Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
titanium | [no description available] | medium | 7 | 0 | titanium group element atom | |
caseins | [no description available] | medium | 30 | 0 | | |
tyrosine | [no description available] | medium | 2,406 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
zirconium | [no description available] | medium | 1 | 0 | titanium group element atom | |
yttrium | [no description available] | medium | 1 | 0 | d-block element atom; rare earth metal atom; scandium group element atom | |
fluorides | [no description available] | medium | 13 | 0 | halide anion; monoatomic fluorine | |
alendronate | [no description available] | medium | 2 | 0 | 1,1-bis(phosphonic acid); primary amino compound | bone density conservation agent; EC 2.5.1.1 (dimethylallyltranstransferase) inhibitor |
acid phosphatase | [no description available] | medium | 37 | 0 | | |
calpastatin | [no description available] | medium | 1 | 0 | polypeptide | EC 3.4.22.52 (calpain-1) inhibitor; EC 3.4.22.53 (calpain-2) inhibitor |
calpain | [no description available] | medium | 12 | 0 | | |
methane | [no description available] | medium | 2 | 0 | alkane; gas molecular entity; mononuclear parent hydride; one-carbon compound | bacterial metabolite; fossil fuel; greenhouse gas |
gold | [no description available] | medium | 6 | 0 | copper group element atom; elemental gold | |
uridine triphosphate | [no description available] | medium | 3 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
carbachol | [no description available] | medium | 24 | 0 | ammonium salt; carbamate ester | cardiotonic drug; miotic; muscarinic agonist; nicotinic acetylcholine receptor agonist; non-narcotic analgesic |
serine | [no description available] | medium | 56 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
threonine | [no description available] | medium | 36 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
ganglioside, gd2 | [no description available] | medium | 1 | 0 | | |
fluorine | [no description available] | medium | 6 | 0 | diatomic fluorine; gas molecular entity | NMR chemical shift reference compound |
phenylalanine | [no description available] | medium | 44 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
histidine | [no description available] | medium | 17 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
phosphohistidine | [no description available] | medium | 5 | 0 | | |
phenyl acetate | [no description available] | medium | 6 | 0 | benzenes; phenyl acetates | |
n-formylglycine | [no description available] | medium | 1 | 0 | N-acylglycine; N-formyl amino acid | |
glycine | [no description available] | medium | 7 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
epidermal growth factor | [no description available] | medium | 377 | 0 | | |
su 11248 | [no description available] | medium | 3 | 0 | monocarboxylic acid amide; pyrroles | angiogenesis inhibitor; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; immunomodulator; neuroprotective agent; vascular endothelial growth factor receptor antagonist |
phosphoserine | [no description available] | medium | 351 | 0 | non-proteinogenic alpha-amino acid; O-phosphoamino acid; serine derivative | human metabolite |
phosphothreonine | [no description available] | high | 195 | 0 | L-threonine derivative; non-proteinogenic L-alpha-amino acid; O-phosphoamino acid | Escherichia coli metabolite |
arginine | [no description available] | medium | 27 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
tyrosine o-sulfate | [no description available] | medium | 13 | 0 | aryl sulfate; L-tyrosine derivative; O-sulfoamino acid | human metabolite |
sulfur | [no description available] | medium | 1 | 0 | chalcogen; nonmetal atom | macronutrient |
triazoles | [no description available] | medium | 10 | 0 | 1,2,3-triazole | |
phosphatidylcholines | [no description available] | medium | 3 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
histamine | [no description available] | medium | 8 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
paxilline | [no description available] | medium | 155 | 0 | diterpene alkaloid; enone; organic heterohexacyclic compound; terpenoid indole alkaloid; tertiary alcohol | anticonvulsant; Aspergillus metabolite; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor; genotoxin; geroprotector; mycotoxin; Penicillium metabolite; potassium channel blocker |
tetradecanoylphorbol acetate | [no description available] | medium | 211 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
chlorine | [no description available] | medium | 13 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
vanadates | [no description available] | medium | 239 | 0 | trivalent inorganic anion; vanadium oxoanion | EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor |
pervanadate | [no description available] | medium | 52 | 0 | | |
leucine | [no description available] | medium | 11 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
4-nitrophenylphosphate | [no description available] | medium | 20 | 0 | aryl phosphate | mouse metabolite |
nitrophenols | [no description available] | medium | 22 | 0 | | |
stearates | [no description available] | medium | 1 | 0 | | |
stearoyl chloride | [no description available] | medium | 1 | 0 | | |
imatinib mesylate | [no description available] | medium | 30 | 0 | methanesulfonate salt | anticoronaviral agent; antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
naphthoquinones | [no description available] | medium | 4 | 0 | | |
benzofurans | [no description available] | medium | 2 | 0 | | |
2-acetylfuranonaphthoquinone | [no description available] | medium | 1 | 0 | | |
thromboplastin | [no description available] | medium | 2 | 0 | | |
bp-1-102 | [no description available] | medium | 1 | 0 | | |
n-methylaspartate | [no description available] | medium | 9 | 0 | amino dicarboxylic acid; D-alpha-amino acid; D-aspartic acid derivative; secondary amino compound | neurotransmitter agent |
ouabain | [no description available] | medium | 5 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
lysine | [no description available] | medium | 19 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
glutamic acid | [no description available] | medium | 21 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
proanthocyanidin | [no description available] | medium | 1 | 0 | | |
procyanidin | [no description available] | medium | 1 | 0 | proanthocyanidin | |
equol | [no description available] | medium | 2 | 0 | hydroxyisoflavans | |
epichlorohydrin | [no description available] | medium | 1 | 0 | epoxide; organochlorine compound | |
piperidines | [no description available] | medium | 6 | 0 | | |
decitabine | [no description available] | medium | 1 | 0 | 2'-deoxyribonucleoside | |
ovalbumin | [no description available] | medium | 8 | 0 | | |
adenine | [no description available] | medium | 2 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pci 32765 | [no description available] | medium | 1 | 0 | acrylamides; aromatic amine; aromatic ether; N-acylpiperidine; pyrazolopyrimidine; tertiary carboxamide | antineoplastic agent; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor |
alpha-synuclein | [no description available] | medium | 3 | 0 | | |
erlotinib hydrochloride | [no description available] | medium | 8 | 0 | hydrochloride; terminal acetylenic compound | antineoplastic agent; protein kinase inhibitor |
quinazolines | [no description available] | medium | 28 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; quinazolines | |
bibw 2992 | [no description available] | medium | 1 | 0 | aromatic ether; enamide; furans; monochlorobenzenes; organofluorine compound; quinazolines; secondary carboxamide; tertiary amino compound | antineoplastic agent; tyrosine kinase inhibitor |
sepharose | [no description available] | medium | 4 | 0 | | |
sirolimus | [no description available] | medium | 12 | 0 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
titanium dioxide | [no description available] | medium | 5 | 0 | titanium oxides | food colouring |
fluorophosphate | [no description available] | medium | 1 | 0 | fluorine molecular entity; phosphoric acid derivative | |
organophosphonates | [no description available] | medium | 12 | 0 | divalent inorganic anion; phosphite ion | |
tungstate | [no description available] | medium | 5 | 0 | divalent inorganic anion; tungsten oxoanion | |
rhosin | [no description available] | medium | 1 | 0 | D-tryptophan derivative; hydrazone; quinoxaline derivative | antineoplastic agent; RhoA inhibitor; RhoC inhibitor |
gastrins | [no description available] | medium | 9 | 0 | | |
substance p | [no description available] | medium | 5 | 0 | peptide | neurokinin-1 receptor agonist; neurotransmitter; vasodilator agent |
crenolanib | [no description available] | medium | 1 | 0 | aminopiperidine; aromatic ether; benzimidazoles; oxetanes; quinolines; tertiary amino compound | angiogenesis inhibitor; antineoplastic agent; apoptosis inducer; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor |
ng-nitroarginine methyl ester | [no description available] | medium | 3 | 0 | alpha-amino acid ester; L-arginine derivative; methyl ester; N-nitro compound | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
tempo | [no description available] | medium | 1 | 0 | aminoxyls; piperidines | catalyst; ferroptosis inhibitor; radical scavenger |
GDC-0623 | [no description available] | medium | 1 | 0 | hydroxamic acid ester; imidazopyridine; monofluorobenzenes; organoiodine compound; primary alcohol; secondary amino compound; substituted aniline | antineoplastic agent; apoptosis inducer; EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor |
niacinamide | [no description available] | medium | 4 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
crizotinib | [no description available] | medium | 1 | 0 | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)pyrazol-4-yl]pyridin-2-amine | antineoplastic agent; biomarker; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor |
dactolisib | [no description available] | medium | 2 | 0 | imidazoquinoline; nitrile; quinolines; ring assembly; ureas | antineoplastic agent; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; mTOR inhibitor |
cyclin d1 | [no description available] | medium | 14 | 0 | | |
aminoimidazole carboxamide | [no description available] | medium | 3 | 0 | aminoimidazole; monocarboxylic acid amide | mouse metabolite |
acetylcysteine | [no description available] | medium | 17 | 0 | acetylcysteine; L-cysteine derivative; N-acetyl-L-amino acid | antidote to paracetamol poisoning; antiinfective agent; antioxidant; antiviral drug; ferroptosis inhibitor; geroprotector; human metabolite; mucolytic; radical scavenger; vulnerary |
aica ribonucleotide | [no description available] | medium | 2 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
u 73122 | [no description available] | medium | 9 | 0 | aromatic ether; aza-steroid; maleimides | EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor |
selenic acid | [no description available] | medium | 1 | 0 | selenium oxoacid | |
fluorescein-5-isothiocyanate | [no description available] | medium | 8 | 0 | fluorescein isothiocyanate | |
1,2-distearoylphosphatidylethanolamine | [no description available] | medium | 1 | 0 | phosphatidylethanolamine zwitterion; phosphatidylethanolamine | human metabolite |
glycidyl nitrate | [no description available] | medium | 1 | 0 | | |
go 6976 | [no description available] | medium | 5 | 0 | indolocarbazole; organic heterohexacyclic compound | EC 2.7.11.13 (protein kinase C) inhibitor |
acetylglucosamine | [no description available] | medium | 5 | 0 | N-acetyl-D-glucosamine | epitope |
uridine diphosphate glucuronic acid | [no description available] | medium | 1 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate glucose | [no description available] | medium | 1 | 0 | UDP-D-glucose | fundamental metabolite |
verlukast | [no description available] | medium | 1 | 0 | | |
glycolipids | [no description available] | medium | 10 | 0 | | |
malachite green | [no description available] | medium | 2 | 0 | organic chloride salt | antibacterial agent; antifungal drug; carcinogenic agent; environmental contaminant; fluorochrome; histological dye; teratogenic agent |
c.i. 42510 | [no description available] | medium | 4 | 0 | | |
oligonucleotides | [no description available] | medium | 8 | 0 | | |
2,3-diphosphoglycerate | [no description available] | medium | 2 | 0 | bisphosphoglyceric acid; tetronic acid derivative | human metabolite |
3-phosphoglycerate | [no description available] | medium | 1 | 0 | monophosphoglyceric acid; tetronic acid derivative | algal metabolite; fundamental metabolite |
2-phosphoglycerate | [no description available] | medium | 1 | 0 | monophosphoglyceric acid; tetronic acid derivative | |
deoxyglucose | [no description available] | medium | 28 | 0 | | |
cryptotanshinone | [no description available] | medium | 1 | 0 | abietane diterpenoid | anticoronaviral agent |
phenanthrenes | [no description available] | medium | 1 | 0 | | |
g(m3) ganglioside | [no description available] | medium | 9 | 0 | alpha-N-acetylneuraminyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-ceramide; sialodiosylceramide; sialotriaosylceramide | mouse metabolite |
g(m2) ganglioside | [no description available] | medium | 2 | 0 | N-acetyl-beta-D-galactosaminyl-(1->4)-alpha-N-acetylneuraminosyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-N-acylsphingosine; sialotriaosylceramide | antigen |
nitrofen | [no description available] | medium | 2 | 0 | organic molecular entity | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor; herbicide |
erythrosine | [no description available] | medium | 6 | 0 | | |
cefoxitin | [no description available] | medium | 1 | 0 | L-serine derivative; non-proteinogenic L-alpha-amino acid | tumour antigen |
paraquat | [no description available] | medium | 1 | 0 | organic cation | geroprotector; herbicide |
adenosine diphosphate | [no description available] | medium | 19 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
kainic acid | [no description available] | medium | 6 | 0 | dicarboxylic acid; L-proline derivative; non-proteinogenic L-alpha-amino acid; pyrrolidinecarboxylic acid | antinematodal drug; excitatory amino acid agonist |
myristic acid | [no description available] | medium | 15 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite |
s 1033 | [no description available] | medium | 4 | 0 | (trifluoromethyl)benzenes; imidazoles; pyridines; pyrimidines; secondary amino compound; secondary carboxamide | anticoronaviral agent; antineoplastic agent; tyrosine kinase inhibitor |
ag-490 | [no description available] | medium | 12 | 0 | catechols; enamide; monocarboxylic acid amide; nitrile; secondary carboxamide | anti-inflammatory agent; antioxidant; apoptosis inducer; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; geroprotector; STAT3 inhibitor |
glutaral | [no description available] | medium | 3 | 0 | dialdehyde | cross-linking reagent; disinfectant; fixative |
sarcosine | [no description available] | medium | 1 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
genistein | [no description available] | medium | 205 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; human urinary metabolite; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
sarkosyl | [no description available] | medium | 1 | 0 | | |
oxidopamine | [no description available] | medium | 2 | 0 | benzenetriol; catecholamine; primary amino compound | drug metabolite; human metabolite; neurotoxin |
dasatinib | [no description available] | medium | 8 | 0 | 1,3-thiazoles; aminopyrimidine; monocarboxylic acid amide; N-(2-hydroxyethyl)piperazine; N-arylpiperazine; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antineoplastic agent; tyrosine kinase inhibitor |
thiazoles | [no description available] | medium | 28 | 0 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
cysteine | [no description available] | medium | 33 | 0 | cysteinium | fundamental metabolite |
transforming growth factor alpha | [no description available] | medium | 30 | 0 | | |
arsenic | [no description available] | medium | 31 | 0 | metalloid atom; pnictogen | micronutrient |
oxophenylarsine | [no description available] | medium | 30 | 0 | arsine oxides | antineoplastic agent; apoptosis inducer; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor |
urea | [no description available] | medium | 4 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
3-phenylpropionic acid | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | antifungal agent; human metabolite; plant metabolite |
sq-23377 | [no description available] | medium | 28 | 0 | cyclic ether; enol; polyunsaturated fatty acid; very long-chain fatty acid | calcium ionophore; metabolite |
ag 1879 | [no description available] | medium | 20 | 0 | aromatic amine; monochlorobenzenes; pyrazolopyrimidine | beta-adrenergic antagonist; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; geroprotector |
ro 31-8220 | [no description available] | medium | 8 | 0 | imidothiocarbamic ester; indoles; maleimides | EC 2.7.11.13 (protein kinase C) inhibitor |
angiotensin ii | [no description available] | medium | 51 | 0 | amino acid zwitterion; angiotensin II | human metabolite |
aldosterone | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
leptin | [no description available] | medium | 14 | 0 | | |
wortmannin | [no description available] | medium | 70 | 0 | acetate ester; cyclic ketone; delta-lactone; organic heteropentacyclic compound | anticoronaviral agent; antineoplastic agent; autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector; Penicillium metabolite; radiosensitizing agent |
inositol 3,4,5-trisphosphate | [no description available] | medium | 1 | 0 | | |
niclosamide | [no description available] | medium | 1 | 0 | benzamides; C-nitro compound; monochlorobenzenes; salicylanilides; secondary carboxamide | anthelminthic drug; anticoronaviral agent; antiparasitic agent; apoptosis inducer; molluscicide; piscicide; STAT3 inhibitor |
stattic | [no description available] | medium | 2 | 0 | 1-benzothiophenes; C-nitro compound; sulfone | antineoplastic agent; radiosensitizing agent; STAT3 inhibitor |
alanine | [no description available] | medium | 12 | 0 | alanine zwitterion; alanine; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; fundamental metabolite |
8-(trifluoromethyl)-1,2,3,4,5-benzopentathiepin-6-amine | [no description available] | medium | 1 | 0 | | |
diethyl phosphate | [no description available] | medium | 1 | 0 | dialkyl phosphate | human xenobiotic metabolite; mouse metabolite |
phosphonic acid | [no description available] | medium | 1 | 0 | | |
phosphoric acid | [no description available] | medium | 2 | 0 | phosphoric acids | algal metabolite; fertilizer; human metabolite; NMR chemical shift reference compound; solvent |
guanosine triphosphate | [no description available] | medium | 31 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
involucrin | [no description available] | medium | 1 | 0 | | |
bromochloroacetic acid | [no description available] | medium | 6 | 0 | 2-bromocarboxylic acid; monocarboxylic acid; organochlorine compound | |
alpha-chymotrypsin | [no description available] | medium | 5 | 0 | | |
proline | [no description available] | medium | 14 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
nephrin | [no description available] | medium | 4 | 0 | | |
4,4-difluoro-4-bora-3a,4a-diaza-s-indacene | [no description available] | medium | 2 | 0 | BODIPY compound | |
myelin basic protein | [no description available] | medium | 24 | 0 | | |
glycerophosphoinositol 4,5-bisphosphate | [no description available] | medium | 22 | 0 | | |
