Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).
| Member | Definition | Class |
|---|
| (20s)-20-hydroxycholesterol | An oxysterol that is cholesterol substituted by a hydroxy group at position 20. | 20-hydroxycholesterol |
| 1-butanol | A primary alcohol that is butane in which a hydrogen of one of the methyl groups is substituted by a hydroxy group. It it produced in small amounts in humans by the gut microbes. | butan-1-ol |
| 1-hydroxyphenanthrene | | 1-phenanthrol |
| 1-methyluric acid | An oxopurine that is 7,9-dihydro-1H-purine-2,6,8(3H)-trione substituted by a methyl group at N-1. It is one of the metabolites of caffeine found in human urine. | 1-methyluric acid |
| 1-methylxanthine | A 1-methylxanthine tautomer where the imidazole proton is located at the 7-position. | 1-methyl-7H-xanthine |
| 1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine | A phosphatidylcholine 30:0 in which the phosphatidyl acyl groups at positions 1 and 2 are myristoyl (tetradecanoyl) and palmitoyl (hexadecanoyl) respectively. | 1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine |
| 1-naphthaldehyde | A naphthaldehyde with a formyl group at position 1. | 1-naphthaldehyde |
| 1-naphthalenemethanol | A naphthylmethanol that is methanol in which one of the hydrogens of the methyl group is replaced by a naphthalen-1-yl group. | (1-naphthyl)methanol |
| 1-nitronaphthalene | A mononitronaphthalene substituted by a nitro group at position 1. | 1-nitronaphthalene |
| 1-palmitoyl-2-docosahexaenoyl-sn-glycero-3-phosphocholine | A phosphatidylcholine 38:6 in which the acyl groups at C-1 and C-2 are specified as hexadecanoyl and (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl respectively. | 1-hexadecanoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoyl)-sn-glycero-3-phosphocholine |
| 1-palmitoyl-2-oleoyl-sn-glycerol | A 1,2-diacyl-sn-glycerol with palmitoyl as the 1-acyl group and oleoyl as the 2-acyl group. | 1-palmitoyl-2-oleoyl-sn-glycerol |
| 1-palmitoyl-2-oleoylphosphatidylethanolamine, (z & r)-isomer | A 1,2-diacyl-sn-glycero-3-phosphoethanolamine in which the 1- and 2-acyl groups are specified as hexadecanoyl (palmitoyl) and 9Z-octadecenoyl (oleoyl) respectively. | {1-hexadecanoyl-2-[(Z)-octadec-9-enoyl]-sn-glycero-3-phospho}ethanolamine; 1-hexadecanoyl-2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine zwitterion; 1-hexadecanoyl-2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine |
| 1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine | A phosphatidylcholine 32:1 in which the acyl groups at C-1 and C-2 are hexadecanoyl and (9Z)-hexadec-9-enoyl respectively. | 1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine |
| 1-stearoyl-2-linoleoyl-sn-glycerol | A 1,2-diacyl-sn-glycerol in which the acyl groups at positions 1 and 2 are specified as stearoyl and linoleoyl respectively. | 1-stearoyl-2-linoleoyl-sn-glycerol |
| 1-stearoyl-2-linoleoylphosphatidylcholine | A phosphatidylcholine 36:2 in which the acyl groups positions 1 and 2 are specified as octadecanoyl and (9Z,12Z)-octadecadienoyl respectively. | 1-octadecanoyl-2-[(9Z,12Z)-octadecadienoyl]-sn-glycero-3-phosphocholine |
| 1-stearoyl-2-oleoyl-sn-glycerol | A 1,2-diacyl-sn-glycerol that has stearoyl and oleoyl as the 1- and 2-acyl groups respectively. | 1-octadecanoyl-2-[(9Z)-octadecenoyl]-sn-glycerol |
| 1,2-dihydroxy-1,2-dihydronaphthalene | A member of the class of naphthalenediols that is 1,2-dihydronaphthalene substituted by hydroxy groups at positions 1 and 2 respectively. | 1,2-dihydronaphthalene-1,2-diol |
| 1,2-dihydroxynaphthalene | | naphthalene-1,2-diol |
| 1,2-dioleoylphosphatidylserine | A 3-sn-phosphatidyl L-serine in which the phosphatidyl acyl groups are both oleoyl. | 1,2-dioleoyl-sn-glycero-3-phospho-L-serine |
| 1,3,7-trimethylurate | An oxopurine in which the purine ring is substituted by oxo groups at positions 2, 6, and 8, and the nitrogens at positions 1, 3, and 7 are substituted by methyl groups. It is a metabolite of caffeine. | 1,3,7-trimethyluric acid |
| 1,5-dihydro-fad | | FADH2 |
| 1,7-dimethyluric acid | An oxopurine that is 7,9-dihydro-1H-purine-2,6,8(3H)-trione substituted by methyl groups at N-1 and N-7. It is a metabolite of caffeine and is often found in human urine samples. | 1,7-dimethyluric acid |
| 1,7-dimethylxanthine | A dimethylxanthine having the two methyl groups located at positions 1 and 7. It is a metabolite of caffeine and theobromine in animals. | 1,7-dimethylxanthine |
| 10-formyltetrahydrofolate | A form of tetrahydrofolate that acts as a donor of formyl groups in anabolism. In these reactions 10-formyltetrahydrofolic acid is used as a substrate in formyltransferase reactions, which is important in purine biosynthesis. | 10-formyltetrahydrofolic acid |
| 11-cis-retinal | A retinal having 2E,4Z,6E,8E-double bond geometry. | 11-cis-retinal |
| 11-dehydrocorticosterone | An 11-oxo steroid that is corticosterone in which the hydroxy substituent at the 11beta position has been oxidised to give the corresponding ketone. | 11-dehydrocorticosterone |
| 11,12-dihydroxyeicosatrienoic acid | A DHET obtained by formal dihydroxylation across the 11,12-double bond of arachidonic acid. | (5Z,8Z,14Z)-11,12-dihydroxyicosatrienoic acid |
| 13-oxo-9,11-octadecadienoic acid | An oxooctadecadienoic acid that consists of 9Z,11E-octadecadienoic acid bearing an additional 13-keto substituent. In addtion it has been found as a natural product found in Carthamus oxyacantha. | 13-oxo-9Z,11E-ODE |
| 13(S)-HODE | An HODE (hydroxyoctadecadienoic acid) in which the double bonds are at positions 9 and 11 (E and Z geometry, respectively) and the hydroxy group is at position 13 (with S-configuration). | 13(S)-HODE |
| 14,15-dihydroxyeicosatrienoic acid | A DHET obtained by formal dihydroxylation across the 14,15-double bond of arachidonic acid. | (5Z,8Z,11Z)-14,15-dihydroxyicosatrienoic acid |
| 15-hydroperoxy-5,8,11,13-eicosatetraenoic acid, (s)-(e,z,z,z)-isomer | The (S)-enantiomer of 15-HPETE. | 15(S)-HPETE |
| 15-hydroxy-5,8,11,13-eicosatetraenoic acid | An optically active form of 15-HETE having 15(S)-configuration.. | 15(S)-HETE |
| 16-hydroxydehydroepiandrosterone | | 16alpha-hydroxydehydroepiandrosterone |
| 17-alpha-hydroxypregnenolone | A hydroxypregnenolone carrying an alpha-hydroxy group at position 17. | 17alpha-hydroxypregnenolone |
| 17-alpha-hydroxyprogesterone | A 17alpha-hydroxy steroid that is the 17alpha-hydroxy derivative of progesterone. | 17alpha-hydroxyprogesterone |
| 18-hydroxycorticosterone | A 18-hydroxy steroid that is corticosterone substituted by a hydroxy group at position 18. | 18-hydroxycorticosterone |
| 19-hydroxy-4-androstene-3,17-dione | | 19-hydroxyandrost-4-ene-3,17-dione |
| 19-hydroxytestosterone | A 3-oxo Delta(4)-steroid that is testosterone which is substituted by a hydroxy group at positions 19. | 19-hydroxytestosterone |
| 2-heptanone | A dialkyl ketone with methyl and pentyl as the alkyl groups. | heptan-2-one |
| 2-hydroxy-1,4-benzoquinone | The simplest member of the class of 2-hydroxy-1,4-benzoquinones, that is 1,4-benzoquinone in which a single hydrogen is replaced by a hydroxy group. | 2-hydroxy-1,4-benzoquinone |
| 2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | An imidazopyridine that is 1H--imidazo[4,5-b]pyridine which is substituted at positions 1, 2, and 6 by methyl, hydoxyamino, and phenyl groups, respectively. The active metabolite of the dietary carcinogen PhIP. | N-hydroxy-PhIP |
| 2-hydroxyestradiol | A 2-hydroxy steroid that consists of 17beta-estradiol having an additional hydroxy group at position 2. | 2-hydroxy-17beta-estradiol |
| 2-hydroxyphenylacetic acid | A hydroxy monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 2-hydroxyphenyl group. It is a metabolite of phenylalanine and is excreted in the urine of patients suffering from diseases like phenylketonuria. | (2-hydroxyphenyl)acetic acid |
| 2-hydroxypropylphosphonic acid | A phosphonic acid consisting of propan-2-ol with the phospho group at the 1-position. | 2-hydroxypropylphosphonic acid |
| 2-ketoarginine | A 2-oxo monocarboxylic acid that is 2-oxopentanoic acid in which one of the methyl hydrogens is substituted by a carbamimidamido group. | 5-guanidino-2-oxopentanoic acid zwitterion; 5-guanidino-2-oxopentanoic acid |
| 2-methoxyestradiol | A 17beta-hydroxy steroid, being 17beta-estradiol methoxylated at C-2. | 2-methoxy-17beta-estradiol |
| 2-methoxyestrone | A 17-oxo steroid that is estrone in which the hydrogen at position 2 has been replaced by a methoxy group. | 2-methoxyestrone |
| 2-naphthaldehyde | A naphthaldehyde that is naphthalene substituted by a formyl group at position 2. | 2-naphthaldehyde |
| 2-naphthalenemethanol | A naphthylmethanol that is methanol in which one of the methyl hydrogens has been replaced by a (2-naphthyl) group. | (2-naphthyl)methanol |
| 2-naphthoic acid | A naphthoic acid that is naphthalene carrying a carboxy group at position 2. | 2-naphthoic acid |
| 2-naphthol | A naphthol carrying a hydroxy group at position 2. | 2-naphthol |
| 2-phenylacetamide | A monocarboxylic acid amide that is acetamide substituted by a phenyl group at position 2. | 2-phenylacetamide |
| 2,2,2-trichloroethanol | | 2,2,2-trichloroethanol |
| 2,3-oxidosqualene | A 2,3-epoxysqualene in which the chiral centre has S configuration. It is converted into lanosterol by lanosterol synthase (EC 5.4.99.7) in a key rate-limiting step in the biosynthesis of chloesterol, steroid hormones, and vitamin D. | (S)-2,3-epoxysqualene |
| 2,5-dihydroxybenzaldehyde | A dihydroxybenzaldehyde carrying hydroxy groups at positions 2 and 5. | 2,5-dihydroxybenzaldehyde |
| 2,5-dihydroxybenzoic acid | A dihydroxybenzoic acid having the two hydroxy groups at the 2- and 5-positions. | 2,5-dihydroxybenzoic acid |
| 2,5-dihydroxypyridine | A dihydroxypyridine that is pyridine substituted by hydroxy groups at positions 2 and 5. | pyridine-2,5-diol |
| 2,8-dihydroxyadenine | A member of the class of 6-aminopurines that is adenine bearing two hydroxy substituents at positions 2 and 8. It is a highly insoluble metabolite of adenine that causes radiolucent urolithiasis. It is produced by individuals who suffer from adenine phosphoribosyltransferase (APRT) deficiency, a rare autosomal recessive error of purine metabolism. | 2,8-dihydroxyadenine; 2,8-dioxoadenine |
| 2'-deoxyadenosine | A purine 2'-deoxyribonucleoside having adenine as the nucleobase. | 2'-deoxyadenosine |
| 2'-deoxyadenosine triphosphate | A purine 2'-deoxyribonucleoside 5'-triphosphate having adenine as the nucleobase. | dATP |
| 2'-deoxyadenosine triphosphate | A purine 2'-deoxyribonucleoside 5'-diphosphate having adenine as the nucleobase. | dADP |
| 2'-deoxycytidine 5'-triphosphate | A 2'-deoxycytidine phosphate having cytosine as the nucleobase. | dCTP |
| 2'-deoxycytidine diphosphate | A 2'-deoxycytidine phosphate that is the 2'- deoxy derivative of cytidine 5'-diphosphate (CDP). | dCDP |
| 2'-deoxyguanosine 5'-phosphate | A purine 2'-deoxyribonucleoside 5'-monophosphate having guanine as the nucleobase. | 2'-deoxyguanosine 5'-monophosphate |
| 2'-deoxyinosine triphosphate | A deoxyinosine phosphate compound having a triphosphate group at the 5'-position. | dITP |
| 2'-deoxyuridylic acid | A pyrimidine 2'-deoxyribonucleoside 5'-monophosphate having uracil as the nucleobase. | dUMP |
| 20-alpha-dihydroprogesterone | | (20S)-20-hydroxypregn-4-en-3-one |
| 20-hydroxy-5,8,11,14-eicosatetraenoic acid | A HETE that consists of arachidonic acid bearing a hydroxy substituent at position 20. | 20-HETE |
| 20,22-dihydroxycholesterol | An oxysterol that is cholesterol substituted by hydroxy groups at positions 20 and 22 (the 20R,22R-stereoisomer). | (20R,22R)-20,22-dihydroxycholesterol |
| 21-deoxycortisol | A deoxycortisol that is 17xi-pregn-4-ene-3,20-dione substituted by a beta-hydroxy group at position 11 and an alpha-hydroxy group at position 17. It is a marker of virilizing adrenal hyperplasia caused by 21-hydroxylase deficiency. | 21-deoxycortisol |
| 21-hydroxypregnenolone | A hydroxypregnenolone that is pregnenolone which has been substituted by a hydroxy group at position 21. | 21-hydroxypregnenolone |
| 24-hydroxycholesterol | A 24-hydroxycholesterol that has S configuration at position 24. It is the major metabolic breakdown product of cholesterol in the brain. | (24S)-24-hydroxycholesterol |
| 24-methylenecholesterol | A 3beta-sterol having the structure of cholesterol with a methylene group at C-24. | 24-methylenecholesterol |
| 24,25-dihydrolanosterol | A 3beta-sterol formed from lanosterol by reduction across the C-24-C-25 double bond. | 24,25-dihydrolanosterol |
| 27-hydroxycholesterol | A 26-hydroxycholesterol in which the 25-position has R-configuration. | (25R)-cholest-5-ene-3beta,26-diol |
| 3-hydroxy-3-methylglutaryl-coenzyme a | A 3-hydroxy-3-methylglutaryl-CoA where the 3-hydroxy-3-methylglutaryl component has (S)-configuration. | (3S)-3-hydroxy-3-methylglutaryl-CoA |
| 3-hydroxyanthranilic acid | An aminobenzoic acid that is benzoic acid substituted at C-2 by an amine group and at C-3 by a hydroxy group. It is an intermediate in the metabolism of the amino acid tryptophan. | 3-hydroxyanthranilic acid |
| 3-hydroxybutyryl-coenzyme a | A hydroxybutanoyl-CoA having 3-hydroxybutanoyl as the S-acyl component. | 3-hydroxybutanoyl-CoA |
| 3-mercaptopyruvic acid | A 2-oxo monocarboxylic acid that is pyruvic acid substituted by a sulfanyl group at position 3. | 3-mercaptopyruvic acid |
| 3,3-dimethylallyl pyrophosphate | A prenol phosphate that is a phosphoantigen comprising the O-pyrophosphate of prenol. | prenyl diphosphate |
| 3,4-dihydroxymandelic acid | A catechol that is the 3,4-dihydroxy derivative of mandelic acid; a metabolite of L-dopa. | 3,4-dihydroxymandelic acid |
| 3,4-dihydroxyphenylacetaldehyde | A phenylacetaldehyde in which the 3 and 4 positions of the phenyl group are substituted by hydroxy groups. | 3,4-dihydroxyphenylacetaldehyde |
| 3,4-dihydroxyphenylglycol | A tetrol composed of ethyleneglycol having a 3,4-dihydroxyphenyl group at the 1-position. | 3,4-dihydroxyphenylethyleneglycol |
| 3,4-dihydroxyphenylglycolaldehyde | A hydroxyaldehyde consisting of phenylacetaldehyde having three hydroxy substituents located at the alpha-, 3- and 4-positions. It is a metabolite of noradrenaline. | 3,4-dihydroxymandelaldehyde |
| 3,7-dimethyluric acid | An oxopurine that is 7,9-dihydro-1H-purine-2,6,8(3H)-trione substituted by methyl groups at N-3 and N-7. | 3,7-dimethyluric acid |
| 3,7,12-trihydroxycoprostane | | 5beta-cholestane-3alpha,7alpha,12alpha-triol |
| 3'-cmp | A cytidine 3'-phosphate compound with a monophosphate group at the 3'-position. | 3'-CMP |
| 4-aminobutyraldehyde | An omega-aminoaldehyde that is butanal in which one of the hydrogens of the terminal methyl group has been replaced by an amino group. | 4-aminobutanal |
| 4-bromophenol | A bromophenol containing only hydroxy and bromo substituents that are para to one another. | 4-bromophenol |
| 4-hydroxyacetophenone | A monohydroxyacetophenone carrying a hydroxy substituent at position 4'. | 4'-hydroxyacetophenone |
| 4-hydroxybenzaldehyde | A hydroxybenzaldehyde that is benzaldehyde substituted with a hydroxy group at position C-4. | 4-hydroxybenzaldehyde |
| 4-hydroxyphenylacetaldehyde | | (4-hydroxyphenyl)acetaldehyde |
| 4-hydroxyphenylacetic acid | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 4-hydroxyphenyl group. | 4-hydroxyphenylacetic acid |
| 4-nitrophenol | A member of the class of 4-nitrophenols that is phenol in which the hydrogen that is para to the hydroxy group has been replaced by a nitro group. | 4-nitrophenol |
| 4-nitrophenylphosphate | An aryl phosphate resulting from the mono-esterification of phosphoric acid with 4-nitrophenol. | 4-nitrophenyl phosphate |
| 4-phosphoerythronate | The D-enantiomer of 4-phosphoerythronic acid. | 4-phospho-D-erythronic acid |
| 4,4-dimethyl-5-alpha-cholesta-(8,24)-dien-3-beta-ol | A 3beta-sterol formed formally by loss of a methyl group from the 14-position of lanosterol. | 14-demethyllanosterol |
| 4,4-dimethylcholesta-8,14,24-trienol | | 4,4-dimethyl-5alpha-cholesta-8,14,24-trien-3beta-ol |
| 5-acetylamino-6-formylamino-3-methyluracil | | 5-acetamido-6-formamido-3-methyluracil |
| 5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | An aminouracil that is D-ribitol in which the hydroxy group at position 1 is substituted by the 6-amino group of 5,6-diaminouracil. Early intermediate in bacterial riboflavin synthesis. | 5-amino-6-(D-ribitylamino)uracil |
| 5-diphosphomevalonic acid | The 5-diphospho derivative of (R)-mevalonic acid. | (R)-5-diphosphomevalonic acid |
| 5-formamidoimidazole-4-carboxamide ribotide | | 5-formamido-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide |
| 5-hydroxy-6,8,11,14-eicosatetraenoic acid | A HETE having a (5S)-hydroxy group and (6E)-, (8Z)-, (11Z)- and (14Z)-double bonds. | 5(S)-HETE |
| 5-hydroxy-6,8,11,14,17-eicosapentaenoic acid | A hydroxyicosapentaenoic acid that consists of 6E,8Z,11Z,14Z,17Z-icosapentaenoic acid with the hydroxy group located at position 5. | 5-HEPE |
| 5-hydroxyisourate | An oxopurine that is 5,7-dihydro-1H-purine-2,6,8(9H)-trione in which the hydrogen at position 5 is substituted by a hydroxy group. | 5-hydroxyisouric acid |
| 5-hydroxykynuramine | A hydroxykynurenamine where the hydroxy group is located at the 5-position. | 5-hydroxykynurenamine |
| 5-hydroxymethylcytosine | A nucleobase analogue that is cytosine in which the hydrogen at position 5 is replaced by a hydroxymethyl group. | 5-(hydroxymethyl)cytosine |
| 5-hydroxytryptophan | The L-enantiomer of 5-hydroxytryptophan. | 5-hydroxy-L-tryptophan zwitterion; 5-hydroxy-L-tryptophan |
| 5-methoxytryptamine | A member of the class of tryptamines that is the methyl ether derivative of serotonin. | 5-methoxytryptamine |
| 5-oxo-6,8,11,14-eicosatetraenoic acid | An oxoicosatetraenoic acid having a 5-oxo group; and (6E)-, (8Z), (11Z)- and (14Z)-double bonds. | 5-oxo-ETE |
| 5,10-methenyltetrahydrofolate | The 5,10-methenyl derivative of tetrahydrofolic acid arising from enzymatic cyclisation of 5-formyltetrahydrofolic acid. | (6R)-5,10-methenyltetrahydrofolic acid |
| 5,6-dihydrothymine | A pyrimidone obtained by formal addition of hydrogen across the 5,6-position of thymine. | 5,6-dihydrothymine |
| 5,6-dihydroxy-2-indolylcarboxylic acid | A dihydroxyindole that is indole-2-carboxylic acid substituted by hydroxy groups at positions 5 and 6. | 5,6-dihydroxyindole-2-carboxylic acid |
| 5,6-dihydroxyindole | | 5,6-dihydroxyindole |
| 5,6-epoxy-8,11,14-eicosatrienoic acid | An EET obtained by formal epoxidation of the 5,6-double bond of arachidonic acid. | 5,6-EET |
| 5'-deoxyadenosine | A 5'-deoxyribonucleoside compound having adenosine as the nucleobase. | 5'-deoxyadenosine |
| 5'-methylthioadenosine | Adenosine with the hydroxy group at C-5' substituted with a methylthio (methylsulfanyl) group. | 5'-S-methyl-5'-thioadenosine |
| 5beta-pregnane-3,20-dione | A C21-steroid that is 5beta-pregnane with oxo groups at positions 3 and 20. | 5beta-pregnane-3,20-dione |
| 6-hydroxymelatonin | A member of the class of tryptamines that is melatonin with a hydroxy group substituent at position 6. | 6-hydroxymelatonin |
| 6-hydroxynicotinic acid | A monohydroxypyridine that is the 6-hydroxy derivative of nicotinic acid. | 6-hydroxynicotinic acid |
| 6-ketoprostaglandin f1 alpha | A prostaglandin Falpha that is prostaglandin F1alpha bearing a keto substituent at the 6-position. | 6-oxoprostaglandin F1alpha |
| 6-phosphonoglucono-delta-lactone | An aldonolactone phosphate comprising D-glucono-1,5-lactone having the phosphate group at the 6-position. | 6-O-phosphono-D-glucono-1,5-lactone |
| 6,6-dimethyl-2-methylenebicyclo(3.1.1)heptan-3-ol | A pinane monoterpenoid that is a bicyclo[3.1.1]heptane substituted by two methyl groups at position 6, a methylidene group at position 2 and a hydroxy group at position 3. | pinocarveol |
| 7 alpha-hydroxy-4-cholesten-3-one | A cholestanoid consisting of a cholesterol core having an oxo group at the 3-position, a C=C bond at the 4,5-position and an alpha-hydroxy group at the 7-position. | 7alpha-hydroxycholest-4-en-3-one |
| 7-dehydrocholesterol | | cholesta-5,7-dien-3beta-ol |
| 7-methylxanthine | An oxopurine that is xanthine in which the hydrogen attached to the nitrogen at position 7 is replaced by a methyl group. It is an intermediate metabolite in the synthesis of caffeine. | 7-methylxanthine |
| 7,8-dihydroneopterin | A neopterin where positions C-7 and C-8 have been hydrogenated. | 7,8-dihydroneopterin |
| 8,9-epoxyeicosatrienoic acid | An EET obtained by formal epoxidation of the 8,9-double bond of arachidonic acid. | 8,9-EET |
| 9-hydroxy-10,12-octadecadienoic acid | A HODE that consists of (10E,12Z)-octadecadienoic acid with the hydroxy substituent located at position 9. | 9-HODE; alpha-dimorphecolic acid |
| acetaldehyde | The aldehyde formed from acetic acid by reduction of the carboxy group. It is the most abundant carcinogen in tobacco smoke. | acetaldehyde |
| acetoacetyl coa | A 3-oxoacyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of acetoacetic acid. | acetoacetyl-CoA |
| acetol | A propanone that is acetone in which one of the methyl hydrogens is replaced by a hydroxy group. | hydroxyacetone |
| acetyl adenylate | | 5'-acetylphosphoadenosine |
| acetyl phosphate | An acyl monophosphate in which the acyl group specified is acetyl. | acetyl dihydrogen phosphate |
| acetylgalactosamine | The D-enantiomer of N-acetylgalactosamine. | N-acetyl-D-galactosamine |
| acryloyl-coenzyme a | The S-acryloyl derivative of coenzyme A. | acryloyl-CoA |
| adenine | The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. | adenine |
| adenosine 3'-phosphate-5'-phosphate | An adenosine bisphosphate having two monophosphate groups at the 3'- and 5'-positions. | adenosine 3',5'-bismonophosphate |
| adenosine diphosphate ribose | A nucleotide-sugar having ADP as the nucleotide fragment and D-ribofuranos-5-yl as the sugar component. | ADP-D-ribose |
| adenosine phosphosulfate | An adenosine 5'-phosphate having a sulfo group attached to one the phosphate OH groups. | 5'-adenylyl sulfate |
| adrenic acid | A docosatetraenoic acid in which the four double bonds are located at positions 7, 10, 13 and 16 (geometry unspecified). | 7,10,13,16-docosatetraenoic acid |
| agmatine | | agmatine |
| aica ribonucleotide | A 1-(phosphoribosyl)imidazolecarboxamide that is acadesine in which the hydroxy group at the 5' position has been converted to its monophosphate derivative. | AICA ribonucleotide |
| aldosterone | A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. | aldosterone |
| allantoic acid | A member of the class of ureas that consists of acetic acid in which the two methyl hydrogens are replaced by carbamoylamino groups respectively. | allantoic acid |
| allysine | An optically active form of allysine having L-configuration. | L-allysine zwitterion; L-allysine |
| alpha-hydroxyglutarate | A 2-hydroxydicarboxylic acid that is glutaric acid in which one hydrogen alpha- to a carboxylic acid group is substituted by a hydroxy group. | 2-hydroxyglutaric acid |
| alpha-keto-delta-guanidinovaleric acid | A 2-oxo monocarboxylic acid that is 2-oxopentanoic acid in which one of the methyl hydrogens is substituted by a carbamimidamido group. | 5-guanidino-2-oxopentanoic acid zwitterion; 5-guanidino-2-oxopentanoic acid |
| alpha-ketoadipic acid | An oxo dicarboxylic acid that is adipic acid substituted by an oxo group at position 2. | 2-oxoadipic acid |
| alpha-linolenic acid | A linolenic acid with cis-double bonds at positions 9, 12 and 15. Shown to have an antithrombotic effect. | alpha-linolenic acid |
| alpha-ribazole | | alpha-ribazole |
| aminoacetone | A propanone consisting of acetone having an amino group at the 1-position. | aminoacetone |
| aminoethylphosphonic acid | A phosphonic acid in which the hydrogen attached to the phosphorus of phosphonic acid is substituted by a 2-aminoethyl group. | (2-aminoethyl)phosphonic acid zwitterion; (2-aminoethyl)phosphonic acid |
| aminoimidazole carboxamide | An aminoimidazole in which the amino group is at C-5 with a carboxamido group at C-4. | 5-aminoimidazole-4-carboxamide |
| aminolevulinic acid | The simplest delta-amino acid in which the hydrogens at the gamma position are replaced by an oxo group. It is metabolised to protoporphyrin IX, a photoactive compound which accumulates in the skin. Used (in the form of the hydrochloride salt)in combination with blue light illumination for the treatment of minimally to moderately thick actinic keratosis of the face or scalp. | 5-aminolevulinic acid; 5-ammoniolevulinate |
| ammonium hydroxide | An azane that consists of a single nitrogen atom covelently bonded to three hydrogen atoms. | ammonia |
| androstane-3,17-dione, (5alpha)-isomer | The 5alpha-stereoisomer of androstane-3,17-dione. | 5alpha-androstane-3,17-dione |
| androstane-3,17-dione, (5beta)-isomer | An androstane-3,17-dione with a 5beta-configuration. | 5beta-androstane-3,17-dione |
