 1 | 2 |
Coagulation factor VII | Homo sapiens (human) | Ki | 8,000.0000 | 1 | 1 |
Coagulation factor XII | Homo sapiens (human) | Ki | 100.0000 | 1 | 6 |
Cocaine esterase | Homo sapiens (human) | Ki | 100.0000 | 2 | 2 |
Cyclin-dependent kinase 1 | Homo sapiens (human) | IC50 | 200.0000 | 1 | 1 |
Cytochrome P450 1A1 | Rattus norvegicus (Norway rat) | IC50 | 97.3618 | 2 | 2 |
Cytochrome P450 1B1 | Homo sapiens (human) | IC50 | 120.0000 | 1 | 1 |
Cytochrome P450 2A5 | Mus musculus (house mouse) | IC50 | 3.0000 | 1 | 1 |
Cytochrome P450 2A6 | Homo sapiens (human) | IC50 | 4.4100 | 1 | 1 |
Cytochrome P450 2B1 | Rattus norvegicus (Norway rat) | IC50 | 180.9850 | 2 | 2 |
Cytochrome P450 2C9 | Homo sapiens (human) | IC50 | 0.1400 | 1 | 1 |
Cytochrome P450 3A4 | Homo sapiens (human) | Ki | 10.6000 | 1 | 1 |
Cytochrome P450 3A5 | Homo sapiens (human) | IC50 | 40.0000 | 1 | 1 |
D-amino-acid oxidase | Homo sapiens (human) | IC50 | 1,125.0000 | 1 | 1 |
D-aspartate oxidase | Homo sapiens (human) | IC50 | 2,778.0000 | 1 | 1 |
D(1A) dopamine receptor | Homo sapiens (human) | Ki | 390.0000 | 1 | 2 |
D(2) dopamine receptor | Homo sapiens (human) | Ki | 160.0000 | 1 | 1 |
Deoxyhypusine synthase | Rattus norvegicus (Norway rat) | IC50 | 156.0000 | 1 | 1 |
Deoxyuridine triphosphatase, putative | Trypanosoma cruzi strain CL Brener | Ki | 18.4000 | 1 | 1 |
Dihydrofolate reductase | Homo sapiens (human) | IC50 | 6,500.0000 | 1 | 1 |
Dihydrofolate reductase | Homo sapiens (human) | Ki | 1,401.1850 | 2 | 2 |
Dihydrofolate synthase/folylpolyglutamate synthase | Escherichia coli K-12 | Ki | 3.1000 | 1 | 1 |
Disintegrin and metalloproteinase domain-containing protein 17 | Homo sapiens (human) | IC50 | 200.0000 | 1 | 1 |
DNA gyrase subunit A | Escherichia coli K-12 | IC50 | 0.1441 | 10 | 10 |
DNA gyrase subunit A | Mycobacterium tuberculosis H37Rv | IC50 | 7.4958 | 12 | 13 |
DNA gyrase subunit A | Staphylococcus aureus | IC50 | 0.0383 | 13 | 13 |
DNA gyrase subunit A | Escherichia coli K-12 | Ki | 0.0447 | 1 | 3 |
DNA gyrase subunit A | Staphylococcus aureus | Ki | 0.0360 | 2 | 4 |
DNA gyrase subunit B | Escherichia coli K-12 | IC50 | 0.1537 | 15 | 15 |
DNA gyrase subunit B | Mycobacterium tuberculosis H37Rv | IC50 | 8.0372 | 11 | 12 |
DNA gyrase subunit B | Mycolicibacterium smegmatis | IC50 | 25.8523 | 7 | 7 |
DNA gyrase subunit B | Mycolicibacterium smegmatis MC2 155 | IC50 | 0.0460 | 1 | 1 |
DNA gyrase subunit B | Staphylococcus aureus | IC50 | 0.0474 | 19 | 19 |
DNA gyrase subunit B | Streptococcus pneumoniae TIGR4 | IC50 | 0.0370 | 1 | 1 |
DNA gyrase subunit B | Escherichia coli K-12 | Ki | 0.0353 | 2 | 4 |
DNA gyrase subunit B | Staphylococcus aureus | Ki | 0.0360 | 2 | 4 |
DNA polymerase beta | Homo sapiens (human) | IC50 | 1.4000 | 1 | 1 |
DNA topoisomerase | Streptococcus pneumoniae | IC50 | 2.0300 | 1 | 1 |
DNA topoisomerase 1 | Homo sapiens (human) | IC50 | 31.0000 | 1 | 1 |
DNA topoisomerase 2-alpha | Homo sapiens (human) | IC50 | 256.0000 | 1 | 1 |
DNA topoisomerase 4 subunit A | Staphylococcus aureus | IC50 | 25.6000 | 5 | 5 |
DNA topoisomerase 4 subunit A | Escherichia coli K-12 | Ki | 0.0447 | 1 | 3 |
DNA topoisomerase 4 subunit B | Staphylococcus aureus | IC50 | 22.6500 | 6 | 6 |
DNA topoisomerase 4 subunit B | Escherichia coli K-12 | Ki | 0.0447 | 1 | 3 |
DNA-directed RNA polymerase subunit beta | Escherichia coli O127:H6 str. E2348/69 | IC50 | 511.3333 | 3 | 3 |
DNA-directed RNA polymerase subunit beta | Mycobacterium tuberculosis H37Rv | IC50 | 0.0100 | 1 | 1 |
E3 ubiquitin-protein ligase XIAP | Homo sapiens (human) | IC50 | 80.2000 | 1 | 1 |
Enoyl-[acyl-carrier-protein] reductase [NADH] | Mycobacterium tuberculosis H37Rv | IC50 | 0.0300 | 1 | 1 |
Excitatory amino acid transporter 1 | Homo sapiens (human) | IC50 | 159.1112 | 5 | 12 |
Excitatory amino acid transporter 1 | Homo sapiens (human) | Ki | 33.3114 | 1 | 2 |
Excitatory amino acid transporter 2 | Homo sapiens (human) | IC50 | 48.5752 | 3 | 7 |
Excitatory amino acid transporter 2 | Homo sapiens (human) | Ki | 62.5478 | 1 | 2 |
Excitatory amino acid transporter 3 | Homo sapiens (human) | IC50 | 33.9961 | 2 | 6 |
Excitatory amino acid transporter 3 | Homo sapiens (human) | Ki | 25.0848 | 1 | 2 |
Excitatory amino acid transporter 4 | Rattus norvegicus (Norway rat) | IC50 | 12.1228 | 2 | 6 |
Eyes absent homolog 2 | Homo sapiens (human) | IC50 | 8,200.0000 | 1 | 1 |
Farnesyl pyrophosphate synthase | Homo sapiens (human) | IC50 | 212.0000 | 2 | 2 |
Farnesyl pyrophosphate synthase | Homo sapiens (human) | Ki | 35.1500 | 2 | 2 |
Fatty acid synthase | Homo sapiens (human) | Ki | 1,500.0000 | 1 | 1 |
Fatty acid-binding protein 5 | Homo sapiens (human) | Ki | 1.2570 | 2 | 4 |
Fatty acid-binding protein, adipocyte | Homo sapiens (human) | IC50 | 26.1000 | 1 | 1 |
Fatty acid-binding protein, adipocyte | Homo sapiens (human) | Ki | 0.8425 | 2 | 2 |
Fatty acid-binding protein, liver | Rattus norvegicus (Norway rat) | Ki | 1.5400 | 2 | 2 |
Fatty-acid amide hydrolase 1 | Rattus norvegicus (Norway rat) | IC50 | 3.3000 | 1 | 1 |
Fatty-acid amide hydrolase 1 | Homo sapiens (human) | Ki | 6.0000 | 1 | 1 |
Fatty-acid amide hydrolase 1 | Rattus norvegicus (Norway rat) | Ki | 0.3900 | 1 | 1 |
Fibrinogen C domain-containing protein 1 | Homo sapiens (human) | IC50 | 5,000.0000 | 1 | 1 |
Fructose-1,6-bisphosphatase 1 | Homo sapiens (human) | IC50 | 12.0000 | 1 | 1 |
Fucose-binding lectin PA-IIL | Pseudomonas aeruginosa PAO1 | IC50 | 2.1300 | 3 | 3 |
G-protein coupled receptor 84 | Homo sapiens (human) | Ki | 11.4550 | 1 | 2 |
GABA theta subunit | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit beta-1 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit beta-2 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit beta-3 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit delta | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit epsilon | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit gamma-1 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit gamma-2 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit gamma-3 | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit pi | Rattus norvegicus (Norway rat) | IC50 | 67.0000 | 1 | 1 |
Gamma-aminobutyric acid receptor subunit rho-1 | Homo sapiens (human) | IC50 | 12.9000 | 1 | 1 |
Genome polyprotein | Zika virus | IC50 | 14.2000 | 1 | 1 |
Glucose transporter | Leishmania mexicana | IC50 | 12.0000 | 1 | 1 |
Glucose-1-phosphate cytidylyltransferase | Salmonella enterica subsp. enterica serovar Typhi | Ki | 35.0000 | 1 | 1 |
Glucose-6-phosphate 1-dehydrogenase | Homo sapiens (human) | Ki | 15.4000 | 1 | 1 |
Glutamate carboxypeptidase 2 | Homo sapiens (human) | IC50 | 475.5000 | 2 | 4 |
Glutamate dehydrogenase 1, mitochondrial | Bos taurus (cattle) | Ki | 10,000.0000 | 1 | 1 |
Glutamate racemase | Helicobacter pylori 26695 | Ki | 33,555.6000 | 3 | 3 |
Glutamate receptor 1 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
Glutamate receptor 1 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
Glutamate receptor 1 | Homo sapiens (human) | Ki | 198.8164 | 4 | 5 |
Glutamate receptor 1 | Rattus norvegicus (Norway rat) | Ki | 0.6345 | 2 | 2 |
Glutamate receptor 2 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
Glutamate receptor 2 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
Glutamate receptor 2 | Homo sapiens (human) | Ki | 198.5640 | 4 | 5 |
Glutamate receptor 2 | Rattus norvegicus (Norway rat) | Ki | 0.4452 | 4 | 5 |
Glutamate receptor 3 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
Glutamate receptor 3 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
Glutamate receptor 3 | Homo sapiens (human) | Ki | 495.0000 | 1 | 2 |
Glutamate receptor 3 | Rattus norvegicus (Norway rat) | Ki | 2.3122 | 4 | 4 |
Glutamate receptor 4 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
Glutamate receptor 4 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
Glutamate receptor 4 | Homo sapiens (human) | Ki | 198.5208 | 4 | 5 |
Glutamate receptor 4 | Rattus norvegicus (Norway rat) | Ki | 0.7270 | 2 | 2 |
Glutamate receptor ionotropic, kainate 1 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
Glutamate receptor ionotropic, kainate 1 | Homo sapiens (human) | Ki | 0.7010 | 2 | 2 |
Glutamate receptor ionotropic, kainate 1 | Rattus norvegicus (Norway rat) | Ki | 0.1284 | 5 | 7 |
Glutamate receptor ionotropic, kainate 2 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