neuropeptide y | [no description available] | medium | 1 | 0 | | |
bradykinin | [no description available] | medium | 26 | 0 | oligopeptide | human blood serum metabolite; vasodilator agent |
orabase | [no description available] | medium | 1 | 0 | | |
chitosan | [no description available] | medium | 1 | 0 | | |
galactose | [no description available] | medium | 5 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
acetylgalactosamine | [no description available] | medium | 1 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-hydroxy-2-nonenal | [no description available] | medium | 3 | 0 | 4-hydroxynon-2-enal; 4-hydroxynonenal | |
fingolimod hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | immunosuppressive agent; prodrug; sphingosine-1-phosphate receptor agonist |
sphingosine | [no description available] | medium | 14 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
3-hydroxybutyric acid | [no description available] | medium | 1 | 0 | (omega-1)-hydroxy fatty acid; 3-hydroxy monocarboxylic acid; hydroxybutyric acid | human metabolite |
sorbitol | [no description available] | medium | 3 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
glyoxylic acid | [no description available] | medium | 1 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-oxindole | [no description available] | medium | 1 | 0 | gamma-lactam; indolinone | |
aspartic acid | [no description available] | medium | 12 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
malonic acid | [no description available] | medium | 2 | 0 | alpha,omega-dicarboxylic acid | human metabolite |
colforsin | [no description available] | medium | 33 | 0 | acetate ester; cyclic ketone; labdane diterpenoid; organic heterotricyclic compound; tertiary alpha-hydroxy ketone; triol | adenylate cyclase agonist; anti-HIV agent; antihypertensive agent; plant metabolite; platelet aggregation inhibitor; protein kinase A agonist |
n,n,n',n'-tetrakis(2-pyridylmethyl)ethylenediamine | [no description available] | medium | 1 | 0 | N-substituted diamine; pyridines; tertiary amino compound | apoptosis inducer; chelator; copper chelator |
pyrroles | [no description available] | medium | 12 | 0 | pyrrole; secondary amine | |
su 5402 | [no description available] | medium | 2 | 0 | | |
g(m1) ganglioside | [no description available] | medium | 8 | 0 | alpha-N-acetylneuraminosyl-(2->3)-[beta-D-galactosyl-(1->3)-N-acetyl-beta-D-galactosaminyl-(1->4)]-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-N-acylsphingosine; sialotetraosylceramide | |
akb-9778 | [no description available] | medium | 1 | 0 | | |
tetramethylrhodamine | [no description available] | medium | 2 | 0 | xanthene dye | |
interleukin-8 | [no description available] | medium | 13 | 0 | | |
5-carboxytetramethylrhodamine succinimidyl ester | [no description available] | medium | 1 | 0 | | |
atovaquone | [no description available] | medium | 1 | 0 | hydroxy-1,2-naphthoquinone | |
mocetinostat | [no description available] | medium | 5 | 0 | aminopyrimidine; benzamides; pyridines; secondary amino compound; secondary carboxamide; substituted aniline | antineoplastic agent; apoptosis inducer; autophagy inducer; cardioprotective agent; EC 3.5.1.98 (histone deacetylase) inhibitor; hepatotoxic agent |
heme | [no description available] | medium | 1 | 0 | | |
dihydroxyphenylalanine | [no description available] | medium | 3 | 0 | hydroxyphenylalanine; non-proteinogenic alpha-amino acid; tyrosine derivative | human metabolite |
fibrinogen | [no description available] | medium | 23 | 0 | iditol | fungal metabolite |
n-formylmethionine leucyl-phenylalanine | [no description available] | medium | 36 | 0 | tripeptide | |
5,7-dihydroxy-4',6-dimethoxyflavone | [no description available] | medium | 1 | 0 | dihydroxyflavone; dimethoxyflavone | plant metabolite |
harmine | [no description available] | medium | 2 | 0 | harmala alkaloid | anti-HIV agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; metabolite |
6-cyano-7-nitroquinoxaline-2,3-dione | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
geranylgeranylacetone | [no description available] | medium | 1 | 0 | | |
noscapine | [no description available] | medium | 2 | 0 | aromatic ether; benzylisoquinoline alkaloid; cyclic acetal; isobenzofuranone; organic heterobicyclic compound; organic heterotricyclic compound; tertiary amino compound | antineoplastic agent; antitussive; apoptosis inducer; plant metabolite |
bendamustine hydrochloride | [no description available] | medium | 1 | 0 | | |
endothelin-1 | [no description available] | medium | 10 | 0 | | |
isoproterenol | [no description available] | medium | 11 | 0 | catechols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; sympathomimetic agent |
ag 556 | [no description available] | medium | 2 | 0 | | |
tamoxifen | [no description available] | medium | 5 | 0 | stilbenoid; tertiary amino compound | angiogenesis inhibitor; antineoplastic agent; bone density conservation agent; EC 1.2.3.1 (aldehyde oxidase) inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; estrogen antagonist; estrogen receptor antagonist; estrogen receptor modulator |
fucose | [no description available] | medium | 1 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
clodronic acid | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid); one-carbon compound; organochlorine compound | antineoplastic agent; bone density conservation agent |
ag-1296 | [no description available] | medium | 2 | 0 | quinoxaline derivative | |
etoposide | [no description available] | medium | 13 | 0 | beta-D-glucoside; furonaphthodioxole; organic heterotetracyclic compound | antineoplastic agent; DNA synthesis inhibitor |
i(3)so3-galactosylceramide | [no description available] | medium | 3 | 0 | galactosylceramide sulfate; N-acyl-beta-D-galactosylsphingosine | |
casein kinase ii | [no description available] | medium | 8 | 0 | | |
inositol 1,4,5-trisphosphate | [no description available] | medium | 39 | 0 | myo-inositol trisphosphate | mouse metabolite |
chlorpromazine | [no description available] | medium | 3 | 0 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
sphingosine kinase | [no description available] | medium | 1 | 0 | | |
lysophosphatidic acid | [no description available] | medium | 4 | 0 | 1-acyl-sn-glycerol 3-phosphate | |
losartan potassium | [no description available] | medium | 41 | 0 | | |
cholanic acid | [no description available] | medium | 2 | 0 | cholanic acids | |
betadex | [no description available] | medium | 8 | 0 | cyclodextrin | |
cicaprost | [no description available] | medium | 1 | 0 | monoterpenoid | |
hydroxyurea | [no description available] | medium | 3 | 0 | one-carbon compound; ureas | antimetabolite; antimitotic; antineoplastic agent; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; genotoxin; immunomodulator; radical scavenger; teratogenic agent |
cycloheximide | [no description available] | medium | 19 | 0 | antibiotic fungicide; cyclic ketone; dicarboximide; piperidine antibiotic; piperidones; secondary alcohol | anticoronaviral agent; bacterial metabolite; ferroptosis inhibitor; neuroprotective agent; protein synthesis inhibitor |
glycogen | [no description available] | medium | 15 | 0 | | |
methotrexate | [no description available] | medium | 2 | 0 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
indazoles | [no description available] | medium | 3 | 0 | indazole | |
sodium glutamate | [no description available] | medium | 1 | 0 | monosodium glutamate | flavouring agent |
peroxynitrous acid | [no description available] | medium | 3 | 0 | nitrogen oxoacid | |
4-butyrolactone | [no description available] | medium | 3 | 0 | butan-4-olide | metabolite; neurotoxin |
staurosporine | [no description available] | medium | 57 | 1 | ammonium ion derivative | |
pseudomonas aeruginosa autoinducer | [no description available] | medium | 1 | 0 | N-acyl homoserine lactone | |
okadaic acid | [no description available] | medium | 36 | 0 | ketal | |
homoserine | [no description available] | medium | 1 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
arachidonic acid | [no description available] | medium | 21 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
caffeine | [no description available] | medium | 5 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
dephostatin | [no description available] | medium | 4 | 0 | | |
cyclosporine | [no description available] | medium | 9 | 0 | | |
oleic acid | [no description available] | medium | 6 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
cycloolivil | [no description available] | medium | 1 | 0 | lignan | |
ethyl acetate | [no description available] | medium | 1 | 0 | acetate ester; ethyl ester; volatile organic compound | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor; metabolite; polar aprotic solvent; Saccharomyces cerevisiae metabolite |
oleuropein | [no description available] | medium | 1 | 0 | beta-D-glucoside; catechols; diester; methyl ester; pyrans; secoiridoid glycoside | anti-inflammatory agent; antihypertensive agent; antineoplastic agent; antioxidant; apoptosis inducer; NF-kappaB inhibitor; nutraceutical; plant metabolite; radical scavenger |
phenylethyl alcohol | [no description available] | medium | 1 | 0 | benzenes; primary alcohol | Aspergillus metabolite; fragrance; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite |
3,4-dihydroxyphenylethanol | [no description available] | medium | 1 | 0 | catechols; primary alcohol | antineoplastic agent; antioxidant; metabolite |
iridoids | [no description available] | medium | 1 | 0 | | |
damnacanthal | [no description available] | medium | 1 | 0 | aldehyde; monohydroxyanthraquinone | |
su 6656 | [no description available] | medium | 3 | 0 | | |
3,3',4,5'-tetrahydroxystilbene | [no description available] | medium | 7 | 0 | catechols; polyphenol; resorcinols; stilbenol | antineoplastic agent; apoptosis inducer; geroprotector; hypoglycemic agent; plant metabolite; protein kinase inhibitor; tyrosine kinase inhibitor |
1,7-phenanthroline | [no description available] | medium | 7 | 0 | phenanthroline | |
stilbenes | [no description available] | medium | 8 | 0 | stilbene | |
phosphoglycolate | [no description available] | medium | 1 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
lignans | [no description available] | medium | 2 | 0 | | |
2,3-bis(3'-hydroxybenzyl)butyrolactone | [no description available] | medium | 1 | 0 | lignan | |
uridine diphosphate n-acetylglucosamine | [no description available] | medium | 1 | 0 | | |
tetracycline | [no description available] | medium | 2 | 0 | | |
pirinixic acid | [no description available] | medium | 2 | 0 | aryl sulfide; organochlorine compound; pyrimidines | |
n-oleoylethanolamine | [no description available] | medium | 1 | 0 | endocannabinoid; N-(long-chain-acyl)ethanolamine; N-acylethanolamine 18:1 | EC 3.5.1.23 (ceramidase) inhibitor; geroprotector; PPARalpha agonist |
chlortetracycline | [no description available] | medium | 5 | 0 | | |
1-methyl-3-isobutylxanthine | [no description available] | medium | 12 | 0 | 3-isobutyl-1-methylxanthine | |
activins | [no description available] | medium | 1 | 0 | | |
enalaprilat anhydrous | [no description available] | medium | 1 | 0 | dicarboxylic acid; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
1-anilino-8-naphthalenesulfonate | [no description available] | medium | 2 | 0 | aminonaphthalene; naphthalenesulfonic acid | fluorescent probe |
anandamide | [no description available] | medium | 2 | 0 | endocannabinoid; N-acylethanolamine 20:4 | human blood serum metabolite; neurotransmitter; vasodilator agent |
lapatinib | [no description available] | medium | 1 | 0 | furans; organochlorine compound; organofluorine compound; quinazolines | antineoplastic agent; tyrosine kinase inhibitor |
carmustine | [no description available] | medium | 2 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
podophyllotoxin | [no description available] | medium | 3 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antimitotic; antineoplastic agent; keratolytic drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
cytarabine | [no description available] | medium | 3 | 0 | beta-D-arabinoside; monosaccharide derivative; pyrimidine nucleoside | antimetabolite; antineoplastic agent; antiviral agent; immunosuppressive agent |
prednisone | [no description available] | medium | 1 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; immunosuppressive agent; prodrug |
melphalan | [no description available] | medium | 1 | 0 | L-phenylalanine derivative; nitrogen mustard; non-proteinogenic L-alpha-amino acid; organochlorine compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
terbium | [no description available] | medium | 3 | 0 | f-block element atom; lanthanoid atom | |
guanosine monophosphate | [no description available] | medium | 2 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
1,4,7,10-tetrakis(carbamoylmethyl)-1,4,7,10-tetraazacyclododecane | [no description available] | medium | 1 | 0 | | |
cytochalasin d | [no description available] | medium | 36 | 0 | | |
quinpirole | [no description available] | medium | 1 | 0 | pyrazoloquinoline | dopamine agonist |
sphingosine 1-phosphate | [no description available] | medium | 6 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
glucose, (beta-d)-isomer | [no description available] | medium | 11 | 0 | D-glucopyranose | epitope; mouse metabolite |
octyl glucoside | [no description available] | medium | 3 | 0 | beta-D-glucoside | plant metabolite |
emerin | [no description available] | medium | 1 | 0 | | |
calcimycin | [no description available] | medium | 37 | 0 | benzoxazole | |
transforming growth factor beta | [no description available] | medium | 25 | 0 | | |
zithromax | [no description available] | medium | 1 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; xenobiotic |
2-tert-butylhydroquinone | [no description available] | medium | 2 | 0 | hydroquinones | food antioxidant |
cadmium | [no description available] | medium | 2 | 0 | cadmium molecular entity; zinc group element atom | |
pd 173074 | [no description available] | medium | 1 | 0 | aromatic amine; biaryl; dimethoxybenzene; pyridopyrimidine; tertiary amino compound; ureas | antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; fibroblast growth factor receptor antagonist |
fluorouracil | [no description available] | medium | 1 | 0 | nucleobase analogue; organofluorine compound | antimetabolite; antineoplastic agent; environmental contaminant; immunosuppressive agent; radiosensitizing agent; xenobiotic |
cyclic gmp | [no description available] | medium | 13 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
adenosine | [no description available] | medium | 5 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
methionine | [no description available] | medium | 15 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
argon | [no description available] | medium | 1 | 0 | monoatomic argon; noble gas atom; p-block element atom | food packaging gas; neuroprotective agent |
calcitriol | [no description available] | medium | 8 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
lithocholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; monohydroxy-5beta-cholanic acid | geroprotector; human metabolite; mouse metabolite |
sorafenib | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; aromatic ether; monochlorobenzenes; phenylureas; pyridinecarboxamide | angiogenesis inhibitor; anticoronaviral agent; antineoplastic agent; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; ferroptosis inducer; tyrosine kinase inhibitor |
isoxazoles | [no description available] | medium | 4 | 0 | isoxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
gefitinib | [no description available] | medium | 5 | 0 | aromatic ether; monochlorobenzenes; monofluorobenzenes; morpholines; quinazolines; secondary amino compound; tertiary amino compound | antineoplastic agent; epidermal growth factor receptor antagonist |
neuromedin b | [no description available] | medium | 2 | 0 | | |
neurokinin b | [no description available] | medium | 2 | 0 | polypeptide | |
colchicine | [no description available] | medium | 9 | 0 | alkaloid; colchicine | anti-inflammatory agent; gout suppressant; mutagen |
chloroquine | [no description available] | medium | 4 | 0 | aminoquinoline; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; antirheumatic drug; autophagy inhibitor; dermatologic drug |
arginyl-glycyl-aspartic acid | [no description available] | medium | 12 | 0 | oligopeptide | |
thromboxane b2 | [no description available] | medium | 3 | 0 | thromboxanes B | human metabolite; mouse metabolite |
cerium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
ceric oxide | [no description available] | medium | 1 | 0 | cerium molecular entity; metal oxide | |
c-peptide | [no description available] | medium | 4 | 1 | | |
8-aminohexylamino camp | [no description available] | medium | 1 | 0 | | |
vorinostat | [no description available] | medium | 2 | 0 | dicarboxylic acid diamide; hydroxamic acid | antineoplastic agent; apoptosis inducer; EC 3.5.1.98 (histone deacetylase) inhibitor |
ephrin-a5 | [no description available] | medium | 2 | 0 | | |
thapsigargin | [no description available] | medium | 28 | 0 | butyrate ester; organic heterotricyclic compound; sesquiterpene lactone | calcium channel blocker; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor |
zinc oxide | [no description available] | medium | 1 | 0 | zinc molecular entity | |
alpha-aminopyridine | [no description available] | medium | 1 | 0 | | |
fg 9041 | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
nifedipine | [no description available] | medium | 5 | 0 | C-nitro compound; dihydropyridine; methyl ester | calcium channel blocker; human metabolite; tocolytic agent; vasodilator agent |
ketamine | [no description available] | medium | 1 | 0 | cyclohexanones; monochlorobenzenes; secondary amino compound | analgesic; environmental contaminant; intravenous anaesthetic; neurotoxin; NMDA receptor antagonist; xenobiotic |
quinoxalines | [no description available] | medium | 4 | 0 | mancude organic heterobicyclic parent; naphthyridine; ortho-fused heteroarene | |
biotin | [no description available] | medium | 8 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
potassium chloride | [no description available] | medium | 11 | 0 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
valproic acid | [no description available] | medium | 2 | 0 | branched-chain fatty acid; branched-chain saturated fatty acid | anticonvulsant; antimanic drug; EC 3.5.1.98 (histone deacetylase) inhibitor; GABA agent; neuroprotective agent; psychotropic drug; teratogenic agent |
3-nitrotyrosine | [no description available] | medium | 9 | 0 | 2-nitrophenols; C-nitro compound; nitrotyrosine; non-proteinogenic alpha-amino acid | |
dodecylphosphocholine | [no description available] | medium | 1 | 0 | phosphocholines | detergent |
phosphorylcholine | [no description available] | medium | 3 | 0 | phosphocholines | allergen; epitope; hapten; human metabolite; mouse metabolite |
5-methylcytosine | [no description available] | medium | 1 | 0 | methylcytosine; pyrimidines | human metabolite |
cytosine | [no description available] | medium | 1 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5-hydroxymethylcytosine | [no description available] | medium | 1 | 0 | aminopyrimidine; aromatic primary alcohol; nucleobase analogue; pyrimidone | human metabolite; mouse metabolite |
osteogenic growth peptide | [no description available] | medium | 1 | 0 | | |
y 27632 | [no description available] | medium | 2 | 0 | aromatic amide | |