| androstenediol | A 3beta-hydroxy-Delta(5)-steroid that is 3beta-hydroxyandrost-5-ene carrying an additional hydroxy group at position 17beta. | androst-5-ene-3beta,17beta-diol |
| androstenedione | A 3-oxo Delta(4)-steroid that is androst-4-ene substituted by oxo groups at positions 3 and 17. It is a steroid hormone synthesized in the adrenal glands and gonads. | androst-4-ene-3,17-dione |
| androsterone | An androstanoid that is 5alpha-androstane having a hydroxy substituent at the 3alpha-position and an oxo group at the 17-position. It is a metabolite of dehydroepiandrosterone . | androsterone |
| androsterone glucuronide | A steroid glucosiduronic acid having androsterone as the steroid component. | androsterone 3-glucosiduronic acid |
| androsterone sulfate | A steroid sulfate that is the 3-sulfate of androsterone. | androsterone sulfate |
| anserine | A dipeptide comprising of beta-alanine and 3-methyl-L-histidine units. | anserine zwitterion; anserine |
| anthranilic acid | An aminobenzoic acid that is benzoic acid having a single amino substituent located at position 2. It is a metabolite produced in L-tryptophan-kynurenine pathway in the central nervous system. | anthranilic acid |
| arabinose | The six-membered ring form of L-arabinose. | L-arabinopyranose |
| arachidonic acid | A long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. | arachidonic acid |
| arachidonic acid 5-hydroperoxide | An icosatetraenoic acid in which the double bonds are located at the 6-7, 8-9, 11-12, and 14-15 positions and have E, Z, Z, and Z geometry, respectively, and in which the pro-S hydrogen is substituted by a hydroperoxy group. | 5(S)-HPETE |
| arachidonic acid omega-9 hydroperoxide | The (S)-enantiomer of 12-HPETE. | 12(S)-HPETE |
| arginine | An L-alpha-amino acid that is the L-isomer of arginine. | L-arginine |
| asparagine | An optically active form of asparagine having L-configuration. | L-asparagine zwitterion; L-asparagine |
| aspartic acid | The L-enantiomer of aspartic acid. | L-aspartic acid |
| benzo(a)pyrene | An ortho- and peri-fused polycyclic arene consisting of five fused benzene rings. | benzo[a]pyrene |
| beta carotene | A cyclic carotene obtained by dimerisation of all-trans-retinol. A strongly-coloured red-orange pigment abundant in plants and fruit and the most active and important provitamin A carotenoid. | beta-carotene |
| beta-glucono-1,5-lactone | An aldono-1,5-lactone obtained from D-gluconic acid. | D-glucono-1,5-lactone |
| beta-sulfopyruvic acid | A carboxyalkanesulfonic acid comprising pyruvic acid with a sulfo group attached at the C-3 position. | 3-sulfopyruvic acid |
| beta-ureidoisobutyric acid | A ureidocarboxylic acid that is 2-methylpropanoic acid substituted by a carbamoylamino group at position 3. | 3-ureidoisobutyric acid |
| betaine aldehyde | A quaternary ammonium ion that is nitrogen substituted by three methyl groups and a 2-oxoethyl group. It is an intermediate in the metabolism of amino acids like glycine, serine and threonine. | betaine aldehyde |
| bilirubin | A member of the class of biladienes that is a linear tetrapyrrole with the dipyrrole units being of both exovinyl and endovinyl type. A product of heme degradation, it is produced in the reticuloendothelial system by the reduction of biliverdin and transported to the liver as a complex with serum albumin. | bilirubin IXalpha |
| biocytin | A monocarboxylic acid amide that results from the formal condensation of the carboxylic acid group of biotin with the N(6)-amino group of L-lysine. | biocytin zwitterion; biocytin |
| biotin | An organic heterobicyclic compound that consists of 2-oxohexahydro-1H-thieno[3,4-d]imidazole having a valeric acid substituent attached to the tetrahydrothiophene ring. The parent of the class of biotins. | biotin |
| bromobenzene | The simplest member of the class of bromobenzenes, that is benzene in which a single hydrogen has been substituted by a bromine. A liquid at room temperature (m.p. -30degreeC; b.p.760 156degreeC), it is used as a solvent, particularly for large-scale crystallisations, and for the introduction of phenyl groups in organic synthesis. | bromobenzene |
| butyraldehyde | A member of the class of butanals that consists of propane bearing a formyl substituent at the 1-position. The parent of the class of butanals. | butanal |
| butyryl-coenzyme a | A short-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of butyric acid. | butyryl-CoA |
| cadaverine | An alkane-alpha,omega-diamine comprising a straight-chain pentane core with amino substitutents at positions 1 and 5. A colourless syrupy liquid diamine with a distinctive unpleasant odour, it is a homologue of putresceine and is formed by the bacterial decarboxylation of lysine that occurs during protein hydrolysis during putrefaction of animal tissue. It is also found in plants such as soyabean. | cadaverine |
| caffeic acid | The trans-isomer of caffeic acid. | trans-caffeic acid |
| caffeine | A trimethylxanthine in which the three methyl groups are located at positions 1, 3, and 7. A purine alkaloid that occurs naturally in tea and coffee. | caffeine |
| calcifediol | A hydroxycalciol that is calciol in which the hydrogen at position 25 has been replaced by a hydroxy group. A prehormone resulting from the oxidation of calciol in the liver, it is further hydroxylated in the kidney to give calcitriol, the active form of vitamin D3. | calcidiol |
| calcitriol | A hydroxycalciol that is calcidiol in which the pro-S hydrogen of calcidiol is replaced by a hydroxy group. It is the active form of vitamin D3, produced fom calciol via hydoxylation in the liver to form calcidiol, which is subsequently oxidised in the kidney to give calcitriol. | calcitriol |
| campesterol | | campesterol |
| carbamyl phosphate | | carbamoyl phosphate |
| carbon monoxide | A one-carbon compound in which the carbon is joined only to a single oxygen. It is a colourless, odourless, tasteless, toxic gas. | carbon monoxide |
| carbonic acid | | carbonic acid |
| carboxyaminoimidazole ribotide | | 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylic acid |
| carnitine | An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. | carnitine |
| carnosine | A dipeptide that is the N-(beta-alanyl) derivative of L-histidine. | carnosine zwitterion; carnosine |
| cdp ethanolamine | A phosphoethanolamine consisting of ethanolamine having a cytidine 5'-diphosphate moiety attached to the oxygen. | CDP-ethanolamine |
| cerium | A cholesterol ester obtained by the formal condensation of the hydroxy group of cholesterol with the carboxy group of myristic acid. | cholesteryl myristate |
| cerium | The (9Z,12Z)-stereoisomer of cholesteryl octadeca-9,12-dienoate. | cholesteryl linoleate |
| chenodeoxycholic acid | A dihydroxy-5beta-cholanic acid that is (5beta)-cholan-24-oic acid substituted by hydroxy groups at positions 3 and 7 respectively. | chenodeoxycholic acid |
| chloral hydrate | An organochlorine compound that is the hydrate of trichloroacetaldehyde. | chloral hydrate |
| cholest-5-en-3 beta,7 alpha-diol | The 7alpha-hydroxy derivative of cholesterol. | 7alpha-hydroxycholesterol |
| cholestane-3,7,12,26-tetrol | | 5beta-cholestane-3alpha,7alpha,12alpha,26-tetrol |
| cholesteryl arachidonate | A cholesterol ester obtained by the formal condensation of the hydroxy group in cholesterol with the carboxy group of arachidonic acid. | cholesteryl arachidonate |
| cholesteryl oleate | The (Z)-stereoisomer of cholesteryl octadec-9-enoate. | cholesteryl oleate |
| cholesteryl palmitate | A cholesterol ester obtained by the formal condensation of cholesterol with palmitic acid. | cholesteryl palmitate |
| cholic acid | A bile acid that is 5beta-cholan-24-oic acid bearing three alpha-hydroxy substituents at position 3, 7 and 12. | cholic acid |
| choline | A choline that is the parent compound of the cholines class, consisting of ethanolamine having three methyl substituents attached to the amino function. | choline |
| cifostodine | A 2',3'-cyclic pyrimidine nucleotide in which cytidine is the parent nucleoside. | 2',3'-cyclic CMP |
| citrulline | The L-enantiomer of citrulline. | L-citrulline zwitterion; L-citrulline |
| cocaine | A tropane alkaloid obtained from leaves of the South American shrub Erythroxylon coca. | cocaine |
| coenzyme a | A thiol comprising a panthothenate unit in phosphoric anhydride linkage with a 3',5'-adenosine diphosphate unit; and an aminoethanethiol unit. | coenzyme A |
| colfosceril palmitate | A phosphatidylcholine 32:0 in which the 1- and 2-acyl groups are specified as hexadecanoyl (palmitoyl). A synthetic phospholipid used in liposomes and lipid bilayers to study biological membranes. It is also a major constituent of pulmonary surfactants. | 1,2-dihexadecanoyl-sn-glycero-3-phosphocholine |
| coniferyl alcohol | A phenylpropanoid that is one of the main monolignols, produced by the reduction of the carboxy functional group in cinnamic acid and the addition of a hydroxy and a methoxy substituent to the aromatic ring. | coniferol |
| coproporphyrinogen iii | | coproporphyrinogen III |
| corticosterone | A 21-hydroxy steroid that consists of pregn-4-ene substituted by hydroxy groups at positions 11 and 21 and oxo groups at positions 3 and 20. Corticosterone is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands. | corticosterone |
| cortisone | A C21-steroid that is pregn-4-ene substituted by hydroxy groups at positions 17 and 21 and oxo group at positions 3, 11 and 20. | cortisone |
| cortodoxone | A deoxycortisol that is cortisol in which the hydroxy group at position 11 has been replaced by a hydrogen. | 11-deoxycortisol |
| creatine | A glycine derivative having methyl and amidino groups attached to the nitrogen. | creatine zwitterion; creatine |
| cyclic gmp | A 3',5'-cyclic purine nucleotide in which the purine nucleobase is specified as guanidine. | 3',5'-cyclic GMP |
| cyclopropylamine | A primary aliphatic amine that consists of cyclopropane bearing a single amino substituent. | cyclopropylamine |
| cyclosporine | A keto-disaccharide that is beta-D-galactosyl-(1->4)-beta-D-glucose in which the hydroxy group at position 3 of the galactosyl moiety has been oxidised to the corresponding ketone. | 3'-ketolactose |
| cyromazine | | cyromazine |
| cysteamine | An amine that consists of an ethane skeleton substituted with a thiol group at C-1 and an amino group at C-2. | cysteamine |
| cysteine sulfinic acid | The organosulfinic acid arising from oxidation of the sulfhydryl group of L-cysteine. | 3-sulfino-L-alanine |
| cystine | The L-enantiomer of the sulfur-containing amino acid cystine. | L-cystine zwitterion; L-cystine |
| cytidine | A pyrimidine nucleoside in which cytosine is attached to ribofuranose via a beta-N(1)-glycosidic bond. | cytidine |
| cytidine diphosphate | A pyrimidine ribonucleoside 5'-diphosphate having cytosine as the nucleobase. | CDP |
| cytidine diphosphate choline | A member of the class of phosphocholines that is the chloine ester of CDP. It is an intermediate obtained in the biosynthetic pathway of structural phospholipids in cell membranes. | CDP-choline |
| cytidine diphosphate choline | A member of the class of phosphocholines that is the chloine ester of CDP. It is an intermediate obtained in the biosynthetic pathway of structural phospholipids in cell membranes. | CDP-choline |
| cytidine monophosphate | A pyrimidine ribonucleoside 5'-monophosphate having cytosine as the nucleobase. | cytidine 5'-monophosphate |
| cytidine monophosphate n-acetylneuraminic acid | A nucleotide sugar used as a donor by glycosyltransferases for the synthesis of sugar chains | CMP-N-acetyl-beta-neuraminic acid |
| cytidine triphosphate | | CTP |
| cytosine | An aminopyrimidine that is pyrimidin-2-one having the amino group located at position 4. | cytosine |
| d-aspartic acid | The D-enantiomer of aspartic acid. | D-aspartic acid |
| d-glutamate | An optically active form of glutamic acid having D-configuration. | D-glutamic acid |
| d-glutamine | The D-enantiomer of glutamine. | D-glutamine zwitterion; D-glutamine |
| D-proline | The D-enantiomer of proline. | D-proline zwitterion; D-proline |
| dehydroalanine | A 2,3-dehydroamino acid that is alanine which has been dehydrogenated to introduce a double bond between positions 2 and 3. | 2-aminoacrylic acid; 2-ammonioprop-2-enoate |
| dehydroascorbic acid | Dehydroascorbic acid having the L-configuration. | L-dehydroascorbic acid |
| dehydroepiandrosterone | An androstanoid that is androst-5-ene substituted by a beta-hydroxy group at position 3 and an oxo group at position 17. It is a naturally occurring steroid hormone produced by the adrenal glands. | dehydroepiandrosterone |
| dehydroepiandrosterone sulfate | A steroid sulfate that is the 3-sulfooxy derivative of dehydroepiandrosterone. | dehydroepiandrosterone sulfate |
| deoxycytidine | A pyrimidine 2'-deoxyribonucleoside having cytosine as the nucleobase. | 2'-deoxycytidine |
| deoxycytidine monophosphate | A pyrimidine 2'-deoxyribonucleoside 5'-monophosphate having cytosine as the nucleobase. | 2'-deoxycytosine 5'-monophosphate |
| deoxyguanosine | A purine 2'-deoxyribonucleoside having guanine as the nucleobase. | 2'-deoxyguanosine |
| deoxyguanosine triphosphate | A purine 2'-deoxyribonucleoside 5'-triphosphate having guanine as the nucleobase. | dGTP |
| deoxyinosine | A purine 2'-deoxyribonucleoside that is inosine in which the hydroxy group at position 2' is replaced by a hydrogen. | 2'-deoxyinosine |
| deoxyinosine monophosphate | A deoxyinosine phosphate that is 5'-inosinic acid in which the hydroxy group at position 2' by a hydrogen atom. | 2'-deoxyinosine-5'-monophosphate |
| deoxyribose | A deoxypentose that is D-ribose in which the hydroxy group at position C-2 is replaced by hydrogen. | 2-deoxy-D-ribose |
| deoxyuridine | A pyrimidine 2'-deoxyribonucleoside having uracil as the nucleobase. | 2'-deoxyuridine |
| deoxyuridine triphosphate | A deoxyuridine phosphate having a triphosphate group at the 5'-position. | dUTP |
| dephosphocoenzyme a | An adenosine 5'-phosphate that is coenzyme A in which the phosphate group at position 3' has been replaced by a hydrogen atom. It is an intermediate metabolite in pantothenate and CoA biosynthesis. | 3'-dephospho-CoA |
| desmosterol | A cholestanoid that is cholesta-5,24-diene substituted by a beta-hydroxy group at position 3. It is an intermediate metabolite obtained during the synthesis of cholesterol. | desmosterol |
| desoxycorticosterone | A mineralocorticoid that is progesterone substituted at position 21 by a hydroxy group. | 11-deoxycorticosterone |
| diadenosine tetraphosphate | A diadenosyl tetraphosphate compound having the two 5'-adenosyl residues attached at the P(1)- and P(4)-positions. | P(1),P(4)-bis(5'-adenosyl) tetraphosphate |
| diadenosine triphosphate | A diadenosyl triphosphate having the two 5'-adenosyl residues attached at the P(1)- and P(3)-positions. | P(1),P(3)-bis(5'-adenosyl) triphosphate |
| diethyl phosphate | A dialkyl phosphate having ethyl as the alkyl group. | diethyl hydrogen phosphate |
| diguanosine tetraphosphate | A purine ribonucleoside 5'-tetraphosphate compound having 5'-guanosyl residues at the P(1)- and P(4)-positions. | P(1),P(4)-bis(5'-guanosyl) tetraphosphate |
| dihydroferulic acid | A monocarboxylic acid that is propanoic acid in which one of the hydrogens at position 3 has been replaced by a 4-hydroxy-3-methoxyphenyl group. | dihydroferulic acid |
| dihydrofolate | A folic acid derivative acted upon by dihydrofolate reductase to produce tetrahydrofolic acid. It interacts with bacteria during cell division and is targeted by various drugs to prevent nucleic acid synthesis. | dihydrofolic acid |
| dihydrolipoamide | | dihydrolipoamide |
| dihydroneopterin triphosphate | | 7,8-dihydroneopterin 3'-triphosphate |
| dihydrosphingosine 1-phosphate | A sphingoid 1-phosphate that is the monophosphorylated derivative of sphinganine. | sphinganine 1-phosphate |
| dihydrotestosterone | A 17beta-hydroxy steroid that is testosterone in which the 4,5 double bond has been reduced to a single bond with alpha-configuration at position 5. | 17beta-hydroxy-5alpha-androstan-3-one |
| dihydrouracil | A pyrimidine obtained by formal addition of hydrogen across the 5,6-position of uracil. | 5,6-dihydrouracil |
| dihydroxyacetone | A ketotriose consisting of acetone bearing hydroxy substituents at positions 1 and 3. The simplest member of the class of ketoses and the parent of the class of glycerones. | dihydroxyacetone |
| dihydroxyacetone phosphate | A member of the class of glycerone phosphates that consists of glycerone bearing a single phospho substituent. | dihydroxyacetone phosphate |
| dihydroxycoprostane | | 5beta-cholestane-3alpha,7alpha-diol |
| diiodotyrosine | A diiodotyrosine that is L-tyrosine carrying iodo-substituents at positions C-3 and C-5 of the benzyl group. It is an intermediate in the thyroid hormone synthesis. | 3,5-diiodo-L-tyrosine |
| dimethylglycine | An N-methylglycine that is glycine carrying two N-methyl substituents. | N,N-dimethylglycine zwitterion; N,N-dimethylglycine |
| dimyristoylphosphatidylcholine | A 1,2-diacyl-sn-glycero-3-phosphocholine where the two phosphatidyl acyl groups are specified as tetradecanoyl (myristoyl). | 1,2-di-O-myristoyl-sn-glycero-3-phosphocholine |
| dinoprost | A prostaglandins Falpha that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. It is a naturally occurring prostaglandin used to induce labor. | prostaglandin F2alpha |
| dinoprostone | Prostaglandin F2alpha in which the hydroxy group at position 9 has been oxidised to the corresponding ketone. Prostaglandin E2 is the most common and most biologically potent of mammalian prostaglandins. | prostaglandin E2 |
| diquafosol | A pyrimidine ribonucleoside 5'-tetraphosphate compound having 5'-uridinyl residues at the P(1)- and P(4)-positions. | P(1),P(4)-bis(uridin-5'-yl) tetraphosphate |
| docosahexaenoate | A docosahexaenoic acid having six cis-double bonds at positions 4, 7, 10, 13, 16 and 19. | all-cis-docosa-4,7,10,13,16,19-hexaenoic acid |
| dopaquinone | An L-phenylalanine derivative in which the phenyl group of L-phenylalanine is replaced by a 3,4-dioxocyclohexa-1,5-dien-1-yl group. | L-dopaquinone zwitterion; L-dopaquinone |
| dyspropterin | A tetrahydropterin that is 2-amino-5,6,7,8-tetrahydropteridin-4(3H)-one substituted by a 2-oxopropanoyl group at position 6. | dyspropterin |
| ecgonine methyl ester | The O-debenzoyl analogue of cocaine. | ecgonine methyl ester |
| eicosapentaenoic acid | An icosapentaenoic acid having five cis-double bonds at positions 5, 8, 11, 14 and 17. | all-cis-5,8,11,14,17-icosapentaenoic acid |
| epietiocholanolone | A 3beta-hydroxy steroid that is 5beta-androstane substituted by a hydroxy group at position 3beta and an oxo group at position 17. It is a metabolite of testosterone. | epietiocholanolone |
| epoprostenol | | prostaglandin I2 |
| erythrose 4-phosphate | An erythrose phosphate that is D-erythrose carrying a phosphate group at position 4. It is an intermediate in the pentose phosphate pathway and Calvin cycle. | D-erythrose 4-phosphate |
| estradiol-3-glucuronide | A steroid glucosiduronic acid that consists of 17beta-estradiol having a beta-glucuronyl residue attached at position 3 via a glycosidic linkage. | 17beta-estradiol 3-glucosiduronic acid |
| estriol | A 3-hydroxy steroid that is estra-1,3,5(10)-trien-3-ol substituted by additional hydroxy groups at positions 16 and 17 (16alpha,17beta-stereoisomer). | estriol |
| estrone | A 17-oxo steroid that is estra-1,3,5(10)-triene substituted by an hydroxy group at position 3 and an oxo group at position 17. | estrone |
| estrone sulfate | A steroid sulfate that is the 3-sulfate of estrone. | estrone 3-sulfate |
| estrone-3-glucuronide | The 3-beta-D-glucuronide of estrone. | estrone 3-O-(beta-D-glucuronide) |
| ethanolamine | A member of the class of ethanolamines that is ethane with an amino substituent at C-1 and a hydroxy substituent at C-2, making it both a primary amine and a primary alcohol. | ethanolamine |
| ethylene dibromide | A bromoalkane that is ethane carrying bromo substituents at positions 1 and 2. It is produced by marine algae. | 1,2-dibromoethane |
| ethylene glycol | A 1,2-glycol compound produced via reaction of ethylene oxide with water. | ethylene glycol |
| ethylene oxide | A saturated organic heteromonocyclic parent that is a three-membered heterocycle of two carbon atoms and one oxygen atom. | oxirane |
| etiocholanolone | An androstanoid that is 5beta-androstane substituted by an alpha-hydroxy group at position 3 and an oxo group at position 17. It is a metabolite of testosterone in mammals. | 3alpha-hydroxy-5beta-androstan-17-one |
| farnesyl pyrophosphate | The trans,trans-stereoisomer of farnesyl diphosphate. | 2-trans,6-trans-farnesyl diphosphate |
| flavin mononucleotide | A flavin mononucleotide that is riboflavin (vitamin B2) in which the primary hydroxy group has been converted to its dihydrogen phosphate ester. | FMN |
| flavin-adenine dinucleotide | A flavin adenine dinucleotide in which the substituent at position 10 of the flavin nucleus is a 5'-adenosyldiphosphoribityl group. | FAD |
| folic acid | An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. | folic acid |
| formaldehyde | An aldehyde resulting from the formal oxidation of methanol. | formaldehyde |
| fructose 2,6-diphosphate | A D-fructofuranose 2,6-bisphosphate with a beta-configuration at the anomeric centre. | beta-D-fructofuranose 2,6-bisphosphate |
| fructose-1,6-diphosphate | A D-fructofuranose 1,6-bisphosphate with a beta-configuration at the anomeric position. | beta-D-fructofuranose 1,6-bisphosphate |
| fucose | The pyranose form of L-fucose. | L-fucopyranose |
| g(m3) ganglioside | A sialotriaosylceramide consisting of beta-D-GalNAc-(1->4)-[alpha-Neu5Ac-(2->3)]-beta-D-Gal-(1->4)-beta-D-Glc attached to the primary hydroxy function of ceramide(d18:1/24:1(15Z)). | 3)-beta-D-Gal-(1->4)-beta-D-Glc-(1<->1')-Cer(d18:1/24:1(15Z)).html>alpha-Neu5Ac-(2->3)-beta-D-Gal-(1->4)-beta-D-Glc-(1<->1')-Cer(d18:1/24:1(15Z)); ganglioside GM3 |
| galactitol | An optically inactive hexitol having meso-configuration. | galactitol |
| galactose | A galactopyranose having D-configuration. | D-galactopyranose |
| galactose | A D-galactopyranose having beta-configuration at the anomeric centre. | beta-D-galactose |
| galactose | D-Galactopyranose having alpha-configuration at the anomeric centre. | alpha-D-galactose |
| galactose-1-phosphate | A D-galactopyranose 1-phosphate having alpha-configuration at the anomeric centre. | alpha-D-galactose 1-phosphate |
| gamma-glutamyl phosphate | | L-gamma-glutamyl phosphate |
| gamma-glutamylcysteine | A molecular entity formed when L-cysteine amino group binds to the gamma-carbonyl of L-glutamic acid. | L-gamma-glutamyl-L-cysteine |
| gamma-guanidinobutyric acid | The 4-guanidino derivative of butanoic acid. | 4-guanidinobutanoic acid zwitterion; 4-guanidinobutanoic acid; 4-guanidinobutyric acid |
| gamma-linolenic acid | A C18, omega-6 acid fatty acid comprising a linolenic acid having cis- double bonds at positions 6, 9 and 12. | gamma-linolenic acid |
| gdp-4-keto-6-deoxymannose | A GDP-sugar having 4-dehydro-6-deoxy-alpha-D-mannose as the sugar portion. | GDP-4-dehydro-6-deoxy-alpha-D-mannose |
| geranyl pyrophosphate | The diphosphate of the polyprenol compound geraniol. | geranyl diphosphate |
| geranylgeranyl pyrophosphate | The all-trans-isomer of geranylgeranyl diphosphate. | 2-trans,6-trans,10-trans-geranylgeranyl diphosphate |
| gibberellic acid | A C19-gibberellin that is a pentacyclic diterpenoid responsible for promoting growth and elongation of cells in plants. Initially identified in Gibberella fujikuroi,it differs from gibberellin A1 in the presence of a double bond between C-3 and C-4. | gibberellin A3 |
| glucosamine | A D-glucosamine whose structure comprises D-glucopyranose having an amino substituent at position 2. | 2-amino-2-deoxy-D-glucopyranose |
| glucose | D-Glucopyranose having alpha-configuration at the anomeric centre. | alpha-D-glucose |
| glucose, (beta-d)-isomer | D-Glucopyranose with beta configuration at the anomeric centre. | beta-D-glucose |
| glutamic acid | An optically active form of glutamic acid having L-configuration. | L-glutamic acid |
| glutamine | An optically active form of glutamine having L-configuration. | L-glutamine zwitterion; L-glutamine |
| glutaryl-coenzyme a | An omega-carboxyacyl-CoA that results from the formal condensation of the thiol group of coenzyme A with one of the carboxy groups of glutaric acid. | glutaryl-CoA |
| glutathione disulfide | | glutathione disulfide |
| glutaurine | A dipeptide resulting from the formal condensation of the amino group of taurine with the gamma-carboxy group of L-glutamic acid. It was initially found in the parathyroid in 1980 and later in the brain of mammals. | glutaurine zwitterion; glutaurine |
| glyceraldehyde 3-phosphate | | D-glyceraldehyde 3-phosphate |