Glutamate receptor ionotropic, kainate 2 | Homo sapiens (human) | Ki | 1.1060 | 2 | 2 |
Glutamate receptor ionotropic, kainate 2 | Rattus norvegicus (Norway rat) | Ki | 0.9566 | 7 | 9 |
Glutamate receptor ionotropic, kainate 3 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
Glutamate receptor ionotropic, kainate 3 | Homo sapiens (human) | Ki | 0.7890 | 2 | 2 |
Glutamate receptor ionotropic, kainate 3 | Rattus norvegicus (Norway rat) | Ki | 124.0651 | 5 | 8 |
Glutamate receptor ionotropic, kainate 4 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
Glutamate receptor ionotropic, kainate 4 | Rattus norvegicus (Norway rat) | Ki | 0.0630 | 1 | 1 |
Glutamate receptor ionotropic, kainate 5 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
Glutamate receptor ionotropic, kainate 5 | Homo sapiens (human) | Ki | 0.7337 | 3 | 3 |
Glutamate receptor ionotropic, kainate 5 | Rattus norvegicus (Norway rat) | Ki | 0.0630 | 1 | 1 |
Glutamate receptor ionotropic, NMDA 1 | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | IC50 | 63.5474 | 9 | 11 |
Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutamate receptor ionotropic, NMDA 2A | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | IC50 | 24.1814 | 7 | 8 |
Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutamate receptor ionotropic, NMDA 2B | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | IC50 | 24.1814 | 7 | 8 |
Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutamate receptor ionotropic, NMDA 2C | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | IC50 | 24.1814 | 7 | 8 |
Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutamate receptor ionotropic, NMDA 2D | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | IC50 | 24.1814 | 7 | 8 |
Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutamate receptor ionotropic, NMDA 3A | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | IC50 | 24.1814 | 7 | 8 |
Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutamate receptor ionotropic, NMDA 3B | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | IC50 | 24.1814 | 7 | 8 |
Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | Ki | 8.4950 | 5 | 6 |
Glutaminyl-peptide cyclotransferase | Homo sapiens (human) | Ki | 2,965.0000 | 1 | 2 |
Glutaminyl-peptide cyclotransferase | Mus musculus (house mouse) | Ki | 19,300.0000 | 1 | 1 |
Glutathione reductase, mitochondrial | Homo sapiens (human) | IC50 | 57.4500 | 1 | 2 |
Glutathione reductase, mitochondrial | Homo sapiens (human) | Ki | 48.6500 | 1 | 2 |
Glutathione S-transferase omega-1 | Homo sapiens (human) | IC50 | 75.0000 | 1 | 1 |
Glyceraldehyde-3-phosphate dehydrogenase | Homo sapiens (human) | IC50 | 500.0000 | 2 | 2 |
Gonadotropin-releasing hormone receptor | Rattus norvegicus (Norway rat) | Ki | 6.5000 | 1 | 3 |
green fluorescent protein, partial | Aequorea victoria | IC50 | 67.5880 | 1 | 1 |
GTP:AMP phosphotransferase AK3, mitochondrial | Rattus norvegicus (Norway rat) | Ki | 0.3000 | 1 | 1 |
Guanine deaminase | Homo sapiens (human) | Ki | 4.3400 | 1 | 1 |
guanine nucleotide-binding protein subunit alpha-15 | Homo sapiens (human) | IC50 | 29.9020 | 1 | 1 |
Heat shock protein HSP 90 | Oryctolagus cuniculus (rabbit) | IC50 | 382.0000 | 2 | 2 |
Heat shock protein HSP 90-beta | Homo sapiens (human) | IC50 | 3,057.7500 | 3 | 4 |
Hexose transporter 1 | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 12.0000 | 1 | 1 |
High affinity choline transporter 1 | Mus musculus (house mouse) | IC50 | 1.6000 | 1 | 1 |
Histone acetyltransferase KAT2B | Homo sapiens (human) | IC50 | 41.9100 | 1 | 1 |
Histone acetyltransferase KAT5 | Homo sapiens (human) | IC50 | 82.2700 | 1 | 1 |
Histone acetyltransferase p300 | Homo sapiens (human) | IC50 | 45.9400 | 1 | 1 |
Histone-lysine N-methyltransferase EHMT1 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
Histone-lysine N-methyltransferase EHMT2 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
Hydroxycarboxylic acid receptor 2 | Homo sapiens (human) | IC50 | 4.3681 | 16 | 16 |
Hydroxycarboxylic acid receptor 2 | Mus musculus (house mouse) | IC50 | 0.1400 | 3 | 3 |
Hydroxycarboxylic acid receptor 2 | Homo sapiens (human) | Ki | 0.0787 | 3 | 3 |
Hypoxanthine-guanine phosphoribosyltransferase | Homo sapiens (human) | Ki | 5.6667 | 2 | 3 |
Indoleamine 2,3-dioxygenase 1 | Homo sapiens (human) | IC50 | 498.7000 | 1 | 1 |
Indolethylamine N-methyltransferase | Homo sapiens (human) | Ki | 700.0000 | 1 | 2 |
Inosine-5'-monophosphate dehydrogenase 1 | Homo sapiens (human) | Ki | 0.2500 | 1 | 1 |
Inosine-5'-monophosphate dehydrogenase 2 | Homo sapiens (human) | Ki | 0.2500 | 1 | 1 |
Intestinal-type alkaline phosphatase | Bos taurus (cattle) | IC50 | 80.2060 | 5 | 5 |
Intestinal-type alkaline phosphatase | Homo sapiens (human) | IC50 | 39.0400 | 3 | 5 |
L-lactate dehydrogenase | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1,046.2500 | 2 | 2 |
L-lactate dehydrogenase | Plasmodium falciparum CDC/Honduras | IC50 | 1,243.1000 | 1 | 5 |
L-lactate dehydrogenase | Homo sapiens (human) | IC50 | 25,000.0000 | 1 | 1 |
L-lactate dehydrogenase A chain | Homo sapiens (human) | IC50 | 57.2000 | 2 | 2 |
L-lactate dehydrogenase A chain | Mus musculus (house mouse) | IC50 | 56.6667 | 1 | 3 |
L-lactate dehydrogenase A chain | Bos taurus (cattle) | Ki | 136.0000 | 1 | 1 |
L-lactate dehydrogenase A chain | Homo sapiens (human) | Ki | 109.5000 | 4 | 4 |
L-lactate dehydrogenase B chain | Bos taurus (cattle) | IC50 | 1,243.1000 | 1 | 5 |
L-lactate dehydrogenase B chain | Homo sapiens (human) | IC50 | 33.8000 | 2 | 2 |
L-lactate dehydrogenase B chain | Mus musculus (house mouse) | IC50 | 56.6667 | 1 | 3 |
L-lactate dehydrogenase B chain | Homo sapiens (human) | Ki | 94.4000 | 2 | 2 |
L-lactate dehydrogenase C chain | Mus musculus (house mouse) | IC50 | 56.6667 | 1 | 3 |
Lanosterol 14-alpha demethylase | Homo sapiens (human) | IC50 | 30.0000 | 1 | 1 |
Large neutral amino acids transporter small subunit 1 | Homo sapiens (human) | IC50 | 124.8333 | 3 | 12 |
Large neutral amino acids transporter small subunit 1 | Rattus norvegicus (Norway rat) | Ki | 55.0000 | 1 | 1 |
large T antigen | Betapolyomavirus macacae | IC50 | 14.0900 | 1 | 2 |
Lecithin retinol acyltransferase | Homo sapiens (human) | IC50 | 14.9000 | 1 | 1 |
Lethal factor | Bacillus anthracis | Ki | 0.2535 | 2 | 2 |
Leucine-rich repeat serine/threonine-protein kinase 2 | Homo sapiens (human) | IC50 | 15.8090 | 1 | 1 |
Leucine-rich repeat serine/threonine-protein kinase 2 | Homo sapiens (human) | Ki | 6.7150 | 1 | 1 |
Lipopolysaccharide heptosyltransferase 1 | Escherichia coli K-12 | Ki | 500.0000 | 1 | 1 |
Liver carboxylesterase 1 | Homo sapiens (human) | Ki | 100.0000 | 3 | 8 |
Liver carboxylesterase 1 | Oryctolagus cuniculus (rabbit) | Ki | 100.0000 | 3 | 8 |
Low molecular weight phosphotyrosine protein phosphatase | Homo sapiens (human) | Ki | 13.0000 | 1 | 1 |
Lysine--tRNA ligase | Plasmodium falciparum 3D7 | IC50 | 2.5000 | 1 | 1 |
Lysine-specific demethylase 4E | Homo sapiens (human) | IC50 | 5,000.0000 | 1 | 1 |
Lysyl oxidase homolog 2 | Homo sapiens (human) | IC50 | 60.1000 | 1 | 1 |
Macrophage migration inhibitory factor | Homo sapiens (human) | IC50 | 400.0000 | 1 | 1 |
Malate dehydrogenase, cytoplasmic | Sus scrofa (pig) | IC50 | 1,369.2500 | 2 | 6 |
Malate dehydrogenase, mitochondrial | Sus scrofa (pig) | IC50 | 1,369.2500 | 2 | 6 |
Matrilysin | Homo sapiens (human) | IC50 | 125.2600 | 1 | 5 |
Metabotropic glutamate receptor 1 | Homo sapiens (human) | Ki | 252.7050 | 3 | 4 |
Metabotropic glutamate receptor 1 | Rattus norvegicus (Norway rat) | Ki | 0.3400 | 1 | 1 |
Metabotropic glutamate receptor 2 | Homo sapiens (human) | Ki | 13.1200 | 5 | 5 |
Metabotropic glutamate receptor 3 | Homo sapiens (human) | Ki | 9.0000 | 1 | 1 |
Metabotropic glutamate receptor 3 | Rattus norvegicus (Norway rat) | Ki | 10,000.0000 | 1 | 2 |
Metabotropic glutamate receptor 4 | Homo sapiens (human) | Ki | 604.4800 | 4 | 5 |
Metabotropic glutamate receptor 4 | Rattus norvegicus (Norway rat) | Ki | 3.4000 | 2 | 2 |
Metabotropic glutamate receptor 5 | Homo sapiens (human) | Ki | 253.2375 | 3 | 4 |
Metabotropic glutamate receptor 6 | Homo sapiens (human) | Ki | 89.0000 | 1 | 2 |
Metabotropic glutamate receptor 7 | Homo sapiens (human) | Ki | 5,400.0000 | 1 | 1 |
Metabotropic glutamate receptor 8 | Homo sapiens (human) | IC50 | 0.0057 | 1 | 1 |
Metabotropic glutamate receptor 8 | Homo sapiens (human) | Ki | 9.5000 | 1 | 1 |