spiperone | [no description available] | medium | 1 | 0 | aromatic ketone; azaspiro compound; organofluorine compound; piperidines; tertiary amino compound | alpha-adrenergic antagonist; antipsychotic agent; dopaminergic antagonist; psychotropic drug; serotonergic antagonist |
coumermycin | [no description available] | medium | 1 | 0 | aromatic amide; coumarins; glycoside; heteroarenecarboxylate ester; pyrroles | antimicrobial agent; antineoplastic agent; bacterial metabolite; DNA synthesis inhibitor; Hsp90 inhibitor; topoisomerase IV inhibitor |
nsc 74859 | [no description available] | medium | 2 | 0 | amidobenzoic acid; monohydroxybenzoic acid; tosylate ester | STAT3 inhibitor |
pyrimethamine | [no description available] | medium | 1 | 0 | aminopyrimidine; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
phospho-l-arginine | [no description available] | medium | 3 | 0 | L-arginine derivative; non-proteinogenic L-alpha-amino acid; phosphagen; phosphoamino acid | animal metabolite |
hydrobromic acid | [no description available] | medium | 1 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
isoprene | [no description available] | medium | 1 | 0 | alkadiene; hemiterpene; volatile organic compound | plant metabolite |
phenylephrine | [no description available] | medium | 4 | 0 | phenols; phenylethanolamines; secondary amino compound | alpha-adrenergic agonist; cardiotonic drug; mydriatic agent; nasal decongestant; protective agent; sympathomimetic agent; vasoconstrictor agent |
blister | [no description available] | medium | 1 | 0 | cyclic ketone; pyrroloquinoline; tertiary alcohol; tertiary alpha-hydroxy ketone | inhibitor |
chlorpyrifos | [no description available] | medium | 1 | 0 | chloropyridine; organic thiophosphate | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; insecticide; xenobiotic |
o,o-diethyl o-3,5,6-trichloro-2-pyridyl phosphate | [no description available] | medium | 1 | 0 | | |
gx 15-070 | [no description available] | medium | 1 | 0 | | |
1,2-bis(2-aminophenoxy)ethane-n,n,n',n'-tetraacetic acid | [no description available] | medium | 9 | 0 | polyamino carboxylic acid; tetracarboxylic acid | chelator |
egtazic acid | [no description available] | medium | 30 | 0 | diether; tertiary amino compound; tetracarboxylic acid | chelator |
h 89 | [no description available] | medium | 1 | 0 | N-[2-(4-bromocinnamylamino)ethyl]isoquinoline-5-sulfonamide | |
simvastatin | [no description available] | medium | 3 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; statin (semi-synthetic) | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; ferroptosis inducer; geroprotector; prodrug |
orotic acid | [no description available] | medium | 1 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
carboxyamido-triazole | [no description available] | medium | 3 | 0 | | |
deoxycholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human blood serum metabolite |
homocysteine | [no description available] | medium | 3 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
adenylyl imidodiphosphate | [no description available] | medium | 3 | 0 | adenosine 5'-phosphate | |
deuterium | [no description available] | medium | 2 | 0 | dihydrogen | |
hydrogen | [no description available] | medium | 7 | 0 | elemental hydrogen; elemental molecule; gas molecular entity | antioxidant; electron donor; food packaging gas; fuel; human metabolite |
metallothionein | [no description available] | medium | 6 | 0 | | |
adenosine monophosphate | [no description available] | medium | 7 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | adenosine A1 receptor agonist; cofactor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.11 (fructose-bisphosphatase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
cangrelor | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate; aryl sulfide; nucleoside triphosphate analogue; organochlorine compound; organofluorine compound; secondary amino compound | P2Y12 receptor antagonist; platelet aggregation inhibitor |
iloprost | [no description available] | medium | 2 | 0 | carbobicyclic compound; monocarboxylic acid; secondary alcohol | platelet aggregation inhibitor; vasodilator agent |
penicillamine | [no description available] | medium | 7 | 0 | non-proteinogenic alpha-amino acid; penicillamine | antirheumatic drug; chelator; copper chelator; drug allergen |
u 0126 | [no description available] | medium | 6 | 0 | aryl sulfide; dinitrile; enamine; substituted aniline | antineoplastic agent; antioxidant; apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; osteogenesis regulator; vasoconstrictor agent |
s-nitro-n-acetylpenicillamine | [no description available] | medium | 4 | 0 | | |
pyrimidinones | [no description available] | medium | 1 | 0 | | |
rosiglitazone | [no description available] | medium | 1 | 0 | aminopyridine; thiazolidinediones | EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; insulin-sensitizing drug |
nickel | [no description available] | medium | 2 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
3-methylcholanthrene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene | aryl hydrocarbon receptor agonist; carcinogenic agent |
leupeptins | [no description available] | medium | 10 | 0 | | |
benzyloxycarbonylleucyl-leucyl-leucine aldehyde | [no description available] | medium | 7 | 0 | amino aldehyde; carbamate ester; tripeptide | proteasome inhibitor |
lactacystin | [no description available] | medium | 5 | 0 | lactam; S-substituted L-cysteine | |
fasudil | [no description available] | medium | 3 | 0 | isoquinolines; N-sulfonyldiazepane | antihypertensive agent; calcium channel blocker; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; geroprotector; neuroprotective agent; nootropic agent; vasodilator agent |
1-(5-isoquinolinesulfonyl)-2-methylpiperazine | [no description available] | medium | 24 | 0 | isoquinolines; N-sulfonylpiperazine | EC 2.7.11.13 (protein kinase C) inhibitor |
mannitol | [no description available] | medium | 3 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
rtki cpd | [no description available] | medium | 15 | 0 | | |
hydrazine | [no description available] | medium | 3 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
pd 98059 | [no description available] | medium | 38 | 0 | aromatic amine; monomethoxyflavone | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; geroprotector |
europium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
sodium dodecyl sulfate | [no description available] | medium | 3 | 0 | organic sodium salt | detergent; protein denaturant |
su 5614 | [no description available] | medium | 1 | 0 | organochlorine compound; oxindoles; pyrroles | vascular endothelial growth factor receptor antagonist |
arginyl-glycyl-aspartyl-serine | [no description available] | medium | 5 | 0 | | |
kt 5720 | [no description available] | medium | 4 | 0 | carboxylic ester; gamma-lactam; hemiaminal; indolocarbazole; organic heterooctacyclic compound; semisynthetic derivative; tertiary alcohol | EC 2.7.11.11 (cAMP-dependent protein kinase) inhibitor |
1,2-bis(2-aminophenoxy)ethane n,n,n',n'-tetraacetic acid acetoxymethyl ester | [no description available] | medium | 4 | 0 | | |
adenosine-3',5'-cyclic phosphorothioate | [no description available] | medium | 2 | 0 | nucleoside 3',5'-cyclic phosphorothioate | |
2-(4-morpholinyl)-8-phenyl-4h-1-benzopyran-4-one | [no description available] | medium | 24 | 0 | chromones; morpholines; organochlorine compound | autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector |
parthenolide | [no description available] | medium | 2 | 0 | germacranolide | |
sesquiterpenes | [no description available] | medium | 2 | 0 | | |
iodine | [no description available] | medium | 3 | 0 | diatomic iodine | nutrient |
propylthiouracil | [no description available] | medium | 1 | 0 | pyrimidinethione | antidote to paracetamol poisoning; antimetabolite; antioxidant; antithyroid drug; carcinogenic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; hormone antagonist |
monensin | [no description available] | medium | 2 | 0 | cyclic hemiketal; monocarboxylic acid; polyether antibiotic; spiroketal | antifungal agent; coccidiostat; ionophore |
ym-90709 | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
tretinoin | [no description available] | medium | 20 | 0 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
dinoprostone | [no description available] | medium | 18 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
edetic acid | [no description available] | medium | 11 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
ergosterol | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | fungal metabolite; Saccharomyces cerevisiae metabolite |
thymidine | [no description available] | medium | 30 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
eptifibatide | [no description available] | medium | 1 | 0 | homodetic cyclic peptide; macrocycle; organic disulfide | anticoagulant; platelet aggregation inhibitor |
tirofiban | [no description available] | medium | 1 | 0 | L-tyrosine derivative; piperidines; sulfonamide | anticoagulant; fibrin modulating drug; platelet glycoprotein-IIb/IIIa receptor antagonist |
sdz psc 833 | [no description available] | medium | 1 | 0 | homodetic cyclic peptide | |
verapamil | [no description available] | medium | 3 | 0 | aromatic ether; nitrile; polyether; tertiary amino compound | |
n-(9-acridinyl)maleimide | [no description available] | medium | 1 | 0 | | |
n-(4-(2-benzimidazolyl)phenyl)maleimide | [no description available] | medium | 1 | 0 | | |
lysophosphatidylcholines | [no description available] | medium | 6 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine | |
deoxyribose | [no description available] | medium | 1 | 0 | deoxypentose | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
bisindolylmaleimide i | [no description available] | medium | 15 | 0 | | |
methylcellulose | [no description available] | medium | 1 | 0 | | |
captopril | [no description available] | medium | 2 | 0 | alkanethiol; L-proline derivative; N-acylpyrrolidine; pyrrolidinemonocarboxylic acid | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
cucurbitacin i | [no description available] | medium | 1 | 0 | cucurbitacin; tertiary alpha-hydroxy ketone | antineoplastic agent; plant metabolite |
sincalide | [no description available] | medium | 6 | 0 | oligopeptide | |
cholecystokinin | [no description available] | medium | 5 | 0 | | |
benzylamine | [no description available] | medium | 1 | 0 | aralkylamine; primary amine | allergen; EC 3.5.5.1 (nitrilase) inhibitor; plant metabolite |
phosphorus | [no description available] | medium | 5 | 0 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
1,1-diethyl-2-hydroxy-2-nitrosohydrazine | [no description available] | medium | 1 | 0 | organic anion | |
8-((4-chlorophenyl)thio)cyclic-3',5'-gmp | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; aryl sulfide; organochlorine compound; ribonucleotide | protein kinase agonist |
2,2'-(hydroxynitrosohydrazono)bis-ethanamine | [no description available] | medium | 2 | 0 | | |
hexachlorobenzene | [no description available] | medium | 1 | 0 | aromatic fungicide; chlorobenzenes | antifungal agrochemical; carcinogenic agent; persistent organic pollutant |
oxalic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid | algal metabolite; human metabolite; plant metabolite |
cgp 77675 | [no description available] | medium | 1 | 0 | | |
galactosamine | [no description available] | medium | 1 | 0 | D-galactosamine; primary amino compound | toxin |
bucladesine | [no description available] | medium | 17 | 0 | 3',5'-cyclic purine nucleotide | |
n-(2-(methylamino)ethyl)-5-isoquinolinesulfonamide | [no description available] | medium | 4 | 0 | isoquinolines; sulfonamide | |
hirudin | [no description available] | medium | 3 | 0 | | |
bromodeoxyuridine | [no description available] | medium | 11 | 0 | pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent |
4-o-methyl-12-o-tetradecanoylphorbol 13-acetate | [no description available] | medium | 1 | 0 | | |
4-methoxyamphetamine | [no description available] | medium | 1 | 0 | | |
amphetamine | [no description available] | medium | 1 | 0 | primary amine | |
acetylleucyl-leucyl-norleucinal | [no description available] | medium | 1 | 0 | aldehyde; tripeptide | cysteine protease inhibitor |
phenoxyacetic acid | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid | allergen; Aspergillus metabolite; human xenobiotic metabolite; plant growth retardant |
salicylates | [no description available] | medium | 3 | 0 | monohydroxybenzoate | plant metabolite |
phosphorus radioisotopes | [no description available] | medium | 60 | 0 | | |
ecdysterone | [no description available] | medium | 1 | 0 | 14alpha-hydroxy steroid; 20-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; ecdysteroid; phytoecdysteroid | animal metabolite; plant metabolite |
dactinomycin | [no description available] | medium | 5 | 0 | actinomycin | mutagen |
4-phosphonomethylphenylalanine | [no description available] | medium | 5 | 0 | | |
sodium tungstate(vi) | [no description available] | medium | 1 | 0 | inorganic sodium salt | reagent |
4-hydroxycoumarin | [no description available] | medium | 1 | 0 | hydroxycoumarin | |
agar | [no description available] | medium | 5 | 0 | | |
4-aminophenylphosphate | [no description available] | medium | 3 | 0 | | |
chromium | [no description available] | medium | 4 | 0 | chromium group element atom; metal allergen | micronutrient |
thiazolyl blue | [no description available] | medium | 2 | 0 | organic bromide salt | colorimetric reagent; dye |
docetaxel anhydrous | [no description available] | medium | 1 | 0 | secondary alpha-hydroxy ketone; tetracyclic diterpenoid | antimalarial; antineoplastic agent; photosensitizing agent |
diphenyleneiodonium | [no description available] | medium | 3 | 0 | organic cation | |
deferoxamine | [no description available] | medium | 4 | 0 | acyclic desferrioxamine | bacterial metabolite; ferroptosis inhibitor; iron chelator; siderophore |
dithiothreitol | [no description available] | medium | 11 | 0 | 1,4-dimercaptobutane-2,3-diol; butanediols; dithiol; glycol; thiol | chelator; human metabolite; reducing agent |
pd 123319 | [no description available] | medium | 4 | 0 | imidazopyridine | angiotensin receptor antagonist; endothelin receptor antagonist; vasoconstrictor agent |
cgp 42112a | [no description available] | medium | 3 | 0 | benzyl ester; oligopeptide; pyridinecarboxamide | angiotensin receptor agonist; anti-inflammatory agent; antineoplastic agent; neuroprotective agent; vasodilator agent |
cyanine dye 3 | [no description available] | medium | 2 | 0 | | |
carbocyanines | [no description available] | medium | 3 | 0 | cyanine dye; organic iodide salt | fluorochrome |
3-aminotyrosine | [no description available] | medium | 1 | 0 | | |
4-nitrophenylalanine | [no description available] | medium | 1 | 0 | C-nitro compound | |
trichostatin a | [no description available] | medium | 1 | 0 | antibiotic antifungal agent; hydroxamic acid; trichostatin | bacterial metabolite; EC 3.5.1.98 (histone deacetylase) inhibitor; geroprotector |
cadaverine | [no description available] | medium | 3 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
monodansylcadaverine | [no description available] | medium | 3 | 0 | aminonaphthalene; primary amino compound; sulfonamide; tertiary amino compound | EC 2.3.2.13 (protein-glutamine gamma-glutamyltransferase) inhibitor; fluorochrome; protective agent |
concanavalin a | [no description available] | medium | 24 | 0 | | |
tacrolimus | [no description available] | medium | 7 | 0 | macrolide lactam | bacterial metabolite; immunosuppressive agent |
anthralin | [no description available] | medium | 2 | 0 | anthracenes | antipsoriatic |
latrunculin b | [no description available] | medium | 2 | 0 | cyclic hemiketal; macrolide; oxabicycloalkane; thiazolidinone | actin polymerisation inhibitor; metabolite; toxin |
thiazolidines | [no description available] | medium | 6 | 0 | thiazolidine | |
losartan | [no description available] | medium | 4 | 0 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
oxamic acid | [no description available] | medium | 1 | 0 | dicarboxylic acid monoamide | Escherichia coli metabolite |
lactic acid | [no description available] | medium | 2 | 0 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
cytochalasin b | [no description available] | medium | 14 | 0 | cytochalasin; lactam; lactone; organic heterotricyclic compound | actin polymerisation inhibitor; metabolite; mycotoxin; platelet aggregation inhibitor |
leukotriene b4 | [no description available] | medium | 5 | 0 | dihydroxy monocarboxylic acid; hydroxy polyunsaturated fatty acid; leukotriene; long-chain fatty acid | human metabolite; mouse metabolite; plant metabolite; vasoconstrictor agent |
indomethacin | [no description available] | medium | 10 | 0 | aromatic ether; indole-3-acetic acids; monochlorobenzenes; N-acylindole | analgesic; drug metabolite; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; gout suppressant; non-steroidal anti-inflammatory drug; xenobiotic metabolite; xenobiotic |
latrunculin a | [no description available] | medium | 3 | 0 | cyclic hemiketal; macrolide; oxabicycloalkane; thiazolidinone | actin polymerisation inhibitor; metabolite; toxin |
phalloidine | [no description available] | medium | 3 | 0 | homodetic cyclic peptide | |
fluorescein | [no description available] | medium | 4 | 0 | 2-benzofurans; gamma-lactone; organic heteropentacyclic compound; oxaspiro compound; polyphenol; xanthene dye | fluorescent dye; radioopaque medium |
ferroin | [no description available] | medium | 1 | 0 | | |
teriflunomide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; aromatic amide; enamide; enol; nitrile; secondary carboxamide | drug metabolite; EC 1.3.98.1 [dihydroorotate oxidase (fumarate)] inhibitor; hepatotoxic agent; non-steroidal anti-inflammatory drug; tyrosine kinase inhibitor |
pyrimidine | [no description available] | medium | 1 | 0 | diazine; pyrimidines | Daphnia magna metabolite |
leflunomide | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; isoxazoles; monocarboxylic acid amide | antineoplastic agent; antiparasitic agent; EC 1.3.98.1 [dihydroorotate oxidase (fumarate)] inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; hepatotoxic agent; immunosuppressive agent; non-steroidal anti-inflammatory drug; prodrug; pyrimidine synthesis inhibitor; tyrosine kinase inhibitor |
pd 173955 | [no description available] | medium | 1 | 0 | aryl sulfide; dichlorobenzene; methyl sulfide; pyridopyrimidine | tyrosine kinase inhibitor |
ap23464 | [no description available] | medium | 1 | 0 | | |
taurine | [no description available] | medium | 3 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
trifluoperazine | [no description available] | medium | 4 | 0 | N-alkylpiperazine; N-methylpiperazine; organofluorine compound; phenothiazines | antiemetic; calmodulin antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; phenothiazine antipsychotic drug |
picropodophyllin | [no description available] | medium | 2 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antineoplastic agent; insulin-like growth factor receptor 1 antagonist; plant metabolite; tyrosine kinase inhibitor |
butorphanol | [no description available] | medium | 1 | 0 | morphinane alkaloid | antitussive; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
midostaurin | [no description available] | medium | 2 | 1 | benzamides; gamma-lactam; indolocarbazole; organic heterooctacyclic compound | antineoplastic agent; EC 2.7.11.13 (protein kinase C) inhibitor |
singlet oxygen | [no description available] | medium | 1 | 0 | chalcogen; monoatomic oxygen; nonmetal atom | macronutrient |