| glycerate 1,3-biphosphate | The (R)-enantiomer of 3-phosphoglyceroyl dihydrogen phosphate. | 3-phospho-D-glyceroyl dihydrogen phosphate |
| glycerol | A triol with a structure of propane substituted at positions 1, 2 and 3 by hydroxy groups. | glycerol |
| glycerylphosphorylcholine | A member of the class of phosphocholines that is the choline ester of sn-glycero-3-phosphate. It is one of the major osmolyte in the renal medullary cells. | choline alfoscerate |
| glycocyamine | The N-amidino derivative of glycine. | guanidinoacetic acid zwitterion; guanidinoacetic acid |
| glyoxylic acid | A 2-oxo monocarboxylic acid that is acetic acid bearing an oxo group at the alpha carbon atom. | glyoxylic acid |
| guanine | A 2-aminopurine carrying a 6-oxo substituent. | guanine |
| guanosine diphosphate | A purine ribonucleoside 5'-diphosphate resulting from the formal condensation of the hydroxy group at the 5' position of guanosine with pyrophosphoric acid. | GDP |
| guanosine diphosphate mannose | The alpha-anomer of GDP-D-mannose. | GDP-alpha-D-mannose |
| guanosine monophosphate | A purine ribonucleoside 5'-monophosphate having guanine as the nucleobase. | guanosine 5'-monophosphate |
| guanosine pentaphosphate | A guanosine bisphosphate having a diphosphate at the 3'-position and a triphosphate at the 5'-position. | guanosine 3'-diphosphate 5'-triphosphate |
| guanosine tetraphosphate | A guanosine bisphosphate having diphosphate groups at both the 3' and 5'-positions. | guanosine 3',5'-bis(diphosphate) |
| guanosine triphosphate | | GTP |
| hexadecanal | | hexadecanal |
| hexanoyl-coenzyme a | A medium-chain fatty acyl-CoA having hexanoyl as the S-acyl group. | hexanoyl-CoA |
| histamine | A member of the class of imidazoles that is 1H-imidazole substituted at position C-4 by a 2-aminoethyl group. | histamine |
| histidine | The L-enantiomer of the amino acid histidine. | L-histidine zwitterion; L-histidine |
| homocitrulline | A L-lysine derivative that is L-lysine having a carbamoyl group at the N(6)-position. It is found in individuals with urea cycle disorders. | L-homocitrulline zwitterion; L-homocitrulline |
| homocitrulline | An amino acid zwitterion of L-homocitrulline arising from transfer of a proton from the carboxy to the amino group; major species at pH 7.3. | L-homocitrulline zwitterion; L-homocitrulline |
| homocysteine | A homocysteine that has L configuration. | L-homocysteine zwitterion; L-homocysteine |
| homovanillic acid | A monocarboxylic acid that is the 3-O-methyl ether of (3,4-dihydroxyphenyl)acetic acid. It is a catecholamine metabolite. | homovanillic acid |
| hordenine | | hordenine |
| hydantoin-5-propionic acid | A imidazolidine-2,4-dione that is hydantoin substituted by a 2-carboxyethyl group at position 4. | hydantoin-5-propionic acid |
| hydrobromic acid | A diatomic molecule containing covalently bonded hydrogen and bromine atoms. | hydrogen bromide |
| hydrochloric acid | A mononuclear parent hydride consisting of covalently bonded hydrogen and chlorine atoms. | hydrogen chloride |
| hydrogen carbonate | The carbon oxoanion resulting from the removal of a proton from carbonic acid. | hydrogencarbonate |
| hydrogen selenide | | selane |
| hydrogen sulfite | | hydrogensulfite |
| hydroiodic acid | A diatomic molecule containing covalently bonded hydrogen and iodine atoms. | hydrogen iodide |
| hydromethylthionine | A member of the class of phenothiazines that is 10H-phenothiazine in which the ring hydrogens at positions 3 and 7 have been replaced by dimethylamino groups. | leucomethylene blue |
| hydroquinone | A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. | hydroquinone |
| hydroxide ion | | hydroxide |
| hydroxyhydroquinone | A benzenetriol carrying hydroxy groups at positions 1, 2 and 4. | benzene-1,2,4-triol |
| hydroxyindoleacetaldehyde | An aldehyde that is acetaldehyde substituted by a 5-hydroxyindol-3-yl group. | (5-hydroxyindol-3-yl)acetaldehyde |
| hydroxyindoleacetic acid | A member of the class of indole-3-acetic acids that is indole-3-acetic acid substituted by a hydroxy group at C-5. | (5-hydroxyindol-3-yl)acetic acid |
| hydroxymethylbilane | | preuroporphyrinogen |
| hydroxyproline | An optically active form of 4-hydroxyproline having L-trans-configuration. | trans-4-hydroxy-L-proline zwitterion; trans-4-hydroxy-L-proline |
| hyodeoxycholic acid | A member of the class of 5beta-cholanic acids that is (5beta)-cholan-24-oic acid substituted by alpha-hydroxy groups at positions 3 and 6. | hyodeoxycholic acid |
| hypotaurine | An aminosulfinic acid comprising ethylamine having the sulfo group at the 2-position. | hypotaurine zwitterion; hypotaurine |
| imidazoleacetic acid | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens has been replaced by an imidazol-4-yl group. | imidazol-4-ylacetic acid; imidazol-5-ylacetic acid |
| indole-3-acetaldehyde | An indoleacetaldehyde that is acetaldehyde in which one of the methyl hydrogens are replaced by a indol-3-yl group. It is an intermediate metabolite in the metabolism of tryptophan. | indol-3-ylacetaldehyde |
| indoleacetic acid | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens has been replaced by a 1H-indol-3-yl group. | indole-3-acetic acid |
| inosine | A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. | inosine |
| inosine triphosphate | The inosine phosphate that has a triphosphate group at the 5'-position. It is an intermediate in the metabolism of purine. | ITP |
| inosinic acid | A purine ribonucleoside 5'-monophosphate having hypoxanthine as the nucleobase. | IMP |
| inositol 1,4,5-trisphosphate | | 1D-myo-inositol 1,4,5-trisphosphate |
| inositol 3,4-bisphosphate | | 1D-myo-inositol 3,4-bisphosphate |
| inositol-1,4,5,6-tetrakisphosphate | A myo-inositol tetrakisphosphate having the four phosphate groups at the 1-, 4-, 5- and 6-positions. | 1D-myo-inositol 1,4,5,6-tetrakisphosphate |
| inositol-3,4,5,6-tetrakisphosphate | A myo-inositol tetrakisphosphate having the four phosphate groups placed at the 3-, 4-, 5- and 6-positions. | 1D-myo-inositol 3,4,5,6-tetrakisphosphate |
| iron | | iron(2+) |
| isobutyryl-coenzyme a | A short-chain, methyl-branched fatty acyl-CoA that is the S-isobutyryl derivative of coenzyme A. | isobutyryl-CoA |
| isocaproaldehyde | | 4-methylpentanal |
| isoleucine | The L-enantiomer of isoleucine. | L-isoleucine zwitterion; L-isoleucine |
| isomaltose | A glycosylglucose consisting of two D-glucopyranose units connected by an alpha-(1->6)-linkage. | isomaltose |
| isopentenyl pyrophosphate | A prenol phosphate comprising 3-methylbut-3-en-1-ol having an O-diphosphate substituent. | isopentenyl diphosphate |
| isovaleryl-coenzyme a | A methylbutanoyl-CoA is the S-isovaleryl derivative of coenzyme A. | isovaleryl-CoA |
| ketodihydrosphingosine | A 2-amino-1-hydroxyoctadecan-3-one that has S-configuration. | 3-dehydrosphinganine |
| kynurenine | A kynurenine that has L configuration. | L-kynurenine zwitterion; L-kynurenine |
| lactaldehyde | A member of the class of propanals obtained by the reduction of the carboxylic group of lactic acid (2-hydroxypropanoic acid). | lactaldehyde |
| lanosterol | A tetracyclic triterpenoid that is lanosta-8,24-diene substituted by a beta-hydroxy group at the 3beta position. It is the compound from which all steroids are derived. | lanosterol |
| lathosterol | A cholestanoid that is (5alpha)-cholest-7-ene substituted by a beta-hydroxy group at position 3. | 5alpha-cholest-7-en-3beta-ol |
| lauroyl-coenzyme a | A medium-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of lauric (dodecanoic) acid. | lauroyl-CoA |
| leucine | The L-enantiomer of leucine. | L-leucine zwitterion; L-leucine |
| leucovorin | A formyltetrahydrofolic acid in which the formyl group is located at position 5. | 5-formyltetrahydrofolic acid |
| leukotriene a4 | A leukotriene that is the (5S,6S)-epoxy derivative of (7E,9E,11Z,14Z)-icosa-7,9,11,14-tetraenoic acid. | leukotriene A4 |
| leukotriene b4 | A leukotriene composed of (6Z,8E,10E,14Z)-icosatetraenoic acid having (5S)- and (12R)-hydroxy substituents. It is a lipid mediator of inflammation that is generated from arachidonic acid via the 5-lipoxygenase pathway. | leukotriene B4 |
| leukotriene c4 | A leukotriene that is (5S,7E,9E,11Z,14Z)-5-hydroxyicosa-7,9,11,14-tetraenoic acid in which a glutathionyl group is attached at position 6 via a sulfide linkage. | leukotriene C4 |
| leukotriene d4 | A leukotriene that is (7E,9E,11Z,14Z)-icosa-7,9,11,14-tetraenoic acid substituted by a hydroxy group at position 5 (5S) and a L-cysteinylglycinyl group at position 6 (6R). | leukotriene D4 |
| levodopa | An optically active form of dopa having L-configuration. Used to treat the stiffness, tremors, spasms, and poor muscle control of Parkinson's disease | L-dopa zwitterion; L-dopa |
| lipoamide | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of lipoic acid with ammonia. | lipoamide |
| lithocholic acid | A monohydroxy-5beta-cholanic acid with a alpha-hydroxy substituent at position 3. It is a bile acid obtained from chenodeoxycholic acid by bacterial action. | lithocholic acid |
| lysine | An L-alpha-amino acid; the L-isomer of lysine. | L-lysine zwitterion; L-lysine |
| lyso-pc | A lysophosphatidylcholine 16:0 in which a hexadecanoyl (palmitoyl) group is attached to the glycero moiety at position 1. | 1-hexadecanoyl-sn-glycero-3-phosphocholine |
| maleic acid | A butenedioic acid in which the double bond has cis- (Z)-configuration. | maleic acid |
| malonyl coenzyme a | The S-malonyl derivative of coenzyme A. | malonyl-CoA |
| melatonin | A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen atom is replaced by a 2-(5-methoxy-1H-indol-3-yl)ethyl group. It is a hormone secreted by the pineal gland in humans. | melatonin |
| mephentermine | A 2-aminooctadecane-1,3-diol having (2S,3R)-configuration. | sphinganine |
| methanol | The primary alcohol that is the simplest aliphatic alcohol, comprising a methyl and an alcohol group. | methanol |
| methionine | The L-enantiomer of methionine. | L-methionine zwitterion; L-methionine |
| methyl-4-tyramine | | N-methyltyramine |
| methylamine | The simplest of the methylamines, consisting of ammonia bearing a single methyl substituent. | methylamine |
| methylphenyl carbinol | An aromatic alcohol that is ethanol substituted by a phenyl group at position 1. | 1-phenylethanol |
| monodehydroascorbate | | monodehydro-L-ascorbic acid |
| monoiodotyrosine | The monoiodotyrosine that is L-tyrosine carrying an iodo-substituent at position C-3 of the benzyl group. | 3-iodo-L-tyrosine zwitterion; 3-iodo-L-tyrosine |
| n-acetylaspartic acid | An N-acyl-L-aspartic acid in which the acyl group is specified as acetyl. | N-acetyl-L-aspartic acid |
| n-acetylglucosamine-1-phosphate | A N-acetyl-D-glucosamine 1-phosphate that is 2-deoxy-D-glucopyranose 1-(dihydrogen phosphate) substituted by an acetamido group at position 2. | 2-acetamido-2-deoxy-D-glucopyranose 1-phosphate |
| n-acetylneuraminic acid | An N-acylneuraminic acid where the N-acyl group is specified as acetyl. | N-acetylneuraminic acid |
| n-acetylputrescine | An N-monoacetylalkane-alpha,omega-diamine that is the N-monoacetyl derivative of putrescine. | N-acetylputrescine |
| n-acetylserotonin | An N-acylserotonin resulting from the formal condensation of the primary amino group of serotonin with the carboxy group of acetic acid. | N-acetylserotonin |
| n-carbamoyl-beta-alanine | A beta-alanine derivative that is propionic acid bearing a ureido group at position 3. | N-carbamoyl-beta-alanine |
| n-cyclohexylformamide | A member of the class of formamides that is cyclohexane substituted by a formamido group. | N-cyclohexylformamide |
| n-palmitoylgalactosylsphingosine | A D-galactosyl-N-acylsphingosine in which the ceramide N-acyl group is specified as hexadecanoyl. | N-(hexadecanoyl)-beta-D-galactosylsphingosine |
| n-stearoylsphingomyelin | A sphingomyelin d18:1 in which the ceramide N-acyl group is specified as stearoyl (octadecanoyl). | N-stearoylsphingosine-1-phosphocholine |
| n'-formylkynurenine | | N-formyl-L-kynurenine zwitterion; N-formyl-L-kynurenine |
| n'-methyl-2-pyridone-5-carboxamide | A pyridone that is 2-pyridone substituted with a carboxamide group at C-5 and a methyl group at N-1. | N-methyl-6-pyridone-3-carboxamide |
| n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | | alpha-ribazole 5'-phosphate |
| n(1)-methylnicotinamide | A pyridinium ion comprising nicotinamide having a methyl group at the 1-position. It is a metabolite of nicotinamide which was initially considered to be biologically inactive but has emerged as an anti-thrombotic and anti-inflammatory agent. | 1-methylnicotinamide |
| naphthalene | An aromatic hydrocarbon comprising two fused benzene rings. It occurs in the essential oils of numerous plant species e.g. magnolia. | naphthalene |
| niacin | A pyridinemonocarboxylic acid that is pyridine in which the hydrogen at position 3 is replaced by a carboxy group. | nicotinic acid |
| niacinamide | A pyridinecarboxamide that is pyridine in which the hydrogen at position 3 is replaced by a carboxamide group. | nicotinamide |
| nicotinamide mononucleotide | | NMN zwitterion |
| nicotinamide-beta-riboside | A pyridine nucleoside consisting of nicotinamide with a beta-D-ribofuranosyl moiety at the 1-position. | N-ribosylnicotinamide |
| nicotinic acid adenine dinucleotide | | deamido-NAD(+) |
| o,o-diethyl phosphorothionate | An organic thiophosphate that is the diethyl ester of phosphorothioic O,O,O-acid. | O,O-diethyl hydrogen thiophosphate |
| obtusifoliol | | obtusifoliol |
| oleic acid | An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. | oleic acid |
| oleoyl-coenzyme a | An octadecenoyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of oleic acid. | oleoyl-CoA |
| ornithine | An optically active form of ornithine having L-configuration. | L-ornithine |
| orotic acid | A pyrimidinemonocarboxylic acid that is uracil bearing a carboxy substituent at position C-6. | orotic acid |
| orotidylic acid | A pyrimidine ribonucleoside 5'-monophosphate having 6-carboxyuracil as the nucleobase. | orotidine 5'-phosphate |
| palmitoyl coenzyme a | A long-chain fatty acyl-CoA resulting from the formal condensation of the carboxy group of hexadecanoic acid with the thiol group of coenzyme A. | palmitoyl-CoA |
| palmitoylcarnitine | An O-acyl-L-carnitine in which the acyl group is specified as palmitoyl (hexadecanoyl). | O-palmitoyl-L-carnitine |
| pantetheine | An amide obtained by formal condensation of the carboxy group of pantothenic acid and the amino group of cysteamine. | pantetheine |
| pantothenylcysteine 4'-phosphate | The N-[(R)-4-phosphopantothenoyl] derivative of L-cysteine. | N-[(R)-4-phosphopantothenoyl]-L-cysteine |
| paraoxon | An aryl dialkyl phosphate where both the alkyl groups are ethyl and the aryl group is 4-nitrophenyl. | paraoxon |
| parathion | | parathion |
| perillaldehyde | An aldehyde that is cyclohex-1-ene-1-carbaldehyde substituted by a prop-1-en-2-yl group at position 4. | perillyl aldehyde |
| perillic acid | | perillic acid |
| phenanthrene | A polycyclic aromatic hydrocarbon composed of three fused benzene rings which takes its name from the two terms 'phenyl' and 'anthracene.' | phenanthrene |
| phenethylamine | A phenylethylamine having the phenyl substituent at the 2-position. | 2-phenylethylamine |
| phenol | An organic hydroxy compound that consists of benzene bearing a single hydroxy substituent. The parent of the class of phenols. | phenol |
| phenylacetaldehyde | An aldehyde that consists of acetaldehyde bearing a methyl substituent; the parent member of the phenylacetaldehyde class of compounds. | phenylacetaldehyde |
| phenylacetyl-coenzyme a | An acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of phenylacetic acid. | phenylacetyl-CoA |
| phenylacetylglycine | A N-acylglycine that is glycine substituted on nitrogen with a phenylacetyl group. | phenylacetylglycine |
| phenylalanine | The L-enantiomer of phenylalanine. | L-phenylalanine zwitterion; L-phenylalanine |
| phenylphosphate | An aryl phosphate resulting from the mono-esterification of phosphoric acid with phenol. | phenyl phosphate |
| phosphatidylcholines | A phosphatidylcholine 40:6 in which the acyl groups at positions 1 and 2 are octadecanoyl and (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl respectively. | 1-octadecanoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoyl)-sn-glycero-3-phosphocholine |
| phosphoadenosine phosphosulfate | An adenosine bisphosphate having monophosphate groups at the 3'- and 5'-positions and a sulfo group attached to the phosphate at position 5'. | 3'-phospho-5'-adenylyl sulfate |
| phosphocreatine | A phosphoamino acid consisting of creatine having a phospho group attached at the primary nitrogen of the guanidino group. | N-phosphocreatine |
| phosphoglycolate | The O-phospho derivative of glycolic acid. | 2-phosphoglycolic acid |
| phosphonoacetaldehyde | A phosphonic acid consisting of acetaldehyde with the phospho group at the 2-position. | phosphonoacetaldehyde |
| phosphopantothenic acid | An amidoalkyl phosphate that is the 4-phosphate derivative of (R)-pantothenic acid. | (R)-4'-phosphopantothenic acid |
| phosphoribosyl pyrophosphate | A derivative of alpha-D-ribose having a phosphate group at the 5-position and a diphosphate at the 1-position. | 5-O-phosphono-alpha-D-ribofuranosyl diphosphate |
| phosphorylcholine | The phosphate of choline; and the parent compound of the phosphocholine family. | phosphocholine |
| phosphorylethanolamine | The ethanolamine mono-ester of phosphoric acid, and a metabolite of phospholipid metabolism. This phosphomonoester shows strong structural similarity to the inhibitory neurotransmitter GABA, and is decreased in post-mortem Alzheimer's disease brain. | O-phosphoethanolamine |
| phytosphingosine | | phytosphingosine |
| plasmenylserine | The L-enantiomer of O-phosphoserine. | O-phospho-L-serine |
| porphobilinogen | A dicarboxylic acid that is pyrole bearing aminomethyl, carboxymethyl and 2-carboxyethyl substituents at positions 2, 3 and 4 respectively. | porphobilinogen |
| pregnenolone | A 20-oxo steroid that is pregn-5-ene substituted by a beta-hydroxy group at position 3 and an oxo group at position 20. | pregnenolone |
| proline | Pyrrolidine in which the pro-S hydrogen at position 2 is substituted by a carboxylic acid group. L-Proline is the only one of the twenty DNA-encoded amino acids which has a secondary amino group alpha to the carboxyl group. It is an essential component of collagen and is important for proper functioning of joints and tendons. It also helps maintain and strengthen heart muscles. | L-proline zwitterion; L-proline |
| propiolaldehyde | | prop-2-ynal |
| propionyl-coenzyme a | An acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of propionic acid. | propionyl-CoA |
| propylene glycol | The simplest member of the class of propane-1,2-diols, consisting of propane in which a hydrogen at position 1 and a hydrogen at position 2 are substituted by hydroxy groups. A colourless, viscous, hygroscopic, low-melting (-59degreeC) and high-boiling (188degreeC) liquid with low toxicity, it is used as a solvent, emulsifying agent, and antifreeze. | propane-1,2-diol |
| prosomatostatin | A heterodetic cyclic peptide consisting of somatostatin in which the amino terminus has been acylated by the fourteen membered peptide Ser-Ala-Asn-Ser-Asn-Pro-Ala-Met-Ala-Pro-Arg-Glu-Arg-Lys. | somatostatin-28 |
| prostaglandin d2 | A member of the class of prostaglandins D that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9 and 15 and an oxo group at position 11 (the 5Z,9alpha,13E,15S- stereoisomer). | prostaglandin D2 |
| prostaglandin g2 | | prostaglandin G2 |
| prostaglandin h2 | | prostaglandin H2 |
| protoporphyrinogen | | protoporphyrinogen |
| pyridoxal | A pyridinecarbaldehyde that is pyridine-4-carbaldehyde bearing methyl, hydroxy and hydroxymethyl substituents at positions 2, 3 and 5 respectively. The 4-carboxyaldehyde form of vitamin B6, it is converted into pyridoxal phosphate, a coenzyme for the synthesis of amino acids, neurotransmitters, sphingolipids and aminolevulinic acid. | pyridoxal |
| pyridoxal phosphate | The monophosphate ester obtained by condensation of phosphoric acid with the primary hydroxy group of pyridoxal. | pyridoxal 5'-phosphate |
| pyridoxamine | A monohydroxypyridine that is pyridine substituted by a hydroxy group at position 3, an aminomethyl group at position 4, a hydroxymethyl group at position 5 and a methyl group at position 2. The 4-aminomethyl form of vitamin B6, it is used (in the form of the hydrochloride salt) for treatment of diabetic nephropathy. | pyridoxamine |
| pyridoxamine dihydrochloride | A hydrochloride obtained by combining pyridoxamine with two molar equivalents of hydrochloric acid. Used for treatment of diabetic nephropathy. | pyridoxamine dihydrochloride |
| pyridoxamine phosphate | A vitamin B6 phosphate that is the phosphoric ester derivative of pyridoxamine. | pyridoxamine 5'-phosphate |
| pyridoxic acid | A methylpyridine that is 2-methylpyridine substituted by a hydroxy group at C-3, a carboxy group at C-4, and a hydroxymethyl group at C-5. It is the catabolic product of vitamin B6 and is excreted in the urine. | 4-pyridoxic acid |
| pyridoxine | A hydroxymethylpyridine with hydroxymethyl groups at positions 4 and 5, a hydroxy group at position 3 and a methyl group at position 2. The 4-methanol form of vitamin B6, it is converted intoto pyridoxal phosphate which is a coenzyme for synthesis of amino acids, neurotransmitters, sphingolipids and aminolevulinic acid. | pyridoxine |
| pyridoxine 5-phosphate | | pyridoxine 5'-phosphate |
| pyruvaldehyde | A 2-oxo aldehyde derived from propanal. | methylglyoxal |
| quinolinic acid | A pyridinedicarboxylic acid that is pyridine substituted by carboxy groups at positions 2 and 3. It is a metabolite of tryptophan. | quinolinic acid |
| quinone | The simplest member of the class of 1,4-benzoquinones, obtained by the formal oxidation of hydroquinone to the corresponding diketone. It is a metabolite of benzene. | 1,4-benzoquinone |
| raffinose | A trisaccharide composed of alpha-D-galactopyranose, alpha-D-glucopyranose and beta-D-fructofuranose joined in sequence by 1->6 and 1<->2 glycosidic linkages, respectively. | raffinose |
| raphanusamic acid | A thiazolidinemonocarboxylic acid that is 2-thioxo-1,3-thiazolidine with the carboxy group located at position 4 (the R-enantiomer). | raphanusamic acid |
| retinaldehyde | A retinal in which all four exocyclic double bonds have E- (trans-) geometry. | all-trans-retinal |
| retinol | A retinol in which all four exocyclic double bonds have E- (trans-) geometry. | all-trans-retinol |
| riboflavin | D-Ribitol in which the hydroxy group at position 5 is substituted by a 7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl moiety. It is a nutritional factor found in milk, eggs, malted barley, liver, kidney, heart, and leafy vegetables, but the richest natural source is yeast. The free form occurs only in the retina of the eye, in whey, and in urine; its principal forms in tissues and cells are as flavin mononucleotide and flavin-adenine dinucleotide. | riboflavin |
| ribulose 5-phosphate | The D-enantiomer of ribulose 5-phosphate that is one of the end-products of the pentose phosphate pathway. | D-ribulose 5-phosphate |
| s-adenosyl-3-methylthiopropylamine | The S-adenosyl derivative of methioninamine. It acts as the aminopropyl donor in the biosynthesis of the polyamines, spermidine and spermine. | S-adenosylmethioninamine |
| s-chloromethylglutathione | An S-substituted glutathione that is glutathione in which the mercapto hydrogen has been replaced by a chloromethyl group. | S-(chloromethyl)glutathione |
| s-hydroxymethylglutathione | An S-substituted glutathione that is glutathione in which the mercapto hydrogen has been replaced by a hydroxymethyl group. | S-(hydroxymethyl)glutathione |
| s-tetradecanoyl-coenzyme a | A long-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of myristic acid. | myristoyl-CoA |
| saccharopine | The N(6)-(1,3-dicarboxypropan-1-yl) derivative of L-lysine. | L-saccharopine |
| saicar | A 1-(phosphoribosyl)imidazolecarboxamide resulting from the formal condesation of the darboxy group of 5-amino-1-(5-O-phosphono-beta-D-ribofuranosyl)-1H-imidazole-4-carboxylic acid with the amino group of L-aspartic acid. | SAICAR |
| samarium | A sphingomyelin 34:1 in which the N-acyl group and sphingoid base are specified as hexadecanoyl and sphingosine respectively. | N-hexadecanoylsphingosine-1-phosphocholine |
| sarcosine | A N-alkylglycine that is the N-methyl derivative of glycine. It is an intermediate in the metabolic pathway of glycine. | sarcosine zwitterion; sarcosine |
| sedoheptulose 1,7-bisphosphate | | sedoheptulose 1,7-bisphosphate |
| sedoheptulose 7-phosphate | A ketoheptose phosphate consisting of sedoheptulose having a phosphate group at the 7-position. It is an intermediate metabolite in the pentose phosphate pathway. | sedoheptulose 7-phosphate |