Metabotropic glutamate receptor 8 | Rattus norvegicus (Norway rat) | Ki | 3.4000 | 2 | 2 |
Microtubule-associated proteins 1A/1B light chain 3A | Homo sapiens (human) | IC50 | 42.9000 | 1 | 1 |
Microtubule-associated proteins 1A/1B light chain 3A | Homo sapiens (human) | Ki | 8.8000 | 1 | 1 |
Microtubule-associated proteins 1A/1B light chain 3B | Homo sapiens (human) | IC50 | 172.0000 | 1 | 1 |
Microtubule-associated proteins 1A/1B light chain 3B | Homo sapiens (human) | Ki | 19.3000 | 1 | 1 |
Mitogen-activated protein kinase | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1.0000 | 1 | 1 |
Monocarboxylate transporter 10 | Rattus norvegicus (Norway rat) | Ki | 3,100.0000 | 1 | 1 |
Multidrug and toxin extrusion protein 1 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
Multidrug resistance-associated protein 4 | Homo sapiens (human) | IC50 | 102.6333 | 1 | 3 |
Myeloperoxidase | Homo sapiens (human) | IC50 | 2.2500 | 1 | 1 |
N-acetyllactosaminide alpha-1,3-galactosyltransferase | Mus musculus (house mouse) | Ki | 128.0000 | 1 | 1 |
N(4)-(beta-N-acetylglucosaminyl)-L-asparaginase | Homo sapiens (human) | Ki | 600.0000 | 1 | 1 |
N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 | Homo sapiens (human) | Ki | 2,350.0000 | 1 | 2 |
NAD-dependent histone deacetylase SIR2 | Saccharomyces cerevisiae S288C | IC50 | 50.0000 | 1 | 1 |
NAD-dependent protein deacetylase | Schistosoma mansoni | IC50 | 221.5500 | 2 | 2 |
NAD-dependent protein deacetylase HST2 | Saccharomyces cerevisiae S288C | IC50 | 91.0000 | 1 | 1 |
NAD-dependent protein deacetylase sirtuin-1 | Homo sapiens (human) | IC50 | 130.9500 | 12 | 12 |
NAD-dependent protein deacetylase sirtuin-2 | Homo sapiens (human) | IC50 | 28.2214 | 14 | 14 |
NAD-dependent protein deacetylase sirtuin-3, mitochondrial | Homo sapiens (human) | IC50 | 78.4571 | 7 | 7 |
NAD-dependent protein deacetylase sirtuin-6 | Homo sapiens (human) | IC50 | 173.3500 | 4 | 4 |
NAD-dependent protein deacylase sirtuin-5, mitochondrial | Homo sapiens (human) | IC50 | 58.2000 | 3 | 3 |
NAD(+) hydrolase SARM1 | Homo sapiens (human) | IC50 | 43.8000 | 1 | 1 |
Neuronal acetylcholine receptor subunit alpha-10 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
Neuronal acetylcholine receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | Ki | 34.0000 | 2 | 3 |
Neuronal acetylcholine receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | Ki | 42.2500 | 3 | 4 |
Neuronal acetylcholine receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | Ki | 38.7500 | 3 | 4 |
Neuronal acetylcholine receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
Neuronal acetylcholine receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
Neuronal acetylcholine receptor subunit alpha-7 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
Neuronal acetylcholine receptor subunit alpha-9 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
Neuronal acetylcholine receptor subunit beta-2 | Rattus norvegicus (Norway rat) | Ki | 35.2000 | 4 | 5 |
Neuronal acetylcholine receptor subunit beta-3 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
Neuronal acetylcholine receptor subunit beta-4 | Rattus norvegicus (Norway rat) | Ki | 41.5000 | 3 | 4 |
Neutral amino acid transporter A | Homo sapiens (human) | IC50 | 2,079.4000 | 1 | 5 |
Neutral amino acid transporter B(0) | Homo sapiens (human) | IC50 | 3,390.0000 | 1 | 5 |
NH(3)-dependent NAD(+) synthetase | Bacillus subtilis subsp. subtilis str. 168 | IC50 | 1.0000 | 1 | 1 |
Nicotinamidase | Saccharomyces cerevisiae S288C | Ki | 2,000.0000 | 1 | 1 |
Nischarin | Rattus norvegicus (Norway rat) | IC50 | 36.5320 | 2 | 2 |
Nitric oxide synthase, brain | Homo sapiens (human) | Ki | 2,350.0000 | 1 | 2 |
Nitric oxide synthase, brain | Rattus norvegicus (Norway rat) | Ki | 2,350.0000 | 1 | 2 |
Nociceptin receptor | Mus musculus (house mouse) | Ki | 240.0000 | 1 | 1 |
nonstructural protein 1 | Influenza A virus (A/California/07/2009(H1N1)) | IC50 | 0.2000 | 1 | 1 |
Ornithine transcarbamylase, mitochondrial | Homo sapiens (human) | Ki | 1,043.3333 | 3 | 3 |
Orotidine 5'-phosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 765.0000 | 1 | 2 |
Orotidine 5'-phosphate decarboxylase | Plasmodium falciparum (malaria parasite P. falciparum) | Ki | 5,105.0000 | 1 | 2 |
P2X purinoceptor 1 | Homo sapiens (human) | IC50 | 10.0000 | 1 | 1 |
P2Y purinoceptor 1 | Meleagris gallopavo (turkey) | IC50 | 9.5450 | 2 | 2 |
P2Y purinoceptor 12 | Homo sapiens (human) | IC50 | 250.0000 | 1 | 1 |
P2Y purinoceptor 2 | Mus musculus (house mouse) | IC50 | 1.5100 | 1 | 1 |
Peroxisomal N(1)-acetyl-spermine/spermidine oxidase | Homo sapiens (human) | Ki | 1,370.0000 | 1 | 1 |
Phenol oxidase | Plutella xylostella (diamondback moth) | IC50 | 78.3200 | 1 | 1 |
Phenylethanolamine N-methyltransferase | Bos taurus (cattle) | Ki | 456.0000 | 3 | 3 |
Phosphodiesterase | Bos taurus (cattle) | IC50 | 0.1000 | 1 | 1 |
Phospholipase A-2-activating protein | Homo sapiens (human) | IC50 | 5.0000 | 1 | 3 |
Poly [ADP-ribose] polymerase 1 | Homo sapiens (human) | IC50 | 187.0070 | 6 | 7 |
Poly [ADP-ribose] polymerase 2 | Mus musculus (house mouse) | IC50 | 129.5245 | 1 | 2 |
Polyamine oxidase 1 | Zea mays | Ki | 3.0000 | 1 | 1 |
Polyphenol oxidase 1 | Agaricus bisporus | IC50 | 320.0000 | 1 | 1 |
Polyphenol oxidase 2 | Agaricus bisporus | IC50 | 3,815.7969 | 28 | 32 |
Polyunsaturated fatty acid 5-lipoxygenase | Homo sapiens (human) | Ki | 27.0000 | 1 | 1 |
Polyunsaturated fatty acid lipoxygenase ALOX15 | Oryctolagus cuniculus (rabbit) | IC50 | 2.9490 | 1 | 1 |
Proline--tRNA ligase | Plasmodium falciparum 3D7 | IC50 | 2.5000 | 1 | 1 |
Prolyl 4-hydroxylase | Paramecium bursaria Chlorella virus 1 | IC50 | 1,000.0000 | 1 | 1 |
Prolyl 4-hydroxylase subunit alpha-1 | Gallus gallus (chicken) | Ki | 17,000.0000 | 1 | 2 |
Prostaglandin G/H synthase 1 | Bos taurus (cattle) | IC50 | 500.0000 | 1 | 1 |
Prostaglandin G/H synthase 2 | Ovis aries (sheep) | IC50 | 500.0000 | 1 | 1 |
Protein cereblon | Homo sapiens (human) | IC50 | 1,893.0000 | 1 | 3 |
Protein cereblon | Homo sapiens (human) | Ki | 45,783.0000 | 2 | 3 |
Protein kinase domain-containing protein | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1.0000 | 1 | 1 |
Protein mono-ADP-ribosyltransferase PARP15 | Homo sapiens (human) | IC50 | 15.0000 | 1 | 2 |
Proto-oncogene tyrosine-protein kinase Src | Homo sapiens (human) | IC50 | 73.0000 | 1 | 2 |
Proton-coupled amino acid transporter 1 | Homo sapiens (human) | Ki | 28,037.5000 | 1 | 8 |
Purine nucleoside phosphorylase | Homo sapiens (human) | IC50 | 5.0000 | 1 | 2 |
Purine nucleoside phosphorylase | Homo sapiens (human) | Ki | 752.5000 | 1 | 2 |
Reverse transcriptase/RNaseH | Human immunodeficiency virus 1 | Ki | 0.0610 | 1 | 1 |
Riboflavin-binding protein | Gallus gallus (chicken) | Ki | 0.3500 | 1 | 1 |
Ribonuclease pancreatic | Homo sapiens (human) | IC50 | 312.0000 | 1 | 1 |
Ribonuclease pancreatic | Bos taurus (cattle) | Ki | 268.2571 | 3 | 7 |
Ribonuclease pancreatic | Homo sapiens (human) | Ki | 103.0000 | 1 | 1 |
Ricin | Ricinus communis (castor bean) | IC50 | 900.0000 | 1 | 1 |
Seed linoleate 13S-lipoxygenase-1 | Glycine max (soybean) | Ki | 22.0000 | 1 | 1 |
Seminal ribonuclease | Bos taurus (cattle) | Ki | 673.8500 | 1 | 4 |
Shiga toxin subunit A | Shigella dysenteriae | IC50 | 11.5000 | 1 | 1 |
Sigma non-opioid intracellular receptor 1 | Cavia porcellus (domestic guinea pig) | Ki | 10.0000 | 1 | 1 |
Sodium- and chloride-dependent betaine transporter | Homo sapiens (human) | IC50 | 630.9570 | 1 | 1 |
Sodium- and chloride-dependent creatine transporter 1 | Rattus norvegicus (Norway rat) | IC50 | 1.6000 | 1 | 1 |
Sodium- and chloride-dependent GABA transporter 1 | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 1 |
Sodium- and chloride-dependent GABA transporter 2 | Homo sapiens (human) | IC50 | 39.8107 | 1 | 1 |
Sodium- and chloride-dependent GABA transporter 3 | Homo sapiens (human) | IC50 | 31.6228 | 1 | 1 |
Sodium- and chloride-dependent glycine transporter 1 | Homo sapiens (human) | IC50 | 91.0000 | 1 | 1 |
Sodium- and chloride-dependent taurine transporter | Homo sapiens (human) | IC50 | 10.0000 | 1 | 1 |
Sodium/iodide cotransporter | Rattus norvegicus (Norway rat) | IC50 | 14.0000 | 1 | 1 |
Solute carrier family 15 member 1 | Homo sapiens (human) | Ki | 396.6667 | 2 | 3 |
Solute carrier family 15 member 1 | Rattus norvegicus (Norway rat) | Ki | 2,200.0000 | 1 | 1 |