methylinositol | [no description available] | medium | 1 | 1 | | |
inositol | [no description available] | medium | 4 | 1 | cyclitol; hexol | |
gamma-aminobutyric acid | [no description available] | medium | 2 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid | human metabolite; neurotransmitter; Saccharomyces cerevisiae metabolite; signalling molecule |
cytochrome c-t | [no description available] | medium | 2 | 0 | | |
theophylline | [no description available] | medium | 2 | 0 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
glucagon | [no description available] | medium | 5 | 0 | peptide hormone | |
lestaurtinib | [no description available] | medium | 1 | 0 | indolocarbazole | |
glycyl-arginyl-glycyl-aspartyl-serine | [no description available] | medium | 2 | 0 | | |
androstenedione | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
oxytocin | [no description available] | medium | 2 | 0 | heterodetic cyclic peptide; peptide hormone | oxytocic; vasodilator agent |
lucifer yellow | [no description available] | medium | 1 | 0 | organic lithium salt | fluorochrome |
diazinon | [no description available] | medium | 1 | 0 | organic thiophosphate; pyrimidines | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; nematicide; xenobiotic |
chromomycin a3 | [no description available] | medium | 1 | 0 | | |
carnitine | [no description available] | medium | 1 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
amlodipine | [no description available] | medium | 1 | 0 | dihydropyridine; ethyl ester; methyl ester; monochlorobenzenes; primary amino compound | antihypertensive agent; calcium channel blocker; vasodilator agent |
tryptophan | [no description available] | medium | 5 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
pd 166326 | [no description available] | medium | 1 | 0 | | |
morphine | [no description available] | medium | 2 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary amino compound | anaesthetic; drug allergen; environmental contaminant; geroprotector; mu-opioid receptor agonist; opioid analgesic; plant metabolite; vasodilator agent; xenobiotic |
phenethyl isothiocyanate | [no description available] | medium | 2 | 0 | isothiocyanate | antineoplastic agent; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; metabolite |
naphthalimides | [no description available] | medium | 1 | 0 | | |
alpha-methylphenylalanine | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | |
brij-58 | [no description available] | medium | 1 | 0 | | |
allylglycine | [no description available] | medium | 2 | 0 | | |
glutamine | [no description available] | medium | 5 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
hydroxyl radical | [no description available] | medium | 3 | 0 | oxygen hydride; oxygen radical; reactive oxygen species | |
cucurbitacins | [no description available] | medium | 1 | 0 | 11-oxo steroid | |
8-bromo cyclic adenosine monophosphate | [no description available] | medium | 10 | 0 | 3',5'-cyclic purine nucleotide; adenyl ribonucleotide; organobromine compound | antidepressant; protein kinase agonist |
iminodiacetic acid | [no description available] | medium | 1 | 0 | amino dicarboxylic acid; glycine derivative; non-proteinogenic alpha-amino acid | chelator |
cellulose | [no description available] | medium | 1 | 0 | glycoside | |
tn14003 | [no description available] | medium | 1 | 0 | | |
sorbic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; sorbic acid | |
heparitin sulfate | [no description available] | medium | 2 | 0 | | |
magnesium sulfate | [no description available] | medium | 1 | 0 | magnesium salt; metal sulfate; organic magnesium salt | anaesthetic; analgesic; anti-arrhythmia drug; anticonvulsant; calcium channel blocker; cardiovascular drug; fertilizer; tocolytic agent |
transferrin | [no description available] | medium | 5 | 0 | | |
4-hydroxy-5-nitrophenyl acetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid anion | |
2-nitro-5-thiocyanobenzoic acid | [no description available] | medium | 1 | 0 | | |
nitrites | [no description available] | medium | 3 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | human metabolite |
fibrin | [no description available] | medium | 3 | 0 | peptide | |
geldanamycin | [no description available] | medium | 7 | 0 | | |
pentoxifylline | [no description available] | medium | 1 | 0 | oxopurine | |
albuterol | [no description available] | medium | 1 | 0 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
pulmicort | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic acetal; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; bronchodilator agent; drug allergen |
nocodazole | [no description available] | medium | 7 | 0 | aromatic ketone; benzimidazoles; carbamate ester; thiophenes | antimitotic; antineoplastic agent; microtubule-destabilising agent; tubulin modulator |
warfarin | [no description available] | medium | 1 | 0 | benzenes; hydroxycoumarin; methyl ketone | |
rhodostomin | [no description available] | medium | 1 | 0 | | |
sulfites | [no description available] | medium | 1 | 0 | divalent inorganic anion; sulfur oxide; sulfur oxoanion | |
alkenes | [no description available] | medium | 1 | 0 | | |
staurosporine aglycone | [no description available] | medium | 10 | 0 | | |
1,2,3,4-tetrahydroisoquinoline | [no description available] | medium | 1 | 0 | isoquinolines | |
sulfamic acid | [no description available] | medium | 1 | 0 | sulfamic acids | |
bl 4162a | [no description available] | medium | 1 | 0 | imidazoquinazoline | anticoagulant; antifibrinolytic drug; cardiovascular drug; platelet aggregation inhibitor |
phenylhydrazine | [no description available] | medium | 2 | 0 | phenylhydrazines | xenobiotic |
imidazole | [no description available] | medium | 1 | 0 | imidazole | |
reboxetine | [no description available] | medium | 1 | 0 | aromatic ether | |
fluoxetine | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; aromatic ether; secondary amino compound | |
haloperidol | [no description available] | medium | 1 | 0 | aromatic ketone; hydroxypiperidine; monochlorobenzenes; organofluorine compound; tertiary alcohol | antidyskinesia agent; antiemetic; dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
dapi | [no description available] | medium | 1 | 0 | indoles | fluorochrome |
phosphoramidic acid | [no description available] | medium | 1 | 0 | phosphoric acid derivative | |
15-deoxyprostaglandin j2 | [no description available] | medium | 1 | 0 | | |
prostaglandin d2 | [no description available] | medium | 1 | 0 | prostaglandins D | human metabolite; mouse metabolite |
galactose | [no description available] | medium | 1 | 0 | | |
lewis x antigen | [no description available] | medium | 4 | 0 | | |
halothane | [no description available] | medium | 1 | 0 | haloalkane; organobromine compound; organochlorine compound; organofluorine compound | inhalation anaesthetic |
l 451167 | [no description available] | medium | 2 | 0 | | |
thymine | [no description available] | medium | 1 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
picolinic acid | [no description available] | medium | 1 | 0 | pyridinemonocarboxylic acid | human metabolite; MALDI matrix material |
tyrphostin ag 1024 | [no description available] | medium | 1 | 0 | alkylbenzene | |
bis(maltolato)oxovanadium(iv) | [no description available] | medium | 2 | 0 | | |
acetaldehyde | [no description available] | medium | 1 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
xanthenes | [no description available] | medium | 2 | 0 | xanthene | |
sd 1029 | [no description available] | medium | 1 | 0 | | |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine | [no description available] | medium | 17 | 0 | 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine | antihypertensive agent; beta-adrenergic antagonist; bronchoconstrictor agent; hematologic agent; vasodilator agent |
n,n-diisopropylethylamine | [no description available] | medium | 1 | 0 | tertiary amino compound | |
2-(1h-benzotriazol-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate | [no description available] | medium | 1 | 0 | | |
2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | medium | 1 | 0 | imidazopyridine; primary amino compound | carcinogenic agent; mutagen |
lidocaine | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid amide; tertiary amino compound | anti-arrhythmia drug; drug allergen; environmental contaminant; local anaesthetic; xenobiotic |
bupivacaine | [no description available] | medium | 1 | 0 | aromatic amide; piperidinecarboxamide; tertiary amino compound | |
ferric ammonium citrate | [no description available] | medium | 1 | 0 | | |
buthionine sulfoximine | [no description available] | medium | 3 | 0 | diastereoisomeric mixture; homocysteines; non-proteinogenic alpha-amino acid; sulfoximide | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
asbestos, crocidolite | [no description available] | medium | 2 | 0 | | |
econazole | [no description available] | medium | 2 | 0 | dichlorobenzene; ether; imidazoles; monochlorobenzenes | |
thimerosal | [no description available] | medium | 1 | 0 | alkylmercury compound | antifungal drug; antiseptic drug; disinfectant; drug allergen |
methylmercuric chloride | [no description available] | medium | 1 | 0 | chlorine molecular entity; mercury coordination entity; one-carbon compound | |
mercuric chloride | [no description available] | medium | 5 | 0 | mercury coordination entity | sensitiser |
p-chloromercuribenzoic acid | [no description available] | medium | 2 | 0 | chlorine molecular entity; mercuribenzoic acid | |
quinolinic acid | [no description available] | medium | 1 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
vasotocin | [no description available] | medium | 1 | 0 | | |
n-acetylneuraminic acid | [no description available] | medium | 2 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
n-glycolylneuraminic acid | [no description available] | medium | 1 | 0 | N-acylneuraminic acid | |
methacycline | [no description available] | medium | 2 | 0 | 1,2-diglyceride | |
ro 31-7549 | [no description available] | medium | 4 | 0 | | |
brefeldin a | [no description available] | medium | 2 | 0 | macrolide antibiotic | Penicillium metabolite |
ap20187 | [no description available] | medium | 1 | 0 | aromatic ether; carboxylic ester; N-acylpiperidine; tertiary amino compound | ligand |
aminosalicylic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; phenols | antitubercular agent |
hydrogen carbonate | [no description available] | medium | 3 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nicotine | [no description available] | medium | 2 | 0 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
3-((3-cholamidopropyl)dimethylammonium)-1-propanesulfonate | [no description available] | medium | 3 | 0 | 1,1-diunsubstituted alkanesulfonate | |
palmitic acid | [no description available] | medium | 4 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 1.1.1.189 (prostaglandin-E2 9-reductase) inhibitor; plant metabolite |
adenosine 5'-o-(3-thiotriphosphate) | [no description available] | medium | 1 | 0 | nucleoside triphosphate analogue | |
pazopanib | [no description available] | medium | 1 | 0 | aminopyrimidine; indazoles; sulfonamide | angiogenesis modulating agent; antineoplastic agent; tyrosine kinase inhibitor; vascular endothelial growth factor receptor antagonist |
protocatechualdehyde | [no description available] | medium | 1 | 0 | dihydroxybenzaldehyde | |
salvianolic acid B | [no description available] | medium | 1 | 0 | 1-benzofurans; catechols; dicarboxylic acid; enoate ester; polyphenol | anti-inflammatory agent; antidepressant; antineoplastic agent; antioxidant; apoptosis inducer; autophagy inhibitor; cardioprotective agent; hepatoprotective agent; hypoglycemic agent; neuroprotective agent; osteogenesis regulator; plant metabolite |
3,4-dihydroxyphenyllactic acid | [no description available] | medium | 1 | 0 | 2-hydroxy monocarboxylic acid; catechols | |
diacetyldichlorofluorescein | [no description available] | medium | 1 | 0 | | |
rottlerin | [no description available] | medium | 3 | 0 | aromatic ketone; benzenetriol; chromenol; enone; methyl ketone | anti-allergic agent; antihypertensive agent; antineoplastic agent; apoptosis inducer; K-ATP channel agonist; metabolite |
cediranib | [no description available] | medium | 1 | 0 | aromatic ether | |
thiophenes | [no description available] | medium | 1 | 0 | mancude organic heteromonocyclic parent; monocyclic heteroarene; thiophenes; volatile organic compound | non-polar solvent |
propranolol | [no description available] | medium | 2 | 0 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
chelerythrine | [no description available] | medium | 3 | 0 | benzophenanthridine alkaloid; organic cation | antibacterial agent; antineoplastic agent; EC 2.7.11.13 (protein kinase C) inhibitor |
nsc-87877 | [no description available] | medium | 1 | 0 | | |
trifluoroacetic acid | [no description available] | medium | 1 | 0 | fluoroalkanoic acid | human xenobiotic metabolite; NMR chemical shift reference compound; reagent |
carbodiimides | [no description available] | medium | 2 | 0 | carbodiimide | |
fumonisin b1 | [no description available] | medium | 1 | 0 | diester; fumonisin; primary amino compound; triol | carcinogenic agent; metabolite |
isoleucine | [no description available] | medium | 2 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
lewis y antigen | [no description available] | medium | 1 | 0 | | |
daidzein | [no description available] | medium | 3 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; phytoestrogen; plant metabolite |
15-hydroxy-11 alpha,9 alpha-(epoxymethano)prosta-5,13-dienoic acid | [no description available] | medium | 4 | 0 | | |
phytoestrogens | [no description available] | medium | 1 | 0 | | |
methyl methanesulfonate | [no description available] | medium | 2 | 0 | methanesulfonate ester | alkylating agent; apoptosis inducer; carcinogenic agent; genotoxin; mutagen |
reserpine | [no description available] | medium | 1 | 0 | alkaloid ester; methyl ester; yohimban alkaloid | adrenergic uptake inhibitor; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; first generation antipsychotic; plant metabolite; xenobiotic |
taurolithocholic acid | [no description available] | medium | 1 | 0 | bile acid taurine conjugate; monocarboxylic acid amide | human metabolite |
taurochenodeoxycholic acid | [no description available] | medium | 1 | 0 | bile acid taurine conjugate | human metabolite; mouse metabolite |
taurolithocholic acid 3-sulfate | [no description available] | medium | 1 | 0 | steroid sulfate oxoanion | human metabolite |
ursodoxicoltaurine | [no description available] | medium | 1 | 0 | bile acid taurine conjugate | anti-inflammatory agent; apoptosis inhibitor; bone density conservation agent; cardioprotective agent; human metabolite; neuroprotective agent |
silicon | [no description available] | medium | 1 | 0 | carbon group element atom; metalloid atom; nonmetal atom | |
davallialactone | [no description available] | medium | 1 | 0 | | |
valine | [no description available] | medium | 3 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
4-(5-benzo(1,3)dioxol-5-yl-4-pyridin-2-yl-1h-imidazol-2-yl)benzamide | [no description available] | medium | 1 | 0 | benzamides; benzodioxoles; imidazoles; pyridines | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor |
ceruletide | [no description available] | medium | 1 | 0 | oligopeptide | diagnostic agent; gastrointestinal drug |
mercury | [no description available] | medium | 2 | 0 | elemental mercury; zinc group element atom | neurotoxin |
dihydrotestosterone | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; 17beta-hydroxyandrostan-3-one; 3-oxo-5alpha-steroid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
manganese | [no description available] | medium | 23 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
phorbols | [no description available] | medium | 7 | 0 | diterpene; terpenoid fundamental parent | |
cytidine monophosphate | [no description available] | medium | 2 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine monophosphate | [no description available] | medium | 2 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
thymidine monophosphate | [no description available] | medium | 1 | 0 | thymidine 5'-monophosphate | fundamental metabolite |
glutathione disulfide | [no description available] | medium | 1 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
p-azobenzenearsonate | [no description available] | medium | 1 | 0 | | |
vanadium | [no description available] | medium | 17 | 0 | elemental vanadium; vanadium group element atom | micronutrient |
perylene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene; perylenes | |
hypericin | [no description available] | medium | 1 | 0 | | |
azides | [no description available] | medium | 5 | 0 | pseudohalide anion | mitochondrial respiratory-chain inhibitor |
herbimycin | [no description available] | medium | 86 | 0 | 1,4-benzoquinones; lactam; macrocycle | antimicrobial agent; apoptosis inducer; herbicide; Hsp90 inhibitor; tyrosine kinase inhibitor |
cyanogen bromide | [no description available] | medium | 4 | 0 | | |
phenobarbital | [no description available] | medium | 1 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
sodium azide | [no description available] | medium | 3 | 0 | inorganic sodium salt | antibacterial agent; explosive; mitochondrial respiratory-chain inhibitor; mutagen |
guanylyl imidodiphosphate | [no description available] | medium | 4 | 0 | nucleoside triphosphate analogue | |
ag-213 | [no description available] | medium | 31 | 0 | | |
muramidase | [no description available] | medium | 8 | 0 | | |
tyrphostin ag 1112 | [no description available] | medium | 1 | 0 | | |
ha 1004 | [no description available] | medium | 2 | 0 | isoquinolines | |
guanosine 5'-o-(2-thiodiphosphate) | [no description available] | medium | 2 | 0 | nucleoside diphosphate analogue | |
guanosine diphosphate | [no description available] | medium | 13 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
masoprocol | [no description available] | medium | 2 | 0 | nordihydroguaiaretic acid | antineoplastic agent; hypoglycemic agent; lipoxygenase inhibitor; metabolite |
fisetin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavonoid; 7-hydroxyflavonol; tetrahydroxyflavone | anti-inflammatory agent; antioxidant; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; metabolite; plant metabolite |
quercetin | [no description available] | medium | 8 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | antibacterial agent; antineoplastic agent; antioxidant; Aurora kinase inhibitor; chelator; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; geroprotector; phytoestrogen; plant metabolite; protein kinase inhibitor; radical scavenger |
3-hydroxyflavone | [no description available] | medium | 1 | 0 | flavonols; monohydroxyflavone | |
sodium fluoride | [no description available] | medium | 6 | 0 | fluoride salt | mutagen |
troglitazone | [no description available] | medium | 2 | 0 | chromanes; thiazolidinone | anticoagulant; anticonvulsant; antineoplastic agent; antioxidant; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; hypoglycemic agent; platelet aggregation inhibitor; vasodilator agent |
3-o-methylglucose | [no description available] | medium | 8 | 0 | D-aldohexose derivative | |
hexamethylene bisacetamide | [no description available] | medium | 3 | 0 | acetamides | |
suramin | [no description available] | medium | 14 | 0 | naphthalenesulfonic acid; phenylureas; secondary carboxamide | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