| serine | The L-enantiomer of serine. | L-serine zwitterion; L-serine |
| sitosterol, (3beta)-isomer | A member of the class of phytosterols that is stigmast-5-ene substituted by a beta-hydroxy group at position 3. | sitosterol |
| sorbitol | The D-enantiomer of glucitol (also known as D-sorbitol). | D-glucitol |
| sorbitol 6-phosphate | The 6-O-phospho derivative of D-glucitol. | D-glucitol 6-phosphate |
| sphingosine | A sphing-4-enine in which the double bond is trans. | sphingosine |
| sphingosine 1-phosphate | A phosphosphingolipid that consists of sphingosine having a phospho group attached at position 1 | sphingosine 1-phosphate |
| squalene | A triterpene consisting of 2,6,10,15,19,23-hexamethyltetracosane having six double bonds at the 2-, 6-, 10-, 14-, 18- and 22-positions with (all-E)-configuration. | squalene |
| stachyose | A tetrasaccharide consisting of sucrose having an alpha-D-galactosyl-(1->6)-alpha-D-galactosyl moiety attached at the 6-position of the glucose. | stachyose |
| stearidonic acid | An octadecatetraenoic acid having four double bonds located at positions 6, 9, 12 and 15 (the all-cis-isomer). It has been isolated from Lithospermum officinale and fish oils. | all-cis-octadeca-6,9,12,15-tetraenoic acid |
| stearoyl-coenzyme a | A long-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of stearic acid. | stearoyl-CoA |
| styrene | A vinylarene that is benzene carrying a vinyl group. It has been isolated from the benzoin resin produced by Styrax species. | styrene |
| succinic semialdehyde | | succinic semialdehyde |
| succinyl-coenzyme a | An omega-carboxyacyl-CoA having succinoyl as the S-acyl component. | succinyl-CoA |
| sucrose | A glycosyl glycoside formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose. | sucrose |
| tartronate semialdehyde | | 2-hydroxy-3-oxopropanoic acid |
| taurine | An amino sulfonic acid that is the 2-amino derivative of ethanesulfonic acid. It is a naturally occurring amino acid derived from methionine and cysteine metabolism. An abundant component of fish- and meat-based foods, it has been used as an oral supplement in the treatment of disorders such as cystic fibrosis and hypertension. | taurine zwitterion; taurine |
| taurochenodeoxycholic acid | A bile acid taurine conjugate of chenodeoxycholic acid. | taurochenodeoxycholic acid |
| tele-methylhistamine | A primary amino compound that is the N(tele)-methyl derivative of histamine. | N(tele)-methylhistamine |
| theobromine | A dimethylxanthine having the two methyl groups located at positions 3 and 7. A purine alkaloid derived from the cacao plant, it is found in chocolate, as well as in a number of other foods, and is a vasodilator, diuretic and heart stimulator. | theobromine |
| thiamine | A primary alcohol that is 1,3-thiazol-3-ium substituted by (4-amino-2-methylpyrimidin-5-yl)methyl, methyl and 2-hydroxyethyl groups at positions 3, 4 and 5, respectively. | thiamine(1+) |
| thiocysteine | An S-substituted L-cysteine where the S-substituent is specified as sulfanyl. | 3-disulfanyl-L-alanine zwitterion; 3-disulfanyl-L-alanine |
| threonine | An optically active form of threonine having L-configuration. | L-threonine zwitterion; L-threonine |
| thromboxane a2 | A thromboxane which is produced by activated platelets and has prothrombotic properties: it stimulates activation of new platelets as well as increases platelet aggregation. | thromboxane A2 |
| thromboxane b2 | A member of the class of thromboxanes B that is (5Z,13E)-thromboxa-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. | thromboxane B2 |
| thromboxane b3 | A member of the class of thromboxanes B that is (5Z,13E,17Z)-thromboxa-5,13,17-trien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. | thromboxane B3 |
| thymidine | A pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. | thymidine |
| thymidine 5'-diphosphate | A thymidine phosphate having a diphosphate group at the 5'-position. | dTDP |
| thymidine 5'-triphosphate | A thymidine phosphate having a triphosphate group at the 5'-position. | dTTP |
| thymine | A pyrimidine nucleobase that is uracil in which the hydrogen at position 5 is replaced by a methyl group. | thymine |
| thyroxine | The L-enantiomer of thyroxine. | L-thyroxine zwitterion; L-thyroxine |
| trans-4-coumaric acid | The trans-isomer of 4-coumaric acid. | trans-4-coumaric acid |
| trehalose | A trehalose in which both glucose residues have alpha-configuration at the anomeric carbon. | alpha,alpha-trehalose |
| trichloroacetaldehyde | An organochlorine compound that consists of acetaldehyde where all the methyl hydrogens are replaced by chloro groups. | trichloroacetaldehyde |
| trichloroacetic acid | A monocarboxylic acid that is acetic acid in which all three methyl hydrogens are substituted by chlorine. | trichloroacetic acid |
| trichloroepoxyethane | | trichloroepoxyethane |
| trichloroethylene | A member of the class of chloroethenes that is ethene substituted by chloro groups at positions 1, 1 and 2. | trichloroethene |
| triiodothyronine | An iodothyronine compound having iodo substituents at the 3-, 3'- and 5-positions. Although some is produced in the thyroid, most of the 3,3',5-triiodo-L-thyronine in the body is generated by mono-deiodination of L-thyroxine in the peripheral tissues. Its metabolic activity is about 3 to 5 times that of L-thyroxine. The sodium salt is used in the treatment of hypothyroidism. | 3,3',5-triiodo-L-thyronine zwitterion; 3,3',5-triiodo-L-thyronine |
| trilinolein | A triglyceride formed by acylation of the three hydroxy groups of glycerol with linoleic acid. | 1,2,3-trilinoleoylglycerol |
| trimethylenediamine | An alkane-alpha,omega-diamine comprising a propane skeleton with amino substituents at positions 1 and 3. | trimethylenediamine |
| trimethyllysine | An alpha-amino-acid cation that is the N(6)-trimethyl derivative of L-lysine. | N(6),N(6),N(6)-trimethyl-L-lysine zwitterion; N(6),N(6),N(6)-trimethyl-L-lysine |
| tryptamine | An aminoalkylindole consisting of indole having a 2-aminoethyl group at the 3-position. | tryptamine |
| tryptophan | The L-enantiomer of tryptophan. | L-tryptophan zwitterion; L-tryptophan |
| tyramine | A primary amino compound obtained by formal decarboxylation of the amino acid tyrosine. | tyramine |
| uracil | A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. | uracil |
| urea | A carbonyl group with two C-bound amine groups. The commercially available fertilizer has an analysis of 46-0-0 (N-P2O5-K2O). | carbamimidic acid; urea |
| uric acid | An oxopurine in which the purine ring is substituted by oxo groups at positions 2, 6, and 8. | 1H-purine-2,6,8-triol; 2,6-dihydroxy-7,9-dihydro-8H-purin-8-one; 6-hydroxy-1H-purine-2,8(7H,9H)-dione; 7,9-dihydro-1H-purine-2,6,8(3H)-trione; 7H-purine-2,6,8-triol; 9H-purine-2,6,8-triol |
| uridine diphosphate | | UDP |
| uridine diphosphate galactose | A UDP-D-galactose in which the anomeric centre of the galactose moiety has alpha-configuration. | UDP-alpha-D-galactose |
| uridine diphosphate glucuronic acid | A UDP-sugar having alpha-D-glucuronic acid as the sugar component. | UDP-alpha-D-glucuronic acid |
| uridine monophosphate | A pyrimidine ribonucleoside 5'-monophosphate having uracil as the nucleobase. | uridine 5'-monophosphate |
| uridine triphosphate | A pyrimidine ribonucleoside 5'-triphosphate having uracil as the nucleobase. | UTP |
| uroporphyrinogen iii | | uroporphyrinogen III |
| ursodeoxycholic acid | A bile acid found in the bile of bears (Ursidae) as a conjugate with taurine. Used therapeutically, it prevents the synthesis and absorption of cholesterol and can lead to the dissolution of gallstones. | ursodeoxycholic acid |
| valine | The L-enantiomer of valine. | L-valine zwitterion; L-valine |
| vinylidene chloride | A member of the class of chloroethenes that is ethene in which both of the hydrogens attached to one of the carbons are replaced by chlorines. | 1,1-dichloroethene |
| vitamin a2 | A retinoid derived from 3,4-desaturation of the beta-ionone ring of all-trans-retinol. | all-trans-3,4-didehydroretinol |
| xanthosine | A purine nucleoside in which xanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. | xanthosine |
| xanthosine 5'-triphosphate | A purine ribonucleoside 5'-monophosphate having xanthine as the nucleobase. | 5'-xanthylic acid |
| xanthosine 5'-triphosphate | The xanthosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. | XTP |
| xanthurenic acid 8-methyl ether | A quinolinemonocarboxylic acid that is kynurenic acid which is substituted by a methoxy group at position 8. | 4-hydroxy-8-methoxyquinaldic acid |
| xylulose | The D-enantiomer of xylulose. | D-xylulose |
| xylulose-5-phosphate, (d)-isomer | The D-enantiomer of xylulose 5-phosphate. | D-xylulose 5-phosphate |
| zymostenol | A cholestanoid that is 5alpha-cholestane substituted by a beta-hydroxy group at position 3. | 5alpha-cholest-8-en-3beta-ol |
| zymosterol | | zymosterol |
| Protein | Taxonomy | Measurement | Average (mM) | Bioassay(s) | Drugs |
|---|
| 10 kDa chaperonin | Escherichia coli | IC50 | 36.3833 | 2 | 6 |
| 10 kDa heat shock protein, mitochondrial | Homo sapiens (human) | IC50 | 38.1667 | 1 | 3 |
| 17-beta-hydroxysteroid dehydrogenase type 1 | Homo sapiens (human) | IC50 | 0.3790 | 5 | 6 |
| 17-beta-hydroxysteroid dehydrogenase type 1 | Homo sapiens (human) | Ki | 4.7515 | 2 | 2 |
| 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | Escherichia coli K-12 | IC50 | 768.0000 | 1 | 1 |
| 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase | Homo sapiens (human) | Ki | 100.0000 | 1 | 1 |
| 4-aminobutyrate aminotransferase, mitochondrial | Homo sapiens (human) | IC50 | 1,734.8333 | 2 | 3 |
| 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 | Homo sapiens (human) | IC50 | 76.5000 | 1 | 2 |
| 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 | Homo sapiens (human) | Ki | 79.3000 | 1 | 2 |
| 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase FUT5 | Homo sapiens (human) | IC50 | 67.0000 | 1 | 1 |
| 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase FUT6 | Homo sapiens (human) | IC50 | 123.5500 | 1 | 6 |
| 4-hydroxy-tetrahydrodipicolinate synthase | Escherichia coli K-12 | Ki | 16.0000 | 1 | 1 |
| 5-hydroxytryptamine receptor 1A | Homo sapiens (human) | Ki | 0.0020 | 3 | 3 |
| 5-hydroxytryptamine receptor 1A | Rattus norvegicus (Norway rat) | Ki | 0.0707 | 6 | 7 |
| 5-hydroxytryptamine receptor 1B | Homo sapiens (human) | Ki | 0.0198 | 1 | 2 |
| 5-hydroxytryptamine receptor 1B | Rattus norvegicus (Norway rat) | Ki | 1.8845 | 4 | 6 |
| 5-hydroxytryptamine receptor 1D | Homo sapiens (human) | Ki | 0.0332 | 2 | 2 |
| 5-hydroxytryptamine receptor 1D | Rattus norvegicus (Norway rat) | Ki | 0.1515 | 2 | 2 |
| 5-hydroxytryptamine receptor 1F | Rattus norvegicus (Norway rat) | Ki | 0.1515 | 2 | 2 |
| 5-hydroxytryptamine receptor 2A | Rattus norvegicus (Norway rat) | IC50 | 0.0855 | 2 | 2 |
| 5-hydroxytryptamine receptor 2A | Homo sapiens (human) | Ki | 8.4762 | 4 | 4 |
| 5-hydroxytryptamine receptor 2A | Rattus norvegicus (Norway rat) | Ki | 2.8305 | 10 | 12 |
| 5-hydroxytryptamine receptor 2B | Homo sapiens (human) | IC50 | 13.6300 | 1 | 1 |
| 5-hydroxytryptamine receptor 2B | Rattus norvegicus (Norway rat) | IC50 | 0.0855 | 2 | 2 |
| 5-hydroxytryptamine receptor 2B | Homo sapiens (human) | Ki | 8.6760 | 1 | 1 |
| 5-hydroxytryptamine receptor 2B | Rattus norvegicus (Norway rat) | Ki | 0.7146 | 8 | 10 |
| 5-hydroxytryptamine receptor 2C | Rattus norvegicus (Norway rat) | IC50 | 0.0855 | 2 | 2 |
| 5-hydroxytryptamine receptor 2C | Homo sapiens (human) | Ki | 0.0475 | 1 | 2 |
| 5-hydroxytryptamine receptor 2C | Rattus norvegicus (Norway rat) | Ki | 0.6951 | 9 | 11 |
| 5-hydroxytryptamine receptor 3A | Rattus norvegicus (Norway rat) | Ki | 0.3010 | 1 | 1 |
| 5-hydroxytryptamine receptor 3B | Rattus norvegicus (Norway rat) | Ki | 0.3010 | 1 | 1 |
| 5-hydroxytryptamine receptor 4 | Homo sapiens (human) | Ki | 0.1362 | 2 | 2 |
| 5-hydroxytryptamine receptor 4 | Rattus norvegicus (Norway rat) | Ki | 0.3010 | 1 | 1 |
| 5-hydroxytryptamine receptor 5A | Rattus norvegicus (Norway rat) | Ki | 0.3010 | 1 | 1 |
| 5-hydroxytryptamine receptor 5B | Rattus norvegicus (Norway rat) | Ki | 0.3010 | 1 | 1 |
| 5-hydroxytryptamine receptor 6 | Homo sapiens (human) | Ki | 0.1060 | 2 | 3 |
| 5-hydroxytryptamine receptor 6 | Rattus norvegicus (Norway rat) | Ki | 0.3010 | 1 | 1 |
| 5-hydroxytryptamine receptor 7 | Homo sapiens (human) | Ki | 0.0419 | 3 | 4 |
| 5-hydroxytryptamine receptor 7 | Rattus norvegicus (Norway rat) | Ki | 0.1510 | 2 | 2 |
| 5'-nucleotidase | Rattus norvegicus (Norway rat) | IC50 | 80.2000 | 1 | 1 |
| 6-phosphogluconate dehydrogenase, decarboxylating | Homo sapiens (human) | Ki | 5.4150 | 2 | 2 |
| 6-phosphogluconate dehydrogenase, decarboxylating | Ovis aries (sheep) | Ki | 10.7900 | 1 | 1 |
| 60 kDa chaperonin | Escherichia coli K-12 | IC50 | 250.0000 | 1 | 3 |
| 60 kDa chaperonin | Escherichia coli | IC50 | 36.3833 | 2 | 6 |
| 60 kDa heat shock protein, mitochondrial | Homo sapiens (human) | IC50 | 38.1667 | 1 | 3 |
| 72 kDa type IV collagenase | Homo sapiens (human) | IC50 | 105.9035 | 2 | 7 |
| 90-kda heat shock protein beta HSP90 beta, partial | Homo sapiens (human) | IC50 | 50.0000 | 1 | 1 |
| Acetylcholinesterase | Electrophorus electricus (electric eel) | IC50 | 0.0150 | 1 | 1 |
| Acetylcholinesterase | Homo sapiens (human) | IC50 | 1,087.4338 | 7 | 8 |
| Acetylcholinesterase | Mus musculus (house mouse) | IC50 | 0.0130 | 1 | 1 |
| Acetylcholinesterase | Tetronarce californica (Pacific electric ray) | IC50 | 1,000.0000 | 1 | 1 |
| Acetylcholinesterase | Electrophorus electricus (electric eel) | Ki | 0.0012 | 1 | 1 |
| Acetylcholinesterase | Homo sapiens (human) | Ki | 57.7086 | 2 | 7 |
| Acetylcholinesterase | Bos taurus (cattle) | IC50 | 0.1000 | 2 | 3 |
| Acetylcholinesterase | Drosophila melanogaster (fruit fly) | IC50 | 40,000.0000 | 1 | 1 |
| Adenosine deaminase | Bos taurus (cattle) | Ki | 325.0000 | 1 | 2 |
| Adenosine receptor A1 | Homo sapiens (human) | IC50 | 0.4109 | 1 | 1 |
| Adenosine receptor A1 | Rattus norvegicus (Norway rat) | IC50 | 48.6920 | 4 | 5 |
| Adenosine receptor A1 | Cavia porcellus (domestic guinea pig) | Ki | 100.0000 | 5 | 5 |
| Adenosine receptor A1 | Homo sapiens (human) | Ki | 33.2337 | 16 | 16 |
| Adenosine receptor A1 | Rattus norvegicus (Norway rat) | Ki | 39.0060 | 40 | 53 |
| Adenosine receptor A2a | Homo sapiens (human) | IC50 | 20.4720 | 1 | 1 |
| Adenosine receptor A2a | Rattus norvegicus (Norway rat) | IC50 | 63.0000 | 1 | 5 |
| Adenosine receptor A2a | Cavia porcellus (domestic guinea pig) | Ki | 50.0000 | 3 | 3 |
| Adenosine receptor A2a | Homo sapiens (human) | Ki | 19.6611 | 21 | 22 |
| Adenosine receptor A2a | Rattus norvegicus (Norway rat) | Ki | 136.8836 | 30 | 47 |
| Adenosine receptor A2b | Rattus norvegicus (Norway rat) | IC50 | 63.0000 | 1 | 5 |
| Adenosine receptor A2b | Homo sapiens (human) | Ki | 24.1682 | 21 | 22 |
| Adenosine receptor A2b | Mus musculus (house mouse) | Ki | 23.0000 | 1 | 1 |
| Adenosine receptor A2b | Rattus norvegicus (Norway rat) | Ki | 55.7321 | 16 | 28 |
| Adenosine receptor A3 | Homo sapiens (human) | IC50 | 37.8650 | 2 | 2 |
| Adenosine receptor A3 | Homo sapiens (human) | Ki | 30.2181 | 14 | 14 |
| Adenosine receptor A3 | Rattus norvegicus (Norway rat) | Ki | 48.9757 | 7 | 7 |
| Adenosylhomocysteinase | Homo sapiens (human) | Ki | 925.0000 | 1 | 1 |
| Adenylate cyclase type 10 | Homo sapiens (human) | IC50 | 3.0000 | 1 | 1 |
| Alcohol dehydrogenase 1A | Homo sapiens (human) | Ki | 2.3000 | 1 | 1 |
| Alcohol dehydrogenase 1C | Homo sapiens (human) | Ki | 5.2000 | 1 | 1 |
| Alcohol dehydrogenase E chain | Equus caballus (horse) | Ki | 3,383.3180 | 3 | 3 |
| Alcohol dehydrogenase S chain | Equus caballus (horse) | Ki | 3,383.3180 | 3 | 3 |
| Aldehyde oxidase | Homo sapiens (human) | Ki | 30.0000 | 1 | 1 |
| Aldo-keto reductase family 1 member B1 | Homo sapiens (human) | IC50 | 41.0000 | 3 | 4 |
| Aldo-keto reductase family 1 member B1 | Homo sapiens (human) | Ki | 34.9000 | 1 | 4 |
| Aldo-keto reductase family 1 member B10 | Homo sapiens (human) | IC50 | 76.5000 | 1 | 2 |
| ALK tyrosine kinase receptor | Homo sapiens (human) | Ki | 0.0002 | 1 | 1 |
| Alkaline phosphatase, tissue-nonspecific isozyme | Homo sapiens (human) | IC50 | 63.0200 | 3 | 5 |
| Alkaline phosphatase, tissue-nonspecific isozyme | Bos taurus (cattle) | IC50 | 80.2033 | 3 | 3 |
| All-trans-retinol dehydrogenase [NAD | Homo sapiens (human) | Ki | 380.0000 | 1 | 1 |
| All-trans-retinol dehydrogenase [NAD(+)] ADH1B | Homo sapiens (human) | Ki | 3.4000 | 1 | 1 |
| All-trans-retinol dehydrogenase [NAD(+)] ADH4 | Homo sapiens (human) | Ki | 84.0000 | 1 | 1 |
| Alpha-(1,3)-fucosyltransferase 7 | Homo sapiens (human) | IC50 | 123.5500 | 1 | 6 |
| Alpha-1A adrenergic receptor | Rattus norvegicus (Norway rat) | IC50 | 2.3653 | 2 | 2 |
| Alpha-1A adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 2.6740 | 1 | 1 |
| Alpha-1B adrenergic receptor | Rattus norvegicus (Norway rat) | IC50 | 4.7300 | 1 | 1 |
| Alpha-1B adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 2.6740 | 1 | 1 |
| Alpha-2A adrenergic receptor | Rattus norvegicus (Norway rat) | IC50 | 5.7544 | 1 | 1 |
| Alpha-2A adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 25.3500 | 2 | 2 |
| Alpha-2B adrenergic receptor | Rattus norvegicus (Norway rat) | IC50 | 5.7544 | 1 | 1 |
| Alpha-2B adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 25.3500 | 2 | 2 |
| Alpha-2C adrenergic receptor | Rattus norvegicus (Norway rat) | IC50 | 5.7544 | 1 | 1 |
| Alpha-2C adrenergic receptor | Rattus norvegicus (Norway rat) | Ki | 25.3500 | 2 | 2 |
| Alpha-glucosidase MAL12 | Saccharomyces cerevisiae S288C | IC50 | 90.8000 | 1 | 1 |
| Alpha-ketoglutarate-dependent dioxygenase FTO | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 2 |
| Alpha-synuclein | Homo sapiens (human) | IC50 | 39.8960 | 2 | 5 |
| Amine oxidase [flavin-containing] A | Homo sapiens (human) | IC50 | 20.2640 | 3 | 3 |
| Amine oxidase [flavin-containing] B | Homo sapiens (human) | IC50 | 30.1000 | 2 | 2 |
| Amine oxidase [flavin-containing] B | Homo sapiens (human) | Ki | 3,700.0000 | 2 | 2 |
| Amino acid transporter | Rattus norvegicus (Norway rat) | IC50 | 1,227.1938 | 6 | 16 |
| Aminopeptidase N | Sus scrofa (pig) | IC50 | 100.0000 | 1 | 1 |
| Amyloid-beta precursor protein | Homo sapiens (human) | IC50 | 15.1283 | 6 | 7 |
| Androgen receptor | Homo sapiens (human) | IC50 | 6.3503 | 30 | 30 |
| Androgen receptor | Mus musculus (house mouse) | IC50 | 0.0010 | 1 | 1 |
| Androgen receptor | Rattus norvegicus (Norway rat) | IC50 | 29.5103 | 9 | 20 |
| Androgen receptor | Homo sapiens (human) | Ki | 0.0014 | 19 | 19 |
| Androgen receptor | Rattus norvegicus (Norway rat) | Ki | 1.0301 | 6 | 8 |
| Angiotensin-converting enzyme | Homo sapiens (human) | Ki | 86.0000 | 1 | 1 |
| Anthrax toxin receptor 2 | Homo sapiens (human) | IC50 | 300.0000 | 1 | 1 |
| apelin receptor | Homo sapiens (human) | IC50 | 66.6000 | 1 | 1 |
| Arginase-1 | Bos taurus (cattle) | IC50 | 245.5000 | 1 | 2 |
| Aromatase | Homo sapiens (human) | IC50 | 25.4200 | 4 | 8 |
| Aromatase | Homo sapiens (human) | Ki | 0.8650 | 4 | 5 |
| Aryl hydrocarbon receptor | Homo sapiens (human) | Ki | 21.6000 | 1 | 1 |
| Asc-type amino acid transporter 1 | Rattus norvegicus (Norway rat) | IC50 | 28.5000 | 1 | 2 |
| Asialoglycoprotein receptor 1 | Homo sapiens (human) | IC50 | 15,524.5000 | 1 | 2 |
| ATP-binding cassette sub-family C member 3 | Homo sapiens (human) | IC50 | 133.0000 | 1 | 4 |
| ATP-citrate synthase | Rattus norvegicus (Norway rat) | Ki | 300.0000 | 1 | 1 |
| bcl-2-related protein A1 | Mus musculus (house mouse) | IC50 | 20.0000 | 1 | 1 |
| Beta-carbonic anhydrase 1 | Mycobacterium tuberculosis H37Rv | Ki | 10.8837 | 2 | 8 |
| Beta-galactosidase | Homo sapiens (human) | Ki | 4,886.6667 | 1 | 3 |
| Beta-galactoside alpha-2,6-sialyltransferase 1 | Rattus norvegicus (Norway rat) | Ki | 64.0000 | 1 | 1 |
| Beta-glucuronidase | Escherichia coli K-12 | IC50 | 253.9500 | 1 | 2 |
| Beta-glucuronidase | Homo sapiens (human) | IC50 | 77.9000 | 1 | 1 |
| Beta-lactamase | Aeromonas hydrophila | Ki | 200.0000 | 1 | 1 |
| Bifunctional aspartokinase/homoserine dehydrogenase 1 | Escherichia coli K-12 | Ki | 38,000.0000 | 1 | 2 |
| Bifunctional dihydrofolate reductase-thymidylate synthase | Toxoplasma gondii | IC50 | 500.0000 | 1 | 1 |
| Bifunctional purine biosynthesis protein ATIC | Homo sapiens (human) | IC50 | 25.0000 | 1 | 1 |
| Bifunctional purine biosynthesis protein ATIC | Homo sapiens (human) | Ki | 0.4000 | 1 | 1 |
| Bile acid receptor | Homo sapiens (human) | IC50 | 3.9392 | 2 | 2 |
| Bile salt export pump | Homo sapiens (human) | IC50 | 544.6554 | 6 | 24 |
| Bile salt export pump | Rattus norvegicus (Norway rat) | IC50 | 1,000.0000 | 1 | 1 |
| Bile salt export pump | Homo sapiens (human) | Ki | 28.0000 | 1 | 1 |
| BiP isoform A | Glycine max (soybean) | IC50 | 600.0000 | 1 | 1 |
| Broad substrate specificity ATP-binding cassette transporter ABCG2 | Homo sapiens (human) | IC50 | 4,671.0000 | 3 | 3 |
| Butyrophilin subfamily 3 member A1 | Homo sapiens (human) | IC50 | 391.5000 | 1 | 2 |
| C-8 sterol isomerase | Saccharomyces cerevisiae S288C | Ki | 100.0000 | 1 | 1 |
| C-C chemokine receptor type 6 | Homo sapiens (human) | IC50 | 20.9000 | 1 | 2 |
| C-X-C chemokine receptor type 5 isoform 1 | Homo sapiens (human) | IC50 | 32.4940 | 1 | 1 |
| Calcium-dependent protein kinase 1 | Plasmodium falciparum 3D7 | IC50 | 1.0000 | 1 | 1 |
| Calcium-dependent protein kinase 4 | Plasmodium falciparum 3D7 | IC50 | 1.0000 | 1 | 1 |
| Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B | Rattus norvegicus (Norway rat) | IC50 | 70.0000 | 1 | 1 |
| Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1C | Rattus norvegicus (Norway rat) | IC50 | 70.0000 | 1 | 1 |
| Calcium/calmodulin-dependent protein kinase type II subunit alpha | Rattus norvegicus (Norway rat) | IC50 | 0.0021 | 1 | 1 |
| Calcium/calmodulin-dependent protein kinase type II subunit alpha | Homo sapiens (human) | Ki | 34.7318 | 1 | 3 |
| Calcium/calmodulin-dependent protein kinase type II subunit alpha | Rattus norvegicus (Norway rat) | Ki | 1.9953 | 1 | 1 |
| cAMP-dependent protein kinase catalytic subunit alpha | Rattus norvegicus (Norway rat) | IC50 | 0.0980 | 1 | 1 |
| cAMP-specific 3',5'-cyclic phosphodiesterase 4A | Homo sapiens (human) | IC50 | 747.0000 | 1 | 1 |
| cAMP-specific 3',5'-cyclic phosphodiesterase 4A | Homo sapiens (human) | Ki | 1.1150 | 1 | 1 |
| cAMP-specific 3',5'-cyclic phosphodiesterase 4B | Homo sapiens (human) | Ki | 1.1150 | 1 | 1 |
| cAMP-specific 3',5'-cyclic phosphodiesterase 4D | Homo sapiens (human) | Ki | 1.1150 | 1 | 1 |
| Canalicular multispecific organic anion transporter 1 | Homo sapiens (human) | IC50 | 133.0000 | 1 | 4 |
| Canalicular multispecific organic anion transporter 1 | Rattus norvegicus (Norway rat) | IC50 | 5.4800 | 1 | 1 |
| Canalicular multispecific organic anion transporter 1 | Rattus norvegicus (Norway rat) | Ki | 132.0000 | 1 | 1 |
| Cannabinoid receptor 1 | Rattus norvegicus (Norway rat) | Ki | 166.8970 | 2 | 3 |
| Cannabinoid receptor 2 | Mus musculus (house mouse) | Ki | 0.0002 | 1 | 1 |
| Carbonic anhydrase | Candida albicans SC5314 | Ki | 9.1600 | 1 | 2 |
| Carbonic anhydrase | Dicentrarchus labrax (European seabass) | Ki | 9.8150 | 1 | 2 |
| Carbonic anhydrase | Methanosarcina thermophila | Ki | 121,462.5000 | 2 | 8 |
| Carbonic anhydrase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 52,360.0000 | 2 | 5 |
| Carbonic anhydrase | Stylophora pistillata | Ki | 8,508.0000 | 1 | 5 |
| Carbonic anhydrase | Cryptococcus neoformans var. grubii | Ki | 13.4000 | 1 | 2 |
| Carbonic anhydrase | Mycobacterium tuberculosis H37Rv | Ki | 45.2000 | 1 | 2 |
| Carbonic anhydrase | Stylophora pistillata | Ki | 195.7400 | 1 | 5 |
| Carbonic anhydrase 1 | Homo sapiens (human) | IC50 | 11,401.0596 | 3 | 5 |
| Carbonic anhydrase 1 | Homo sapiens (human) | Ki | 4,929.5409 | 31 | 111 |
| Carbonic anhydrase 12 | Homo sapiens (human) | Ki | 107.1021 | 11 | 39 |
| Carbonic anhydrase 13 | Mus musculus (house mouse) | IC50 | 1.0355 | 1 | 2 |
| Carbonic anhydrase 13 | Homo sapiens (human) | Ki | 697.0000 | 2 | 2 |
| Carbonic anhydrase 13 | Mus musculus (house mouse) | Ki | 8,928.3374 | 6 | 38 |
| Carbonic anhydrase 14 | Homo sapiens (human) | Ki | 118.0325 | 8 | 36 |
| Carbonic anhydrase 15 | Mus musculus (house mouse) | Ki | 17,220.0500 | 4 | 13 |
| Carbonic anhydrase 2 | Homo sapiens (human) | IC50 | 10,334.1253 | 4 | 6 |
| Carbonic anhydrase 2 | Homo sapiens (human) | Ki | 36,185.2073 | 35 | 118 |
| Carbonic anhydrase 2 | Mycobacterium tuberculosis H37Rv | Ki | 2.0450 | 1 | 6 |
| Carbonic anhydrase 3 | Bos taurus (cattle) | IC50 | 4.6300 | 1 | 1 |
| Carbonic anhydrase 3 | Bos taurus (cattle) | Ki | 9.6460 | 2 | 5 |
| Carbonic anhydrase 3 | Homo sapiens (human) | Ki | 124.2412 | 6 | 33 |
| Carbonic anhydrase 4 | Homo sapiens (human) | Ki | 5,974.3744 | 14 | 66 |
| Carbonic anhydrase 5A, mitochondrial | Homo sapiens (human) | Ki | 16,340.4814 | 10 | 45 |