Solute carrier family 15 member 2 | Homo sapiens (human) | Ki | 28.9202 | 1 | 2 |
Solute carrier family 15 member 2 | Rattus norvegicus (Norway rat) | Ki | 230.0000 | 1 | 1 |
Solute carrier family 2, facilitated glucose transporter member 1 | Homo sapiens (human) | IC50 | 12.0000 | 1 | 1 |
Solute carrier family 2, facilitated glucose transporter member 9 | Homo sapiens (human) | IC50 | 650.0000 | 1 | 2 |
Solute carrier family 22 member 1 | Mus musculus (house mouse) | IC50 | 55.0000 | 1 | 1 |
Solute carrier family 22 member 1 | Rattus norvegicus (Norway rat) | IC50 | 925.0000 | 2 | 2 |
Solute carrier family 22 member 1 | Rattus norvegicus (Norway rat) | Ki | 4,668.0000 | 2 | 2 |
Solute carrier family 22 member 1 | Homo sapiens (human) | IC50 | 4,354.0000 | 1 | 1 |
Solute carrier family 22 member 1 | Homo sapiens (human) | Ki | 24,000.0000 | 1 | 1 |
Solute carrier family 22 member 11 | Homo sapiens (human) | Ki | 235.5000 | 1 | 1 |
Solute carrier family 22 member 2 | Mus musculus (house mouse) | IC50 | 217.0000 | 1 | 1 |
Solute carrier family 22 member 2 | Rattus norvegicus (Norway rat) | IC50 | 804.5000 | 2 | 2 |
Solute carrier family 22 member 2 | Rattus norvegicus (Norway rat) | Ki | 646.0000 | 1 | 1 |
Solute carrier family 22 member 6 | Homo sapiens (human) | Ki | 5.4100 | 1 | 1 |
Solute carrier family 22 member 8 | Homo sapiens (human) | Ki | 141.8000 | 2 | 2 |
Solute carrier organic anion transporter family member 1A1 | Rattus norvegicus (Norway rat) | Ki | 18.2000 | 1 | 1 |
Solute carrier organic anion transporter family member 1A2 | Homo sapiens (human) | Ki | 51.0000 | 1 | 1 |
Solute carrier organic anion transporter family member 1A3 | Rattus norvegicus (Norway rat) | Ki | 8.2000 | 1 | 1 |
Solute carrier organic anion transporter family member 1A4 | Rattus norvegicus (Norway rat) | Ki | 1.4300 | 2 | 2 |
Solute carrier organic anion transporter family member 1B1 | Homo sapiens (human) | IC50 | 1.5000 | 4 | 4 |
Solute carrier organic anion transporter family member 1B1 | Homo sapiens (human) | Ki | 9.0500 | 2 | 2 |
Solute carrier organic anion transporter family member 1B3 | Homo sapiens (human) | IC50 | 1.5000 | 1 | 1 |
Solute carrier organic anion transporter family member 1B3 | Homo sapiens (human) | Ki | 3.2000 | 2 | 2 |
Solute carrier organic anion transporter family member 2A1 | Homo sapiens (human) | Ki | 48,000.0000 | 1 | 1 |
Solute carrier organic anion transporter family member 2B1 | Homo sapiens (human) | IC50 | 65.0000 | 1 | 1 |
Solute carrier organic anion transporter family member 2B1 | Homo sapiens (human) | Ki | 63.0000 | 1 | 1 |
Spermidine synthase | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 159.0000 | 1 | 1 |
Squalene synthase | Rattus norvegicus (Norway rat) | Ki | 2.6000 | 1 | 1 |
Sterol O-acyltransferase 1 | Cricetulus griseus (Chinese hamster) | IC50 | 224.4333 | 2 | 6 |
Sterol O-acyltransferase 1 | Homo sapiens (human) | IC50 | 1,000.0000 | 2 | 2 |
Sterol O-acyltransferase 1 | Rattus norvegicus (Norway rat) | IC50 | 1,000.0000 | 1 | 1 |
Stromelysin-1 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
Substance-P receptor | Cavia porcellus (domestic guinea pig) | IC50 | 500.0000 | 1 | 3 |
Succinate-semialdehyde dehydrogenase, mitochondrial | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 1 |
TAR DNA-binding protein 43 | Homo sapiens (human) | IC50 | 19.9526 | 1 | 1 |
Thiopurine S-methyltransferase | Homo sapiens (human) | IC50 | 2,884.0300 | 1 | 1 |
Thiosulfate sulfurtransferase | Homo sapiens (human) | IC50 | 54.4000 | 2 | 2 |
Thymidine kinase | Human alphaherpesvirus 1 strain SC16 | IC50 | 1.0000 | 1 | 1 |
Thymidine kinase | Macacine alphaherpesvirus 1 | IC50 | 4.1000 | 1 | 1 |
Thymidine kinase | Staphylococcus aureus | Ki | 257.0000 | 1 | 1 |
Thymidine kinase 2 | Rattus norvegicus (Norway rat) | Ki | 320.0000 | 1 | 1 |
Thymidine kinase, cytosolic | Homo sapiens (human) | IC50 | 163.4737 | 4 | 6 |
Thymidine kinase, cytosolic | Homo sapiens (human) | Ki | 1.1000 | 2 | 2 |
Thymidine phosphorylase | Mus musculus (house mouse) | Ki | 347,000.0000 | 1 | 1 |
Thymidylate kinase | Homo sapiens (human) | Ki | 180.0000 | 2 | 2 |
Thymidylate kinase | Mycobacterium tuberculosis H37Rv | Ki | 125.2857 | 6 | 7 |
Thymidylate synthase | Homo sapiens (human) | Ki | 3.0000 | 1 | 1 |
Thymidylate synthase | Lacticaseibacillus casei | Ki | 2.2600 | 1 | 1 |
Thymidylate synthase | Mus musculus (house mouse) | Ki | 6.5000 | 1 | 1 |
Thymidylate synthase | Bos taurus (cattle) | Ki | 8.0000 | 1 | 1 |
Tissue factor | Homo sapiens (human) | IC50 | 100.0000 | 1 | 2 |
Tissue factor | Homo sapiens (human) | Ki | 8,000.0000 | 1 | 1 |
trace amine-associated receptor 1 | Homo sapiens (human) | IC50 | 0.8818 | 1 | 1 |
Trans-sialidase | Trypanosoma cruzi | Ki | 7,300.0000 | 2 | 2 |
Transient receptor potential cation channel subfamily V member 2 | Rattus norvegicus (Norway rat) | IC50 | 10.0000 | 2 | 2 |
Trehalose-phosphatase | Brugia malayi | Ki | 10,000.0000 | 1 | 1 |
Trypsin | Sus scrofa (pig) | IC50 | 200.0000 | 1 | 2 |
Tryptophan 2,3-dioxygenase | Homo sapiens (human) | Ki | 11,500.0000 | 1 | 1 |
Tyrosinase | Homo sapiens (human) | IC50 | 6,025.0956 | 7 | 9 |
Tyrosinase | Mus musculus (house mouse) | IC50 | 407.2550 | 5 | 6 |
Tyrosine-protein phosphatase non-receptor type 1 | Homo sapiens (human) | IC50 | 6.3000 | 1 | 2 |
Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens (human) | IC50 | 8,000.0000 | 1 | 1 |
UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit | Homo sapiens (human) | IC50 | 1.8000 | 1 | 1 |
Uracil nucleotide/cysteinyl leukotriene receptor | Homo sapiens (human) | IC50 | 30.0000 | 1 | 1 |
Urease subunit alpha | Helicobacter pylori 26695 | Ki | 6,470.0000 | 1 | 1 |
Urease subunit beta | Helicobacter pylori 26695 | Ki | 6,470.0000 | 1 | 1 |
Uridine 5'-monophosphate synthase | Homo sapiens (human) | Ki | 810.0000 | 1 | 2 |
Voltage-dependent calcium channel subunit alpha-2/delta-1 | Mus musculus (house mouse) | Ki | 0.9786 | 1 | 2 |
Xanthine dehydrogenase/oxidase | Homo sapiens (human) | IC50 | 201.1825 | 3 | 4 |
Activation Measurements
Protein | Taxonomy | Measurement | Average (mM) | Bioassay(s) | Drugs |
---|---|---|---|---|---|
2-amino-4-hydroxy-6-hydroxymethyldihydropteridine pyrophosphokinase | Escherichia coli K-12 | Kd | 38.0000 | 1 | 1 |
2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | Burkholderia pseudomallei K96243 | Kd | 537.5000 | 2 | 2 |
2-dehydropantoate 2-reductase | Escherichia coli K-12 | Kd | 263.0000 | 1 | 2 |
5-hydroxytryptamine receptor 1A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 1B | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 1D | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 1F | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 2A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 2B | Rattus norvegicus (Norway rat) | Kd | 6.7068 | 3 | 7 |
5-hydroxytryptamine receptor 2C | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 3A | Homo sapiens (human) | EC50 | 26.0000 | 1 | 1 |
5-hydroxytryptamine receptor 3A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 3B | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 4 | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 5A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 5B | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 6 | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
5-hydroxytryptamine receptor 7 | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
Adenosine kinase | Homo sapiens (human) | Kd | 3,000.0000 | 2 | 2 |
Advanced glycosylation end product-specific receptor | Homo sapiens (human) | Kd | 0.0430 | 1 | 1 |
Advanced glycosylation end product-specific receptor | Rattus norvegicus (Norway rat) | Kd | 0.0430 | 1 | 1 |
Albumin | Homo sapiens (human) | Kd | 12.0000 | 1 | 3 |
Autoinducer 2-binding periplasmic protein LuxP | Vibrio harveyi | EC50 | 0.0860 | 3 | 3 |
bcl-2-like protein 11 isoform 1 | Homo sapiens (human) | EC50 | 350.0000 | 1 | 1 |
Beta-secretase 1 | Homo sapiens (human) | Kd | 2,000.0000 | 1 | 1 |
Butyrophilin subfamily 3 member A1 | Homo sapiens (human) | EC50 | 9.1256 | 8 | 12 |
Butyrophilin subfamily 3 member A1 | Homo sapiens (human) | Kd | 2.9050 | 2 | 2 |
Carbonic anhydrase 2 | Homo sapiens (human) | Kd | 450,000.0000 | 1 | 1 |
Carbonic anhydrase 9 | Homo sapiens (human) | Kd | 150,000.0000 | 1 | 1 |
Chain A, 2,2-dialkylglycine decarboxylase | Burkholderia cepacia | Kd | 600.0000 | 1 | 1 |