dizocilpine maleate | [no description available] | medium | 3 | 0 | maleate salt; tetracyclic antidepressant | anaesthetic; anticonvulsant; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist |
bicuculline | [no description available] | medium | 2 | 0 | benzylisoquinoline alkaloid; isoquinoline alkaloid; isoquinolines | agrochemical; central nervous system stimulant; GABA-gated chloride channel antagonist; GABAA receptor antagonist; neurotoxin |
st 638 | [no description available] | medium | 6 | 0 | | |
fura-2 | [no description available] | medium | 5 | 0 | | |
s-allylcysteine | [no description available] | medium | 1 | 0 | L-alpha-amino acid zwitterion; S-hydrocarbyl-L-cysteine | antineoplastic agent; metabolite |
s-allylmercaptocysteine | [no description available] | medium | 1 | 0 | | |
phorbol-12,13-didecanoate | [no description available] | medium | 1 | 0 | | |
thrombin receptor peptide sfllrnp | [no description available] | medium | 1 | 0 | | |
thrombin receptor peptide (42-55) | [no description available] | medium | 2 | 0 | | |
ryanodine | [no description available] | medium | 1 | 0 | | |
erbstatin | [no description available] | medium | 10 | 0 | | |
lavendustin a | [no description available] | medium | 11 | 0 | aromatic amine | |
indo-1 | [no description available] | medium | 1 | 0 | indoles | fluorochrome |
aluminum fluoride | [no description available] | medium | 3 | 0 | aluminium coordination entity | |
thromboxane a2 | [no description available] | medium | 8 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
alprostadil | [no description available] | medium | 4 | 0 | prostaglandins E | anticoagulant; human metabolite; platelet aggregation inhibitor; vasodilator agent |
sq 30741 | [no description available] | medium | 1 | 0 | | |
apyrase | [no description available] | medium | 1 | 0 | | |
phosphatidylethanol | [no description available] | medium | 5 | 0 | | |
brimonidine tartrate | [no description available] | medium | 2 | 0 | | |
indo-1 pentaacetoxymethyl ester | [no description available] | medium | 1 | 0 | | |
4-chloromercuribenzenesulfonate | [no description available] | medium | 1 | 0 | arenesulfonic acid; arylmercury compound | |
uric acid | [no description available] | medium | 6 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
tyrphostin a23 | [no description available] | medium | 9 | 0 | catechols | |
dimethyl sulfoxide | [no description available] | medium | 9 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
tiazofurin | [no description available] | medium | 1 | 0 | 1,3-thiazoles; C-glycosyl compound; monocarboxylic acid amide | antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; prodrug |
ribavirin | [no description available] | medium | 1 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide | anticoronaviral agent; antiinfective agent; antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
lipid a | [no description available] | medium | 5 | 0 | dodecanoate ester; lipid A; tetradecanoate ester | Escherichia coli metabolite |
ethylmaleimide | [no description available] | medium | 9 | 0 | maleimides | anticoronaviral agent; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.1.1 (hexokinase) inhibitor |
lovastatin | [no description available] | medium | 3 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | anticholesteremic drug; antineoplastic agent; Aspergillus metabolite; prodrug |
kaempferol | [no description available] | medium | 2 | 0 | 7-hydroxyflavonol; flavonols; tetrahydroxyflavone | antibacterial agent; geroprotector; human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; plant metabolite |
adenosine diphosphate ribose | [no description available] | medium | 6 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
pioglitazone | [no description available] | medium | 4 | 0 | aromatic ether; pyridines; thiazolidinediones | antidepressant; cardioprotective agent; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; geroprotector; hypoglycemic agent; insulin-sensitizing drug; PPARgamma agonist; xenobiotic |
ucn 1028 c | [no description available] | medium | 12 | 0 | | |
tyrphostin 25 | [no description available] | medium | 11 | 0 | benzenetriol | |
phorbol 12,13-dibutyrate | [no description available] | medium | 17 | 0 | butyrate ester; phorbol ester; tertiary alpha-hydroxy ketone | |
paclitaxel | [no description available] | medium | 3 | 0 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
mastoparan | [no description available] | medium | 1 | 0 | mastoparans; peptidyl amide | antimicrobial agent |
exp3174 | [no description available] | medium | 1 | 0 | biphenylyltetrazole; imidazoles; organochlorine compound | metabolite |
choline | [no description available] | medium | 1 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
methylene blue | [no description available] | medium | 1 | 0 | organic chloride salt | acid-base indicator; antidepressant; antimalarial; antimicrobial agent; antioxidant; cardioprotective agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 4.6.1.2 (guanylate cyclase) inhibitor; fluorochrome; histological dye; neuroprotective agent; physical tracer |
s-nitroso-n-acetylpenicillamine | [no description available] | medium | 2 | 0 | nitroso compound; nitrosothio compound | nitric oxide donor; vasodilator agent |
dimercaprol | [no description available] | medium | 2 | 0 | dithiol; primary alcohol | chelator |
cholecalciferol | [no description available] | medium | 3 | 0 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol; steroid hormone | geroprotector; human metabolite |
metribolone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo steroid; anabolic androgenic steroid | androgen |
3,3'-dithiobis(sulfosuccinimidyl propionate) | [no description available] | medium | 1 | 0 | | |
1-butanol | [no description available] | medium | 3 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
phosphatidylbutanol | [no description available] | medium | 2 | 0 | | |
pituitrin | [no description available] | medium | 6 | 0 | | |
miconazole | [no description available] | medium | 1 | 0 | dichlorobenzene; ether; imidazoles | |
3,3'-dipropyl-2,2'-thiadicarbocyanine | [no description available] | medium | 1 | 0 | | |
acetone | [no description available] | medium | 1 | 0 | ketone body; methyl ketone; propanones; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; human metabolite; polar aprotic solvent |
8-azidoadenosine 5'-triphosphate | [no description available] | medium | 1 | 0 | | |
raffinose | [no description available] | medium | 1 | 0 | raffinose family oligosaccharide; trisaccharide | mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2-aminoisobutyric acid | [no description available] | medium | 1 | 0 | 2,2-dialkylglycine zwitterion; 2,2-dialkylglycine | |
methylprednisolone | [no description available] | medium | 1 | 0 | 6-methylprednisolone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antiemetic; environmental contaminant; neuroprotective agent; xenobiotic |
du-21220 | [no description available] | medium | 1 | 0 | benzyl alcohols; polyphenol; secondary alcohol; secondary amino compound | |
ristocetin | [no description available] | medium | 1 | 0 | glycopeptide; heterodetic cyclic peptide; macrocycle; tetrasaccharide derivative | antibacterial drug; antimicrobial agent; bacterial metabolite; platelet-activating factor receptor agonist |
linoleic acid | [no description available] | medium | 1 | 0 | octadecadienoic acid; omega-6 fatty acid | algal metabolite; Daphnia galeata metabolite; plant metabolite |
13-hydroxy-9,11-octadecadienoic acid | [no description available] | medium | 1 | 0 | octadecadienoic acid | |
aluminum chloride | [no description available] | medium | 2 | 0 | aluminium coordination entity | Lewis acid |
1,2-dimethylhydrazine | [no description available] | medium | 1 | 0 | hydrazines | alkylating agent; carcinogenic agent |
dimethylhydrazines | [no description available] | medium | 1 | 0 | | |
mercaptoethanol | [no description available] | medium | 3 | 0 | alkanethiol; primary alcohol | geroprotector |
durapatite | [no description available] | medium | 2 | 0 | | |
bw-755c | [no description available] | medium | 1 | 0 | | |
4-n,n-dimethylaminoazobenzene-4'-sulfonyl chloride | [no description available] | medium | 3 | 0 | | |
p-dimethylaminoazobenzene | [no description available] | medium | 3 | 0 | azobenzenes | |
aspirin | [no description available] | medium | 9 | 0 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
azoxymethane | [no description available] | medium | 1 | 0 | | |
phosphoric acid, trisodium salt | [no description available] | medium | 1 | 0 | sodium phosphate | |
vesnarinone | [no description available] | medium | 1 | 0 | organic molecular entity | |
pyrazines | [no description available] | medium | 1 | 0 | diazine; pyrazines | Daphnia magna metabolite |
amiloride | [no description available] | medium | 5 | 0 | aromatic amine; guanidines; organochlorine compound; pyrazines | diuretic; sodium channel blocker |
emodin | [no description available] | medium | 3 | 0 | trihydroxyanthraquinone | antineoplastic agent; laxative; plant metabolite; tyrosine kinase inhibitor |
2,2'-azobis(2-amidinopropane) | [no description available] | medium | 1 | 0 | monoazo compound | |
tyrphostin a9 | [no description available] | medium | 1 | 0 | alkylbenzene | geroprotector |
5'-methylthioadenosine | [no description available] | medium | 1 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
tautomycin | [no description available] | medium | 2 | 0 | | |
flecainide | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid amide; organofluorine compound; piperidines | anti-arrhythmia drug |
eflornithine | [no description available] | medium | 4 | 0 | alpha-amino acid; fluoroamino acid | trypanocidal drug |
8-bromocyclic gmp | [no description available] | medium | 5 | 0 | 3',5'-cyclic purine nucleotide; organobromine compound | muscle relaxant; protein kinase G agonist |
calcium pyrophosphate | [no description available] | medium | 2 | 0 | calcium phosphate | |
methyl 2,5-dihydroxycinnamate | [no description available] | medium | 4 | 0 | cinnamate ester; hydroquinones; methyl ester | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; geroprotector; human urinary metabolite; plant metabolite |
sphingosine phosphorylcholine | [no description available] | medium | 1 | 0 | | |
muscimol | [no description available] | medium | 1 | 0 | alkaloid; isoxazoles; primary amino compound | fungal metabolite; GABA agonist; oneirogen; psychotropic drug |
bay-k-8644 | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; C-nitro compound; dihydropyridine; methyl ester | |
atrial natriuretic factor | [no description available] | medium | 2 | 0 | polypeptide | |
maitotoxin | [no description available] | medium | 1 | 0 | | |
lipid x | [no description available] | medium | 1 | 0 | N-acyl-D-glucosamine 1-phosphate | Escherichia coli metabolite |
sdz mrl 953 | [no description available] | medium | 1 | 0 | | |
sdz 880-431 | [no description available] | medium | 1 | 0 | | |
7-hydroxystaurosporine | [no description available] | medium | 1 | 0 | | |
aluminum | [no description available] | medium | 6 | 0 | boron group element atom; elemental aluminium; metal atom | |
1,2-dielaidoylphosphatidylethanolamine | [no description available] | medium | 1 | 0 | | |
ag-879 | [no description available] | medium | 1 | 0 | | |
gastrin-releasing peptide | [no description available] | medium | 3 | 0 | | |
barium | [no description available] | medium | 1 | 0 | alkaline earth metal atom; elemental barium | |
cortisone | [no description available] | medium | 1 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
retinol | [no description available] | medium | 3 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
trichloroacetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
pindolol | [no description available] | medium | 1 | 0 | indoles; secondary amine | antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; serotonergic antagonist; vasodilator agent |
sta 2 | [no description available] | medium | 1 | 0 | | |
guanine | [no description available] | medium | 1 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
queuine | [no description available] | medium | 1 | 0 | pyrrolopyrimidine | Escherichia coli metabolite |
ethyl methanesulfonate | [no description available] | medium | 1 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; genotoxin; mutagen; teratogenic agent |
rubidium | [no description available] | medium | 1 | 0 | alkali metal atom | |
iodine | [no description available] | medium | 2 | 0 | halide anion; monoatomic iodine | human metabolite |
phosphocreatine | [no description available] | medium | 1 | 0 | phosphagen; phosphoamino acid | human metabolite; mouse metabolite |
phosphoenolpyruvate | [no description available] | medium | 2 | 0 | carboxyalkyl phosphate; monocarboxylic acid | fundamental metabolite |
phenylphosphate | [no description available] | medium | 5 | 0 | aryl phosphate | mouse metabolite |
dimethylformamide | [no description available] | medium | 1 | 0 | formamides; volatile organic compound | geroprotector; hepatotoxic agent; polar aprotic solvent |
methylene chloride | [no description available] | medium | 1 | 0 | chloromethanes; volatile organic compound | carcinogenic agent; polar aprotic solvent; refrigerant |
phenylbutazone | [no description available] | medium | 1 | 0 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
demecolcine | [no description available] | medium | 1 | 0 | alkaloid; secondary amino compound | antineoplastic agent; microtubule-destabilising agent |
8-((4-chlorophenyl)thio)cyclic-3',5'-amp | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; adenyl ribonucleotide; aryl sulfide; organochlorine compound | protein kinase agonist |
gamma-linolenic acid | [no description available] | medium | 2 | 0 | linolenic acid; omega-6 fatty acid | human metabolite; mouse metabolite; plant metabolite |
8-chloro-cyclic adenosine monophosphate | [no description available] | medium | 1 | 0 | | |
ag 30 | [no description available] | medium | 1 | 0 | | |
diiodotyrosine | [no description available] | medium | 1 | 0 | diiodotyrosine; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite |
dityrosine | [no description available] | medium | 4 | 0 | biphenyls; non-proteinogenic alpha-amino acid; tyrosine derivative | biomarker |
monoiodotyrosine | [no description available] | medium | 1 | 0 | amino acid zwitterion; L-tyrosine derivative; monoiodotyrosine; non-proteinogenic L-alpha-amino acid | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; human metabolite; mouse metabolite |
adrenomedullin | [no description available] | medium | 1 | 0 | | |
asparagine | [no description available] | medium | 2 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
diethylstilbestrol | [no description available] | medium | 1 | 0 | olefinic compound; polyphenol | antifungal agent; antineoplastic agent; autophagy inducer; calcium channel blocker; carcinogenic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; endocrine disruptor; xenoestrogen |
rg 13022 | [no description available] | medium | 1 | 0 | | |
nitrates | [no description available] | medium | 6 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | |
arginine vasopressin | [no description available] | medium | 5 | 0 | vasopressin | cardiovascular drug; hematologic agent; mitogen |
guanosine 5'-o-(3-thiotriphosphate) | [no description available] | medium | 11 | 0 | nucleoside triphosphate analogue | |
rges peptide | [no description available] | medium | 1 | 0 | | |
fura-2-am | [no description available] | medium | 1 | 0 | | |
zinc chloride | [no description available] | medium | 3 | 0 | inorganic chloride; zinc molecular entity | astringent; disinfectant; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; Lewis acid |
molybdenum | [no description available] | medium | 3 | 0 | chromium group element atom | micronutrient |
molybdate ion | [no description available] | medium | 3 | 0 | divalent inorganic anion; molybdenum oxoanion | Escherichia coli metabolite |
tetramisole | [no description available] | medium | 1 | 0 | imidazothiazole | environmental contaminant; xenobiotic |
omega-n-methylarginine | [no description available] | medium | 2 | 0 | amino acid zwitterion; arginine derivative; guanidines; L-arginine derivative; non-proteinogenic L-alpha-amino acid | |
tetrafluoroaluminate | [no description available] | medium | 2 | 0 | | |
sodium salicylate | [no description available] | medium | 1 | 0 | organic molecular entity | |
butyric acid | [no description available] | medium | 5 | 0 | fatty acid 4:0; straight-chain saturated fatty acid | human urinary metabolite; Mycoplasma genitalium metabolite |
camphor, (+-)-isomer | [no description available] | medium | 1 | 0 | bornane monoterpenoid; cyclic monoterpene ketone | plant metabolite |
isosorbide dinitrate | [no description available] | medium | 1 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
potassium cyanide | [no description available] | medium | 1 | 0 | cyanide salt; one-carbon compound; potassium salt | EC 1.15.1.1 (superoxide dismutase) inhibitor; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; neurotoxin |
4-aminopyridine | [no description available] | medium | 1 | 0 | aminopyridine; aromatic amine | avicide; orphan drug; potassium channel blocker |
inositol-1,3,4,5-tetrakisphosphate | [no description available] | medium | 1 | 0 | inositol phosphate | |
mifepristone | [no description available] | medium | 2 | 0 | 3-oxo-Delta(4) steroid; acetylenic compound; tertiary amino compound | abortifacient; contraceptive drug; hormone antagonist; synthetic oral contraceptive |
cytochalasin e | [no description available] | medium | 2 | 0 | cytochalasan alkaloid | metabolite |
jasplakinolide | [no description available] | medium | 3 | 0 | cyclodepsipeptide; phenols | actin polymerisation inducer; animal metabolite; antifungal agent; antineoplastic agent; apoptosis inducer; marine metabolite; neuroprotective agent |
imipramine | [no description available] | medium | 2 | 0 | dibenzoazepine | adrenergic uptake inhibitor; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
icatibant | [no description available] | medium | 1 | 0 | | |
2-methylthio-atp | [no description available] | medium | 1 | 0 | | |
6-ketoprostaglandin f1 alpha | [no description available] | medium | 2 | 0 | prostaglandins Falpha | human metabolite; mouse metabolite |
methanol | [no description available] | medium | 2 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
trehalose | [no description available] | medium | 1 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uranyl acetate | [no description available] | medium | 1 | 0 | | |
phosphoryl chloride | [no description available] | medium | 1 | 0 | phosphorus coordination entity | |
calpeptin | [no description available] | medium | 2 | 0 | amino acid amide | |
substance p, phe(5)-trp(7,9)-leu(11)- | [no description available] | medium | 1 | 0 | | |
neurotensin | [no description available] | medium | 1 | 0 | peptide hormone | human metabolite; mitogen; neurotransmitter; vulnerary |
geranylgeraniol | [no description available] | medium | 2 | 0 | geranylgeraniol | |
flag peptide | [no description available] | medium | 2 | 0 | peptide | |
tosylphenylalanyl chloromethyl ketone | [no description available] | medium | 1 | 0 | alpha-chloroketone; sulfonamide | alkylating agent; serine proteinase inhibitor |
pyruvic acid | [no description available] | medium | 1 | 0 | 2-oxo monocarboxylic acid | cofactor; fundamental metabolite |
e-z cinnamic acid | [no description available] | medium | 1 | 0 | cinnamic acid | plant metabolite |