| Carbonic anhydrase 5B, mitochondrial | Homo sapiens (human) | Ki | 14,912.1384 | 8 | 43 |
| Carbonic anhydrase 6 | Homo sapiens (human) | IC50 | 4.6300 | 1 | 1 |
| Carbonic anhydrase 6 | Homo sapiens (human) | Ki | 199.3415 | 10 | 50 |
| Carbonic anhydrase 7 | Homo sapiens (human) | Ki | 288.1015 | 8 | 39 |
| Carbonic anhydrase 9 | Homo sapiens (human) | Ki | 1,647.4349 | 15 | 45 |
| Carbonic anhydrase, alpha family | Hydrogenovibrio crunogenus XCL-2 | Ki | 218,666.6667 | 1 | 3 |
| carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 1 isoform 1 | Homo sapiens (human) | IC50 | 4.8230 | 1 | 1 |
| Carboxylic ester hydrolase | Equus caballus (horse) | IC50 | 0.1000 | 1 | 1 |
| Carboxylic ester hydrolase | Musca domestica (house fly) | IC50 | 25,000.0000 | 1 | 1 |
| Carnitine O-palmitoyltransferase 1, muscle isoform | Rattus norvegicus (Norway rat) | IC50 | 1.2000 | 1 | 1 |
| Caspase-1 | Homo sapiens (human) | IC50 | 4.8800 | 2 | 2 |
| Catechol O-methyltransferase | Homo sapiens (human) | Ki | 5,400.0000 | 1 | 1 |
| Catechol O-methyltransferase | Rattus norvegicus (Norway rat) | Ki | 3,460.0000 | 1 | 1 |
| Cathepsin K | Homo sapiens (human) | IC50 | 15.0000 | 1 | 1 |
| Cationic amino acid transporter 3 | Homo sapiens (human) | IC50 | 220.5000 | 1 | 2 |
| Cationic trypsin | Bos taurus (cattle) | Ki | 11.0000 | 1 | 1 |
| CD209 antigen | Homo sapiens (human) | IC50 | 2,950.0000 | 1 | 1 |
| CD209 antigen | Homo sapiens (human) | Ki | 6,700.0000 | 1 | 1 |
| CDGSH iron-sulfur domain-containing protein 1 | Homo sapiens (human) | IC50 | 26.5400 | 1 | 1 |
| CDGSH iron-sulfur domain-containing protein 1 | Homo sapiens (human) | Ki | 1.1340 | 1 | 1 |
| Cdk-related protein kinase 6 | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1.0000 | 1 | 1 |
| cGMP-inhibited 3',5'-cyclic phosphodiesterase A | Homo sapiens (human) | IC50 | 2.4000 | 1 | 1 |
| cGMP-inhibited 3',5'-cyclic phosphodiesterase B | Homo sapiens (human) | IC50 | 2.4000 | 1 | 1 |
| Chain A, 2-ENOYL-COA HYDRATASE | Rattus norvegicus (Norway rat) | Ki | 1.6000 | 1 | 1 |
| Chain A, Acetylcholinesterase | Tetronarce californica (Pacific electric ray) | Ki | 0.0331 | 1 | 1 |
| Chain A, ADENOSINE DEAMINASE | Mus musculus (house mouse) | Ki | 0.0000 | 1 | 2 |
| Chain A, Aicar Transformylase-imp Cyclohydrolase | Gallus gallus (chicken) | Ki | 0.1200 | 1 | 1 |
| Chain A, Aminopeptidase | Streptomyces griseus | Ki | 11,780.0000 | 1 | 5 |
| Chain A, Arginase 1 | Rattus norvegicus (Norway rat) | Ki | 1,650.0000 | 1 | 4 |
| Chain A, Beta-phosphoglucomutase | Lactococcus lactis | Ki | 30.0000 | 1 | 4 |
| Chain A, Bifunctional purine biosynthesis protein PURH | Homo sapiens (human) | Ki | 0.1200 | 1 | 1 |
| Chain A, Carbonic anhydrase 2 | Homo sapiens (human) | Ki | 0.0900 | 1 | 3 |
| Chain A, Chitinase | Clonostachys rosea | Ki | 19,700.0000 | 1 | 1 |
| Chain A, Deoxynucleoside kinase | Drosophila melanogaster (fruit fly) | IC50 | 1,000.0000 | 1 | 1 |
| Chain A, Enolase | Homarus gammarus (European lobster) | Ki | 200.0000 | 1 | 1 |
| Chain A, EOSINOPHIL-DERIVED NEUROTOXIN | Homo sapiens (human) | Ki | 32.0000 | 1 | 3 |
| Chain A, Fatty-acid amide hydrolase 1 | Rattus norvegicus (Norway rat) | IC50 | 0.0046 | 1 | 1 |
| Chain A, Glucosamine--fructose-6-phosphate aminotransferase [isomerizing] | Escherichia coli | Ki | 15.0000 | 1 | 1 |
| Chain A, Glucose-1-phosphate cytidylyltransferase | Salmonella enterica subsp. enterica serovar Typhi str. CT18 | Ki | 35.0000 | 1 | 1 |
| Chain A, Glutamate Racemase | Aquifex pyrophilus | Ki | 50,000.0000 | 1 | 1 |
| Chain A, Glutamate Receptor Subunit 2 | Rattus norvegicus (Norway rat) | IC50 | 0.8210 | 1 | 2 |
| Chain A, Glycogen Phosphorylase | Oryctolagus cuniculus (rabbit) | Ki | 100.0000 | 1 | 1 |
| Chain A, Hypoxanthine Phosphoribosyltransferase | Escherichia coli | Ki | 386.5000 | 1 | 4 |
| Chain A, Hypoxanthine-guanine phosphoribosyltransferase | Caldanaerobacter subterraneus subsp. tengcongensis MB4 | Ki | 45.0000 | 1 | 1 |
| Chain A, L-ARGININE\\:GLYCINE AMIDINOTRANSFERASE | Homo sapiens (human) | Ki | 253.0000 | 1 | 1 |
| Chain A, Leucine Aminopeptidase | Bos taurus (cattle) | Ki | 0.0600 | 1 | 1 |
| Chain A, Methionine aminopeptidase | Pyrococcus furiosus | Ki | 150,000.0000 | 1 | 1 |
| Chain A, METHYLGLYOXAL SYNTHASE | Escherichia coli | Ki | 3.9000 | 1 | 2 |
| Chain A, MTA/SAH nucleosidase | Escherichia coli | Ki | 300.0000 | 1 | 1 |
| Chain A, NAD-dependent deacetylase | Thermotoga maritima | IC50 | 1,000.0000 | 1 | 1 |
| Chain A, orotidine 5'-monophosphate decarboxylase | Archaea | Ki | 100.2050 | 1 | 2 |
| Chain A, orotidine 5'-monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
| Chain A, orotidine monophosphate decarboxylase | Methanothermobacter thermautotrophicus | Ki | 100.2050 | 1 | 2 |
| Chain A, orotidine monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
| Chain A, Penicillin Amidohydrolase | Escherichia coli | Ki | 94.5000 | 1 | 14 |
| Chain A, Phosphoenolpyruvate Phosphomutase | Mytilus edulis | Ki | 22.0000 | 1 | 1 |
| Chain A, PROTEIN (HYDROXYNITRILE LYASE) | Hevea brasiliensis (rubber tree) | Ki | 390.0000 | 1 | 2 |
| Chain A, Protein (peroxisome Proliferator Activated Receptor (ppar-delta)) | Homo sapiens (human) | IC50 | 4.0000 | 1 | 1 |
| Chain A, Proto-oncogene Tyrosine-protein Kinase Src | Homo sapiens (human) | IC50 | 3,500.0000 | 1 | 26 |
| Chain A, Protocatechuate 3,4-dioxygenase | Pseudomonas putida | Ki | 5,000.0000 | 1 | 6 |
| Chain A, retinol dehydratase | Spodoptera frugiperda (fall armyworm) | Ki | 0.1100 | 1 | 1 |
| Chain A, Ribonuclease pancreatic | Bos taurus (cattle) | Ki | 1,317.8571 | 1 | 7 |
| Chain A, Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplast | Pisum sativum (garden pea) | Ki | 36,600.0000 | 1 | 2 |
| Chain A, Sulfotransferase 1A1 | Homo sapiens (human) | Ki | 283.0000 | 1 | 2 |
| Chain A, TRIOSEPHOSPHATE ISOMERASE | Homo sapiens (human) | Ki | 7.4000 | 1 | 1 |
| Chain A, TRIOSEPHOSPHATE ISOMERASE | Moritella marina | Ki | 89,000.0000 | 1 | 1 |
| Chain A, Triosephosphate Isomerase | Plasmodium falciparum (malaria parasite P. falciparum) | Ki | 29.0000 | 1 | 2 |
| Chain A, Triosephosphate Isomerase | Saccharomyces cerevisiae (brewer's yeast) | Ki | 15.0000 | 1 | 1 |
| Chain A, Triosephosphate Isomerase | Trypanosoma brucei brucei | Ki | 52.0000 | 1 | 1 |
| Chain A, triosephosphate isomerase, glycosomal | Trypanosoma brucei brucei | Ki | 60.0000 | 1 | 1 |
| Chain A, TRYPSIN | Bos taurus (cattle) | Ki | 11,000.0000 | 1 | 6 |
| Chain A, Uracil-DNA Glycosylase | Thermus thermophilus | Ki | 0.0880 | 1 | 1 |
| Chain A, X-ray structure of the sucrose-phosphatase (SPP) from Synechocystis sp.PCC6803 in complex with cellobiose | Synechocystis sp. PCC 6803 | Ki | 26,000.0000 | 1 | 1 |
| Chain A, X-ray structure of the sucrose-phosphatase (SPP) from Synechocystis sp.PCC6803 in complex with maltose | Synechocystis sp. PCC 6803 | Ki | 26,000.0000 | 1 | 1 |
| Chain A, X-ray structure of the sucrose-phosphatase (SPP) from Synechocystis sp.PCC6803 in complex with trehalose | Synechocystis sp. PCC 6803 | Ki | 26,000.0000 | 1 | 1 |
| Chain B, 2-ENOYL-COA HYDRATASE | Rattus norvegicus (Norway rat) | Ki | 1.6000 | 1 | 1 |
| Chain B, Aicar Transformylase-imp Cyclohydrolase | Gallus gallus (chicken) | Ki | 0.1200 | 1 | 1 |
| Chain B, Bifunctional purine biosynthesis protein PURH | Homo sapiens (human) | Ki | 0.1200 | 1 | 1 |
| Chain B, CTP synthase | Escherichia coli K-12 | Ki | 110.0000 | 1 | 1 |
| Chain B, Glutamate Receptor Subunit 2 | Rattus norvegicus (Norway rat) | IC50 | 0.8210 | 1 | 1 |
| Chain B, lectin I B chain | Viscum album (European mistletoe) | IC50 | 900.0000 | 1 | 1 |
| Chain B, orotidine 5'-monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
| Chain B, orotidine monophosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 100.2050 | 1 | 2 |
| Chain B, Penicillin Amidohydrolase | Escherichia coli | Ki | 94.5000 | 1 | 14 |
| Chain B, TRIOSEPHOSPHATE ISOMERASE | Homo sapiens (human) | Ki | 7.4000 | 1 | 1 |
| Chain B, Triosephosphate Isomerase | Plasmodium falciparum (malaria parasite P. falciparum) | Ki | 29.0000 | 1 | 2 |
| Chain F, Methylglyoxal synthase | Escherichia coli | Ki | 3.9000 | 1 | 2 |
| Chain H, IGG1-KAPPA DB3 FAB (HEAVY CHAIN) | Mus musculus (house mouse) | IC50 | 0.0145 | 1 | 6 |
| Chain L, IGG1-KAPPA DB3 FAB (LIGHT CHAIN) | Mus musculus (house mouse) | IC50 | 0.0145 | 1 | 6 |
| Chain M, PROTOCATECHUATE 3,4-DIOXYGENASE | Pseudomonas putida | Ki | 5,000.0000 | 1 | 6 |
| Chain O, Protein (glycerol Kinase) | Escherichia coli | Ki | 250.0000 | 1 | 1 |
| Chain X, Dimeric dihydrodiol dehydrogenase | Macaca fascicularis (crab-eating macaque) | IC50 | 0.9700 | 1 | 1 |
| Chitotriosidase-1 | Homo sapiens (human) | IC50 | 363.0000 | 1 | 2 |
| Cholecystokinin receptor type A | Homo sapiens (human) | Ki | 0.3020 | 1 | 1 |
| Cholesteryl ester transfer protein | Homo sapiens (human) | IC50 | 0.1400 | 1 | 1 |
| Choline O-acetyltransferase | Homo sapiens (human) | IC50 | 1,800,000,000.0000 | 1 | 1 |
| Choline O-acetyltransferase | Homo sapiens (human) | Ki | 75.0000 | 1 | 1 |
| Choline O-acetyltransferase | Rattus norvegicus (Norway rat) | Ki | 47,000.0000 | 1 | 1 |
| Choline trimethylamine-lyase | Oleidesulfovibrio alaskensis G20 | IC50 | 26.0000 | 1 | 1 |
| Cholinesterase | Equus caballus (horse) | IC50 | 0.0160 | 1 | 1 |
| Cholinesterase | Homo sapiens (human) | IC50 | 10.3514 | 4 | 5 |
| Cholinesterase | Homo sapiens (human) | Ki | 57.8650 | 2 | 7 |
| CMP-N-acetylneuraminate-beta-1,4-galactoside alpha-2,3-sialyltransferase | Rattus norvegicus (Norway rat) | Ki | 65.0000 | 1 | 1 |
| CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 | Homo sapiens (human) | IC50 | 123.5500 | 1 | 6 |
| Coagulation factor VII | Homo sapiens (human) | IC50 | 64.6000 | 1 | 5 |
| Coagulation factor VII | Homo sapiens (human) | Ki | 8,000.0000 | 1 | 1 |
| Coagulation factor XII | Homo sapiens (human) | Ki | 67.1675 | 1 | 6 |
| Cocaine esterase | Homo sapiens (human) | Ki | 100.0000 | 1 | 1 |
| core protein, partial | | IC50 | 35.9842 | 3 | 4 |
| Corticosteroid-binding globulin | Homo sapiens (human) | Ki | 3.6222 | 1 | 16 |
| Cyclin-dependent kinase 1 | Homo sapiens (human) | IC50 | 200.0000 | 1 | 1 |
| cysteine protease ATG4B isoform a | Homo sapiens (human) | IC50 | 15.3000 | 1 | 1 |
| Cysteinyl leukotriene receptor 1 | Homo sapiens (human) | IC50 | 0.0038 | 2 | 2 |
| Cysteinyl leukotriene receptor 1 | Homo sapiens (human) | Ki | 0.0004 | 2 | 2 |
| Cytochrome P450 1A1 | Homo sapiens (human) | Ki | 61.0000 | 3 | 3 |
| Cytochrome P450 1A2 | Homo sapiens (human) | IC50 | 239.0133 | 2 | 3 |
| Cytochrome P450 1A2 | Homo sapiens (human) | Ki | 8.6413 | 2 | 3 |
| Cytochrome P450 1A2 | Rattus norvegicus (Norway rat) | Ki | 0.0003 | 1 | 1 |
| Cytochrome P450 1B1 | Homo sapiens (human) | IC50 | 50.0000 | 1 | 1 |
| Cytochrome P450 1B1 | Homo sapiens (human) | Ki | 25.0000 | 2 | 2 |
| Cytochrome P450 2A13 | Homo sapiens (human) | Ki | 16.0000 | 1 | 1 |
| Cytochrome P450 2A5 | Mus musculus (house mouse) | IC50 | 51.2779 | 2 | 7 |
| Cytochrome P450 2A6 | Homo sapiens (human) | IC50 | 75.4891 | 2 | 7 |
| Cytochrome P450 2A6 | Homo sapiens (human) | Ki | 1.7000 | 1 | 1 |
| Cytochrome P450 2C11 | Rattus norvegicus (Norway rat) | Ki | 0.0003 | 1 | 1 |
| Cytochrome P450 2C19 | Homo sapiens (human) | Ki | 0.0001 | 1 | 1 |
| Cytochrome P450 2C9 | Homo sapiens (human) | IC50 | 0.0747 | 2 | 2 |
| Cytochrome P450 2D6 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
| Cytochrome P450 2D6 | Homo sapiens (human) | Ki | 0.0002 | 2 | 2 |
| Cytochrome P450 3A4 | Homo sapiens (human) | IC50 | 50.0046 | 2 | 2 |
| Cytochrome P450 3A4 | Homo sapiens (human) | Ki | 0.0001 | 1 | 1 |
| Cytochrome P450 3A5 | Homo sapiens (human) | IC50 | 40.0000 | 1 | 1 |
| Cytosolic phospholipase A2 gamma | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
| D | Rattus norvegicus (Norway rat) | IC50 | 5.7544 | 1 | 1 |
| D-amino-acid oxidase | Homo sapiens (human) | IC50 | 1,125.0000 | 1 | 1 |
| D-aspartate oxidase | Homo sapiens (human) | IC50 | 2,778.0000 | 1 | 1 |
| D(1A) dopamine receptor | Homo sapiens (human) | Ki | 390.0000 | 1 | 2 |
| D(2) dopamine receptor | Homo sapiens (human) | Ki | 160.0000 | 1 | 1 |
| D(2) dopamine receptor | Rattus norvegicus (Norway rat) | Ki | 0.3300 | 1 | 1 |
| Deoxyhypusine synthase | Rattus norvegicus (Norway rat) | IC50 | 156.0000 | 1 | 1 |
| Deoxyuridine triphosphatase, putative | Trypanosoma cruzi strain CL Brener | Ki | 18.4000 | 1 | 1 |
| Dihydrofolate reductase | Homo sapiens (human) | IC50 | 3,412.5000 | 2 | 2 |
| Dihydrofolate reductase | Homo sapiens (human) | Ki | 1,401.1850 | 2 | 2 |
| Dihydrofolate synthase/folylpolyglutamate synthase | Escherichia coli K-12 | Ki | 3.1000 | 1 | 1 |
| Dihydroorotate dehydrogenase | Leishmania major | IC50 | 1,668.9450 | 1 | 2 |
| Dihydroorotate dehydrogenase | Schistosoma mansoni | IC50 | 8.8000 | 1 | 1 |
| Dihydroorotate dehydrogenase (quinone), mitochondrial | Homo sapiens (human) | IC50 | 34.0000 | 1 | 1 |
| Dipeptidyl peptidase 4 | Homo sapiens (human) | IC50 | 3.3700 | 1 | 1 |
| Disabled homolog 2-interacting protein | Homo sapiens (human) | Ki | 1.2600 | 1 | 1 |
| Disintegrin and metalloproteinase domain-containing protein 17 | Homo sapiens (human) | IC50 | 200.0000 | 1 | 1 |
| DNA dC->dU-editing enzyme APOBEC-3G isoform 1 | Homo sapiens (human) | IC50 | 18.8800 | 2 | 2 |
| DNA polymerase beta | Homo sapiens (human) | IC50 | 13.8500 | 2 | 2 |
| DNA topoisomerase 1 | Homo sapiens (human) | IC50 | 31.0000 | 1 | 1 |
| DNA-dependent protein kinase catalytic subunit | Homo sapiens (human) | IC50 | 10,000.0000 | 1 | 1 |
| Dual specificity protein phosphatase 1 | Mus musculus (house mouse) | IC50 | 50.0000 | 1 | 1 |
| Dual specificity protein phosphatase 3 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
| Dual specificity protein phosphatase 6 | Rattus norvegicus (Norway rat) | IC50 | 50.0000 | 1 | 1 |
| E3 ubiquitin-protein ligase Mdm2 | Homo sapiens (human) | IC50 | 13.9000 | 1 | 1 |
| E3 ubiquitin-protein ligase XIAP | Homo sapiens (human) | IC50 | 80.2000 | 1 | 1 |
| Ecdysone receptor | Drosophila melanogaster (fruit fly) | IC50 | 41.6869 | 1 | 1 |
| Endochitinase B1 | Aspergillus fumigatus | IC50 | 363.0000 | 1 | 2 |
| Ephrin type-A receptor 2 | Homo sapiens (human) | IC50 | 53.7720 | 2 | 2 |
| Ephrin type-A receptor 2 | Mus musculus (house mouse) | IC50 | 68.0000 | 2 | 2 |
| Epidermal growth factor receptor | Homo sapiens (human) | IC50 | 1,220.5760 | 3 | 5 |
| Epidermal growth factor receptor | Homo sapiens (human) | Ki | 700.0000 | 2 | 4 |
| Estrogen receptor | Homo sapiens (human) | IC50 | 1.1158 | 8 | 11 |
| Estrogen receptor | Homo sapiens (human) | Ki | 0.0013 | 1 | 2 |
| Estrogen receptor beta | Homo sapiens (human) | IC50 | 0.2832 | 7 | 8 |
| Excitatory amino acid transporter 1 | Homo sapiens (human) | IC50 | 177.4872 | 5 | 13 |
| Excitatory amino acid transporter 1 | Homo sapiens (human) | Ki | 33.3114 | 1 | 2 |
| Excitatory amino acid transporter 2 | Homo sapiens (human) | IC50 | 48.5752 | 3 | 7 |
| Excitatory amino acid transporter 2 | Homo sapiens (human) | Ki | 62.5478 | 1 | 2 |
| Excitatory amino acid transporter 3 | Homo sapiens (human) | IC50 | 33.9961 | 2 | 6 |
| Excitatory amino acid transporter 3 | Homo sapiens (human) | Ki | 25.0848 | 1 | 2 |
| Excitatory amino acid transporter 4 | Rattus norvegicus (Norway rat) | IC50 | 12.1228 | 2 | 6 |
| Fatty acid synthase | Homo sapiens (human) | Ki | 75,750.0000 | 1 | 2 |
| Fatty acid-binding protein 5 | Homo sapiens (human) | Ki | 4.3045 | 2 | 4 |
| Fatty acid-binding protein, adipocyte | Homo sapiens (human) | IC50 | 14.4250 | 2 | 2 |
| Fatty acid-binding protein, adipocyte | Homo sapiens (human) | Ki | 0.8425 | 2 | 2 |
| Fatty acid-binding protein, heart | Homo sapiens (human) | IC50 | 0.3670 | 1 | 1 |
| Fatty acid-binding protein, liver | Rattus norvegicus (Norway rat) | Ki | 1.5400 | 2 | 2 |
| Fatty-acid amide hydrolase 1 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
| Fatty-acid amide hydrolase 1 | Mus musculus (house mouse) | IC50 | 5.9000 | 1 | 1 |
| Fatty-acid amide hydrolase 1 | Rattus norvegicus (Norway rat) | IC50 | 3.3000 | 1 | 1 |
| Fatty-acid amide hydrolase 1 | Homo sapiens (human) | Ki | 6.0000 | 1 | 1 |
| Fatty-acid amide hydrolase 1 | Rattus norvegicus (Norway rat) | Ki | 0.2085 | 2 | 2 |
| Fibrinogen C domain-containing protein 1 | Homo sapiens (human) | IC50 | 5,000.0000 | 1 | 1 |
| fMet-Leu-Phe receptor | Homo sapiens (human) | IC50 | 66.7000 | 1 | 1 |
| Fructose-1,6-bisphosphatase 1 | Homo sapiens (human) | IC50 | 12.0000 | 1 | 1 |
| Fucose-binding lectin PA-IIL | Pseudomonas aeruginosa PAO1 | IC50 | 2.1300 | 3 | 3 |
| G-protein coupled bile acid receptor 1 | Homo sapiens (human) | IC50 | 6.0000 | 1 | 1 |
| G-protein coupled bile acid receptor 1 | Mus musculus (house mouse) | IC50 | 5.3000 | 1 | 1 |
| GABA theta subunit | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| GABA theta subunit | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gag-Pol polyprotein | HIV-1 M:B_HXB2R | IC50 | 2.7000 | 1 | 1 |
| Galectin-1 | Homo sapiens (human) | IC50 | 50,000.0000 | 1 | 1 |
| Galectin-3 | Homo sapiens (human) | IC50 | 50,000.0000 | 1 | 1 |
| Gamma-aminobutyric acid receptor subunit alpha-1 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-2 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | IC50 | 17.8417 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-3 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-4 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-5 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | IC50 | 14.3154 | 4 | 5 |
| Gamma-aminobutyric acid receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-6 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-1 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-1 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit beta-1 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-2 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-2 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit beta-2 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-3 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-3 | Rattus norvegicus (Norway rat) | IC50 | 14.3154 | 4 | 5 |
| Gamma-aminobutyric acid receptor subunit beta-3 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit delta | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit delta | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit delta | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit epsilon | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit epsilon | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit epsilon | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit gamma-1 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit gamma-1 | Rattus norvegicus (Norway rat) | IC50 | 17.8417 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit gamma-1 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit gamma-2 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit gamma-2 | Rattus norvegicus (Norway rat) | IC50 | 14.3154 | 4 | 5 |
| Gamma-aminobutyric acid receptor subunit gamma-2 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit gamma-3 | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit gamma-3 | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit gamma-3 | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit pi | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gamma-aminobutyric acid receptor subunit pi | Rattus norvegicus (Norway rat) | IC50 | 17.8418 | 3 | 4 |
| Gamma-aminobutyric acid receptor subunit pi | Rattus norvegicus (Norway rat) | Ki | 0.0032 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit rho-1 | Homo sapiens (human) | IC50 | 12.9000 | 1 | 1 |
| Gamma-aminobutyric acid receptor subunit theta | Homo sapiens (human) | IC50 | 75.0000 | 2 | 2 |
| Gastrin/cholecystokinin type B receptor | Homo sapiens (human) | Ki | 0.3020 | 1 | 1 |
| Ghrelin O-acyltransferase | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 1 |
| Glucocorticoid receptor | Homo sapiens (human) | IC50 | 10.5785 | 2 | 4 |
| Glucocorticoid receptor | Rattus norvegicus (Norway rat) | IC50 | 20.0000 | 2 | 2 |
| Glucocorticoid receptor | Homo sapiens (human) | Ki | 6.3293 | 1 | 3 |
| Glucose transporter | Leishmania mexicana | IC50 | 12.0000 | 1 | 1 |
| Glucose-1-phosphate cytidylyltransferase | Salmonella enterica subsp. enterica serovar Typhi | Ki | 35.0000 | 1 | 1 |
| Glucose-6-phosphate 1-dehydrogenase | Homo sapiens (human) | IC50 | 45.3075 | 4 | 8 |
| Glucose-6-phosphate 1-dehydrogenase | Homo sapiens (human) | Ki | 10.1667 | 3 | 3 |
| Glucose-6-phosphate 1-dehydrogenase | Trypanosoma brucei | Ki | 1.4000 | 2 | 2 |
| glucose-6-phosphate 1-dehydrogenase isoform b | Homo sapiens (human) | IC50 | 48.2500 | 1 | 2 |
| glucose-6-phosphate dehydrogenase-6-phosphogluconolactonase | Plasmodium berghei | IC50 | 34.3733 | 3 | 6 |
| Glutamate carboxypeptidase 2 | Homo sapiens (human) | IC50 | 475.5000 | 2 | 4 |
| Glutamate dehydrogenase 1, mitochondrial | Bos taurus (cattle) | Ki | 10,000.0000 | 1 | 1 |
| Glutamate racemase | Helicobacter pylori 26695 | Ki | 33,555.6000 | 3 | 3 |
| Glutamate receptor 1 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
| Glutamate receptor 1 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
| Glutamate receptor 1 | Homo sapiens (human) | Ki | 198.5205 | 4 | 4 |
| Glutamate receptor 1 | Rattus norvegicus (Norway rat) | Ki | 0.6345 | 2 | 2 |
| Glutamate receptor 2 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
| Glutamate receptor 2 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
| Glutamate receptor 2 | Homo sapiens (human) | Ki | 198.2050 | 4 | 4 |
| Glutamate receptor 2 | Rattus norvegicus (Norway rat) | Ki | 0.4452 | 4 | 5 |
| Glutamate receptor 3 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
| Glutamate receptor 3 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
| Glutamate receptor 3 | Homo sapiens (human) | Ki | 790.0000 | 1 | 1 |
| Glutamate receptor 3 | Rattus norvegicus (Norway rat) | Ki | 2.3122 | 4 | 4 |
| Glutamate receptor 4 | Homo sapiens (human) | IC50 | 0.6130 | 1 | 1 |
| Glutamate receptor 4 | Rattus norvegicus (Norway rat) | IC50 | 33.7257 | 5 | 6 |
| Glutamate receptor 4 | Homo sapiens (human) | Ki | 198.1510 | 4 | 4 |
| Glutamate receptor 4 | Rattus norvegicus (Norway rat) | Ki | 0.7270 | 2 | 2 |
| Glutamate receptor ionotropic, kainate 1 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
| Glutamate receptor ionotropic, kainate 1 | Homo sapiens (human) | Ki | 0.7010 | 2 | 2 |
| Glutamate receptor ionotropic, kainate 1 | Rattus norvegicus (Norway rat) | Ki | 0.1284 | 5 | 7 |
| Glutamate receptor ionotropic, kainate 2 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
| Glutamate receptor ionotropic, kainate 2 | Homo sapiens (human) | Ki | 1.1060 | 2 | 2 |
| Glutamate receptor ionotropic, kainate 2 | Rattus norvegicus (Norway rat) | Ki | 0.9566 | 7 | 9 |
| Glutamate receptor ionotropic, kainate 3 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
| Glutamate receptor ionotropic, kainate 3 | Homo sapiens (human) | Ki | 0.7890 | 2 | 2 |
| Glutamate receptor ionotropic, kainate 3 | Rattus norvegicus (Norway rat) | Ki | 113.2172 | 5 | 7 |
| Glutamate receptor ionotropic, kainate 4 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
| Glutamate receptor ionotropic, kainate 4 | Rattus norvegicus (Norway rat) | Ki | 0.0630 | 1 | 1 |
| Glutamate receptor ionotropic, kainate 5 | Rattus norvegicus (Norway rat) | IC50 | 0.3800 | 3 | 5 |
| Glutamate receptor ionotropic, kainate 5 | Homo sapiens (human) | Ki | 0.7337 | 3 | 3 |
| Glutamate receptor ionotropic, kainate 5 | Rattus norvegicus (Norway rat) | Ki | 0.0630 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 1 | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | IC50 | 64.5315 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 2A | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | IC50 | 14.6074 | 6 | 7 |
| Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 2B | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | IC50 | 14.6074 | 6 | 7 |
| Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 2C | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | IC50 | 14.6074 | 6 | 7 |
| Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 2D | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | IC50 | 14.6074 | 6 | 7 |
| Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 3A | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | IC50 | 14.6074 | 6 | 7 |
| Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 3B | Homo sapiens (human) | IC50 | 0.0700 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | IC50 | 14.6074 | 6 | 7 |
| Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | Ki | 7.6212 | 7 | 8 |
| Glutaminyl-peptide cyclotransferase | Homo sapiens (human) | Ki | 6,916.6667 | 1 | 3 |
| Glutaminyl-peptide cyclotransferase | Mus musculus (house mouse) | Ki | 9,671.0000 | 1 | 2 |
| Glutathione reductase, mitochondrial | Homo sapiens (human) | IC50 | 57.4500 | 1 | 2 |
| Glutathione reductase, mitochondrial | Homo sapiens (human) | Ki | 48.6500 | 1 | 2 |