Chain A, 6,7-Dimethyl-8-ribityllumazine Synthase | Schizosaccharomyces pombe (fission yeast) | Kd | 1.2000 | 1 | 1 |
Chain A, Acetylcholinesterase | Mus musculus (house mouse) | Kd | 930.0000 | 1 | 7 |
Chain A, Adipocyte Lipid-binding Protein | Mus musculus (house mouse) | Kd | 0.3000 | 1 | 1 |
Chain A, ADP-RIBOSYLATION FACTOR-LIKE PROTEIN 3 | Mus musculus (house mouse) | Kd | 0.0240 | 1 | 1 |
Chain A, ALDOLASE | Oryctolagus cuniculus (rabbit) | Kd | 1.0000 | 1 | 1 |
Chain A, ANAEROBIC RIBONUCLEOTIDE-TRIPHOSPHATE REDUCTASE LARGE CHAIN | Tequatrovirus T4 | Kd | 16.0000 | 1 | 4 |
Chain A, Avidin | Gallus gallus (chicken) | Kd | 102.6500 | 1 | 4 |
Chain A, BCL-2-RELATED PROTEIN A1 | Homo sapiens (human) | EC50 | 350.0000 | 1 | 1 |
Chain A, Choline-binding protein | Bacillus subtilis subsp. subtilis str. JH642 | Kd | 30.5000 | 1 | 1 |
Chain A, Core-streptavidin | Streptomyces avidinii | Kd | 0.0300 | 1 | 16 |
Chain A, DODECIN | Halobacterium salinarum R1 | Kd | 1.2680 | 1 | 2 |
Chain A, DODECIN | Halorhodospira halophila | Kd | 1.2680 | 1 | 2 |
Chain A, Dutpase | Leishmania major | Kd | 140.0000 | 1 | 3 |
Chain A, Elongation factor 2 | Saccharomyces cerevisiae (brewer's yeast) | Kd | 3.9000 | 1 | 1 |
Chain A, Elongation Factor G | Thermus thermophilus HB8 | Kd | 11.0000 | 1 | 1 |
Chain A, ELONGATION FACTOR TU (EF-TU) | Bos taurus (cattle) | Kd | 1.0000 | 1 | 1 |
Chain A, Eukaryotic peptide chain release factor GTP-binding subunit | Schizosaccharomyces pombe (fission yeast) | Kd | 3.8000 | 1 | 1 |
Chain A, Glutamine Binding Protein | Escherichia coli | Kd | 0.5000 | 1 | 1 |
Chain A, Glycine betaine/carnitine/choline-binding protein | Bacillus subtilis | Kd | 28.0000 | 1 | 4 |
Chain A, Glycogen phosphorylase, liver form | Homo sapiens (human) | Kd | 550.0000 | 1 | 4 |
Chain A, Guanine nucleotide-binding protein G(i), alpha-1 subunit | Homo sapiens (human) | Kd | 1.2000 | 1 | 1 |
Chain A, Gyrase | Escherichia coli | Kd | 1.2000 | 1 | 1 |
Chain A, heparan sulfate (glucosamine) 3-O-sulfotransferase 1 | Mus musculus (house mouse) | Kd | 14.0000 | 1 | 1 |
Chain A, HISTIDINE-BINDING PROTEIN | Escherichia coli | Kd | 0.0640 | 1 | 1 |
Chain A, hypoxanthine phosphoribosyltransferase | Trypanosoma cruzi | Kd | 788.4000 | 1 | 4 |
Chain A, HYPOXANTHINE-GUANINE PHOSPHORIBOSYLTRANSFERASE | Toxoplasma gondii RH | Kd | 34.0500 | 1 | 4 |
Chain A, interferon-inducible GTPase | Mus musculus (house mouse) | Kd | 0.6400 | 1 | 4 |
Chain A, MALTOPORIN | Escherichia coli | Kd | 15,000.0000 | 1 | 1 |
Chain A, Membrane lipoprotein tmpC | Treponema pallidum | Kd | 0.2100 | 1 | 3 |
Chain A, MUSCLE FATTY ACID BINDING PROTEIN | Homo sapiens (human) | Kd | 0.4300 | 1 | 3 |
Chain A, NUCLEOSIDE DIPHOSPHATE KINASE | Dictyostelium discoideum | Kd | 14.0000 | 1 | 1 |
Chain A, Phenylethanolamine N-methyltransferase | Homo sapiens (human) | Kd | 180.0000 | 1 | 13 |
Chain A, Phosphomannomutase/phosphoglucomutase | Pseudomonas aeruginosa | Kd | 1,200.0000 | 1 | 1 |
Chain A, Protein (streptavidin) | Streptomyces avidinii | Kd | 0.0002 | 1 | 1 |
Chain A, Protein (thymidylate Synthase) | Lacticaseibacillus casei | Kd | 4.0000 | 1 | 1 |
Chain A, PUTATIVE GLYCINE BETAINE-BINDING ABC TRANSPORTER PROTEIN | Sinorhizobium meliloti | Kd | 2.3000 | 1 | 2 |
Chain A, Pyridoxal phosphate biosynthetic protein pdxJ | Escherichia coli | Kd | 54.0000 | 1 | 1 |
Chain A, ras-related C3 botulinum toxin substrate 1 isoform Rac1b | Homo sapiens (human) | Kd | 0.0016 | 1 | 2 |
Chain A, Ribonuclease A | Bos taurus (cattle) | Kd | 47.4000 | 1 | 1 |
Chain A, Ribosome-inactivating protein 3 | Zea mays | Kd | 0.0063 | 1 | 1 |
Chain A, Ribosome-inactivating protein alpha-trichosanthin | Trichosanthes kirilowii | Kd | 260.0000 | 1 | 1 |
Chain A, Ricin A chain | Ricinus communis (castor bean) | Kd | 700.0000 | 1 | 1 |
Chain A, SERUM ALBUMIN | Homo sapiens (human) | Kd | 0.0085 | 1 | 2 |
Chain A, Shikimate kinase | Mycobacterium tuberculosis | Kd | 44.0000 | 1 | 1 |
Chain A, Slr1257 protein | Synechocystis sp. PCC 6803 substr. Kazusa | Kd | 0.2400 | 1 | 1 |
Chain A, Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 13 |
Chain A, Streptavidin Complex With Biotin | Streptomyces avidinii | Kd | 0.0000 | 1 | 1 |
Chain A, ThiT | Lactococcus cremoris subsp. cremoris NZ9000 | Kd | 0.0001 | 1 | 1 |
Chain A, Thymidylate Synthase | Lacticaseibacillus casei | Kd | 23.7424 | 1 | 38 |
Chain A, Trp Rna-binding Attenuation Protein | Geobacillus stearothermophilus | Kd | 7.5000 | 1 | 1 |
Chain A, Undecaprenyl pyrophosphate synthetase | Escherichia coli | Kd | 520.0000 | 1 | 1 |
Chain A, Uracil Phosphoribosyltransferase | Toxoplasma gondii | Kd | 465.0000 | 1 | 1 |
Chain A, Xanthine phosphoribosyltransferase | Bacillus subtilis | Kd | 4.5000 | 1 | 1 |
Chain A, ykoF | Bacillus subtilis | Kd | 10.0000 | 1 | 1 |
Chain B, 6,7-Dimethyl-8-ribityllumazine Synthase | Schizosaccharomyces pombe (fission yeast) | Kd | 1.2000 | 1 | 1 |
Chain B, Avidin | Gallus gallus (chicken) | Kd | 205.0000 | 1 | 1 |
Chain B, Dutpase | Leishmania major | Kd | 140.0000 | 1 | 2 |
Chain B, EUKARYOTIC TRANSLATION INITIATION FACTOR 4E | Homo sapiens (human) | Kd | 110,000.0000 | 1 | 1 |
Chain B, HYPOXANTHINE-GUANINE PHOSPHORIBOSYLTRANSFERASE | Toxoplasma gondii RH | Kd | 34.0500 | 1 | 2 |
Chain B, MALTOPORIN | Escherichia coli | Kd | 15,000.0000 | 1 | 1 |
Chain B, Protein (streptavidin) | Streptomyces avidinii | Kd | 0.0002 | 1 | 1 |
Chain B, PyrR bifunctional protein | [Bacillus] caldolyticus | Kd | 30.0000 | 1 | 1 |
Chain B, Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 4 |
Chain B, tryptophanyl-tRNA synthetase | Deinococcus radiodurans | Kd | 30.0000 | 1 | 1 |
Chain B, Uracil Phosphoribosyltransferase | Toxoplasma gondii | Kd | 465.0000 | 1 | 1 |
Chain B, ykoF | Bacillus subtilis | Kd | 10.0000 | 1 | 1 |
Chain C, DODECIN | Halorhodospira halophila | Kd | 1.2680 | 1 | 2 |
Chain C, Tryptophanyl-tRNA synthetase II | Deinococcus radiodurans | Kd | 30.0000 | 1 | 1 |
Chain C, Uracil Phosphoribosyltransferase | Toxoplasma gondii | Kd | 465.0000 | 1 | 1 |
Chain D, Circularly Permuted Core-streptavidin E51/a46 | Streptomyces avidinii | Kd | 0.0439 | 1 | 1 |
Chain D, Core-streptavidin | Streptomyces avidinii | Kd | 0.0300 | 1 | 16 |
Chain D, Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 9 |
Chain E, DODECIN | Halorhodospira halophila | Kd | 1.2680 | 1 | 2 |
Chain E, LYSINE, ARGININE, ORNITHINE-BINDING PROTEIN | Salmonella enterica subsp. enterica serovar Typhimurium | Kd | 0.2570 | 1 | 6 |
Chain E, Pyridoxal phosphate biosynthetic protein pdxJ | Escherichia coli | Kd | 54.0000 | 1 | 1 |
Chain H, Immunoglobulin Igg1 Heavy chain | Homo sapiens (human) | Kd | 0.0018 | 1 | 1 |
Chain K, Trp Rna-binding Attenuation Protein | Geobacillus stearothermophilus | Kd | 7.5000 | 1 | 1 |
Chain L, Immunoglobulin Igg1 Lambda Light Chain | Homo sapiens (human) | Kd | 0.0018 | 1 | 1 |
Cytochrome P450 2B6 | Homo sapiens (human) | EC50 | 1.3000 | 1 | 1 |
Cytochrome P450 2C9 | Homo sapiens (human) | EC50 | 1.0000 | 1 | 1 |
Dihydrofolate reductase | Escherichia coli K-12 | Kd | 2.3613 | 10 | 10 |
Dihydropteroate synthase | Bacillus anthracis | Kd | 5.6200 | 1 | 1 |
DNA gyrase subunit B | Escherichia coli K-12 | Kd | 0.0175 | 2 | 2 |
DNA polymerase subunit gamma-1 | Homo sapiens (human) | Kd | 0.8000 | 1 | 1 |
Endolysin | Tequatrovirus T4 | Kd | 290.0000 | 1 | 1 |
Estrogen receptor | Rattus norvegicus (Norway rat) | EC50 | 0.3620 | 1 | 2 |
Estrogen receptor beta | Rattus norvegicus (Norway rat) | EC50 | 0.3620 | 1 | 2 |
Fatty acid-binding protein, liver | Homo sapiens (human) | Kd | 0.5500 | 2 | 2 |
G-protein coupled receptor 84 | Homo sapiens (human) | EC50 | 58.9625 | 2 | 4 |
Galectin-1 | Homo sapiens (human) | Kd | 1,330.0000 | 1 | 1 |
Genome polyprotein | Zika virus | EC50 | 24.8000 | 1 | 1 |
Genome polyprotein | Kd | 40.0000 | 1 | 1 | |
Glutamate receptor 1 | Homo sapiens (human) | EC50 | 792,445,056.0762 | 12 | 20 |
Glutamate receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 27.3799 | 6 | 7 |
Glutamate receptor 2 | Homo sapiens (human) | EC50 | 722,116,393.1444 | 8 | 11 |
Glutamate receptor 2 | Rattus norvegicus (Norway rat) | EC50 | 1,482,620,106.9400 | 4 | 5 |
Glutamate receptor 3 | Homo sapiens (human) | EC50 | 2,264,128,594.8718 | 5 | 7 |
Glutamate receptor 3 | Rattus norvegicus (Norway rat) | EC50 | 54.8048 | 5 | 6 |
Glutamate receptor 4 | Homo sapiens (human) | EC50 | 9,952,675,009.4244 | 2 | 4 |
Glutamate receptor 4 | Rattus norvegicus (Norway rat) | EC50 | 18.6392 | 4 | 5 |