monorden | [no description available] | medium | 2 | 0 | cyclic ketone; enone; epoxide; macrolide antibiotic; monochlorobenzenes; phenols | antifungal agent; metabolite; tyrosine kinase inhibitor |
farnesol | [no description available] | medium | 2 | 0 | farnesol | plant metabolite |
fti 277 | [no description available] | medium | 1 | 0 | | |
spermine | [no description available] | medium | 1 | 0 | polyazaalkane; tetramine | antioxidant; fundamental metabolite; immunosuppressive agent |
spermidine | [no description available] | medium | 2 | 0 | polyazaalkane; triamine | autophagy inducer; fundamental metabolite; geroprotector |
formaldehyde | [no description available] | medium | 1 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
quinine | [no description available] | medium | 1 | 0 | cinchona alkaloid | antimalarial; muscle relaxant; non-narcotic analgesic |
charybdotoxin | [no description available] | medium | 1 | 0 | | |
alpha-Neup5Ac-(2->3)-beta-D-Galp-(1->4)-[alpha-L-Fucp-(1->3)]-D-GlcpNAc | [no description available] | medium | 2 | 0 | amino tetrasaccharide; glucosamine oligosaccharide | epitope |
bepafant | [no description available] | medium | 2 | 0 | | |
aurintricarboxylic acid | [no description available] | medium | 2 | 0 | monohydroxybenzoic acid; quinomethanes; tricarboxylic acid | fluorochrome; histological dye; insulin-like growth factor receptor 1 antagonist |
s-(2,4-dinitrophenyl)glutathione | [no description available] | medium | 1 | 0 | glutathione conjugate | |
naphthyl glucuronide | [no description available] | medium | 1 | 0 | | |
u 73343 | [no description available] | medium | 1 | 0 | | |
cyc 202 | [no description available] | medium | 2 | 0 | 2,6-diaminopurines | antiviral drug; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
olomoucine | [no description available] | medium | 2 | 0 | 2,6-diaminopurines; ethanolamines | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
kinetin | [no description available] | medium | 2 | 0 | 6-aminopurines; furans | cytokinin; geroprotector |
peroxynitric acid | [no description available] | medium | 5 | 0 | nitrogen oxoacid | |
calyculin a | [no description available] | medium | 6 | 0 | | |
oxazoles | [no description available] | medium | 6 | 0 | 1,3-oxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
selenium | [no description available] | medium | 1 | 0 | chalcogen; nonmetal atom | micronutrient |
amyloid beta-peptides | [no description available] | medium | 1 | 0 | | |
ddt | [no description available] | medium | 1 | 0 | benzenoid aromatic compound; chlorophenylethane; monochlorobenzenes; organochlorine insecticide | bridged diphenyl acaricide; carcinogenic agent; endocrine disruptor; persistent organic pollutant |
diamide | [no description available] | medium | 5 | 0 | 1,1'-azobis(N,N-dimethylformamide) | |
dinoprost | [no description available] | medium | 2 | 0 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
s-ethylcysteine | [no description available] | medium | 1 | 0 | S-alkyl-L-cysteine zwitterion; S-alkyl-L-cysteine | antitubercular agent |
allopurinol | [no description available] | medium | 3 | 0 | nucleobase analogue; organic heterobicyclic compound | antimetabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor; gout suppressant; radical scavenger |
xanthine | [no description available] | medium | 2 | 0 | xanthine | Saccharomyces cerevisiae metabolite |
sodium propionate | [no description available] | medium | 1 | 0 | organic sodium salt | antifungal drug; food preservative |
propionic acid | [no description available] | medium | 2 | 0 | saturated fatty acid; short-chain fatty acid | antifungal drug |
beta-endorphin | [no description available] | medium | 1 | 0 | | |
su 4984 | [no description available] | medium | 1 | 0 | | |
tiludronic acid | [no description available] | medium | 1 | 0 | organochlorine compound | |
microcystin | [no description available] | medium | 1 | 0 | peptide | |
digitonin | [no description available] | medium | 4 | 0 | | |
corticosterone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
beta-naphthyl phosphate | [no description available] | medium | 1 | 0 | aryl phosphate | chromogenic compound |
guanosine | [no description available] | medium | 1 | 0 | guanosines; purines D-ribonucleoside | fundamental metabolite |
flavin mononucleotide | [no description available] | medium | 1 | 0 | | |
pyridoxal phosphate | [no description available] | medium | 1 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
folic acid | [no description available] | medium | 2 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
rx 821002 | [no description available] | medium | 1 | 0 | benzodioxine; cyclic ketal; imidazolines | alpha-adrenergic antagonist |
idazoxan | [no description available] | medium | 1 | 0 | benzodioxine; imidazolines | alpha-adrenergic antagonist |
bryostatin 1 | [no description available] | medium | 1 | 0 | | |
arachidonyltrifluoromethane | [no description available] | medium | 2 | 0 | fatty acid derivative; ketone; olefinic compound; organofluorine compound | EC 3.1.1.4 (phospholipase A2) inhibitor |
sq 29548 | [no description available] | medium | 1 | 0 | | |
echistatin | [no description available] | medium | 3 | 0 | | |
5-chloro-2-methyl-4-isothiazolin-3-one | [no description available] | medium | 1 | 0 | 1,2-thiazoles; organochlorine compound | antimicrobial agent; environmental contaminant; xenobiotic |
foscarnet | [no description available] | medium | 1 | 0 | carboxylic acid; one-carbon compound; phosphonic acids | antiviral drug; geroprotector; HIV-1 reverse transcriptase inhibitor; sodium-dependent Pi-transporter inhibitor |
catechin | [no description available] | medium | 3 | 0 | catechin | antioxidant; plant metabolite |
epigallocatechin gallate | [no description available] | medium | 3 | 0 | flavans; gallate ester; polyphenol | antineoplastic agent; antioxidant; apoptosis inducer; geroprotector; Hsp90 inhibitor; neuroprotective agent; plant metabolite |
xylose | [no description available] | medium | 1 | 0 | D-xylose | |
ly 311727 | [no description available] | medium | 1 | 0 | | |
bumetanide | [no description available] | medium | 1 | 0 | amino acid; benzoic acids; sulfonamide | diuretic; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor |
chondroitin sulfates | [no description available] | medium | 1 | 0 | | |
glycyl-arginyl-glycyl-aspartyl-seryl-proline | [no description available] | medium | 1 | 0 | | |
methylnitronitrosoguanidine | [no description available] | medium | 1 | 0 | nitroso compound | alkylating agent |
enkephalin, methionine | [no description available] | medium | 1 | 0 | | |
sb 203580 | [no description available] | medium | 11 | 0 | imidazoles; monofluorobenzenes; pyridines; sulfoxide | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; geroprotector; Hsp90 inhibitor; neuroprotective agent |
flurazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; monofluorobenzenes; organochlorine compound; tertiary amino compound | anticonvulsant; anxiolytic drug; GABAA receptor agonist; sedative |
loxtidine | [no description available] | medium | 1 | 0 | aromatic ether; piperidines; primary alcohol; triazoles | H2-receptor antagonist |
vasoactive intestinal peptide | [no description available] | medium | 1 | 0 | | |
pyrophosphate | [no description available] | medium | 2 | 0 | diphosphate ion | |
4-nitrophenol | [no description available] | medium | 1 | 0 | 4-nitrophenols | human xenobiotic metabolite; mouse metabolite |
n-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide | [no description available] | medium | 1 | 0 | aromatic ether; C-nitro compound; sulfonamide | antineoplastic agent; cyclooxygenase 2 inhibitor |
dibutyryl cyclic gmp | [no description available] | medium | 1 | 0 | | |
ethacrynic acid | [no description available] | medium | 1 | 0 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid | EC 2.5.1.18 (glutathione transferase) inhibitor; ion transport inhibitor; loop diuretic |
ammonium chloride | [no description available] | medium | 1 | 0 | ammonium salt; inorganic chloride | ferroptosis inhibitor |
methylamine | [no description available] | medium | 3 | 0 | methylamines; one-carbon compound; primary aliphatic amine | mouse metabolite |
4,4'-diisothiocyanostilbene-2,2'-disulfonic acid | [no description available] | medium | 2 | 0 | | |
dihydro-dids | [no description available] | medium | 1 | 0 | | |
ag 127 | [no description available] | medium | 3 | 0 | | |
englitazone | [no description available] | medium | 1 | 0 | | |
galactocerebroside | [no description available] | medium | 1 | 0 | | |
gentamicin | [no description available] | medium | 1 | 0 | | |
galactosyl-(1-3)galactose | [no description available] | medium | 1 | 0 | O-acyl carbohydrate | |
vitamin k semiquinone radical | [no description available] | medium | 2 | 0 | | |
dinitrofluorobenzene | [no description available] | medium | 2 | 0 | C-nitro compound; organofluorine compound | agrochemical; allergen; chromatographic reagent; EC 2.7.3.2 (creatine kinase) inhibitor; protein-sequencing agent; spectrophotometric reagent |
lactoferrin | [no description available] | medium | 1 | 0 | | |
lysophosphatidylinositol | [no description available] | medium | 1 | 0 | | |
resveratrol | [no description available] | medium | 1 | 0 | resveratrol | antioxidant; phytoalexin; plant metabolite; quorum sensing inhibitor; radical scavenger |
isopropyl thiogalactoside | [no description available] | medium | 1 | 0 | S-glycosyl compound | |
atropine | [no description available] | medium | 1 | 0 | | |
nigericin | [no description available] | medium | 1 | 0 | polycyclic ether | antibacterial agent; antimicrobial agent; bacterial metabolite; potassium ionophore |
gallocatechol | [no description available] | medium | 1 | 0 | gallocatechin | antioxidant; metabolite; radical scavenger |
epicatechin gallate | [no description available] | medium | 1 | 0 | catechin; gallate ester; polyphenol | EC 3.2.1.1 (alpha-amylase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
fluo-3 | [no description available] | medium | 1 | 0 | xanthene dye | fluorochrome |
2,4-dinitrophenol | [no description available] | medium | 3 | 0 | dinitrophenol | allergen; antiseptic drug; bacterial xenobiotic metabolite; geroprotector; oxidative phosphorylation inhibitor |
cyclopentane | [no description available] | medium | 1 | 0 | cycloalkane; cyclopentanes; volatile organic compound | non-polar solvent |
glucosamine | [no description available] | medium | 4 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
inosine | [no description available] | medium | 1 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
metrizoate | [no description available] | medium | 1 | 0 | monocarboxylic acid | radioopaque medium |
2-hydroxy-5-(2,5-dihydrobenzyl)aminobenzoic acid | [no description available] | medium | 1 | 0 | aromatic amine | |
promegestone | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid | antineoplastic agent; progesterone receptor agonist; progestin |
1-ethyl-3-(3-dimethylaminoethyl)carbodiimide | [no description available] | medium | 1 | 0 | | |
glycerol | [no description available] | medium | 1 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
5-iodoacetamidofluorescein | [no description available] | medium | 1 | 0 | | |
(3,4-dihydroxyphenylamino)-2-imidazoline | [no description available] | medium | 1 | 0 | | |
hypoxanthine | [no description available] | medium | 1 | 0 | nucleobase analogue; oxopurine; purine nucleobase | fundamental metabolite |
gadolinium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
afimoxifene | [no description available] | medium | 1 | 0 | phenols; tertiary amino compound | antineoplastic agent; estrogen receptor antagonist; metabolite |
beta-escin | [no description available] | medium | 1 | 0 | | |
diacetyl | [no description available] | medium | 1 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
diacetylmonoxime | [no description available] | medium | 1 | 0 | | |
ml 7 | [no description available] | medium | 1 | 0 | N-sulfonyldiazepane; organoiodine compound | EC 2.7.11.18 (myosin-light-chain kinase) inhibitor |
isotretinoin | [no description available] | medium | 1 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; teratogenic agent |
picryl chloride | [no description available] | medium | 1 | 0 | C-nitro compound; monochlorobenzenes | allergen; epitope; explosive; hapten |
pravastatin | [no description available] | medium | 1 | 0 | 3-hydroxy carboxylic acid; carbobicyclic compound; carboxylic ester; hydroxy monocarboxylic acid; secondary alcohol; statin (semi-synthetic) | anticholesteremic drug; environmental contaminant; metabolite; xenobiotic |
mevalonic acid | [no description available] | medium | 1 | 0 | 3,5-dihydroxy-3-methylpentanoic acid | |
jtt 501 | [no description available] | medium | 1 | 0 | | |
thyroxine | [no description available] | medium | 1 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
ag 183 | [no description available] | medium | 1 | 0 | | |
p-methoxy-n-methylphenethylamine | [no description available] | medium | 1 | 0 | aromatic ether; secondary amino compound | metabolite |
c.i. fluorescent brightening agent 28 | [no description available] | medium | 1 | 0 | | |
web 2086 | [no description available] | medium | 1 | 0 | organonitrogen heterocyclic compound; organosulfur heterocyclic compound | |
camptothecin | [no description available] | medium | 2 | 0 | delta-lactone; pyranoindolizinoquinoline; quinoline alkaloid; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; genotoxin; plant metabolite |
1,10-phenanthroline | [no description available] | medium | 1 | 0 | phenanthroline | EC 2.7.1.1 (hexokinase) inhibitor; EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor |
12-hydroxy-5,8,10,14-eicosatetraenoic acid | [no description available] | medium | 1 | 0 | | |
guanosine tetraphosphate | [no description available] | medium | 1 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
streptomycin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; antibiotic fungicide; streptomycins | antibacterial drug; antifungal agrochemical; antimicrobial agent; antimicrobial drug; bacterial metabolite; protein synthesis inhibitor |
a-factor (streptomyces) | [no description available] | medium | 1 | 0 | butan-4-olide; primary alcohol | metabolite |
sodium bicarbonate | [no description available] | medium | 2 | 0 | one-carbon compound; organic sodium salt | antacid; food anticaking agent |
4-acetamido-4'-isothiocyanatostilbene-2,2'-disulfonic acid | [no description available] | medium | 1 | 0 | stilbenoid | |
ninhydrin | [no description available] | medium | 1 | 0 | aromatic ketone; beta-diketone; indanones; ketone hydrate | colour indicator; human metabolite |
ro 31-9790 | [no description available] | medium | 1 | 0 | | |
9,10-dimethyl-1,2-benzanthracene | [no description available] | medium | 1 | 0 | ortho-fused polycyclic arene; tetraphenes | carcinogenic agent |
7-nitroindazole | [no description available] | medium | 1 | 0 | | |
strontium | [no description available] | medium | 1 | 0 | alkaline earth metal atom | |
evans blue | [no description available] | medium | 1 | 0 | organic sodium salt | fluorochrome; histological dye; sodium channel blocker; teratogenic agent |
eicosapentaenoic acid | [no description available] | medium | 1 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
leupeptin | [no description available] | medium | 1 | 0 | aldehyde; tripeptide | bacterial metabolite; calpain inhibitor; cathepsin B inhibitor; EC 3.4.21.4 (trypsin) inhibitor; serine protease inhibitor |
ubenimex | [no description available] | medium | 1 | 0 | | |
carbobenzoxy-leucyl-leucyl-norvalinal | [no description available] | medium | 2 | 0 | peptide | |
tert-butylhydroperoxide | [no description available] | medium | 1 | 0 | alkyl hydroperoxide | antibacterial agent; oxidising agent |
13-hydroperoxy-9,11-octadecadienoic acid | [no description available] | medium | 1 | 0 | hydroperoxy polyunsaturated fatty acid; octadecadienoic acid | |
5-nitro-2-(3-phenylpropylamino)benzoic acid | [no description available] | medium | 1 | 0 | nitrobenzoic acid | |
anisomycin | [no description available] | medium | 3 | 0 | monohydroxypyrrolidine; organonitrogen heterocyclic antibiotic | anticoronaviral agent; antimicrobial agent; antineoplastic agent; antiparasitic agent; bacterial metabolite; DNA synthesis inhibitor; protein synthesis inhibitor |
luteolin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavonoid; tetrahydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; apoptosis inducer; c-Jun N-terminal kinase inhibitor; EC 2.3.1.85 (fatty acid synthase) inhibitor; immunomodulator; nephroprotective agent; plant metabolite; radical scavenger; vascular endothelial growth factor receptor antagonist |
n-hydroxysuccinimide suberic acid ester | [no description available] | medium | 1 | 0 | | |
acetic anhydride | [no description available] | medium | 1 | 0 | acyclic carboxylic anhydride | metabolite; reagent |
mtt formazan | [no description available] | medium | 1 | 0 | | |
formazans | [no description available] | medium | 1 | 0 | | |
phorbol | [no description available] | medium | 1 | 0 | cyclic ketone; enone; tertiary alcohol; tertiary alpha-hydroxy ketone; tetracyclic diterpenoid | |
farnesylthioacetic acid | [no description available] | medium | 1 | 0 | | |
n-acetyl-s-geranylgeranyl-cysteine | [no description available] | medium | 1 | 0 | diterpenoid | |
sri 63-441 | [no description available] | medium | 1 | 0 | | |
fluphenazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; organofluorine compound; phenothiazines | anticoronaviral agent; dopaminergic antagonist; phenothiazine antipsychotic drug |
tocotrienol, alpha | [no description available] | medium | 1 | 0 | tocotrienol; vitamin E | ferroptosis inhibitor; human metabolite; neuroprotective agent; plant metabolite |
d-alpha tocopherol | [no description available] | medium | 2 | 0 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
plastochromanol 8 | [no description available] | medium | 1 | 0 | | |
tocotrienols | [no description available] | medium | 1 | 0 | diterpenoid | |
vanadium pentoxide | [no description available] | medium | 1 | 0 | vanadium oxide | |
phosphatidylinositol 4-phosphate | [no description available] | medium | 2 | 0 | | |
propyl gallate | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | |
ethylene | [no description available] | medium | 1 | 0 | alkene; gas molecular entity | plant hormone; refrigerant |
vanadyl sulfate | [no description available] | medium | 1 | 0 | metal sulfate; vanadium coordination entity | |
emetine | [no description available] | medium | 2 | 0 | isoquinoline alkaloid; pyridoisoquinoline | antiamoebic agent; anticoronaviral agent; antiinfective agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; expectorant; plant metabolite; protein synthesis inhibitor |
ethanolamine | [no description available] | medium | 1 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
melatonin | [no description available] | medium | 1 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
citric acid, anhydrous | [no description available] | medium | 2 | 0 | tricarboxylic acid | antimicrobial agent; chelator; food acidity regulator; fundamental metabolite |
fascaplysine | [no description available] | medium | 1 | 0 | | |
u 69593 | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; N-alkylpyrrolidine; organic heterobicyclic compound; oxaspiro compound | anti-inflammatory agent; diuretic; kappa-opioid receptor agonist |
linsidomine | [no description available] | medium | 1 | 0 | morpholines | |
molsidomine | [no description available] | medium | 1 | 0 | ethyl ester; morpholines; oxadiazole; zwitterion | antioxidant; apoptosis inhibitor; cardioprotective agent; nitric oxide donor; vasodilator agent |