| Glyceraldehyde-3-phosphate dehydrogenase | Homo sapiens (human) | IC50 | 500.0000 | 2 | 2 |
| Glycine receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | IC50 | 13.9247 | 1 | 3 |
| Glycine receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | Ki | 6.3293 | 1 | 3 |
| Glycine receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | IC50 | 13.9247 | 1 | 3 |
| Glycine receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | Ki | 6.3293 | 1 | 3 |
| Glycine receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | IC50 | 13.9247 | 1 | 3 |
| Glycine receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | Ki | 6.3293 | 1 | 3 |
| Glycine receptor subunit beta | Rattus norvegicus (Norway rat) | IC50 | 13.9247 | 1 | 3 |
| Glycine receptor subunit beta | Rattus norvegicus (Norway rat) | Ki | 6.3293 | 1 | 3 |
| Glycogen phosphorylase, liver form | Rattus norvegicus (Norway rat) | IC50 | 648.0000 | 1 | 1 |
| Glycogen phosphorylase, liver form | Homo sapiens (human) | Ki | 4,900.0000 | 1 | 1 |
| Glycogen phosphorylase, muscle form | Oryctolagus cuniculus (rabbit) | IC50 | 159.1933 | 13 | 15 |
| Glycogen phosphorylase, muscle form | Rattus norvegicus (Norway rat) | IC50 | 182.0000 | 1 | 1 |
| Glycogen phosphorylase, muscle form | Homo sapiens (human) | Ki | 1,700.0000 | 1 | 1 |
| Glycogen phosphorylase, muscle form | Oryctolagus cuniculus (rabbit) | Ki | 2,900.0000 | 4 | 5 |
| Gonadotropin-releasing hormone receptor | Rattus norvegicus (Norway rat) | Ki | 6.5000 | 1 | 3 |
| green fluorescent protein, partial | Aequorea victoria | IC50 | 67.5880 | 1 | 1 |
| Guanine deaminase | Homo sapiens (human) | Ki | 6.1325 | 1 | 4 |
| guanine nucleotide-binding protein subunit alpha-15 | Homo sapiens (human) | IC50 | 29.9020 | 1 | 1 |
| heat shock protein HSP 90-alpha isoform 2 | Homo sapiens (human) | IC50 | 50.0000 | 1 | 1 |
| Heat shock protein HSP 90-beta | Homo sapiens (human) | IC50 | 4,000.0000 | 2 | 3 |
| Hexose transporter 1 | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 12.0000 | 1 | 1 |
| High affinity choline transporter 1 | Mus musculus (house mouse) | IC50 | 1.6000 | 1 | 1 |
| Histamine H1 receptor | Homo sapiens (human) | IC50 | 0.1585 | 1 | 2 |
| Histamine H1 receptor | Rattus norvegicus (Norway rat) | IC50 | 0.1585 | 1 | 3 |
| Histamine H1 receptor | Cavia porcellus (domestic guinea pig) | Ki | 12.5892 | 1 | 1 |
| Histamine H1 receptor | Homo sapiens (human) | Ki | 1,440,809,206.6944 | 11 | 11 |
| Histamine H1 receptor | Rattus norvegicus (Norway rat) | Ki | 15,848,900,000.0000 | 1 | 1 |
| Histamine H2 receptor | Homo sapiens (human) | Ki | 13.7162 | 7 | 7 |
| Histamine H3 receptor | Cavia porcellus (domestic guinea pig) | Ki | 0.0001 | 1 | 1 |
| Histamine H3 receptor | Homo sapiens (human) | Ki | 1.1824 | 17 | 18 |
| Histamine H3 receptor | Mus musculus (house mouse) | Ki | 0.0680 | 1 | 1 |
| Histamine H4 receptor | Homo sapiens (human) | Ki | 0.5926 | 18 | 19 |
| Histamine H4 receptor | Mus musculus (house mouse) | Ki | 0.0607 | 2 | 2 |
| Histamine H4 receptor | Rattus norvegicus (Norway rat) | Ki | 0.0996 | 2 | 2 |
| Histamine H4 receptor | Cavia porcellus (domestic guinea pig) | Ki | 0.0060 | 1 | 1 |
| Histamine N-methyltransferase | Rattus norvegicus (Norway rat) | Ki | 0.0144 | 1 | 1 |
| Histone acetyltransferase KAT2B | Homo sapiens (human) | IC50 | 41.9100 | 1 | 1 |
| Histone acetyltransferase KAT5 | Homo sapiens (human) | IC50 | 82.2700 | 1 | 1 |
| Histone acetyltransferase KAT8 | Homo sapiens (human) | IC50 | 1,000.0000 | 1 | 1 |
| Histone acetyltransferase p300 | Homo sapiens (human) | IC50 | 45.9400 | 1 | 1 |
| Histone deacetylase 1 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 1 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 11 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 11 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 2 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 2 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 3 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 3 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 4 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 4 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 5 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 5 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 6 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 6 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 7 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 7 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 8 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 8 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone deacetylase 9 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Histone deacetylase 9 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Histone-lysine N-methyltransferase EHMT1 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 2 |
| Histone-lysine N-methyltransferase EHMT2 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 2 |
| Hyaluronidase-1 | Homo sapiens (human) | IC50 | 2,000.0000 | 1 | 1 |
| Hydroxycarboxylic acid receptor 2 | Homo sapiens (human) | IC50 | 4.3681 | 16 | 16 |
| Hydroxycarboxylic acid receptor 2 | Mus musculus (house mouse) | IC50 | 0.1400 | 3 | 3 |
| Hydroxycarboxylic acid receptor 2 | Homo sapiens (human) | Ki | 3.5590 | 4 | 4 |
| Hypoxanthine-guanine phosphoribosyltransferase | Homo sapiens (human) | Ki | 5.6667 | 2 | 3 |
| Ileal sodium/bile acid cotransporter | Homo sapiens (human) | Ki | 28.1333 | 1 | 3 |
| Indoleamine 2,3-dioxygenase 1 | Homo sapiens (human) | IC50 | 498.7000 | 1 | 1 |
| Indoleamine 2,3-dioxygenase 1 | Homo sapiens (human) | Ki | 158.0000 | 2 | 2 |
| Indolethylamine N-methyltransferase | Homo sapiens (human) | Ki | 700.0000 | 1 | 2 |
| Inosine-5'-monophosphate dehydrogenase 1 | Homo sapiens (human) | Ki | 0.2500 | 1 | 1 |
| Inosine-5'-monophosphate dehydrogenase 2 | Homo sapiens (human) | Ki | 0.2500 | 1 | 1 |
| Inositol 1,4,5-trisphosphate receptor type 1 | Homo sapiens (human) | IC50 | 0.0300 | 3 | 3 |
| Inositol 1,4,5-trisphosphate receptor type 2 | Homo sapiens (human) | IC50 | 0.0300 | 3 | 3 |
| Inositol 1,4,5-trisphosphate receptor type 3 | Homo sapiens (human) | IC50 | 0.0300 | 3 | 3 |
| Inositol polyphosphate-5-phosphatase A | Homo sapiens (human) | Ki | 15.0000 | 1 | 1 |
| Inositol-trisphosphate 3-kinase A | Rattus norvegicus (Norway rat) | IC50 | 17.5333 | 1 | 3 |
| Integrase | Human immunodeficiency virus 1 | IC50 | 27.9200 | 5 | 5 |
| integrase, partial | Human immunodeficiency virus 1 | IC50 | 0.5939 | 2 | 2 |
| Interstitial collagenase | Homo sapiens (human) | IC50 | 0.2389 | 1 | 1 |
| Intestinal-type alkaline phosphatase | Bos taurus (cattle) | IC50 | 80.2060 | 5 | 5 |
| Intestinal-type alkaline phosphatase | Homo sapiens (human) | IC50 | 39.0400 | 3 | 5 |
| Lanosterol 14-alpha demethylase | Homo sapiens (human) | IC50 | 200.0000 | 1 | 2 |
| Large neutral amino acids transporter small subunit 1 | Homo sapiens (human) | IC50 | 112.0000 | 4 | 14 |
| Large neutral amino acids transporter small subunit 1 | Rattus norvegicus (Norway rat) | Ki | 55.0000 | 1 | 1 |
| large T antigen | Betapolyomavirus macacae | IC50 | 28.8300 | 1 | 7 |
| lens epithelium-derived growth factor p75 | Homo sapiens (human) | IC50 | 0.5939 | 2 | 2 |
| Leucine-rich repeat serine/threonine-protein kinase 2 | Homo sapiens (human) | IC50 | 15.8090 | 1 | 1 |
| Leucine-rich repeat serine/threonine-protein kinase 2 | Homo sapiens (human) | Ki | 6.7150 | 1 | 1 |
| Leukotriene B4 receptor 1 | Homo sapiens (human) | IC50 | 0.0019 | 1 | 1 |
| Leukotriene B4 receptor 1 | Homo sapiens (human) | Ki | 0.1327 | 4 | 4 |
| Leukotriene B4 receptor 2 | Homo sapiens (human) | Ki | 0.2630 | 2 | 2 |
| Linoleate 9S-lipoxygenase-4 | Glycine max (soybean) | IC50 | 600.0000 | 1 | 1 |
| Lipopolysaccharide heptosyltransferase 1 | Escherichia coli K-12 | Ki | 500.0000 | 1 | 1 |
| Lipoxygenase | Solanum tuberosum (potato) | IC50 | 3.5000 | 2 | 2 |
| Liver carboxylesterase 1 | Homo sapiens (human) | Ki | 71.8579 | 2 | 7 |
| Liver carboxylesterase 1 | Oryctolagus cuniculus (rabbit) | Ki | 71.8579 | 2 | 7 |
| Low molecular weight phosphotyrosine protein phosphatase | Homo sapiens (human) | Ki | 13.0000 | 1 | 1 |
| Lysine--tRNA ligase | Plasmodium falciparum 3D7 | IC50 | 2.5000 | 1 | 1 |
| Lysine-specific demethylase 4E | Homo sapiens (human) | IC50 | 5,000.0000 | 1 | 1 |
| Lysosomal acid glucosylceramidase | Homo sapiens (human) | Ki | 30.0000 | 1 | 1 |
| Lysosomal alpha-glucosidase | Rattus norvegicus (Norway rat) | IC50 | 34.6900 | 1 | 1 |
| Lysosomal Pro-X carboxypeptidase | Homo sapiens (human) | Ki | 10.0000 | 1 | 1 |
| Lysyl oxidase homolog 2 | Homo sapiens (human) | IC50 | 60.1000 | 1 | 1 |
| M-phase inducer phosphatase 2 | Homo sapiens (human) | IC50 | 50.0000 | 1 | 1 |
| M1-family alanyl aminopeptidase | Plasmodium falciparum 3D7 | IC50 | 2.6000 | 1 | 1 |
| Macrophage migration inhibitory factor | Homo sapiens (human) | IC50 | 236.8000 | 1 | 2 |
| Macrophage migration inhibitory factor | Homo sapiens (human) | Ki | 62.0000 | 1 | 1 |
| Malate dehydrogenase, mitochondrial | Homo sapiens (human) | IC50 | 43.6000 | 1 | 1 |
| Matrilysin | Homo sapiens (human) | IC50 | 123.5500 | 1 | 6 |
| Matrix metalloproteinase-9 | Homo sapiens (human) | IC50 | 0.0156 | 2 | 2 |
| Mcl-1 | Homo sapiens (human) | IC50 | 54.0000 | 1 | 1 |
| Melatonin receptor type 1A | Homo sapiens (human) | IC50 | 0.0025 | 18 | 18 |
| Melatonin receptor type 1A | Gallus gallus (chicken) | Ki | 0.0007 | 7 | 8 |
| Melatonin receptor type 1A | Homo sapiens (human) | Ki | 0.0009 | 67 | 70 |
| Melatonin receptor type 1B | Homo sapiens (human) | IC50 | 0.0035 | 12 | 12 |
| Melatonin receptor type 1B | Gallus gallus (chicken) | Ki | 0.0007 | 8 | 9 |
| Melatonin receptor type 1B | Homo sapiens (human) | Ki | 0.0005 | 62 | 65 |
| Melatonin receptor type 1C | Gallus gallus (chicken) | Ki | 0.0007 | 7 | 8 |
| Metabotropic glutamate receptor 1 | Rattus norvegicus (Norway rat) | IC50 | 0.0004 | 2 | 2 |
| Metabotropic glutamate receptor 1 | Homo sapiens (human) | Ki | 3.6067 | 3 | 3 |
| Metabotropic glutamate receptor 1 | Rattus norvegicus (Norway rat) | Ki | 0.3400 | 1 | 1 |
| Metabotropic glutamate receptor 2 | Homo sapiens (human) | Ki | 7.6500 | 4 | 4 |
| Metabotropic glutamate receptor 3 | Homo sapiens (human) | Ki | 9.0000 | 1 | 1 |
| Metabotropic glutamate receptor 3 | Rattus norvegicus (Norway rat) | Ki | 10,000.0000 | 1 | 2 |
| Metabotropic glutamate receptor 4 | Homo sapiens (human) | Ki | 5.6000 | 4 | 4 |
| Metabotropic glutamate receptor 4 | Rattus norvegicus (Norway rat) | Ki | 3.4000 | 2 | 2 |
| Metabotropic glutamate receptor 5 | Homo sapiens (human) | Ki | 4.3167 | 3 | 3 |
| Metabotropic glutamate receptor 5 | Rattus norvegicus (Norway rat) | Ki | 0.0052 | 1 | 1 |
| Metabotropic glutamate receptor 6 | Homo sapiens (human) | Ki | 38.0000 | 1 | 1 |
| Metabotropic glutamate receptor 7 | Homo sapiens (human) | Ki | 5,400.0000 | 1 | 1 |
| Metabotropic glutamate receptor 8 | Homo sapiens (human) | IC50 | 0.0057 | 1 | 1 |
| Metabotropic glutamate receptor 8 | Homo sapiens (human) | Ki | 9.5000 | 1 | 1 |
| Metabotropic glutamate receptor 8 | Rattus norvegicus (Norway rat) | Ki | 3.4000 | 2 | 2 |
| Methylcytosine dioxygenase TET2 | Homo sapiens (human) | IC50 | 261.5000 | 1 | 1 |
| Mineralocorticoid receptor | Rattus norvegicus (Norway rat) | IC50 | 1.0715 | 2 | 4 |
| Mineralocorticoid receptor | Homo sapiens (human) | IC50 | 0.1232 | 3 | 3 |
| Mitogen-activated protein kinase | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1.0000 | 1 | 1 |
| Mitogen-activated protein kinase 3 | Homo sapiens (human) | IC50 | 3.1570 | 1 | 1 |
| Mu-type opioid receptor | Rattus norvegicus (Norway rat) | Ki | 0.0003 | 1 | 1 |
| Multidrug and toxin extrusion protein 1 | Homo sapiens (human) | IC50 | 260.7000 | 1 | 2 |
| Multidrug resistance-associated protein 1 | Homo sapiens (human) | Ki | 0.4500 | 1 | 1 |
| Multidrug resistance-associated protein 4 | Homo sapiens (human) | IC50 | 93.0000 | 5 | 10 |
| Muscarinic acetylcholine receptor | Cavia porcellus (domestic guinea pig) | Ki | 0.0002 | 1 | 1 |
| Muscarinic acetylcholine receptor DM1 | Drosophila melanogaster (fruit fly) | Ki | 100.0000 | 2 | 2 |
| Muscarinic acetylcholine receptor M1 | Rattus norvegicus (Norway rat) | IC50 | 54.0000 | 1 | 4 |
| Muscarinic acetylcholine receptor M1 | Rattus norvegicus (Norway rat) | Ki | 61.3985 | 2 | 2 |
| Muscarinic acetylcholine receptor M2 | Rattus norvegicus (Norway rat) | IC50 | 54.0000 | 1 | 3 |
| Muscarinic acetylcholine receptor M2 | Sus scrofa (pig) | Ki | 0.2344 | 1 | 1 |
| Muscarinic acetylcholine receptor M3 | Rattus norvegicus (Norway rat) | IC50 | 54.0000 | 1 | 3 |
| Muscarinic acetylcholine receptor M4 | Rattus norvegicus (Norway rat) | IC50 | 54.0000 | 1 | 3 |
| Muscarinic acetylcholine receptor M5 | Rattus norvegicus (Norway rat) | IC50 | 54.0000 | 1 | 3 |
| Myeloperoxidase | Homo sapiens (human) | IC50 | 2.6250 | 1 | 2 |
| N-acetyllactosaminide alpha-1,3-galactosyltransferase | Mus musculus (house mouse) | Ki | 128.0000 | 1 | 1 |
| N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D | Homo sapiens (human) | IC50 | 68.0000 | 1 | 1 |
| N(4)-(beta-N-acetylglucosaminyl)-L-asparaginase | Homo sapiens (human) | Ki | 600.0000 | 1 | 1 |
| N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 | Homo sapiens (human) | IC50 | 640.0000 | 1 | 1 |
| N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 | Homo sapiens (human) | Ki | 2,350.0000 | 1 | 2 |
| NAD-dependent histone deacetylase SIR2 | Saccharomyces cerevisiae S288C | IC50 | 50.0000 | 1 | 1 |
| NAD-dependent protein deacetylase | Schistosoma mansoni | IC50 | 221.5500 | 2 | 2 |
| NAD-dependent protein deacetylase HST2 | Saccharomyces cerevisiae S288C | IC50 | 91.0000 | 1 | 1 |
| NAD-dependent protein deacetylase sirtuin-1 | Homo sapiens (human) | IC50 | 130.9500 | 12 | 12 |
| NAD-dependent protein deacetylase sirtuin-2 | Homo sapiens (human) | IC50 | 28.2214 | 14 | 14 |
| NAD-dependent protein deacetylase sirtuin-3, mitochondrial | Homo sapiens (human) | IC50 | 78.4571 | 7 | 7 |
| NAD-dependent protein deacetylase sirtuin-6 | Homo sapiens (human) | IC50 | 173.3500 | 4 | 4 |
| NAD-dependent protein deacylase sirtuin-5, mitochondrial | Homo sapiens (human) | IC50 | 58.2000 | 3 | 3 |
| NAD(+) hydrolase SARM1 | Homo sapiens (human) | IC50 | 43.8000 | 1 | 1 |
| Neuraminidase | Influenza A virus (A/Wilson-Smith/1933(H1N1)) | IC50 | 100.0000 | 1 | 1 |
| Neuronal acetylcholine receptor subunit alpha-10 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
| Neuronal acetylcholine receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | Ki | 34.0000 | 2 | 3 |
| Neuronal acetylcholine receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | Ki | 42.2500 | 3 | 4 |
| Neuronal acetylcholine receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | Ki | 38.7500 | 3 | 4 |
| Neuronal acetylcholine receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
| Neuronal acetylcholine receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
| Neuronal acetylcholine receptor subunit alpha-7 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
| Neuronal acetylcholine receptor subunit alpha-9 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
| Neuronal acetylcholine receptor subunit beta-2 | Rattus norvegicus (Norway rat) | Ki | 35.2000 | 4 | 5 |
| Neuronal acetylcholine receptor subunit beta-3 | Rattus norvegicus (Norway rat) | Ki | 42.0000 | 1 | 2 |
| Neuronal acetylcholine receptor subunit beta-4 | Rattus norvegicus (Norway rat) | Ki | 41.5000 | 3 | 4 |
| Neutral amino acid transporter A | Homo sapiens (human) | IC50 | 1,441.3333 | 2 | 6 |
| Neutral amino acid transporter B(0) | Homo sapiens (human) | IC50 | 2,918.6667 | 2 | 6 |
| Nicotinamidase | Saccharomyces cerevisiae S288C | Ki | 2,000.0000 | 1 | 1 |
| Nicotinamide N-methyltransferase | Homo sapiens (human) | IC50 | 30.0000 | 1 | 1 |
| Nischarin | Rattus norvegicus (Norway rat) | IC50 | 36.5320 | 2 | 2 |
| Nitric oxide synthase, brain | Homo sapiens (human) | Ki | 2,350.0000 | 1 | 2 |
| Nitric oxide synthase, brain | Rattus norvegicus (Norway rat) | Ki | 2,350.0000 | 1 | 2 |
| Nociceptin receptor | Mus musculus (house mouse) | Ki | 0.0003 | 1 | 1 |
| nonstructural protein 1 | Influenza A virus (A/California/07/2009(H1N1)) | IC50 | 0.2000 | 1 | 1 |
| Orotidine 5'-phosphate decarboxylase | Methanothermobacter thermautotrophicus str. Delta H | Ki | 765.0000 | 1 | 2 |
| Orotidine 5'-phosphate decarboxylase | Plasmodium falciparum (malaria parasite P. falciparum) | Ki | 5,105.0000 | 1 | 2 |
| Oxoeicosanoid receptor 1 | Homo sapiens (human) | IC50 | 1.3343 | 2 | 3 |
| P2X purinoceptor 1 | Homo sapiens (human) | IC50 | 10.0000 | 1 | 1 |
| P2Y purinoceptor 1 | Meleagris gallopavo (turkey) | IC50 | 9.5450 | 2 | 2 |
| P2Y purinoceptor 12 | Homo sapiens (human) | IC50 | 250.0000 | 1 | 1 |
| P2Y purinoceptor 2 | Mus musculus (house mouse) | IC50 | 1.5100 | 1 | 1 |
| Palmitoleoyl-protein carboxylesterase NOTUM | Homo sapiens (human) | IC50 | 62.5333 | 2 | 3 |
| Pancreatic triacylglycerol lipase | Sus scrofa (pig) | IC50 | 1,000.0000 | 1 | 1 |
| Peptide deformylase | Escherichia coli | IC50 | 1,000.0000 | 1 | 1 |
| Peptide deformylase 1A, chloroplastic/mitochondrial | Arabidopsis thaliana (thale cress) | IC50 | 1,000.0000 | 1 | 1 |
| Peroxisomal N(1)-acetyl-spermine/spermidine oxidase | Homo sapiens (human) | Ki | 800.0000 | 1 | 1 |
| Phenylethanolamine N-methyltransferase | Bos taurus (cattle) | IC50 | 669.0000 | 1 | 1 |
| Phenylethanolamine N-methyltransferase | Bos taurus (cattle) | Ki | 456.0000 | 3 | 3 |
| Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform | Homo sapiens (human) | IC50 | 3,630.0000 | 1 | 1 |
| Phosphodiesterase | Bos taurus (cattle) | IC50 | 0.1000 | 1 | 1 |
| Phosphodiesterase | Rattus norvegicus (Norway rat) | IC50 | 70.0000 | 1 | 1 |
| Phosphoenolpyruvate carboxykinase, cytosolic [GTP] | Rattus norvegicus (Norway rat) | Ki | 37.0000 | 1 | 1 |
| Phospholipase A-2-activating protein | Homo sapiens (human) | IC50 | 5.0000 | 1 | 3 |
| phospholipase A2 precursor | Homo sapiens (human) | IC50 | 22.3000 | 1 | 1 |
| Plasma kallikrein | Homo sapiens (human) | IC50 | 0.0031 | 1 | 1 |
| Poly [ADP-ribose] polymerase 1 | Homo sapiens (human) | IC50 | 187.0070 | 6 | 7 |
| Poly [ADP-ribose] polymerase 2 | Mus musculus (house mouse) | IC50 | 129.5245 | 1 | 2 |
| Polyamine deacetylase HDAC10 | Homo sapiens (human) | IC50 | 2,540.0000 | 1 | 1 |
| Polyamine deacetylase HDAC10 | Homo sapiens (human) | Ki | 10.8400 | 1 | 1 |
| Polyamine oxidase 1 | Zea mays | Ki | 3.0000 | 1 | 1 |
| Polyphenol oxidase 2 | Agaricus bisporus | IC50 | 1,351.4455 | 19 | 22 |
| Polyunsaturated fatty acid 5-lipoxygenase | Homo sapiens (human) | IC50 | 29.9000 | 7 | 8 |
| Polyunsaturated fatty acid 5-lipoxygenase | Rattus norvegicus (Norway rat) | IC50 | 23.2071 | 5 | 7 |
| Polyunsaturated fatty acid 5-lipoxygenase | Homo sapiens (human) | Ki | 27.0000 | 1 | 1 |
| Polyunsaturated fatty acid lipoxygenase ALOX12 | Homo sapiens (human) | IC50 | 71.6667 | 2 | 3 |
| Polyunsaturated fatty acid lipoxygenase ALOX15 | Homo sapiens (human) | IC50 | 60.0000 | 2 | 3 |
| Polyunsaturated fatty acid lipoxygenase ALOX15 | Oryctolagus cuniculus (rabbit) | IC50 | 28.4964 | 2 | 5 |
| Polyunsaturated fatty acid lipoxygenase ALOX15B | Homo sapiens (human) | IC50 | 100.0000 | 1 | 2 |
| Potassium voltage-gated channel subfamily H member 2 | Homo sapiens (human) | IC50 | 64.3022 | 7 | 7 |
| Progesterone receptor | Homo sapiens (human) | IC50 | 7.3000 | 1 | 1 |
| Progesterone receptor | Oryctolagus cuniculus (rabbit) | IC50 | 0.4400 | 2 | 2 |
| Proliferating cell nuclear antigen | Homo sapiens (human) | IC50 | 26.8000 | 1 | 2 |
| Proline--tRNA ligase | Plasmodium falciparum 3D7 | IC50 | 2.5000 | 1 | 1 |
| Prolyl 4-hydroxylase | Paramecium bursaria Chlorella virus 1 | IC50 | 1,000.0000 | 1 | 1 |
| Prolyl 4-hydroxylase subunit alpha-1 | Gallus gallus (chicken) | Ki | 3,856.7500 | 1 | 4 |
| Prostacyclin receptor | Homo sapiens (human) | IC50 | 36.7533 | 3 | 3 |
| Prostacyclin receptor | Homo sapiens (human) | Ki | 10.0000 | 1 | 1 |
| Prostaglandin D2 receptor | Homo sapiens (human) | IC50 | 4.5000 | 2 | 2 |
| Prostaglandin E2 receptor EP1 subtype | Homo sapiens (human) | IC50 | 0.1578 | 4 | 4 |
| Prostaglandin E2 receptor EP1 subtype | Homo sapiens (human) | Ki | 0.0121 | 3 | 3 |
| Prostaglandin E2 receptor EP1 subtype | Mus musculus (house mouse) | Ki | 0.0060 | 2 | 2 |
| Prostaglandin E2 receptor EP2 subtype | Homo sapiens (human) | IC50 | 13.7566 | 8 | 8 |
| Prostaglandin E2 receptor EP2 subtype | Rattus norvegicus (Norway rat) | IC50 | 0.0052 | 1 | 1 |
| Prostaglandin E2 receptor EP2 subtype | Homo sapiens (human) | Ki | 0.0092 | 6 | 6 |
| Prostaglandin E2 receptor EP2 subtype | Mus musculus (house mouse) | Ki | 0.0220 | 2 | 2 |
| Prostaglandin E2 receptor EP3 subtype | Homo sapiens (human) | IC50 | 0.1090 | 4 | 4 |
| Prostaglandin E2 receptor EP3 subtype | Homo sapiens (human) | Ki | 0.0020 | 4 | 4 |
| Prostaglandin E2 receptor EP3 subtype | Mus musculus (house mouse) | Ki | 0.0050 | 2 | 2 |
| Prostaglandin E2 receptor EP4 subtype | Homo sapiens (human) | IC50 | 0.9357 | 9 | 9 |
| Prostaglandin E2 receptor EP4 subtype | Rattus norvegicus (Norway rat) | IC50 | 0.0021 | 1 | 1 |
| Prostaglandin E2 receptor EP4 subtype | Homo sapiens (human) | Ki | 0.0010 | 8 | 8 |
| Prostaglandin E2 receptor EP4 subtype | Mus musculus (house mouse) | Ki | 0.0031 | 2 | 2 |
| Prostaglandin F2-alpha receptor | Bos taurus (cattle) | IC50 | 0.1400 | 1 | 1 |
| Prostaglandin F2-alpha receptor | Homo sapiens (human) | IC50 | 0.0139 | 4 | 4 |
| Prostaglandin F2-alpha receptor | Bos taurus (cattle) | Ki | 0.1290 | 1 | 1 |
| Prostaglandin F2-alpha receptor | Homo sapiens (human) | Ki | 0.1190 | 1 | 1 |
| Prostaglandin G/H synthase 1 | Homo sapiens (human) | IC50 | 200.0700 | 2 | 2 |
| Prostaglandin G/H synthase 1 | Ovis aries (sheep) | IC50 | 3.0000 | 1 | 1 |
| Prostaglandin G/H synthase 1 | Homo sapiens (human) | Ki | 4.0000 | 1 | 1 |
| Prostaglandin G/H synthase 1 | Bos taurus (cattle) | IC50 | 124.2005 | 2 | 5 |
| Prostaglandin G/H synthase 2 | Homo sapiens (human) | IC50 | 44.2800 | 3 | 3 |
| Prostaglandin G/H synthase 2 | Ovis aries (sheep) | IC50 | 132.2250 | 1 | 4 |
| Prostaglandin G/H synthase 2 | Bos taurus (cattle) | IC50 | 0.0713 | 2 | 2 |
| Protein cereblon | Homo sapiens (human) | IC50 | 2,707.5000 | 1 | 2 |
| Protein cereblon | Homo sapiens (human) | Ki | 212.0000 | 1 | 1 |
| Protein kinase C alpha type | Rattus norvegicus (Norway rat) | IC50 | 40.0000 | 3 | 4 |
| Protein kinase C beta type | Rattus norvegicus (Norway rat) | IC50 | 40.0000 | 3 | 4 |
| Protein kinase C delta type | Rattus norvegicus (Norway rat) | IC50 | 34.3333 | 2 | 3 |
| Protein kinase C epsilon type | Rattus norvegicus (Norway rat) | IC50 | 34.3333 | 2 | 3 |
| Protein kinase C eta type | Rattus norvegicus (Norway rat) | IC50 | 34.3333 | 2 | 3 |
| Protein kinase C gamma type | Rattus norvegicus (Norway rat) | IC50 | 40.0000 | 3 | 4 |
| Protein kinase C theta type | Rattus norvegicus (Norway rat) | IC50 | 34.3333 | 2 | 3 |
| Protein kinase C zeta type | Rattus norvegicus (Norway rat) | IC50 | 34.3333 | 2 | 3 |
| Protein kinase domain-containing protein | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 1.0000 | 1 | 1 |
| Protein mono-ADP-ribosyltransferase PARP15 | Homo sapiens (human) | IC50 | 15.0000 | 1 | 2 |
| Prothrombin | Homo sapiens (human) | IC50 | 754.9250 | 4 | 4 |
| Prothrombin | Homo sapiens (human) | Ki | 0.2672 | 1 | 1 |
| Proto-oncogene tyrosine-protein kinase Src | Homo sapiens (human) | IC50 | 1,993.2500 | 6 | 8 |
| Proton-coupled amino acid transporter 1 | Homo sapiens (human) | Ki | 19,820.0000 | 1 | 10 |
| Purine nucleoside phosphorylase | Homo sapiens (human) | IC50 | 5.0000 | 1 | 2 |
| Purine nucleoside phosphorylase | Homo sapiens (human) | Ki | 752.5000 | 1 | 2 |
| rac GTPase-activating protein 1 isoform a | Homo sapiens (human) | IC50 | 52.2600 | 1 | 1 |
| Receptor tyrosine-protein kinase erbB-2 | Homo sapiens (human) | IC50 | 41.5030 | 1 | 1 |
| Renin | Homo sapiens (human) | Ki | 15.0000 | 1 | 1 |
| Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | IC50 | 36.7633 | 3 | 3 |
| Replicase polyprotein 1ab | Severe acute respiratory syndrome-related coronavirus | IC50 | 100.0000 | 1 | 1 |
| Retinal dehydrogenase 1 | Rattus norvegicus (Norway rat) | Ki | 2.3000 | 1 | 1 |
| Retinoic acid receptor RXR-alpha | Homo sapiens (human) | Ki | 6.9620 | 1 | 2 |
| Reverse transcriptase/RNaseH | Human immunodeficiency virus 1 | Ki | 0.0610 | 1 | 1 |
| Riboflavin-binding protein | Gallus gallus (chicken) | Ki | 0.3500 | 1 | 1 |
| Ribonuclease pancreatic | Homo sapiens (human) | IC50 | 312.0000 | 1 | 1 |
| Ribonuclease pancreatic | Bos taurus (cattle) | Ki | 343.4600 | 3 | 5 |
| Ribonuclease pancreatic | Homo sapiens (human) | Ki | 103.0000 | 1 | 1 |
| Ribosyldihydronicotinamide dehydrogenase [quinone] | Homo sapiens (human) | IC50 | 7.6032 | 8 | 9 |
| Ribosyldihydronicotinamide dehydrogenase [quinone] | Homo sapiens (human) | Ki | 0.0422 | 2 | 2 |