Glutamate receptor ionotropic, kainate 1 | Homo sapiens (human) | EC50 | 57.3333 | 3 | 3 |
Glutamate receptor ionotropic, kainate 1 | Rattus norvegicus (Norway rat) | EC50 | 129.1633 | 2 | 3 |
Glutamate receptor ionotropic, kainate 2 | Homo sapiens (human) | EC50 | 25.0000 | 2 | 2 |
Glutamate receptor ionotropic, kainate 2 | Rattus norvegicus (Norway rat) | EC50 | 65.9615 | 2 | 3 |
Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | EC50 | 0.9360 | 12 | 13 |
Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | EC50 | 1.1369 | 6 | 7 |
Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | EC50 | 0.5800 | 5 | 5 |
Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | EC50 | 0.3340 | 5 | 5 |
Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | EC50 | 0.2160 | 5 | 5 |
Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | EC50 | 0.1600 | 3 | 3 |
Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | EC50 | 0.1600 | 3 | 3 |
Glutamate transporter homolog | Pyrococcus horikoshii OT3 | Kd | 0.0010 | 1 | 1 |
glycogen synthase kinase-3 beta isoform 1 | Homo sapiens (human) | EC50 | 300.0000 | 1 | 1 |
guanine nucleotide-binding protein subunit alpha-15 | Homo sapiens (human) | EC50 | 29.9020 | 1 | 1 |
Heat shock cognate 71 kDa protein | Homo sapiens (human) | Kd | 130.9130 | 1 | 2 |
Heat shock protein HSP 90-alpha | Homo sapiens (human) | EC50 | 700.0000 | 1 | 1 |
Heat shock protein HSP 90-alpha | Homo sapiens (human) | Kd | 500.0000 | 1 | 1 |
Heat shock protein HSP 90-beta | Homo sapiens (human) | EC50 | 700.0000 | 1 | 1 |
Heat shock protein HSP 90-beta | Homo sapiens (human) | Kd | 500.0000 | 1 | 1 |
Histidine triad nucleotide-binding protein 1 | Homo sapiens (human) | Kd | 67.0000 | 1 | 1 |
Histidine triad nucleotide-binding protein 1 | Mus musculus (house mouse) | Kd | 1,150.0000 | 2 | 2 |
Histidine-binding periplasmic protein | Escherichia coli K-12 | Kd | 0.1140 | 1 | 1 |
Hydroxycarboxylic acid receptor 2 | Homo sapiens (human) | EC50 | 0.7757 | 27 | 30 |
Hydroxycarboxylic acid receptor 2 | Mus musculus (house mouse) | EC50 | 0.1093 | 3 | 3 |
Hydroxycarboxylic acid receptor 2 | Rattus norvegicus (Norway rat) | EC50 | 0.2493 | 3 | 3 |
Hydroxycarboxylic acid receptor 3 | Homo sapiens (human) | EC50 | 31.9526 | 3 | 3 |
insulin-degrading enzyme isoform 1 | Homo sapiens (human) | EC50 | 2.4495 | 2 | 2 |
Insulin-like growth factor-binding protein 5 | Homo sapiens (human) | Kd | 696,000.0000 | 7 | 7 |
Integrin alpha-IIb | Homo sapiens (human) | EC50 | 7.4000 | 1 | 1 |
Integrin alpha-L | Homo sapiens (human) | Kd | 300.0000 | 2 | 2 |
Integrin beta-2 | Homo sapiens (human) | Kd | 300.0000 | 2 | 2 |
Integrin beta-3 | Homo sapiens (human) | EC50 | 7.4000 | 1 | 1 |
Intercellular adhesion molecule 1 | Homo sapiens (human) | Kd | 300.0000 | 2 | 2 |
Jacalin | Artocarpus heterophyllus (jackfruit) | Kd | 16.0000 | 1 | 1 |
Menin | Homo sapiens (human) | Kd | 15.6000 | 1 | 1 |
Metabotropic glutamate receptor 1 | Homo sapiens (human) | EC50 | 454.4214 | 4 | 7 |
Metabotropic glutamate receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 144.5210 | 11 | 15 |
Metabotropic glutamate receptor 2 | Homo sapiens (human) | EC50 | 133.1877 | 12 | 16 |
Metabotropic glutamate receptor 2 | Rattus norvegicus (Norway rat) | EC50 | 12.4192 | 9 | 13 |
Metabotropic glutamate receptor 3 | Homo sapiens (human) | EC50 | 2.8572 | 5 | 5 |
Metabotropic glutamate receptor 3 | Rattus norvegicus (Norway rat) | EC50 | 3.1035 | 4 | 5 |
Metabotropic glutamate receptor 4 | Homo sapiens (human) | EC50 | 507.8500 | 4 | 6 |
Metabotropic glutamate receptor 4 | Rattus norvegicus (Norway rat) | EC50 | 392.4860 | 10 | 16 |
Metabotropic glutamate receptor 5 | Homo sapiens (human) | EC50 | 163.5500 | 4 | 4 |
Metabotropic glutamate receptor 5 | Rattus norvegicus (Norway rat) | EC50 | 89.1014 | 9 | 12 |
Metabotropic glutamate receptor 6 | Homo sapiens (human) | EC50 | 405.8167 | 4 | 6 |
Metabotropic glutamate receptor 6 | Rattus norvegicus (Norway rat) | EC50 | 42.6500 | 6 | 8 |
Metabotropic glutamate receptor 7 | Homo sapiens (human) | EC50 | 540.2360 | 4 | 5 |
Metabotropic glutamate receptor 7 | Rattus norvegicus (Norway rat) | EC50 | 1,592.0000 | 3 | 5 |
Metabotropic glutamate receptor 8 | Mus musculus (house mouse) | EC50 | 0.0220 | 1 | 1 |
Metabotropic glutamate receptor 8 | Rattus norvegicus (Norway rat) | EC50 | 14.4933 | 3 | 3 |
Methionine--tRNA ligase, mitochondrial | Homo sapiens (human) | EC50 | 7.9000 | 1 | 1 |
Methylosome protein 50 | Homo sapiens (human) | Kd | 0.6610 | 1 | 1 |
Microtubule-associated proteins 1A/1B light chain 3A | Homo sapiens (human) | Kd | 7.5000 | 1 | 1 |
Microtubule-associated proteins 1A/1B light chain 3B | Homo sapiens (human) | Kd | 17.4000 | 1 | 1 |
N-alpha-acetyltransferase 50 | Homo sapiens (human) | Kd | 0.1560 | 1 | 1 |
Nitric oxide synthase, inducible | Homo sapiens (human) | Kd | 7.0000 | 2 | 2 |
NPYLR7B | Aedes aegypti (yellow fever mosquito) | EC50 | 0.5080 | 1 | 1 |
Nuclear receptor subfamily 1 group I member 2 | Homo sapiens (human) | EC50 | 2.1656 | 9 | 9 |
Nuclear receptor subfamily 4 group A member 2 | Homo sapiens (human) | Kd | 50.0000 | 1 | 1 |
Olfactory receptor 51E2 | Homo sapiens (human) | EC50 | 0.1477 | 1 | 3 |
Olfactory receptor class A-like protein 1 | Danio rerio (zebrafish) | EC50 | 30.5000 | 1 | 1 |
P2X purinoceptor 1 | Homo sapiens (human) | EC50 | 0.1820 | 1 | 1 |
P2X purinoceptor 1 | Rattus norvegicus (Norway rat) | EC50 | 1.5910 | 2 | 2 |
P2X purinoceptor 2 | Homo sapiens (human) | EC50 | 27.2500 | 2 | 2 |
P2X purinoceptor 3 | Homo sapiens (human) | EC50 | 0.5000 | 1 | 1 |
P2X purinoceptor 4 | Homo sapiens (human) | EC50 | 1.0000 | 1 | 1 |
P2X purinoceptor 4 | Rattus norvegicus (Norway rat) | EC50 | 219.0000 | 1 | 1 |
P2Y purinoceptor 1 | Homo sapiens (human) | EC50 | 40.9520 | 4 | 5 |
P2Y purinoceptor 1 | Meleagris gallopavo (turkey) | EC50 | 7.5400 | 3 | 3 |
P2Y purinoceptor 1 | Rattus norvegicus (Norway rat) | EC50 | 5.0000 | 1 | 1 |
P2Y purinoceptor 11 | Homo sapiens (human) | EC50 | 54.5000 | 1 | 2 |
P2Y purinoceptor 14 | Homo sapiens (human) | EC50 | 32.2120 | 5 | 5 |
P2Y purinoceptor 2 | Homo sapiens (human) | EC50 | 27.9564 | 40 | 58 |
P2Y purinoceptor 2 | Rattus norvegicus (Norway rat) | EC50 | 0.1300 | 1 | 1 |
P2Y purinoceptor 2 | Mus musculus (house mouse) | EC50 | 1.2600 | 1 | 1 |
P2Y purinoceptor 4 | Homo sapiens (human) | EC50 | 1.2273 | 15 | 16 |
P2Y purinoceptor 4 | Rattus norvegicus (Norway rat) | EC50 | 2.8000 | 1 | 2 |
P2Y purinoceptor 6 | Homo sapiens (human) | EC50 | 8.2296 | 17 | 24 |
P2Y purinoceptor 6 | Rattus norvegicus (Norway rat) | EC50 | 0.2000 | 2 | 2 |
PA-I galactophilic lectin | Pseudomonas aeruginosa PAO1 | Kd | 87.5000 | 1 | 1 |
Peroxisome proliferator-activated receptor alpha | Homo sapiens (human) | EC50 | 36.0000 | 1 | 1 |
Protein arginine N-methyltransferase 5 | Homo sapiens (human) | Kd | 0.6610 | 1 | 1 |
Protein argonaute-2 | Homo sapiens (human) | Kd | 15.0000 | 1 | 1 |
Protein farnesyltransferase subunit beta | Homo sapiens (human) | Kd | 0.0020 | 1 | 1 |
Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha | Homo sapiens (human) | Kd | 0.0020 | 1 | 1 |
Protein Rev | HIV-1 M:B_HXB2R | Kd | 0.1800 | 1 | 1 |
Prothrombin | Homo sapiens (human) | EC50 | 7.4000 | 1 | 1 |
Purine nucleoside phosphorylase | Bos taurus (cattle) | Kd | 0.9350 | 4 | 4 |
putative potassium channel subunit | Homo sapiens (human) | EC50 | 10.4100 | 1 | 1 |
Pyruvate kinase PKM | Homo sapiens (human) | EC50 | 1,300.0000 | 1 | 1 |
Ras-related protein Rab-7a | Homo sapiens (human) | Kd | 0.2173 | 4 | 8 |
Reverse transcriptase/RNaseH | Human immunodeficiency virus 1 | Kd | 14.6612 | 15 | 25 |
Riboflavin-binding protein | Gallus gallus (chicken) | Kd | 0.0229 | 4 | 4 |
Sigma non-opioid intracellular receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 0.1060 | 1 | 1 |
Sodium-dependent dopamine transporter | Rattus norvegicus (Norway rat) | EC50 | 0.0070 | 1 | 1 |
Sodium-dependent dopamine transporter | Homo sapiens (human) | EC50 | 0.1060 | 1 | 1 |
Solute carrier family 2, facilitated glucose transporter member 9 | Homo sapiens (human) | EC50 | 766.6667 | 2 | 3 |
Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 1 |
streptokinase A precursor | Streptococcus pyogenes M1 GAS | EC50 | 0.5040 | 2 | 3 |
Taste receptor type 2 member 16 | Homo sapiens (human) | EC50 | 5,800.0000 | 2 | 2 |
Thiamine transporter ThiT | Lactococcus cremoris subsp. cremoris MG1363 | Kd | 2.4687 | 7 | 7 |