ag 538 | [no description available] | medium | 1 | 0 | | |
vitamin b 12 | [no description available] | medium | 1 | 0 | | |
lipoteichoic acid | [no description available] | medium | 2 | 0 | | |
pyrrolidonecarboxylic acid | [no description available] | medium | 1 | 0 | 5-oxoproline; L-proline derivative; non-proteinogenic L-alpha-amino acid | algal metabolite |
carbon tetrachloride | [no description available] | medium | 1 | 0 | chlorocarbon; chloromethanes | hepatotoxic agent; refrigerant |
fulvestrant | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid; organofluorine compound; sulfoxide | antineoplastic agent; estrogen antagonist; estrogen receptor antagonist |
ponceau s | [no description available] | medium | 1 | 0 | organic sodium salt; organosulfonate salt | fluorochrome; histological dye |
thiourea | [no description available] | medium | 1 | 0 | one-carbon compound; thioureas; ureas | antioxidant; chromophore |
1,3-dimethylthiourea | [no description available] | medium | 1 | 0 | | |
tiopronin | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
malondialdehyde | [no description available] | medium | 1 | 0 | dialdehyde | biomarker |
allyl isothiocyanate | [no description available] | medium | 1 | 0 | alkenyl isothiocyanate; isothiocyanate | antimicrobial agent; antineoplastic agent; apoptosis inducer; lachrymator; metabolite |
benzyloxycarbonylvalyl-alanyl-aspartyl fluoromethyl ketone | [no description available] | medium | 1 | 0 | | |
noc 9 | [no description available] | medium | 1 | 0 | | |
n(6)-cyclopentyladenosine | [no description available] | medium | 1 | 0 | | |
tetrodotoxin | [no description available] | medium | 1 | 0 | azatetracycloalkane; oxatetracycloalkane; quinazoline alkaloid | animal metabolite; bacterial metabolite; marine metabolite; neurotoxin; voltage-gated sodium channel blocker |
beta-(5-hydroxy-2-pyridyl)alanine | [no description available] | medium | 1 | 0 | | |
acetohexamide | [no description available] | medium | 1 | 0 | | |
sucrose | [no description available] | medium | 1 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
phenol | [no description available] | medium | 1 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
fusicoccin | [no description available] | medium | 1 | 0 | | |
glycosides | [no description available] | medium | 1 | 0 | | |
hypochlorous acid | [no description available] | medium | 1 | 0 | chlorine oxoacid; reactive oxygen species | EC 2.5.1.18 (glutathione transferase) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite |
diphenylhexatriene | [no description available] | medium | 1 | 0 | alkatriene | fluorochrome |
alvocidib | [no description available] | medium | 1 | 0 | dihydroxyflavone; hydroxypiperidine; monochlorobenzenes; tertiary amino compound | antineoplastic agent; antirheumatic drug; apoptosis inducer; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
4-(n-methyl-n-nitrosamino)-1-(3-pyridyl)-1-butanone | [no description available] | medium | 1 | 0 | nitrosamine; pyridines | |
ozone | [no description available] | medium | 1 | 0 | elemental molecule; gas molecular entity; reactive oxygen species; triatomic oxygen | antiseptic drug; disinfectant; electrophilic reagent; greenhouse gas; mutagen; oxidising agent; tracer |
6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | [no description available] | medium | 1 | 0 | chromanol; monocarboxylic acid; phenols | antioxidant; ferroptosis inhibitor; neuroprotective agent; radical scavenger; Wnt signalling inhibitor |
edelfosine | [no description available] | medium | 1 | 0 | glycerophosphocholine | |
pyrrolidine dithiocarbamate | [no description available] | medium | 1 | 0 | dithiocarbamic acids; pyrrolidines | anticonvulsant; antineoplastic agent; geroprotector; neuroprotective agent; NF-kappaB inhibitor; radical scavenger |
arabinose | [no description available] | medium | 1 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
ammonium hydroxide | [no description available] | medium | 1 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
caprolactam | [no description available] | medium | 1 | 0 | caprolactams | human blood serum metabolite |
leptomycin b | [no description available] | medium | 1 | 0 | | |
nimodipine | [no description available] | medium | 1 | 0 | 2-methoxyethyl ester; C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; isopropyl ester | antihypertensive agent; calcium channel blocker; cardiovascular drug; vasodilator agent |
fructosamine | [no description available] | medium | 1 | 0 | | |
puromycin | [no description available] | medium | 1 | 0 | puromycins | antiinfective agent; antimicrobial agent; antineoplastic agent; EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor; EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor; nucleoside antibiotic; protein synthesis inhibitor |
busulfan | [no description available] | medium | 1 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; insect sterilant; teratogenic agent |
ebrotidine | [no description available] | medium | 1 | 0 | sulfonamide | |
isradipine | [no description available] | medium | 1 | 0 | benzoxadiazole; dihydropyridine; isopropyl ester; methyl ester | |
arsenic acid | [no description available] | medium | 1 | 0 | arsenic oxoacid | Escherichia coli metabolite |
kemptide | [no description available] | medium | 2 | 0 | | |
angiotensin i | [no description available] | medium | 1 | 0 | angiotensin; peptide zwitterion | human metabolite; neurotransmitter agent |
kt 5926 | [no description available] | medium | 1 | 0 | gamma-lactam; hemiaminal; indolocarbazole; methyl ester; organic heterooctacyclic compound; tertiary alcohol | EC 2.7.11.18 (myosin-light-chain kinase) inhibitor |
iodoacetic acid | [no description available] | medium | 1 | 0 | haloacetic acid; organoiodine compound | alkylating agent |
veratridine | [no description available] | medium | 1 | 0 | | |
dimethyl sulfate | [no description available] | medium | 1 | 0 | alkyl sulfate | alkylating agent; immunosuppressive agent |
nadp | [no description available] | medium | 2 | 0 | | |
amanitins | [no description available] | medium | 1 | 0 | | |
7-nitrobenz-2-oxa-1,3-diazole-phallacidin | [no description available] | medium | 1 | 0 | | |
tyramine | [no description available] | medium | 1 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
quin2 | [no description available] | medium | 1 | 0 | | |
thiabendazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; benzimidazole fungicide; benzimidazoles | antifungal agrochemical; antinematodal drug |
plumbagin | [no description available] | medium | 1 | 0 | hydroxy-1,4-naphthoquinone; phenols | anticoagulant; antineoplastic agent; immunological adjuvant; metabolite |
ethylene glycol | [no description available] | medium | 1 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
5,5'-dimethyl-bis(2-aminophenoxy)ethane-n,n,n',n'-tetraacetate | [no description available] | medium | 1 | 0 | polyamino carboxylic acid | chelator |
hexacyanoferrate iii | [no description available] | medium | 1 | 0 | | |
peptide elongation factor 2 | [no description available] | medium | 1 | 0 | | |
aphidicolin | [no description available] | medium | 1 | 0 | tetracyclic diterpenoid | antimicrobial agent; antimitotic; antineoplastic agent; antiviral drug; apoptosis inducer; Aspergillus metabolite; DNA synthesis inhibitor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; fungal metabolite |
2-amino-5-phosphonovalerate | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | NMDA receptor antagonist |
big gastrin | [no description available] | medium | 1 | 0 | | |
lithium | [no description available] | medium | 1 | 0 | alkali metal atom | |
pilocarpine | [no description available] | medium | 1 | 0 | pilocarpine | antiglaucoma drug |
beta-glycerophosphoric acid | [no description available] | medium | 1 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
quinone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones | cofactor; human xenobiotic metabolite; mouse metabolite |
w 7 | [no description available] | medium | 1 | 0 | | |
o-phthalaldehyde | [no description available] | medium | 2 | 0 | benzaldehydes; dialdehyde | epitope |
phenylglyoxal | [no description available] | medium | 1 | 0 | phenylacetaldehydes | |
1-carboxyglutamic acid | [no description available] | medium | 1 | 0 | | |
sodium hydroxide | [no description available] | medium | 1 | 0 | alkali metal hydroxide | |
mannose | [no description available] | medium | 1 | 0 | D-aldohexose; D-mannose; mannopyranose | metabolite |
nitroblue tetrazolium | [no description available] | medium | 1 | 0 | organic cation | |
2-(methylamino)isobutyric acid | [no description available] | medium | 1 | 0 | alanine derivative; alpha-amino acid zwitterion; non-proteinogenic alpha-amino acid; secondary amino compound | human urinary metabolite |
mannose-6-phosphate | [no description available] | medium | 1 | 0 | D-mannopyranose 6-phosphate | |
isomethyleugenol | [no description available] | medium | 10 | 0 | isomethyleugenol | |
guaifenesin | [no description available] | medium | 1 | 0 | methoxybenzenes | |
cinidon-ethyl | [no description available] | medium | 1 | 0 | ethyl ester; isoindoles; monochlorobenzenes | herbicide |
eye | [no description available] | medium | 2 | 0 | | |
1-((3,5-dichloro)-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone | [no description available] | medium | 17 | 0 | dichlorobenzene; differentiation-inducing factor; monomethoxybenzene; resorcinols | eukaryotic metabolite; signalling molecule |
bassianolide | [no description available] | medium | 1 | 0 | cyclodepsipeptide; cyclooctadepsipeptide | antineoplastic agent; fungal metabolite; insecticide |
torpedo | [no description available] | medium | 13 | 0 | | |
apigenin | [no description available] | medium | 1 | 0 | trihydroxyflavone | antineoplastic agent; metabolite |
khellin | [no description available] | medium | 1 | 0 | furanochromone; organic heterotricyclic compound; oxacycle | anti-asthmatic agent; bronchodilator agent; cardiovascular drug; vasodilator agent |
trazodone hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | adrenergic antagonist; antidepressant; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
isoniazid | [no description available] | medium | 1 | 0 | carbohydrazide | antitubercular agent; drug allergen |
monoisopropanolamine | [no description available] | low | 0 | 0 | amino alcohol; secondary alcohol | Escherichia coli metabolite |
dihydro-3-coumaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid | Escherichia coli metabolite; human xenobiotic metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
5,6,7,8-tetrahydropteridine | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
allantoin | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
carbamic acid | [no description available] | low | 0 | 0 | carbon oxoacid; one-carbon compound; organonitrogen compound | Escherichia coli metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
2-aminoacetaldehyde | [no description available] | low | 0 | 0 | amino aldehyde; omega-aminoaldehyde | Escherichia coli metabolite |
2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; amino acid zwitterion; beta-amino acid; diamino acid; non-proteinogenic alpha-amino acid | Escherichia coli metabolite |
octanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
hydrogen sulfide | [no description available] | low | 0 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
oxaluric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; ureas | Escherichia coli metabolite |
n(1)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; metabolite |
propionaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; propanals | Escherichia coli metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1,4-dihydroxy-2-naphthoic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; naphthalenediols; naphthohydroquinone; naphthoic acid | Escherichia coli metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
hydrogen cyanide | [no description available] | low | 0 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
toxopyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
thiocyanic acid | [no description available] | low | 0 | 0 | hydracid; one-carbon compound; organosulfur compound | Escherichia coli metabolite |
hydroquinone | [no description available] | low | 0 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
iminoaspartic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; ketimine | Escherichia coli metabolite |
indole | [no description available] | low | 0 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
pyruvaldehyde | [no description available] | low | 0 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
niacin | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
hydroxypyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
diphosphoric acid | [no description available] | low | 0 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | Escherichia coli metabolite |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
dimethyl sulfide | [no description available] | low | 0 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
sulfur dioxide | [no description available] | low | 0 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
thiamine | [no description available] | low | 0 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
trimethyloxamine | [no description available] | low | 0 | 0 | tertiary amine oxide | Escherichia coli metabolite; metabolite; osmolyte |
trimethylamine | [no description available] | low | 0 | 0 | methylamines; tertiary amine | Escherichia coli metabolite; human xenobiotic metabolite |
uracil | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
4-cresol | [no description available] | low | 0 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
chloramphenicol | [no description available] | low | 0 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
cytidine | [no description available] | low | 0 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cytidine triphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
methanesulfonic acid | [no description available] | low | 0 | 0 | alkanesulfonic acid; one-carbon compound | Escherichia coli metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
framycetin | [no description available] | low | 0 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
shikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
1,3,4-butanetriol | [no description available] | low | 0 | 0 | triol | bacterial xenobiotic metabolite; Escherichia coli metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
silver | [no description available] | low | 0 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
myrmicacin | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; medium-chain fatty acid | antimitotic; Escherichia coli metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n-(3-aminopropyl)cadaverine | [no description available] | low | 0 | 0 | polyazaalkane; triamine | Escherichia coli metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
hydracrylic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
D-serine | [no description available] | low | 0 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
D-tyrosine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; tyrosine | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
coenzyme a | [no description available] | low | 0 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
L-2-aminoadipic acid | [no description available] | low | 0 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
3'-uridylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 3'-monophosphate; uridine phosphate | Escherichia coli metabolite |
2',3'-cyclic amp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
2,5-diketogluconic acid | [no description available] | low | 0 | 0 | diketoaldonic acid | Escherichia coli metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
selenodiglutathione | [no description available] | low | 0 | 0 | glutathione derivative; thioselenide | Escherichia coli metabolite; metabolite |
2-deoxyglucose-6-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | Escherichia coli metabolite; Mycoplasma genitalium metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
thymidine diphosphate-l-rhamnose | [no description available] | low | 0 | 0 | dTDP-L-rhamnose | Escherichia coli metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
trehalose-6-phosphate | [no description available] | low | 0 | 0 | trehalose phosphate | Escherichia coli metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
aerobactin | [no description available] | low | 0 | 0 | L-lysine derivative | Escherichia coli metabolite; siderophore; virulence factor |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glutamate-1-semialdehyde | [no description available] | low | 0 | 0 | 5-oxo monocarboxylic acid; amino acid zwitterion; gamma-amino acid; glutamic semialdehyde | Escherichia coli metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
o-phosphohomoserine | [no description available] | low | 0 | 0 | O-phosphorylhomoserine | Escherichia coli metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
2,3-dihydroxybenzoylserine | [no description available] | low | 0 | 0 | L-serine derivative | Escherichia coli metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
beta-aspartyl phosphate | [no description available] | medium | 0 | 0 | aminoacyl phosphate; L-aspartic acid derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
abrine | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-methyl-L-alpha-amino acid zwitterion; N-methyl-L-alpha-amino acid | Escherichia coli metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-deoxy-d-arabino-heptulosonate-7-phosphate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
glucosamine 1-phosphate | [no description available] | low | 0 | 0 | glucosamine phosphate | Escherichia coli metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
9-mercaptodethiobiotin | [no description available] | low | 0 | 0 | imidazolidinone; monocarboxylic acid; thiol; ureas | Escherichia coli metabolite |
idonic acid | [no description available] | low | 0 | 0 | idonic acid | Escherichia coli metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxythreonine | [no description available] | medium | 0 | 0 | amino acid zwitterion; hydroxy-amino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite |
2-oxo-3-deoxygalactonic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
ribose 1-phosphate | [no description available] | low | 0 | 0 | D-ribose 1-phosphate | Escherichia coli metabolite |
diaminopimelic acid | [no description available] | low | 0 | 0 | 2,6-diaminopimelic acid; amino acid zwitterion | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
3-dehydroquinic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 4-hydroxy monocarboxylic acid; 4-oxo monocarboxylic acid; 5-hydroxy monocarboxylic acid; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
o-succinylhomoserine | [no description available] | low | 0 | 0 | hemisuccinate; o-succinylhomoserine | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
cysteinylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
tartaric acid | [no description available] | low | 0 | 0 | tartaric acid | Escherichia coli metabolite |
s-ribosyl-l-homocysteine | [no description available] | low | 0 | 0 | S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | Escherichia coli metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | [no description available] | low | 0 | 0 | diadenosyl pentaphosphate | Escherichia coli metabolite; vasoconstrictor agent |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