| Ricin | Ricinus communis (castor bean) | IC50 | 900.0000 | 1 | 1 |
| RNA polymerase beta subunit (EC 2.7.7.6), partial | Escherichia coli | IC50 | 23.7759 | 1 | 1 |
| S-ribosylhomocysteine lyase | Bacillus subtilis subsp. subtilis str. 168 | Ki | 61.0000 | 1 | 1 |
| Seed linoleate 13S-lipoxygenase-1 | Glycine max (soybean) | IC50 | 301.5000 | 4 | 4 |
| Seed linoleate 13S-lipoxygenase-1 | Glycine max (soybean) | Ki | 22.0000 | 1 | 1 |
| Seminal ribonuclease | Bos taurus (cattle) | Ki | 877.4000 | 1 | 3 |
| Sepiapterin reductase | Homo sapiens (human) | IC50 | 5.0000 | 1 | 1 |
| Serine-protein kinase ATM | Homo sapiens (human) | IC50 | 200.0000 | 1 | 1 |
| Serine/threonine-protein kinase ATR | Homo sapiens (human) | IC50 | 1,100.0000 | 1 | 1 |
| Serine/threonine-protein kinase mTOR | Homo sapiens (human) | IC50 | 400.0000 | 1 | 1 |
| Serine/threonine-protein kinase/endoribonuclease IRE1 | Homo sapiens (human) | IC50 | 20.0000 | 1 | 1 |
| Serum paraoxonase/arylesterase 1 | Homo sapiens (human) | IC50 | 10,875.0000 | 1 | 2 |
| Sex hormone-binding globulin | Homo sapiens (human) | IC50 | 0.0038 | 1 | 1 |
| Sex hormone-binding globulin | Rattus norvegicus (Norway rat) | IC50 | 0.0230 | 1 | 1 |
| Shiga toxin subunit A | Shigella dysenteriae | IC50 | 11.5000 | 1 | 1 |
| Sialidase-1 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
| Sialidase-2 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
| Sialidase-3 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
| Sialidase-4 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
| Sigma non-opioid intracellular receptor 1 | Homo sapiens (human) | IC50 | 1.0500 | 1 | 2 |
| Sigma non-opioid intracellular receptor 1 | Cavia porcellus (domestic guinea pig) | Ki | 10.0000 | 1 | 1 |
| Sigma non-opioid intracellular receptor 1 | Homo sapiens (human) | Ki | 22.2150 | 2 | 2 |
| Similar to alpha-tubulin isoform 1 | Bos taurus (cattle) | IC50 | 17.8889 | 5 | 9 |
| Sodium- and chloride-dependent creatine transporter 1 | Homo sapiens (human) | IC50 | 5.0000 | 1 | 1 |
| Sodium- and chloride-dependent creatine transporter 1 | Rattus norvegicus (Norway rat) | IC50 | 1.6000 | 1 | 1 |
| Sodium- and chloride-dependent GABA transporter 1 | Mus musculus (house mouse) | IC50 | 616.5950 | 1 | 1 |
| Sodium- and chloride-dependent GABA transporter 2 | Mus musculus (house mouse) | IC50 | 102.3290 | 1 | 1 |
| Sodium- and chloride-dependent GABA transporter 3 | Mus musculus (house mouse) | IC50 | 17.3780 | 1 | 1 |
| Sodium- and chloride-dependent glycine transporter 1 | Homo sapiens (human) | IC50 | 91.0000 | 1 | 1 |
| Sodium- and chloride-dependent glycine transporter 2 | Homo sapiens (human) | IC50 | 0.6000 | 1 | 1 |
| Sodium- and chloride-dependent taurine transporter | Homo sapiens (human) | IC50 | 10.0000 | 1 | 1 |
| Sodium-dependent dopamine transporter | Mus musculus (house mouse) | IC50 | 0.2000 | 1 | 1 |
| Sodium-dependent dopamine transporter | Rattus norvegicus (Norway rat) | IC50 | 1.3496 | 47 | 67 |
| Sodium-dependent dopamine transporter | Mus musculus (house mouse) | Ki | 0.8500 | 1 | 1 |
| Sodium-dependent dopamine transporter | Rattus norvegicus (Norway rat) | Ki | 25.8768 | 25 | 40 |
| Sodium-dependent dopamine transporter | Homo sapiens (human) | IC50 | 0.5660 | 35 | 35 |
| Sodium-dependent dopamine transporter | Homo sapiens (human) | Ki | 0.5769 | 31 | 34 |
| Sodium-dependent noradrenaline transporter | Homo sapiens (human) | IC50 | 1.2861 | 22 | 22 |
| Sodium-dependent noradrenaline transporter | Homo sapiens (human) | Ki | 1.6163 | 30 | 32 |
| Sodium-dependent serotonin transporter | Homo sapiens (human) | IC50 | 1.0837 | 25 | 26 |
| Sodium-dependent serotonin transporter | Rattus norvegicus (Norway rat) | IC50 | 0.8885 | 15 | 18 |
| Sodium-dependent serotonin transporter | Homo sapiens (human) | Ki | 0.5889 | 32 | 36 |
| Sodium-dependent serotonin transporter | Rattus norvegicus (Norway rat) | Ki | 0.5521 | 18 | 27 |
| Sodium/bile acid cotransporter | Homo sapiens (human) | IC50 | 3.6000 | 1 | 1 |
| Solute carrier family 15 member 1 | Homo sapiens (human) | IC50 | 141,200.0000 | 1 | 1 |
| Solute carrier family 15 member 1 | Homo sapiens (human) | Ki | 790.0000 | 1 | 1 |
| Solute carrier family 15 member 1 | Rattus norvegicus (Norway rat) | Ki | 5,100.0000 | 1 | 2 |
| Solute carrier family 15 member 2 | Homo sapiens (human) | IC50 | 28.0000 | 1 | 1 |
| Solute carrier family 15 member 2 | Rattus norvegicus (Norway rat) | Ki | 148.0000 | 1 | 2 |
| Solute carrier family 2, facilitated glucose transporter member 1 | Homo sapiens (human) | IC50 | 12.0000 | 1 | 1 |
| Solute carrier family 2, facilitated glucose transporter member 9 | Homo sapiens (human) | IC50 | 650.0000 | 1 | 2 |
| Solute carrier family 22 member 1 | Mus musculus (house mouse) | IC50 | 55.0000 | 1 | 1 |
| Solute carrier family 22 member 1 | Rattus norvegicus (Norway rat) | IC50 | 541.1750 | 4 | 4 |
| Solute carrier family 22 member 1 | Rattus norvegicus (Norway rat) | Ki | 1,826.5000 | 5 | 6 |
| Solute carrier family 22 member 1 | Homo sapiens (human) | IC50 | 2,187.8500 | 2 | 2 |
| Solute carrier family 22 member 1 | Homo sapiens (human) | Ki | 12,003.5100 | 2 | 2 |
| Solute carrier family 22 member 2 | Homo sapiens (human) | IC50 | 34.2000 | 1 | 1 |
| Solute carrier family 22 member 2 | Mus musculus (house mouse) | IC50 | 217.0000 | 1 | 1 |
| Solute carrier family 22 member 2 | Rattus norvegicus (Norway rat) | IC50 | 271.6333 | 5 | 6 |
| Solute carrier family 22 member 2 | Rattus norvegicus (Norway rat) | Ki | 172.6964 | 6 | 7 |
| Solute carrier family 22 member 20 | Mus musculus (house mouse) | Ki | 5,538.8082 | 1 | 5 |
| Solute carrier family 22 member 3 | Homo sapiens (human) | IC50 | 0.9450 | 2 | 2 |
| Solute carrier family 22 member 3 | Rattus norvegicus (Norway rat) | IC50 | 6.6500 | 1 | 2 |
| Solute carrier family 22 member 3 | Homo sapiens (human) | Ki | 140.0000 | 1 | 1 |
| Solute carrier family 22 member 6 | Mus musculus (house mouse) | Ki | 417.9609 | 3 | 7 |
| Solute carrier family 22 member 8 | Homo sapiens (human) | Ki | 275.0000 | 1 | 1 |
| Solute carrier family 22 member 8 | Rattus norvegicus (Norway rat) | Ki | 9.1000 | 1 | 1 |
| Solute carrier organic anion transporter family member 1A1 | Rattus norvegicus (Norway rat) | Ki | 7.8286 | 1 | 7 |
| Solute carrier organic anion transporter family member 1A3 | Rattus norvegicus (Norway rat) | Ki | 11.1500 | 1 | 2 |
| Solute carrier organic anion transporter family member 1A4 | Rattus norvegicus (Norway rat) | IC50 | 50.4000 | 1 | 1 |
| Solute carrier organic anion transporter family member 1B1 | Homo sapiens (human) | IC50 | 0.8458 | 1 | 3 |
| Solute carrier organic anion transporter family member 1B1 | Homo sapiens (human) | Ki | 0.3590 | 2 | 4 |
| Solute carrier organic anion transporter family member 1B3 | Homo sapiens (human) | IC50 | 2.4704 | 1 | 3 |
| Solute carrier organic anion transporter family member 1B3 | Homo sapiens (human) | Ki | 1.9033 | 1 | 3 |
| Solute carrier organic anion transporter family member 1C1 | Mus musculus (house mouse) | Ki | 38.6500 | 1 | 2 |
| Solute carrier organic anion transporter family member 2A1 | Homo sapiens (human) | Ki | 5,000.0203 | 2 | 3 |
| Solute carrier organic anion transporter family member 2A1 | Mus musculus (house mouse) | Ki | 0.1010 | 1 | 2 |
| Solute carrier organic anion transporter family member 2A1 | Rattus norvegicus (Norway rat) | Ki | 0.0427 | 2 | 3 |
| Solute carrier organic anion transporter family member 2B1 | Rattus norvegicus (Norway rat) | IC50 | 0.2870 | 1 | 1 |
| Solute carrier organic anion transporter family member 4C1 | Homo sapiens (human) | IC50 | 8.0000 | 1 | 1 |
| Spermidine synthase | Plasmodium falciparum (malaria parasite P. falciparum) | IC50 | 159.0000 | 1 | 1 |
| Sphingosine 1-phosphate receptor 1 | Homo sapiens (human) | IC50 | 0.0008 | 6 | 6 |
| Sphingosine 1-phosphate receptor 2 | Homo sapiens (human) | IC50 | 0.0019 | 4 | 4 |
| Sphingosine 1-phosphate receptor 3 | Homo sapiens (human) | IC50 | 0.0004 | 6 | 6 |
| Sphingosine 1-phosphate receptor 4 | Homo sapiens (human) | IC50 | 0.0522 | 7 | 7 |
| Sphingosine 1-phosphate receptor 5 | Homo sapiens (human) | IC50 | 0.0020 | 5 | 5 |
| Sphingosine kinase 1 | Homo sapiens (human) | IC50 | 3.8600 | 1 | 1 |
| Sphingosine kinase 2 | Homo sapiens (human) | IC50 | 1.5600 | 1 | 1 |
| Squalene synthase | Rattus norvegicus (Norway rat) | Ki | 2.6000 | 1 | 1 |
| Sterol O-acyltransferase 1 | Cricetulus griseus (Chinese hamster) | IC50 | 224.4333 | 2 | 6 |
| Sterol O-acyltransferase 1 | Homo sapiens (human) | IC50 | 1,000.0000 | 2 | 2 |
| Sterol O-acyltransferase 1 | Rattus norvegicus (Norway rat) | IC50 | 1,000.0000 | 1 | 1 |
| Sterol regulatory element-binding protein 1 | Homo sapiens (human) | IC50 | 1.1760 | 1 | 1 |
| Steryl-sulfatase | Homo sapiens (human) | IC50 | 22.0667 | 3 | 3 |
| Steryl-sulfatase | Homo sapiens (human) | Ki | 60.0000 | 1 | 1 |
| Stromelysin-1 | Homo sapiens (human) | IC50 | 500.0000 | 1 | 1 |
| Substance-P receptor | Cavia porcellus (domestic guinea pig) | IC50 | 500.0000 | 1 | 3 |
| Succinate-semialdehyde dehydrogenase, mitochondrial | Homo sapiens (human) | IC50 | 95.3500 | 1 | 2 |
| Sucrase-isomaltase, intestinal | Rattus norvegicus (Norway rat) | IC50 | 87.4500 | 1 | 1 |
| TAR DNA-binding protein 43 | Homo sapiens (human) | IC50 | 19.9526 | 1 | 1 |
| Tat | Human immunodeficiency virus 1 | IC50 | 11.7530 | 1 | 1 |
| Testosterone 17-beta-dehydrogenase 3 | Homo sapiens (human) | IC50 | 155.7734 | 9 | 11 |
| Thiosulfate sulfurtransferase | Homo sapiens (human) | IC50 | 69.6000 | 1 | 3 |
| Thromboxane A2 receptor | Homo sapiens (human) | IC50 | 5.0000 | 2 | 2 |
| Thymidine kinase | Human alphaherpesvirus 1 strain SC16 | IC50 | 1.0000 | 1 | 1 |
| Thymidine kinase | Macacine alphaherpesvirus 1 | IC50 | 4.1000 | 1 | 1 |
| Thymidine kinase | Staphylococcus aureus | Ki | 257.0000 | 1 | 1 |
| Thymidine kinase 2 | Rattus norvegicus (Norway rat) | Ki | 320.0000 | 1 | 1 |
| Thymidine kinase, cytosolic | Homo sapiens (human) | IC50 | 163.4737 | 4 | 6 |
| Thymidine kinase, cytosolic | Homo sapiens (human) | Ki | 1.1000 | 2 | 2 |
| Thymidine phosphorylase | Mus musculus (house mouse) | Ki | 347,000.0000 | 1 | 1 |
| Thymidylate kinase | Homo sapiens (human) | Ki | 180.0000 | 2 | 2 |
| Thymidylate kinase | Mycobacterium tuberculosis H37Rv | Ki | 125.2857 | 6 | 7 |
| Thymidylate synthase | Homo sapiens (human) | IC50 | 395.0000 | 2 | 2 |
| Thymidylate synthase | Mus musculus (house mouse) | IC50 | 590.0000 | 2 | 2 |
| Thymidylate synthase | Homo sapiens (human) | Ki | 21.5000 | 2 | 2 |
| Thymidylate synthase | Lacticaseibacillus casei | Ki | 2.2600 | 1 | 1 |
| Thymidylate synthase | Mus musculus (house mouse) | Ki | 6.5000 | 1 | 1 |
| Thymidylate synthase | Bos taurus (cattle) | Ki | 8.0000 | 1 | 1 |
| Thyroid hormone receptor alpha | Homo sapiens (human) | IC50 | 0.0006 | 7 | 8 |
| Thyroid hormone receptor alpha | Homo sapiens (human) | Ki | 0.0013 | 4 | 4 |
| Thyroid hormone receptor beta | Homo sapiens (human) | IC50 | 0.0006 | 8 | 9 |
| Thyroid hormone receptor beta | Rattus norvegicus (Norway rat) | IC50 | 0.0031 | 1 | 2 |
| Thyroid hormone receptor beta | Homo sapiens (human) | Ki | 0.0012 | 5 | 5 |
| Thyroid hormone receptor beta | Rattus norvegicus (Norway rat) | Ki | 9.0000 | 1 | 1 |
| Tissue factor | Homo sapiens (human) | IC50 | 64.6000 | 1 | 5 |
| Tissue factor | Homo sapiens (human) | Ki | 8,000.0000 | 1 | 1 |
| trace amine-associated receptor 1 | Homo sapiens (human) | IC50 | 0.8818 | 1 | 1 |
| Trans-sialidase | Trypanosoma cruzi | Ki | 7,300.0000 | 2 | 2 |
| Transient receptor potential cation channel subfamily M member 8 | Homo sapiens (human) | IC50 | 12.0000 | 2 | 2 |
| Transient receptor potential cation channel subfamily V member 2 | Rattus norvegicus (Norway rat) | IC50 | 10.0000 | 2 | 4 |
| Transporter | Rattus norvegicus (Norway rat) | IC50 | 3.2277 | 13 | 15 |
| Transporter | Rattus norvegicus (Norway rat) | Ki | 2.2399 | 16 | 19 |
| Transthyretin | Homo sapiens (human) | IC50 | 4.9626 | 2 | 3 |
| Trehalose-phosphatase | Brugia malayi | Ki | 10,000.0000 | 1 | 1 |
| Trypsin | Sus scrofa (pig) | IC50 | 200.0000 | 1 | 5 |
| Tryptophan 2,3-dioxygenase | Homo sapiens (human) | Ki | 11,500.0000 | 1 | 1 |
| Tryptophan 5-hydroxylase 1 | Rattus norvegicus (Norway rat) | Ki | 0.4900 | 1 | 1 |
| Tubulin alpha-1A chain | Sus scrofa (pig) | IC50 | 2.2000 | 1 | 1 |
| Tubulin beta chain | Sus scrofa (pig) | IC50 | 2.2000 | 1 | 1 |
| Tubulin beta-2B chain | Bos taurus (cattle) | IC50 | 1,786.1750 | 8 | 8 |
| Type-1 angiotensin II receptor | Homo sapiens (human) | IC50 | 0.1246 | 1 | 1 |
| Tyrosinase | Homo sapiens (human) | IC50 | 2,867.8333 | 6 | 6 |
| Tyrosinase | Mus musculus (house mouse) | IC50 | 195.5900 | 2 | 3 |
| Tyrosinase | Mus musculus (house mouse) | Ki | 240.0000 | 1 | 1 |
| Tyrosine 3-monooxygenase | Homo sapiens (human) | IC50 | 0.7200 | 1 | 1 |
| Tyrosine 3-monooxygenase | Rattus norvegicus (Norway rat) | IC50 | 0.0014 | 1 | 1 |
| Tyrosine-protein kinase Fyn | Homo sapiens (human) | IC50 | 14.1905 | 1 | 2 |
| Tyrosine-protein kinase Lck | Homo sapiens (human) | IC50 | 3.7290 | 1 | 1 |
| Tyrosine-protein phosphatase non-receptor type 1 | Homo sapiens (human) | IC50 | 48.8517 | 6 | 6 |
| Tyrosine-protein phosphatase non-receptor type 2 | Homo sapiens (human) | IC50 | 13.2850 | 2 | 2 |
| Tyrosine-protein phosphatase non-receptor type 22 | Homo sapiens (human) | IC50 | 2.5200 | 1 | 1 |
| Tyrosine-protein phosphatase non-receptor type 7 | Homo sapiens (human) | IC50 | 100.0000 | 1 | 1 |
| Ubiquitin carboxyl-terminal hydrolase 2 | Homo sapiens (human) | IC50 | 65.7750 | 2 | 4 |
| ubiquitin-conjugating enzyme E2 N | Homo sapiens (human) | IC50 | 6.3125 | 2 | 2 |
| UDP-glucuronosyltransferase 1A1 | Homo sapiens (human) | IC50 | 5.2500 | 2 | 2 |
| UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit | Homo sapiens (human) | IC50 | 1.8000 | 1 | 1 |
| Uracil nucleotide/cysteinyl leukotriene receptor | Homo sapiens (human) | IC50 | 30.0000 | 1 | 2 |
| Urease subunit alpha | Helicobacter pylori 26695 | Ki | 6,470.0000 | 1 | 1 |
| Urease subunit beta | Helicobacter pylori 26695 | Ki | 6,470.0000 | 1 | 1 |
| Uridine 5'-monophosphate synthase | Homo sapiens (human) | Ki | 810.0000 | 1 | 2 |
| Vif | Human immunodeficiency virus 1 | IC50 | 1.6600 | 1 | 1 |
| Vitamin D3 receptor | Bos taurus (cattle) | IC50 | 0.0000 | 1 | 1 |
| Vitamin D3 receptor | Homo sapiens (human) | IC50 | 33.3366 | 21 | 29 |
| Vitamin D3 receptor | Rattus norvegicus (Norway rat) | Ki | 0.0001 | 11 | 11 |
| Voltage-dependent calcium channel subunit alpha-2/delta-1 | Mus musculus (house mouse) | Ki | 0.9786 | 1 | 2 |
| Xanthine dehydrogenase/oxidase | Bos taurus (cattle) | IC50 | 6.8000 | 1 | 1 |
| Xanthine dehydrogenase/oxidase | Homo sapiens (human) | IC50 | 201.1825 | 3 | 4 |
| Protein | Taxonomy | Measurement | Average (mM) | Bioassay(s) | Drugs |
|---|
| 1,25-dihydroxyvitamin D(3) 24-hydroxylase, mitochondrial | Homo sapiens (human) | EC50 | 0.0030 | 1 | 1 |
| 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine pyrophosphokinase | Escherichia coli K-12 | Kd | 38.0000 | 1 | 1 |
| 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | Burkholderia pseudomallei K96243 | Kd | 537.5000 | 2 | 2 |
| 2-dehydropantoate 2-reductase | Escherichia coli K-12 | Kd | 263.0000 | 1 | 2 |
| 5-hydroxytryptamine receptor 1A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 1B | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 1D | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 1F | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 2A | Homo sapiens (human) | EC50 | 0.0282 | 3 | 5 |
| 5-hydroxytryptamine receptor 2A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 2B | Homo sapiens (human) | EC50 | 0.0011 | 1 | 2 |
| 5-hydroxytryptamine receptor 2B | Rattus norvegicus (Norway rat) | Kd | 5.9356 | 4 | 8 |
| 5-hydroxytryptamine receptor 2C | Homo sapiens (human) | EC50 | 0.0002 | 1 | 2 |
| 5-hydroxytryptamine receptor 2C | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 3A | Homo sapiens (human) | EC50 | 26.0000 | 1 | 1 |
| 5-hydroxytryptamine receptor 3A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 3B | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 4 | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 5A | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 5B | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 6 | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| 5-hydroxytryptamine receptor 7 | Rattus norvegicus (Norway rat) | Kd | 6.5007 | 2 | 6 |
| Acetylcholinesterase | Electrophorus electricus (electric eel) | Kd | 170.0000 | 1 | 1 |
| Adenosine receptor A1 | Homo sapiens (human) | Kd | 45.0000 | 1 | 1 |
| Adenosine receptor A2a | Homo sapiens (human) | EC50 | 75.9000 | 1 | 1 |
| Adenosine receptor A2a | Homo sapiens (human) | Kd | 15.3144 | 2 | 2 |
| Advanced glycosylation end product-specific receptor | Homo sapiens (human) | Kd | 0.0430 | 1 | 1 |
| Advanced glycosylation end product-specific receptor | Rattus norvegicus (Norway rat) | Kd | 0.0430 | 1 | 1 |
| Alpha-2A adrenergic receptor | Homo sapiens (human) | EC50 | 10.1550 | 1 | 2 |
| Alpha-2B adrenergic receptor | Homo sapiens (human) | EC50 | 10.1550 | 1 | 2 |
| Alpha-2C adrenergic receptor | Homo sapiens (human) | EC50 | 10.1550 | 1 | 2 |
| Alpha-crystallin B chain | Homo sapiens (human) | EC50 | 1.4200 | 1 | 1 |
| Amyloid-beta precursor protein | Homo sapiens (human) | EC50 | 216.0000 | 1 | 1 |
| Androgen receptor | Homo sapiens (human) | EC50 | 0.0058 | 26 | 26 |
| Androgen receptor | Mus musculus (house mouse) | EC50 | 0.0040 | 1 | 1 |
| Androgen receptor | Rattus norvegicus (Norway rat) | EC50 | 0.0019 | 2 | 2 |
| Androgen receptor | Homo sapiens (human) | Kd | 0.0002 | 1 | 1 |
| Angiotensin-converting enzyme | Rattus norvegicus (Norway rat) | EC50 | 0.0060 | 2 | 7 |
| Aryl hydrocarbon receptor | Homo sapiens (human) | EC50 | 1.3525 | 2 | 2 |
| Asialoglycoprotein receptor 1 | Homo sapiens (human) | Kd | 5,730.0000 | 1 | 2 |
| bcl-2-like protein 11 isoform 1 | Homo sapiens (human) | EC50 | 350.0000 | 1 | 1 |
| Beta-lactoglobulin | Bos taurus (cattle) | Kd | 0.0360 | 1 | 1 |
| Beta-secretase 1 | Homo sapiens (human) | Kd | 2,000.0000 | 1 | 1 |
| Bile acid receptor | Homo sapiens (human) | EC50 | 23.2410 | 33 | 41 |
| Bile acid receptor | Mus musculus (house mouse) | EC50 | 16.8000 | 2 | 2 |
| Butyrophilin subfamily 3 member A1 | Homo sapiens (human) | EC50 | 27.3750 | 3 | 4 |
| Carbon monoxide dehydrogenase small chain | Afipia carboxidovorans OM5 | Kd | 47.6000 | 1 | 1 |
| Carbonic anhydrase 2 | Homo sapiens (human) | Kd | 450,000.0000 | 1 | 1 |
| Carbonic anhydrase 9 | Homo sapiens (human) | Kd | 150,000.0000 | 1 | 1 |
| Chain A, 2,2-dialkylglycine decarboxylase | Burkholderia cepacia | Kd | 600.0000 | 1 | 1 |
| Chain A, 6,7-Dimethyl-8-ribityllumazine Synthase | Schizosaccharomyces pombe (fission yeast) | Kd | 1.2000 | 1 | 1 |
| Chain A, Acetylcholinesterase | Mus musculus (house mouse) | Kd | 930.0000 | 1 | 7 |
| Chain A, Adipocyte Lipid-binding Protein | Mus musculus (house mouse) | Kd | 2.3500 | 1 | 2 |
| Chain A, ADP-RIBOSYLATION FACTOR-LIKE PROTEIN 3 | Mus musculus (house mouse) | Kd | 0.0240 | 1 | 1 |
| Chain A, Agglutinin alpha chain | Artocarpus integer | Kd | 820.0000 | 1 | 3 |
| Chain A, ALDOLASE | Oryctolagus cuniculus (rabbit) | Kd | 1.0000 | 1 | 1 |
| Chain A, ANAEROBIC RIBONUCLEOTIDE-TRIPHOSPHATE REDUCTASE LARGE CHAIN | Tequatrovirus T4 | Kd | 16.0000 | 1 | 4 |
| Chain A, Aspartate aminotransferase | Escherichia coli | Kd | 2,413.3333 | 1 | 6 |
| Chain A, Avidin | Gallus gallus (chicken) | Kd | 102.6500 | 1 | 4 |
| Chain A, BCL-2-RELATED PROTEIN A1 | Homo sapiens (human) | EC50 | 350.0000 | 1 | 1 |
| Chain A, BETA-SPECTRIN | Mus musculus (house mouse) | Kd | 40.0000 | 1 | 1 |
| Chain A, CARBONIC ANHYDRASE II | Homo sapiens (human) | Kd | 125.0000 | 1 | 1 |
| Chain A, Cellular retinoic acid-binding protein 2 | Homo sapiens (human) | Kd | 0.1200 | 1 | 2 |
| Chain A, CHIMERA OF IG KAPPA CHAIN: HUMAN CONSTANT REGION AND MOUSE VARIABLE REGION | synthetic construct | Kd | 0.4000 | 1 | 1 |
| Chain A, Choline-binding protein | Bacillus subtilis subsp. subtilis str. JH642 | Kd | 30.5000 | 1 | 1 |
| Chain A, Core-streptavidin | Streptomyces avidinii | Kd | 0.0300 | 1 | 16 |
| Chain A, Dihydrofolate reductase | Escherichia coli | Kd | 9.5100 | 1 | 1 |
| Chain A, DODECIN | Halobacterium salinarum R1 | Kd | 1.2680 | 1 | 2 |
| Chain A, DODECIN | Halorhodospira halophila | Kd | 1.2680 | 1 | 2 |
| Chain A, Dutpase | Leishmania major | Kd | 140.0000 | 1 | 3 |
| Chain A, Elongation factor 2 | Saccharomyces cerevisiae (brewer's yeast) | Kd | 3.9000 | 1 | 1 |
| Chain A, Elongation Factor G | Thermus thermophilus HB8 | Kd | 11.0000 | 1 | 1 |
| Chain A, ELONGATION FACTOR TU (EF-TU) | Bos taurus (cattle) | Kd | 1.0000 | 1 | 1 |
| Chain A, Eukaryotic peptide chain release factor GTP-binding subunit | Schizosaccharomyces pombe (fission yeast) | Kd | 3.8000 | 1 | 1 |
| Chain A, FATTY ACID-BINDING PROTEIN, BRAIN | Homo sapiens (human) | Kd | 0.0534 | 1 | 2 |
| Chain A, Ferritin light chain | Equus caballus (horse) | Kd | 16,500.0000 | 1 | 7 |
| Chain A, FLAVODOXIN | Nitratidesulfovibrio vulgaris | Kd | 0.0018 | 1 | 11 |
| Chain A, Flavodoxin | Nitratidesulfovibrio vulgaris str. Hildenborough | Kd | 0.0023 | 1 | 8 |
| Chain A, FLAVODOXIN | Synechococcus elongatus PCC 7942 = FACHB-805 | Kd | 0.0011 | 1 | 15 |
| Chain A, GLUCOSE/GALACTOSE-BINDING PROTEIN | Salmonella enterica subsp. enterica serovar Typhimurium | Kd | 0.2000 | 1 | 1 |
| Chain A, Glutamine Binding Protein | Escherichia coli | Kd | 0.5000 | 1 | 1 |
| Chain A, Glycine betaine/carnitine/choline-binding protein | Bacillus subtilis | Kd | 28.0000 | 1 | 4 |
| Chain A, Glycogen phosphorylase, liver form | Homo sapiens (human) | Kd | 250.0000 | 1 | 12 |
| Chain A, Guanine nucleotide-binding protein G(i), alpha-1 subunit | Homo sapiens (human) | Kd | 1.2000 | 1 | 1 |
| Chain A, heparan sulfate (glucosamine) 3-O-sulfotransferase 1 | Mus musculus (house mouse) | Kd | 14.0000 | 1 | 1 |
| Chain A, HISTIDINE-BINDING PROTEIN | Escherichia coli | Kd | 0.0640 | 1 | 1 |
| Chain A, hypoxanthine phosphoribosyltransferase | Trypanosoma cruzi | Kd | 788.4000 | 1 | 4 |
| Chain A, HYPOXANTHINE-GUANINE PHOSPHORIBOSYLTRANSFERASE | Toxoplasma gondii RH | Kd | 34.0500 | 1 | 4 |
| Chain A, Inositol 1,4,5-trisphosphate receptor type 1 | Mus musculus (house mouse) | Kd | 0.0001 | 1 | 1 |
| Chain A, interferon-inducible GTPase | Mus musculus (house mouse) | Kd | 0.6400 | 1 | 4 |
| Chain A, L-ARABINOSE-BINDING PROTEIN | Escherichia coli | Kd | 0.0650 | 1 | 8 |
| Chain A, Lectin | Erythrina corallodendron | Kd | 637.0000 | 1 | 4 |
| Chain A, Lysozyme | Tequatrovirus T4 | Kd | 91.0000 | 1 | 4 |
| Chain A, MALTOPORIN | Escherichia coli | Kd | 15,000.0000 | 1 | 1 |
| Chain A, Membrane lipoprotein tmpC | Treponema pallidum | Kd | 0.2100 | 1 | 3 |
| Chain A, Methionyl-tRNA synthetase | Escherichia coli | Kd | 11.0000 | 1 | 2 |
| Chain A, MUSCLE FATTY ACID BINDING PROTEIN | Homo sapiens (human) | Kd | 0.4300 | 1 | 3 |
| Chain A, Nadh Oxidase | Thermus thermophilus HB8 | Kd | 0.0900 | 1 | 1 |
| Chain A, Nadph Dehydrogenase 1 | Saccharomyces cerevisiae (brewer's yeast) | Kd | 1.0000 | 1 | 1 |
| Chain A, NUCLEOSIDE DIPHOSPHATE KINASE | Dictyostelium discoideum | Kd | 14.0000 | 1 | 1 |
| Chain A, Phenazine biosynthesis protein phzF | Pseudomonas fluorescens | Kd | 1.4000 | 1 | 1 |
| Chain A, Phenylethanolamine N-methyltransferase | Homo sapiens (human) | Kd | 180.0000 | 1 | 13 |
| Chain A, Phospholipase C Delta-1 | Rattus norvegicus (Norway rat) | Kd | 0.2100 | 1 | 1 |
| Chain A, PLASMA RETINOL-BINDING PROTEIN PRECURSOR | Homo sapiens (human) | Kd | 0.1900 | 1 | 1 |
| Chain A, Protein (female-specific Histamine Binding Protein 2) | Rhipicephalus appendiculatus | Kd | 0.0017 | 1 | 1 |
| Chain A, Protein (fmn-binding Protein) | Nitratidesulfovibrio vulgaris str. 'Miyazaki F' | Kd | 0.0004 | 1 | 1 |
| Chain A, Protein (streptavidin) | Streptomyces avidinii | Kd | 0.0002 | 1 | 1 |
| Chain A, Protein (thymidylate Synthase) | Lacticaseibacillus casei | Kd | 4.0000 | 1 | 1 |
| Chain A, Putative Glycine Betaine-binding Abc Transporter Protein | Sinorhizobium meliloti | Kd | 2.3000 | 1 | 2 |
| Chain A, ras-related C3 botulinum toxin substrate 1 isoform Rac1b | Homo sapiens (human) | Kd | 0.0016 | 1 | 2 |
| Chain A, Retinaldehyde-binding protein 1 | Homo sapiens (human) | Kd | 0.0100 | 1 | 2 |
| Chain A, Ribosome-inactivating protein 3 | Zea mays | Kd | 0.0063 | 1 | 1 |
| Chain A, Ribosome-inactivating protein alpha-trichosanthin | Trichosanthes kirilowii | Kd | 260.0000 | 1 | 1 |
| Chain A, Ricin A chain | Ricinus communis (castor bean) | Kd | 700.0000 | 1 | 1 |
| Chain A, SERUM ALBUMIN | Homo sapiens (human) | Kd | 0.0498 | 1 | 4 |
| Chain A, Sex Hormone-Binding Globulin | Homo sapiens (human) | Kd | 0.0009 | 1 | 1 |
| Chain A, Slr1257 protein | Synechocystis sp. PCC 6803 substr. Kazusa | Kd | 0.2400 | 1 | 1 |
| Chain A, Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 13 |
| Chain A, Streptavidin Complex With Biotin | Streptomyces avidinii | Kd | 0.0000 | 1 | 1 |
| Chain A, ThiT | Lactococcus cremoris subsp. cremoris NZ9000 | Kd | 0.0001 | 1 | 1 |
| Chain A, Thymidylate Synthase | Lacticaseibacillus casei | Kd | 23.7424 | 1 | 38 |
| Chain A, Trp Rna-binding Attenuation Protein | Geobacillus stearothermophilus | Kd | 7.5000 | 1 | 1 |
| Chain A, Undecaprenyl pyrophosphate synthetase | Escherichia coli | Kd | 520.0000 | 1 | 1 |
| Chain A, Uracil Phosphoribosyltransferase | Toxoplasma gondii | Kd | 465.0000 | 1 | 1 |
| Chain A, Vitamin D Nuclear Receptor | Homo sapiens (human) | Kd | 0.0006 | 1 | 1 |
| Chain A, Xanthine phosphoribosyltransferase | Bacillus subtilis | Kd | 4.5000 | 1 | 1 |
| Chain A, ykoF | Bacillus subtilis | Kd | 10.0000 | 1 | 1 |
| Chain B, 6,7-Dimethyl-8-ribityllumazine Synthase | Schizosaccharomyces pombe (fission yeast) | Kd | 1.2000 | 1 | 1 |
| Chain B, Agglutinin beta-3 chain | Artocarpus integer | Kd | 820.0000 | 1 | 1 |
| Chain B, Aspartate aminotransferase | Escherichia coli | Kd | 1,920.0000 | 1 | 4 |
| Chain B, Avidin | Gallus gallus (chicken) | Kd | 205.0000 | 1 | 1 |
| Chain B, CHIMERA OF IG GAMMA-1 CHAIN: HUMAN CONSTANT REGION AND MOUSE VARIABLE REGION | synthetic construct | Kd | 0.4000 | 1 | 1 |
| Chain B, Dutpase | Leishmania major | Kd | 140.0000 | 1 | 2 |
| Chain B, EUKARYOTIC TRANSLATION INITIATION FACTOR 4E | Homo sapiens (human) | Kd | 110,000.0000 | 1 | 1 |
| Chain B, HYPOXANTHINE-GUANINE PHOSPHORIBOSYLTRANSFERASE | Toxoplasma gondii RH | Kd | 34.0500 | 1 | 2 |
| Chain B, MALTOPORIN | Escherichia coli | Kd | 15,000.0000 | 1 | 1 |
| Chain B, Protein (fmn-binding Protein) | Nitratidesulfovibrio vulgaris str. 'Miyazaki F' | Kd | 0.0004 | 1 | 1 |
| Chain B, Protein (streptavidin) | Streptomyces avidinii | Kd | 0.0002 | 1 | 1 |
| Chain B, PyrR bifunctional protein | [Bacillus] caldolyticus | Kd | 30.0000 | 1 | 1 |
| Chain B, Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 4 |
| Chain B, tryptophanyl-tRNA synthetase | Deinococcus radiodurans | Kd | 30.0000 | 1 | 1 |
| Chain B, Uracil Phosphoribosyltransferase | Toxoplasma gondii | Kd | 465.0000 | 1 | 1 |
| Chain B, ykoF | Bacillus subtilis | Kd | 10.0000 | 1 | 1 |
| Chain C, Agglutinin alpha chain | Artocarpus integer | Kd | 820.0000 | 1 | 1 |
| Chain C, DODECIN | Halorhodospira halophila | Kd | 1.2680 | 1 | 2 |
| Chain C, Tryptophanyl-tRNA synthetase II | Deinococcus radiodurans | Kd | 30.0000 | 1 | 1 |
| Chain C, Uracil Phosphoribosyltransferase | Toxoplasma gondii | Kd | 465.0000 | 1 | 1 |
| Chain D, Agglutinin beta-3 chain | Artocarpus integer | Kd | 820.0000 | 1 | 1 |
| Chain D, Circularly Permuted Core-streptavidin E51/a46 | Streptomyces avidinii | Kd | 0.0439 | 1 | 1 |
| Chain D, Core-streptavidin | Streptomyces avidinii | Kd | 0.0300 | 1 | 16 |
| Chain D, Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 9 |
| Chain E, DODECIN | Halorhodospira halophila | Kd | 1.2680 | 1 | 2 |
| Chain E, LYSINE, ARGININE, ORNITHINE-BINDING PROTEIN | Salmonella enterica subsp. enterica serovar Typhimurium | Kd | 0.1813 | 1 | 9 |
| Chain H, Fab M82G2, Heavy chain | Mus musculus (house mouse) | Kd | 0.1400 | 1 | 2 |
| Chain H, Immunoglobulin Igg1 Heavy chain | Homo sapiens (human) | Kd | 0.0018 | 1 | 1 |
| Chain K, Trp Rna-binding Attenuation Protein | Geobacillus stearothermophilus | Kd | 7.5000 | 1 | 1 |
| Chain L, Fab M82G2, Light chain | Mus musculus (house mouse) | Kd | 0.1400 | 1 | 2 |
| Chain L, Immunoglobulin Igg1 Lambda Light Chain | Homo sapiens (human) | Kd | 0.0018 | 1 | 1 |
| Chain X, Thyroid hormone receptor beta-1 | Homo sapiens (human) | Kd | 0.0010 | 1 | 4 |
| Cysteinyl leukotriene receptor 1 | Homo sapiens (human) | EC50 | 0.0219 | 1 | 2 |
| Cysteinyl leukotriene receptor 2 | Homo sapiens (human) | EC50 | 0.0066 | 1 | 2 |
| Cytochrome P450 2A13 | Homo sapiens (human) | Kd | 5.2000 | 1 | 1 |
| Cytochrome P450 2A6 | Homo sapiens (human) | Kd | 2.3000 | 1 | 1 |
| Cytochrome P450 2C9 | Homo sapiens (human) | EC50 | 1.0000 | 1 | 1 |
| Cytochrome P450 3A4 | Homo sapiens (human) | EC50 | 0.0019 | 1 | 1 |
| Dihydrofolate reductase | Escherichia coli K-12 | Kd | 2.5864 | 10 | 13 |
| DNA polymerase subunit gamma-1 | Homo sapiens (human) | Kd | 0.8000 | 1 | 1 |
| DNA repair and recombination protein RadA | Pyrococcus furiosus DSM 3638 | Kd | 460.0000 | 1 | 1 |
| Endolysin | Tequatrovirus T4 | Kd | 86.6500 | 4 | 6 |
| Estrogen receptor | Homo sapiens (human) | EC50 | 1.7269 | 11 | 11 |
| Estrogen receptor | Rattus norvegicus (Norway rat) | EC50 | 150.0000 | 1 | 2 |
| Estrogen receptor beta | Homo sapiens (human) | EC50 | 0.6096 | 14 | 14 |
| Estrogen receptor beta | Rattus norvegicus (Norway rat) | EC50 | 150.0000 | 1 | 2 |
| Fatty acid-binding protein 5 | Mus musculus (house mouse) | Kd | 0.0421 | 1 | 1 |
| Fatty acid-binding protein, adipocyte | Homo sapiens (human) | Kd | 0.1800 | 1 | 1 |
| Fatty acid-binding protein, liver | Homo sapiens (human) | Kd | 0.5500 | 2 | 2 |
| Free fatty acid receptor 1 | Homo sapiens (human) | EC50 | 9.7070 | 7 | 8 |
| Free fatty acid receptor 4 | Homo sapiens (human) | EC50 | 2.9180 | 2 | 2 |
| G-protein coupled bile acid receptor 1 | Homo sapiens (human) | EC50 | 17.8482 | 14 | 34 |
| G-protein coupled receptor 35 | Homo sapiens (human) | EC50 | 23.4000 | 2 | 2 |
| GABA theta subunit | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-1 | Homo sapiens (human) | EC50 | 14,519.2264 | 5 | 7 |
| Gamma-aminobutyric acid receptor subunit alpha-1 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-2 | Homo sapiens (human) | EC50 | 600.0000 | 1 | 1 |
| Gamma-aminobutyric acid receptor subunit alpha-2 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-3 | Homo sapiens (human) | EC50 | 300.0000 | 1 | 1 |
| Gamma-aminobutyric acid receptor subunit alpha-3 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-4 | Homo sapiens (human) | EC50 | 125.8736 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-4 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-5 | Homo sapiens (human) | EC50 | 141.1793 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-5 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit alpha-6 | Homo sapiens (human) | EC50 | 460.0000 | 1 | 1 |
| Gamma-aminobutyric acid receptor subunit alpha-6 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit beta-1 | Homo sapiens (human) | EC50 | 138.0190 | 1 | 2 |
| Gamma-aminobutyric acid receptor subunit beta-1 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit beta-2 | Homo sapiens (human) | EC50 | 12,636.2132 | 5 | 8 |
| Gamma-aminobutyric acid receptor subunit beta-2 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit beta-3 | Homo sapiens (human) | EC50 | 405.0000 | 6 | 6 |
| Gamma-aminobutyric acid receptor subunit beta-3 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit delta | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit epsilon | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit gamma-1 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit gamma-2 | Homo sapiens (human) | EC50 | 6,487.2340 | 12 | 16 |
| Gamma-aminobutyric acid receptor subunit gamma-2 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit gamma-3 | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit pi | Rattus norvegicus (Norway rat) | EC50 | 4.3333 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit rho-1 | Homo sapiens (human) | EC50 | 8.3903 | 2 | 3 |
| Gamma-aminobutyric acid receptor subunit rho-2 | Homo sapiens (human) | EC50 | 3.0000 | 1 | 1 |
| Glucocorticoid receptor | Homo sapiens (human) | EC50 | 298.7000 | 1 | 1 |
| Glutamate receptor 1 | Homo sapiens (human) | EC50 | 792,445,056.0762 | 12 | 20 |
| Glutamate receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 27.3799 | 6 | 7 |
| Glutamate receptor 2 | Homo sapiens (human) | EC50 | 722,116,393.1444 | 8 | 11 |
| Glutamate receptor 2 | Rattus norvegicus (Norway rat) | EC50 | 1,482,620,106.9400 | 4 | 5 |
| Glutamate receptor 3 | Homo sapiens (human) | EC50 | 2,264,128,594.8718 | 5 | 7 |
| Glutamate receptor 3 | Rattus norvegicus (Norway rat) | EC50 | 54.8048 | 5 | 6 |
| Glutamate receptor 4 | Homo sapiens (human) | EC50 | 9,952,675,009.4244 | 2 | 4 |
| Glutamate receptor 4 | Rattus norvegicus (Norway rat) | EC50 | 18.6392 | 4 | 5 |
| Glutamate receptor ionotropic, kainate 1 | Homo sapiens (human) | EC50 | 57.3333 | 3 | 3 |
| Glutamate receptor ionotropic, kainate 1 | Rattus norvegicus (Norway rat) | EC50 | 129.1633 | 2 | 3 |
| Glutamate receptor ionotropic, kainate 2 | Homo sapiens (human) | EC50 | 25.0000 | 2 | 2 |
| Glutamate receptor ionotropic, kainate 2 | Rattus norvegicus (Norway rat) | EC50 | 65.9615 | 2 | 3 |
| Glutamate receptor ionotropic, NMDA 1 | Homo sapiens (human) | EC50 | 0.2825 | 4 | 4 |
| Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | EC50 | 1.3123 | 7 | 8 |
| Glutamate receptor ionotropic, NMDA 1 | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 2A | Homo sapiens (human) | EC50 | 0.2000 | 3 | 3 |
| Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | EC50 | 1.4497 | 4 | 5 |
| Glutamate receptor ionotropic, NMDA 2A | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 2B | Homo sapiens (human) | EC50 | 0.5300 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | EC50 | 0.9600 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2B | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | EC50 | 0.5600 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2C | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | EC50 | 0.2850 | 2 | 2 |
| Glutamate receptor ionotropic, NMDA 2D | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | EC50 | 0.1200 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 3A | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | EC50 | 0.1200 | 1 | 1 |
| Glutamate receptor ionotropic, NMDA 3B | Rattus norvegicus (Norway rat) | Kd | 150.0000 | 1 | 1 |
| Glutamate transporter homolog | Pyrococcus horikoshii OT3 | Kd | 0.0055 | 1 | 2 |
| glycogen synthase kinase-3 beta isoform 1 | Homo sapiens (human) | EC50 | 300.0000 | 1 | 1 |
| guanine nucleotide-binding protein subunit alpha-15 | Homo sapiens (human) | EC50 | 29.9020 | 1 | 1 |
| Heat shock cognate 71 kDa protein | Homo sapiens (human) | Kd | 130.9130 | 1 | 2 |
| Histamine H1 receptor | Cavia porcellus (domestic guinea pig) | EC50 | 0.1622 | 1 | 1 |
| Histamine H1 receptor | Homo sapiens (human) | EC50 | 0.1511 | 8 | 8 |
| Histamine H1 receptor | Rattus norvegicus (Norway rat) | EC50 | 4.4668 | 1 | 1 |
| Histamine H1 receptor | Cavia porcellus (domestic guinea pig) | Kd | 0.0008 | 1 | 3 |
| Histamine H1 receptor | Homo sapiens (human) | Kd | 0.0045 | 1 | 1 |
| Histamine H2 receptor | Cavia porcellus (domestic guinea pig) | EC50 | 0.8074 | 5 | 5 |
| Histamine H2 receptor | Homo sapiens (human) | EC50 | 1.8055 | 15 | 15 |
| Histamine H2 receptor | Homo sapiens (human) | Kd | 0.0122 | 1 | 1 |
| Histamine H3 receptor | Homo sapiens (human) | EC50 | 0.0615 | 17 | 17 |
| Histamine H3 receptor | Homo sapiens (human) | Kd | 0.0030 | 1 | 1 |
| Histamine H4 receptor | Homo sapiens (human) | EC50 | 0.1124 | 20 | 20 |
| Histamine H4 receptor | Mus musculus (house mouse) | EC50 | 2.8596 | 5 | 5 |
| Histamine H4 receptor | Rattus norvegicus (Norway rat) | EC50 | 14.1624 | 4 | 4 |
| Histamine H4 receptor | Homo sapiens (human) | Kd | 0.0105 | 2 | 2 |
| Histamine H4 receptor | Mus musculus (house mouse) | Kd | 0.0420 | 1 | 1 |
| Histamine H4 receptor | Rattus norvegicus (Norway rat) | Kd | 0.1340 | 1 | 1 |
| Histidine triad nucleotide-binding protein 1 | Homo sapiens (human) | Kd | 67.0000 | 1 | 1 |
| Histidine triad nucleotide-binding protein 1 | Mus musculus (house mouse) | Kd | 1,150.0000 | 2 | 2 |
| Histidine-binding periplasmic protein | Escherichia coli K-12 | Kd | 0.1140 | 1 | 1 |
| Hsf1 protein | Mus musculus (house mouse) | EC50 | 4.0710 | 1 | 1 |
| Hydroxycarboxylic acid receptor 2 | Homo sapiens (human) | EC50 | 0.7757 | 27 | 30 |
| Hydroxycarboxylic acid receptor 2 | Mus musculus (house mouse) | EC50 | 0.1093 | 3 | 3 |
| Hydroxycarboxylic acid receptor 2 | Rattus norvegicus (Norway rat) | EC50 | 0.2493 | 3 | 3 |
| Hydroxycarboxylic acid receptor 3 | Homo sapiens (human) | EC50 | 31.9526 | 3 | 3 |
| Inositol 1,4,5-trisphosphate receptor type 1 | Homo sapiens (human) | Kd | 0.2600 | 1 | 1 |
| Inositol 1,4,5-trisphosphate receptor type 1 | Rattus norvegicus (Norway rat) | EC50 | 0.0829 | 12 | 16 |
| Inositol 1,4,5-trisphosphate receptor type 1 | Rattus norvegicus (Norway rat) | Kd | 0.0245 | 10 | 12 |
| Inositol 1,4,5-trisphosphate receptor type 3 | Homo sapiens (human) | Kd | 0.1950 | 1 | 1 |
| insulin-degrading enzyme isoform 1 | Homo sapiens (human) | EC50 | 2.4495 | 2 | 2 |
| Integrin alpha-IIb | Homo sapiens (human) | EC50 | 7.4000 | 1 | 1 |
| Integrin beta-3 | Homo sapiens (human) | EC50 | 7.4000 | 1 | 1 |
| Iodotyrosine deiodinase | Haliscomenobacter hydrossis DSM 1100 | Kd | 4.1450 | 1 | 2 |
| Iodotyrosine deiodinase 1 | Homo sapiens (human) | Kd | 4.1450 | 1 | 2 |
| Jacalin | Artocarpus heterophyllus (jackfruit) | Kd | 16.0000 | 1 | 1 |
| Kappa-type opioid receptor | Cavia porcellus (domestic guinea pig) | EC50 | 0.0000 | 1 | 1 |
| Lanosterol 14-alpha demethylase | Mycobacterium tuberculosis H37Rv | Kd | 100.0000 | 1 | 1 |
| Melatonin receptor type 1A | Gallus gallus (chicken) | EC50 | 0.0226 | 1 | 1 |
| Melatonin receptor type 1A | Homo sapiens (human) | EC50 | 0.0008 | 11 | 11 |
| Melatonin receptor type 1B | Gallus gallus (chicken) | EC50 | 0.0226 | 1 | 1 |
| Melatonin receptor type 1B | Homo sapiens (human) | EC50 | 0.0025 | 12 | 12 |
| Melatonin receptor type 1C | Gallus gallus (chicken) | EC50 | 0.0226 | 1 | 1 |
| Melatonin receptor type 1C | Xenopus laevis (African clawed frog) | EC50 | 0.0001 | 3 | 3 |
| Metabotropic glutamate receptor 1 | Homo sapiens (human) | EC50 | 454.4214 | 4 | 7 |
| Metabotropic glutamate receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 12.9088 | 11 | 13 |
| Metabotropic glutamate receptor 2 | Homo sapiens (human) | EC50 | 193.5002 | 12 | 16 |
| Metabotropic glutamate receptor 2 | Rattus norvegicus (Norway rat) | EC50 | 8.3136 | 9 | 11 |
| Metabotropic glutamate receptor 3 | Homo sapiens (human) | EC50 | 2.8572 | 5 | 5 |
| Metabotropic glutamate receptor 3 | Rattus norvegicus (Norway rat) | EC50 | 3.1035 | 4 | 5 |
| Metabotropic glutamate receptor 4 | Homo sapiens (human) | EC50 | 9.4200 | 4 | 5 |
| Metabotropic glutamate receptor 4 | Rattus norvegicus (Norway rat) | EC50 | 19.9840 | 10 | 14 |
| Metabotropic glutamate receptor 5 | Homo sapiens (human) | EC50 | 163.5500 | 4 | 4 |
| Metabotropic glutamate receptor 5 | Rattus norvegicus (Norway rat) | EC50 | 5.4229 | 10 | 13 |
| Metabotropic glutamate receptor 6 | Homo sapiens (human) | EC50 | 549.1500 | 4 | 6 |
| Metabotropic glutamate receptor 6 | Rattus norvegicus (Norway rat) | EC50 | 28.7429 | 6 | 7 |
| Metabotropic glutamate receptor 7 | Homo sapiens (human) | EC50 | 540.2360 | 4 | 5 |
| Metabotropic glutamate receptor 7 | Rattus norvegicus (Norway rat) | EC50 | 1,592.0000 | 3 | 5 |
| Metabotropic glutamate receptor 8 | Mus musculus (house mouse) | EC50 | 0.0220 | 1 | 1 |
| Metabotropic glutamate receptor 8 | Rattus norvegicus (Norway rat) | EC50 | 14.4933 | 3 | 3 |
| Methylcytosine dioxygenase TET2 | Homo sapiens (human) | Kd | 3.4200 | 1 | 1 |
| Methylosome protein 50 | Homo sapiens (human) | Kd | 0.6610 | 1 | 1 |
| Mineralocorticoid receptor | Homo sapiens (human) | EC50 | 0.0012 | 5 | 5 |
| Mineralocorticoid receptor | Homo sapiens (human) | Kd | 0.0005 | 1 | 2 |
| Mu-type opioid receptor | Cavia porcellus (domestic guinea pig) | EC50 | 0.0080 | 1 | 1 |
| Mu-type opioid receptor | Rattus norvegicus (Norway rat) | EC50 | 0.0070 | 1 | 1 |
| N-alpha-acetyltransferase 50 | Homo sapiens (human) | Kd | 0.1560 | 1 | 1 |
| Nitric oxide synthase, inducible | Homo sapiens (human) | Kd | 7.0000 | 2 | 2 |
| NPC1-like intracellular cholesterol transporter 1 | Homo sapiens (human) | EC50 | 10.0000 | 1 | 1 |
| NPYLR7B | Aedes aegypti (yellow fever mosquito) | EC50 | 0.5080 | 1 | 1 |
| Nuclear factor NF-kappa-B p105 subunit | Homo sapiens (human) | Kd | 0.2160 | 1 | 1 |
| Nuclear receptor ROR-gamma | Homo sapiens (human) | EC50 | 0.0662 | 2 | 4 |
| Nuclear receptor subfamily 1 group I member 2 | Homo sapiens (human) | EC50 | 28.4255 | 2 | 4 |
| Nuclear receptor subfamily 4 group A member 2 | Homo sapiens (human) | Kd | 50.0000 | 1 | 2 |
| Olfactory receptor 51E2 | Homo sapiens (human) | EC50 | 13.2560 | 1 | 4 |
| Olfactory receptor class A-like protein 1 | Danio rerio (zebrafish) | EC50 | 1.9000 | 1 | 1 |
| Oxoeicosanoid receptor 1 | Homo sapiens (human) | EC50 | 0.1135 | 2 | 2 |
| Oxysterols receptor LXR-alpha | Homo sapiens (human) | EC50 | 0.2833 | 2 | 6 |
| P2X purinoceptor 1 | Homo sapiens (human) | EC50 | 0.1820 | 1 | 1 |
| P2X purinoceptor 1 | Rattus norvegicus (Norway rat) | EC50 | 1.5910 | 2 | 2 |
| P2X purinoceptor 2 | Homo sapiens (human) | EC50 | 27.2500 | 2 | 2 |
| P2X purinoceptor 3 | Homo sapiens (human) | EC50 | 0.5000 | 1 | 1 |
| P2X purinoceptor 4 | Homo sapiens (human) | EC50 | 1.0000 | 1 | 1 |
| P2X purinoceptor 4 | Rattus norvegicus (Norway rat) | EC50 | 219.0000 | 1 | 1 |
| P2Y purinoceptor 1 | Homo sapiens (human) | EC50 | 44.8000 | 3 | 5 |
| P2Y purinoceptor 1 | Meleagris gallopavo (turkey) | EC50 | 7.5400 | 3 | 3 |
| P2Y purinoceptor 1 | Rattus norvegicus (Norway rat) | EC50 | 0.0600 | 1 | 1 |
| P2Y purinoceptor 11 | Homo sapiens (human) | EC50 | 54.5000 | 1 | 2 |
| P2Y purinoceptor 14 | Homo sapiens (human) | EC50 | 23.2000 | 5 | 7 |
| P2Y purinoceptor 2 | Homo sapiens (human) | EC50 | 38.0326 | 40 | 74 |
| P2Y purinoceptor 2 | Rattus norvegicus (Norway rat) | EC50 | 0.1300 | 1 | 1 |
| P2Y purinoceptor 2 | Mus musculus (house mouse) | EC50 | 1.2600 | 1 | 1 |
| P2Y purinoceptor 4 | Homo sapiens (human) | EC50 | 1.1054 | 15 | 18 |
| P2Y purinoceptor 4 | Rattus norvegicus (Norway rat) | EC50 | 2.8000 | 1 | 2 |
| P2Y purinoceptor 6 | Homo sapiens (human) | EC50 | 8.4104 | 17 | 26 |
| P2Y purinoceptor 6 | Rattus norvegicus (Norway rat) | EC50 | 0.2000 | 2 | 2 |
| PA-I galactophilic lectin | Pseudomonas aeruginosa PAO1 | Kd | 59.7500 | 2 | 2 |
| Palmitoleoyl-protein carboxylesterase NOTUM | Homo sapiens (human) | EC50 | 45.8000 | 1 | 1 |
| Palmitoleoyl-protein carboxylesterase NOTUM | Homo sapiens (human) | Kd | 85.0000 | 1 | 1 |
| Peroxisome proliferator-activated receptor alpha | Homo sapiens (human) | EC50 | 36.0000 | 1 | 1 |
| Peroxisome proliferator-activated receptor gamma | Homo sapiens (human) | EC50 | 8.9000 | 1 | 2 |
| Peroxisome proliferator-activated receptor gamma | Homo sapiens (human) | Kd | 1.4220 | 2 | 5 |
| Phospholipase A2 | Homo sapiens (human) | Kd | 150.0000 | 1 | 1 |
| Potassium channel subfamily K member 2 | Homo sapiens (human) | EC50 | 377.0000 | 1 | 1 |
| Potassium voltage-gated channel subfamily A member 1 | Homo sapiens (human) | EC50 | 39.5000 | 2 | 2 |
| Progesterone receptor | Homo sapiens (human) | EC50 | 8.2000 | 1 | 1 |
| Prostacyclin receptor | Homo sapiens (human) | EC50 | 0.3470 | 1 | 1 |
| Prostaglandin E2 receptor EP1 subtype | Homo sapiens (human) | EC50 | 0.3018 | 2 | 2 |
| Prostaglandin E2 receptor EP2 subtype | Homo sapiens (human) | EC50 | 0.1381 | 5 | 5 |
| Prostaglandin E2 receptor EP2 subtype | Rattus norvegicus (Norway rat) | EC50 | 0.0096 | 2 | 2 |
| Prostaglandin E2 receptor EP3 subtype | Homo sapiens (human) | EC50 | 1.1512 | 2 | 2 |
| Prostaglandin E2 receptor EP4 subtype | Homo sapiens (human) | EC50 | 0.0028 | 5 | 5 |
| Prostaglandin E2 receptor EP4 subtype | Rattus norvegicus (Norway rat) | EC50 | 0.0021 | 2 | 2 |
| Prostaglandin F2-alpha receptor | Homo sapiens (human) | EC50 | 0.1178 | 3 | 3 |
| Prostaglandin F2-alpha receptor | Mus musculus (house mouse) | EC50 | 0.0185 | 2 | 2 |
| Prostaglandin G/H synthase 2 | Homo sapiens (human) | Kd | 8.0700 | 1 | 1 |
| Protein arginine N-methyltransferase 5 | Homo sapiens (human) | Kd | 0.6610 | 1 | 1 |
| Protein argonaute-2 | Homo sapiens (human) | Kd | 15.0000 | 1 | 1 |
| Protein farnesyltransferase subunit beta | Homo sapiens (human) | Kd | 0.0020 | 1 | 1 |
| Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha | Homo sapiens (human) | Kd | 0.0020 | 1 | 1 |
| Prothrombin | Homo sapiens (human) | EC50 | 1.8522 | 4 | 4 |
| Purine nucleoside phosphorylase | Bos taurus (cattle) | Kd | 0.9350 | 4 | 4 |
| putative potassium channel subunit | Homo sapiens (human) | EC50 | 10.4100 | 1 | 1 |
| Pyruvate kinase PKM | Homo sapiens (human) | EC50 | 650.0115 | 1 | 2 |
| Ras-related protein Rab-7a | Homo sapiens (human) | Kd | 0.2173 | 4 | 8 |
| recombinase A | Mycobacterium tuberculosis H37Rv | EC50 | 5.7660 | 2 | 2 |
| Retinoic acid receptor RXR-alpha | Homo sapiens (human) | EC50 | 7.7008 | 2 | 2 |
| Retinoic acid receptor RXR-alpha | Mus musculus (house mouse) | EC50 | 16.8000 | 1 | 1 |
| Retinoic acid receptor RXR-alpha | Homo sapiens (human) | Kd | 0.9300 | 1 | 1 |
| Retinol-binding protein 4 | Homo sapiens (human) | Kd | 0.1820 | 1 | 1 |
| Reverse transcriptase/RNaseH | Human immunodeficiency virus 1 | Kd | 14.6612 | 15 | 25 |
| Riboflavin-binding protein | Gallus gallus (chicken) | Kd | 0.0229 | 4 | 4 |
| Sex hormone-binding globulin | Homo sapiens (human) | Kd | 0.4336 | 1 | 17 |
| Sigma intracellular receptor 2 | Homo sapiens (human) | Kd | 6.6000 | 1 | 1 |
| Sigma non-opioid intracellular receptor 1 | Cavia porcellus (domestic guinea pig) | EC50 | 0.0024 | 1 | 1 |
| Sigma non-opioid intracellular receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 0.1060 | 1 | 1 |
| Sigma non-opioid intracellular receptor 1 | Homo sapiens (human) | Kd | 12.4000 | 1 | 1 |
| Sodium-dependent dopamine transporter | Rattus norvegicus (Norway rat) | EC50 | 0.0070 | 1 | 1 |
| Sodium-dependent dopamine transporter | Homo sapiens (human) | EC50 | 0.1060 | 1 | 1 |
| Sodium-dependent serotonin transporter | Homo sapiens (human) | EC50 | 0.0011 | 1 | 1 |
| Solute carrier family 2, facilitated glucose transporter member 9 | Homo sapiens (human) | EC50 | 766.6667 | 2 | 3 |
| Somatostatin receptor type 2 | Homo sapiens (human) | EC50 | 0.0023 | 1 | 1 |
| Sphingosine 1-phosphate receptor 1 | Homo sapiens (human) | EC50 | 0.0067 | 15 | 15 |
| Sphingosine 1-phosphate receptor 2 | Homo sapiens (human) | EC50 | 0.0097 | 7 | 7 |
| Sphingosine 1-phosphate receptor 3 | Homo sapiens (human) | EC50 | 0.0087 | 13 | 13 |
| Sphingosine 1-phosphate receptor 4 | Homo sapiens (human) | EC50 | 0.1270 | 6 | 6 |
| Sphingosine 1-phosphate receptor 5 | Homo sapiens (human) | EC50 | 0.0235 | 8 | 8 |
| Streptavidin | Streptomyces avidinii | Kd | 0.0000 | 1 | 1 |
| streptokinase A precursor | Streptococcus pyogenes M1 GAS | EC50 | 76.2800 | 2 | 2 |
| Thiamine transporter ThiT | Lactococcus cremoris subsp. cremoris MG1363 | Kd | 2.4687 | 7 | 7 |
| Thiamine-binding periplasmic protein | Escherichia coli K-12 | Kd | 0.0038 | 1 | 1 |
| Thromboxane A2 receptor | Homo sapiens (human) | EC50 | 0.7500 | 2 | 2 |
| Thyroid hormone receptor alpha | Homo sapiens (human) | EC50 | 0.0076 | 14 | 16 |
| Thyroid hormone receptor alpha | Homo sapiens (human) | Kd | 0.0001 | 6 | 8 |
| Thyroid hormone receptor beta | Homo sapiens (human) | EC50 | 0.0260 | 11 | 13 |
| Thyroid hormone receptor beta | Homo sapiens (human) | Kd | 0.0001 | 6 | 8 |
| trace amine-associated receptor 1 | Homo sapiens (human) | EC50 | 0.5072 | 6 | 9 |
| Trace amine-associated receptor 1 | Mus musculus (house mouse) | EC50 | 0.1387 | 7 | 7 |
| Trace amine-associated receptor 1 | Rattus norvegicus (Norway rat) | EC50 | 0.1663 | 6 | 8 |
| Transcription factor p65 | Homo sapiens (human) | Kd | 13.0000 | 1 | 1 |
| Transient receptor potential cation channel subfamily A member 1 | Homo sapiens (human) | EC50 | 41.0000 | 1 | 1 |
| Transient receptor potential cation channel subfamily A member 1 | Rattus norvegicus (Norway rat) | EC50 | 30.2492 | 1 | 2 |
| Transient receptor potential cation channel subfamily M member 2 | Homo sapiens (human) | EC50 | 100.0000 | 1 | 1 |
| Transient receptor potential cation channel subfamily V member 4 | Mus musculus (house mouse) | EC50 | 0.1500 | 1 | 1 |
| Transketolase | Homo sapiens (human) | Kd | 6,800.0000 | 1 | 1 |
| Transporter | Rattus norvegicus (Norway rat) | EC50 | 0.0039 | 1 | 2 |
| Transthyretin | Homo sapiens (human) | EC50 | 97.0000 | 1 | 1 |
| Tyrosine-protein kinase Lck | Homo sapiens (human) | Kd | 300.0000 | 1 | 1 |
| UDP-galactopyranose mutase | Klebsiella pneumoniae | Kd | 54.0000 | 1 | 1 |
| UDP-galactopyranose mutase | Mycobacterium tuberculosis H37Rv | Kd | 35.0000 | 1 | 1 |
| Vitamin D-binding protein | Homo sapiens (human) | Kd | 0.0240 | 1 | 1 |
| Vitamin D3 receptor | Bos taurus (cattle) | EC50 | 0.0001 | 2 | 2 |
| Vitamin D3 receptor | Homo sapiens (human) | EC50 | 27.2512 | 38 | 46 |
| Vitamin D3 receptor | Mus musculus (house mouse) | EC50 | 0.3500 | 1 | 2 |
| Vitamin D3 receptor | Rattus norvegicus (Norway rat) | EC50 | 0.0002 | 7 | 7 |
| Vitamin D3 receptor | Homo sapiens (human) | Kd | 7.1800 | 4 | 4 |
| Vitamin D3 receptor | Sus scrofa (pig) | Kd | 0.0001 | 1 | 1 |
| Vitamin D3 receptor A | Danio rerio (zebrafish) | EC50 | 0.0055 | 1 | 1 |
| Vitamin D3 receptor A | Danio rerio (zebrafish) | Kd | 1.2000 | 1 | 1 |