Thiamine-binding periplasmic protein | Escherichia coli K-12 | Kd | 0.0038 | 1 | 1 |
Thromboxane A2 receptor | Homo sapiens (human) | EC50 | 0.1000 | 1 | 1 |
Trace amine-associated receptor 1 | Homo sapiens (human) | EC50 | 0.2943 | 6 | 8 |
Trace amine-associated receptor 1 | Mus musculus (house mouse) | EC50 | 0.1387 | 7 | 7 |
Trace amine-associated receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 0.1457 | 6 | 7 |
Transient receptor potential cation channel subfamily A member 1 | Homo sapiens (human) | EC50 | 75.2000 | 1 | 1 |
Transient receptor potential cation channel subfamily A member 1 | Rattus norvegicus (Norway rat) | EC50 | 116.0000 | 1 | 1 |
Transient receptor potential cation channel subfamily M member 2 | Homo sapiens (human) | EC50 | 100.0000 | 1 | 1 |
Transketolase | Homo sapiens (human) | Kd | 6,800.0000 | 1 | 1 |
Trp operon repressor | Escherichia coli K-12 | Kd | 25.1000 | 1 | 1 |
Tyrosine-protein kinase Lck | Homo sapiens (human) | Kd | 50,000.0000 | 1 | 1 |
UDP-galactopyranose mutase | Klebsiella pneumoniae | Kd | 54.0000 | 1 | 1 |
UDP-galactopyranose mutase | Mycobacterium tuberculosis H37Rv | Kd | 35.0000 | 1 | 1 |
Other Measurements
Protein | Taxonomy | Measurement | Average (mM) | Bioassay(s) | Drugs |
---|---|---|---|---|---|
2-dehydro-3-deoxy-6-phosphogalactonate aldolase | Escherichia coli K-12 | Km | 295.0000 | 2 | 2 |
5-hydroxytryptamine receptor 1D | Homo sapiens (human) | KA | 121.5000 | 1 | 2 |
5-methylthioadenosine/S-adenosylhomocysteine deaminase | Thermotoga maritima MSB8 | Km | 44.0000 | 1 | 1 |
AAA family ATPase | Staphylococcus aureus | Km | 21.5667 | 2 | 3 |
Acetylcholinesterase | Mus musculus (house mouse) | Km | 13.0000 | 1 | 2 |
Adenosine deaminase | Bos taurus (cattle) | Km | 31.0000 | 1 | 1 |
Adenosine receptor A1 | Rattus norvegicus (Norway rat) | KA | 3.6667 | 1 | 3 |
Adenosine receptor A2a | Homo sapiens (human) | Affinity constant | 10.0000 | 1 | 1 |
Adenosine receptor A2a | Rattus norvegicus (Norway rat) | KA | 3.6667 | 1 | 6 |
Adenosine receptor A2b | Homo sapiens (human) | Affinity constant | 10.0000 | 1 | 1 |
Adenosylhomocysteinase | Homo sapiens (human) | Km | 2.5000 | 1 | 1 |
Amine oxidase [flavin-containing] A | Homo sapiens (human) | Km | 514.0000 | 1 | 1 |
Amine oxidase [flavin-containing] A | Bos taurus (cattle) | Km | 2,200.0000 | 1 | 2 |
Amine oxidase [flavin-containing] B | Bos taurus (cattle) | Km | 2,200.0000 | 1 | 2 |
Amine oxidase [flavin-containing] B | Homo sapiens (human) | Km | 104.7000 | 1 | 1 |
Aminoglycoside 3'-phosphotransferase | Pseudomonas aeruginosa PAO1 | Km | 17.5000 | 1 | 1 |
Arylacetamide deacetylase | Homo sapiens (human) | Km | 200.0000 | 1 | 2 |
Asparagine synthetase [glutamine-hydrolyzing] | Homo sapiens (human) | Kis | 1,450.0000 | 1 | 1 |
Bifunctional purine biosynthesis protein ATIC | Homo sapiens (human) | Km | 1.9000 | 1 | 1 |
Butyrophilin subfamily 3 member A1 | Homo sapiens (human) | ED50 | 100.0000 | 1 | 1 |
CAD protein | Homo sapiens (human) | Km | 50.0000 | 1 | 1 |
Carbonic anhydrase | Candida albicans SC5314 | KA | 19.6000 | 1 | 3 |
Carbonic anhydrase | Methanosarcina thermophila | KA | 58.0000 | 1 | 3 |
Carbonic anhydrase | Methanothermobacter thermautotrophicus str. Delta H | Ka | 43.7750 | 1 | 4 |
Carbonic anhydrase | Saccharomyces cerevisiae S288C | Ka | 86.0000 | 2 | 7 |
Carbonic anhydrase | Cryptococcus neoformans var. grubii | KA | 39.2667 | 1 | 3 |
Carbonic anhydrase | Nakaseomyces glabratus CBS 138 | Ka | 22.7500 | 1 | 4 |
Carbonic anhydrase 1 | Homo sapiens (human) | Activity | 0.0300 | 1 | 1 |
Carbonic anhydrase 1 | Homo sapiens (human) | KA | 15.8710 | 17 | 49 |
Carbonic anhydrase 12 | Homo sapiens (human) | KA | 21.7133 | 3 | 6 |
Carbonic anhydrase 13 | Homo sapiens (human) | KA | 0.5650 | 1 | 2 |
Carbonic anhydrase 13 | Mus musculus (house mouse) | KA | 8.2875 | 2 | 4 |
Carbonic anhydrase 14 | Homo sapiens (human) | KA | 5.7967 | 3 | 6 |
Carbonic anhydrase 15 | Mus musculus (house mouse) | KA | 26.3333 | 1 | 3 |
Carbonic anhydrase 2 | Homo sapiens (human) | Activity | 10.0000 | 1 | 1 |
Carbonic anhydrase 2 | Homo sapiens (human) | Ka | 25.8421 | 19 | 56 |
Carbonic anhydrase 3 | Homo sapiens (human) | KA | 30.3556 | 4 | 9 |
Carbonic anhydrase 4 | Bos taurus (cattle) | KA | 46.0000 | 2 | 3 |
Carbonic anhydrase 4 | Homo sapiens (human) | Ka | 25.3909 | 5 | 11 |
Carbonic anhydrase 5A, mitochondrial | Homo sapiens (human) | KA | 4.0850 | 3 | 6 |
Carbonic anhydrase 5B, mitochondrial | Homo sapiens (human) | KA | 4.0283 | 3 | 6 |
Carbonic anhydrase 6 | Homo sapiens (human) | KA | 15.1160 | 4 | 10 |
Carbonic anhydrase 7 | Homo sapiens (human) | Ka | 22.8783 | 3 | 6 |
Carbonic anhydrase 9 | Homo sapiens (human) | KA | 19.4171 | 4 | 7 |
Carbonic anhydrase-like protein, putative | Trypanosoma cruzi strain CL Brener | KA | 38.9211 | 1 | 9 |
Cell division inhibitor SulA | Escherichia coli K-12 | Activity | 6.3000 | 1 | 1 |
Choline O-acetyltransferase | Rattus norvegicus (Norway rat) | Km | 290.0000 | 1 | 1 |
Cytidine deaminase | Homo sapiens (human) | Km | 40.5000 | 1 | 2 |
Cytochrome P450 1A1 | Rattus norvegicus (Norway rat) | Ks | 320.0000 | 1 | 1 |
Cytochrome P450 2B1 | Rattus norvegicus (Norway rat) | Ks | 62.0000 | 1 | 1 |
Cytochrome P450 3A4 | Homo sapiens (human) | Activity | 25.0000 | 1 | 1 |
D(1A) dopamine receptor | Homo sapiens (human) | KL | 390.0000 | 1 | 1 |
Deoxycytidine kinase | Rattus norvegicus (Norway rat) | IC | 10,000.0000 | 1 | 1 |
Deoxycytidine kinase | Homo sapiens (human) | Km | 44.5500 | 5 | 8 |
Deoxycytidylate deaminase | Homo sapiens (human) | Km | 87.0000 | 1 | 1 |
Dihydrofolate reductase | Lacticaseibacillus casei | Km | 0.3600 | 1 | 1 |
Dihydroxyacetone phosphate acyltransferase | Homo sapiens (human) | Radius of inhibition zone | 9,214.2857 | 7 | 7 |
DNA gyrase subunit A | Escherichia coli K-12 | Activity | 3.1000 | 1 | 1 |
DNA gyrase subunit A | Staphylococcus aureus | MIC | 0.0100 | 1 | 1 |
DNA gyrase subunit B | Staphylococcus aureus | MIC | 0.0100 | 1 | 1 |
Dopamine beta-hydroxylase | Bos taurus (cattle) | Km | 2,000.0000 | 1 | 1 |
Excitatory amino acid transporter 1 | Homo sapiens (human) | Km | 8.5500 | 2 | 2 |
Excitatory amino acid transporter 2 | Homo sapiens (human) | Km | 21.0000 | 2 | 2 |
Excitatory amino acid transporter 3 | Homo sapiens (human) | Km | 17.4500 | 2 | 2 |
Excitatory amino acid transporter 3 | Rattus norvegicus (Norway rat) | Ks | 5.1000 | 1 | 1 |
Flavodoxin | Helicobacter pylori 26695 | MIC | 88.0000 | 3 | 3 |
Fructose-1,6-bisphosphatase 1 | Homo sapiens (human) | ED50 | 250.0000 | 1 | 1 |
General amino-acid permease GAP1 | Saccharomyces cerevisiae S288C | Km | 37.0000 | 1 | 1 |
Geranylgeranyl pyrophosphate synthase | Homo sapiens (human) | Km | 0.7100 | 1 | 1 |
Geranylgeranyl pyrophosphate synthase | Saccharomyces cerevisiae S288C | Km | 3.2000 | 1 | 1 |
Glutamate 5-kinase | Escherichia coli K-12 | I0.5 | 2.5000 | 1 | 1 |
Glutamate racemase | Enterococcus faecalis V583 | Km | 725.0000 | 1 | 2 |
Glutamate racemase | Helicobacter pylori 26695 | Km | 2,691.6667 | 3 | 6 |
Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | KA | 23.1167 | 1 | 3 |
Glutathione reductase | Plasmodium falciparum 3D7 | Km | 114.7000 | 1 | 1 |
Growth factor receptor-bound protein 2 | Homo sapiens (human) | ID50 | 6,200.0000 | 1 | 1 |
Guanine deaminase | Homo sapiens (human) | Km | 11.2100 | 1 | 1 |
Heat shock protein HSP 90-beta | Homo sapiens (human) | Activity | 700.0000 | 1 | 1 |
Histamine H3 receptor | Rattus norvegicus (Norway rat) | Km | 104.7000 | 1 | 1 |
Histidinol dehydrogenase | Brucella suis 1330 | Km | 12.0000 | 1 | 1 |
Hypoxanthine-guanine phosphoribosyltransferase | Homo sapiens (human) | Km | 1.9000 | 2 | 2 |
Indoleamine 2,3-dioxygenase 1 | Homo sapiens (human) | Km | 15.0000 | 1 | 1 |
Inosine-5'-monophosphate dehydrogenase | Escherichia coli K-12 | Km | 16.0000 | 1 | 1 |
Inosine-5'-monophosphate dehydrogenase 1 | Homo sapiens (human) | Km | 12.0000 | 1 | 1 |
Inosine-5'-monophosphate dehydrogenase 2 | Homo sapiens (human) | Km | 12.0000 | 1 | 1 |
interferon gamma precursor | Homo sapiens (human) | AC50 | 20.1400 | 2 | 2 |
KHG/KDPG aldolase | Escherichia coli K-12 | Kcat | 300.0000 | 1 | 1 |
KHG/KDPG aldolase | Escherichia coli K-12 | Km | 200.0000 | 1 | 1 |
Large neutral amino acids transporter small subunit 1 | Homo sapiens (human) | Km | 12.6000 | 2 | 2 |
Membrane primary amine oxidase | Homo sapiens (human) | Km | 3,725.0000 | 1 | 1 |
Membrane primary amine oxidase | Mus musculus (house mouse) | Km | 34.8000 | 1 | 1 |
Metabotropic glutamate receptor 1 | Homo sapiens (human) | Activity | 1.0000 | 1 | 1 |
Metabotropic glutamate receptor 2 | Homo sapiens (human) | Activity | 4.0000 | 1 | 1 |
Metabotropic glutamate receptor 3 | Homo sapiens (human) | Activity | 9.0000 | 1 | 1 |
Metabotropic glutamate receptor 4 | Homo sapiens (human) | Activity | 12.0000 | 1 | 1 |
Metabotropic glutamate receptor 5 | Homo sapiens (human) | Activity | 4.0000 | 1 | 1 |
Metabotropic glutamate receptor 6 | Homo sapiens (human) | Activity | 20.0000 | 1 | 1 |
Metabotropic glutamate receptor 7 | Homo sapiens (human) | Activity | 5,400.0000 | 1 | 1 |
Monocarboxylate transporter 1 | Rattus norvegicus (Norway rat) | Km | 3,034.0933 | 3 | 3 |
Monocarboxylate transporter 10 | Rattus norvegicus (Norway rat) | Km | 5,370.0000 | 1 | 2 |
Monocarboxylate transporter 2 | Rattus norvegicus (Norway rat) | Km | 740.0000 | 1 | 1 |
Monocarboxylate transporter 4 | Homo sapiens (human) | Km | 519,000.0000 | 1 | 1 |
Multidrug resistance associated protein | Homo sapiens (human) | Km | 1,740.0000 | 1 | 1 |
Multidrug resistance-associated protein 1 | Homo sapiens (human) | Km | 93.0000 | 1 | 1 |
Multidrug resistance-associated protein 4 | Homo sapiens (human) | Km | 324.8450 | 2 | 2 |
Multidrug resistance-associated protein 5 | Homo sapiens (human) | Km | 2.1000 | 1 | 1 |
Muscarinic acetylcholine receptor M1 | Homo sapiens (human) | Km | 15.0000 | 1 | 1 |
Muscarinic acetylcholine receptor M2 | Homo sapiens (human) | Km | 15.0000 | 1 | 1 |
Muscarinic acetylcholine receptor M4 | Homo sapiens (human) | Km | 15.0000 | 1 | 1 |
Nitric oxide synthase, brain | Homo sapiens (human) | Activity | 14.5000 | 1 | 1 |
Nitric oxide synthase, brain | Rattus norvegicus (Norway rat) | Km | 2.7000 | 1 | 1 |
Nitric oxide synthase, endothelial | Bos taurus (cattle) | Activity | 25.0000 | 1 | 1 |
Nitric oxide synthase, endothelial | Bos taurus (cattle) | Km | 1.1000 | 1 | 1 |
Nitric oxide synthase, inducible | Homo sapiens (human) | Activity | 14.0000 | 1 | 1 |
Nitric oxide synthase, inducible | Homo sapiens (human) | Km | 5.7000 | 2 | 2 |
Nitric oxide synthase, inducible | Mus musculus (house mouse) | Km | 9.5000 | 1 | 1 |
Nucleoside diphosphate kinase A | Homo sapiens (human) | Activity | 1.3000 | 1 | 1 |
Nucleoside diphosphate kinase B | Homo sapiens (human) | Activity | 1.4000 | 1 | 1 |
Orotidine 5'-phosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Km | 3.5000 | 2 | 2 |
Orotidine 5'-phosphate decarboxylase | Saccharomyces cerevisiae S288C | Km | 0.7000 | 1 | 1 |
Orotidine 5'-phosphate decarboxylase | Plasmodium falciparum (malaria parasite P. falciparum) | Km | 13.0000 | 1 | 1 |
Oxygen-dependent coproporphyrinogen-III oxidase, mitochondrial | Homo sapiens (human) | Km | 680.0000 | 1 | 1 |
Peroxisomal N(1)-acetyl-spermine/spermidine oxidase | Homo sapiens (human) | Km | 11.0000 | 1 | 1 |
Peroxisome proliferator-activated receptor delta | Homo sapiens (human) | Emax | 47.0000 | 1 | 1 |
Plasma kallikrein | Homo sapiens (human) | KA | 4.1033 | 1 | 3 |
Polyphenol oxidase 2 | Agaricus bisporus | ID50 | 6,200.0000 | 1 | 1 |
Polyphenol oxidase 2 | Agaricus bisporus | Km | 730.0000 | 2 | 2 |
Polyunsaturated fatty acid 5-lipoxygenase | Rattus norvegicus (Norway rat) | Ks | 320.0000 | 1 | 1 |
Probable deoxycytidylate deaminase | Caenorhabditis elegans | Km | 38.0000 | 1 | 1 |
Protein farnesyltransferase subunit beta | Homo sapiens (human) | Km | 0.0735 | 2 | 2 |
Protein farnesyltransferase subunit beta | Saccharomyces cerevisiae S288C | Km | 27.0000 | 1 | 1 |
Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha | Homo sapiens (human) | Km | 0.0735 | 2 | 2 |
Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha | Saccharomyces cerevisiae S288C | Km | 27.0000 | 1 | 1 |
Protein kinase C alpha type | Homo sapiens (human) | Km | 102.0000 | 1 | 1 |
Proto-oncogene tyrosine-protein kinase Src | Homo sapiens (human) | ID50 | 3,500.0000 | 1 | 1 |
Proton-coupled amino acid transporter 1 | Homo sapiens (human) | pKi | 2,000.0000 | 1 | 1 |
Purine nucleoside phosphorylase | Homo sapiens (human) | Km | 395.0000 | 2 | 2 |
Purine nucleoside phosphorylase | Bos taurus (cattle) | Kieq | 4.0000 | 1 | 1 |
Pyridoxal kinase | Homo sapiens (human) | Km | 66.3000 | 1 | 3 |
Receptor-type tyrosine-protein phosphatase beta | Homo sapiens (human) | Kis | 780.4433 | 2 | 3 |
Reverse transcriptase/RNaseH | Human immunodeficiency virus 1 | Km | 2.1945 | 21 | 36 |
Ribonucleoside-diphosphate reductase large subunit | Homo sapiens (human) | Km | 135.0000 | 1 | 2 |
Ribonucleoside-diphosphate reductase subunit M2 | Homo sapiens (human) | Km | 135.0000 | 1 | 2 |
Ribonucleoside-diphosphate reductase subunit M2 B | Homo sapiens (human) | Km | 135.0000 | 1 | 2 |
RNA-directed RNA polymerase | Km | 8.7760 | 4 | 5 | |
S-adenosylmethionine synthase isoform type-1 | Rattus norvegicus (Norway rat) | Km | 1,540.0000 | 1 | 1 |
S-adenosylmethionine synthase isoform type-2 | Rattus norvegicus (Norway rat) | Km | 4,000.0000 | 1 | 1 |
S-methyl-5'-thioadenosine phosphorylase | Homo sapiens (human) | Km | 30.4000 | 2 | 4 |
SLC16A10 protein | Homo sapiens (human) | Km | 596.3500 | 1 | 2 |
Solute carrier family 22 member 1 | Mus musculus (house mouse) | Km | 42.0000 | 1 | 1 |
Solute carrier family 22 member 1 | Rattus norvegicus (Norway rat) | Km | 514.0000 | 4 | 4 |
Solute carrier family 22 member 1 | Homo sapiens (human) | Activity | 1,360.3333 | 1 | 3 |
Solute carrier family 22 member 2 | Homo sapiens (human) | Km | 475.5000 | 4 | 4 |
Solute carrier family 22 member 2 | Rattus norvegicus (Norway rat) | Km | 998.7500 | 4 | 4 |
Solute carrier family 22 member 3 | Homo sapiens (human) | Km | 2,500.0000 | 1 | 1 |
Solute carrier family 22 member 3 | Rattus norvegicus (Norway rat) | Km | 900.0000 | 1 | 1 |
Solute carrier family 22 member 6 | Homo sapiens (human) | Km | 947.0000 | 1 | 1 |
Solute carrier organic anion transporter family member 1B1 | Homo sapiens (human) | Km | 7.2500 | 2 | 2 |
Solute carrier organic anion transporter family member 1B3 | Homo sapiens (human) | Km | 2.3000 | 1 | 1 |
Squalene synthase | Homo sapiens (human) | Km | 2.3000 | 1 | 1 |
Squalene synthase | Rattus norvegicus (Norway rat) | Km | 12.7000 | 1 | 1 |
Sulfotransferase 1A1 | Rattus norvegicus (Norway rat) | Km | 10.0000 | 1 | 1 |
Taste receptor type 2 member 16 | Homo sapiens (human) | Activity | 500.0000 | 2 | 2 |
Thymidine kinase | Human alphaherpesvirus 1 (Herpes simplex virus type 1) | Km | 1.0000 | 1 | 1 |
Thymidine kinase | Human alphaherpesvirus 1 strain SC16 | Km | 0.8100 | 1 | 1 |
Thymidine kinase | Ureaplasma parvum serovar 3 str. ATCC 700970 | Km | 1.9000 | 1 | 1 |
Thymidine kinase | Vaccinia virus WR | Km | 21.0000 | 1 | 1 |
Thymidine kinase | Macacine alphaherpesvirus 1 | Km | 0.6750 | 1 | 2 |
Thymidine kinase | Staphylococcus aureus | Km | 2.8000 | 1 | 1 |
Thymidine kinase, cytosolic | Homo sapiens (human) | ID50 | 425.5000 | 1 | 4 |
Thymidine kinase, cytosolic | Homo sapiens (human) | Km | 7.0611 | 9 | 9 |
Thymidine kinase, cytosolic | Rattus norvegicus (Norway rat) | Km | 4.8000 | 2 | 2 |
Thymidine kinase, cytosolic | Rattus norvegicus (Norway rat) | Phosphorylation rate | 100.0000 | 1 | 1 |
Thymidine phosphorylase | Escherichia coli K-12 | Km | 993.3333 | 3 | 3 |
Thymidine phosphorylase | Homo sapiens (human) | Km | 373.0000 | 1 | 2 |
Thymidylate kinase | Homo sapiens (human) | Km | 170.0000 | 1 | 1 |
Thymidylate kinase | Mycobacterium tuberculosis H37Rv | Km | 2,100.0000 | 2 | 2 |
Thymidylate synthase | Mus musculus (house mouse) | ID50 | 75.0000 | 1 | 1 |
Thymidylate synthase | Homo sapiens (human) | Km | 5.2500 | 1 | 1 |
Thymidylate synthase | Lacticaseibacillus casei | Km | 5.1000 | 2 | 2 |
Thymidylate synthase | Escherichia coli | Km | 2.0000 | 1 | 1 |
Tryprostatin B synthase | Aspergillus fumigatus Af293 | Km | 820.0000 | 1 | 1 |
Tryptophan 2,3-dioxygenase | Homo sapiens (human) | Km | 167.0000 | 1 | 1 |
Tryptophan dimethylallyltransferase | Aspergillus fumigatus Af293 | Km | 140.0000 | 1 | 1 |
Tyrosine-protein kinase Lck | Homo sapiens (human) | ID50 | 5,000.0000 | 1 | 1 |
Tyrosine-protein phosphatase non-receptor type 11 | Homo sapiens (human) | ID50 | 33,000.0000 | 1 | 1 |
UMP-CMP kinase | Homo sapiens (human) | Km | 298.7500 | 2 | 4 |
Uridine-cytidine kinase 1 | Homo sapiens (human) | Km | 131.0000 | 1 | 1 |