glutathionylspermidine | [no description available] | low | 0 | 0 | glutathione derivative | Escherichia coli metabolite |
arbutin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
2-c-methylerythritol 4-phosphate | [no description available] | low | 0 | 0 | tetritol phosphate | Escherichia coli metabolite |
1-deoxy-d-xylulose 5-phosphate | [no description available] | low | 0 | 0 | xylulose phosphate | Escherichia coli metabolite |
c(alpha)-formylglycine | [no description available] | medium | 0 | 0 | 3-oxoalanine; amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
palmitoleic acid | [no description available] | low | 0 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
riboflavin | [no description available] | low | 0 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
sucrose-6-phosphate | [no description available] | low | 0 | 0 | disaccharide phosphate | Escherichia coli metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
fusidic acid | [no description available] | low | 0 | 0 | 11alpha-hydroxy steroid; 3alpha-hydroxy steroid; alpha,beta-unsaturated monocarboxylic acid; steroid acid; steroid antibiotic; sterol ester | EC 2.7.1.33 (pantothenate kinase) inhibitor; Escherichia coli metabolite; protein synthesis inhibitor |
iminoglycine | [no description available] | low | 0 | 0 | dehydroamino acid; imine; zwitterion | Escherichia coli metabolite |
2-keto-3-deoxy-6-phosphogluconate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
formyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | [no description available] | low | 0 | 0 | lipid As | Escherichia coli metabolite |
maleamic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dicarboxylic acid monoamide | bacterial xenobiotic metabolite; Escherichia coli metabolite |
retinol palmitate | [no description available] | low | 0 | 0 | all-trans-retinyl ester; retinyl palmitate | antioxidant; Escherichia coli metabolite; human xenobiotic metabolite |
canthaxanthin | [no description available] | low | 0 | 0 | carotenone | biological pigment; Escherichia coli metabolite; food colouring; fungal metabolite |
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; phosphoantigen |
menaquinone 7 | [no description available] | low | 0 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
5-ketogluconic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
menaquinone 9 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite |
allolactose | [no description available] | low | 0 | 0 | glycosylglucose | Escherichia coli metabolite |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
1-deoxy-2-pentulose | [no description available] | low | 0 | 0 | deoxypentose | Escherichia coli metabolite |
fructosyl-lysine | [no description available] | low | 0 | 0 | fructosamine; glyco-amino acid | Escherichia coli metabolite |
methionine sulfoxide | [no description available] | low | 0 | 0 | amino acid zwitterion; L-methionine S-oxide | Escherichia coli metabolite |
(S)-4,5-dihydroxypentane-2,3-dione | [no description available] | low | 0 | 0 | alpha-diketone; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
kdo2-lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid As; tetradecanoate ester | Escherichia coli metabolite |
oxalyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
novobiocin | [no description available] | low | 0 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
inosine triphosphate | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3'-guanylic acid | [no description available] | low | 0 | 0 | guanosine 3'-phosphate; purine ribonucleoside 3'-monophosphate | Escherichia coli metabolite |
2',3'-cyclic gmp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
rifampin | [no description available] | low | 0 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
leucovorin | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
colibactin | [no description available] | low | 0 | 0 | 1,3-thiazoles; azaspiro compound; polyketide; pyrroline; secondary carboxamide | alkylating agent; carcinogenic agent; Escherichia coli metabolite; genotoxin |
levodopa | [no description available] | low | 0 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
3-methoxytyrosine | [no description available] | low | 0 | 0 | aromatic L-alpha-amino acid zwitterion; L-tyrosine derivative; monomethoxybenzene; non-proteinogenic L-alpha-amino acid | human metabolite |
ethyl n-alpha-acetyl-tyrosinate | [no description available] | low | 0 | 0 | acetamides; ethyl ester; L-tyrosine derivative; phenols | |
methyldopa | [no description available] | low | 0 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | alpha-adrenergic agonist; antihypertensive agent; hapten; peripheral nervous system drug; sympatholytic agent |
benzoyltyrosine ethyl ester | [no description available] | low | 0 | 0 | benzamides; ethyl ester; L-tyrosine derivative; phenols | chromogenic compound |
droxidopa | [no description available] | low | 0 | 0 | catechols; L-tyrosine derivative | antihypertensive agent; prodrug; vasoconstrictor agent |
3-chloro-L-tyrosine | [no description available] | low | 0 | 0 | chloroamino acid; L-alpha-amino acid zwitterion; L-tyrosine derivative; monochlorobenzenes; non-proteinogenic L-alpha-amino acid | biomarker; human metabolite |
tyrosinamide | [no description available] | low | 0 | 0 | amino acid amide; L-tyrosine derivative | |
methyl-3-tyrosine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | |
2-s-cysteinyldopa | [no description available] | low | 0 | 0 | amino dicarboxylic acid; aryl sulfide; catechols; diamine; L-tyrosine derivative; S-conjugate; S-organyl-L-cysteine | human urinary metabolite |
n-hydroxytyrosine | [no description available] | low | 0 | 0 | L-tyrosine derivative; N-hydroxy-alpha-amino-acid | |
metyrosine | [no description available] | low | 0 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | antihypertensive agent; EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor |
lysine tyrosylquinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; L-lysine derivative; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | |
ornithine | [no description available] | low | 0 | 0 | non-proteinogenic L-alpha-amino acid; ornithine | algal metabolite; hepatoprotective agent; mouse metabolite |
homoarginine | [no description available] | low | 0 | 0 | homoarginine; L-lysine derivative; non-proteinogenic L-alpha-amino acid | biomarker; EC 3.1.3.1 (alkaline phosphatase) inhibitor; human metabolite; rat metabolite; xenobiotic metabolite |
diazooxonorleucine | [no description available] | low | 0 | 0 | amino acid zwitterion; diazo compound; ketone; non-proteinogenic L-alpha-amino acid | analgesic; antibacterial agent; antimetabolite; antineoplastic agent; antiviral agent; apoptosis inducer; bacterial metabolite; EC 2.4.2.14 (amidophosphoribosyltransferase) inhibitor; EC 3.5.1.2 (glutaminase) inhibitor; EC 6.3.4.2 [CTP synthase (glutamine hydrolyzing)] inhibitor; EC 6.3.5.1 [NAD(+) synthase (glutamine-hydrolysing)] inhibitor; EC 6.3.5.2 [GMP synthase (glutamine-hydrolysing)] inhibitor; EC 6.3.5.3 (phosphoribosylformylglycinamidine synthase) inhibitor; EC 6.3.5.4 [asparagine synthase (glutamine-hydrolysing)] inhibitor; EC 6.3.5.5 [carbamoyl-phosphate synthase (glutamine-hydrolysing)] inhibitor; glutamine antagonist |
norleucine | [no description available] | low | 0 | 0 | 2-aminohexanoic acid; L-alpha-amino acid zwitterion; non-proteinogenic L-alpha-amino acid | |
3-methylhistidine | [no description available] | low | 0 | 0 | L-histidine derivative; non-proteinogenic L-alpha-amino acid; zwitterion | human metabolite; Saccharomyces cerevisiae metabolite |
homocitrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; L-lysine derivative; non-proteinogenic L-alpha-amino acid; ureas | human metabolite; mouse metabolite |
cystine | [no description available] | low | 0 | 0 | cystine zwitterion; cystine; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
djenkolic acid | [no description available] | low | 0 | 0 | dithioacetal; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | plant metabolite; toxin |
furanomycin | [no description available] | low | 0 | 0 | dihydrofuran; non-proteinogenic L-alpha-amino acid | antibacterial agent; antimicrobial agent; bacterial metabolite |
biocytin | [no description available] | low | 0 | 0 | azabicycloalkane; L-alpha-amino acid zwitterion; L-lysine derivative; monocarboxylic acid amide; non-proteinogenic L-alpha-amino acid; thiabicycloalkane; ureas | mouse metabolite |
o-methylserine | [no description available] | low | 0 | 0 | L-serine derivative; non-proteinogenic L-alpha-amino acid | metabolite |
methionine sulfoximine | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-methionine derivative; methionine sulfoximine; non-proteinogenic L-alpha-amino acid | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor; geroprotector |
1-methylhistidine | [no description available] | low | 0 | 0 | L-histidine derivative; non-proteinogenic L-alpha-amino acid; zwitterion | human metabolite |
albizziin | [no description available] | low | 0 | 0 | non-proteinogenic L-alpha-amino acid | |
s-2-aminoethyl cysteine | [no description available] | low | 0 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid | EC 5.4.3.2 (lysine 2,3-aminomutase) inhibitor; metabolite; protein synthesis inhibitor |
beta-n-methylamino-l-alanine | [no description available] | low | 0 | 0 | diamino acid; L-alanine derivative; non-proteinogenic L-alpha-amino acid; secondary amino compound | bacterial metabolite; neurotoxin |
4-ketoproline | [no description available] | low | 0 | 0 | 4-oxoproline; amino acid zwitterion; L-proline derivative; non-proteinogenic L-alpha-amino acid | |
s-methylthiocitrulline | [no description available] | low | 0 | 0 | imidothiocarbamic ester; L-arginine derivative; L-ornithine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; neuroprotective agent |
indospicine | [no description available] | low | 0 | 0 | carboxamidine; non-proteinogenic L-alpha-amino acid | hepatotoxic agent; plant metabolite |
coprine | [no description available] | low | 0 | 0 | cyclopropanes; dicarboxylic acid monoamide; L-glutamine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; metabolite; mycotoxin |
tabtoxinine beta-lactam | [no description available] | low | 0 | 0 | beta-lactam antibiotic; monobactam; non-proteinogenic L-alpha-amino acid; tertiary alpha-hydroxy ketone | apoptosis inducer; bacterial metabolite; EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor |
pentosidine | [no description available] | low | 0 | 0 | imidazopyridine; non-proteinogenic L-alpha-amino acid | biomarker; cross-linking reagent |
mannopine | [no description available] | low | 0 | 0 | amino acid opine; dicarboxylic acid monoamide; hexitol derivative; L-glutamine derivative; non-proteinogenic L-alpha-amino acid; secondary amino compound | plant metabolite |
dansyllysine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid; sulfonamide | epitope |
deoxyhypusine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | human metabolite |
2-formyl-5-(hydroxymethyl)pyrrole-1-norleucine | [no description available] | low | 0 | 0 | L-lysine derivative; N-substituted pyrraline; non-proteinogenic L-alpha-amino acid | |
n(6)-carboxymethyllysine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | antigen |
n,n-dimethylarginine | [no description available] | low | 0 | 0 | dimethylarginine; guanidines; L-arginine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
5-fluorowillardiine | [no description available] | low | 0 | 0 | L-alanine derivative; non-proteinogenic L-alpha-amino acid; organofluorine compound | AMPA receptor agonist |
4-fluorothreonine | [no description available] | low | 0 | 0 | amino acid zwitterion; fluoroamino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | |
ovothiol a | [no description available] | low | 0 | 0 | aryl thiol; L-alpha-amino acid zwitterion; L-histidine derivative; non-proteinogenic L-alpha-amino acid | antioxidant; marine metabolite; radical scavenger |
selenomethylselenocysteine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-selenocysteine derivative; non-proteinogenic L-alpha-amino acid; Se-methylselenocysteine | antineoplastic agent |
vinylglycine | [no description available] | low | 0 | 0 | glycine derivative; L-alpha-amino acid zwitterion; non-proteinogenic L-alpha-amino acid | EC 4.4.1.14 (1-aminocyclopropane-1-carboxylate synthase) inhibitor |
i-677 | [no description available] | low | 0 | 0 | L-serine derivative; non-proteinogenic L-alpha-amino acid | antimetabolite; antimicrobial agent; antineoplastic agent; metabolite |
allysine | [no description available] | low | 0 | 0 | allysine; amino acid zwitterion; aminoadipate semialdehyde; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
kynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; kynurenine; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
n(5)-hydroxy-l-arginine | [no description available] | low | 0 | 0 | hydroxy-L-arginine; non-proteinogenic L-alpha-amino acid | |
felinine | [no description available] | low | 0 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid; S-alkyl-L-cysteine zwitterion | mammalian metabolite; pheromone |
serine o-sulfate | [no description available] | low | 0 | 0 | L-serine derivative; non-proteinogenic L-alpha-amino acid; O-sulfoamino acid | |
epsilon-n-methyllysine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | |
trifluoromethionine | [no description available] | low | 0 | 0 | L-methionine derivative; non-proteinogenic L-alpha-amino acid; organofluorine compound | |
cysteinesulfenic acid | [no description available] | low | 0 | 0 | L-cysteine derivative; non-proteinogenic L-alpha-amino acid | |
symmetric dimethylarginine | [no description available] | low | 0 | 0 | amino acid zwitterion; dimethylarginine; guanidines; L-arginine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
delta-n-methylarginine | [no description available] | low | 0 | 0 | guanidines; L-arginine derivative; non-proteinogenic L-alpha-amino acid | |
2-amino-4-phosphonobutyric acid | [no description available] | low | 0 | 0 | non-proteinogenic L-alpha-amino acid; phosphonic acids | metabotropic glutamate receptor agonist |
epsilon n-dimethyllysine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | |
carbocysteine | [no description available] | low | 0 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid | mucolytic |
acivicin | [no description available] | low | 0 | 0 | isoxazoles; non-proteinogenic L-alpha-amino acid; organochlorine compound | antileishmanial agent; antimetabolite; antimicrobial agent; antineoplastic agent; EC 2.3.2.2 (gamma-glutamyltransferase) inhibitor; glutamine antagonist; metabolite |
canavanine | [no description available] | low | 0 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid | phytogenic insecticide; plant metabolite |
5-hydroxytryptophan | [no description available] | low | 0 | 0 | 5-hydroxytryptophan; amino acid zwitterion; hydroxy-L-tryptophan; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; plant metabolite |
agaritine | [no description available] | low | 0 | 0 | amino acid zwitterion; benzyl alcohols; carbohydrazide; L-glutamic acid derivative; non-proteinogenic L-alpha-amino acid | |
n'-formylkynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-formylkynurenine; non-proteinogenic amino acid derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
3,5-dichlorotyrosine | [no description available] | low | 0 | 0 | chloroamino acid; dichlorobenzene; dihalogenated L-tyrosine; non-proteinogenic L-alpha-amino acid | |
nitroarginine | [no description available] | low | 0 | 0 | guanidines; L-arginine derivative; N-nitro compound; non-proteinogenic L-alpha-amino acid | |
willardiine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | |
mimosine | [no description available] | low | 0 | 0 | 4-pyridones; amino acid zwitterion; non-proteinogenic L-alpha-amino acid | EC 1.14.18.1 (tyrosinase) inhibitor; plant metabolite |
canaline | [no description available] | low | 0 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid | antimetabolite; antineoplastic agent; phytogenic insecticide; plant metabolite |
2,5-dihydrophenylalanine | [no description available] | low | 0 | 0 | non-proteinogenic L-alpha-amino acid | |
3,5-dihydroxyphenylglycine | [no description available] | low | 0 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid; resorcinols | |
methionine sulfone | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-methionine derivative; methionine sulfone; non-proteinogenic L-alpha-amino acid | animal metabolite |
(S)-ATPA | [no description available] | low | 0 | 0 | isoxazoles; non-proteinogenic L-alpha-amino acid | metabolite |
azaserine | [no description available] | low | 0 | 0 | carboxylic ester; diazo compound; L-serine derivative; non-proteinogenic L-alpha-amino acid | antifungal agent; antimetabolite; antimicrobial agent; antineoplastic agent; glutamine antagonist; immunosuppressive agent; metabolite |
4-fluorophenyl-L-alanine | [no description available] | low | 0 | 0 | 4-fluorophenylalanine; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid | |
o-methyl threonine | [no description available] | low | 0 | 0 | ether; L-threonine derivative; non-proteinogenic L-alpha-amino acid | antibacterial agent; bleaching agent |
n(6)-(1-iminoethyl)lysine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | |
glycerophosphoserine | [no description available] | low | 0 | 0 | glycerol 1-phosphodiester; L-serine derivative; non-proteinogenic L-alpha-amino acid | |
7-chlorotryptophan | [no description available] | low | 0 | 0 | 7-chlorotryptophan; amino acid zwitterion; L-tryptophan derivative; non-proteinogenic L-alpha-amino acid | |
leukotriene e4 | [no description available] | low | 0 | 0 | amino dicarboxylic acid; L-cysteine thioether; leukotriene; non-proteinogenic L-alpha-amino acid; secondary alcohol | |
domoic acid | [no description available] | low | 0 | 0 | L-proline derivative; non-proteinogenic L-alpha-amino acid; pyrrolidinecarboxylic acid; tricarboxylic acid | algal metabolite; hapten; marine metabolite; neuromuscular agent; neurotoxin |
4-chlorothreonine | [no description available] | low | 0 | 0 | chloroamino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | |
cilastatin | [no description available] | low | 0 | 0 | carboxamide; L-cysteine derivative; non-proteinogenic L-alpha-amino acid; organic sulfide | EC 3.4.13.19 (membrane dipeptidase) inhibitor; environmental contaminant; protease inhibitor; xenobiotic |
3-tyrosine | [no description available] | low | 0 | 0 | hydroxyphenylalanine; L-alpha-amino acid zwitterion; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; phenols | plant metabolite |
(S)-2-amino-6-boronohexanoic acid | [no description available] | low | 0 | 0 | non-proteinogenic L-alpha-amino acid; organoboron compound | |
6-bromotryptophan | [no description available] | low | 0 | 0 | aromatic L-alpha-amino acid zwitterion; bromoamino acid; bromoindole; L-alpha-amino acid zwitterion; L-tryptophan derivative; non-proteinogenic L-alpha-amino acid | |
6-chlorotryptophan | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-tryptophan derivative; non-proteinogenic L-alpha-amino acid; organochlorine compound | |
anticapsin | [no description available] | low | 0 | 0 | alicyclic ketone; epoxide; L-alanine derivative; L-alpha-amino acid zwitterion; non-proteinogenic L-alpha-amino acid | antimetabolite; antimicrobial agent; bacterial metabolite; EC 2.6.1.16 (glutamine--fructose-6-phosphate transaminase (isomerizing)) inhibitor |
n(6)-(1-carboxyethyl)lysine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | |