Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
enprofylline | [no description available] | medium | 7 | 0 | oxopurine | anti-arrhythmia drug; anti-asthmatic drug; bronchodilator agent; non-steroidal anti-inflammatory drug |
theophylline | [no description available] | high | 559 | 18 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
theophylline | [no description available] | high | 559 | 0 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
caffeine | [no description available] | high | 618 | 27 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
caffeine | [no description available] | high | 618 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
1-methyl-3-isobutylxanthine | [no description available] | medium | 16 | 0 | 3-isobutyl-1-methylxanthine | |
sarcosine | [no description available] | medium | 1 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
indomethacin | [no description available] | medium | 11 | 0 | aromatic ether; indole-3-acetic acids; monochlorobenzenes; N-acylindole | analgesic; drug metabolite; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; gout suppressant; non-steroidal anti-inflammatory drug; xenobiotic metabolite; xenobiotic |
aminopyrine | [no description available] | medium | 9 | 0 | pyrazolone; tertiary amino compound | antipyretic; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
methylaniline | [no description available] | medium | 1 | 0 | methylaniline; phenylalkylamine; secondary amine | |
deanol | [no description available] | medium | 1 | 0 | ethanolamines; tertiary amine | curing agent; radical scavenger |
ephedrine | [no description available] | high | 8 | 1 | phenethylamine alkaloid; phenylethanolamines | bacterial metabolite; environmental contaminant; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
ephedrine | [no description available] | high | 8 | 0 | phenethylamine alkaloid; phenylethanolamines | bacterial metabolite; environmental contaminant; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
ai 77b | [no description available] | medium | 1 | 0 | | |
1,7-dimethylxanthine | [no description available] | high | 94 | 0 | dimethylxanthine | central nervous system stimulant; human blood serum metabolite; human xenobiotic metabolite; mouse metabolite |
1,7-dimethylxanthine | [no description available] | high | 94 | 5 | dimethylxanthine | central nervous system stimulant; human blood serum metabolite; human xenobiotic metabolite; mouse metabolite |
7-methylxanthine | [no description available] | medium | 9 | 0 | oxopurine; purine alkaloid | human xenobiotic metabolite; mouse metabolite; plant metabolite |
3-methylxanthine | [no description available] | medium | 7 | 0 | 3-methylxanthine | metabolite |
1-methylxanthine | [no description available] | medium | 4 | 0 | 1-methylxanthine | mouse metabolite |
1-propylxanthine | [no description available] | medium | 1 | 0 | | |
1-isoamyl-3-isobutylxanthine | [no description available] | medium | 1 | 0 | | |
1,3-dipropylxanthine | [no description available] | medium | 1 | 0 | | |
psb 1115 | [no description available] | medium | 1 | 0 | oxopurine | |
purine | [no description available] | medium | 15 | 0 | purine | |
uric acid | [no description available] | high | 39 | 2 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
uric acid | [no description available] | high | 39 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
xanthine | [no description available] | medium | 20 | 0 | xanthine | Saccharomyces cerevisiae metabolite |
1,3-dimethyluric acid | [no description available] | medium | 3 | 0 | oxopurine | metabolite |
1,3,7,9-tetramethyluric acid | [no description available] | medium | 3 | 0 | oxopurine; purine alkaloid | analgesic; anti-inflammatory agent; human xenobiotic metabolite; plant metabolite |
6-methylpurine | [no description available] | medium | 1 | 0 | purines | EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor |
6-chloropurine | [no description available] | medium | 1 | 0 | purines | |
gamma-aminobutyric acid | [no description available] | medium | 7 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid | human metabolite; neurotransmitter; Saccharomyces cerevisiae metabolite; signalling molecule |
acetamide | [no description available] | medium | 1 | 0 | acetamides; carboximidic acid; monocarboxylic acid amide; N-acylammonia | |
quinacrine | [no description available] | medium | 1 | 0 | acridines; aromatic ether; organochlorine compound; tertiary amino compound | antimalarial; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor |
catechol | [no description available] | medium | 1 | 0 | catechols | allelochemical; genotoxin; plant metabolite |
taxifolin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-hydroxyflavanones; dihydroflavonols; pentahydroxyflavanone; secondary alpha-hydroxy ketone | |
phosphonoacetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; phosphonic acids | antiviral agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor |
3,4-dihydroxyphenylacetic acid | [no description available] | medium | 2 | 0 | catechols; dihydroxyphenylacetic acid | human metabolite |
aminocaproic acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; epsilon-amino acid; omega-amino fatty acid | antifibrinolytic drug; hematologic agent; metabolite |
diacetyl | [no description available] | medium | 1 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
hydroquinone | [no description available] | medium | 1 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
melatonin | [no description available] | medium | 2 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
n-acetylserotonin | [no description available] | medium | 1 | 0 | acetamides; N-acylserotonin; phenols | antioxidant; human metabolite; mouse metabolite; tropomyosin-related kinase B receptor agonist |
pyrazinamide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; N-acylammonia; pyrazines | antitubercular agent; prodrug |
quinolinic acid | [no description available] | high | 2 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
taurine | [no description available] | medium | 1 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
2-amino-5-phosphonovalerate | [no description available] | medium | 2 | 0 | non-proteinogenic alpha-amino acid | NMDA receptor antagonist |
alpha-methyl-4-carboxyphenylglycine | [no description available] | medium | 1 | 0 | | |
3-(2-carboxypiperazin-4-yl)propyl-1-phosphonic acid | [no description available] | medium | 1 | 0 | | |
1-hydroxy-3-amino-2-pyrrolidone | [no description available] | medium | 1 | 0 | | |
ibotenic acid | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | neurotoxin |
n(8)-bromoacetyl-n(1)-3'-(4-indolyloxy)-2'-hydroxypropyl-1,8-diamino-4-menthane | [no description available] | medium | 1 | 0 | | |
sk&f-38393 | [no description available] | medium | 3 | 0 | benzazepine; catechols; secondary amino compound | |
vanilmandelic acid | [no description available] | medium | 1 | 0 | 2-hydroxy monocarboxylic acid; aromatic ether; phenols | human metabolite |
1,10-diaminodecane | [no description available] | medium | 1 | 0 | | |
1,3-diethyl-8-phenylxanthine | [no description available] | medium | 1 | 0 | | |
1,3-dipropyl-8-cyclopentylxanthine | [no description available] | medium | 72 | 0 | oxopurine | adenosine A1 receptor antagonist; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
1,3-dipropyl-8-(4-sulfophenyl)xanthine | [no description available] | medium | 3 | 0 | | |
1,5-dihydroxyisoquinoline | [no description available] | medium | 1 | 0 | isoquinolinol | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor |
pk 11195 | [no description available] | medium | 1 | 0 | aromatic amide; isoquinolines; monocarboxylic acid amide; monochlorobenzenes | antineoplastic agent |
1-(2-trifluoromethylphenyl)imidazole | [no description available] | medium | 1 | 0 | imidazoles | |
1-aminobenzotriazole | [no description available] | medium | 1 | 0 | | |
1-methylimidazole | [no description available] | medium | 1 | 0 | imidazoles | |
edelfosine | [no description available] | medium | 1 | 0 | glycerophosphocholine | |
1h-(1,2,4)oxadiazolo(4,3-a)quinoxalin-1-one | [no description available] | medium | 1 | 0 | oxadiazoloquinoxaline | EC 4.6.1.2 (guanylate cyclase) inhibitor |
2,2'-dipyridyl | [no description available] | medium | 1 | 0 | bipyridine | chelator; ferroptosis inhibitor |
2-hydroxysaclofen | [no description available] | medium | 1 | 0 | organochlorine compound | |
3,4-dichloroisocoumarin | [no description available] | medium | 1 | 0 | isocoumarins; organochlorine compound | geroprotector; serine protease inhibitor |
phaclofen | [no description available] | medium | 1 | 0 | organophosphate oxoanion; zwitterion | |
3-aminobenzamide | [no description available] | medium | 3 | 0 | benzamides; substituted aniline | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor |
3-bromo-7-nitroindazole | [no description available] | medium | 1 | 0 | | |
3-nitropropionic acid | [no description available] | medium | 1 | 0 | C-nitro compound | antimycobacterial drug; EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor; mycotoxin; neurotoxin |
4-amino-1,8-naphthalimide | [no description available] | medium | 1 | 0 | benzoisoquinoline; dicarboximide | |
4-aminopyridine | [no description available] | medium | 1 | 0 | aminopyridine; aromatic amine | avicide; orphan drug; potassium channel blocker |
homovanillic acid | [no description available] | medium | 1 | 0 | guaiacols; monocarboxylic acid | human metabolite; mouse metabolite |
4-hydroxybenzoic acid hydrazide | [no description available] | medium | 1 | 0 | carbohydrazide; phenols | |
4-phenyl-3-furoxancarbonitrile | [no description available] | medium | 1 | 0 | 1,2,5-oxadiazole; benzenes; N-oxide; nitrile | geroprotector; nitric oxide donor; platelet aggregation inhibitor; soluble guanylate cyclase activator; vasodilator agent |
5,5-dimethyl-1-pyrroline-1-oxide | [no description available] | medium | 1 | 0 | 1-pyrroline nitrones | neuroprotective agent; spin trapping reagent |
phenytoin | [no description available] | medium | 5 | 0 | imidazolidine-2,4-dione | anticonvulsant; drug allergen; sodium channel blocker; teratogenic agent |
5,7-dichlorokynurenic acid | [no description available] | medium | 1 | 0 | quinolines | |
5-(n,n-hexamethylene)amiloride | [no description available] | medium | 1 | 0 | aromatic amine; azepanes; guanidines; monocarboxylic acid amide; organochlorine compound; pyrazines | antineoplastic agent; apoptosis inducer; odorant receptor antagonist; sodium channel blocker |
ethylisopropylamiloride | [no description available] | medium | 1 | 0 | aromatic amine; guanidines; monocarboxylic acid amide; organochlorine compound; pyrazines; tertiary amino compound | anti-arrhythmia drug; neuroprotective agent; sodium channel blocker |
5-fluoroindole-2-carboxylic acid | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
hydroxyindoleacetic acid | [no description available] | high | 3 | 0 | indole-3-acetic acids | drug metabolite; human metabolite; mouse metabolite |
phenanthridone | [no description available] | medium | 1 | 0 | lactam; phenanthridines | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; immunosuppressive agent; mutagen |
6-chloromelatonin | [no description available] | medium | 1 | 0 | acetamides | |
6-hydroxymelatonin | [no description available] | medium | 1 | 0 | acetamides; tryptamines | metabolite; mouse metabolite |
6-methoxytryptoline | [no description available] | medium | 1 | 0 | | |
6-nitroso-1,2-benzopyrone | [no description available] | medium | 1 | 0 | | |
7-chlorokynurenic acid | [no description available] | medium | 1 | 0 | organochlorine compound; quinolinemonocarboxylic acid | neuroprotective agent; NMDA receptor antagonist |
7-nitroindazole | [no description available] | medium | 1 | 0 | | |
8-(4-sulfophenyl)theophylline | [no description available] | medium | 8 | 0 | | |
8-cyclopentyl-1,3-dimethylxanthine | [no description available] | medium | 19 | 0 | oxopurine | |
8-phenyltheophylline | [no description available] | medium | 8 | 0 | | |
acetazolamide | [no description available] | medium | 7 | 0 | monocarboxylic acid amide; sulfonamide; thiadiazoles | anticonvulsant; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
acetohexamide | [no description available] | medium | 1 | 0 | acetophenones; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
ag 127 | [no description available] | medium | 1 | 0 | nitrophenol | |
rtki cpd | [no description available] | medium | 1 | 0 | aromatic ether; monochlorobenzenes; quinazolines | antineoplastic agent; antiviral agent; epidermal growth factor receptor antagonist; geroprotector |
tyrphostin a23 | [no description available] | medium | 1 | 0 | catechols | |
tyrphostin 25 | [no description available] | medium | 1 | 0 | benzenetriol | |
tyrphostin a1 | [no description available] | medium | 1 | 0 | methoxybenzenes | geroprotector |
1-aminoindan-1,5-dicarboxylic acid | [no description available] | medium | 1 | 0 | | |
albuterol | [no description available] | medium | 1 | 0 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
alpha-methyltyrosine methyl ester | [no description available] | medium | 1 | 0 | | |
altretamine | [no description available] | medium | 1 | 0 | triamino-1,3,5-triazine | |
amfonelic acid | [no description available] | medium | 1 | 0 | | |
amifostine anhydrous | [no description available] | medium | 1 | 0 | diamine; organic thiophosphate | antioxidant; prodrug; radiation protective agent |
amoxapine | [no description available] | medium | 1 | 0 | dibenzooxazepine | adrenergic uptake inhibitor; antidepressant; dopaminergic antagonist; geroprotector; serotonin uptake inhibitor |
aniracetam | [no description available] | medium | 1 | 0 | N-acylpyrrolidine; pyrrolidin-2-ones | |
2-amino-4-phosphonobutyric acid | [no description available] | medium | 1 | 0 | | |
aspirin | [no description available] | medium | 28 | 0 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
aspirin | [no description available] | medium | 28 | 7 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
atenolol | [no description available] | medium | 1 | 0 | ethanolamines; monocarboxylic acid amide; propanolamine | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; sympatholytic agent; xenobiotic |
alpha-amino-3-hydroxy-5-tert-butyl-4-isoxazolepropionate | [no description available] | medium | 1 | 0 | alpha-amino acid | |
aurintricarboxylic acid | [no description available] | medium | 1 | 0 | monohydroxybenzoic acid; quinomethanes; tricarboxylic acid | fluorochrome; histological dye; insulin-like growth factor receptor 1 antagonist |
azathioprine | [no description available] | medium | 1 | 0 | aryl sulfide; C-nitro compound; imidazoles; thiopurine | antimetabolite; antineoplastic agent; carcinogenic agent; DNA synthesis inhibitor; hepatotoxic agent; immunosuppressive agent; prodrug |
azelaic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | antibacterial agent; antineoplastic agent; dermatologic drug; plant metabolite |
baclofen | [no description available] | medium | 2 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid; monochlorobenzenes; primary amino compound | central nervous system depressant; GABA agonist; muscle relaxant |
bay-k-8644 | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; dihydropyridine; methyl ester | |
benzamide | [no description available] | medium | 2 | 0 | benzamides | |
bepridil | [no description available] | medium | 1 | 0 | pyrrolidines; tertiary amine | anti-arrhythmia drug; antihypertensive agent; calcium channel blocker; vasodilator agent |
bml 190 | [no description available] | medium | 1 | 0 | N-acylindole | |
brimonidine | [no description available] | medium | 1 | 0 | imidazoles; quinoxaline derivative; secondary amine | adrenergic agonist; alpha-adrenergic agonist; antihypertensive agent |
bumetanide | [no description available] | medium | 1 | 0 | amino acid; benzoic acids; sulfonamide | diuretic; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor |
carbamazepine | [no description available] | medium | 4 | 0 | dibenzoazepine; ureas | analgesic; anticonvulsant; antimanic drug; drug allergen; EC 3.5.1.98 (histone deacetylase) inhibitor; environmental contaminant; glutamate transporter activator; mitogen; non-narcotic analgesic; sodium channel blocker; xenobiotic |
carbetapentane | [no description available] | medium | 2 | 0 | benzenes | |
carisoprodol | [no description available] | medium | 1 | 0 | carbamate ester | muscle relaxant |
carmustine | [no description available] | medium | 1 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
cgs 12066 | [no description available] | medium | 1 | 0 | N-arylpiperazine; organofluorine compound; pyrroloquinoxaline | serotonergic agonist |
cgs 15943 | [no description available] | medium | 4 | 0 | aromatic amine; biaryl; furans; organochlorine compound; primary amino compound; quinazolines; triazoloquinazoline | adenosine A1 receptor antagonist; adenosine A2A receptor antagonist; antineoplastic agent; central nervous system stimulant |
chlorambucil | [no description available] | medium | 2 | 0 | aromatic amine; monocarboxylic acid; nitrogen mustard; organochlorine compound; tertiary amino compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
chlormezanone | [no description available] | medium | 1 | 0 | 1,3-thiazine; lactam; monochlorobenzenes; sulfone | antipsychotic agent; anxiolytic drug; muscle relaxant |
chlorothiazide | [no description available] | medium | 4 | 0 | benzothiadiazine | antihypertensive agent; diuretic |
chlorpropamide | [no description available] | medium | 3 | 0 | monochlorobenzenes; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
chlorzoxazone | [no description available] | medium | 1 | 0 | 1,3-benzoxazoles; heteroaryl hydroxy compound; organochlorine compound | muscle relaxant; sedative |
cilostamide | [no description available] | medium | 1 | 0 | quinolines | |
cilostazol | [no description available] | medium | 1 | 0 | lactam; tetrazoles | anticoagulant; bronchodilator agent; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; fibrin modulating drug; neuroprotective agent; platelet aggregation inhibitor; vasodilator agent |
cimetidine | [no description available] | medium | 5 | 0 | aliphatic sulfide; guanidines; imidazoles; nitrile | adjuvant; analgesic; anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
cimetidine | [no description available] | medium | 5 | 1 | aliphatic sulfide; guanidines; imidazoles; nitrile | adjuvant; analgesic; anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
cinoxacin | [no description available] | medium | 1 | 0 | cinnolines; oxacycle; oxo carboxylic acid | antibacterial drug; antiinfective agent |
ciprofibrate | [no description available] | medium | 1 | 0 | cyclopropanes; monocarboxylic acid; organochlorine compound | antilipemic drug |
clofibrate | [no description available] | medium | 1 | 0 | aromatic ether; ethyl ester; monochlorobenzenes | anticholesteremic drug; antilipemic drug; geroprotector; PPARalpha agonist |
clotrimazole | [no description available] | medium | 2 | 0 | conazole antifungal drug; imidazole antifungal drug; imidazoles; monochlorobenzenes | antiinfective agent; environmental contaminant; xenobiotic |
cx546 | [no description available] | medium | 1 | 0 | | |
cyclothiazide | [no description available] | medium | 1 | 0 | benzothiadiazine | antihypertensive agent; diuretic |
dephostatin | [no description available] | medium | 1 | 0 | | |
nonivamide | [no description available] | medium | 1 | 0 | capsaicinoid; phenols | lachrymator |
r 59022 | [no description available] | medium | 1 | 0 | diarylmethane | |
diazoxide | [no description available] | medium | 1 | 0 | benzothiadiazine; organochlorine compound; sulfone | antihypertensive agent; beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; diuretic; K-ATP channel agonist; sodium channel blocker; sympathomimetic agent; vasodilator agent |
pentetic acid | [no description available] | medium | 1 | 0 | pentacarboxylic acid | copper chelator |
diphenyleneiodonium | [no description available] | medium | 1 | 0 | organic cation | |
dipyridamole | [no description available] | high | 22 | 7 | piperidines; pyrimidopyrimidine; tertiary amino compound; tetrol | adenosine phosphodiesterase inhibitor; EC 3.5.4.4 (adenosine deaminase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
dipyridamole | [no description available] | high | 22 | 0 | piperidines; pyrimidopyrimidine; tertiary amino compound; tetrol | adenosine phosphodiesterase inhibitor; EC 3.5.4.4 (adenosine deaminase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
disopyramide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; pyridines; tertiary amino compound | anti-arrhythmia drug |
disulfiram | [no description available] | medium | 1 | 0 | organic disulfide; organosulfur acaricide | angiogenesis inhibitor; antineoplastic agent; apoptosis inducer; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; EC 3.1.1.1 (carboxylesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; ferroptosis inducer; fungicide; NF-kappaB inhibitor |
2-amino-7-phosphonoheptanoic acid | [no description available] | medium | 1 | 0 | | |
thiorphan | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
2,3-dimethoxy-1,4-naphthoquinone | [no description available] | medium | 1 | 0 | 1,4-naphthoquinones | |
domperidone | [no description available] | medium | 1 | 0 | benzimidazoles; heteroarylpiperidine | antiemetic; dopaminergic antagonist |
droperidol | [no description available] | medium | 1 | 0 | aromatic ketone; benzimidazoles; organofluorine compound | anaesthesia adjuvant; antiemetic; dopaminergic antagonist; first generation antipsychotic |
ebselen | [no description available] | medium | 1 | 0 | benzoselenazole | anti-inflammatory drug; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; EC 3.1.3.25 (inositol-phosphate phosphatase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 3.5.4.1 (cytosine deaminase) inhibitor; EC 5.1.3.2 (UDP-glucose 4-epimerase) inhibitor; enzyme mimic; ferroptosis inhibitor; genotoxin; hepatoprotective agent; neuroprotective agent; radical scavenger |
ellipticine | [no description available] | medium | 2 | 0 | indole alkaloid; organic heterotetracyclic compound; organonitrogen heterocyclic compound; polycyclic heteroarene | antineoplastic agent; plant metabolite |
emodin | [no description available] | medium | 2 | 0 | trihydroxyanthraquinone | antineoplastic agent; laxative; plant metabolite; tyrosine kinase inhibitor |
ethosuximide | [no description available] | medium | 1 | 0 | dicarboximide; pyrrolidinone | anticonvulsant; geroprotector; T-type calcium channel blocker |
etodolac | [no description available] | medium | 1 | 0 | monocarboxylic acid; organic heterotricyclic compound | antipyretic; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
felbamate | [no description available] | medium | 1 | 0 | carbamate ester | anticonvulsant; neuroprotective agent |
felodipine | [no description available] | medium | 1 | 0 | dichlorobenzene; dihydropyridine; ethyl ester; methyl ester | anti-arrhythmia drug; antihypertensive agent; calcium channel blocker; vasodilator agent |
fenofibrate | [no description available] | medium | 1 | 0 | aromatic ether; chlorobenzophenone; isopropyl ester; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
flumazenil | [no description available] | medium | 2 | 0 | ethyl ester; imidazobenzodiazepine; organofluorine compound | antidote to benzodiazepine poisoning; GABA antagonist |
fluorouracil | [no description available] | medium | 2 | 0 | nucleobase analogue; organofluorine compound | antimetabolite; antineoplastic agent; environmental contaminant; immunosuppressive agent; radiosensitizing agent; xenobiotic |
fluspirilene | [no description available] | medium | 1 | 0 | diarylmethane | |
flutamide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; monocarboxylic acid amide | androgen antagonist; antineoplastic agent |
formoterol fumarate | [no description available] | medium | 1 | 0 | formamides; phenols; phenylethanolamines; secondary alcohol; secondary amino compound | |
fpl 64176 | [no description available] | medium | 1 | 0 | carboxylic ester; pyrroles | calcium channel agonist |
furafylline | [no description available] | medium | 2 | 0 | oxopurine | |
furosemide | [no description available] | medium | 3 | 0 | chlorobenzoic acid; furans; sulfonamide | environmental contaminant; loop diuretic; xenobiotic |
fusaric acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; pyridines | |
gabapentin | [no description available] | medium | 1 | 0 | gamma-amino acid | anticonvulsant; calcium channel blocker; environmental contaminant; xenobiotic |
4-amino-5-hexynoic acid | [no description available] | medium | 1 | 0 | | |
glipizide | [no description available] | medium | 1 | 0 | aromatic amide; monocarboxylic acid amide; N-sulfonylurea; pyrazines | EC 2.7.1.33 (pantothenate kinase) inhibitor; hypoglycemic agent; insulin secretagogue |
glyburide | [no description available] | medium | 6 | 0 | monochlorobenzenes; N-sulfonylurea | anti-arrhythmia drug; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor; hypoglycemic agent |
1-(5-isoquinolinesulfonyl)piperazine | [no description available] | medium | 1 | 0 | isoquinolines | |
haloperidol | [no description available] | medium | 5 | 0 | aromatic ketone; hydroxypiperidine; monochlorobenzenes; organofluorine compound; tertiary alcohol | antidyskinesia agent; antiemetic; dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
hemicholinium 3 | [no description available] | medium | 1 | 0 | morpholines | |
4-fluorohexahydrosiladifenidol | [no description available] | medium | 1 | 0 | | |
hydrochlorothiazide | [no description available] | medium | 4 | 0 | benzothiadiazine; organochlorine compound; sulfonamide | antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
hydroxyurea | [no description available] | medium | 3 | 0 | one-carbon compound; ureas | antimetabolite; antimitotic; antineoplastic agent; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; genotoxin; immunomodulator; radical scavenger; teratogenic agent |
ibudilast | [no description available] | medium | 1 | 0 | pyrazolopyridine | |
ibuprofen | [no description available] | medium | 1 | 0 | monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; radical scavenger; xenobiotic |
ic 261 | [no description available] | medium | 1 | 0 | indoles | |
ifenprodil | [no description available] | medium | 1 | 0 | piperidines | |
indirubin-3'-monoxime | [no description available] | medium | 1 | 0 | | |
iodoacetamide | [no description available] | medium | 1 | 0 | | |
4-piperidinecarboxylic acid | [no description available] | medium | 1 | 0 | | |
4-(4'-hydroxyphenyl)-amino-6,7-dimethoxyquinazoline | [no description available] | medium | 1 | 0 | | |
jl 18 | [no description available] | medium | 1 | 0 | | |
nsc 664704 | [no description available] | medium | 2 | 0 | indolobenzazepine; lactam; organobromine compound | cardioprotective agent; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor; EC 2.7.11.26 (tau-protein kinase) inhibitor; geroprotector |
ketoconazole | [no description available] | medium | 2 | 0 | dichlorobenzene; dioxolane; ether; imidazoles; N-acylpiperazine; N-arylpiperazine | |
ketoprofen | [no description available] | medium | 2 | 0 | benzophenones; oxo monocarboxylic acid | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
kynurenic acid | [no description available] | medium | 1 | 0 | monohydroxyquinoline; quinolinemonocarboxylic acid | G-protein-coupled receptor agonist; human metabolite; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist; Saccharomyces cerevisiae metabolite |
2-amino-3-phosphonopropionic acid | [no description available] | medium | 1 | 0 | alanine derivative; non-proteinogenic alpha-amino acid; phosphonic acids | human metabolite; metabotropic glutamate receptor antagonist |
lamotrigine | [no description available] | medium | 1 | 0 | 1,2,4-triazines; dichlorobenzene; primary arylamine | anticonvulsant; antidepressant; antimanic drug; calcium channel blocker; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; excitatory amino acid antagonist; geroprotector; non-narcotic analgesic; xenobiotic |
lansoprazole | [no description available] | medium | 1 | 0 | benzimidazoles; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor |
beta-lapachone | [no description available] | medium | 2 | 0 | benzochromenone; orthoquinones | anti-inflammatory agent; antineoplastic agent; plant metabolite |
leflunomide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; isoxazoles; monocarboxylic acid amide | antineoplastic agent; antiparasitic agent; EC 1.3.98.1 [dihydroorotate oxidase (fumarate)] inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; hepatotoxic agent; immunosuppressive agent; non-steroidal anti-inflammatory drug; prodrug; pyrimidine synthesis inhibitor; tyrosine kinase inhibitor |
linopirdine | [no description available] | medium | 1 | 0 | indoles | |
loratadine | [no description available] | medium | 1 | 0 | benzocycloheptapyridine; ethyl ester; N-acylpiperidine; organochlorine compound; tertiary carboxamide | anti-allergic agent; cholinergic antagonist; geroprotector; H1-receptor antagonist |
loxoprofen | [no description available] | medium | 1 | 0 | cyclopentanones; monocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
2-(4-morpholinyl)-8-phenyl-4h-1-benzopyran-4-one | [no description available] | medium | 1 | 0 | chromones; morpholines; organochlorine compound | autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector |
meclofenamate sodium anhydrous | [no description available] | medium | 1 | 0 | organic sodium salt | |
methiothepin | [no description available] | medium | 1 | 0 | aryl sulfide; dibenzothiepine; N-alkylpiperazine; tertiary amino compound | antipsychotic agent; dopaminergic antagonist; geroprotector; serotonergic antagonist |
methoctramine | [no description available] | medium | 1 | 0 | aromatic ether; tetramine | muscarinic antagonist |
nocodazole | [no description available] | medium | 1 | 0 | aromatic ketone; benzimidazoles; carbamate ester; thiophenes | antimitotic; antineoplastic agent; microtubule-destabilising agent; tubulin modulator |
3-Hydroxy-alpha-methyl-DL-tyrosine | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | |
metolazone | [no description available] | medium | 1 | 0 | organochlorine compound; quinazolines; sulfonamide | antihypertensive agent; diuretic; ion transport inhibitor |
milrinone | [no description available] | medium | 1 | 0 | bipyridines; nitrile; pyridone | cardiotonic drug; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
minoxidil | [no description available] | medium | 2 | 0 | dialkylarylamine; tertiary amino compound | |
mitotane | [no description available] | medium | 1 | 0 | diarylmethane | |
mitoxantrone | [no description available] | medium | 1 | 0 | dihydroxyanthraquinone | analgesic; antineoplastic agent |
ml 7 | [no description available] | medium | 1 | 0 | N-sulfonyldiazepane; organoiodine compound | EC 2.7.11.18 (myosin-light-chain kinase) inhibitor |
n-(4-aminobutyl)-5-chloro-2-naphthalenesulfonamide | [no description available] | medium | 1 | 0 | naphthalenes; organochlorine compound; primary amino compound; sulfonamide | |
n-bromoacetamide | [no description available] | medium | 1 | 0 | | |
ethylmaleimide | [no description available] | medium | 1 | 0 | maleimides | anticoronaviral agent; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.1.1 (hexokinase) inhibitor |
fg 7142 | [no description available] | medium | 1 | 0 | beta-carbolines | |
fenamic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; secondary amino compound | membrane transport modulator |
n 0840 | [no description available] | medium | 1 | 0 | | |
nialamide | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
niclosamide | [no description available] | medium | 1 | 0 | benzamides; C-nitro compound; monochlorobenzenes; salicylanilides; secondary carboxamide | anthelminthic drug; anticoronaviral agent; antiparasitic agent; apoptosis inducer; molluscicide; piscicide; STAT3 inhibitor |
nifedipine | [no description available] | high | 3 | 0 | C-nitro compound; dihydropyridine; methyl ester | calcium channel blocker; human metabolite; tocolytic agent; vasodilator agent |
niflumic acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; pyridines | |
nilutamide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; imidazolidinone | androgen antagonist; antineoplastic agent |
nimesulide | [no description available] | medium | 1 | 0 | aromatic ether; C-nitro compound; sulfonamide | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
nimodipine | [no description available] | high | 2 | 0 | 2-methoxyethyl ester; C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; isopropyl ester | antihypertensive agent; calcium channel blocker; cardiovascular drug; vasodilator agent |
nipecotic acid | [no description available] | medium | 1 | 0 | beta-amino acid; piperidinemonocarboxylic acid | |
nitrendipine | [no description available] | medium | 1 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; ethyl ester; methyl ester | antihypertensive agent; calcium channel blocker; geroprotector; vasodilator agent |
masoprocol | [no description available] | medium | 1 | 0 | catechols; lignan; tetrol | antioxidant; ferroptosis inhibitor; geroprotector; plant metabolite |
5-nitro-2-(3-phenylpropylamino)benzoic acid | [no description available] | medium | 1 | 0 | nitrobenzoic acid | |
ns 2028 | [no description available] | medium | 1 | 0 | | |
ns 1619 | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; benzimidazoles; phenols | potassium channel opener |
o(6)-benzylguanine | [no description available] | medium | 1 | 0 | | |
ofloxacin | [no description available] | medium | 1 | 0 | 3-oxo monocarboxylic acid; N-arylpiperazine; N-methylpiperazine; organofluorine compound; oxazinoquinoline | |
olomoucine | [no description available] | medium | 1 | 0 | 2,6-diaminopurines; ethanolamines | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
oxaprozin | [no description available] | medium | 1 | 0 | 1,3-oxazoles; monocarboxylic acid | analgesic; non-steroidal anti-inflammatory drug |
oxatomide | [no description available] | medium | 1 | 0 | benzimidazoles; diarylmethane; N-alkylpiperazine | anti-allergic agent; anti-inflammatory agent; geroprotector; H1-receptor antagonist; serotonergic antagonist |
oxiracetam | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
oxolinic acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; organic heterotricyclic compound; oxacycle; quinolinemonocarboxylic acid; quinolone antibiotic | antibacterial drug; antifungal agent; antiinfective agent; antimicrobial agent; enzyme inhibitor |
quinone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones | cofactor; human xenobiotic metabolite; mouse metabolite |
fenclonine | [no description available] | medium | 1 | 0 | phenylalanine derivative | |
palmidrol | [no description available] | medium | 1 | 0 | endocannabinoid; N-(long-chain-acyl)ethanolamine; N-(saturated fatty acyl)ethanolamine | anti-inflammatory drug; anticonvulsant; antihypertensive agent; neuroprotective agent |
pd 98059 | [no description available] | medium | 1 | 0 | aromatic amine; monomethoxyflavone | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; geroprotector |
pentamidine | [no description available] | medium | 1 | 0 | aromatic ether; carboxamidine; diether | anti-inflammatory agent; antifungal agent; calmodulin antagonist; chemokine receptor 5 antagonist; EC 2.3.1.48 (histone acetyltransferase) inhibitor; NMDA receptor antagonist; S100 calcium-binding protein B inhibitor; trypanocidal drug; xenobiotic |
pentoxifylline | [no description available] | medium | 609 | 0 | oxopurine | |
pentoxifylline | [no description available] | medium | 609 | 99 | oxopurine | |
perphenazine | [no description available] | medium | 1 | 0 | N-(2-hydroxyethyl)piperazine; N-alkylpiperazine; organochlorine compound; phenothiazines | antiemetic; dopaminergic antagonist; phenothiazine antipsychotic drug |
phenyl biguanide | [no description available] | medium | 1 | 0 | guanidines | central nervous system drug |
phenylbutazone | [no description available] | medium | 4 | 0 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
phloretin | [no description available] | medium | 2 | 0 | dihydrochalcones | antineoplastic agent; plant metabolite |
picotamide | [no description available] | medium | 1 | 0 | benzamides | |
pinacidil | [no description available] | medium | 1 | 0 | pyridines | |
pindolol | [no description available] | medium | 1 | 0 | indoles; secondary amine | antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; serotonergic antagonist; vasodilator agent |
piperidine-4-sulfonic acid | [no description available] | medium | 1 | 0 | | |
piracetam | [no description available] | medium | 5 | 0 | organonitrogen compound; organooxygen compound | |
piracetam | [no description available] | medium | 5 | 2 | organonitrogen compound; organooxygen compound | |
pirenperone | [no description available] | medium | 1 | 0 | aromatic ketone | |
praziquantel | [no description available] | medium | 1 | 0 | isoquinolines | |
primidone | [no description available] | medium | 3 | 0 | pyrimidone | anticonvulsant; environmental contaminant; xenobiotic |
proglumide | [no description available] | medium | 1 | 0 | benzamides; dicarboxylic acid monoamide; glutamine derivative; racemate | anti-ulcer drug; cholecystokinin antagonist; cholinergic antagonist; delta-opioid receptor agonist; drug metabolite; gastrointestinal drug; opioid analgesic; xenobiotic metabolite |
propentofylline | [no description available] | medium | 16 | 0 | oxopurine | |
propofol | [no description available] | medium | 2 | 0 | phenols | anticonvulsant; antiemetic; intravenous anaesthetic; radical scavenger; sedative |
pf 5901 | [no description available] | medium | 1 | 0 | quinolines | |
riluzole | [no description available] | medium | 1 | 0 | benzothiazoles | |
risperidone | [no description available] | medium | 2 | 0 | 1,2-benzoxazoles; heteroarylpiperidine; organofluorine compound; pyridopyrimidine | alpha-adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; psychotropic drug; second generation antipsychotic; serotonergic antagonist |
ritanserin | [no description available] | medium | 1 | 0 | organofluorine compound; piperidines; thiazolopyrimidine | antidepressant; antipsychotic agent; anxiolytic drug; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; serotonergic antagonist |
4-(3-butoxy-4-methoxybenzyl)-2-imidazolidinone | [no description available] | medium | 3 | 0 | methoxybenzenes | |
rolipram | [no description available] | medium | 1 | 0 | pyrrolidin-2-ones | antidepressant; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
salmeterol xinafoate | [no description available] | medium | 1 | 0 | ether; phenols; primary alcohol; secondary alcohol; secondary amino compound | |
sb 202190 | [no description available] | medium | 1 | 0 | imidazoles; organofluorine compound; phenols; pyridines | apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor |
sobuzoxane | [no description available] | medium | 1 | 0 | organic molecular entity | |
spiroxatrine | [no description available] | medium | 1 | 0 | imidazolidines | |
sq 22536 | [no description available] | medium | 1 | 0 | nucleoside analogue; oxolanes | EC 4.6.1.1 (adenylate cyclase) inhibitor |
sulfaphenazole | [no description available] | medium | 1 | 0 | primary amino compound; pyrazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial drug; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 1.14.13.67 (quinine 3-monooxygenase) inhibitor; P450 inhibitor |
sulpiride | [no description available] | medium | 1 | 0 | benzamides; N-alkylpyrrolidine; sulfonamide | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
t0156 | [no description available] | medium | 1 | 0 | naphthyridine derivative | |
1,4-bis(2-(3,5-dichloropyridyloxy))benzene | [no description available] | medium | 1 | 0 | | |
terfenadine | [no description available] | medium | 1 | 0 | diarylmethane | |
tetraisopropylpyrophosphamide | [no description available] | medium | 1 | 0 | phosphoramide | |
thalidomide | [no description available] | medium | 1 | 0 | phthalimides; piperidones | |
8-(n,n-diethylamino)octyl-3,4,5-trimethoxybenzoate | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | |
tolazamide | [no description available] | medium | 1 | 0 | N-sulfonylurea | hypoglycemic agent; potassium channel blocker |
tolbutamide | [no description available] | medium | 1 | 0 | N-sulfonylurea | human metabolite; hypoglycemic agent; insulin secretagogue; potassium channel blocker |
(1,2,5,6-tetrahydropyridin-4-yl)methylphosphinic acid | [no description available] | medium | 1 | 0 | | |
ici 136,753 | [no description available] | medium | 1 | 0 | pyrazolopyridine | |
triamterene | [no description available] | medium | 1 | 0 | pteridines | diuretic; sodium channel blocker |
trimethoprim | [no description available] | medium | 1 | 0 | aminopyrimidine; methoxybenzenes | antibacterial drug; diuretic; drug allergen; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; environmental contaminant; xenobiotic |
tropicamide | [no description available] | medium | 1 | 0 | acetamides | |
tyrphostin a9 | [no description available] | medium | 1 | 0 | alkylbenzene | geroprotector |
vigabatrin | [no description available] | medium | 1 | 0 | gamma-amino acid | anticonvulsant; EC 2.6.1.19 (4-aminobutyrate--2-oxoglutarate transaminase) inhibitor |
8-(4-((2-aminoethyl)aminocarbonylmethyloxy)phenyl)-1,3-dipropylxanthine | [no description available] | medium | 5 | 0 | | |
3-(5'-hydroxymethyl-2'-furyl)-1-benzylindazole | [no description available] | medium | 1 | 0 | aromatic primary alcohol; furans; indazoles | antineoplastic agent; apoptosis inducer; platelet aggregation inhibitor; soluble guanylate cyclase activator; vasodilator agent |
zardaverine | [no description available] | medium | 1 | 0 | organofluorine compound; pyridazinone | anti-asthmatic drug; bronchodilator agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; peripheral nervous system drug |
cortisone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
corticosterone | [no description available] | high | 4 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
reserpine | [no description available] | high | 9 | 0 | alkaloid ester; methyl ester; yohimban alkaloid | adrenergic uptake inhibitor; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; first generation antipsychotic; plant metabolite; xenobiotic |
procaine hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
isoproterenol hydrochloride | [no description available] | medium | 1 | 0 | catechols | |
histamine dihydrochloride | [no description available] | medium | 1 | 0 | | |
carbachol | [no description available] | medium | 3 | 0 | ammonium salt; carbamate ester | cardiotonic drug; miotic; muscarinic agonist; nicotinic acetylcholine receptor agonist; non-narcotic analgesic |
spironolactone | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; oxaspiro compound; steroid lactone; thioester | aldosterone antagonist; antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
estrone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-hydroxy steroid; phenolic steroid; phenols | antineoplastic agent; bone density conservation agent; estrogen; human metabolite; mouse metabolite |
androsterone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid; C19-steroid | androgen; anticonvulsant; human blood serum metabolite; human metabolite; human urinary metabolite; mouse metabolite; pheromone |
promazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
pilocarpine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
dimethylphenylpiperazinium iodide | [no description available] | medium | 1 | 0 | N-arylpiperazine; organic iodide salt; piperazinium salt; quaternary ammonium salt | nicotinic acetylcholine receptor agonist |
pentylenetetrazole | [no description available] | medium | 2 | 0 | organic heterobicyclic compound; organonitrogen heterocyclic compound | |
racepinephrine hydrochloride | [no description available] | medium | 1 | 0 | | |
(4-(m-chlorophenylcarbamoyloxy)-2-butynyl)trimethylammonium chloride | [no description available] | medium | 1 | 0 | | |
hexamethonium bromide | [no description available] | medium | 1 | 0 | | |
cystamine dihydrochloride | [no description available] | medium | 1 | 0 | | |
cantharidin | [no description available] | medium | 2 | 0 | cyclic dicarboxylic anhydride; monoterpenoid | EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; herbicide |
tetraethylammonium chloride | [no description available] | medium | 1 | 0 | organic chloride salt; quaternary ammonium salt | potassium channel blocker |
aspartic acid | [no description available] | high | 2 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
glutamine | [no description available] | medium | 1 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
vincristine | [no description available] | medium | 1 | 0 | acetate ester; formamides; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; tertiary alcohol; tertiary amino compound; vinca alkaloid | antineoplastic agent; drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
physostigmine | [no description available] | medium | 2 | 0 | carbamate ester; indole alkaloid | antidote to curare poisoning; EC 3.1.1.8 (cholinesterase) inhibitor; miotic |
apomorphine | [no description available] | medium | 2 | 0 | aporphine alkaloid | alpha-adrenergic drug; antidyskinesia agent; antiparkinson drug; dopamine agonist; emetic; serotonergic drug |
promethazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; geroprotector; H1-receptor antagonist; local anaesthetic; sedative |
bromodeoxyuridine | [no description available] | medium | 1 | 0 | pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent |
levodopa | [no description available] | high | 2 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
methoxamine hydrochloride | [no description available] | medium | 1 | 0 | dimethoxybenzene | |
papaverine hydrochloride | [no description available] | medium | 2 | 0 | | |
bretylium tosylate | [no description available] | medium | 2 | 0 | organosulfonate salt; quaternary ammonium salt | adrenergic antagonist; anti-arrhythmia drug; antihypertensive agent |
berlition | [no description available] | medium | 1 | 0 | dithiolanes; heterocyclic fatty acid; lipoic acid; thia fatty acid | cofactor; nutraceutical; prosthetic group |
methacholine chloride | [no description available] | medium | 2 | 0 | quaternary ammonium salt | |
androstenedione | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
colchicine | [no description available] | medium | 7 | 0 | alkaloid; colchicine | anti-inflammatory agent; gout suppressant; mutagen |
yohimbine hydrochloride | [no description available] | medium | 2 | 0 | | |
gallamine triethiodide | [no description available] | medium | 1 | 0 | | |
cycloheximide | [no description available] | medium | 3 | 0 | antibiotic fungicide; cyclic ketone; dicarboximide; piperidine antibiotic; piperidones; secondary alcohol | anticoronaviral agent; bacterial metabolite; ferroptosis inhibitor; neuroprotective agent; protein synthesis inhibitor |
egtazic acid | [no description available] | medium | 1 | 0 | diether; tertiary amino compound; tetracarboxylic acid | chelator |
cycloserine | [no description available] | medium | 1 | 0 | 4-amino-1,2-oxazolidin-3-one; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic; zwitterion | antiinfective agent; antimetabolite; antitubercular agent; metabolite; NMDA receptor agonist |
17-alpha-hydroxyprogesterone | [no description available] | medium | 1 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
quinacrine monohydrochloride | [no description available] | medium | 1 | 0 | | |
chlorpromazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride; phenothiazines | anticoronaviral agent; phenothiazine antipsychotic drug |
cytarabine hydrochloride | [no description available] | medium | 1 | 0 | | |
tryptophan | [no description available] | high | 4 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
lidocaine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug; local anaesthetic |
arginine | [no description available] | high | 4 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
rotenone | [no description available] | medium | 2 | 0 | organic heteropentacyclic compound; rotenones | antineoplastic agent; metabolite; mitochondrial NADH:ubiquinone reductase inhibitor; phytogenic insecticide; piscicide; toxin |
synephrine | [no description available] | medium | 1 | 0 | ethanolamines; phenethylamine alkaloid; phenols | alpha-adrenergic agonist; plant metabolite |
pyridostigmine bromide | [no description available] | medium | 1 | 0 | pyridinium salt | |
imipramine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant |
neostigmine bromide | [no description available] | medium | 1 | 0 | bromide salt | |
edrophonium chloride | [no description available] | medium | 1 | 0 | chloride salt; quaternary ammonium salt | antidote; diagnostic agent; EC 3.1.1.8 (cholinesterase) inhibitor |
suramin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
pyrazolanthrone | [no description available] | medium | 1 | 0 | anthrapyrazole; aromatic ketone; cyclic ketone | antineoplastic agent; c-Jun N-terminal kinase inhibitor; geroprotector |
methapyrilene hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-allergic agent; carcinogenic agent; H1-receptor antagonist; sedative |
tetrracaine hydrochloride | [no description available] | medium | 1 | 0 | benzoate ester | |
chelidamic acid | [no description available] | medium | 1 | 0 | | |
2-chloroadenosine | [no description available] | medium | 7 | 0 | purine nucleoside | |
diphenhydramine hydrochloride | [no description available] | medium | 5 | 0 | hydrochloride; organoammonium salt | anti-allergic agent; antiemetic; antiparkinson drug; antipruritic drug; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; sedative |
diphenhydramine hydrochloride | [no description available] | medium | 5 | 1 | hydrochloride; organoammonium salt | anti-allergic agent; antiemetic; antiparkinson drug; antipruritic drug; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; sedative |
cysteamine hydrochloride | [no description available] | medium | 1 | 0 | | |
propantheline bromide | [no description available] | medium | 1 | 0 | xanthenes | |
hydralazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antihypertensive agent; vasodilator agent |
ethamivan | [no description available] | medium | 2 | 0 | methoxybenzenes; phenols | |
ethamivan | [no description available] | medium | 2 | 1 | methoxybenzenes; phenols | |
pargyline hydrochloride | [no description available] | medium | 1 | 0 | | |
aminophylline | [no description available] | high | 25 | 1 | mixture | bronchodilator agent; cardiotonic drug |
aminophylline | [no description available] | high | 25 | 0 | mixture | bronchodilator agent; cardiotonic drug |
azacitidine | [no description available] | medium | 1 | 0 | N-glycosyl-1,3,5-triazine; nucleoside analogue | antineoplastic agent |
orphenadrine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antiparkinson drug; H1-receptor antagonist; muscarinic antagonist; muscle relaxant; NMDA receptor antagonist; parasympatholytic |
betamethasone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic agent; anti-inflammatory drug; immunosuppressive agent |
benzenaminium, 4,4'-(3-oxo-1,5-pentanediyl)bis(n,n-dimethyl-n-2-propenyl-), dibromide | [no description available] | medium | 1 | 0 | | |
cyproterone acetate | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; chlorinated steroid; steroid ester | androgen antagonist; geroprotector; progestin |
bicuculline | [no description available] | medium | 4 | 0 | benzylisoquinoline alkaloid; isoquinoline alkaloid; isoquinolines | agrochemical; central nervous system stimulant; GABA-gated chloride channel antagonist; GABAA receptor antagonist; neurotoxin |
kainic acid | [no description available] | medium | 3 | 0 | dicarboxylic acid; L-proline derivative; non-proteinogenic L-alpha-amino acid; pyrrolidinecarboxylic acid | antinematodal drug; excitatory amino acid agonist |
podophyllotoxin | [no description available] | medium | 2 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antimitotic; antineoplastic agent; keratolytic drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
tetrahydrozoline hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | nasal decongestant; sympathomimetic agent; vasoconstrictor agent |
dequalinium chloride | [no description available] | medium | 1 | 0 | organic chloride salt | antifungal agent; antineoplastic agent; antiseptic drug; mitochondrial NADH:ubiquinone reductase inhibitor |
decamethonium dibromide | [no description available] | medium | 1 | 0 | | |
amitriptyline hydrochloride | [no description available] | medium | 1 | 0 | organic tricyclic compound | |
naphazoline hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
doxylamine succinate | [no description available] | medium | 1 | 0 | organic molecular entity | |
carbamylhydrazine monohydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
formestane | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; enol; hydroxy steroid | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
debrisoquin sulfate | [no description available] | medium | 1 | 0 | organic sulfate salt | |
betaine hydrochloride | [no description available] | medium | 1 | 0 | | |
bethanechol chloride | [no description available] | medium | 1 | 0 | carbamate ester; chloride salt; quaternary ammonium salt | muscarinic agonist |
acetylcysteine | [no description available] | medium | 3 | 0 | acetylcysteine; L-cysteine derivative; N-acetyl-L-amino acid | antidote to paracetamol poisoning; antiinfective agent; antioxidant; antiviral drug; ferroptosis inhibitor; geroprotector; human metabolite; mucolytic; radical scavenger; vulnerary |
Mecamylamine hydrochloride | [no description available] | medium | 1 | 0 | monoterpenoid | |
vinblastine | [no description available] | medium | 1 | 0 | | |
cyproheptadine hydrochloride (anhydrous) | [no description available] | medium | 1 | 0 | hydrochloride | |
5 alpha-androstane-3 alpha,17 beta-diol | [no description available] | medium | 1 | 0 | androstane-3alpha,17beta-diol | Daphnia magna metabolite; human metabolite |
pimozide | [no description available] | medium | 1 | 0 | benzimidazoles; heteroarylpiperidine; organofluorine compound | antidyskinesia agent; dopaminergic antagonist; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
azetidyl-2-carboxylic acid | [no description available] | medium | 1 | 0 | azetidine-2-carboxylic acid | |
muscarine | [no description available] | medium | 2 | 0 | | |
antazoline hydrochloride | [no description available] | medium | 1 | 0 | | |
doxifluridine | [no description available] | medium | 1 | 0 | organofluorine compound; pyrimidine 5'-deoxyribonucleoside | antimetabolite; antineoplastic agent; prodrug |
meclofenoxate hydrochloride | [no description available] | medium | 1 | 0 | | |
clonidine hydrochloride | [no description available] | medium | 1 | 0 | dichlorobenzene | |
beclomethasone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; corticosteroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic drug; anti-inflammatory drug |
buthionine sulfoximine | [no description available] | medium | 1 | 0 | diastereoisomeric mixture; homocysteines; non-proteinogenic alpha-amino acid; sulfoximide | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
mexiletine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug |
cyclophosphamide | [no description available] | medium | 1 | 0 | hydrate | alkylating agent; antineoplastic agent; carcinogenic agent; immunosuppressive agent |
suxamethonium chloride | [no description available] | medium | 1 | 0 | chloride salt | muscle relaxant |
cyclobenzaprine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; muscle relaxant |
n-methylaspartate | [no description available] | medium | 3 | 0 | amino dicarboxylic acid; D-alpha-amino acid; D-aspartic acid derivative; secondary amino compound | neurotransmitter agent |
3-deazaadenosine | [no description available] | medium | 1 | 0 | | |
metoclopramide hydrochloride | [no description available] | medium | 1 | 0 | | |
isoetharine mesylate | [no description available] | medium | 1 | 0 | | |
zalcitabine | [no description available] | medium | 1 | 0 | pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
propionylpromazine hydrochloride | [no description available] | medium | 1 | 0 | | |
camptothecin | [no description available] | high | 3 | 0 | delta-lactone; pyranoindolizinoquinoline; quinoline alkaloid; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; genotoxin; plant metabolite |
nsc-145,668 | [no description available] | medium | 1 | 0 | hydrochloride | antimetabolite; antineoplastic agent |
clodronic acid | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid); one-carbon compound; organochlorine compound | antineoplastic agent; bone density conservation agent |
benserazide hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
pancuronium bromide | [no description available] | medium | 1 | 0 | bromide salt | cholinergic antagonist; muscle relaxant; nicotinic antagonist |
tetradecanoylphorbol acetate | [no description available] | high | 4 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
danazol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | anti-estrogen; estrogen antagonist; geroprotector |
metergoline | [no description available] | medium | 1 | 0 | carbamate ester; ergoline alkaloid | dopamine agonist; geroprotector; serotonergic antagonist |
lisuride | [no description available] | medium | 1 | 0 | monocarboxylic acid amide | antidyskinesia agent; antiparkinson drug; dopamine agonist; serotonergic agonist |
disopyramide phosphate | [no description available] | medium | 1 | 0 | organoammonium phosphate | |
bromocriptine | [no description available] | medium | 2 | 0 | indole alkaloid | antidyskinesia agent; antiparkinson drug; dopamine agonist; hormone antagonist |
ergocristine | [no description available] | medium | 1 | 0 | ergot alkaloid | |
triamcinolone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 16alpha-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
zidovudine | [no description available] | medium | 1 | 0 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
paclitaxel | [no description available] | medium | 3 | 0 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
buspirone hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
etoposide | [no description available] | medium | 2 | 0 | beta-D-glucoside; furonaphthodioxole; organic heterotetracyclic compound | antineoplastic agent; DNA synthesis inhibitor |
propafenone hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug |
etazolate hydrochloride | [no description available] | medium | 1 | 0 | | |
butaclamol | [no description available] | medium | 1 | 0 | amino alcohol; organic heteropentacyclic compound; tertiary alcohol; tertiary amino compound | dopaminergic antagonist |
ribavirin | [no description available] | medium | 1 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide | anticoronaviral agent; antiinfective agent; antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
carbidopa | [no description available] | medium | 1 | 0 | catechols; hydrate; hydrazines; monocarboxylic acid | antidyskinesia agent; antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
cephradine | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; cephalosporin | antibacterial drug |
methyldopa | [no description available] | medium | 3 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | alpha-adrenergic agonist; antihypertensive agent; hapten; peripheral nervous system drug; sympatholytic agent |
lonidamine | [no description available] | medium | 1 | 0 | dichlorobenzene; indazoles; monocarboxylic acid | antineoplastic agent; antispermatogenic agent; EC 2.7.1.1 (hexokinase) inhibitor; geroprotector |
dexibuprofen | [no description available] | medium | 1 | 0 | ibuprofen | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
quisqualic acid | [no description available] | medium | 2 | 0 | non-proteinogenic alpha-amino acid | |
pirfenidone | [no description available] | medium | 1 | 0 | pyridone | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
flecainide acetate | [no description available] | medium | 1 | 0 | acetate salt | anti-arrhythmia drug |
nicardipine hydrochloride | [no description available] | medium | 1 | 0 | dihydropyridine | geroprotector |
idarubicin | [no description available] | medium | 1 | 0 | anthracycline antibiotic; deoxy hexoside; monosaccharide derivative | |
captopril | [no description available] | medium | 1 | 0 | alkanethiol; L-proline derivative; N-acylpyrrolidine; pyrrolidinemonocarboxylic acid | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
terazosin hydrochloride anhydrous | [no description available] | medium | 1 | 0 | | |
pergolide mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | antiparkinson drug; dopamine agonist; geroprotector |
ranitidine hydrochloride | [no description available] | medium | 1 | 0 | | |
colforsin | [no description available] | high | 7 | 0 | acetate ester; cyclic ketone; labdane diterpenoid; organic heterotricyclic compound; tertiary alpha-hydroxy ketone; triol | adenylate cyclase agonist; anti-HIV agent; antihypertensive agent; plant metabolite; platelet aggregation inhibitor; protein kinase A agonist |
cefaclor anhydrous | [no description available] | medium | 1 | 0 | cephalosporin | antibacterial drug; drug allergen |
alo 2145 | [no description available] | medium | 1 | 0 | hydrochloride | alpha-adrenergic agonist; antiglaucoma drug |
enoximone | [no description available] | medium | 1 | 0 | aromatic ketone | |
atomoxetine | [no description available] | medium | 1 | 0 | aromatic ether; secondary amino compound; toluenes | adrenergic uptake inhibitor; antidepressant; environmental contaminant; xenobiotic |
raloxifene hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
mifepristone | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; acetylenic compound; tertiary amino compound | abortifacient; contraceptive drug; hormone antagonist; synthetic oral contraceptive |
quinpirole hydrochloride | [no description available] | medium | 1 | 0 | | |
imazodan | [no description available] | medium | 1 | 0 | | |
mibefradil dihydrochloride | [no description available] | medium | 1 | 0 | | |
aptiganel hydrochloride | [no description available] | medium | 1 | 0 | | |
adenosine | [no description available] | high | 153 | 1 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
adenosine | [no description available] | high | 153 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
phenelzine sulfate | [no description available] | medium | 1 | 0 | organic molecular entity | |
fluoxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride; N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine | |
propranolol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
bupropion hydrochloride | [no description available] | medium | 1 | 0 | aromatic ketone | |
diltiazem hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antihypertensive agent; calcium channel blocker; vasodilator agent |
trazodone hydrochloride | [no description available] | medium | 3 | 0 | hydrochloride | adrenergic antagonist; antidepressant; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
verapamil hydrochloride | [no description available] | medium | 1 | 0 | | |
doxazosin mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | geroprotector |
amantadine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antiviral agent; dopamine agonist; NMDA receptor antagonist |
mevastatin | [no description available] | medium | 2 | 0 | 2-pyranones; carboxylic ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | antifungal agent; apoptosis inducer; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; fungal metabolite; Penicillium metabolite |
chloroquine diphosphate | [no description available] | medium | 1 | 0 | | |
dobutamine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | beta-adrenergic agonist; cardiotonic drug; sympathomimetic agent |
desipramine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | drug allergen |
dopamine hydrochloride | [no description available] | medium | 1 | 0 | catecholamine | |
proadifen hydrochloride | [no description available] | medium | 1 | 0 | | |
4-nitrobenzylthioinosine | [no description available] | medium | 4 | 0 | purine nucleoside | |
metrifudil | [no description available] | medium | 1 | 0 | | |
rutecarpine | [no description available] | medium | 3 | 0 | beta-carbolines | |
trihexyphenidyl hydrochloride | [no description available] | medium | 1 | 0 | aralkylamine | |
thioridazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | first generation antipsychotic; geroprotector |
procainamide hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug |
siquil | [no description available] | medium | 1 | 0 | hydrochloride | anticoronaviral agent |
sotalol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anti-arrhythmia drug; beta-adrenergic antagonist |
oxymetazoline hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | alpha-adrenergic agonist; nasal decongestant; sympathomimetic agent; vasoconstrictor agent |
alprenolol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
2-methoxyestradiol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
fluphenazine hydrochloride | [no description available] | medium | 1 | 0 | phenothiazines | anticoronaviral agent |
tryptamine monohydrochloride | [no description available] | medium | 1 | 0 | | |
clomipramine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anticoronaviral agent; antidepressant; serotonergic antagonist; serotonergic drug |
amiloride hydrochloride | [no description available] | medium | 1 | 0 | hydrate | diuretic; sodium channel blocker |
prazosin hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
mianserin hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | geroprotector |
lomefloxacin hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antimicrobial agent; antitubercular agent; photosensitizing agent |
fenspiride hydrochloride | [no description available] | medium | 1 | 0 | | |
nilverm | [no description available] | medium | 1 | 0 | organic molecular entity | |
sanguinarine chloride | [no description available] | medium | 1 | 0 | | |
ropinirole hydrochloride | [no description available] | medium | 1 | 0 | indoles | |
plasmenylserine | [no description available] | medium | 1 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5-aminovaleric acid hydrochloride | [no description available] | medium | 1 | 0 | | |
n-acetyltryptamine | [no description available] | medium | 1 | 0 | acetamides; indoles | |
D-serine | [no description available] | medium | 1 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
dihydroergotamine mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | non-narcotic analgesic; serotonergic agonist; vasoconstrictor agent |
ranolazine hydrochloride | [no description available] | medium | 1 | 0 | | |
loxapine succinate | [no description available] | medium | 1 | 0 | succinate salt | geroprotector |
guanfacine hydrochloride | [no description available] | medium | 1 | 0 | acetamides | geroprotector |
pirenzepine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
labetalol hydrochloride | [no description available] | medium | 1 | 0 | salicylamides | |
acecainide hydrochloride | [no description available] | medium | 1 | 0 | | |
loperamide hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anticoronaviral agent; antidiarrhoeal drug; mu-opioid receptor agonist |
maprotiline hydrochloride | [no description available] | medium | 1 | 0 | anthracenes | |
protoporphyrin ix, disodium salt | [no description available] | medium | 1 | 0 | | |
siguazodan | [no description available] | medium | 1 | 0 | pyridazinone | |
3-octadecanamido-2-ethoxypropylphosphocholine | [no description available] | medium | 1 | 0 | | |
chelerythrine chloride | [no description available] | medium | 2 | 0 | | |
tosyllysine chloromethyl ketone | [no description available] | medium | 1 | 0 | | |
5-(n-methyl-n-isobutyl)amiloride | [no description available] | medium | 1 | 0 | | |
1-(5-isoquinolinesulfonyl)-2-methylpiperazine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | EC 2.7.11.13 (protein kinase C) inhibitor |
amperozide hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anxiolytic drug; dopamine uptake inhibitor; geroprotector; second generation antipsychotic; serotonergic antagonist |
pyrrolidine dithiocarbamic acid | [no description available] | medium | 1 | 0 | | |
agroclavine | [no description available] | medium | 1 | 0 | ergot alkaloid | |
s-methylisothiourea sulfate | [no description available] | medium | 1 | 0 | | |
p-Aminobenzamidine dihydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
benzamidine hydrochloride | [no description available] | medium | 1 | 0 | | |
ketorolac tromethamine | [no description available] | medium | 1 | 0 | organoammonium salt | analgesic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor |
methionine sulfoximine | [no description available] | medium | 1 | 0 | L-alpha-amino acid zwitterion; L-methionine derivative; methionine sulfoximine; non-proteinogenic L-alpha-amino acid | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor; geroprotector |
tretazicar | [no description available] | medium | 1 | 0 | | |
carbetapentane citrate | [no description available] | medium | 1 | 0 | carbonyl compound | |
phentolamine mesylate | [no description available] | medium | 1 | 0 | | |
mephentermine | [no description available] | medium | 1 | 0 | 2-aminooctadecane-1,3-diol | EC 2.7.11.13 (protein kinase C) inhibitor; human metabolite; mouse metabolite |
oxybutynin hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
nimustine | [no description available] | medium | 1 | 0 | hydrochloride | antineoplastic agent |
cordium | [no description available] | medium | 1 | 0 | hydrate; hydrochloride | |
L-2-aminoadipic acid | [no description available] | medium | 1 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
prilocaine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | local anaesthetic |
mor-14 | [no description available] | medium | 1 | 0 | hydroxypiperidine; piperidine alkaloid; tertiary amino compound | anti-HIV agent; cardioprotective agent; EC 3.2.1.20 (alpha-glucosidase) inhibitor; plant metabolite |
brexanolone | [no description available] | medium | 1 | 0 | 3-hydroxy-5alpha-pregnan-20-one | antidepressant; GABA modulator; human metabolite; intravenous anaesthetic; sedative |
phenylisopropyladenosine | [no description available] | medium | 1 | 0 | aromatic amine; benzenes; hydrocarbyladenosine; purine nucleoside; secondary amino compound | adenosine A1 receptor agonist; neuroprotective agent |
hexamethonium chloride | [no description available] | medium | 1 | 0 | | |
6-(4-nitrobenzylthio)guanosine | [no description available] | medium | 1 | 0 | | |
3-aminopropylphosphonic acid | [no description available] | medium | 1 | 0 | phosphonic acids; primary amino compound; zwitterion | GABAB receptor agonist |
5'-n-methylcarboxamideadenosine | [no description available] | medium | 1 | 0 | | |
3,7-dimethyl-1-propargylxanthine | [no description available] | medium | 182 | 0 | | |
3,7-dimethyl-1-propargylxanthine | [no description available] | medium | 182 | 1 | | |
zpck | [no description available] | medium | 1 | 0 | | |
n(6)-phenyladenosine | [no description available] | medium | 1 | 0 | purine nucleoside | |
tetrahydrodeoxycorticosterone | [no description available] | medium | 1 | 0 | 21-hydroxy steroid | |
n-methyladenosine | [no description available] | medium | 1 | 0 | methyladenosine | |
mizoribine | [no description available] | medium | 1 | 0 | imidazoles | anticoronaviral agent |
1-amino-1,3-dicarboxycyclopentane | [no description available] | medium | 1 | 0 | | |
u 73122 | [no description available] | medium | 1 | 0 | aromatic ether; aza-steroid; maleimides | EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor |
alphaxalone | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
s-nitrosoglutathione | [no description available] | medium | 1 | 0 | glutathione derivative; nitrosothio compound | bronchodilator agent; nitric oxide donor; platelet aggregation inhibitor; signalling molecule |
cp-55,940 | [no description available] | medium | 1 | 0 | | |
vanoxerine | [no description available] | medium | 1 | 0 | hydrochloride | dopamine uptake inhibitor |
methyl 6,7-dimethoxy-4-ethyl-beta-carboline-3-carboxylate | [no description available] | medium | 1 | 0 | beta-carbolines | |
u 69593 | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; N-alkylpyrrolidine; organic heterobicyclic compound; oxaspiro compound | anti-inflammatory agent; diuretic; kappa-opioid receptor agonist |
cv 3988 | [no description available] | medium | 1 | 0 | | |
beta-carboline-3-carboxylic acid methyl ester | [no description available] | medium | 1 | 0 | beta-carbolines | |
methoctramine | [no description available] | medium | 1 | 0 | hydrochloride | muscarinic antagonist |
hypotaurine | [no description available] | medium | 1 | 0 | aminosulfinic acid; zwitterion | human metabolite; metabolite; mouse metabolite |
dihydrokainate | [no description available] | medium | 1 | 0 | dicarboxylic acid | |
gabazine | [no description available] | medium | 1 | 0 | | |
cl 218872 | [no description available] | medium | 1 | 0 | pyridazines; ring assembly | |
betaxolol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antihypertensive agent; beta-adrenergic antagonist |
catechin | [no description available] | medium | 2 | 0 | hydrate | geroprotector |
1-(2-methoxyphenyl)-4-(4-(2-phthalimido)butyl)piperazine | [no description available] | medium | 1 | 0 | hydrobromide | serotonergic antagonist |
s-methylthiocitrulline | [no description available] | medium | 1 | 0 | imidothiocarbamic ester; L-arginine derivative; L-ornithine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; neuroprotective agent |
dihydrocapsaicin | [no description available] | medium | 1 | 0 | capsaicinoid | |
ml 9 | [no description available] | medium | 1 | 0 | | |
parthenolide | [no description available] | medium | 2 | 0 | germacranolide | |
3',4'-dichlorobenzamil | [no description available] | medium | 1 | 0 | guanidines; pyrazines | |
1-(carboxymethylthio)tetradecane | [no description available] | medium | 1 | 0 | straight-chain fatty acid | |
2-iodomelatonin | [no description available] | medium | 1 | 0 | acetamides | |
arcaine, sulfate | [no description available] | medium | 1 | 0 | | |
gr 113808 | [no description available] | medium | 1 | 0 | indolyl carboxylate ester; piperidines; sulfonamide | serotonergic antagonist |
gallopamil hydrochloride | [no description available] | medium | 1 | 0 | | |
gamma-glutamylaminomethylsulfonic acid | [no description available] | medium | 1 | 0 | | |
buthionine sulfoximine | [no description available] | medium | 1 | 0 | 2-amino-4-(S-butylsulfonimidoyl)butanoic acid | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
sb 204070a | [no description available] | medium | 1 | 0 | | |
1-(2-(4-aminophenyl)ethyl)-4-(3-trifluoromethylphenyl)piperazine | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; N-alkylpiperazine; N-arylpiperazine; primary arylamine; substituted aniline | geroprotector; serotonergic agonist |
l 655240 | [no description available] | medium | 1 | 0 | methylindole | |
san 58035 | [no description available] | medium | 1 | 0 | | |
nnc 711 | [no description available] | medium | 1 | 0 | | |
4-(alpha-(4-allyl-2,5-dimethyl-1-piperazinyl)-3-methoxybenzyl)-n,n-diethylbenzamide | [no description available] | medium | 1 | 0 | diarylmethane | |
e 64 | [no description available] | medium | 2 | 0 | dicarboxylic acid monoamide; epoxy monocarboxylic acid; guanidines; L-leucine derivative; zwitterion | antimalarial; antiparasitic agent; protease inhibitor |
azetidine-2,4-dicarboxylic acid | [no description available] | medium | 1 | 0 | | |
pre 084 | [no description available] | medium | 1 | 0 | morpholines | |
methotrexate | [no description available] | medium | 6 | 0 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
1-(2-allylphenoxy)-3-((8-bromoacetylamino-4-menthane-1-yl)amino)-1-propanol | [no description available] | medium | 1 | 0 | | |
sr 2640 | [no description available] | medium | 1 | 0 | quinolines | |
ici 204448 | [no description available] | medium | 1 | 0 | | |
4-amino-1-(6-chloro-2-pyridyl)piperidine hydrochloride | [no description available] | medium | 1 | 0 | | |
n,n-di-n-hexyl-2-(4-fluorophenyl)indole-3-acetamide | [no description available] | medium | 1 | 0 | phenylindole | |
3,5-bis(trifluoromethyl)benzyl n-acetyltryptophan | [no description available] | medium | 1 | 0 | | |
8-cyclopentyl-3-(3-((4-(fluorosulfonyl)benzoyl)oxy)propyl)-1-propylxanthine | [no description available] | medium | 1 | 0 | | |
l 741626 | [no description available] | medium | 1 | 0 | piperidines | |
nisoxetine hydrochloride | [no description available] | medium | 1 | 0 | | |
ng-nitroarginine methyl ester | [no description available] | medium | 1 | 0 | hydrochloride | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
tilarginine acetate | [no description available] | medium | 1 | 0 | | |
alpha-guanidinoglutaric acid | [no description available] | medium | 1 | 0 | L-glutamic acid derivative | |
3,4-dichloro-n-methyl-n-(2-(1-pyrrolidinyl)cyclohexyl)-benzeneacetamide, (trans)-(+-)-isomer | [no description available] | medium | 1 | 0 | | |
imidazole-4-acetic acid hydrochloride | [no description available] | medium | 1 | 0 | | |
nsc-141549 | [no description available] | medium | 1 | 0 | | |
2-chloro-2-deoxyglucose | [no description available] | medium | 1 | 0 | | |
idazoxan hydrochloride | [no description available] | medium | 1 | 0 | | |
isoguvacine hydrochloride | [no description available] | medium | 1 | 0 | | |
8-methoxymethyl-3-isobutyl-1-methylxanthine | [no description available] | medium | 1 | 0 | oxopurine | |
cyc 202 | [no description available] | medium | 1 | 0 | 2,6-diaminopurines | antiviral drug; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
Serotonin hydrochloride | [no description available] | medium | 1 | 0 | tryptamines | |
n-phthaloylglutamic acid | [no description available] | medium | 1 | 0 | L-glutamic acid derivative; phthalimides | |
1,3-dipropyl-7-methylxanthine | [no description available] | medium | 1 | 0 | | |
ag 3-5 | [no description available] | medium | 1 | 0 | C-nitro compound | |
n-n-propylnorapomorphine | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
urapidil monohydrochloride | [no description available] | medium | 1 | 0 | | |
aminopterin | [no description available] | medium | 1 | 0 | dicarboxylic acid | EC 1.5.1.3 (dihydrofolate reductase) inhibitor; mutagen |
azepexole, dihydrochloride | [no description available] | medium | 1 | 0 | | |
2,5-dimethoxy-4-iodoamphetamine hydrochloride | [no description available] | medium | 1 | 0 | | |
abt 980 | [no description available] | medium | 1 | 0 | | |
sk&f 75670 | [no description available] | medium | 1 | 0 | | |
esatenolol | [no description available] | medium | 1 | 0 | atenolol | beta-adrenergic antagonist |
nbi 27914 | [no description available] | medium | 1 | 0 | dialkylarylamine; tertiary amino compound | |
sb 216763 | [no description available] | medium | 1 | 0 | indoles; maleimides | |
(R)-atenolol | [no description available] | medium | 1 | 0 | atenolol | |
memantine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; antiparkinson drug; dopaminergic agent; neuroprotective agent; NMDA receptor antagonist |
pefabloc | [no description available] | medium | 1 | 0 | | |
pongidae | [no description available] | medium | 1 | 0 | | |
succinylproline | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
sb 205384 | [no description available] | medium | 1 | 0 | thienopyridine | |
hydrastine | [no description available] | medium | 1 | 0 | isoquinolines | metabolite |
gabaculine hydrochloride | [no description available] | medium | 1 | 0 | | |
etiron monohydrobromide | [no description available] | medium | 1 | 0 | | |
bmy 7378 | [no description available] | medium | 1 | 0 | | |
vesamicol | [no description available] | medium | 1 | 0 | | |
cortisone | [no description available] | high | 3 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
vincristine sulfate | [no description available] | medium | 2 | 0 | organic sulfate salt | antineoplastic agent; geroprotector |
n-methylserotonin oxalate salt | [no description available] | medium | 1 | 0 | | |
nsc 95397 | [no description available] | medium | 1 | 0 | 1,4-naphthoquinones | |
wortmannin | [no description available] | medium | 2 | 0 | acetate ester; cyclic ketone; delta-lactone; organic heteropentacyclic compound | anticoronaviral agent; antineoplastic agent; autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector; Penicillium metabolite; radiosensitizing agent |
lithium chloride | [no description available] | medium | 1 | 0 | inorganic chloride; lithium salt | antimanic drug; geroprotector |
canavanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid | phytogenic insecticide; plant metabolite |
5-hydroxytryptophan | [no description available] | medium | 1 | 0 | 5-hydroxytryptophan; amino acid zwitterion; hydroxy-L-tryptophan; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; plant metabolite |
ouabain | [no description available] | medium | 2 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
tosylphenylalanyl chloromethyl ketone | [no description available] | medium | 1 | 0 | alpha-chloroketone; sulfonamide | alkylating agent; serine proteinase inhibitor |
monoiodotyrosine | [no description available] | medium | 1 | 0 | amino acid zwitterion; L-tyrosine derivative; monoiodotyrosine; non-proteinogenic L-alpha-amino acid | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; human metabolite; mouse metabolite |
nitroarginine | [no description available] | medium | 2 | 0 | guanidines; L-arginine derivative; N-nitro compound; non-proteinogenic L-alpha-amino acid | |
willardiine | [no description available] | medium | 1 | 0 | amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | |
cortodoxone | [no description available] | medium | 1 | 0 | deoxycortisol; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
amiodarone hydrochloride | [no description available] | medium | 1 | 0 | aromatic ketone | |
dicyclomine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antispasmodic drug; muscarinic antagonist |
metyrosine | [no description available] | medium | 1 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | antihypertensive agent; EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor |
nortriptyline hydrochloride | [no description available] | medium | 1 | 0 | organic tricyclic compound | geroprotector |
paromomycin sulfate | [no description available] | medium | 1 | 0 | | |
Dubinidine | [no description available] | medium | 2 | 0 | organic heterotricyclic compound; organonitrogen heterocyclic compound; oxacycle | |
cyclopamine | [no description available] | medium | 2 | 0 | piperidines | glioma-associated oncogene inhibitor |
s-(4-azidophenacyl)glutathione | [no description available] | medium | 1 | 0 | peptide | |
hydroxylamine hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
sb 228357 | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
3,5-dihydroxyphenylglycine | [no description available] | medium | 1 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid; resorcinols | |
actinonin | [no description available] | medium | 1 | 0 | | |
vinpocetine | [no description available] | medium | 4 | 0 | alkaloid | geroprotector |
vinpocetine | [no description available] | medium | 4 | 1 | alkaloid | geroprotector |
dihydroergocristine monomesylate | [no description available] | medium | 2 | 0 | methanesulfonate salt | alpha-adrenergic antagonist; geroprotector; vasodilator agent |
tretinoin | [no description available] | medium | 2 | 0 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
resveratrol | [no description available] | medium | 2 | 0 | resveratrol | antioxidant; phytoalexin; plant metabolite; quorum sensing inhibitor; radical scavenger |
oleic acid | [no description available] | high | 11 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
thapsigargin | [no description available] | medium | 2 | 0 | butyrate ester; organic heterotricyclic compound; sesquiterpene lactone | calcium channel blocker; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor |
brivudine | [no description available] | medium | 1 | 0 | | |
5,11-diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol | [no description available] | medium | 1 | 0 | carbotetracyclic compound; polyphenol | estrogen receptor agonist; estrogen receptor antagonist; geroprotector; neuroprotective agent |
2-amino-3-(5-tert-butyl-3-(phosphonomethoxy)-4-isoxazolyl)propionic acid | [no description available] | medium | 1 | 0 | | |
adenosine-5'-(n-ethylcarboxamide) | [no description available] | high | 21 | 1 | adenosines; monocarboxylic acid amide | adenosine A1 receptor agonist; adenosine A2A receptor agonist; antineoplastic agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; vasodilator agent |
adenosine-5'-(n-ethylcarboxamide) | [no description available] | high | 21 | 0 | adenosines; monocarboxylic acid amide | adenosine A1 receptor agonist; adenosine A2A receptor agonist; antineoplastic agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; vasodilator agent |
L-cycloserine | [no description available] | medium | 2 | 0 | 4-amino-1,2-oxazolidin-3-one | anti-HIV agent; anticonvulsant; EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor |
1,4-dideoxy-1,4-imino-d-arabinitol | [no description available] | medium | 1 | 0 | | |
purvalanol a | [no description available] | medium | 1 | 0 | purvalanol | |
melphalan | [no description available] | medium | 2 | 0 | L-phenylalanine derivative; nitrogen mustard; non-proteinogenic L-alpha-amino acid; organochlorine compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
isoliquiritigenin | [no description available] | medium | 1 | 0 | chalcones | antineoplastic agent; biological pigment; EC 1.14.18.1 (tyrosinase) inhibitor; GABA modulator; geroprotector; metabolite; NMDA receptor antagonist |
rauwolscine | [no description available] | medium | 2 | 0 | methyl 17-hydroxy-20xi-yohimban-16-carboxylate | |
gw9662 | [no description available] | medium | 1 | 0 | benzamides | |
calmidazolium | [no description available] | medium | 1 | 0 | organic chloride salt | apoptosis inducer; calmodulin antagonist |
tropisetron hydrochloride | [no description available] | medium | 1 | 0 | | |
Reactive blue 2 | [no description available] | medium | 1 | 0 | anthraquinone | |
5,6-dichloro-1-ethyl-1,3-dihydro-2h-benzimidazol-2-one | [no description available] | medium | 1 | 0 | dichlorobenzene | |
quinidine sulfate | [no description available] | medium | 1 | 0 | | |
ipratropium bromide anhydrous | [no description available] | medium | 1 | 0 | | |
methamilane methiodide | [no description available] | medium | 1 | 0 | | |
pilocarpine nitrate | [no description available] | medium | 1 | 0 | | |
r 59949 | [no description available] | medium | 1 | 0 | diarylmethane | |
n(6)-cyclopentyladenosine | [no description available] | medium | 23 | 0 | | |
methylatropine nitrate | [no description available] | medium | 1 | 0 | | |
sb 366791 | [no description available] | medium | 1 | 0 | | |
ag-213 | [no description available] | medium | 1 | 0 | | |
3,3',4,5'-tetrahydroxystilbene | [no description available] | medium | 2 | 0 | catechols; polyphenol; resorcinols; stilbenol | antineoplastic agent; apoptosis inducer; geroprotector; hypoglycemic agent; plant metabolite; protein kinase inhibitor; tyrosine kinase inhibitor |
bemesetron | [no description available] | medium | 1 | 0 | | |
(S)-(-)-pindolol | [no description available] | medium | 1 | 0 | pindolol | |
levosulpiride | [no description available] | medium | 1 | 0 | sulpiride | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
caffeic acid | [no description available] | medium | 4 | 0 | caffeic acid | geroprotector; mouse metabolite |
4-fluorophenyl-L-alanine | [no description available] | medium | 1 | 0 | 4-fluorophenylalanine; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid | |
urocanic acid | [no description available] | medium | 1 | 0 | urocanic acid | human metabolite |
cotinine | [no description available] | high | 3 | 0 | N-alkylpyrrolidine; pyridines; pyrrolidin-2-ones; pyrrolidine alkaloid | antidepressant; biomarker; human xenobiotic metabolite; plant metabolite |
cinnarizine | [no description available] | medium | 3 | 0 | diarylmethane; N-alkylpiperazine; olefinic compound | anti-allergic agent; antiemetic; calcium channel blocker; geroprotector; H1-receptor antagonist; histamine antagonist; muscarinic antagonist |
cinnarizine | [no description available] | medium | 3 | 2 | diarylmethane; N-alkylpiperazine; olefinic compound | anti-allergic agent; antiemetic; calcium channel blocker; geroprotector; H1-receptor antagonist; histamine antagonist; muscarinic antagonist |
sulindac | [no description available] | medium | 2 | 0 | monocarboxylic acid; organofluorine compound; sulfoxide | analgesic; antineoplastic agent; antipyretic; apoptosis inducer; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug; tocolytic agent |
cysteine sulfinic acid | [no description available] | medium | 1 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
d-ap7 | [no description available] | medium | 1 | 0 | | |
(1R,2S)-tranylcypromine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
tacrine hydrochloride | [no description available] | medium | 1 | 0 | | |
4-bromotetramisole, oxalate (1:1), salt(s)-isomer | [no description available] | medium | 1 | 0 | | |
3-hydroxybenzylhydrazine hydrochloride | [no description available] | medium | 1 | 0 | | |
1-(3-chlorophenyl)biguanide hydrochloride | [no description available] | medium | 1 | 0 | | |
4-chlorophenylalanine methyl ester, hydrochloride, (dl)-isomer | [no description available] | medium | 1 | 0 | | |
capsazepine | [no description available] | medium | 1 | 0 | benzazepine; catechols; monochlorobenzenes; thioureas | capsaicin receptor antagonist |
diphenyleneiodium chloride | [no description available] | medium | 1 | 0 | organic chloride salt | EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor; G-protein-coupled receptor agonist |
azetidine-2,4-dicarboxylic acid, (cis)-isomer | [no description available] | medium | 1 | 0 | | |
tamoxifen citrate | [no description available] | medium | 1 | 0 | citrate salt | angiogenesis inhibitor; anticoronaviral agent |
pimagedine hydrochloride | [no description available] | medium | 1 | 0 | | |
Betaine Aldehyde Chloride | [no description available] | medium | 1 | 0 | quaternary ammonium salt | |
eskazine | [no description available] | medium | 1 | 0 | | |
monastrol | [no description available] | medium | 1 | 0 | enoate ester; ethyl ester; phenols; racemate; thioureas | antileishmanial agent; antimitotic; antineoplastic agent; EC 3.5.1.5 (urease) inhibitor |
u 0126 | [no description available] | medium | 1 | 0 | aryl sulfide; dinitrile; enamine; substituted aniline | antineoplastic agent; antioxidant; apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; osteogenesis regulator; vasoconstrictor agent |
4-diphenylacetoxy-n-methylpiperidine methiodide | [no description available] | medium | 1 | 0 | iodide salt; quaternary ammonium salt | cholinergic antagonist; muscarinic antagonist |
1-(4-hydroxybenzyl)imidazole-2-thiol | [no description available] | medium | 1 | 0 | | |
2-chloro-n(6)-(3-iodobenzyl)adenosine-5'-n-methyluronamide | [no description available] | medium | 2 | 0 | | |
bp 897 | [no description available] | medium | 1 | 0 | naphthalenecarboxamide | |
trequinsin hydrochloride | [no description available] | medium | 1 | 0 | | |
neboglamine | [no description available] | medium | 1 | 0 | | |
benzatropine methanesulfonate | [no description available] | medium | 1 | 0 | | |
sb 203186 | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
n-(1-methyl-5-indolyl)-n'-(3-methyl-5-isothiazolyl)urea | [no description available] | medium | 1 | 0 | 1,2-thiazoles; indoles; ureas | receptor modulator; serotonergic antagonist |
gw 7647 | [no description available] | medium | 1 | 0 | aryl sulfide; monocarboxylic acid; ureas | PPARalpha agonist |
ro 41-0960 | [no description available] | medium | 1 | 0 | | |
cgp 13501 | [no description available] | medium | 1 | 0 | alkylbenzene | |
n-(2-(4-(4-chlorophenyl)piperazin-1-yl)ethyl)-3-methoxybenzamide | [no description available] | medium | 1 | 0 | | |
brl 15572 | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; secondary alcohol | geroprotector; serotonergic antagonist |
mrs 1523 | [no description available] | medium | 1 | 0 | | |
or486 | [no description available] | medium | 1 | 0 | | |
fg 9041 | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
iik7 | [no description available] | medium | 1 | 0 | | |
sb 415286 | [no description available] | medium | 1 | 0 | C-nitro compound; maleimides; monochlorobenzenes; phenols; secondary amino compound; substituted aniline | antioxidant; apoptosis inducer; EC 2.7.11.26 (tau-protein kinase) inhibitor; neuroprotective agent |
dm 235 | [no description available] | medium | 1 | 0 | | |
jhw 015 | [no description available] | medium | 1 | 0 | indolecarboxamide | |
bw 723c86 | [no description available] | medium | 1 | 0 | tryptamines | |
sc 560 | [no description available] | medium | 1 | 0 | aromatic ether; monochlorobenzenes; organofluorine compound; pyrazoles | angiogenesis modulating agent; antineoplastic agent; apoptosis inducer; cyclooxygenase 1 inhibitor; non-steroidal anti-inflammatory drug |
sc-19220 | [no description available] | medium | 1 | 0 | aromatic ether | |
le 300 | [no description available] | medium | 1 | 0 | indoles | |
ly 367265 | [no description available] | medium | 1 | 0 | dihydropyridine; fluoroindole; tertiary amino compound; thiadiazoloquinoline | antidepressant; geroprotector; serotonergic antagonist; serotonin uptake inhibitor |
diclofenac sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
cgp 7930 | [no description available] | medium | 1 | 0 | alkylbenzene | |
1,3,5-tris(4-hydroxyphenyl)-4-propyl-1h-pyrazole | [no description available] | medium | 1 | 0 | phenols; pyrazoles | estrogen receptor agonist |
sib 1757 | [no description available] | medium | 1 | 0 | | |
sphingosine | [no description available] | medium | 1 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
apigenin | [no description available] | medium | 2 | 0 | trihydroxyflavone | antineoplastic agent; metabolite |
luteolin | [no description available] | medium | 2 | 0 | 3'-hydroxyflavonoid; tetrahydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; apoptosis inducer; c-Jun N-terminal kinase inhibitor; EC 2.3.1.85 (fatty acid synthase) inhibitor; immunomodulator; nephroprotective agent; plant metabolite; radical scavenger; vascular endothelial growth factor receptor antagonist |
daphnetin | [no description available] | medium | 1 | 0 | hydroxycoumarin | |
genistein | [no description available] | medium | 2 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; human urinary metabolite; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
pulmicort | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic acetal; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; bronchodilator agent; drug allergen |
timolol maleate | [no description available] | medium | 1 | 0 | maleate salt | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist |
brompheniramine maleate | [no description available] | medium | 1 | 0 | maleate salt | anti-allergic agent |
chlorpheniramine maleate | [no description available] | medium | 1 | 0 | organic molecular entity | |
clemastine fumarate | [no description available] | medium | 1 | 0 | fumarate salt | anti-allergic agent; antipruritic drug; H1-receptor antagonist; muscarinic antagonist |
methylergonovine maleate | [no description available] | medium | 1 | 0 | ergoline alkaloid | geroprotector |
astaxanthine | [no description available] | medium | 1 | 0 | carotenol; carotenone | animal metabolite; anticoagulant; antioxidant; food colouring; plant metabolite |
harman | [no description available] | medium | 1 | 0 | harmala alkaloid; indole alkaloid fundamental parent; indole alkaloid | anti-HIV agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; plant metabolite |
morin | [no description available] | medium | 2 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | angiogenesis modulating agent; anti-inflammatory agent; antibacterial agent; antihypertensive agent; antineoplastic agent; antioxidant; EC 5.99.1.2 (DNA topoisomerase) inhibitor; hepatoprotective agent; metabolite; neuroprotective agent |
myricetin | [no description available] | medium | 2 | 0 | 7-hydroxyflavonol; hexahydroxyflavone | antineoplastic agent; antioxidant; cyclooxygenase 1 inhibitor; food component; geroprotector; hypoglycemic agent; plant metabolite |
daidzein | [no description available] | medium | 2 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; phytoestrogen; plant metabolite |
caffeic acid phenethyl ester | [no description available] | medium | 2 | 0 | alkyl caffeate ester | anti-inflammatory agent; antibacterial agent; antineoplastic agent; antioxidant; antiviral agent; immunomodulator; metabolite; neuroprotective agent |
rottlerin | [no description available] | medium | 2 | 0 | aromatic ketone; benzenetriol; chromenol; enone; methyl ketone | anti-allergic agent; antihypertensive agent; antineoplastic agent; apoptosis inducer; K-ATP channel agonist; metabolite |
flupenthixol | [no description available] | medium | 1 | 0 | flupenthixol | dopaminergic antagonist |
n-oleoyldopamine | [no description available] | medium | 1 | 0 | catechols; fatty amide; N-(fatty acyl)-dopamine; secondary carboxamide | TRPV1 agonist |
pheniramine maleate | [no description available] | medium | 1 | 0 | organic molecular entity | |
tranilast | [no description available] | medium | 1 | 0 | amidobenzoic acid; cinnamamides; dimethoxybenzene; secondary carboxamide | anti-allergic agent; anti-asthmatic drug; antineoplastic agent; aryl hydrocarbon receptor agonist; calcium channel blocker; hepatoprotective agent; nephroprotective agent |
trimipramine maleate | [no description available] | medium | 1 | 0 | maleate salt | antidepressant |
isotretinoin | [no description available] | medium | 2 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; teratogenic agent |
xylometazoline hydrochloride | [no description available] | medium | 1 | 0 | | |
flunarizine hydrochloride | [no description available] | medium | 1 | 0 | diarylmethane | |
ketotifen fumarate | [no description available] | medium | 1 | 0 | organoammonium salt | anti-asthmatic drug; H1-receptor antagonist |
cis-flupenthixol dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | geroprotector |
n-arachidonylglycine | [no description available] | medium | 1 | 0 | fatty amide; N-acylglycine | |
n-oleoylethanolamine | [no description available] | medium | 1 | 0 | endocannabinoid; N-(long-chain-acyl)ethanolamine; N-acylethanolamine 18:1 | EC 3.5.1.23 (ceramidase) inhibitor; geroprotector; PPARalpha agonist |
cyclosporine | [no description available] | medium | 2 | 0 | homodetic cyclic peptide | anti-asthmatic drug; anticoronaviral agent; antifungal agent; antirheumatic drug; carcinogenic agent; dermatologic drug; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; geroprotector; immunosuppressive agent; metabolite |
phenoxybenzamine hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
phenylephrine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
mepyramine maleate | [no description available] | medium | 1 | 0 | | |
brefeldin a | [no description available] | medium | 2 | 0 | macrolide antibiotic | Penicillium metabolite |
fenretinide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; retinoid | antineoplastic agent; antioxidant |
4-(2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1-propenyl)benzoic acid | [no description available] | medium | 1 | 0 | benzoic acids; naphthalenes; retinoid | antineoplastic agent; retinoic acid receptor agonist; teratogenic agent |
l-2-(carboxypropyl)glycine | [no description available] | medium | 1 | 0 | | |
4-aminocrotonic acid | [no description available] | medium | 1 | 0 | | |
denopamine | [no description available] | medium | 1 | 0 | dimethoxybenzene | |
l 655,708 | [no description available] | medium | 1 | 0 | | |
ro 41-1049 | [no description available] | medium | 1 | 0 | | |
sb 200646a | [no description available] | medium | 1 | 0 | | |
seglitide | [no description available] | medium | 1 | 0 | | |
sib 1893 | [no description available] | medium | 1 | 0 | | |
su 6656 | [no description available] | medium | 1 | 0 | | |
tyrphostin ag 555 | [no description available] | medium | 1 | 0 | | |
tyrphostin ag-494 | [no description available] | medium | 1 | 0 | | |
tyrphostin b44 | [no description available] | medium | 1 | 0 | | |
ag-490 | [no description available] | medium | 1 | 0 | catechols; enamide; monocarboxylic acid amide; nitrile; secondary carboxamide | anti-inflammatory agent; antioxidant; apoptosis inducer; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; geroprotector; STAT3 inhibitor |
ag 112 | [no description available] | medium | 1 | 0 | | |
ag 183 | [no description available] | medium | 1 | 0 | | |
semaxinib | [no description available] | medium | 1 | 0 | olefinic compound; oxindoles; pyrroles | angiogenesis modulating agent; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; vascular endothelial growth factor receptor antagonist |
8-(3-chlorostyryl)caffeine | [no description available] | medium | 3 | 0 | monochlorobenzenes; trimethylxanthine | adenosine A2A receptor antagonist; EC 1.4.3.4 (monoamine oxidase) inhibitor |
bay 11-7085 | [no description available] | medium | 1 | 0 | benzenes; nitrile; sulfone | anti-inflammatory agent; antibacterial agent; antineoplastic agent; apoptosis inducer; autophagy inducer; EC 2.7.11.10 (IkappaB kinase) inhibitor; ferroptosis inducer; NF-kappaB inhibitor |
molsidomine | [no description available] | medium | 1 | 0 | ethyl ester; morpholines; oxadiazole; zwitterion | antioxidant; apoptosis inhibitor; cardioprotective agent; nitric oxide donor; vasodilator agent |
diamide | [no description available] | medium | 1 | 0 | 1,1'-azobis(N,N-dimethylformamide) | |
nomifensine maleate | [no description available] | medium | 1 | 0 | | |
nalbuphine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
isoalloxazine | [no description available] | medium | 1 | 0 | benzo[g]pteridine-2,4-dione | |
vinblastine sulfate | [no description available] | medium | 2 | 0 | | |
n-methylscopolamine bromide | [no description available] | medium | 1 | 0 | | |
dextromethorphan hydrobromide | [no description available] | medium | 1 | 0 | hydrate; hydrobromide | |
naloxone hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
s-trans,trans-farnesylthiosalicylic acid | [no description available] | medium | 1 | 0 | sesquiterpenoid | |
sulindac sulfone | [no description available] | medium | 1 | 0 | monocarboxylic acid; organofluorine compound; sulfone | apoptosis inducer; cyclooxygenase 2 inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor |
naltrexone hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
guanabenz acetate | [no description available] | medium | 1 | 0 | dichlorobenzene | geroprotector |
nylidrin hydrochloride | [no description available] | medium | 1 | 0 | alkylbenzene | |
triprolidine hydrochloride anhydrous | [no description available] | medium | 1 | 0 | hydrochloride | H1-receptor antagonist |
famotidine | [no description available] | medium | 1 | 0 | 1,3-thiazoles; guanidines; sulfonamide | anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
fenoterol | [no description available] | medium | 1 | 0 | hydrobromide | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
tiapridex | [no description available] | medium | 1 | 0 | benzamides | |
quipazine maleate | [no description available] | medium | 1 | 0 | | |
n-(2-aminoethyl)-4-chlorobenzamide hydrochloride | [no description available] | medium | 1 | 0 | | |
tulobuterol hydrochloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
hp 029 | [no description available] | medium | 1 | 0 | | |
n,n,n-trimethyl-1-(4-stilbenoxy)-2-propylammonium iodide | [no description available] | medium | 1 | 0 | | |
6-(bromomethylene)tetrahydro-3-(1-naphthaleneyl)-2h-pyran-2-one | [no description available] | medium | 2 | 0 | naphthalenes | |
nf023 | [no description available] | medium | 1 | 0 | | |
nf 449 | [no description available] | medium | 1 | 0 | | |
7-chloro-4-hydroxy-2-phenyl-1,8-naphthyridine | [no description available] | medium | 1 | 0 | | |
gr 46611 | [no description available] | medium | 1 | 0 | | |
diacetylmonoxime | [no description available] | medium | 1 | 0 | | |
homatropine hydrobromide, (endo-(+-)-isomer) | [no description available] | medium | 2 | 0 | | |
vancomycin hydrochloride | [no description available] | medium | 1 | 0 | | |
moxisylyte hydrochloride | [no description available] | medium | 1 | 0 | monoterpenoid | |
dizocilpine maleate | [no description available] | medium | 3 | 0 | maleate salt; tetracyclic antidepressant | anaesthetic; anticonvulsant; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist |
beta-aminopropionitrile fumarate | [no description available] | medium | 1 | 0 | | |
flupirtine | [no description available] | medium | 1 | 0 | | |
zimelidine hydrochloride | [no description available] | medium | 1 | 0 | | |
pregna-4,17-diene-3,16-dione, (17z)-isomer | [no description available] | medium | 1 | 0 | | |
su 4312 | [no description available] | medium | 1 | 0 | | |
gw 1929 | [no description available] | medium | 1 | 0 | benzophenones | |
protriptyline hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant |
n(4)-chloroacetylcytosine arabinoside | [no description available] | medium | 1 | 0 | | |
n-(3-(cyclohexylidene-(1h-imidazol-4-ylmethyl))phenyl)ethanesulfonamide | [no description available] | medium | 1 | 0 | | |
n-(4-amino-2-chlorophenyl)phthalimide | [no description available] | medium | 1 | 0 | | |
cb 34 | [no description available] | medium | 1 | 0 | | |
b 43 | [no description available] | medium | 1 | 0 | aromatic amine; aromatic ether; cyclopentanes; primary amino compound; pyrrolopyrimidine | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; geroprotector |
(8R)-7-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,13,14-triol | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
(8R)-7-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,13,14-triol | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
3-(6-chloro-3-pyridazinyl)-3,8-diazabicyclo(3.2.1)octane | [no description available] | medium | 1 | 0 | | |
2-(3,3-diphenylpropylamino)acetamide | [no description available] | medium | 1 | 0 | diarylmethane | |
4-(2-(phenylsulfonylamino)ethylthio)-2,6-difluorophenoxyacetamide | [no description available] | medium | 1 | 0 | | |
gw2974 | [no description available] | medium | 1 | 0 | pyridopyrimidine | |
l 162313 | [no description available] | medium | 1 | 0 | | |
l-165041 | [no description available] | medium | 1 | 0 | aromatic ketone | |
mrs 1754 | [no description available] | medium | 1 | 0 | oxopurine | |
s-nitroso-n-acetylpenicillamine | [no description available] | medium | 1 | 0 | nitroso compound; nitrosothio compound | nitric oxide donor; vasodilator agent |
pd 404182 | [no description available] | medium | 1 | 0 | | |
sb 222200 | [no description available] | medium | 1 | 0 | quinolines | |
dantrolene sodium | [no description available] | medium | 1 | 0 | | |
cr 2945 | [no description available] | medium | 1 | 0 | | |
sb 218795 | [no description available] | medium | 1 | 0 | quinolines | |
dihydroceramide | [no description available] | medium | 1 | 0 | N-acylsphinganine | |
epinephrine bitartrate | [no description available] | medium | 1 | 0 | | |
bicuculline methobromide | [no description available] | medium | 1 | 0 | | |
butylscopolammonium bromide | [no description available] | medium | 2 | 0 | | |
butaclamol hydrochloride | [no description available] | medium | 1 | 0 | | |
a 38503 | [no description available] | medium | 1 | 0 | | |
8-hydroxy-2-(di-n-propylamino)tetralin hydrobromide | [no description available] | medium | 1 | 0 | | |
sk&f 89976-a | [no description available] | medium | 1 | 0 | | |
cv 1808 | [no description available] | medium | 1 | 0 | purine nucleoside | |
fluvoxamine maleate | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes | |
naloxone benzoylhydrazone | [no description available] | medium | 1 | 0 | | |
2-methyl-6-(phenylethynyl)pyridine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anxiolytic drug; metabotropic glutamate receptor antagonist |
amiprilose | [no description available] | medium | 1 | 0 | | |
(R)-fluoxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; serotonin uptake inhibitor |
desmethylselegiline hydrochloride | [no description available] | medium | 1 | 0 | | |
3-morpholino-sydnonimine monohydrochloride | [no description available] | medium | 1 | 0 | | |
t 1032 | [no description available] | medium | 1 | 0 | | |
qx-314 bromide | [no description available] | medium | 1 | 0 | | |
(S)-fluoxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; serotonin uptake inhibitor |
sr 59230a | [no description available] | medium | 1 | 0 | | |
u 74389g | [no description available] | medium | 1 | 0 | | |
1-(2-methoxyphenyl)piperazine hydrochloride | [no description available] | medium | 1 | 0 | | |
y 27632, dihydrochloride, (4(r)-trans)-isomer | [no description available] | medium | 1 | 0 | | |
noscapine hydrochloride | [no description available] | medium | 1 | 0 | | |
a 77636 | [no description available] | medium | 1 | 0 | hydrochloride | antiparkinson drug; dopamine agonist |
cgp 20712a | [no description available] | medium | 1 | 0 | | |
levodopa methyl ester hydrochloride | [no description available] | medium | 1 | 0 | | |
benalfocin hydrochloride | [no description available] | medium | 1 | 0 | | |
lu 19005 | [no description available] | medium | 1 | 0 | | |
benoxathian hydrochloride | [no description available] | medium | 1 | 0 | | |
((2-n-butyl-6,7-dichloro-2-cyclopentyl-2,3-dihydro-1-oxo-1h-inden-5-yl)oxy)acetic acid, (+)-isomer | [no description available] | medium | 1 | 0 | | |
n-cyclopropyl adenosine-5'-carboxamide | [no description available] | medium | 1 | 0 | | |
cefotaxime sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
calpain inhibitor iii | [no description available] | medium | 1 | 0 | | |
GR 127935 hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | serotonergic antagonist |
mrs 1845 | [no description available] | medium | 1 | 0 | | |
1-aminocyclopropane-1-carboxylic acid hydrochloride | [no description available] | medium | 1 | 0 | | |
alaproclate hydrochloride | [no description available] | medium | 1 | 0 | | |
ubenimex | [no description available] | medium | 1 | 0 | peptide | |
3-chloroalanine hydrochloride, (l-ala)-isomer | [no description available] | medium | 1 | 0 | | |
dsp 4 hydrochloride | [no description available] | medium | 1 | 0 | | |
calcimycin | [no description available] | medium | 6 | 0 | benzoxazole | |
(2-(2',6'-dimethoxy)phenoxyethylamino)methylbenzodioxan hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | alpha-adrenergic antagonist |
2-cyclooctyl-2-hydroxyethylamine hydrochloride | [no description available] | medium | 1 | 0 | | |
cirazoline monohydrochloride | [no description available] | medium | 1 | 0 | | |
adtn | [no description available] | medium | 1 | 0 | | |
apocodeine hydrochloride, (r)-isomer | [no description available] | medium | 1 | 0 | | |
Dihydro-beta-erythroidine hydrobromide | [no description available] | medium | 1 | 0 | indoles | |
lilly 78335 | [no description available] | medium | 1 | 0 | | |
efaroxan hydrochloride | [no description available] | medium | 1 | 0 | | |
fenoldopam hydrobromide | [no description available] | medium | 1 | 0 | | |
1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | dopamine uptake inhibitor |
guvacine hydrochloride | [no description available] | medium | 1 | 0 | | |
7-hydroxy-2-n,n-dipropylaminotetralin hydrobromide | [no description available] | medium | 1 | 0 | | |
8-hydroxy-2-(di-n-propylamino)tetralin hydrobromide, (r)-isomer, | [no description available] | medium | 1 | 0 | organic molecular entity | |
1-(2-(4-(4-fluoro-benzoyl)-piperidin-1-yl)-ethyl)-3,3-dimethyl-1,2-dihydro-indol-2-one | [no description available] | medium | 1 | 0 | hydrochloride | receptor modulator; serotonergic antagonist |
4-iodoclonidine | [no description available] | medium | 1 | 0 | | |
4-methylpyrazole monohydrochloride | [no description available] | medium | 1 | 0 | | |
tele-methylhistamine | [no description available] | medium | 1 | 0 | | |
alpha-methyltyrosine methyl ester, monohydrochloride | [no description available] | medium | 1 | 0 | | |
octoclothepine maleate | [no description available] | medium | 1 | 0 | | |
2-(n-phenethyl-n-propyl)amino-5-hydroxytetralin hydrochloride | [no description available] | medium | 1 | 0 | | |
du 24565 | [no description available] | medium | 1 | 0 | | |
2-methoxyidazoxan hydrochloride | [no description available] | medium | 1 | 0 | | |
ro 25-6981 | [no description available] | medium | 1 | 0 | | |
sk&f 77434 | [no description available] | medium | 1 | 0 | hydrobromide | dopamine agonist; prodrug |
3-[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-yl]-1,1-diethylurea | [no description available] | medium | 1 | 0 | organic heterotetracyclic compound; organonitrogen heterocyclic compound | |
demethylcantharidin | [no description available] | medium | 1 | 0 | | |
atropine sulfate | [no description available] | medium | 2 | 0 | | |
1-deoxynojirimycin hydrochloride | [no description available] | medium | 1 | 0 | | |
win 62577 | [no description available] | medium | 1 | 0 | | |
quinine sulfate | [no description available] | medium | 1 | 0 | hydrate | |
quercetin | [no description available] | medium | 1 | 0 | | |
rv 538, (r-(r*,r*))-isomer | [no description available] | medium | 1 | 0 | | |
3,4-dichloro-n-methyl-n-(2-(1-pyrrolidinyl)cyclohexyl)-benzeneacetamide, (1s-cis)-isomer | [no description available] | medium | 1 | 0 | | |
valproate sodium | [no description available] | medium | 1 | 0 | organic sodium salt | geroprotector |
u 63557a | [no description available] | medium | 1 | 0 | | |
taurocholic acid, monosodium salt | [no description available] | medium | 1 | 0 | bile salt | |
cefmetazole sodium | [no description available] | medium | 1 | 0 | organic sodium salt | antimicrobial agent |
fusidate sodium | [no description available] | medium | 1 | 0 | | |
cephapirin sodium | [no description available] | medium | 1 | 0 | cephalosporin; organic sodium salt | antibacterial drug |
sodium cephalothin | [no description available] | medium | 1 | 0 | organic sodium salt | |
cefazolin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
5-hydroxydecanoic acid, monosodium salt | [no description available] | medium | 1 | 0 | | |
ro13-9904 | [no description available] | medium | 1 | 0 | | |
phenytoin sodium | [no description available] | medium | 1 | 0 | | |
cr 1409 | [no description available] | medium | 1 | 0 | | |
cortisol succinate, sodium salt | [no description available] | medium | 1 | 0 | organic molecular entity | |
piroxicam | [no description available] | medium | 1 | 0 | benzothiazine; monocarboxylic acid amide; pyridines | analgesic; antirheumatic drug; cyclooxygenase 1 inhibitor; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
lfm a13 | [no description available] | medium | 1 | 0 | aromatic amide; dibromobenzene; enamide; enol; nitrile; secondary carboxamide | antineoplastic agent; apoptosis inducer; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; EC 2.7.11.21 (polo kinase) inhibitor; geroprotector; platelet aggregation inhibitor |
l 701324 | [no description available] | medium | 1 | 0 | quinolines | |
hispidin | [no description available] | medium | 1 | 0 | 2-pyranones; catechols | antioxidant; EC 2.7.11.13 (protein kinase C) inhibitor; fungal metabolite |
minocycline hydrochloride | [no description available] | medium | 1 | 0 | | |
demeclocycline hydrochloride | [no description available] | medium | 1 | 0 | | |
acyclovir | [no description available] | medium | 1 | 0 | 2-aminopurines; oxopurine | antimetabolite; antiviral drug |
sepiapterin | [no description available] | medium | 1 | 0 | sepiapterin | |
isoxanthopterin | [no description available] | medium | 1 | 0 | dihydroxypteridine | |
clozapine | [no description available] | medium | 1 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine; organochlorine compound | adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; GABA antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; xenobiotic |
ganciclovir | [no description available] | medium | 1 | 0 | 2-aminopurines; oxopurine | antiinfective agent; antiviral drug |
zaprinast | [no description available] | medium | 1 | 0 | triazolopyrimidines | |
allopurinol | [no description available] | medium | 9 | 0 | nucleobase analogue; organic heterobicyclic compound | antimetabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor; gout suppressant; radical scavenger |
thiolactomycin | [no description available] | medium | 1 | 0 | | |
2,4-diaminohypoxanthine | [no description available] | medium | 1 | 0 | hydroxypyrimidine | |
quazinone | [no description available] | medium | 1 | 0 | | |
8-bromocyclic gmp, sodium salt | [no description available] | medium | 1 | 0 | organic sodium salt | muscle relaxant; protein kinase G agonist |
ag-879 | [no description available] | medium | 1 | 0 | | |
adenine | [no description available] | high | 11 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allantoin | [no description available] | medium | 4 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
uracil | [no description available] | high | 9 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
uridine | [no description available] | medium | 3 | 0 | uridines | drug metabolite; fundamental metabolite; human metabolite |
1-methyluric acid | [no description available] | medium | 2 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
1,3,7-trimethylurate | [no description available] | medium | 8 | 0 | oxopurine | human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; mouse metabolite |
3,7-dimethyluric acid | [no description available] | medium | 3 | 0 | oxopurine | metabolite; mouse metabolite |
1,7-dimethyluric acid | [no description available] | medium | 1 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
4-aminophenol | [no description available] | medium | 1 | 0 | aminophenol | allergen; metabolite |
indoleacetic acid | [no description available] | medium | 1 | 0 | indole-3-acetic acids; monocarboxylic acid | auxin; human metabolite; mouse metabolite; plant hormone; plant metabolite |
epibatidine | [no description available] | medium | 1 | 0 | alkaloid | |
aristolochic acid i | [no description available] | medium | 1 | 0 | aristolochic acids; aromatic ether; C-nitro compound; cyclic acetal; monocarboxylic acid; organic heterotetracyclic compound | carcinogenic agent; metabolite; mutagen; nephrotoxin; toxin |
5-methoxypsoralen | [no description available] | medium | 1 | 0 | 5-methoxyfurocoumarin; organic heterotricyclic compound; psoralens | hepatoprotective agent; plant metabolite |
2,3-dimethoxy-5-methyl-6-decyl-1,4-benzoquinone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones | cofactor |
3,3'-diindolylmethane | [no description available] | medium | 1 | 0 | indoles | antineoplastic agent; P450 inhibitor |
embelin | [no description available] | medium | 1 | 0 | dihydroxy-1,4-benzoquinones | antimicrobial agent; antineoplastic agent; hepatitis C protease inhibitor; plant metabolite |
gossypol | [no description available] | medium | 1 | 0 | | |
hypericin | [no description available] | medium | 1 | 0 | | |
indole-3-carbinol | [no description available] | medium | 1 | 0 | indolyl alcohol | antineoplastic agent; plant metabolite |
khellin | [no description available] | medium | 1 | 0 | furanochromone; organic heterotricyclic compound; oxacycle | anti-asthmatic agent; bronchodilator agent; cardiovascular drug; vasodilator agent |
kinetin | [no description available] | medium | 1 | 0 | 6-aminopurines; furans | cytokinin; geroprotector |
lavendustin a | [no description available] | medium | 1 | 0 | aromatic amine | |
lavendustin b | [no description available] | medium | 1 | 0 | | |
vitamin k 3 | [no description available] | medium | 1 | 0 | 1,4-naphthoquinones; vitamin K | angiogenesis inhibitor; antineoplastic agent; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; human urinary metabolite; nutraceutical |
methoxsalen | [no description available] | medium | 1 | 0 | aromatic ether; psoralens | antineoplastic agent; cross-linking reagent; dermatologic drug; photosensitizing agent; plant metabolite |
myristicin | [no description available] | medium | 1 | 0 | organic molecular entity | metabolite |
nalidixic acid | [no description available] | medium | 1 | 0 | 1,8-naphthyridine derivative; monocarboxylic acid; quinolone antibiotic | antibacterial drug; antimicrobial agent; DNA synthesis inhibitor |
6,7-dimethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-isobenzofuran-1-one | [no description available] | medium | 1 | 0 | isoquinolines | |
patulin | [no description available] | medium | 1 | 0 | furopyran; gamma-lactone; lactol | antimicrobial agent; Aspergillus metabolite; carcinogenic agent; mutagen; mycotoxin; Penicillium metabolite |
sanguinarine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; benzophenanthridine alkaloid; botanical anti-fungal agent | |
streptonigrin | [no description available] | medium | 2 | 0 | pyridines; quinolone | antimicrobial agent; antineoplastic agent |
tetrahydropapaverine | [no description available] | medium | 1 | 0 | aromatic ether; benzylisoquinoline alkaloid; benzyltetrahydroisoquinoline; polyether; secondary amino compound | |
trioxsalen | [no description available] | medium | 1 | 0 | psoralens | dermatologic drug; photosensitizing agent |
mitomycin | [no description available] | medium | 2 | 0 | mitomycin | alkylating agent; antineoplastic agent |
kanamycin a | [no description available] | medium | 1 | 0 | kanamycins | bacterial metabolite |
veratramine | [no description available] | medium | 1 | 0 | piperidine alkaloid | |
phlorhizin | [no description available] | medium | 1 | 0 | aryl beta-D-glucoside; dihydrochalcones; monosaccharide derivative | antioxidant; plant metabolite |
gliotoxin | [no description available] | medium | 1 | 0 | dipeptide; organic disulfide; organic heterotetracyclic compound; pyrazinoindole | antifungal agent; EC 2.5.1.58 (protein farnesyltransferase) inhibitor; immunosuppressive agent; mycotoxin; proteasome inhibitor |
tubercidin | [no description available] | medium | 2 | 0 | antibiotic antifungal agent; N-glycosylpyrrolopyrimidine; ribonucleoside | antimetabolite; antineoplastic agent; bacterial metabolite |
veratridine | [no description available] | medium | 1 | 0 | steroid | sodium channel modulator |
gibberellic acid | [no description available] | medium | 1 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone; organic heteropentacyclic compound | mouse metabolite; plant metabolite |
visnagin | [no description available] | medium | 1 | 0 | aromatic ether; furanochromone; polyketide | anti-inflammatory agent; antihypertensive agent; EC 1.1.1.37 (malate dehydrogenase) inhibitor; phytotoxin; plant metabolite; vasodilator agent |
skimmianine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; organic heterotricyclic compound; organonitrogen heterocyclic compound; oxacycle | |
syrosingopine | [no description available] | medium | 1 | 0 | yohimban alkaloid | |
gramine | [no description available] | medium | 1 | 0 | aminoalkylindole; indole alkaloid; tertiary amino compound | antibacterial agent; antiviral agent; plant metabolite; serotonergic antagonist |
methylergonovine | [no description available] | medium | 1 | 0 | ergoline alkaloid | |
2,2'-methylenebis(4-methyl-6-tert-butylphenol) | [no description available] | medium | 1 | 0 | diarylmethane | |
indolebutyric acid | [no description available] | medium | 1 | 0 | indol-3-yl carboxylic acid | auxin; plant hormone; plant metabolite |
shikimic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
monocrotaline | [no description available] | medium | 1 | 0 | pyrrolizidine alkaloid | |
jervine | [no description available] | medium | 1 | 0 | piperidines | |
glycyrrhetinic acid | [no description available] | medium | 1 | 0 | cyclic terpene ketone; hydroxy monocarboxylic acid; pentacyclic triterpenoid | immunomodulator; plant metabolite |
boldine | [no description available] | medium | 1 | 0 | aporphine alkaloid | |
indirubin | [no description available] | medium | 1 | 0 | | |
plumbagin | [no description available] | medium | 1 | 0 | hydroxy-1,4-naphthoquinone; phenols | anticoagulant; antineoplastic agent; immunological adjuvant; metabolite |
cepharanthine | [no description available] | medium | 1 | 0 | bisbenzylisoquinoline alkaloid; isoquinolines | |
aloe emodin | [no description available] | medium | 1 | 0 | aromatic primary alcohol; dihydroxyanthraquinone | antineoplastic agent; plant metabolite |
osthol | [no description available] | medium | 1 | 0 | botanical anti-fungal agent; coumarins | metabolite |
cytisine | [no description available] | medium | 1 | 0 | alkaloid; bridged compound; lactam; organic heterotricyclic compound; secondary amino compound | nicotinic acetylcholine receptor agonist; phytotoxin; plant metabolite |
thymoquinone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones | adjuvant; anti-inflammatory agent; antidepressant; antineoplastic agent; antioxidant; cardioprotective agent; plant metabolite |
oleanolic acid | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | plant metabolite |
hesperidin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-methoxyflavanones; dihydroxyflavanone; disaccharide derivative; flavanone glycoside; monomethoxyflavanone; rutinoside | mutagen |
azomycin | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles | antitubercular agent |
Berberine chloride (TN) | [no description available] | medium | 1 | 0 | organic molecular entity | |
vincamine | [no description available] | medium | 1 | 0 | alkaloid ester; hemiaminal; methyl ester; organic heteropentacyclic compound; vinca alkaloid | antihypertensive agent; metabolite; vasodilator agent |
ecdysone | [no description available] | medium | 1 | 0 | 14alpha-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; 6-oxo steroid; ecdysteroid | prohormone |
n-deacetyl-n-formylcolchicine | [no description available] | medium | 1 | 0 | cyclic ketone | |
2-bromoergocryptine mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | antiparkinson drug |
zingerone | [no description available] | medium | 1 | 0 | methyl ketone; monomethoxybenzene; phenols | anti-inflammatory agent; antiemetic; antioxidant; flavouring agent; fragrance; plant metabolite; radiation protective agent |
phorbol 12,13-dibutyrate | [no description available] | medium | 1 | 0 | butyrate ester; phorbol ester; tertiary alpha-hydroxy ketone | |
swainsonine | [no description available] | medium | 1 | 0 | indolizidine alkaloid | antineoplastic agent; EC 3.2.1.114 (mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase) inhibitor; immunological adjuvant; plant metabolite |
castanospermine | [no description available] | medium | 1 | 0 | indolizidine alkaloid | anti-HIV-1 agent; anti-inflammatory agent; EC 3.2.1.* (glycosidase) inhibitor; metabolite |
daunorubicin hydrochloride | [no description available] | medium | 1 | 0 | anthracycline | |
ursolic acid | [no description available] | medium | 2 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | geroprotector; plant metabolite |
norharman | [no description available] | medium | 1 | 0 | beta-carbolines; mancude organic heterotricyclic parent | fungal metabolite; marine metabolite |
betulinic acid | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-HIV agent; anti-inflammatory agent; antimalarial; antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; plant metabolite |
epigallocatechin gallate | [no description available] | medium | 5 | 0 | flavans; gallate ester; polyphenol | antineoplastic agent; antioxidant; apoptosis inducer; geroprotector; Hsp90 inhibitor; neuroprotective agent; plant metabolite |
baccatin iii | [no description available] | medium | 1 | 0 | acetate ester; benzoate ester; tetracyclic diterpenoid | plant metabolite |
taleranol | [no description available] | medium | 1 | 0 | macrolide | |
narasin | [no description available] | medium | 1 | 0 | diterpene glycoside | |
quassin | [no description available] | medium | 1 | 0 | triterpenoid | |
tomatidine | [no description available] | medium | 1 | 0 | 3beta-hydroxy steroid; azaspiro compound; oxaspiro compound | |
aloxistatin | [no description available] | medium | 1 | 0 | epoxide; ethyl ester; L-leucine derivative; monocarboxylic acid amide | anticoronaviral agent; cathepsin B inhibitor |
bergenin | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | metabolite |
pinocembrin | [no description available] | medium | 1 | 0 | (2S)-flavan-4-one; dihydroxyflavanone | antineoplastic agent; antioxidant; metabolite; neuroprotective agent; vasodilator agent |
isoscopoletin | [no description available] | medium | 1 | 0 | aromatic ether; hydroxycoumarin | plant metabolite |
vinburnine | [no description available] | medium | 1 | 0 | alkaloid | |
epicatechin | [no description available] | medium | 1 | 0 | catechin; polyphenol | antioxidant |
hesperetin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-methoxyflavanones; monomethoxyflavanone; trihydroxyflavanone | antineoplastic agent; antioxidant; plant metabolite |
magnolol | [no description available] | medium | 1 | 0 | biphenyls | |
honokiol | [no description available] | medium | 1 | 0 | biphenyls | |
betulin | [no description available] | medium | 1 | 0 | diol; pentacyclic triterpenoid | analgesic; anti-inflammatory agent; antineoplastic agent; antiviral agent; metabolite |
tetrahydroalstonine | [no description available] | medium | 1 | 0 | methyl ester; organic heteropentacyclic compound; yohimban alkaloid | plant metabolite |
hernandezine | [no description available] | medium | 1 | 0 | bisbenzylisoquinoline alkaloid; isoquinolines | |
picropodophyllin | [no description available] | medium | 1 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antineoplastic agent; insulin-like growth factor receptor 1 antagonist; plant metabolite; tyrosine kinase inhibitor |
tetrandrine | [no description available] | medium | 1 | 0 | bisbenzylisoquinoline alkaloid; isoquinolines | |
dehydrocostus lactone | [no description available] | medium | 1 | 0 | gamma-lactone; guaiane sesquiterpenoid; organic heterotricyclic compound; sesquiterpene lactone | antimycobacterial drug; antineoplastic agent; apoptosis inducer; cyclooxygenase 2 inhibitor; metabolite; trypanocidal drug |
madecassic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; pentacyclic triterpenoid; tetrol | antioxidant; plant metabolite |
panaxadiol | [no description available] | medium | 1 | 0 | triterpenoid saponin | |
tryptanthrine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; organic heterotetracyclic compound; organonitrogen heterocyclic compound | |
homoeriodictyol | [no description available] | medium | 1 | 0 | 3'-methoxyflavanones; 4'-hydroxyflavanones; monomethoxyflavanone; trihydroxyflavanone | flavouring agent; metabolite |
4-hydroxyindole | [no description available] | medium | 1 | 0 | hydroxyindoles; phenols | |
eriocitrin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-hydroxyflavanones; disaccharide derivative; flavanone glycoside; rutinoside; trihydroxyflavanone | antioxidant |
7,8-dihydromethysticin | [no description available] | medium | 1 | 0 | 2-pyranones; aromatic ether | |
nicotine | [no description available] | high | 5 | 0 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
cinchonine | [no description available] | medium | 1 | 0 | (8xi)-cinchonan-9-ol; cinchona alkaloid | metabolite |
aucubin | [no description available] | medium | 1 | 0 | organic molecular entity | metabolite |
lupinine | [no description available] | medium | 1 | 0 | quinolizidine alkaloid | |
matrine | [no description available] | medium | 1 | 0 | alkaloid | |
friedelin | [no description available] | medium | 1 | 0 | cyclic terpene ketone; pentacyclic triterpenoid | anti-inflammatory drug; antipyretic; non-narcotic analgesic; plant metabolite |
catalpol | [no description available] | medium | 1 | 0 | organic molecular entity | metabolite |
quinine hydrochloride | [no description available] | medium | 1 | 0 | | |
sarsasapogenin | [no description available] | medium | 1 | 0 | sapogenin | |
corynanthine | [no description available] | medium | 1 | 0 | yohimban alkaloid | |
prunin protein, prunus | [no description available] | medium | 1 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; flavanone 7-O-beta-D-glucoside; monosaccharide derivative | antibacterial agent; antilipemic drug; hypoglycemic agent; metabolite |
podocarpic acid | [no description available] | medium | 1 | 0 | abietane diterpenoid | |
harmol hydrochloride | [no description available] | medium | 1 | 0 | | |
5-Methoxyflavone | [no description available] | medium | 1 | 0 | ether; flavonoids | |
10-hydroxycamptothecin | [no description available] | medium | 1 | 0 | pyranoindolizinoquinoline | |
corydaline | [no description available] | medium | 1 | 0 | isoquinoline alkaloid; isoquinolines | |
demissidine | [no description available] | medium | 1 | 0 | alkaloid; organic heteropolycyclic compound; steroid | |
cinchonidine | [no description available] | medium | 1 | 0 | (8xi)-cinchonan-9-ol; cinchona alkaloid | metabolite |
propidium iodide | [no description available] | medium | 1 | 0 | organic iodide salt | |
tryptoline | [no description available] | medium | 1 | 0 | beta-carbolines | |
deguelin | [no description available] | medium | 1 | 0 | aromatic ether; diether; organic heteropentacyclic compound; rotenones | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; antiviral agent; apoptosis inducer; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; mitochondrial NADH:ubiquinone reductase inhibitor; plant metabolite |
daidzin | [no description available] | medium | 1 | 0 | 7-hydroxyisoflavones 7-O-beta-D-glucoside; hydroxyisoflavone; monosaccharide derivative | plant metabolite |
cafestol | [no description available] | medium | 1 | 0 | diterpenoid; furans; organic heteropentacyclic compound; primary alcohol; tertiary alcohol | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; antioxidant; apoptosis inducer; hypoglycemic agent; plant metabolite |
homoorientin | [no description available] | medium | 1 | 0 | flavone C-glycoside; tetrahydroxyflavone | antineoplastic agent; radical scavenger |
asiatic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; pentacyclic triterpenoid; triol | angiogenesis modulating agent; metabolite |
angustmycin a | [no description available] | medium | 1 | 0 | 6-aminopurines | |
razadyne | [no description available] | medium | 1 | 0 | | |
phytosphingosine | [no description available] | medium | 1 | 0 | amino alcohol; sphingoid; triol | mouse metabolite; Saccharomyces cerevisiae metabolite |
tetradecanoylphorbol acetate | [no description available] | medium | 1 | 0 | | |
celastrol | [no description available] | medium | 1 | 0 | monocarboxylic acid; pentacyclic triterpenoid | anti-inflammatory drug; antineoplastic agent; antioxidant; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Hsp90 inhibitor; metabolite |
4'-demethylepipodophyllotoxin | [no description available] | medium | 1 | 0 | furonaphthodioxole; organic heterotetracyclic compound; phenols | antineoplastic agent |
n-(n-(3-carboxyoxirane-2-carbonyl)leucyl)isoamylamine | [no description available] | medium | 1 | 0 | leucine derivative | |
sinensetin | [no description available] | medium | 1 | 0 | pentamethoxyflavone | plant metabolite |
harmalol hydrochloride | [no description available] | medium | 1 | 0 | | |
hyoscyamine | [no description available] | medium | 1 | 0 | tropane alkaloid | |
schizandrin a | [no description available] | medium | 1 | 0 | | |
schizandrin b | [no description available] | medium | 1 | 0 | aromatic ether; cyclic acetal; organic heterotetracyclic compound; oxacycle; tannin | anti-asthmatic agent; anti-inflammatory agent; antilipemic drug; antioxidant; apoptosis inhibitor; hepatoprotective agent; nephroprotective agent; neuroprotective agent; plant metabolite |
cryptotanshinone | [no description available] | medium | 1 | 0 | abietane diterpenoid | anticoronaviral agent |
isosakuranetin | [no description available] | medium | 1 | 0 | (2S)-flavan-4-one; 4'-methoxyflavanones; dihydroxyflavanone; monomethoxyflavanone | plant metabolite |
isovitexin | [no description available] | medium | 1 | 0 | C-glycosyl compound; trihydroxyflavone | EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
sclareol | [no description available] | medium | 1 | 0 | labdane diterpenoid | antifungal agent; antimicrobial agent; apoptosis inducer; fragrance; plant metabolite |
tanshinone ii a | [no description available] | medium | 1 | 0 | abietane diterpenoid | |
leucodin | [no description available] | medium | 1 | 0 | sesquiterpene lactone | |
limonin | [no description available] | medium | 1 | 0 | epoxide; furans; hexacyclic triterpenoid; lactone; limonoid; organic heterohexacyclic compound | inhibitor; metabolite; volatile oil component |
maduramicin | [no description available] | medium | 1 | 0 | | |
chelidonine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; alkaloid fundamental parent; benzophenanthridine alkaloid | |
troleandomycin | [no description available] | medium | 1 | 0 | acetate ester; epoxide; macrolide antibiotic; monosaccharide derivative; polyketide; semisynthetic derivative | EC 1.14.13.97 (taurochenodeoxycholate 6alpha-hydroxylase) inhibitor; xenobiotic |
santonin | [no description available] | medium | 1 | 0 | botanical anti-fungal agent; santonin | plant metabolite |
sitosterol, (3beta)-isomer | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C29-steroid; phytosterols; stigmastane sterol | anticholesteremic drug; antioxidant; mouse metabolite; plant metabolite; sterol methyltransferase inhibitor |
anisomycin | [no description available] | medium | 1 | 0 | monohydroxypyrrolidine; organonitrogen heterocyclic antibiotic | anticoronaviral agent; antimicrobial agent; antineoplastic agent; antiparasitic agent; bacterial metabolite; DNA synthesis inhibitor; protein synthesis inhibitor |
acetylstrophanthidin | [no description available] | medium | 1 | 0 | acetate ester | anti-arrhythmia drug |
Harringtonine | [no description available] | medium | 1 | 0 | alkaloid | |
acivicin | [no description available] | medium | 1 | 0 | isoxazoles; non-proteinogenic L-alpha-amino acid; organochlorine compound | antileishmanial agent; antimetabolite; antimicrobial agent; antineoplastic agent; EC 2.3.2.2 (gamma-glutamyltransferase) inhibitor; glutamine antagonist; metabolite |
ketopinic acid | [no description available] | medium | 1 | 0 | | |
gitoxigenin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 16beta-hydroxy steroid; 3beta-hydroxy steroid | |
graveoline | [no description available] | medium | 1 | 0 | quinolines | |
4-oxy-6-(4-oxybezoyloxy)dauc-8,9-en | [no description available] | medium | 1 | 0 | | |
naringenin | [no description available] | medium | 1 | 0 | (2S)-flavan-4-one; naringenin | expectorant; plant metabolite |
puromycin | [no description available] | medium | 4 | 0 | puromycins | antiinfective agent; antimicrobial agent; antineoplastic agent; EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor; EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor; nucleoside antibiotic; protein synthesis inhibitor |
taxifolin | [no description available] | medium | 1 | 0 | taxifolin | metabolite |
mimosine | [no description available] | medium | 1 | 0 | 4-pyridones; amino acid zwitterion; non-proteinogenic L-alpha-amino acid | EC 1.14.18.1 (tyrosinase) inhibitor; plant metabolite |
eriodictyol | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; tetrahydroxyflavanone | |
arbutin | [no description available] | high | 2 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
quinidine | [no description available] | medium | 2 | 0 | cinchona alkaloid | alpha-adrenergic antagonist; anti-arrhythmia drug; antimalarial; drug allergen; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor; muscarinic antagonist; P450 inhibitor; potassium channel blocker; sodium channel blocker |
conessine | [no description available] | medium | 1 | 0 | steroid alkaloid; tertiary amino compound | antibacterial agent; antimalarial; H3-receptor antagonist; plant metabolite |
griseofulvin | [no description available] | medium | 1 | 0 | 1-benzofurans; antibiotic antifungal drug; benzofuran antifungal drug; organochlorine compound; oxaspiro compound | antibacterial agent; Penicillium metabolite |
digitoxin | [no description available] | medium | 3 | 0 | cardenolide glycoside | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor |
hyperforin | [no description available] | medium | 1 | 0 | | |
deltaline | [no description available] | medium | 1 | 0 | acetate ester; cyclic acetal; diterpene alkaloid; organic polycyclic compound; tertiary alcohol; tertiary amino compound | |
ingenol | [no description available] | medium | 1 | 0 | cyclic terpene ketone; tetracyclic diterpenoid | |
picrotin | [no description available] | medium | 1 | 0 | diol; epoxide; gamma-lactone; organic heteropentacyclic compound; picrotoxane sesquiterpenoid; tertiary alcohol | plant metabolite |
picrotoxinin | [no description available] | medium | 1 | 0 | epoxide; gamma-lactone; organic heteropentacyclic compound; picrotoxane sesquiterpenoid; tertiary alcohol | GABA antagonist; plant metabolite; serotonergic antagonist |
naringin | [no description available] | medium | 2 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; disaccharide derivative; neohesperidoside | anti-inflammatory agent; antineoplastic agent; metabolite |
isonaringin | [no description available] | medium | 1 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; disaccharide derivative; rutinoside | anti-inflammatory agent; antioxidant; metabolite |
ochratoxin a | [no description available] | medium | 2 | 0 | isochromanes; monocarboxylic acid amide; N-acyl-L-phenylalanine; organochlorine compound; phenylalanine derivative | Aspergillus metabolite; calcium channel blocker; carcinogenic agent; mycotoxin; nephrotoxin; Penicillium metabolite; teratogenic agent |
gingerol | [no description available] | medium | 1 | 0 | beta-hydroxy ketone; guaiacols | antineoplastic agent; plant metabolite |
securinine | [no description available] | medium | 1 | 0 | indolizines | |
doxorubicin hydrochloride | [no description available] | medium | 1 | 0 | anthracycline | |
ferulic acid | [no description available] | medium | 1 | 0 | ferulic acids | anti-inflammatory agent; antioxidant; apoptosis inhibitor; cardioprotective agent; MALDI matrix material; plant metabolite |
mycophenolic acid | [no description available] | medium | 1 | 0 | 2-benzofurans; gamma-lactone; monocarboxylic acid; phenols | anticoronaviral agent; antimicrobial agent; antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; environmental contaminant; immunosuppressive agent; mycotoxin; Penicillium metabolite; xenobiotic |
alitretinoin | [no description available] | medium | 1 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; metabolite; retinoid X receptor agonist |
12-deoxyphorbol 13-acetate | [no description available] | medium | 1 | 0 | phorbol ester | metabolite |
dactinomycin | [no description available] | medium | 2 | 0 | actinomycin | mutagen |
aphidicolin | [no description available] | medium | 1 | 0 | tetracyclic diterpenoid | antimicrobial agent; antimitotic; antineoplastic agent; antiviral drug; apoptosis inducer; Aspergillus metabolite; DNA synthesis inhibitor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; fungal metabolite |
(+)-usnic acid | [no description available] | medium | 1 | 0 | usnic acid | |
beta, beta-dimethylacrylshikonin, (+)-isomer | [no description available] | medium | 1 | 0 | hydroxy-1,4-naphthoquinone | |
shikonin | [no description available] | medium | 1 | 0 | hydroxy-1,4-naphthoquinone | |
rhapontin | [no description available] | medium | 1 | 0 | rhaponticin | angiogenesis inhibitor; anti-allergic agent; anti-inflammatory agent; antilipemic drug; antineoplastic agent; apoptosis inducer; EC 2.3.1.85 (fatty acid synthase) inhibitor; hypoglycemic agent; neuroprotective agent; plant metabolite |
piperine | [no description available] | medium | 1 | 0 | benzodioxoles; N-acylpiperidine; piperidine alkaloid; tertiary carboxamide | food component; human blood serum metabolite; NF-kappaB inhibitor; plant metabolite |
amygdalin | [no description available] | medium | 1 | 0 | amygdalin | antineoplastic agent; apoptosis inducer; plant metabolite |
hydrastine, (r-(r*,s*))-isomer | [no description available] | medium | 1 | 0 | isoquinolines | |
vasicine | [no description available] | medium | 1 | 0 | | |
heliotrine | [no description available] | medium | 1 | 0 | pyrrolizines | |
sclareolide | [no description available] | medium | 1 | 0 | naphthofuran | |
hypocrellin b | [no description available] | medium | 1 | 0 | | |
capsaicin | [no description available] | medium | 4 | 0 | capsaicinoid | non-narcotic analgesic; TRPV1 agonist; voltage-gated sodium channel blocker |
capsaicin | [no description available] | medium | 4 | 1 | capsaicinoid | non-narcotic analgesic; TRPV1 agonist; voltage-gated sodium channel blocker |
aurapten | [no description available] | medium | 1 | 0 | coumarins; monoterpenoid | antihypertensive agent; antineoplastic agent; antioxidant; apoptosis inducer; dopaminergic agent; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; gamma-secretase modulator; gastrointestinal drug; hepatoprotective agent; matrix metalloproteinase inhibitor; neuroprotective agent; plant metabolite; PPARalpha agonist; vulnerary |
chlorogenic acid | [no description available] | high | 6 | 0 | cinnamate ester; tannin | food component; plant metabolite |
fumonisin b2 | [no description available] | medium | 1 | 0 | diester; diol; fumonisin; primary amino compound | Aspergillus metabolite; carcinogenic agent |
lincomycin | [no description available] | medium | 1 | 0 | carbohydrate-containing antibiotic; L-proline derivative; monocarboxylic acid amide; pyrrolidinecarboxamide; S-glycosyl compound | antimicrobial agent; bacterial metabolite |
valinomycin | [no description available] | medium | 1 | 0 | cyclodepsipeptide; macrocycle | antimicrobial agent; antiviral agent; bacterial metabolite; potassium ionophore |
orlistat | [no description available] | medium | 1 | 0 | beta-lactone; carboxylic ester; formamides; L-leucine derivative | anti-obesity agent; bacterial metabolite; EC 2.3.1.85 (fatty acid synthase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor |
12-deoxyphorbolphenylacetate-20-acetate | [no description available] | medium | 1 | 0 | | |
brassinin | [no description available] | medium | 1 | 0 | dithiocarbamic ester; indole phytoalexin | |
chaetomellic acid a | [no description available] | medium | 1 | 0 | | |
hirsutine | [no description available] | medium | 1 | 0 | | |
3-deoxyvasicine, hydrochloride | [no description available] | medium | 1 | 0 | | |
emetine dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | anticoronaviral agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; protein synthesis inhibitor |
salinomycin | [no description available] | medium | 1 | 0 | polyketide; spiroketal | animal growth promotant; potassium ionophore |
silybin | [no description available] | medium | 1 | 0 | | |
5,6-dehydrokawain | [no description available] | medium | 1 | 0 | 2-pyranones; aromatic ether | |
9,10-dihydrolysergol | [no description available] | medium | 1 | 0 | | |
geranylgeranic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; diterpenoid; methyl-branched fatty acid; trienoic fatty acid | |
quercetin | [no description available] | high | 2 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | antibacterial agent; antineoplastic agent; antioxidant; Aurora kinase inhibitor; chelator; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; geroprotector; phytoestrogen; plant metabolite; protein kinase inhibitor; radical scavenger |
dinoprostone | [no description available] | high | 4 | 1 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
dinoprostone | [no description available] | high | 4 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
dinoprost | [no description available] | high | 2 | 0 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
biochanin a | [no description available] | medium | 1 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones | antineoplastic agent; EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
formononetin | [no description available] | medium | 1 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones | phytoestrogen; plant metabolite |
prostaglandin b1 | [no description available] | medium | 1 | 0 | prostaglandins B | human metabolite |
sterigmatocystin | [no description available] | medium | 1 | 0 | sterigmatocystins | metabolite |
vitexin | [no description available] | medium | 1 | 0 | C-glycosyl compound; trihydroxyflavone | antineoplastic agent; EC 3.2.1.20 (alpha-glucosidase) inhibitor; plant metabolite; platelet aggregation inhibitor |
acacetin | [no description available] | medium | 1 | 0 | dihydroxyflavone; monomethoxyflavone | anticonvulsant; plant metabolite |
quercitrin | [no description available] | medium | 1 | 0 | alpha-L-rhamnoside; monosaccharide derivative; quercetin O-glycoside; tetrahydroxyflavone | antileishmanial agent; antioxidant; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.14.18.1 (tyrosinase) inhibitor; plant metabolite |
scopoletin | [no description available] | medium | 1 | 0 | hydroxycoumarin | plant growth regulator; plant metabolite |
hymecromone | [no description available] | medium | 1 | 0 | hydroxycoumarin | antineoplastic agent; hyaluronic acid synthesis inhibitor |
alprostadil | [no description available] | high | 7 | 2 | prostaglandins E | anticoagulant; human metabolite; platelet aggregation inhibitor; vasodilator agent |
alprostadil | [no description available] | high | 7 | 0 | prostaglandins E | anticoagulant; human metabolite; platelet aggregation inhibitor; vasodilator agent |
quercetin 3-o-glucopyranoside | [no description available] | medium | 1 | 0 | beta-D-glucoside; monosaccharide derivative; quercetin O-glucoside; tetrahydroxyflavone | antineoplastic agent; antioxidant; antipruritic drug; bone density conservation agent; geroprotector; histamine antagonist; osteogenesis regulator; plant metabolite |
rutin | [no description available] | medium | 2 | 0 | disaccharide derivative; quercetin O-glucoside; rutinoside; tetrahydroxyflavone | antioxidant; metabolite |
kaempferol | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; flavonols; tetrahydroxyflavone | antibacterial agent; geroprotector; human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; plant metabolite |
senecionine | [no description available] | medium | 1 | 0 | lactone; pyrrolizidine alkaloid; tertiary alcohol | plant metabolite |
amphotericin b | [no description available] | medium | 3 | 0 | antibiotic antifungal drug; macrolide antibiotic; polyene antibiotic | antiamoebic agent; antiprotozoal drug; bacterial metabolite |
butein | [no description available] | medium | 1 | 0 | chalcones; polyphenol | antineoplastic agent; antioxidant; EC 1.1.1.21 (aldehyde reductase) inhibitor; geroprotector; hypoglycemic agent; plant metabolite; radiosensitizing agent; tyrosine kinase inhibitor |
sulfuretin | [no description available] | medium | 1 | 0 | 1-benzofurans | |
genistin | [no description available] | medium | 1 | 0 | 7-hydroxyisoflavones 7-O-beta-D-glucoside | |
chartreusin | [no description available] | medium | 1 | 0 | benzochromenone; glycoside | |
methysticin | [no description available] | medium | 1 | 0 | 2-pyranones; aromatic ether | |
yangonin | [no description available] | medium | 1 | 0 | 2-pyranones; aromatic ether | |
zearalenone | [no description available] | medium | 1 | 0 | macrolide; resorcinols | fungal metabolite; mycoestrogen |
baicalein | [no description available] | medium | 1 | 0 | trihydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.31 (arachidonate 12-lipoxygenase) inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 4.1.1.17 (ornithine decarboxylase) inhibitor; ferroptosis inhibitor; geroprotector; hormone antagonist; plant metabolite; prostaglandin antagonist; radical scavenger |
chrysin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; dihydroxyflavone | anti-inflammatory agent; antineoplastic agent; antioxidant; EC 2.7.11.18 (myosin-light-chain kinase) inhibitor; hepatoprotective agent; plant metabolite |
datiscetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; tetrahydroxyflavone | |
diosmetin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavonoid; monomethoxyflavone; trihydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; antioxidant; apoptosis inducer; bone density conservation agent; cardioprotective agent; plant metabolite; tropomyosin-related kinase B receptor agonist; vasodilator agent |
diosmin | [no description available] | medium | 1 | 0 | dihydroxyflavanone; disaccharide derivative; glycosyloxyflavone; monomethoxyflavone; rutinoside | anti-inflammatory agent; antioxidant |
fisetin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavonoid; 7-hydroxyflavonol; tetrahydroxyflavone | anti-inflammatory agent; antioxidant; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; metabolite; plant metabolite |
galangin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; trihydroxyflavone | antimicrobial agent; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; plant metabolite |
3-methylquercetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | anticoagulant; EC 1.14.18.1 (tyrosinase) inhibitor; metabolite |
rhamnetin | [no description available] | medium | 1 | 0 | monomethoxyflavone; tetrahydroxyflavone | anti-inflammatory agent; antioxidant; metabolite |
robinetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | plant metabolite |
tamarixetin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | antioxidant; metabolite |
wogonin | [no description available] | medium | 1 | 0 | dihydroxyflavone; monomethoxyflavone | angiogenesis inhibitor; antineoplastic agent; cyclooxygenase 2 inhibitor; plant metabolite |
coumestrol | [no description available] | medium | 1 | 0 | coumestans; delta-lactone; polyphenol | anti-inflammatory agent; antioxidant; plant metabolite |
rosmarinic acid | [no description available] | medium | 1 | 0 | rosmarinic acid | geroprotector; plant metabolite |
wedelolactone | [no description available] | medium | 1 | 0 | aromatic ether; coumestans; delta-lactone; polyphenol | antineoplastic agent; apoptosis inducer; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; hepatoprotective agent; metabolite |
ellagic acid | [no description available] | high | 3 | 0 | catechols; cyclic ketone; lactone; organic heterotetracyclic compound; polyphenol | antioxidant; EC 1.14.18.1 (tyrosinase) inhibitor; EC 2.3.1.5 (arylamine N-acetyltransferase) inhibitor; EC 2.4.1.1 (glycogen phosphorylase) inhibitor; EC 2.5.1.18 (glutathione transferase) inhibitor; EC 2.7.1.127 (inositol-trisphosphate 3-kinase) inhibitor; EC 2.7.1.151 (inositol-polyphosphate multikinase) inhibitor; EC 2.7.4.6 (nucleoside-diphosphate kinase) inhibitor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; food additive; fungal metabolite; geroprotector; plant metabolite; skin lightening agent |
7-hydroxyflavone | [no description available] | medium | 1 | 0 | hydroxyflavonoid | |
prostaglandin a1 | [no description available] | medium | 1 | 0 | prostaglandins A | |
cerulenin | [no description available] | medium | 1 | 0 | epoxide; monocarboxylic acid amide | antifungal agent; antiinfective agent; antilipemic drug; antimetabolite; antimicrobial agent; fatty acid synthesis inhibitor |
rhoifolin | [no description available] | medium | 1 | 0 | dihydroxyflavone; glycosyloxyflavone; neohesperidoside | metabolite |
vitexin rhamnoside | [no description available] | medium | 1 | 0 | C-glycosyl compound; disaccharide derivative; trihydroxyflavone | plant metabolite |
domoic acid | [no description available] | medium | 1 | 0 | L-proline derivative; non-proteinogenic L-alpha-amino acid; pyrrolidinecarboxylic acid; tricarboxylic acid | algal metabolite; hapten; marine metabolite; neuromuscular agent; neurotoxin |
natamycin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; dicarboxylic acid monoester; epoxide; macrolide antibiotic; monosaccharide derivative; polyene antibiotic | antifungal agrochemical; antimicrobial food preservative; apoptosis inducer; bacterial metabolite; ophthalmology drug |
sirolimus | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
cytochalasin b | [no description available] | medium | 2 | 0 | cytochalasin; lactam; lactone; organic heterotricyclic compound | actin polymerisation inhibitor; metabolite; mycotoxin; platelet aggregation inhibitor |
vinorelbine | [no description available] | medium | 1 | 0 | acetate ester; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; ring assembly; vinca alkaloid | antineoplastic agent; photosensitizing agent |
bisdemethoxycurcumin | [no description available] | medium | 1 | 0 | beta-diketone; diarylheptanoid; enone; polyphenol | EC 3.2.1.1 (alpha-amylase) inhibitor; metabolite |
andrographolide | [no description available] | medium | 1 | 0 | carbobicyclic compound; gamma-lactone; labdane diterpenoid; primary alcohol; secondary alcohol | anti-HIV agent; anti-inflammatory drug; antineoplastic agent; metabolite |
isorhamnetin 3-o-glucoside | [no description available] | medium | 1 | 0 | beta-D-glucoside; glycosyloxyflavone; monomethoxyflavone; monosaccharide derivative; trihydroxyflavone | metabolite |
6,7-dihydroxyflavone | [no description available] | medium | 1 | 0 | | |
flavokawain a | [no description available] | medium | 1 | 0 | chalcones | |
flavokawain b | [no description available] | medium | 1 | 0 | chalcones; dimethoxybenzene; phenols | anti-inflammatory agent; antileishmanial agent; antineoplastic agent; apoptosis inducer; metabolite |
kavain | [no description available] | medium | 1 | 0 | racemate | glycine receptor antagonist |
abscisic acid, (+,-)-isomer | [no description available] | medium | 1 | 0 | abscisic acids | abscisic acid receptor agonist |
veratrine | [no description available] | medium | 2 | 0 | alkaloid | |
catharanthine | [no description available] | medium | 1 | 0 | alkaloid ester; bridged compound; methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound; tertiary amino compound | |
cytochalasin e | [no description available] | medium | 1 | 0 | cytochalasan alkaloid | metabolite |
cytochalasin d | [no description available] | medium | 1 | 0 | | |
sinomenine | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
ecdysterone | [no description available] | medium | 1 | 0 | 14alpha-hydroxy steroid; 20-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; ecdysteroid; phytoecdysteroid | animal metabolite; plant metabolite |
bleomycin | [no description available] | medium | 1 | 0 | bleomycin | antineoplastic agent; metabolite |
bakuchiol | [no description available] | medium | 1 | 0 | | |
zerumbone | [no description available] | medium | 1 | 0 | cyclic ketone; sesquiterpenoid | anti-inflammatory agent; glioma-associated oncogene inhibitor; plant metabolite |
solanesol | [no description available] | medium | 1 | 0 | nonaprenol; primary alcohol | plant metabolite |
(1S,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-[oxo-(3,4,5-trimethoxyphenyl)methoxy]-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid methyl ester | [no description available] | medium | 1 | 0 | yohimban alkaloid | |
n-caproylsphingosine | [no description available] | medium | 1 | 0 | N-acylsphingosine | |
monorden | [no description available] | medium | 1 | 0 | cyclic ketone; enone; epoxide; macrolide antibiotic; monochlorobenzenes; phenols | antifungal agent; metabolite; tyrosine kinase inhibitor |
ginkgolide b | [no description available] | medium | 1 | 0 | | |
hydrocotarnine hydrobromide | [no description available] | medium | 1 | 0 | | |
salsolinol hydrobromide | [no description available] | medium | 1 | 0 | | |
lasalocid sodium | [no description available] | medium | 1 | 0 | benzoates; organic sodium salt | coccidiostat; ionophore |
sclerotiorin | [no description available] | medium | 1 | 0 | azaphilone | |
himbacine | [no description available] | medium | 1 | 0 | gamma-lactone; organic heterotricyclic compound; piperidine alkaloid | muscarinic antagonist |
ebelactone b | [no description available] | medium | 1 | 0 | | |
3-o-methylbutein | [no description available] | medium | 1 | 0 | chalcones | |
thermozymocidin | [no description available] | medium | 1 | 0 | alpha-amino fatty acid; hydroxy monocarboxylic acid; non-proteinogenic alpha-amino acid; sphingoid | antifungal agent; antimicrobial agent; antineoplastic agent; apoptosis inducer; EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor; fungal metabolite; immunosuppressive agent |
marein | [no description available] | medium | 1 | 0 | flavonoids; glycoside | |
hydroxyachillin | [no description available] | medium | 1 | 0 | gamma-lactone | |
fumagillin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; carboxylic ester; dicarboxylic acid monoester; meroterpenoid; organooxygen heterocyclic antibiotic; spiro-epoxide | angiogenesis inhibitor; antibacterial drug; antimicrobial agent; antiprotozoal drug; fungal metabolite; methionine aminopeptidase 2 inhibitor |
artesunate | [no description available] | medium | 1 | 0 | artemisinin derivative; cyclic acetal; dicarboxylic acid monoester; hemisuccinate; semisynthetic derivative; sesquiterpenoid | antimalarial; antineoplastic agent; ferroptosis inducer |
anisodamine | [no description available] | medium | 1 | 0 | | |
bufalin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 3beta-hydroxy steroid | animal metabolite; anti-inflammatory agent; antineoplastic agent; cardiotonic drug |
alpha-solanine | [no description available] | medium | 1 | 0 | glycoalkaloid; organic heterohexacyclic compound; steroid saponin; trisaccharide derivative | antineoplastic agent; apoptosis inducer; phytotoxin; plant metabolite |
apigenin-7-o-rutinoside | [no description available] | medium | 1 | 0 | | |
gambogic acid | [no description available] | medium | 1 | 0 | pyranoxanthones | metabolite |
bn 52020 | [no description available] | medium | 1 | 0 | | |
carmine | [no description available] | medium | 1 | 0 | C-glycosyl compound; monocarboxylic acid; tetrahydroxyanthraquinone | animal metabolite; histological dye |
bavachinin | [no description available] | medium | 1 | 0 | flavanones | |
grayanotoxin iii | [no description available] | medium | 1 | 0 | | |
Dihydrotanshinone I | [no description available] | medium | 1 | 0 | abietane diterpenoid | anticoronaviral agent |
cinobufagin | [no description available] | medium | 1 | 0 | steroid lactone | |
cannogenin thevetoside | [no description available] | medium | 1 | 0 | cardenolide glycoside | |
eriodictyol 7-O-beta-D-glucopyranoside | [no description available] | medium | 1 | 0 | beta-D-glucoside; flavanone glycoside; monosaccharide derivative; trihydroxyflavanone | plant metabolite; radical scavenger |
hypocrellin a | [no description available] | medium | 1 | 0 | | |
dihydrorobinetin | [no description available] | medium | 1 | 0 | | |
monensin | [no description available] | medium | 1 | 0 | | |
minocycline | [no description available] | medium | 1 | 0 | | |
dicumarol | [no description available] | medium | 2 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; Hsp90 inhibitor; vitamin K antagonist |
citrinin | [no description available] | medium | 1 | 0 | | |
vulpinic acid | [no description available] | medium | 1 | 0 | butenolide | |
ajmaline | [no description available] | medium | 1 | 0 | | |
rifampin | [no description available] | medium | 1 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
alpha-cyclopiazonic acid | [no description available] | medium | 1 | 0 | alpha-cyclopiazonic acids | |
acetaminophen | [no description available] | high | 9 | 0 | acetamides; phenols | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; cyclooxygenase 3 inhibitor; environmental contaminant; ferroptosis inducer; geroprotector; hepatotoxic agent; human blood serum metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
barbital | [no description available] | medium | 1 | 0 | barbiturates | drug allergen |
benzocaine | [no description available] | medium | 2 | 0 | benzoate ester; substituted aniline | allergen; antipruritic drug; sensitiser; topical anaesthetic |
lidocaine | [no description available] | medium | 2 | 0 | benzenes; monocarboxylic acid amide; tertiary amino compound | anti-arrhythmia drug; drug allergen; environmental contaminant; local anaesthetic; xenobiotic |
papaverine | [no description available] | high | 20 | 0 | benzylisoquinoline alkaloid; dimethoxybenzene; isoquinolines | antispasmodic drug; vasodilator agent |
phenobarbital | [no description available] | medium | 24 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
phenobarbital | [no description available] | medium | 24 | 3 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
trazodone | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; triazolopyridine | adrenergic antagonist; antidepressant; anxiolytic drug; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
prednisolone | [no description available] | medium | 6 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
gamma-resorcylic acid | [no description available] | medium | 1 | 0 | dihydroxybenzoic acid | metabolite |
oligonucleotides | [no description available] | medium | 1 | 0 | | |
clenbuterol | [no description available] | medium | 1 | 0 | amino alcohol; dichlorobenzene; ethanolamines; primary arylamine; secondary amino compound; substituted aniline | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
eosine yellowish-(ys) | [no description available] | medium | 1 | 0 | organic sodium salt; organobromine compound | fluorochrome; histological dye |
erlotinib hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride; terminal acetylenic compound | antineoplastic agent; protein kinase inhibitor |
clay | [no description available] | medium | 1 | 0 | | |
catechin | [no description available] | medium | 44 | 4 | catechin | antioxidant; plant metabolite |
gallic acid | [no description available] | medium | 4 | 0 | trihydroxybenzoic acid | antineoplastic agent; antioxidant; apoptosis inducer; astringent; cyclooxygenase 2 inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; geroprotector; human xenobiotic metabolite; plant metabolite |
flavan-3-ol | [no description available] | medium | 2 | 1 | hydroxyflavonoid | |
guanine | [no description available] | medium | 8 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thymine | [no description available] | medium | 3 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytosine | [no description available] | medium | 3 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
methanol | [no description available] | medium | 5 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
procyanidin | [no description available] | medium | 13 | 1 | proanthocyanidin | |
caseins | [no description available] | medium | 2 | 0 | | |
fluorides | [no description available] | medium | 7 | 0 | halide anion; monoatomic fluorine | |
melamine | [no description available] | medium | 1 | 0 | triamino-1,3,5-triazine | xenobiotic metabolite |
urobilin | [no description available] | medium | 1 | 0 | | |
xylometazoline | [no description available] | medium | 1 | 0 | alkylbenzene | |
citric acid, anhydrous | [no description available] | medium | 3 | 2 | tricarboxylic acid | antimicrobial agent; chelator; food acidity regulator; fundamental metabolite |
flavanone | [no description available] | medium | 3 | 0 | flavanones | |
trilaurin | [no description available] | medium | 1 | 0 | dodecanoate ester; triglyceride | |
terephthalic acid | [no description available] | medium | 2 | 0 | benzenedicarboxylic acid | |
methane | [no description available] | medium | 5 | 0 | alkane; gas molecular entity; mononuclear parent hydride; one-carbon compound | bacterial metabolite; fossil fuel; greenhouse gas |
theanine | [no description available] | medium | 2 | 0 | amino acid zwitterion; N(5)-alkyl-L-glutamine | geroprotector; neuroprotective agent; plant metabolite |
dimethylhydrazines | [no description available] | medium | 1 | 0 | | |
strontium | [no description available] | medium | 2 | 0 | alkaline earth metal atom | |
lactic acid | [no description available] | medium | 2 | 1 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
butyric acid | [no description available] | medium | 1 | 0 | fatty acid 4:0; straight-chain saturated fatty acid | human urinary metabolite; Mycoplasma genitalium metabolite |
aluminum | [no description available] | medium | 3 | 0 | boron group element atom; elemental aluminium; metal atom | |
inositol | [no description available] | medium | 2 | 0 | cyclitol; hexol | |
oxalates | [no description available] | medium | 5 | 1 | | |
proanthocyanidin | [no description available] | medium | 1 | 0 | | |
potassium chloride | [no description available] | medium | 2 | 0 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
ziprasidone | [no description available] | medium | 1 | 0 | 1,2-benzisothiazole; indolones; organochlorine compound; piperazines | antipsychotic agent; dopaminergic antagonist; histamine antagonist; muscarinic antagonist; psychotropic drug; serotonergic antagonist |
thiazoles | [no description available] | medium | 3 | 0 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
phenol | [no description available] | medium | 1 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
epicatechin gallate | [no description available] | medium | 1 | 0 | catechin; gallate ester; polyphenol | EC 3.2.1.1 (alpha-amylase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
malondialdehyde | [no description available] | medium | 2 | 0 | dialdehyde | biomarker |
glucose, (beta-d)-isomer | [no description available] | medium | 1 | 0 | D-glucopyranose | epitope; mouse metabolite |
acteoside | [no description available] | medium | 1 | 0 | catechols; cinnamate ester; disaccharide derivative; glycoside; polyphenol | anti-inflammatory agent; antibacterial agent; antileishmanial agent; neuroprotective agent; plant metabolite |
3-hydroxyflavone | [no description available] | medium | 5 | 3 | flavonols; monohydroxyflavone | |
simvastatin | [no description available] | medium | 1 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; statin (semi-synthetic) | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; ferroptosis inducer; geroprotector; prodrug |
incarvillateine | [no description available] | medium | 2 | 0 | | |
1-anilino-8-naphthalenesulfonate | [no description available] | medium | 1 | 0 | aminonaphthalene; naphthalenesulfonic acid | fluorescent probe |
pectins | [no description available] | medium | 2 | 0 | D-galactopyranuronic acid | |
sodium fluoride | [no description available] | medium | 1 | 1 | fluoride salt | mutagen |
sm 346 | [no description available] | medium | 1 | 0 | | |
catechin gallate | [no description available] | medium | 1 | 0 | flavans; gallate ester; polyphenol | metabolite |
tripalmitin | [no description available] | medium | 1 | 0 | triglyceride | |
enkephalin, ala(2)-mephe(4)-gly(5)- | [no description available] | medium | 2 | 0 | | |
quinazolines | [no description available] | medium | 6 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; quinazolines | |
triazoles | [no description available] | medium | 13 | 0 | 1,2,3-triazole | |
gallocatechol | [no description available] | medium | 2 | 0 | gallocatechin | antioxidant; metabolite; radical scavenger |
nad | [no description available] | medium | 7 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
carbon tetrachloride | [no description available] | medium | 1 | 0 | chlorocarbon; chloromethanes | hepatotoxic agent; refrigerant |
carbene | [no description available] | medium | 2 | 0 | carbene; methanediyl | |
silver | [no description available] | medium | 4 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
verapamil | [no description available] | medium | 6 | 0 | aromatic ether; nitrile; polyether; tertiary amino compound | |
hydrogen | [no description available] | medium | 4 | 0 | elemental hydrogen; elemental molecule; gas molecular entity | antioxidant; electron donor; food packaging gas; fuel; human metabolite |
betadex | [no description available] | medium | 2 | 0 | cyclodextrin | |
doxofylline | [no description available] | medium | 3 | 0 | oxopurine | anti-asthmatic drug; antitussive; bronchodilator agent |
gold | [no description available] | medium | 1 | 0 | copper group element atom; elemental gold | |
muramidase | [no description available] | medium | 2 | 0 | | |
procyanidin b2 | [no description available] | medium | 1 | 0 | biflavonoid; hydroxyflavan; polyphenol; proanthocyanidin | antioxidant; metabolite |
tert-butylhydroperoxide | [no description available] | medium | 1 | 0 | alkyl hydroperoxide | antibacterial agent; oxidising agent |
sulfur dioxide | [no description available] | medium | 1 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
suramin | [no description available] | medium | 5 | 0 | naphthalenesulfonic acid; phenylureas; secondary carboxamide | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
clobutinol | [no description available] | medium | 1 | 0 | benzenes; organic amino compound | |
dextromethorphan | [no description available] | medium | 1 | 0 | 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene | antitussive; environmental contaminant; neurotoxin; NMDA receptor antagonist; oneirogen; prodrug; xenobiotic |
codeine | [no description available] | medium | 4 | 1 | morphinane alkaloid; organic heteropentacyclic compound | antitussive; drug allergen; environmental contaminant; opioid analgesic; opioid receptor agonist; prodrug; xenobiotic |
cyclopentane | [no description available] | medium | 1 | 0 | cycloalkane; cyclopentanes; volatile organic compound | non-polar solvent |
2-(4-(2-carboxyethyl)phenethylamino)-5'-n-ethylcarboxamidoadenosine | [no description available] | medium | 37 | 1 | adenosines; dicarboxylic acid monoamide; monocarboxylic acid | adenosine A2A receptor agonist; anti-inflammatory agent |
naloxone | [no description available] | medium | 6 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary alcohol | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
morphine | [no description available] | medium | 7 | 1 | morphinane alkaloid; organic heteropentacyclic compound; tertiary amino compound | anaesthetic; drug allergen; environmental contaminant; geroprotector; mu-opioid receptor agonist; opioid analgesic; plant metabolite; vasodilator agent; xenobiotic |
alpha,beta-methyleneadenosine 5'-triphosphate | [no description available] | medium | 5 | 0 | nucleoside triphosphate analogue | |
glutamic acid | [no description available] | medium | 4 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
acetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid | antimicrobial food preservative; Daphnia magna metabolite; food acidity regulator; protic solvent |
urea | [no description available] | medium | 7 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
alloxan | [no description available] | medium | 1 | 0 | pyrimidone | hyperglycemic agent; metabolite |
tannins | [no description available] | medium | 6 | 0 | | |
xanthosine | [no description available] | medium | 2 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
quinic acid | [no description available] | medium | 1 | 0 | | |
acridine orange | [no description available] | medium | 2 | 0 | aminoacridines; aromatic amine; tertiary amino compound | fluorochrome; histological dye |
chlorophyll a | [no description available] | medium | 1 | 0 | chlorophyll; methyl ester | cofactor |
formaldehyde | [no description available] | medium | 4 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
niacinamide | [no description available] | medium | 6 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
resorcinol | [no description available] | medium | 1 | 0 | benzenediol; phenolic donor; resorcinols | erythropoietin inhibitor; sensitiser |
n(6)-cyclohexyladenosine | [no description available] | medium | 11 | 0 | | |
methylcellulose | [no description available] | medium | 3 | 0 | | |
ovalbumin | [no description available] | medium | 2 | 0 | | |
isonicotinamide | [no description available] | medium | 1 | 0 | pyridinecarboxamide | |
2,4-diaminopyrimidine | [no description available] | medium | 1 | 0 | aminopyrimidine | |
cyclic gmp | [no description available] | medium | 6 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
arginine methyl ester | [no description available] | medium | 1 | 0 | alpha-amino acid ester | |
6-cyano-7-nitroquinoxaline-2,3-dione | [no description available] | medium | 2 | 0 | quinoxaline derivative | |
valine | [no description available] | medium | 1 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
esmolol | [no description available] | medium | 1 | 0 | aromatic ether; ethanolamines; methyl ester; secondary alcohol; secondary amino compound | |
aspartame | [no description available] | medium | 1 | 0 | carboxylic acid; dipeptide zwitterion; dipeptide; methyl ester | apoptosis inhibitor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; environmental contaminant; micronutrient; nutraceutical; sweetening agent; xenobiotic |
salicylic acid | [no description available] | medium | 4 | 0 | monohydroxybenzoic acid | algal metabolite; antifungal agent; antiinfective agent; EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor; keratolytic drug; plant hormone; plant metabolite |
benzoic acid | [no description available] | medium | 2 | 0 | benzoic acids | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
ginsenosides | [no description available] | medium | 1 | 0 | | |
tricalcium phosphate | [no description available] | medium | 1 | 1 | calcium phosphate | |
erythrosine | [no description available] | medium | 2 | 0 | | |
procyanidin b5 | [no description available] | medium | 1 | 0 | biflavonoid; hydroxyflavan; polyphenol; proanthocyanidin | metabolite |
adenosine diphosphate | [no description available] | medium | 12 | 2 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
5'-adenylyl (beta,gamma-methylene)diphosphonate | [no description available] | medium | 2 | 0 | nucleoside triphosphate analogue | |
phosphorus radioisotopes | [no description available] | medium | 1 | 0 | | |
apyrase | [no description available] | medium | 1 | 0 | | |
zm 241385 | [no description available] | medium | 5 | 0 | diamino-1,3,5-triazine | |
2-toluidine | [no description available] | medium | 1 | 0 | aminotoluene | carcinogenic agent |
protocatechuic acid | [no description available] | medium | 1 | 0 | catechols; dihydroxybenzoic acid | antineoplastic agent; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor; human xenobiotic metabolite; plant metabolite |
dihydro-beta-erythroidine | [no description available] | medium | 1 | 0 | delta-lactone; organic heterotetracyclic compound; tertiary amino compound | nicotinic antagonist |
tubocurarine | [no description available] | medium | 1 | 0 | bisbenzylisoquinoline alkaloid | drug allergen; muscle relaxant; nicotinic antagonist |
ethidium | [no description available] | medium | 1 | 0 | phenanthridines | fluorochrome; intercalator |
thioperamide | [no description available] | medium | 1 | 0 | primary aliphatic amine | |
ranitidine | [no description available] | medium | 1 | 0 | C-nitro compound; furans; organic sulfide; tertiary amino compound | anti-ulcer drug; drug allergen; environmental contaminant; H2-receptor antagonist; xenobiotic |
piperidines | [no description available] | medium | 4 | 0 | | |
substance p | [no description available] | medium | 3 | 0 | peptide | neurokinin-1 receptor agonist; neurotransmitter; vasodilator agent |
decursin | [no description available] | medium | 1 | 0 | coumarins | |
yohimbine | [no description available] | medium | 3 | 0 | methyl 17-hydroxy-20xi-yohimban-16-carboxylate | alpha-adrenergic antagonist; dopamine receptor D2 antagonist; serotonergic antagonist |
cyproheptadine | [no description available] | medium | 1 | 0 | piperidines; tertiary amine | anti-allergic agent; antipruritic drug; gastrointestinal drug; H1-receptor antagonist; serotonergic antagonist |
methysergide | [no description available] | medium | 1 | 0 | ergoline alkaloid | |
1,3-dipropyl-8-(2-amino-4-chlorophenyl)xanthine | [no description available] | medium | 7 | 0 | | |
hydroxyl radical | [no description available] | medium | 1 | 0 | oxygen hydride; oxygen radical; reactive oxygen species | |
phenacetin | [no description available] | medium | 4 | 0 | acetamides; aromatic ether | cyclooxygenase 3 inhibitor; non-narcotic analgesic; peripheral nervous system drug |
4-aminobenzoic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
hyaluronoglucosaminidase | [no description available] | medium | 1 | 0 | | |
barbituric acid | [no description available] | medium | 1 | 0 | barbiturates | allergen; xenobiotic |
cosaldon | [no description available] | medium | 15 | 1 | | |
cardiovascular agents | [no description available] | medium | 4 | 0 | | |
digoxin | [no description available] | medium | 6 | 1 | cardenolide glycoside; steroid saponin | anti-arrhythmia drug; cardiotonic drug; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; epitope |
calcium gluconate | [no description available] | medium | 1 | 0 | calcium salt | nutraceutical |
histamine | [no description available] | medium | 7 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
sulfobromophthalein | [no description available] | medium | 1 | 0 | 2-benzofurans; organobromine compound; organosulfonic acid; phenols | dye |
pentifylline | [no description available] | medium | 18 | 2 | oxopurine | |
niacin | [no description available] | medium | 15 | 3 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
retinol | [no description available] | medium | 8 | 3 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
ammonium chloride | [no description available] | medium | 2 | 0 | ammonium salt; inorganic chloride | ferroptosis inhibitor |
chlorine | [no description available] | medium | 6 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
nitrates | [no description available] | medium | 2 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | |
copper gluconate | [no description available] | medium | 2 | 1 | organic molecular entity | |
benactyzine | [no description available] | medium | 6 | 3 | diarylmethane | |
thiophenes | [no description available] | medium | 1 | 0 | mancude organic heteromonocyclic parent; monocyclic heteroarene; thiophenes; volatile organic compound | non-polar solvent |
mercaptopurine | [no description available] | medium | 3 | 0 | aryl thiol; purines; thiocarbonyl compound | anticoronaviral agent; antimetabolite; antineoplastic agent |
pyrimidine | [no description available] | medium | 1 | 0 | diazine; pyrimidines | Daphnia magna metabolite |
methyl-1alpha, 7alpha-dihydroxy-3-oxopregn-4-en-21-oate | [no description available] | medium | 1 | 0 | | |
tyrosine | [no description available] | medium | 2 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
creatine | [no description available] | medium | 2 | 0 | glycine derivative; guanidines; zwitterion | geroprotector; human metabolite; mouse metabolite; neuroprotective agent; nutraceutical |
cystine | [no description available] | medium | 1 | 0 | | |
metformin | [no description available] | medium | 1 | 0 | guanidines | environmental contaminant; geroprotector; hypoglycemic agent; xenobiotic |
d-alpha tocopherol | [no description available] | medium | 8 | 3 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
streptomycin | [no description available] | medium | 2 | 0 | antibiotic antifungal drug; antibiotic fungicide; streptomycins | antibacterial drug; antifungal agrochemical; antimicrobial agent; antimicrobial drug; bacterial metabolite; protein synthesis inhibitor |
tetracycline | [no description available] | medium | 2 | 0 | | |
iodine | [no description available] | medium | 9 | 0 | diatomic iodine | nutrient |
procaine | [no description available] | medium | 3 | 0 | benzoate ester; substituted aniline; tertiary amino compound | central nervous system depressant; drug allergen; local anaesthetic; peripheral nervous system drug |
thymidine | [no description available] | medium | 5 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
methylene blue | [no description available] | medium | 1 | 0 | organic chloride salt | acid-base indicator; antidepressant; antimalarial; antimicrobial agent; antioxidant; cardioprotective agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 4.6.1.2 (guanylate cyclase) inhibitor; fluorochrome; histological dye; neuroprotective agent; physical tracer |
methazolamide | [no description available] | medium | 2 | 0 | sulfonamide; thiadiazoles | |
lysine | [no description available] | medium | 1 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
mannitol | [no description available] | medium | 2 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
dichlorphenamide | [no description available] | medium | 1 | 0 | dichlorobenzene; sulfonamide | antiglaucoma drug; EC 4.2.1.1 (carbonic anhydrase) inhibitor; ophthalmology drug |
arsenic | [no description available] | medium | 1 | 0 | metalloid atom; pnictogen | micronutrient |
glyceraldehyde | [no description available] | medium | 1 | 0 | aldotriose | fundamental metabolite |
mercury | [no description available] | medium | 2 | 0 | elemental mercury; zinc group element atom | neurotoxin |
cyanides | [no description available] | medium | 4 | 0 | pseudohalide anion | EC 1.9.3.1 (cytochrome c oxidase) inhibitor |
aminosalicylic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; phenols | antitubercular agent |
sodium salicylate | [no description available] | medium | 5 | 0 | organic molecular entity | |
sulfanilamide | [no description available] | medium | 1 | 0 | substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; drug allergen; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
enkephalin, methionine | [no description available] | medium | 1 | 0 | | |
enkephalinamide-met, ala(2)- | [no description available] | medium | 1 | 0 | | |
pentaerythritol tetranitrate | [no description available] | medium | 2 | 0 | pentaerythritol nitrate | explosive; vasodilator agent |
nitroglycerin | [no description available] | medium | 3 | 0 | nitroglycerol | explosive; muscle relaxant; nitric oxide donor; prodrug; tocolytic agent; vasodilator agent; xenobiotic |
thiamine | [no description available] | medium | 3 | 1 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cellulose | [no description available] | medium | 2 | 0 | glycoside | |
caffeine citrate | [no description available] | medium | 1 | 0 | | |
choline | [no description available] | medium | 2 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
atropine | [no description available] | medium | 3 | 1 | | |
dyphylline | [no description available] | medium | 4 | 0 | oxopurine; propane-1,2-diols | bronchodilator agent; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; muscle relaxant; vasodilator agent |
adenosine kinase | [no description available] | medium | 3 | 0 | | |
malonic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid | human metabolite |
trigonelline | [no description available] | medium | 2 | 0 | alkaloid; iminium betaine | food component; human urinary metabolite; plant metabolite |
potassium iodide | [no description available] | medium | 1 | 0 | potassium salt | expectorant; radical scavenger |
iodine | [no description available] | medium | 4 | 0 | halide anion; monoatomic iodine | human metabolite |
salicylates | [no description available] | medium | 8 | 0 | monohydroxybenzoate | plant metabolite |
chloroform | [no description available] | medium | 2 | 0 | chloromethanes; one-carbon compound | carcinogenic agent; central nervous system drug; inhalation anaesthetic; non-polar solvent; refrigerant |
8-cyclopropyltheophylline | [no description available] | medium | 1 | 0 | | |
mrs 1191 | [no description available] | medium | 1 | 0 | cinnamate ester | |
dihydropyridines | [no description available] | medium | 1 | 0 | | |
picrotoxin | [no description available] | medium | 2 | 0 | | |
8-(dicyclopropylmethyl)-1,3-dipropylxanthine | [no description available] | medium | 1 | 0 | | |
fura-2 | [no description available] | medium | 5 | 0 | | |
dextroamphetamine | [no description available] | medium | 3 | 0 | 1-phenylpropan-2-amine | adrenergic agent; adrenergic uptake inhibitor; dopamine uptake inhibitor; dopaminergic agent; neurotoxin; sympathomimetic agent |
thioinosine | [no description available] | medium | 3 | 0 | | |
9-(2-hydroxy-3-nonyl)adenine | [no description available] | medium | 2 | 0 | | |
5,5',6,6'-tetrachloro-1,1',3,3'-tetraethylbenzimidazolocarbocyanine | [no description available] | medium | 1 | 0 | cyanine dye; indolium ion | fluorochrome |
carbocyanines | [no description available] | medium | 1 | 0 | cyanine dye; organic iodide salt | fluorochrome |
sincalide | [no description available] | medium | 1 | 0 | oligopeptide | |
pentobarbital | [no description available] | medium | 3 | 0 | barbiturates | GABAA receptor agonist |
heroin | [no description available] | medium | 1 | 1 | morphinane alkaloid | mu-opioid receptor agonist; opioid analgesic; prodrug |
methadone | [no description available] | medium | 2 | 1 | benzenes; diarylmethane; ketone; tertiary amino compound | |
sumatriptan | [no description available] | medium | 1 | 0 | sulfonamide; tryptamines | serotonergic agonist; vasoconstrictor agent |
technetium tc 99m exametazime | [no description available] | medium | 1 | 0 | | |
adenosine monophosphate | [no description available] | medium | 2 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | adenosine A1 receptor agonist; cofactor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.11 (fructose-bisphosphatase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
3-o-methylglucose | [no description available] | medium | 1 | 0 | D-aldohexose derivative | |
p-aminohippuric acid | [no description available] | medium | 1 | 0 | N-acylglycine | Daphnia magna metabolite |
fluoxetine | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; aromatic ether; secondary amino compound | |
delphinidin | [no description available] | medium | 1 | 0 | 5-hydroxyanthocyanidin | antineoplastic agent; biological pigment; plant metabolite |
cyanidin | [no description available] | medium | 1 | 0 | 5-hydroxyanthocyanidin | antioxidant; metabolite; neuroprotective agent |
linalool | [no description available] | medium | 1 | 0 | monoterpenoid; tertiary alcohol | antimicrobial agent; fragrance; plant metabolite; volatile oil component |
propylene glycol | [no description available] | medium | 1 | 0 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
am-356 | [no description available] | medium | 1 | 0 | fatty amide | |
mrs 1220 | [no description available] | medium | 2 | 0 | quinazolines | |
ng-nitroarginine methyl ester | [no description available] | medium | 4 | 0 | alpha-amino acid ester; L-arginine derivative; methyl ester; N-nitro compound | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
thioacetamide | [no description available] | medium | 1 | 0 | thiocarboxamide | hepatotoxic agent |
istradefylline | [no description available] | medium | 2 | 0 | oxopurine | |
scopolamine hydrobromide | [no description available] | medium | 3 | 1 | | |
n,n-dimethyltryptamine | [no description available] | medium | 1 | 1 | tryptamine alkaloid; tryptamines | |
bufotenin | [no description available] | medium | 1 | 1 | tertiary amine; tryptamine alkaloid | coral metabolite; hallucinogen |
xanthenes | [no description available] | medium | 5 | 0 | xanthene | |
nadp | [no description available] | medium | 3 | 0 | | |
cgs 24012 | [no description available] | medium | 9 | 0 | | |
propranolol | [no description available] | medium | 11 | 0 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
pemetrexed | [no description available] | medium | 1 | 0 | N-acyl-L-glutamic acid; pyrrolopyrimidine | antimetabolite; antineoplastic agent; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; EC 2.1.1.45 (thymidylate synthase) inhibitor; EC 2.1.2.2 (phosphoribosylglycinamide formyltransferase) inhibitor |
rolofylline | [no description available] | medium | 1 | 0 | oxopurine | |
3-(3,4-dimethoxyphenyl)propenoic acid | [no description available] | medium | 1 | 0 | methoxycinnamic acid | |
quinine | [no description available] | medium | 5 | 0 | cinchona alkaloid | antimalarial; muscle relaxant; non-narcotic analgesic |
denatonium benzoate | [no description available] | medium | 1 | 0 | | |
glycyl-l-phenylalanine | [no description available] | medium | 1 | 0 | dipeptide zwitterion; dipeptide | human metabolite; metabolite |
acid phosphatase | [no description available] | medium | 2 | 0 | | |
ubiquinone | [no description available] | medium | 1 | 0 | | |
salicylsalicylic acid | [no description available] | medium | 1 | 0 | benzoate ester; benzoic acids; phenols; salicylates | antineoplastic agent; antirheumatic drug; EC 3.5.2.6 (beta-lactamase) inhibitor; hypoglycemic agent; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
cytidine | [no description available] | medium | 1 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
antipyrine | [no description available] | medium | 4 | 0 | pyrazolone | antipyretic; cyclooxygenase 3 inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
propyphenazone | [no description available] | medium | 1 | 0 | pyrazolone | non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
sucrose | [no description available] | medium | 1 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
docusate | [no description available] | medium | 1 | 0 | diester; organosulfonic acid | |
3-methoxybenzamide | [no description available] | medium | 1 | 0 | | |
chloroquine | [no description available] | medium | 1 | 0 | aminoquinoline; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; antirheumatic drug; autophagy inhibitor; dermatologic drug |
5-methylnicotinamide | [no description available] | medium | 1 | 0 | | |
ici 63197 | [no description available] | medium | 1 | 0 | triazolopyrimidines | |
D-fructopyranose | [no description available] | medium | 2 | 1 | cyclic hemiketal; D-fructose; fructopyranose | sweetening agent |
potassium cyanide | [no description available] | medium | 2 | 0 | cyanide salt; one-carbon compound; potassium salt | EC 1.15.1.1 (superoxide dismutase) inhibitor; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; neurotoxin |
isoproterenol | [no description available] | medium | 12 | 0 | catechols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; sympathomimetic agent |
pituitrin | [no description available] | medium | 1 | 0 | | |
bucladesine | [no description available] | medium | 16 | 0 | 3',5'-cyclic purine nucleotide | |
dihydroergotoxine | [no description available] | medium | 5 | 2 | | |
dihydroalprenolol | [no description available] | medium | 1 | 0 | | |
mopidamol | [no description available] | medium | 2 | 0 | dialkylarylamine; tertiary amino compound | |
suloctidil | [no description available] | medium | 1 | 0 | | |
diltiazem | [no description available] | medium | 2 | 0 | 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate | antihypertensive agent; calcium channel blocker; vasodilator agent |
deuterium | [no description available] | medium | 2 | 0 | dihydrogen | |
deuterium oxide | [no description available] | medium | 1 | 0 | deuterated compound; water | NMR solvent |
vitamin a, pentifyllin, nicotinic acid, and vitamin e combination | [no description available] | medium | 6 | 2 | | |
xenon radioisotopes | [no description available] | medium | 4 | 3 | | |
hexobendine | [no description available] | medium | 2 | 1 | trihydroxybenzoic acid | |
etofylline | [no description available] | medium | 3 | 1 | oxopurine | |
fibrinogen | [no description available] | medium | 19 | 2 | iditol | fungal metabolite |
flunarizine | [no description available] | medium | 1 | 1 | diarylmethane | |
sulfur | [no description available] | medium | 1 | 0 | chalcogen; nonmetal atom | macronutrient |
mesterolone | [no description available] | medium | 1 | 1 | 3-oxo-5alpha-steroid | |
dihydrotestosterone | [no description available] | medium | 1 | 1 | 17beta-hydroxy steroid; 17beta-hydroxyandrostan-3-one; 3-oxo-5alpha-steroid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
enclomiphene | [no description available] | medium | 1 | 1 | | |
thiotepa | [no description available] | medium | 4 | 0 | aziridines | |
sodium hydroxide | [no description available] | medium | 1 | 0 | alkali metal hydroxide | |
thromboxane b2 | [no description available] | medium | 4 | 1 | thromboxanes B | human metabolite; mouse metabolite |
6-ketoprostaglandin f1 alpha | [no description available] | medium | 7 | 2 | prostaglandins Falpha | human metabolite; mouse metabolite |
nafronyl | [no description available] | medium | 5 | 1 | naphthalenes | |
almitrine | [no description available] | medium | 1 | 0 | piperazines; triamino-1,3,5-triazine | central nervous system stimulant |
benfurodil | [no description available] | medium | 1 | 0 | | |
benzofurans | [no description available] | medium | 1 | 0 | | |
almitrine, raubasine drug combination | [no description available] | medium | 1 | 0 | | |
2,3-diphosphoglycerate | [no description available] | medium | 4 | 0 | bisphosphoglyceric acid; tetronic acid derivative | human metabolite |
xanthinol niacinate | [no description available] | medium | 12 | 3 | | |
lisofylline | [no description available] | medium | 8 | 0 | 1-(5-hydroxyhexyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione | anti-inflammatory agent; immunomodulator |
thromboxane a2 | [no description available] | medium | 1 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
arachidonic acid | [no description available] | medium | 3 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
urethane | [no description available] | medium | 1 | 0 | carbamate ester | fungal metabolite; mutagen |
trifluoperazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-methylpiperazine; organofluorine compound; phenothiazines | antiemetic; calmodulin antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; phenothiazine antipsychotic drug |
glucagon | [no description available] | medium | 4 | 0 | peptide hormone | |
buflomedil | [no description available] | medium | 4 | 1 | aromatic ketone | |
nylidrin | [no description available] | medium | 1 | 1 | alkylbenzene | |
gastrins | [no description available] | medium | 2 | 0 | | |
levamisole | [no description available] | medium | 1 | 0 | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | antinematodal drug; antirheumatic drug; EC 3.1.3.1 (alkaline phosphatase) inhibitor; immunological adjuvant; immunomodulator |
thymosin | [no description available] | medium | 1 | 0 | | |
6-amino-5-(formyl-n-methylamino)-1,3-dimethyluracil | [no description available] | medium | 2 | 0 | | |
trifluoroacetic acid | [no description available] | medium | 1 | 0 | fluoroalkanoic acid | human xenobiotic metabolite; NMR chemical shift reference compound; reagent |
methylene chloride | [no description available] | medium | 1 | 0 | chloromethanes; volatile organic compound | carcinogenic agent; polar aprotic solvent; refrigerant |
halothane | [no description available] | medium | 1 | 0 | haloalkane; organobromine compound; organochlorine compound; organofluorine compound | inhalation anaesthetic |
3-methylcholanthrene | [no description available] | medium | 4 | 0 | ortho- and peri-fused polycyclic arene | aryl hydrocarbon receptor agonist; carcinogenic agent |
aminoimidazole carboxamide | [no description available] | medium | 2 | 0 | aminoimidazole; monocarboxylic acid amide | mouse metabolite |
aica ribonucleotide | [no description available] | medium | 2 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
gp 1-515 | [no description available] | medium | 1 | 0 | | |
s-adenosylhomocysteine | [no description available] | medium | 2 | 0 | adenosines; amino acid zwitterion; homocysteine derivative; homocysteines; organic sulfide | cofactor; EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor; EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor; epitope; fundamental metabolite |
s-adenosylmethionine | [no description available] | medium | 4 | 0 | organic cation; sulfonium compound | coenzyme; cofactor; human metabolite; micronutrient; Mycoplasma genitalium metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
web 2086 | [no description available] | medium | 1 | 0 | organonitrogen heterocyclic compound; organosulfur heterocyclic compound | |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine | [no description available] | medium | 2 | 0 | 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine | antihypertensive agent; beta-adrenergic antagonist; bronchoconstrictor agent; hematologic agent; vasodilator agent |
glyoxal | [no description available] | medium | 2 | 0 | dialdehyde | agrochemical; allergen; pesticide; plant growth regulator |
pyruvaldehyde | [no description available] | medium | 1 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
diethylnitrosamine | [no description available] | medium | 1 | 0 | nitrosamine | carcinogenic agent; hepatotoxic agent; mutagen |
2-aminopurine | [no description available] | medium | 1 | 0 | 2-aminopurines; nucleobase analogue | antimetabolite |
dantrolene | [no description available] | medium | 1 | 0 | hydrazone; imidazolidine-2,4-dione | muscle relaxant; neuroprotective agent; ryanodine receptor antagonist |
2-chloro-n(6)cyclopentyladenosine | [no description available] | medium | 6 | 0 | | |
deoxyglucose | [no description available] | medium | 1 | 0 | | |
phenethylamine | [no description available] | medium | 1 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phenethylamine | [no description available] | medium | 1 | 1 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
beta-carboline-3-carboxylic acid ethyl ester | [no description available] | medium | 1 | 0 | beta-carbolines | |
midazolam | [no description available] | medium | 1 | 0 | imidazobenzodiazepine; monofluorobenzenes; organochlorine compound | anticonvulsant; antineoplastic agent; anxiolytic drug; apoptosis inducer; central nervous system depressant; GABAA receptor agonist; general anaesthetic; muscle relaxant; sedative |
tetrodotoxin | [no description available] | medium | 3 | 0 | azatetracycloalkane; oxatetracycloalkane; quinazoline alkaloid | animal metabolite; bacterial metabolite; marine metabolite; neurotoxin; voltage-gated sodium channel blocker |
oxidopamine | [no description available] | medium | 2 | 0 | benzenetriol; catecholamine; primary amino compound | drug metabolite; human metabolite; neurotoxin |
gentamicin | [no description available] | medium | 2 | 0 | | |
phenylephrine | [no description available] | medium | 1 | 0 | phenols; phenylethanolamines; secondary amino compound | alpha-adrenergic agonist; cardiotonic drug; mydriatic agent; nasal decongestant; protective agent; sympathomimetic agent; vasoconstrictor agent |
arginine vasopressin | [no description available] | medium | 1 | 0 | vasopressin | cardiovascular drug; hematologic agent; mitogen |
trimethadione | [no description available] | medium | 1 | 0 | oxazolidinone | anticonvulsant; geroprotector |
bilirubin | [no description available] | medium | 1 | 0 | biladienes; dicarboxylic acid | antioxidant; human metabolite; mouse metabolite |
quinpirole | [no description available] | medium | 1 | 0 | pyrazoloquinoline | dopamine agonist |
ergoline | [no description available] | medium | 2 | 1 | diamine; ergoline alkaloid; indole alkaloid fundamental parent; indole alkaloid; organic heterotetracyclic compound | |
guanethidine | [no description available] | medium | 2 | 0 | azocanes; guanidines | adrenergic antagonist; antihypertensive agent; sympatholytic agent |
diadenosine 5',5''''-p1,p6-hexaphosphate | [no description available] | medium | 1 | 0 | diadenosyl hexaphosphate | vasoconstrictor agent |
nickel chloride | [no description available] | medium | 1 | 0 | nickel coordination entity | calcium channel blocker; hapten |
nickel | [no description available] | medium | 1 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
manganese | [no description available] | medium | 2 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
p(1),p(5)-di(adenosine-5'-)pentaphosphate | [no description available] | medium | 2 | 0 | organophosphate oxoanion | |
d 609 | [no description available] | medium | 1 | 0 | | |
brotizolam | [no description available] | medium | 1 | 1 | organic molecular entity | |
irinotecan | [no description available] | medium | 1 | 0 | carbamate ester; delta-lactone; N-acylpiperidine; pyranoindolizinoquinoline; ring assembly; tertiary alcohol; tertiary amino compound | antineoplastic agent; apoptosis inducer; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
phosphorus | [no description available] | medium | 3 | 0 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
hydrogen cyanide | [no description available] | medium | 1 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
iberiotoxin | [no description available] | medium | 1 | 0 | | |
omega-agatoxin iva | [no description available] | medium | 1 | 0 | | |
5-iodotubercidin | [no description available] | medium | 1 | 0 | organoiodine compound | |
amiloride | [no description available] | medium | 3 | 0 | aromatic amine; guanidines; organochlorine compound; pyrazines | diuretic; sodium channel blocker |
mocetinostat | [no description available] | medium | 1 | 0 | aminopyrimidine; benzamides; pyridines; secondary amino compound; secondary carboxamide; substituted aniline | antineoplastic agent; apoptosis inducer; autophagy inducer; cardioprotective agent; EC 3.5.1.98 (histone deacetylase) inhibitor; hepatotoxic agent |
sodium dodecyl sulfate | [no description available] | medium | 1 | 0 | organic sodium salt | detergent; protein denaturant |
glycine | [no description available] | medium | 2 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
glycogen | [no description available] | medium | 3 | 0 | | |
proadifen | [no description available] | medium | 3 | 0 | diarylmethane | |
methimazole | [no description available] | medium | 1 | 0 | 1,3-dihydroimidazole-2-thiones | antithyroid drug |
n-(1-methyl-2-phenylethyl)adenosine | [no description available] | medium | 6 | 0 | | |
8-chlorotheophylline | [no description available] | medium | 2 | 0 | organochlorine compound; purines | central nervous system stimulant |
metoprolol | [no description available] | medium | 3 | 1 | aromatic ether; propanolamine; secondary alcohol; secondary amino compound | antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; geroprotector; xenobiotic |
beta-endorphin | [no description available] | medium | 1 | 0 | | |
adenosine amine congener | [no description available] | medium | 1 | 0 | | |
kf 17837s | [no description available] | medium | 1 | 0 | | |
inosine | [no description available] | medium | 6 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
diphenhydramine | [no description available] | medium | 2 | 0 | ether; tertiary amino compound | anti-allergic agent; antidyskinesia agent; antiemetic; antiparkinson drug; antipruritic drug; antitussive; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; oneirogen; sedative |
dibucaine | [no description available] | medium | 2 | 0 | aromatic ether; monocarboxylic acid amide; tertiary amino compound | topical anaesthetic |
zithromax | [no description available] | medium | 1 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; xenobiotic |
amikacin | [no description available] | medium | 1 | 0 | alpha-D-glucoside; amino cyclitol glycoside; aminoglycoside; carboxamide | antibacterial drug; antimicrobial agent; nephrotoxin |
nicorandil | [no description available] | medium | 2 | 0 | nitrate ester; pyridinecarboxamide | potassium channel opener; vasodilator agent |
cromakalim | [no description available] | medium | 1 | 0 | | |
neutral red | [no description available] | medium | 1 | 0 | hydrochloride | acid-base indicator; dye; two-colour indicator |
4-anisyltetrazolium blue | [no description available] | medium | 1 | 0 | organic chloride salt | dye |
coomassie brilliant blue r | [no description available] | medium | 1 | 0 | | |
acebutolol | [no description available] | medium | 1 | 0 | alpha-D-glucosyl-(1->4)-D-mannopyranose | |
vasoactive intestinal peptide | [no description available] | medium | 2 | 0 | | |
quipazine | [no description available] | medium | 1 | 0 | piperazines; pyridines | |
6-nitroquipazine | [no description available] | medium | 1 | 0 | nitro compound; quinolines | |
dinitrobenzenes | [no description available] | medium | 1 | 0 | | |
sulfasalazine | [no description available] | medium | 1 | 0 | | |
2-methylthio-atp | [no description available] | medium | 2 | 0 | | |
fluorescein | [no description available] | medium | 2 | 0 | 2-benzofurans; gamma-lactone; organic heteropentacyclic compound; oxaspiro compound; polyphenol; xanthene dye | fluorescent dye; radioopaque medium |
1,4-dioxane | [no description available] | medium | 1 | 0 | dioxane; volatile organic compound | carcinogenic agent; metabolite; NMR chemical shift reference compound; non-polar solvent |
sulforhodamine 101 | [no description available] | medium | 1 | 0 | organic heteroheptacyclic compound | fluorochrome |
fluo-3 | [no description available] | medium | 1 | 0 | xanthene dye | fluorochrome |
2-(2-(5-carboxy)oxazole)-5-hydroxy-6-aminobenzofuran-n,n,o-triacetic acid | [no description available] | medium | 1 | 0 | | |
pyrroles | [no description available] | medium | 1 | 0 | pyrrole; secondary amine | |
kt 5720 | [no description available] | medium | 1 | 0 | carboxylic ester; gamma-lactam; hemiaminal; indolocarbazole; organic heterooctacyclic compound; semisynthetic derivative; tertiary alcohol | EC 2.7.11.11 (cAMP-dependent protein kinase) inhibitor |
n-formylmethionine leucyl-phenylalanine | [no description available] | medium | 6 | 0 | tripeptide | |
buspirone | [no description available] | medium | 1 | 0 | azaspiro compound; N-alkylpiperazine; N-arylpiperazine; organic heteropolycyclic compound; piperidones; pyrimidines | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
adenosine-3',5'-cyclic phosphorothioate | [no description available] | medium | 1 | 0 | nucleoside 3',5'-cyclic phosphorothioate | |
nan 190 | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-arylpiperazine; phthalimides | serotonergic antagonist |
fk 838 | [no description available] | medium | 1 | 0 | | |
ornithine | [no description available] | medium | 1 | 0 | non-proteinogenic L-alpha-amino acid; ornithine | algal metabolite; hepatoprotective agent; mouse metabolite |
2-((2-aminoethylamino)carbonylethylphenylethylamino)-5'-n-ethylcarboxamidoadenosine | [no description available] | medium | 1 | 0 | | |
cocaine | [no description available] | medium | 12 | 2 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
cocaine | [no description available] | medium | 12 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
5'-amino-5'-deoxyadenosine | [no description available] | medium | 1 | 0 | | |
pentostatin | [no description available] | medium | 1 | 0 | coformycins | antimetabolite; antineoplastic agent; Aspergillus metabolite; bacterial metabolite; EC 3.5.4.4 (adenosine deaminase) inhibitor |
ascorbic acid | [no description available] | medium | 3 | 1 | ascorbic acid; vitamin C | coenzyme; cofactor; flour treatment agent; food antioxidant; food colour retention agent; geroprotector; plant metabolite; skin lightening agent |
benzydamine | [no description available] | medium | 1 | 0 | aromatic ether; indazoles; tertiary amino compound | analgesic; central nervous system stimulant; hallucinogen; local anaesthetic; non-steroidal anti-inflammatory drug |
benzydamine n-oxide | [no description available] | medium | 1 | 0 | | |
pyridoxal phosphate-6-azophenyl-2',4'-disulfonic acid | [no description available] | medium | 3 | 0 | arenesulfonic acid; azobenzenes; methylpyridines; monohydroxypyridine; organic phosphate; pyridinecarbaldehyde | purinergic receptor P2X antagonist |
pyridoxal phosphate | [no description available] | medium | 3 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyrrolidonecarboxylic acid | [no description available] | medium | 1 | 0 | 5-oxoproline; L-proline derivative; non-proteinogenic L-alpha-amino acid | algal metabolite |
pyroglutamyl-glutamyl-proline amide | [no description available] | medium | 1 | 0 | oligopeptide | |
phenyl acetate | [no description available] | medium | 2 | 0 | benzenes; phenyl acetates | |
angiotensin ii | [no description available] | medium | 3 | 0 | amino acid zwitterion; angiotensin II | human metabolite |
coenzyme a | [no description available] | medium | 1 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
mercaptoethanol | [no description available] | medium | 1 | 0 | alkanethiol; primary alcohol | geroprotector |
5-aminovaleric acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; delta-amino acid; omega-amino fatty acid | human metabolite |
cadmium | [no description available] | medium | 1 | 0 | cadmium molecular entity; zinc group element atom | |
n-methylnicotinamide | [no description available] | medium | 1 | 0 | pyridinecarboxamide | metabolite |
acetaldehyde | [no description available] | medium | 1 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
hypoxanthine | [no description available] | medium | 1 | 0 | nucleobase analogue; oxopurine; purine nucleobase | fundamental metabolite |
n(6)-(3-iodobenzyl)-5'-n-methylcarboxamidoadenosine | [no description available] | medium | 2 | 0 | adenosines; monocarboxylic acid amide; organoiodine compound | adenosine A3 receptor agonist |
1-methyl-4-phenyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | methylpyridines; phenylpyridine; tetrahydropyridine | neurotoxin |
methylmethacrylate | [no description available] | medium | 1 | 0 | enoate ester; methyl ester | allergen; polymerisation monomer |
hydroxycitric acid | [no description available] | medium | 1 | 0 | carbonyl compound | |
picolinic acid | [no description available] | medium | 1 | 0 | pyridinemonocarboxylic acid | human metabolite; MALDI matrix material |
oxazoles | [no description available] | medium | 1 | 0 | 1,3-oxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
xestospongin a | [no description available] | medium | 1 | 0 | | |
warfarin | [no description available] | medium | 5 | 2 | benzenes; hydroxycoumarin; methyl ketone | |
homocysteine | [no description available] | medium | 1 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
fluorescein-5-isothiocyanate | [no description available] | medium | 1 | 0 | fluorescein isothiocyanate | |
bradykinin | [no description available] | medium | 1 | 0 | oligopeptide | human blood serum metabolite; vasodilator agent |
levoleucovorin | [no description available] | medium | 1 | 0 | 5-formyltetrahydrofolic acid | antineoplastic agent; metabolite |
gr 73632 | [no description available] | medium | 1 | 0 | | |
p-methoxy-n-methylphenethylamine | [no description available] | medium | 1 | 0 | aromatic ether; secondary amino compound | metabolite |
sr 140333 | [no description available] | medium | 1 | 0 | | |
quinuclidines | [no description available] | medium | 1 | 0 | quinuclidines; saturated organic heterobicyclic parent | |
4,4'-diisothiocyanostilbene-2,2'-disulfonic acid | [no description available] | medium | 1 | 0 | | |
aldosterone | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
n 0861 | [no description available] | medium | 1 | 0 | | |
ceruletide | [no description available] | medium | 1 | 0 | oligopeptide | diagnostic agent; gastrointestinal drug |
phentermine | [no description available] | medium | 1 | 0 | primary amine | adrenergic agent; appetite depressant; central nervous system drug; central nervous system stimulant; dopaminergic agent; sympathomimetic agent |
clomipramine | [no description available] | medium | 1 | 0 | dibenzoazepine | anticoronaviral agent; antidepressant; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; serotonergic antagonist; serotonergic drug; serotonin uptake inhibitor |
thiazolyl blue | [no description available] | medium | 1 | 0 | organic bromide salt | colorimetric reagent; dye |
idazoxan | [no description available] | medium | 1 | 0 | benzodioxine; imidazolines | alpha-adrenergic antagonist |
6-anilino-5,8-quinolinedione | [no description available] | medium | 1 | 0 | aminoquinoline; aromatic amine; p-quinones; quinolone | antineoplastic agent; EC 4.6.1.2 (guanylate cyclase) inhibitor |
guanosine 5'-o-(3-thiotriphosphate) | [no description available] | medium | 1 | 0 | nucleoside triphosphate analogue | |
norpseudoephedrine | [no description available] | medium | 1 | 0 | amphetamines; phenethylamine alkaloid | central nervous system stimulant; plant metabolite; psychotropic drug |
norpseudoephedrine | [no description available] | medium | 1 | 1 | amphetamines; phenethylamine alkaloid | central nervous system stimulant; plant metabolite; psychotropic drug |
phenylpropanolamine | [no description available] | medium | 1 | 1 | amphetamines; phenethylamine alkaloid | plant metabolite |
laminaran | [no description available] | medium | 1 | 0 | | |
epiglucan | [no description available] | medium | 1 | 0 | | |
glutaral | [no description available] | medium | 1 | 0 | dialdehyde | cross-linking reagent; disinfectant; fixative |
leucine | [no description available] | medium | 1 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
lanatosides | [no description available] | medium | 1 | 0 | | |
magnesium sulfate | [no description available] | medium | 1 | 0 | magnesium salt; metal sulfate; organic magnesium salt | anaesthetic; analgesic; anti-arrhythmia drug; anticonvulsant; calcium channel blocker; cardiovascular drug; fertilizer; tocolytic agent |
azauridine | [no description available] | medium | 1 | 0 | N-glycosyl-1,2,4-triazine | antimetabolite; antineoplastic agent; drug metabolite |
phosphatidylcholines | [no description available] | medium | 1 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
bencyclane | [no description available] | medium | 2 | 0 | benzenes | |
nitrites | [no description available] | medium | 2 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | human metabolite |
thallium | [no description available] | medium | 1 | 0 | boron group element atom | |
strychnine | [no description available] | medium | 3 | 0 | monoterpenoid indole alkaloid; organic heteroheptacyclic compound | avicide; cholinergic antagonist; glycine receptor antagonist; neurotransmitter agent; rodenticide |
pyridoxine | [no description available] | medium | 1 | 1 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
riboflavin | [no description available] | medium | 1 | 1 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
deferoxamine | [no description available] | medium | 1 | 0 | acyclic desferrioxamine | bacterial metabolite; ferroptosis inhibitor; iron chelator; siderophore |
edetic acid | [no description available] | medium | 4 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
technetium | [no description available] | medium | 2 | 0 | manganese group element atom | |
bismuth | [no description available] | medium | 2 | 0 | metal atom; pnictogen | |
pregnanediol | [no description available] | medium | 1 | 0 | | |
amobarbital | [no description available] | medium | 2 | 0 | barbiturates | |
cyclandelate | [no description available] | medium | 1 | 0 | carboxylic ester; secondary alcohol | vasodilator agent |
isoxsuprine | [no description available] | medium | 1 | 0 | alkylbenzene | |
meclofenoxate | [no description available] | medium | 2 | 0 | monocarboxylic acid | |
diazepam | [no description available] | medium | 3 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; environmental contaminant; sedative; xenobiotic |
secobarbital | [no description available] | medium | 1 | 0 | barbiturates | anaesthesia adjuvant; GABA modulator; sedative |
neurotensin | [no description available] | medium | 1 | 0 | peptide hormone | human metabolite; mitogen; neurotransmitter; vulnerary |
methamphetamine | [no description available] | medium | 1 | 0 | amphetamines; secondary amine | central nervous system stimulant; environmental contaminant; neurotoxin; psychotropic drug; xenobiotic |
1-deaza-2-chloro-n(6)-cyclopentyladenosine | [no description available] | medium | 1 | 0 | | |
1-butanol | [no description available] | medium | 2 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
nicergoline | [no description available] | medium | 1 | 1 | organic heterotetracyclic compound; organonitrogen heterocyclic compound | |
dithiothreitol | [no description available] | medium | 1 | 0 | 1,4-dimercaptobutane-2,3-diol; butanediols; dithiol; glycol; thiol | chelator; human metabolite; reducing agent |
cysteine | [no description available] | medium | 2 | 0 | cysteinium | fundamental metabolite |
metyrapone | [no description available] | medium | 1 | 0 | aromatic ketone | antimetabolite; diagnostic agent; EC 1.14.15.4 (steroid 11beta-monooxygenase) inhibitor |
n-acetyl-4-benzoquinoneimine | [no description available] | medium | 1 | 0 | ketoimine; quinone imine | |
galactosamine | [no description available] | medium | 1 | 0 | D-galactosamine; primary amino compound | toxin |
hwa 138 | [no description available] | medium | 3 | 0 | | |
torbafylline | [no description available] | medium | 6 | 0 | | |
diethylstilbestrol | [no description available] | medium | 2 | 0 | olefinic compound; polyphenol | antifungal agent; antineoplastic agent; autophagy inducer; calcium channel blocker; carcinogenic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; endocrine disruptor; xenoestrogen |
chlordiazepoxide | [no description available] | medium | 2 | 0 | benzodiazepine | |
pargyline | [no description available] | medium | 1 | 0 | aromatic amine | |
5-hydroxytryptophan | [no description available] | medium | 1 | 0 | hydroxytryptophan | human metabolite; neurotransmitter |
st 587 | [no description available] | medium | 1 | 0 | | |
clonidine | [no description available] | medium | 2 | 0 | clonidine; imidazoline | |
iloprost | [no description available] | medium | 1 | 0 | carbobicyclic compound; monocarboxylic acid; secondary alcohol | platelet aggregation inhibitor; vasodilator agent |
xylazine | [no description available] | medium | 1 | 0 | 1,3-thiazine; methylbenzene; secondary amino compound | alpha-adrenergic agonist; analgesic; emetic; muscle relaxant; sedative |
taprostene | [no description available] | medium | 2 | 0 | benzoic acids | |
clindamycin | [no description available] | medium | 1 | 0 | | |
penicillin g | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug; drug allergen; epitope |
lanthanum | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom; scandium group element atom | |
mercuric chloride | [no description available] | medium | 1 | 0 | mercury coordination entity | sensitiser |
glycerol | [no description available] | medium | 2 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
acenocoumarol | [no description available] | medium | 1 | 1 | C-nitro compound; hydroxycoumarin; methyl ketone | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
ticlopidine | [no description available] | medium | 2 | 0 | monochlorobenzenes; thienopyridine | anticoagulant; fibrin modulating drug; hematologic agent; P2Y12 receptor antagonist; platelet aggregation inhibitor |
taurocholic acid | [no description available] | medium | 1 | 0 | amino sulfonic acid; bile acid taurine conjugate | human metabolite |
ketanserin | [no description available] | medium | 2 | 1 | aromatic ketone; organofluorine compound; piperidines; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; cardiovascular drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; serotonergic antagonist |
hydrogen carbonate | [no description available] | medium | 1 | 1 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inosinic acid | [no description available] | medium | 1 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
sulfinpyrazone | [no description available] | medium | 2 | 0 | pyrazolidines; sulfoxide | uricosuric drug |
celiprolol | [no description available] | medium | 1 | 1 | aromatic ketone | |
phosphocreatine | [no description available] | medium | 1 | 0 | phosphagen; phosphoamino acid | human metabolite; mouse metabolite |
flunitrazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; C-nitro compound; monofluorobenzenes | anxiolytic drug; GABAA receptor agonist; sedative |
succinic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid; C4-dicarboxylic acid | anti-ulcer drug; fundamental metabolite; micronutrient; nutraceutical; radiation protective agent |
thiobarbituric acid | [no description available] | medium | 1 | 0 | barbiturates | allergen; reagent |
trichloroepoxypropane | [no description available] | medium | 1 | 1 | | |
diphenylhexatriene | [no description available] | medium | 1 | 0 | alkatriene | fluorochrome |
mechlorethamine | [no description available] | medium | 1 | 0 | nitrogen mustard; organochlorine compound | alkylating agent |
cetiedil | [no description available] | medium | 1 | 0 | azepanes | |
pantothenic acid | [no description available] | medium | 1 | 0 | pantothenic acid; vitamin B5 | antidote to curare poisoning; geroprotector; human blood serum metabolite |
pantogab | [no description available] | medium | 1 | 0 | | |
diclofenac | [no description available] | medium | 1 | 0 | amino acid; aromatic amine; dichlorobenzene; monocarboxylic acid; secondary amino compound | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
concanavalin a | [no description available] | medium | 1 | 0 | | |
ly 171883 | [no description available] | medium | 1 | 0 | acetophenones; aromatic ether; phenols; tetrazoles | anti-asthmatic drug; leukotriene antagonist |
tolazoline | [no description available] | medium | 2 | 0 | imidazoles | alpha-adrenergic antagonist; antihypertensive agent; vasodilator agent |
emetine | [no description available] | medium | 1 | 0 | isoquinoline alkaloid; pyridoisoquinoline | antiamoebic agent; anticoronaviral agent; antiinfective agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; expectorant; plant metabolite; protein synthesis inhibitor |
cytarabine | [no description available] | medium | 2 | 0 | beta-D-arabinoside; monosaccharide derivative; pyrimidine nucleoside | antimetabolite; antineoplastic agent; antiviral agent; immunosuppressive agent |
fenton's reagent | [no description available] | medium | 1 | 0 | | |
alcian blue | [no description available] | medium | 1 | 0 | | |
fructose-1,6-diphosphate | [no description available] | medium | 1 | 0 | | |
flurbiprofen | [no description available] | medium | 1 | 0 | fluorobiphenyl; monocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
phenprocoumon | [no description available] | medium | 1 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
menthol | [no description available] | medium | 1 | 0 | p-menthane monoterpenoid; secondary alcohol | volatile oil component |
benzohexonium | [no description available] | medium | 1 | 0 | | |
pentamine | [no description available] | medium | 1 | 0 | | |
cefoxitin | [no description available] | medium | 1 | 0 | beta-lactam antibiotic allergen; cephalosporin; cephamycin; semisynthetic derivative | antibacterial drug |
calcitriol | [no description available] | medium | 1 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
bamifylline | [no description available] | medium | 1 | 0 | oxopurine | |
phenoxybenzamine | [no description available] | medium | 1 | 0 | aromatic amine | |
ammonium sulfate | [no description available] | medium | 1 | 0 | ammonium salt; inorganic sulfate salt | fertilizer |
propafenone | [no description available] | medium | 1 | 0 | aromatic ketone; secondary alcohol; secondary amino compound | anti-arrhythmia drug |
aluminum chloride | [no description available] | medium | 1 | 0 | aluminium coordination entity | Lewis acid |
galactose | [no description available] | medium | 1 | 0 | | |
phentolamine | [no description available] | medium | 3 | 0 | imidazoles; phenols; substituted aniline; tertiary amino compound | alpha-adrenergic antagonist; vasodilator agent |
hydrazine | [no description available] | medium | 2 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
oxyphenbutazone | [no description available] | medium | 1 | 0 | phenols; pyrazolidines | antimicrobial agent; antineoplastic agent; antipyretic; drug metabolite; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic metabolite |
phenindione | [no description available] | medium | 1 | 0 | aromatic ketone; beta-diketone | anticoagulant |
sulfisoxazole | [no description available] | medium | 1 | 0 | isoxazoles; sulfonamide antibiotic; sulfonamide | antibacterial drug; drug allergen |
sulfamethoxazole | [no description available] | medium | 1 | 0 | isoxazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; antiinfective agent; antimicrobial agent; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; epitope; P450 inhibitor; xenobiotic |
propylthiouracil | [no description available] | medium | 1 | 0 | pyrimidinethione | antidote to paracetamol poisoning; antimetabolite; antioxidant; antithyroid drug; carcinogenic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; hormone antagonist |
floxuridine | [no description available] | medium | 1 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; radiosensitizing agent |
cholecystokinin | [no description available] | medium | 2 | 0 | | |
bromine | [no description available] | medium | 1 | 0 | diatomic bromine | |
tetracaine | [no description available] | medium | 1 | 0 | benzoate ester; tertiary amino compound | local anaesthetic |
lysergic acid diethylamide | [no description available] | medium | 1 | 0 | ergoline alkaloid; monocarboxylic acid amide; organic heterotetracyclic compound | dopamine agonist; hallucinogen; serotonergic agonist |
meprobamate | [no description available] | medium | 1 | 0 | organic molecular entity | |
chlorpromazine | [no description available] | medium | 2 | 0 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
dihydroxyphenylalanine | [no description available] | medium | 1 | 0 | hydroxyphenylalanine; non-proteinogenic alpha-amino acid; tyrosine derivative | human metabolite |
naphazoline | [no description available] | medium | 1 | 0 | naphthalenes | |
histidine | [no description available] | medium | 1 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
pilocarpine | [no description available] | medium | 1 | 0 | pilocarpine | antiglaucoma drug |
meperidine | [no description available] | medium | 1 | 0 | ethyl ester; piperidinecarboxylate ester; tertiary amino compound | antispasmodic drug; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
hydroflumethiazide | [no description available] | medium | 1 | 0 | benzothiadiazine; thiazide | antihypertensive agent; diuretic |
phenylalanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
chlorthalidone | [no description available] | medium | 1 | 0 | isoindoles; monochlorobenzenes; sulfonamide | |
bethanidine | [no description available] | medium | 1 | 0 | guanidines | adrenergic antagonist; antihypertensive agent |
pyrazines | [no description available] | medium | 1 | 0 | diazine; pyrazines | Daphnia magna metabolite |
tyramine | [no description available] | medium | 1 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
molybdenum | [no description available] | medium | 1 | 0 | chromium group element atom | micronutrient |
tungsten | [no description available] | medium | 1 | 0 | chromium group element atom | micronutrient |
silicon | [no description available] | medium | 1 | 0 | carbon group element atom; metalloid atom; nonmetal atom | |
glycosides | [no description available] | medium | 1 | 0 | | |
phosphoenolpyruvate | [no description available] | medium | 1 | 0 | carboxyalkyl phosphate; monocarboxylic acid | fundamental metabolite |
dextropropoxyphene | [no description available] | medium | 3 | 1 | 1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propanoate | mu-opioid receptor agonist; opioid analgesic |
serine | [no description available] | medium | 1 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
agar | [no description available] | medium | 1 | 0 | | |
probenecid | [no description available] | medium | 1 | 0 | benzoic acids; sulfonamide | uricosuric drug |
folic acid | [no description available] | medium | 1 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
pteridines | [no description available] | medium | 1 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; pteridines | |
lead | [no description available] | medium | 1 | 0 | carbon group element atom; elemental lead; metal atom | neurotoxin |
methionine | [no description available] | medium | 2 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
neostigmine | [no description available] | medium | 1 | 0 | quaternary ammonium ion | antidote to curare poisoning; EC 3.1.1.7 (acetylcholinesterase) inhibitor |
chlormerodrin | [no description available] | medium | 1 | 0 | organomercury compound; ureas | diagnostic agent; diuretic |
sorbitol | [no description available] | medium | 1 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
ammonium hydroxide | [no description available] | medium | 2 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
hydantoins | [no description available] | medium | 1 | 0 | imidazolidine-2,4-dione | |
amphetamine | [no description available] | medium | 1 | 0 | primary amine | |
ethionine | [no description available] | medium | 1 | 0 | S-ethylhomocysteine | antimetabolite; carcinogenic agent |
benzene | [no description available] | medium | 1 | 0 | aromatic annulene; benzenes; volatile organic compound | carcinogenic agent; environmental contaminant; non-polar solvent |
thiamine pyrophosphate | [no description available] | medium | 2 | 0 | organic chloride salt; vitamin B1 | |
methyltestosterone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; enone | anabolic agent; androgen; antineoplastic agent |
bromide | [no description available] | medium | 1 | 0 | halide anion; monoatomic bromine | |
apnea | [no description available] | medium | 5 | 0 | purine nucleoside | |
isomethyleugenol | [no description available] | medium | 17 | 0 | isomethyleugenol | |
exudates | [no description available] | medium | 1 | 0 | | |
fomesafen | [no description available] | medium | 2 | 0 | aromatic ether; C-nitro compound; monochlorobenzenes; N-sulfonylcarboxamide; organofluorine compound; phenols | agrochemical; EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor; herbicide |
egg white | [no description available] | medium | 1 | 0 | | |
s,n,n'-tripropylthiocarbamate | [no description available] | medium | 1 | 0 | tertiary amine | |
kava | [no description available] | medium | 1 | 0 | | |
foxes | [no description available] | medium | 1 | 0 | | |
eye | [no description available] | medium | 3 | 0 | | |
fusarium | [no description available] | medium | 1 | 0 | | |
carbon monoxide | [no description available] | low | 0 | 0 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
hydrogen sulfide | [no description available] | low | 0 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
nitrous oxide | [no description available] | low | 0 | 0 | gas molecular entity; nitrogen oxide | analgesic; bacterial metabolite; food packaging gas; food propellant; general anaesthetic; greenhouse gas; inhalation anaesthetic; NMDA receptor antagonist; raising agent; refrigerant; vasodilator agent |
methacholine | [no description available] | low | 0 | 0 | acetate ester; quaternary ammonium ion | bronchoconstrictor agent; cholinergic agonist; epitope; muscarinic agonist; vasodilator agent |
amlodipine | [no description available] | low | 0 | 0 | dihydropyridine; ethyl ester; methyl ester; monochlorobenzenes; primary amino compound | antihypertensive agent; calcium channel blocker; vasodilator agent |
betahistine | [no description available] | low | 0 | 0 | aminoalkylpyridine; secondary amino compound | H1-receptor agonist; vasodilator agent |
carvedilol | [no description available] | low | 0 | 0 | carbazoles; secondary alcohol; secondary amino compound | alpha-adrenergic antagonist; antihypertensive agent; beta-adrenergic antagonist; cardiovascular drug; vasodilator agent |
dilazep | [no description available] | low | 0 | 0 | benzoate ester; diazepane; diester; methoxybenzenes | cardioprotective agent; platelet aggregation inhibitor; vasodilator agent |
doxazosin | [no description available] | low | 0 | 0 | aromatic amine; benzodioxine; monocarboxylic acid amide; N-acylpiperazine; N-arylpiperazine; quinazolines | alpha-adrenergic antagonist; antihyperplasia drug; antihypertensive agent; antineoplastic agent; vasodilator agent |
fenoldopam | [no description available] | low | 0 | 0 | benzazepine | alpha-adrenergic agonist; antihypertensive agent; dopamine agonist; dopaminergic antagonist; vasodilator agent |
fasudil | [no description available] | low | 0 | 0 | isoquinolines; N-sulfonyldiazepane | antihypertensive agent; calcium channel blocker; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; geroprotector; neuroprotective agent; nootropic agent; vasodilator agent |
hydralazine | [no description available] | low | 0 | 0 | azaarene; hydrazines; ortho-fused heteroarene; phthalazines | antihypertensive agent; vasodilator agent |
molsidomine | [no description available] | low | 0 | 0 | ethyl ester; morpholines; oxadiazole; zwitterion | antioxidant; apoptosis inhibitor; cardioprotective agent; nitric oxide donor; vasodilator agent |
pimobendan | [no description available] | low | 0 | 0 | benzimidazoles; pyridazinone | cardiotonic drug; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; vasodilator agent |
troglitazone | [no description available] | low | 0 | 0 | chromanes; thiazolidinone | anticoagulant; anticonvulsant; antineoplastic agent; antioxidant; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; hypoglycemic agent; platelet aggregation inhibitor; vasodilator agent |
isosorbide dinitrate | [no description available] | low | 0 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
nicotinic acid benzyl ester | [no description available] | low | 0 | 0 | benzyl ester | vasodilator agent |
nicotinyl alcohol | [no description available] | low | 0 | 0 | aromatic primary alcohol; pyridines | antilipemic drug; vasodilator agent |
isoamyl nitrite | [no description available] | low | 0 | 0 | nitrite esters | antihypertensive agent; vasodilator agent |
bucladesine | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide; butanamides; butyrate ester | agonist; cardiotonic drug; vasodilator agent |
n-pentyl nitrite | [no description available] | low | 0 | 0 | nitrite esters | vasodilator agent |
pentamethonium | [no description available] | low | 0 | 0 | quaternary ammonium ion | antihypertensive agent; vasodilator agent |
tetramethylpyrazine | [no description available] | low | 0 | 0 | alkaloid; pyrazines | antineoplastic agent; apoptosis inhibitor; bacterial metabolite; neuroprotective agent; platelet aggregation inhibitor; vasodilator agent |
diallyl trisulfide | [no description available] | low | 0 | 0 | organic trisulfide | anti-inflammatory agent; antilipemic drug; antineoplastic agent; antioxidant; antiprotozoal drug; apoptosis inducer; estrogen receptor antagonist; insecticide; platelet aggregation inhibitor; vasodilator agent |
trimethaphan | [no description available] | low | 0 | 0 | sulfonium compound | anaesthesia adjuvant; antihypertensive agent; nicotinic antagonist; vasodilator agent |
isosorbide-5-mononitrate | [no description available] | low | 0 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
clonixin | [no description available] | low | 0 | 0 | aminopyridine; organochlorine compound; pyridinemonocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; lipoxygenase inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; platelet aggregation inhibitor; vasodilator agent |
dotarizine | [no description available] | low | 0 | 0 | cyclic ketal; dioxolane; N-alkylpiperazine | calcium channel blocker; serotonergic antagonist; vasodilator agent |
amlodipine besylate | [no description available] | low | 0 | 0 | organosulfonate salt | antihypertensive agent; calcium channel blocker; vasodilator agent |
d 888 | [no description available] | low | 0 | 0 | aromatic ether; nitrile; tertiary amino compound | anti-arrhythmia drug; calcium channel blocker; vasodilator agent |
spathulenol | [no description available] | low | 0 | 0 | carbotricyclic compound; olefinic compound; sesquiterpenoid; tertiary alcohol | anaesthetic; plant metabolite; vasodilator agent; volatile oil component |
zofenopril | [no description available] | low | 0 | 0 | aryl sulfide; L-proline derivative; N-acyl-L-amino acid; thioester | anticonvulsant; apoptosis inhibitor; cardioprotective agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug; vasodilator agent |
eupatorin | [no description available] | low | 0 | 0 | dihydroxyflavone; polyphenol; trimethoxyflavone | anti-inflammatory agent; antineoplastic agent; apoptosis inducer; Brassica napus metabolite; calcium channel blocker; P450 inhibitor; vasodilator agent |
dihydroergocristine | [no description available] | low | 0 | 0 | ergot alkaloid | adrenergic antagonist; vasodilator agent |
quinaprilat | [no description available] | low | 0 | 0 | dicarboxylic acid; isoquinolines; tertiary carboxamide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; vasodilator agent |
tadalafil | [no description available] | low | 0 | 0 | benzodioxoles; pyrazinopyridoindole | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
nitroflurbiprofen | [no description available] | low | 0 | 0 | biphenyls; carboxylic ester; nitrate ester; organofluorine compound | cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; EC 1.14.13.39 (nitric oxide synthase) inhibitor; geroprotector; non-steroidal anti-inflammatory drug; vasodilator agent |
cgp 42112a | [no description available] | low | 0 | 0 | benzyl ester; oligopeptide; pyridinecarboxamide | angiotensin receptor agonist; anti-inflammatory agent; antineoplastic agent; neuroprotective agent; vasodilator agent |
angiotensin ii, des-phe(8)- | [no description available] | low | 0 | 0 | amino acid zwitterion; angiotensin | vasodilator agent |
fasudil hydrochloride | [no description available] | low | 0 | 0 | hydrochloride | antihypertensive agent; calcium channel blocker; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; neuroprotective agent; nootropic agent; vasodilator agent |
oxytocin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone | oxytocic; vasodilator agent |
convallatoxin | [no description available] | low | 0 | 0 | 14beta-hydroxy steroid; 19-oxo steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; steroid aldehyde; steroid lactone | metabolite; vasodilator agent |
raubasine | [no description available] | low | 0 | 0 | methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound | alpha-adrenergic antagonist; antihypertensive agent; vasodilator agent |
colforsin daropate | [no description available] | low | 0 | 0 | acetate ester; carboxylic ester; cyclic ketone; diol; organic heterotricyclic compound; tertiary amino compound | adenylate cyclase agonist; antihypertensive agent; cardiotonic drug; vasodilator agent |
cinnamaldehyde | [no description available] | low | 0 | 0 | 3-phenylprop-2-enal; cinnamaldehydes | antifungal agent; EC 4.3.1.24 (phenylalanine ammonia-lyase) inhibitor; flavouring agent; hypoglycemic agent; plant metabolite; sensitiser; vasodilator agent |
1-0-octadecyl 2-0-acetyl sn-glycero-3-phosphorylcholine | [no description available] | low | 0 | 0 | 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine | antihypertensive agent; beta-adrenergic antagonist; bronchoconstrictor agent; hematologic agent; vasodilator agent |
or 1259 | [no description available] | low | 0 | 0 | hydrazone; nitrile; pyridazinone | anti-arrhythmia drug; cardiotonic drug; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; vasodilator agent |
zofenoprilate | [no description available] | low | 0 | 0 | aryl sulfide; L-proline derivative; N-acyl-L-amino acid; thiol | anticonvulsant; apoptosis inhibitor; cardioprotective agent; drug metabolite; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; vasodilator agent |
lysine clonixinate | [no description available] | low | 0 | 0 | organoammonium salt | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; lipoxygenase inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; platelet aggregation inhibitor; vasodilator agent |
petasin | [no description available] | low | 0 | 0 | alicyclic ketone; enoate ester; enone; sesquiterpenoid | anti-allergic agent; EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator; plant metabolite; vasodilator agent |
anandamide | [no description available] | low | 0 | 0 | endocannabinoid; N-acylethanolamine 20:4 | human blood serum metabolite; neurotransmitter; vasodilator agent |
sphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
erythrityl tetranitrate | [no description available] | low | 0 | 0 | nitrate ester | explosive; vasodilator agent |
methyl brevifolincarboxylate | [no description available] | low | 0 | 0 | cyclic ketone; delta-lactone; organic heterotricyclic compound; phenols | EC 5.99.1.2 (DNA topoisomerase) inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; metabolite; platelet aggregation inhibitor; radical scavenger; vasodilator agent |
ro 42-5892 | [no description available] | low | 0 | 0 | cyclopropanes; diol; L-histidine derivative; secondary carboxamide; sulfone | antihypertensive agent; EC 3.4.23.15 (renin) inhibitor; peptidomimetic; vasodilator agent |
beraprost | [no description available] | low | 0 | 0 | enyne; monocarboxylic acid; organic heterotricyclic compound; secondary alcohol; secondary allylic alcohol | anti-inflammatory agent; antihypertensive agent; platelet aggregation inhibitor; prostaglandin receptor agonist; vasodilator agent |
u 62840 | [no description available] | low | 0 | 0 | carbotricyclic compound; carboxylic acid | antihypertensive agent; cardiovascular drug; human blood serum metabolite; platelet aggregation inhibitor; vasodilator agent; vitamin K antagonist |
jwh-133 | [no description available] | low | 0 | 0 | benzochromene; dibenzopyran; organic heterotricyclic compound | analgesic; anti-inflammatory agent; antineoplastic agent; apoptosis inhibitor; CB2 receptor agonist; opioid analgesic; vasodilator agent |
triacsin c | [no description available] | low | 0 | 0 | hydrazone; nitroso compound; olefinic compound | antimalarial; apoptosis inhibitor; bacterial metabolite; EC 3.1.1.64 (retinoid isomerohydrolase) inhibitor; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; vasodilator agent |
s-nitrosocysteine | [no description available] | low | 0 | 0 | L-cysteine derivative; nitrosothio compound | hematologic agent; platelet aggregation inhibitor; vasodilator agent |
bay 58-2667 | [no description available] | low | 0 | 0 | aromatic ether; benzoic acids; dicarboxylic acid; tertiary amino compound | antihypertensive agent; soluble guanylate cyclase activator; vasodilator agent |
avanafil | [no description available] | low | 0 | 0 | aromatic amide; monocarboxylic acid amide; organochlorine compound; prolinols; pyrimidines | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; vasodilator agent |
selexipag | [no description available] | low | 0 | 0 | aromatic amine; ether; monocarboxylic acid amide; N-sulfonylcarboxamide; pyrazines; tertiary amino compound | orphan drug; platelet aggregation inhibitor; prodrug; prostacyclin receptor agonist; vasodilator agent |
mre 269 | [no description available] | low | 0 | 0 | aromatic amine; ether; monocarboxylic acid; pyrazines; sulfonamide; tertiary amino compound | drug metabolite; orphan drug; platelet aggregation inhibitor; prostacyclin receptor agonist; vasodilator agent |
n-arachidonoyl l-serine | [no description available] | low | 0 | 0 | N-(fatty acyl)-L-alpha-amino acid | cannabinoid receptor agonist; mammalian metabolite; neuroprotective agent; pro-angiogenic agent; vasodilator agent |
bay 60-4552 | [no description available] | low | 0 | 0 | aminopyrimidine; carbamate ester; monofluorobenzenes; pyrazolopyridine | antihypertensive agent; drug metabolite; soluble guanylate cyclase activator; vasodilator agent |
beraprost sodium | [no description available] | low | 0 | 0 | organic sodium salt | anti-inflammatory agent; antihypertensive agent; platelet aggregation inhibitor; prostaglandin receptor agonist; vasodilator agent |
vericiguat | [no description available] | low | 0 | 0 | aminopyrimidine; carbamate ester; organofluorine compound; pyrazolopyridine | antihypertensive agent; soluble guanylate cyclase activator; vasodilator agent |
praliciguat | [no description available] | low | 0 | 0 | aminopyrimidine; isoxazoles; monofluorobenzenes; organofluorine compound; pyrazoles; secondary amino compound; tertiary alcohol | anti-inflammatory agent; antihypertensive agent; soluble guanylate cyclase activator; vasodilator agent |
sildenafil | [no description available] | low | 0 | 0 | piperazines; pyrazolopyrimidine; sulfonamide | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
vardenafil | [no description available] | low | 0 | 0 | imidazotriazine; N-alkylpiperazine; N-sulfonylpiperazine | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; vasodilator agent |
sildenafil citrate | [no description available] | low | 0 | 0 | citrate salt | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
mirodenafil | [no description available] | low | 0 | 0 | aromatic ether; N-alkylpiperazine; primary alcohol; pyrrolopyrimidine; sulfonamide | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
azelastine | [no description available] | low | 0 | 0 | monochlorobenzenes; phthalazines; tertiary amino compound | anti-allergic agent; anti-asthmatic drug; bronchodilator agent; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; H1-receptor antagonist; platelet aggregation inhibitor |
berotek | [no description available] | low | 0 | 0 | resorcinols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent; tocolytic agent |
methoxyphenamine | [no description available] | low | 0 | 0 | amphetamines | beta-adrenergic agonist; bronchodilator agent |
terbutaline | [no description available] | low | 0 | 0 | phenylethanolamines; resorcinols | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; hypoglycemic agent; sympathomimetic agent; tocolytic agent |
diphemanil methylsulfate | [no description available] | low | 0 | 0 | piperidines; quaternary ammonium salt | bronchodilator agent; muscarinic antagonist; parasympatholytic |
pseudoephedrine | [no description available] | low | 0 | 0 | phenylethanolamines; secondary alcohol; secondary amino compound | anti-asthmatic drug; bronchodilator agent; central nervous system drug; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
colterol | [no description available] | low | 0 | 0 | catechols; ethanolamines; secondary alcohol; secondary amino compound; triol | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent |
bitolterol | [no description available] | low | 0 | 0 | carboxylic ester; diester; ethanolamines; secondary alcohol; secondary amino compound | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; prodrug |
azelastine hydrochloride | [no description available] | low | 0 | 0 | hydrochloride | anti-allergic agent; anti-asthmatic drug; bronchodilator agent; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; H1-receptor antagonist; platelet aggregation inhibitor |
bambuterol hydrochloride | [no description available] | low | 0 | 0 | carbamate ester; hydrochloride; phenylethanolamines | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; prodrug; sympathomimetic agent |
bambuterol | [no description available] | low | 0 | 0 | carbamate ester; phenylethanolamines | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; prodrug; sympathomimetic agent; tocolytic agent |
rp 73401 | [no description available] | low | 0 | 0 | aromatic ether; benzamides; chloropyridine; monocarboxylic acid amide | anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; phosphodiesterase IV inhibitor |
fluticasone propionate | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; corticosteroid; fluorinated steroid; propanoate ester; steroid ester; thioester | adrenergic agent; anti-allergic agent; anti-asthmatic drug; anti-inflammatory drug; bronchodilator agent; dermatologic drug |
arformoterol | [no description available] | low | 0 | 0 | N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent |
nab-365 | [no description available] | low | 0 | 0 | hydrochloride | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
indacaterol | [no description available] | low | 0 | 0 | indanes; monohydroxyquinoline; quinolone; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent |
vilanterol | [no description available] | low | 0 | 0 | benzyl alcohols; dichlorobenzene; ether; phenols; secondary amino compound | beta-adrenergic agonist; bronchodilator agent |
olodaterol | [no description available] | low | 0 | 0 | aromatic ether; benzoxazine; phenols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent |
aclidinium bromide | [no description available] | low | 0 | 0 | organic bromide salt; quaternary ammonium salt | bronchodilator agent; muscarinic antagonist |
pentadecanoic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; food component; human blood serum metabolite; plant metabolite |
gallocatechol | [no description available] | low | 0 | 0 | catechin; flavan-3,3',4',5,5',7-hexol | antioxidant; food component; plant metabolite |
stachydrine | [no description available] | low | 0 | 0 | alkaloid; amino-acid betaine; N-methyl-L-alpha-amino acid | food component; human blood serum metabolite; plant metabolite |
elaidic acid | [no description available] | low | 0 | 0 | octadec-9-enoic acid | food component |
trans-4-coumaric acid | [no description available] | low | 0 | 0 | 4-coumaric acid | food component; mouse metabolite; plant metabolite |
7-hydroxycoumarin | [no description available] | low | 0 | 0 | hydroxycoumarin | fluorescent probe; food component; plant metabolite |
beta-tocopherol | [no description available] | low | 0 | 0 | tocopherol; vitamin E | food component; plant metabolite |
2,3-dihydroxybenzoic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | human xenobiotic metabolite; plant metabolite |
tartronic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid | plant metabolite |
3-phenylpropionic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid | antifungal agent; human metabolite; plant metabolite |
4-hydroxybenzyl alcohol | [no description available] | low | 0 | 0 | benzyl alcohols; phenols | plant metabolite |
4-hydroxybenzaldehyde | [no description available] | low | 0 | 0 | hydroxybenzaldehyde | EC 1.14.17.1 (dopamine beta-monooxygenase) inhibitor; mouse metabolite; plant metabolite |
4-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols | fungal metabolite; human metabolite; mouse metabolite; plant metabolite |
4-hydroxybenzoic acid | [no description available] | low | 0 | 0 | monohydroxybenzoic acid | algal metabolite; plant metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
allantoic acid | [no description available] | low | 0 | 0 | ureas | mouse metabolite; plant metabolite |
benzaldehyde | [no description available] | low | 0 | 0 | benzaldehydes | EC 3.1.1.3 (triacylglycerol lipase) inhibitor; EC 3.5.5.1 (nitrilase) inhibitor; flavouring agent; fragrance; odorant receptor agonist; plant metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
coumarin | [no description available] | low | 0 | 0 | coumarins | fluorescent dye; human metabolite; plant metabolite |
cuminol | [no description available] | low | 0 | 0 | benzyl alcohols; p-menthane monoterpenoid | fragrance; insect repellent; plant metabolite; volatile oil component; xenobiotic metabolite |
cuminaldehyde | [no description available] | low | 0 | 0 | benzaldehydes | insecticide; plant metabolite; volatile oil component |
4-vinylguaiacol | [no description available] | low | 0 | 0 | phenols | flavouring agent; pheromone; plant metabolite |
4-methylumbelliferyl acetate | [no description available] | low | 0 | 0 | acetate ester; coumarins | plant metabolite |
indoleacetamide | [no description available] | low | 0 | 0 | indoles; monocarboxylic acid amide; N-acylammonia | bacterial metabolite; fungal metabolite; plant metabolite |
caprylic aldehyde | [no description available] | low | 0 | 0 | medium-chain fatty aldehyde; n-alkanal; saturated fatty aldehyde | plant metabolite |
n(1)-methylnicotinamide | [no description available] | low | 0 | 0 | pyridinium ion | algal metabolite; anti-inflammatory agent; human urinary metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
guaiacol | [no description available] | low | 0 | 0 | guaiacols | disinfectant; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; expectorant; plant metabolite |
1-aminocyclopropane-1-carboxylic acid | [no description available] | low | 0 | 0 | amino acid zwitterion; monocarboxylic acid; non-proteinogenic alpha-amino acid | ethylene releasers; plant metabolite |
3,4-dihydrocoumarin | [no description available] | low | 0 | 0 | chromanone | plant metabolite |
homogentisic acid | [no description available] | low | 0 | 0 | dihydroxyphenylacetic acid; hydroquinones | human metabolite; plant metabolite |
indol-3-yl pyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; indol-3-yl carboxylic acid | plant metabolite; Saccharomyces cerevisiae metabolite |
melilotic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols | bacterial xenobiotic metabolite; fungal xenobiotic metabolite; human xenobiotic metabolite; plant metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
n-methylphenylethanolamine | [no description available] | low | 0 | 0 | alkaloid; phenylethanolamines | human metabolite; plant metabolite |
naphthalene | [no description available] | low | 0 | 0 | naphthalenes; ortho-fused bicyclic arene | apoptosis inhibitor; carcinogenic agent; environmental contaminant; mouse metabolite; plant metabolite; volatile oil component |
1-octanol | [no description available] | low | 0 | 0 | octanol; primary alcohol | antifungal agent; bacterial metabolite; fuel additive; kairomone; plant metabolite |
oxalic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid | algal metabolite; human metabolite; plant metabolite |
palmitic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 1.1.1.189 (prostaglandin-E2 9-reductase) inhibitor; plant metabolite |
phenylacetic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyrogallol | [no description available] | low | 0 | 0 | benzenetriol; phenolic donor | plant metabolite |
tryptamine | [no description available] | low | 0 | 0 | aminoalkylindole; aralkylamino compound; indole alkaloid; tryptamines | human metabolite; mouse metabolite; plant metabolite |
vanillin | [no description available] | low | 0 | 0 | benzaldehydes; monomethoxybenzene; phenols | anti-inflammatory agent; anticonvulsant; antioxidant; flavouring agent; plant metabolite |
aminopropionitrile | [no description available] | low | 0 | 0 | aminopropionitrile | antineoplastic agent; antirheumatic drug; collagen cross-linking inhibitor; plant metabolite |
meglutol | [no description available] | low | 0 | 0 | 3-hydroxy carboxylic acid; dicarboxylic acid; tertiary alcohol | anticholesteremic drug; antimetabolite; EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; human metabolite; plant metabolite |
methylbufotenin | [no description available] | low | 0 | 0 | aromatic ether; tertiary amino compound; tryptamine alkaloid | hallucinogen; plant metabolite |
7,8-dihydroxyflavone | [no description available] | low | 0 | 0 | dihydroxyflavone | antidepressant; antineoplastic agent; antioxidant; plant metabolite; tropomyosin-related kinase B receptor agonist |
anabasine | [no description available] | low | 0 | 0 | piperidine alkaloid; pyridine alkaloid | nicotinic acetylcholine receptor agonist; plant metabolite; teratogenic agent |
acetovanillone | [no description available] | low | 0 | 0 | acetophenones; aromatic ketone; methyl ketone | antirheumatic drug; EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug; plant metabolite |
benzyl benzoate | [no description available] | low | 0 | 0 | benzoate ester; benzyl ester | acaricide; plant metabolite; scabicide |
2,4-dihydroxy-7-methoxy-1,4-benzoxazin-3-one | [no description available] | low | 0 | 0 | aromatic ether; benzoxazine; cyclic hydroxamic acid; lactol | allelochemical; plant metabolite |
caffeic acid | [no description available] | low | 0 | 0 | catechols; hydroxycinnamic acid | antioxidant; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 2.5.1.18 (glutathione transferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; plant metabolite |
beta-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
camphor, (+-)-isomer | [no description available] | low | 0 | 0 | bornane monoterpenoid; cyclic monoterpene ketone | plant metabolite |
cetyl alcohol | [no description available] | low | 0 | 0 | hexadecanol; long-chain primary fatty alcohol | algal metabolite; flavouring agent; human metabolite; plant metabolite |
chrysanthemic acid | [no description available] | low | 0 | 0 | cyclopropanes; monocarboxylic acid | plant metabolite |
colchicine, (+-)-isomer | [no description available] | low | 0 | 0 | acetamides; alkaloid; aromatic ether; carbotricyclic compound | microtubule-destabilising agent; plant metabolite |
danthron | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | apoptosis inducer; plant metabolite |
decanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; anti-inflammatory agent; antibacterial agent; human metabolite; plant metabolite; volatile oil component |
benzophenone | [no description available] | low | 0 | 0 | benzophenones | photosensitizing agent; plant metabolite |
guvacine | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; beta-amino acid; pyridine alkaloid; secondary amino compound; tetrahydropyridine | GABA reuptake inhibitor; plant metabolite |
beta-thujaplicin | [no description available] | low | 0 | 0 | cyclic ketone; enol; monoterpenoid | antibacterial agent; antifungal agent; antineoplastic agent; antiplasmodial drug; plant metabolite |
indolepropionic acid | [no description available] | low | 0 | 0 | indol-3-yl carboxylic acid | auxin; human metabolite; plant metabolite |
lauric acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; antibacterial agent; plant metabolite |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
protopine | [no description available] | low | 0 | 0 | dibenzazecine alkaloid | plant metabolite |
safrole | [no description available] | low | 0 | 0 | benzodioxoles | flavouring agent; insecticide; metabolite; plant metabolite |
sebacic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite; plant metabolite |
stearic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; saturated fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; human metabolite; plant metabolite |
sulforaphane | [no description available] | low | 0 | 0 | isothiocyanate; sulfoxide | antineoplastic agent; antioxidant; EC 3.5.1.98 (histone deacetylase) inhibitor; plant metabolite |
triacetin | [no description available] | low | 0 | 0 | triglyceride | adjuvant; antifungal drug; food additive carrier; food emulsifier; food humectant; fuel additive; plant metabolite; solvent |
undecylenic acid | [no description available] | low | 0 | 0 | undecenoic acid | antifungal drug; plant metabolite |
hydroxyproline | [no description available] | low | 0 | 0 | 4-hydroxyproline; L-alpha-amino acid zwitterion | human metabolite; mouse metabolite; plant metabolite |
dipropylenetriame | [no description available] | low | 0 | 0 | polyazaalkane | algal metabolite; plant metabolite |
phenylethyl alcohol | [no description available] | low | 0 | 0 | benzenes; primary alcohol | Aspergillus metabolite; fragrance; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite |
ficusin | [no description available] | low | 0 | 0 | psoralens | plant metabolite |
asparagine | [no description available] | low | 0 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
n-pentanol | [no description available] | low | 0 | 0 | pentanol; short-chain primary fatty alcohol | human metabolite; plant metabolite |
threonine | [no description available] | low | 0 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
alizarin | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | chromophore; dye; plant metabolite |
isoleucine | [no description available] | low | 0 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
ethane | [no description available] | low | 0 | 0 | alkane; gas molecular entity | plant metabolite; refrigerant |
isophorone | [no description available] | low | 0 | 0 | cyclic ketone; enone | plant metabolite; solvent |
isoprene | [no description available] | low | 0 | 0 | alkadiene; hemiterpene; volatile organic compound | plant metabolite |
isobutylamine | [no description available] | low | 0 | 0 | alkylamines | plant metabolite |
isobutyric acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; fatty acid 4:0; methyl-branched fatty acid | Daphnia magna metabolite; plant metabolite; volatile oil component |
camphene | [no description available] | low | 0 | 0 | carbobicyclic compound; monoterpene | fragrance; plant metabolite |
alpha-pinene | [no description available] | low | 0 | 0 | pinene | plant metabolite |
purpurin | [no description available] | low | 0 | 0 | trihydroxyanthraquinone | biological pigment; histological dye; plant metabolite |
2,6-dihydroxyanthraquinone | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | antimutagen; plant metabolite |
methyl n-methylanthranilate | [no description available] | low | 0 | 0 | benzoate ester; methyl ester; secondary amino compound; substituted aniline | animal metabolite; fungal metabolite; plant metabolite |
2-furoic acid | [no description available] | low | 0 | 0 | furoic acid | bacterial xenobiotic metabolite; human xenobiotic metabolite; inhibitor; plant metabolite; Saccharomyces cerevisiae metabolite |
piperitone | [no description available] | low | 0 | 0 | cyclic terpene ketone; p-menthane monoterpenoid | plant metabolite; volatile oil component |
resacetophenone | [no description available] | low | 0 | 0 | dihydroxyacetophenone; resorcinols | plant metabolite |
salicylaldehyde | [no description available] | low | 0 | 0 | hydroxybenzaldehyde | nematicide; plant metabolite |
1-methylnaphthalene | [no description available] | low | 0 | 0 | methylnaphthalene | carcinogenic agent; plant metabolite |
pyrogallol 1,3-dimethyl ether | [no description available] | low | 0 | 0 | dimethoxybenzene; phenols | plant metabolite |
veratrole | [no description available] | low | 0 | 0 | dimethoxybenzene | plant metabolite |
isatin | [no description available] | low | 0 | 0 | indoledione | EC 1.4.3.4 (monoamine oxidase) inhibitor; plant metabolite |
phenothiazine | [no description available] | low | 0 | 0 | phenothiazine | ferroptosis inhibitor; plant metabolite; radical scavenger |
veratric acid | [no description available] | low | 0 | 0 | benzoic acids | allergen; plant metabolite |
piperonylic acid | [no description available] | low | 0 | 0 | aromatic carboxylic acid; benzodioxoles; monocarboxylic acid | antifungal agent; EC 1.14.14.91 ( trans-cinnamate 4-monooxygenase) inhibitor; plant metabolite; vulnerary |
benzothiazole | [no description available] | low | 0 | 0 | benzothiazoles | environmental contaminant; plant metabolite; xenobiotic |
2-methylbutanal | [no description available] | low | 0 | 0 | 2-methyl-branched fatty aldehyde; methylbutanal | plant metabolite; Saccharomyces cerevisiae metabolite; volatile oil component |
methylcyclopentane | [no description available] | low | 0 | 0 | cycloalkane; volatile organic compound | human metabolite; plant metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
2-methylvaleric acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; methyl-branched fatty acid; monocarboxylic acid; short-chain fatty acid | flavouring agent; fragrance; plant metabolite |
ethyl 2-methylpropanoate | [no description available] | low | 0 | 0 | fatty acid ethyl ester | plant metabolite |
3-hydroxybenzoic acid | [no description available] | low | 0 | 0 | monohydroxybenzoic acid | bacterial metabolite; plant metabolite |
methyl gallate | [no description available] | low | 0 | 0 | gallate ester | anti-inflammatory agent; antioxidant; plant metabolite |
carveol | [no description available] | low | 0 | 0 | limonene monoterpenoid | plant metabolite; volatile oil component |
methylparaben | [no description available] | low | 0 | 0 | paraben | antifungal agent; antimicrobial food preservative; neuroprotective agent; plant metabolite |
alpha phellandrene | [no description available] | low | 0 | 0 | cyclohexadiene; phellandrene | antimicrobial agent; plant metabolite; volatile oil component |
gamma-terpinene | [no description available] | low | 0 | 0 | cyclohexadiene; monoterpene | antioxidant; human xenobiotic metabolite; plant metabolite; volatile oil component |
alpha-terpinene | [no description available] | low | 0 | 0 | cyclohexadiene; monoterpene | plant metabolite; volatile oil component |
4-cymene | [no description available] | low | 0 | 0 | monoterpene; toluenes | human urinary metabolite; plant metabolite; volatile oil component |
4-hydroxyacetophenone | [no description available] | low | 0 | 0 | monohydroxyacetophenone | fungal metabolite; mouse metabolite; plant metabolite |
4-anisic acid | [no description available] | low | 0 | 0 | methoxybenzoic acid | plant metabolite |
styrene | [no description available] | low | 0 | 0 | styrenes; vinylarene; volatile organic compound | mouse metabolite; mutagen; plant metabolite |
benzylamine | [no description available] | low | 0 | 0 | aralkylamine; primary amine | allergen; EC 3.5.5.1 (nitrilase) inhibitor; plant metabolite |
anisole | [no description available] | low | 0 | 0 | monomethoxybenzene | plant metabolite |
phenyl ether | [no description available] | low | 0 | 0 | aromatic ether | plant metabolite |
1,3-diphenylurea | [no description available] | low | 0 | 0 | phenylureas | cytokinin; plant metabolite |
3-phenylpropanal | [no description available] | low | 0 | 0 | aldehyde; benzenes | flavouring agent; plant metabolite |
2-ethylhexanol | [no description available] | low | 0 | 0 | primary alcohol | plant metabolite; volatile oil component |
4-methylbenzaldehyde | [no description available] | low | 0 | 0 | tolualdehyde | plant metabolite |
ethyl butyrate | [no description available] | low | 0 | 0 | butyrate ester | plant metabolite |
12-hydroxy stearic acid | [no description available] | low | 0 | 0 | hydroxyoctadecanoic acid; secondary alcohol | bacterial xenobiotic metabolite; plant metabolite |
methyl caproate | [no description available] | low | 0 | 0 | fatty acid methyl ester; hexanoate ester | flavouring agent; plant metabolite |
propanethiol | [no description available] | low | 0 | 0 | alkanethiol | plant metabolite |
allyl alcohol | [no description available] | low | 0 | 0 | primary allylic alcohol; propenol | antibacterial agent; fungicide; herbicide; insecticide; plant metabolite |
isoamylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | bacterial metabolite; plant metabolite |
2-pentanone | [no description available] | low | 0 | 0 | methyl ketone; pentanone | plant metabolite |
methylcyclohexane | [no description available] | low | 0 | 0 | cycloalkane; volatile organic compound | aprotic solvent; human metabolite; plant metabolite |
n-pentanoic acid | [no description available] | low | 0 | 0 | short-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
propyl acetate | [no description available] | low | 0 | 0 | acetate ester | fragrance; plant metabolite |
allyl cyanide | [no description available] | low | 0 | 0 | aliphatic nitrile; olefinic compound | antifeedant; neurotoxin; plant metabolite |
ethyl formate | [no description available] | low | 0 | 0 | ethyl ester; formate ester | fumigant; plant metabolite |
pentanal | [no description available] | low | 0 | 0 | saturated fatty aldehyde | plant metabolite |
piperidine | [no description available] | low | 0 | 0 | azacycloalkane; piperidines; saturated organic heteromonocyclic parent; secondary amine | base; catalyst; human metabolite; non-polar solvent; plant metabolite; protic solvent; reagent |
heptanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
1-hexanol | [no description available] | low | 0 | 0 | hexanol; primary alcohol | alarm pheromone; antibacterial agent; fragrance; plant metabolite |
ethyl stearate | [no description available] | low | 0 | 0 | long-chain fatty acid ethyl ester; octadecanoate ester | plant metabolite |
heptanol | [no description available] | low | 0 | 0 | heptanol; primary alcohol | flavouring agent; fragrance; gap junctional intercellular communication inhibitor; plant metabolite |
nonane | [no description available] | low | 0 | 0 | alkane | plant metabolite; volatile oil component |
pelargonic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; antifeedant; Daphnia magna metabolite; plant metabolite |
undecan-2-one | [no description available] | low | 0 | 0 | dialkyl ketone; methyl ketone | plant metabolite; rodenticide |
octyl acetate | [no description available] | low | 0 | 0 | acetate ester | plant metabolite |
decanaldehyde | [no description available] | low | 0 | 0 | medium-chain fatty aldehyde; n-alkanal; saturated fatty aldehyde | antifungal agent; fragrance; plant metabolite |
n-dodecane | [no description available] | low | 0 | 0 | alkane | plant metabolite |
undecan-1-ol | [no description available] | low | 0 | 0 | primary alcohol; undecanol | flavouring agent; plant metabolite |
undecanal | [no description available] | low | 0 | 0 | medium-chain fatty aldehyde; n-alkanal; saturated fatty aldehyde | antimycobacterial drug; plant metabolite; volatile oil component |
dodecanol | [no description available] | low | 0 | 0 | dodecanol; primary alcohol | bacterial metabolite; cosmetic; insect attractant; insecticide; pheromone; plant metabolite |
1-tridecanol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; tridecanol | bacterial metabolite; human metabolite; plant metabolite |
myristyl alcohol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; tetradecanol | pheromone; plant metabolite; volatile oil component |
behenic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
stearyl alcohol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; octadecanol | algal metabolite; human metabolite; plant metabolite |
eicosane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite |
3-hydroxy-3-methylbutene | [no description available] | low | 0 | 0 | olefinic compound; tertiary alcohol | animal metabolite; fragrance; pheromone; plant metabolite |
3,4,5-trimethoxybenzoic acid | [no description available] | low | 0 | 0 | benzoic acids; methoxybenzenes | human urinary metabolite; human xenobiotic metabolite; plant metabolite |
2-chlorobenzoic acid | [no description available] | low | 0 | 0 | 2-halobenzoic acid; monochlorobenzoic acid | plant hormone; plant metabolite |
scoparone | [no description available] | low | 0 | 0 | aromatic ether; coumarins | anti-allergic agent; anti-inflammatory agent; antihypertensive agent; antilipemic drug; immunosuppressive agent; plant metabolite |
dimethoxyphenylethylamine | [no description available] | low | 0 | 0 | alkaloid; aromatic ether; phenylethylamine | allergen; plant metabolite |
ethyl-p-hydroxybenzoate | [no description available] | low | 0 | 0 | ethyl ester; paraben | antifungal agent; antimicrobial food preservative; phytoestrogen; plant metabolite |
piperonal | [no description available] | low | 0 | 0 | arenecarbaldehyde; benzodioxoles | fragrance; insect repellent; plant metabolite |
vanillic acid | [no description available] | low | 0 | 0 | methoxybenzoic acid; monohydroxybenzoic acid | plant metabolite |
peucedanin | [no description available] | low | 0 | 0 | aromatic ether; furanocoumarin; lactone | plant metabolite |
syringaldehyde | [no description available] | low | 0 | 0 | dimethoxybenzene; hydroxybenzaldehyde | hypoglycemic agent; plant metabolite |
2-aminothiophenol | [no description available] | low | 0 | 0 | aryl thiol; substituted aniline | plant metabolite |
estragole | [no description available] | low | 0 | 0 | alkenylbenzene; monomethoxybenzene; phenylpropanoid | carcinogenic agent; flavouring agent; genotoxin; insect attractant; plant metabolite |
citronellol | [no description available] | low | 0 | 0 | monoterpenoid | plant metabolite |
ethyl acetoacetate | [no description available] | low | 0 | 0 | ethyl ester | antibacterial agent; flavouring agent; plant metabolite |
2-hydroxypyridine | [no description available] | low | 0 | 0 | monohydroxypyridine | plant metabolite |
hexanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | human metabolite; plant metabolite |
n-heptane | [no description available] | low | 0 | 0 | alkane; volatile organic compound | non-polar solvent; plant metabolite |
1-nonanol | [no description available] | low | 0 | 0 | nonanol; primary alcohol | antifungal agent; flavouring agent; plant metabolite; volatile oil component |
2-vanillin | [no description available] | low | 0 | 0 | benzaldehydes; guaiacols | antimutagen; plant metabolite |
citronellyl acetate | [no description available] | low | 0 | 0 | acetate ester; monoterpenoid | plant metabolite |
chrysene | [no description available] | low | 0 | 0 | ortho-fused polycyclic arene | plant metabolite |
azulene | [no description available] | low | 0 | 0 | azulenes; mancude carbobicyclic parent; ortho-fused bicyclic arene | plant metabolite; volatile oil component |
pseudoephedrine hydrochloride | [no description available] | low | 0 | 0 | hydrochloride | plant metabolite |
galantamine | [no description available] | low | 0 | 0 | benzazepine alkaloid fundamental parent; benzazepine alkaloid; organic heterotetracyclic compound; tertiary amino compound | antidote to curare poisoning; cholinergic drug; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; plant metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
4-methylcatechol | [no description available] | low | 0 | 0 | methylcatechol | antioxidant; carcinogenic agent; hapten; human metabolite; plant metabolite |
beta-erythroidine | [no description available] | low | 0 | 0 | delta-lactone; indole alkaloid; organic heterotetracyclic compound; tertiary amino compound | muscle relaxant; plant metabolite |
pinane | [no description available] | low | 0 | 0 | carbobicyclic compound; monoterpene; terpenoid fundamental parent | plant metabolite |
naphthazarin | [no description available] | low | 0 | 0 | hydroxy-1,4-naphthoquinone | acaricide; antibacterial agent; antineoplastic agent; apoptosis inducer; geroprotector; plant metabolite |
chrysophanic acid | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | anti-inflammatory agent; antiviral agent; plant metabolite |
reticulin | [no description available] | low | 0 | 0 | benzylisoquinoline alkaloid; benzyltetrahydroisoquinoline; isoquinolinol | plant metabolite |
indole-3-carbaldehyde | [no description available] | low | 0 | 0 | heteroarenecarbaldehyde; indole alkaloid; indoles | bacterial metabolite; human xenobiotic metabolite; marine metabolite; plant metabolite |
4-hydroxyphenylethanol | [no description available] | low | 0 | 0 | phenols | anti-arrhythmia drug; antioxidant; cardiovascular drug; fungal metabolite; geroprotector; plant metabolite; protective agent |
phloretic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid | plant metabolite |
citronellic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; monoterpenoid; monounsaturated fatty acid | flavouring agent; plant metabolite |
isovaleric acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; methylbutyric acid; short-chain fatty acid | mammalian metabolite; plant metabolite |
iberin | [no description available] | low | 0 | 0 | isothiocyanate; sulfoxide | apoptosis inducer; plant metabolite; quorum sensing inhibitor |
16-hydroxypalmitic acid | [no description available] | low | 0 | 0 | hydroxypalmitic acid; omega-hydroxy-long-chain fatty acid | plant metabolite |
arachidic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
octacosanoic acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; ultra-long-chain fatty acid | plant metabolite |
ascaridole | [no description available] | low | 0 | 0 | organic heterobicyclic compound; organic peroxide; p-menthane monoterpenoid | antileishmanial agent; antinematodal drug; plant metabolite |
abietic acid | [no description available] | low | 0 | 0 | abietane diterpenoid; monocarboxylic acid | plant metabolite |
hematoxylin | [no description available] | low | 0 | 0 | organic heterotetracyclic compound; oxacycle; polyphenol; tertiary alcohol | histological dye; plant metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
tryptophol | [no description available] | low | 0 | 0 | indolyl alcohol | auxin; plant metabolite; Saccharomyces cerevisiae metabolite |
hemimellitene | [no description available] | low | 0 | 0 | trimethylbenzene | neurotoxin; plant metabolite |
2-methylbenzaldehyde | [no description available] | low | 0 | 0 | tolualdehyde | plant metabolite |
syringic acid | [no description available] | low | 0 | 0 | benzoic acids; dimethoxybenzene; phenols | plant metabolite |
6-methoxybenzoxazolinone | [no description available] | low | 0 | 0 | aromatic ether; benzoxazole | antibacterial agent; anticonvulsant; antifungal agent; muscle relaxant; plant metabolite |
1,1-dimethoxyethane | [no description available] | low | 0 | 0 | acetal; diether | flavouring agent; plant metabolite |
2-methylfuran | [no description available] | low | 0 | 0 | furans; volatile organic compound | flavouring agent; fuel; hepatotoxic agent; human urinary metabolite; plant metabolite |
perillyl alcohol | [no description available] | low | 0 | 0 | limonene monoterpenoid | plant metabolite; volatile oil component |
cumic acid | [no description available] | low | 0 | 0 | cumic acid | plant metabolite |
tricaprylin | [no description available] | low | 0 | 0 | octanoate ester; triglyceride | anticonvulsant; plant metabolite |
senecioic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; methyl-branched fatty acid; monounsaturated fatty acid; short-chain fatty acid | plant metabolite |
3-hexen-1-ol | [no description available] | low | 0 | 0 | alkenyl alcohol; homoallylic alcohol; primary alcohol; volatile organic compound | plant metabolite |
n-hexadecane | [no description available] | low | 0 | 0 | long-chain alkane | non-polar solvent; plant metabolite; volatile oil component |
beta-phellandrene | [no description available] | low | 0 | 0 | phellandrene | plant metabolite |
tristearin | [no description available] | low | 0 | 0 | triacylglycerol 54:0 | Caenorhabditis elegans metabolite; plant metabolite |
lignoceric acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; very long-chain fatty acid | Daphnia tenebrosa metabolite; human metabolite; plant metabolite; volatile oil component |
4-methyl-1-(1-methylethyl)-3-cyclohexen-1-ol | [no description available] | low | 0 | 0 | terpineol; tertiary alcohol | anti-inflammatory agent; antibacterial agent; antineoplastic agent; antioxidant; antiparasitic agent; apoptosis inducer; plant metabolite; volatile oil component |
6-methylsalicylic acid | [no description available] | low | 0 | 0 | monohydroxybenzoic acid | Penicillium metabolite; plant metabolite |
1-phenyl-1,2-propanedione | [no description available] | low | 0 | 0 | alpha-diketone; aromatic ketone | plant metabolite |
2-methylcyclohexanone | [no description available] | low | 0 | 0 | cyclohexanones | flavouring agent; plant metabolite |
terpinolene | [no description available] | low | 0 | 0 | p-menthadiene | insect repellent; plant metabolite; sedative; volatile oil component |
isovalerylaldehyde | [no description available] | low | 0 | 0 | methylbutanal | flavouring agent; plant metabolite; Saccharomyces cerevisiae metabolite; volatile oil component |
levulinic acid | [no description available] | low | 0 | 0 | oxopentanoic acid; straight-chain saturated fatty acid | plant metabolite |
2-tridecanone | [no description available] | low | 0 | 0 | methyl ketone | flavouring agent; plant metabolite |
octadecane | [no description available] | low | 0 | 0 | long-chain alkane | bacterial metabolite; plant metabolite |
dimethylselenide | [no description available] | low | 0 | 0 | organoselenium compound | bacterial xenobiotic metabolite; plant metabolite |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2-methyl-5-(1-methylethenyl)cyclohexanol | [no description available] | low | 0 | 0 | p-menthane monoterpenoid; secondary alcohol | acaricide; plant metabolite; volatile oil component |
4-carboxybenzaladehyde | [no description available] | low | 0 | 0 | benzaldehydes; benzoic acids; monocarboxylic acid | plant metabolite |
3-methylbenzaldehyde | [no description available] | low | 0 | 0 | tolualdehyde | plant metabolite |
isovanillin | [no description available] | low | 0 | 0 | benzaldehydes; monomethoxybenzene; phenols | animal metabolite; antidiarrhoeal drug; antifungal agent; EC 1.2.3.1 (aldehyde oxidase) inhibitor; HIV protease inhibitor; plant metabolite |
2,5-dimethylfuran | [no description available] | low | 0 | 0 | furans | antifungal agent; bacterial metabolite; fuel; fumigant; human urinary metabolite; Maillard reaction product; plant metabolite |
2-hexanol | [no description available] | low | 0 | 0 | hexanol; secondary alcohol | human metabolite; plant metabolite; semiochemical |
ethyl palmitate | [no description available] | low | 0 | 0 | hexadecanoate ester; long-chain fatty acid ethyl ester | plant metabolite |
2-nonanol | [no description available] | low | 0 | 0 | nonanol; secondary alcohol | bacterial metabolite; flavouring agent; pheromone; plant metabolite; rat metabolite; volatile oil component |
n-propyl disulfide | [no description available] | low | 0 | 0 | organic disulfide | plant metabolite |
tridecane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
n-tetradecane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
pentadecane | [no description available] | low | 0 | 0 | long-chain alkane | animal metabolite; plant metabolite; volatile oil component |
heptadecane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
nonadecane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
n-heneicosane | [no description available] | low | 0 | 0 | long-chain alkane | pheromone; plant metabolite; volatile oil component |
docosane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite |
octacosane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite |
nonacosane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
bulbocapnine | [no description available] | low | 0 | 0 | aporphine alkaloid; aromatic ether; oxacycle; phenols | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; EC 1.4.3.22 (diamine oxidase) inhibitor; plant metabolite |
1,2,3-trimethoxybenzene | [no description available] | low | 0 | 0 | methoxybenzenes | plant metabolite |
2-pyrrolecarboxylic acid | [no description available] | low | 0 | 0 | pyrrolecarboxylic acid | plant metabolite |
tridecanoic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
n-tricosane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
2-propylphenol | [no description available] | low | 0 | 0 | phenols | flavouring agent; plant metabolite |
isovanillic acid | [no description available] | low | 0 | 0 | methoxybenzoic acid; monohydroxybenzoic acid | antibacterial agent; plant metabolite |
tetracosane | [no description available] | low | 0 | 0 | long-chain alkane | plant metabolite; volatile oil component |
docosanol | [no description available] | low | 0 | 0 | docosanol; long-chain primary fatty alcohol | antiviral drug; plant metabolite |
2-methylpyrrolidine | [no description available] | low | 0 | 0 | pyrrolidines | plant metabolite |
2-nonanone | [no description available] | low | 0 | 0 | methyl ketone | plant metabolite |
ethyl gallate | [no description available] | low | 0 | 0 | gallate ester | plant metabolite |
3-methylfuran | [no description available] | low | 0 | 0 | furans; volatile organic compound | Aspergillus metabolite; environmental contaminant; fungal metabolite; Penicillium metabolite; plant metabolite |
dihydroferulic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid; phenylpropanoid | antioxidant; human xenobiotic metabolite; mouse metabolite; plant metabolite |
fenchone, (+-)-isomer | [no description available] | low | 0 | 0 | carbobicyclic compound; cyclic terpene ketone; fenchane monoterpenoid | plant metabolite |
beta-pinene | [no description available] | low | 0 | 0 | pinene | plant metabolite |
glycyrrhizic acid | [no description available] | low | 0 | 0 | enone; glucosiduronic acid; pentacyclic triterpenoid; tricarboxylic acid; triterpenoid saponin | EC 3.4.21.5 (thrombin) inhibitor; plant metabolite |
selenomethionine | [no description available] | low | 0 | 0 | selenoamino acid; selenomethionines | plant metabolite |
1-pentene-3-one | [no description available] | low | 0 | 0 | enone | flavouring agent; genotoxin; human metabolite; plant metabolite |
dodecyldimethylamine oxide | [no description available] | low | 0 | 0 | tertiary amine oxide | detergent; plant metabolite |
2-undecanol | [no description available] | low | 0 | 0 | secondary alcohol; undecanol | animal metabolite; flavouring agent; pheromone; plant metabolite; volatile oil component |
digoxigenin | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 14beta-hydroxy steroid; 3beta-hydroxy steroid; 3beta-sterol | hapten; plant metabolite |
heliamine | [no description available] | low | 0 | 0 | aromatic ether; diether; isoquinoline alkaloid; isoquinolines | plant metabolite |
6h-dibenzo-(b,d)-pyran-6-one | [no description available] | low | 0 | 0 | benzochromenone | plant metabolite |
diallyl disulfide | [no description available] | low | 0 | 0 | organic disulfide | antifungal agent; antineoplastic agent; plant metabolite |
glaucine | [no description available] | low | 0 | 0 | aporphine alkaloid; organic heterotetracyclic compound; polyether; tertiary amino compound | antibacterial agent; antineoplastic agent; antitussive; muscle relaxant; NF-kappaB inhibitor; plant metabolite; platelet aggregation inhibitor; rat metabolite |
dihydroconiferyl alcohol | [no description available] | low | 0 | 0 | eugenol; primary alcohol | plant metabolite |
propyl benzoate | [no description available] | low | 0 | 0 | benzoate ester | antimicrobial food preservative; flavouring agent; plant metabolite |
2-methoxy-1,4-naphthoquinone | [no description available] | low | 0 | 0 | 1,4-naphthoquinones; enol ether | antimicrobial agent; metabolite; plant metabolite |
tricosanoic acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; very long-chain fatty acid | Daphnia magna metabolite; human metabolite; plant metabolite |
alpha-terpineol | [no description available] | low | 0 | 0 | terpineol | plant metabolite |
acetosyringone | [no description available] | low | 0 | 0 | acetophenones; dimethoxybenzene; phenols | anti-asthmatic drug; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug; plant metabolite |
pentadecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | antimicrobial agent; plant metabolite; volatile oil component |
2-ethylfuran | [no description available] | low | 0 | 0 | furans; volatile organic compound | bacterial metabolite; fragrance; Maillard reaction product; plant metabolite |
sabinene | [no description available] | low | 0 | 0 | thujene | plant metabolite |
palmatine | [no description available] | low | 0 | 0 | berberine alkaloid; organic heterotetracyclic compound | plant metabolite |
n-butylbenzenesulfonamide | [no description available] | low | 0 | 0 | sulfonamide | neurotoxin; plant metabolite |
furaneol | [no description available] | low | 0 | 0 | cyclic ketone; enol; furans | flavouring agent; fragrance; plant metabolite |
methyl vanillate | [no description available] | low | 0 | 0 | aromatic ether; benzoate ester; phenols | antioxidant; plant metabolite |
2-octanol | [no description available] | low | 0 | 0 | octanol; secondary alcohol | plant metabolite; volatile oil component |
5-methoxyindole-2-carboxylic acid | [no description available] | low | 0 | 0 | aromatic ether; indolecarboxylic acid | EC 1.8.1.4 (dihydrolipoyl dehydrogenase) inhibitor; hypoglycemic agent; plant metabolite |
canadine, (s)-isomer | [no description available] | low | 0 | 0 | an (S)-7,8,13,14-tetrahydroprotoberberine; canadine | plant metabolite |
14-methylhexadecanoic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; long-chain fatty acid; methyl-branched fatty acid | mammalian metabolite; plant metabolite |
helenalin | [no description available] | low | 0 | 0 | cyclic ketone; gamma-lactone; organic heterotricyclic compound; secondary alcohol; sesquiterpene lactone | anti-inflammatory agent; antineoplastic agent; metabolite; plant metabolite |
dimethyldiselenide | [no description available] | low | 0 | 0 | organoselenium compound | bacterial metabolite; human xenobiotic metabolite; mammalian metabolite; plant metabolite |
isopentenyladenosine | [no description available] | low | 0 | 0 | N-ribosyl-N(6)-isopentenyladenine; nucleoside analogue | antineoplastic agent; plant growth regulator; plant metabolite |
s-methylcysteine | [no description available] | low | 0 | 0 | S-alkyl-L-cysteine zwitterion; S-alkyl-L-cysteine | human urinary metabolite; plant metabolite |
dihydrocarvone | [no description available] | low | 0 | 0 | dihydrocarvones | plant metabolite |
marmesin, (r)-isomer | [no description available] | low | 0 | 0 | marmesin | plant metabolite; rat metabolite; xenobiotic metabolite |
4-hydroxybenzylcyanide | [no description available] | low | 0 | 0 | hydroxynitrile | plant metabolite |
2,3,5-trimethylpyrazine | [no description available] | low | 0 | 0 | pyrazines | animal metabolite; bacterial metabolite; flavouring agent; pheromone; plant metabolite |
2,4-dihydroxy-1,4-benzoxazin-3-one | [no description available] | low | 0 | 0 | benzoxazine; cyclic hydroxamic acid; lactol | allelochemical; herbicide; phytotoxin; plant metabolite |
precocene i | [no description available] | low | 0 | 0 | aromatic ether; chromenes | plant metabolite; precocenes |
1-deoxynojirimycin | [no description available] | low | 0 | 0 | 2-(hydroxymethyl)piperidine-3,4,5-triol; piperidine alkaloid | anti-HIV agent; anti-obesity agent; bacterial metabolite; EC 3.2.1.20 (alpha-glucosidase) inhibitor; hepatoprotective agent; hypoglycemic agent; plant metabolite |
neohesperidin dihydrochalcone | [no description available] | low | 0 | 0 | dihydrochalcones; disaccharide derivative; neohesperidoside | environmental contaminant; plant metabolite; sweetening agent; xenobiotic |
4-anisaldehyde | [no description available] | low | 0 | 0 | benzaldehydes | bacterial metabolite; human urinary metabolite; insect repellent; plant metabolite |
myrcene | [no description available] | low | 0 | 0 | monoterpene | anabolic agent; anti-inflammatory agent; flavouring agent; fragrance; plant metabolite; volatile oil component |
diacetone alcohol | [no description available] | low | 0 | 0 | beta-hydroxy ketone | plant metabolite |
methyl tetradecanoate | [no description available] | low | 0 | 0 | fatty acid methyl ester | flavouring agent; fragrance; plant metabolite |
nonanal | [no description available] | low | 0 | 0 | medium-chain fatty aldehyde; n-alkanal; saturated fatty aldehyde | human metabolite; plant metabolite |
tetradecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | bacterial metabolite; plant metabolite |
silybin | [no description available] | low | 0 | 0 | aromatic ether; benzodioxine; flavonolignan; polyphenol; secondary alpha-hydroxy ketone | antineoplastic agent; antioxidant; hepatoprotective agent; plant metabolite |
oxypeucadanin, (s)-(-)-isomer | [no description available] | low | 0 | 0 | epoxide; furanocoumarin; lactone | plant metabolite |
amygdalin | [no description available] | low | 0 | 0 | cyanogenic glycoside; disaccharide derivative; gentiobioside | plant metabolite |
octyl gallate | [no description available] | low | 0 | 0 | gallate ester | food antioxidant; hypoglycemic agent; plant metabolite |
vanillyl alcohol | [no description available] | low | 0 | 0 | benzyl alcohols; guaiacols | plant metabolite |
benzylaminopurine | [no description available] | low | 0 | 0 | 6-aminopurines | cytokinin; plant metabolite |
allyl methyl disulfide | [no description available] | low | 0 | 0 | organic disulfide | plant metabolite; volatile oil component |
octyl glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside | plant metabolite |
dihydrochalcone | [no description available] | low | 0 | 0 | dihydrochalcones | plant metabolite |
calanolide a | [no description available] | low | 0 | 0 | cyclic ether; delta-lactone; organic heterotetracyclic compound; secondary alcohol | HIV-1 reverse transcriptase inhibitor; plant metabolite |
baicalin | [no description available] | low | 0 | 0 | dihydroxyflavone; glucosiduronic acid; glycosyloxyflavone; monosaccharide derivative | antiatherosclerotic agent; antibacterial agent; anticoronaviral agent; antineoplastic agent; antioxidant; cardioprotective agent; EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; ferroptosis inhibitor; neuroprotective agent; non-steroidal anti-inflammatory drug; plant metabolite; prodrug |
salvin | [no description available] | low | 0 | 0 | abietane diterpenoid; carbotricyclic compound; catechols; monocarboxylic acid | angiogenesis modulating agent; anti-inflammatory agent; antineoplastic agent; antioxidant; apoptosis inducer; food preservative; HIV protease inhibitor; plant metabolite |
1,2,3,4,6-pentakis-O-galloyl-beta-D-glucose | [no description available] | low | 0 | 0 | gallate ester; galloyl beta-D-glucose | anti-inflammatory agent; antineoplastic agent; geroprotector; hepatoprotective agent; plant metabolite; radiation protective agent; radical scavenger |
obtusifoliol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol | mouse metabolite; plant metabolite |
secoisolariciresinol | [no description available] | low | 0 | 0 | secoisolariciresinol | antidepressant; phytoestrogen; plant metabolite |
solanidine | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; solanid-5-en-3-ol; steroid alkaloid fundamental parent | plant metabolite; toxin |
valerophenone | [no description available] | low | 0 | 0 | aromatic ketone | plant metabolite; volatile oil component |
2,4,6-trihydroxyacetophenone | [no description available] | low | 0 | 0 | aromatic ketone; benzenetriol; methyl ketone | MALDI matrix material; plant metabolite |
tangeretin | [no description available] | low | 0 | 0 | pentamethoxyflavone | antineoplastic agent; plant metabolite |
djenkolic acid | [no description available] | low | 0 | 0 | dithioacetal; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | plant metabolite; toxin |
1-hexacosanol | [no description available] | low | 0 | 0 | hexacosanol; very long-chain primary fatty alcohol | insecticide; plant metabolite |
actinidine | [no description available] | low | 0 | 0 | cyclopentapyridine; pyridine alkaloid | pheromone; plant metabolite |
1-octacosanol | [no description available] | low | 0 | 0 | fatty alcohol 28:0; ultra-long-chain primary fatty alcohol | plant metabolite |
suberosin | [no description available] | low | 0 | 0 | aromatic ether; coumarins | anticoagulant; plant metabolite |
artemisinin | [no description available] | low | 0 | 0 | organic peroxide; sesquiterpene lactone | antimalarial; plant metabolite |
methyl syringate | [no description available] | low | 0 | 0 | benzoate ester; dimethoxybenzene; phenols | plant metabolite |
sesamin | [no description available] | low | 0 | 0 | benzodioxoles; furofuran; lignan | antineoplastic agent; neuroprotective agent; plant metabolite |
nobiletin | [no description available] | low | 0 | 0 | methoxyflavone | antineoplastic agent; plant metabolite |
lycorine | [no description available] | low | 0 | 0 | indolizidine alkaloid | anticoronaviral agent; antimalarial; plant metabolite; protein synthesis inhibitor |
alantolactone | [no description available] | low | 0 | 0 | naphthofuran; olefinic compound; sesquiterpene lactone | antineoplastic agent; apoptosis inducer; plant metabolite |
vexibinol | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; tetrahydroxyflavanone | antimalarial; antimicrobial agent; antioxidant; plant metabolite |
kaurenoic acid | [no description available] | low | 0 | 0 | ent-kaurane diterpenoid | anti-HIV-1 agent; antineoplastic agent; plant metabolite |
beta-amyrin | [no description available] | low | 0 | 0 | pentacyclic triterpenoid; secondary alcohol | Aspergillus metabolite; plant metabolite |
pinostrobin | [no description available] | low | 0 | 0 | monohydroxyflavanone; monomethoxyflavanone | antidote; plant metabolite |
xanthomicrol | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | antineoplastic agent; plant metabolite |
voacamine | [no description available] | low | 0 | 0 | alkaloid ester; methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound; tertiary amino compound | angiogenesis inhibitor; antineoplastic agent; plant metabolite |
isoalantolactone | [no description available] | low | 0 | 0 | eudesmane sesquiterpenoid; sesquiterpene lactone | antifungal agent; apoptosis inducer; plant metabolite |
pulsatilla saponin a | [no description available] | low | 0 | 0 | disaccharide derivative; hydroxy monocarboxylic acid; pentacyclic triterpenoid; triterpenoid saponin | anti-inflammatory agent; plant metabolite |
hederagenin | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; pentacyclic triterpenoid; sapogenin | plant metabolite |
magnoflorine | [no description available] | low | 0 | 0 | aporphine alkaloid; quaternary ammonium ion | plant metabolite |
brazilin | [no description available] | low | 0 | 0 | catechols; organic heterotetracyclic compound; tertiary alcohol | anti-inflammatory agent; antibacterial agent; antineoplastic agent; antioxidant; apoptosis inducer; biological pigment; hepatoprotective agent; histological dye; NF-kappaB inhibitor; plant metabolite |
strychnine n-oxide | [no description available] | low | 0 | 0 | monoterpenoid indole alkaloid; organic heteroheptacyclic compound; tertiary amine oxide | plant metabolite |
pinoresinol | [no description available] | low | 0 | 0 | pinoresinol | hypoglycemic agent; phytoestrogen; plant metabolite |
dauricine | [no description available] | low | 0 | 0 | aromatic ether; bisbenzylisoquinoline alkaloid; isoquinolines; phenols; tertiary amino compound | plant metabolite |
uvaretin | [no description available] | low | 0 | 0 | aromatic ether; dihydrochalcones; polyketide; resorcinol | antineoplastic agent; plant metabolite |
fangchinoline | [no description available] | low | 0 | 0 | aromatic ether; bisbenzylisoquinoline alkaloid; macrocycle | anti-HIV-1 agent; anti-inflammatory agent; antineoplastic agent; antioxidant; neuroprotective agent; plant metabolite |
sakuranetin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; flavonoid phytoalexin; monomethoxyflavanone | antimycobacterial drug; plant metabolite |
maslinic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-inflammatory agent; antineoplastic agent; antioxidant; plant metabolite |
indole-5-carboxylic acid | [no description available] | low | 0 | 0 | indolecarboxylic acid | plant metabolite |
phenylalanylleucine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | plant metabolite |
ethyl protocatechuate | [no description available] | low | 0 | 0 | catechols; ethyl ester | antibacterial agent; antioxidant; apoptosis inducer; EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor; plant metabolite |
3,5-dimethoxytoluene | [no description available] | low | 0 | 0 | methoxybenzenes; toluenes | fragrance; plant metabolite |
methylthioethanol | [no description available] | low | 0 | 0 | aliphatic sulfide; primary alcohol | plant metabolite; xenobiotic metabolite |
cryptolepine | [no description available] | low | 0 | 0 | indole alkaloid; organic heterotetracyclic compound; organonitrogen heterocyclic compound | anti-inflammatory agent; antimalarial; antineoplastic agent; cysteine protease inhibitor; plant metabolite |
alpha-bergamotene | [no description available] | low | 0 | 0 | bridged compound; polycyclic olefin; sesquiterpene | plant metabolite; volatile oil component |
loganin | [no description available] | low | 0 | 0 | beta-D-glucoside; cyclopentapyran; enoate ester; iridoid monoterpenoid; methyl ester; monosaccharide derivative; secondary alcohol | anti-inflammatory agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; EC 3.4.23.46 (memapsin 2) inhibitor; neuroprotective agent; plant metabolite |
4-methyl-4-sulfanylpentan-2-one | [no description available] | low | 0 | 0 | alkanethiol; methyl ketone | plant metabolite; Saccharomyces cerevisiae metabolite |
5,7-dimethoxyflavone | [no description available] | low | 0 | 0 | dimethoxyflavone | plant metabolite |
loganic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclopentapyran; glucoside | plant metabolite |
cholest-4-en-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; cholestanoid | human metabolite; plant metabolite |
delta-tocopherol | [no description available] | low | 0 | 0 | tocopherol; vitamin E | food antioxidant; plant metabolite |
cycloartenol | [no description available] | low | 0 | 0 | 3beta-sterol; pentacyclic triterpenoid; phytosterols | plant metabolite |
beta-peltatin | [no description available] | low | 0 | 0 | furonaphthodioxole; gamma-lactone; lignan; organic heterotetracyclic compound; phenols | antineoplastic agent; plant metabolite |
elemol | [no description available] | low | 0 | 0 | olefinic compound; sesquiterpenoid; tertiary alcohol | fragrance; plant metabolite |
vestitol | [no description available] | low | 0 | 0 | aromatic ether; hydroxyisoflavans; methoxyisoflavan | anti-inflammatory agent; phytoalexin; plant metabolite |
gamma-tocopherol | [no description available] | low | 0 | 0 | tocopherol; vitamin E | algal metabolite; food antioxidant; plant metabolite |
orotidine | [no description available] | low | 0 | 0 | nucleoside; pyrimidinemonocarboxylic acid; uridines | bacterial metabolite; fungal metabolite; plant metabolite |
sugiol | [no description available] | low | 0 | 0 | abietane diterpenoid; carbotricyclic compound; cyclic terpene ketone; meroterpenoid; phenols | antineoplastic agent; antioxidant; antiviral agent; plant metabolite; radical scavenger |
erythrose | [no description available] | low | 0 | 0 | erythrose | plant metabolite |
24-methylene cycloartanol | [no description available] | low | 0 | 0 | 3beta-hydroxy steroid; pentacyclic triterpenoid | plant metabolite |
panose | [no description available] | low | 0 | 0 | trisaccharide | plant metabolite |
bursehernin | [no description available] | low | 0 | 0 | aromatic ether; benzodioxoles; butan-4-olide; lignan | plant metabolite |
sesaminol | [no description available] | low | 0 | 0 | benzodioxoles; furofuran; organic hydroxy compound | antioxidant; plant metabolite |
4',5,6,7-tetramethoxyflavone | [no description available] | low | 0 | 0 | tetramethoxyflavone | antimutagen; plant metabolite |
gardenin b | [no description available] | low | 0 | 0 | monohydroxyflavone; tetramethoxyflavone | plant metabolite |
quercetin 5,7,3',4'-tetramethyl ether | [no description available] | low | 0 | 0 | flavonols; tetramethoxyflavone | plant metabolite |
1,2,3,4-tetrahydro-beta-carboline-3-carboxylic acid | [no description available] | low | 0 | 0 | alpha-amino acid; aromatic amino acid; beta-carboline alkaloid | human urinary metabolite; human xenobiotic metabolite; plant metabolite; rat metabolite |
sarsasapogenin, (3beta,5alpha,25r)-isomer | [no description available] | low | 0 | 0 | sapogenin | gout suppressant; plant metabolite |
syringaresinol | [no description available] | low | 0 | 0 | aromatic ether; furofuran; lignan; polyether; polyphenol | plant metabolite |
cyclolaudenol | [no description available] | low | 0 | 0 | 3beta-hydroxy steroid; pentacyclic triterpenoid | plant metabolite |
galgravin | [no description available] | low | 0 | 0 | aryltetrahydrofuran; dimethoxybenzene; lignan; ring assembly | bone density conservation agent; neuroprotective agent; plant metabolite; platelet aggregation inhibitor |
erythrodiol | [no description available] | low | 0 | 0 | diol; pentacyclic triterpenoid; primary alcohol; secondary alcohol | plant metabolite |
6,6-dimethyl-2-methylenebicyclo(3.1.1)heptan-3-ol | [no description available] | low | 0 | 0 | carbobicyclic compound; pinane monoterpenoid; secondary alcohol | GABA modulator; mouse metabolite; plant metabolite; volatile oil component |
selenomethionine | [no description available] | low | 0 | 0 | amino acid zwitterion; selenomethionine | plant metabolite |
1,9-dideoxyforskolin | [no description available] | low | 0 | 0 | acetate ester; labdane diterpenoid; organic heterotricyclic compound | plant metabolite |
triptolide | [no description available] | low | 0 | 0 | diterpenoid; epoxide; gamma-lactam; organic heteroheptacyclic compound | antispermatogenic agent; plant metabolite |
indospicine | [no description available] | low | 0 | 0 | carboxamidine; non-proteinogenic L-alpha-amino acid | hepatotoxic agent; plant metabolite |
nimbin | [no description available] | low | 0 | 0 | acetate ester; cyclic terpene ketone; enone; furans; limonoid; methyl ester; tetracyclic triterpenoid | pesticide; plant metabolite |
neoeriocitrin | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; disaccharide derivative; flavanone glycoside; neohesperidoside; trihydroxyflavanone | plant metabolite |
kahweol | [no description available] | low | 0 | 0 | diterpenoid; furans; organic heteropentacyclic compound; primary alcohol; tertiary alcohol | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; antioxidant; apoptosis inducer; plant metabolite |
valerates | [no description available] | low | 0 | 0 | short-chain fatty acid anion; straight-chain saturated fatty acid anion | plant metabolite |
liquiritigenin | [no description available] | low | 0 | 0 | 4',7-dihydroxyflavanone | hormone agonist; plant metabolite |
s-sulphocysteine | [no description available] | low | 0 | 0 | organic thiosulfate; S-substituted L-cysteine | human metabolite; plant metabolite |
megestrol acetate | [no description available] | low | 0 | 0 | bridged compound; organic heterotetracyclic compound; secondary alcohol; sesquiterpene lactone; spiro compound; tertiary alcohol; tetrol | GABA antagonist; neurotoxin; phytogenic insecticide; plant metabolite |
echinuline | [no description available] | low | 0 | 0 | 2,5-diketopiperazines; indole alkaloid; indoles; olefinic compound | Aspergillus metabolite; marine metabolite; plant metabolite |
cubebin | [no description available] | low | 0 | 0 | benzodioxoles; cyclic acetal; lactol; lignan; secondary alcohol | analgesic; anti-inflammatory agent; antimicrobial agent; histamine antagonist; plant metabolite; trypanocidal drug |
1'-acetoxychavicol acetate | [no description available] | low | 0 | 0 | acetate ester; phenylpropanoid | antineoplastic agent; NF-kappaB inhibitor; plant metabolite |
hydrangenol | [no description available] | low | 0 | 0 | dihydroisocoumarins; phenols | anti-allergic agent; plant metabolite |
matairesinol | [no description available] | low | 0 | 0 | gamma-lactone; lignan; polyphenol | angiogenesis inhibitor; anti-asthmatic agent; phytoestrogen; plant metabolite |
astilbin | [no description available] | low | 0 | 0 | 3'-hydroxyflavanones; 4'-hydroxyflavanones; alpha-L-rhamnoside; flavanone glycoside; monosaccharide derivative; tetrahydroxyflavanone | anti-inflammatory agent; plant metabolite; radical scavenger |
ginsenoside rh2 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 20-hydroxy steroid; beta-D-glucoside; ginsenoside; tetracyclic triterpenoid | antineoplastic agent; apoptosis inducer; bone density conservation agent; cardioprotective agent; hepatoprotective agent; plant metabolite |
mannopine | [no description available] | low | 0 | 0 | amino acid opine; dicarboxylic acid monoamide; hexitol derivative; L-glutamine derivative; non-proteinogenic L-alpha-amino acid; secondary amino compound | plant metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
swertisin | [no description available] | low | 0 | 0 | dihydroxyflavone; flavone C-glycoside; monomethoxyflavone; monosaccharide derivative; polyphenol | adenosine A1 receptor antagonist; anti-inflammatory agent; antioxidant; hypoglycemic agent; plant metabolite |
senegalensin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; trihydroxyflavanone | antibacterial agent; plant metabolite |
glabranin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; dihydroxyflavanone | plant metabolite |
rubiadin | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | antibacterial agent; antioxidant; hepatoprotective agent; plant metabolite |
soranjidiol | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | antibacterial agent; plant metabolite |
skullcapflavone ii | [no description available] | low | 0 | 0 | dihydroxyflavone; tetramethoxyflavone | anti-asthmatic drug; plant metabolite |
rubimaillin | [no description available] | low | 0 | 0 | benzochromene; methyl ester; phenols | acyl-CoA:cholesterol acyltransferase 2 inhibitor; anti-inflammatory agent; antineoplastic agent; apoptosis inducer; neuroprotective agent; NF-kappaB inhibitor; plant metabolite |
tiglic acid | [no description available] | low | 0 | 0 | 2-methylbut-2-enoic acid | plant metabolite |
psorospermin | [no description available] | low | 0 | 0 | epoxide; organic heterotetracyclic compound; xanthones | antineoplastic agent; plant metabolite |
n-methylserotonin | [no description available] | low | 0 | 0 | phenols; tryptamines | human metabolite; plant metabolite |
lyxonic acid | [no description available] | low | 0 | 0 | lyxonic acid | plant metabolite |
kolaviron | [no description available] | low | 0 | 0 | 4'-methoxyflavanones; biflavonoid; dihydroflavonols; ring assembly; secondary alpha-hydroxy ketone | hepatoprotective agent; plant metabolite |
spinosin | [no description available] | low | 0 | 0 | dihydroxyflavone; flavone C-glycoside; monomethoxyflavone | anxiolytic drug; plant metabolite |
acrovestone | [no description available] | low | 0 | 0 | acetophenones; aromatic ether; olefinic compound; polyphenol | antioxidant; EC 1.14.18.1 (tyrosinase) inhibitor; plant metabolite |
cirsiliol | [no description available] | low | 0 | 0 | dimethoxyflavone; trihydroxyflavone | plant metabolite |
matteucinol | [no description available] | low | 0 | 0 | 4'-methoxyflavanones; dihydroxyflavanone; monomethoxyflavanone | plant metabolite; radical scavenger |
guvacoline | [no description available] | low | 0 | 0 | alpha,beta-unsaturated carboxylic ester; beta-amino acid ester; enoate ester; methyl ester; pyridine alkaloid; secondary amino compound; tetrahydropyridine | muscarinic agonist; plant metabolite |
corytuberine | [no description available] | low | 0 | 0 | aporphine alkaloid; aromatic ether; organic heterotetracyclic compound; polyphenol; tertiary amino compound | plant metabolite |
actinodaphine | [no description available] | low | 0 | 0 | aporphine alkaloid; aromatic ether; organic heteropentacyclic compound; phenols; secondary amino compound | antibacterial agent; antifungal agent; antineoplastic agent; apoptosis inducer; plant metabolite; platelet aggregation inhibitor; topoisomerase inhibitor |
ar-turmerone | [no description available] | low | 0 | 0 | enone; sesquiterpenoid | EC 3.1.1.7 (acetylcholinesterase) inhibitor; plant metabolite |
isolariciresinol | [no description available] | low | 0 | 0 | guaiacols; lignan; polyphenol; primary alcohol | plant metabolite |
4'-demethyldesoxypodophyllotoxin | [no description available] | low | 0 | 0 | furonaphthodioxole; gamma-lactone; lignan; methoxybenzenes; phenols | antineoplastic agent; antioxidant; immunosuppressive agent; plant metabolite |
t-cadinol | [no description available] | low | 0 | 0 | cadinane sesquiterpenoid; carbobicyclic compound; octahydronaphthalenes; tertiary alcohol | plant metabolite; volatile oil component |
1-hydroxy-2-methylanthraquinone | [no description available] | low | 0 | 0 | monohydroxyanthraquinone | plant metabolite |
nevadensin | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | plant metabolite |
salvigenin | [no description available] | low | 0 | 0 | monohydroxyflavone; trimethoxyflavone | antilipemic drug; antineoplastic agent; apoptosis inhibitor; autophagy inducer; hypoglycemic agent; immunomodulator; neuroprotective agent; plant metabolite |
secologanin | [no description available] | low | 0 | 0 | aldehyde; beta-D-glucoside; enoate ester; methyl ester; pyrans; secoiridoid glycoside | plant metabolite |
columbianetin acetate | [no description available] | low | 0 | 0 | acetate ester; furanocoumarin | plant metabolite |
maprounic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | HIV-1 reverse transcriptase inhibitor; plant metabolite |
acetyl aleuritolic acid | [no description available] | low | 0 | 0 | acetate ester; monocarboxylic acid; pentacyclic triterpenoid | antineoplastic agent; plant metabolite |
myricanone | [no description available] | low | 0 | 0 | aromatic ether; cyclic ketone; diarylheptanoid; methoxybenzenes; phenols | antineoplastic agent; plant metabolite |
glycyrrhetyl 3-monoglucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; enone; monosaccharide derivative; oxo dicarboxylic acid; pentacyclic triterpenoid; triterpenoid saponin | anti-allergic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; human xenobiotic metabolite; plant metabolite; sweetening agent |
hydroxysitosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid | metabolite; plant metabolite |
capsidiol | [no description available] | low | 0 | 0 | eremophilane sesquiterpenoid; octahydronaphthalenes; sesquiterpene phytoalexin | antifungal agent; plant metabolite |
phaseollin (isoflavan) | [no description available] | low | 0 | 0 | hydroxyisoflavans | plant metabolite |
cirsilineol | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | antineoplastic agent; plant metabolite |
secoxyloganin | [no description available] | low | 0 | 0 | beta-D-glucoside; dicarboxylic acid monoester; enoate ester; methyl ester; monosaccharide derivative; pyrans; secoiridoid glycoside | anti-allergic agent; antioxidant; plant metabolite |
butrin | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; flavanone glycoside; monohydroxyflavanone | anti-inflammatory agent; plant metabolite |
diplopterol | [no description available] | low | 0 | 0 | hopanoid; pentacyclic triterpenoid; tertiary alcohol | plant metabolite |
anacardic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; hydroxybenzoic acid | anti-inflammatory agent; antibacterial agent; anticoronaviral agent; apoptosis inducer; EC 2.3.1.48 (histone acetyltransferase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; neuroprotective agent; plant metabolite |
confertin | [no description available] | low | 0 | 0 | cyclic ketone; gamma-lactone; organic heterotricyclic compound; pseudoguaianolide | anti-inflammatory agent; metabolite; plant metabolite |
pluviatolide | [no description available] | low | 0 | 0 | aromatic ether; benzodioxoles; butan-4-olide; lignan; phenols | plant metabolite |
pectolinarin | [no description available] | low | 0 | 0 | dimethoxyflavone; disaccharide derivative; glycosyloxyflavone; monohydroxyflavanone; rutinoside | anti-inflammatory agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; plant metabolite |
albicanol | [no description available] | low | 0 | 0 | carbobicyclic compound; homoallylic alcohol; primary alcohol; sesquiterpenoid | antifeedant; antifungal agent; antineoplastic agent; fungal metabolite; mammalian metabolite; marine metabolite; plant metabolite |
inuviscolide | [no description available] | low | 0 | 0 | gamma-lactone; organic heterotricyclic compound; sesquiterpene lactone; tertiary alcohol | anti-inflammatory agent; plant metabolite |
helioxanthin | [no description available] | low | 0 | 0 | benzodioxoles; furonaphthodioxole; lignan | anti-HBV agent; antineoplastic agent; plant metabolite |
(2S)-5,7-dihydroxy-6,8-dimethylflavanone | [no description available] | low | 0 | 0 | dihydroxyflavanone | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; plant metabolite |
medioresinol | [no description available] | low | 0 | 0 | dimethoxybenzene; furofuran; lignan; polyphenol | plant metabolite |
5-heptadecylresorcinol | [no description available] | low | 0 | 0 | 5-alkylresorcinol | antineoplastic agent; plant metabolite |
(+)-epicatechin | [no description available] | low | 0 | 0 | catechin; polyphenol | cyclooxygenase 1 inhibitor; plant metabolite |
kobusin | [no description available] | low | 0 | 0 | benzodioxoles; dimethoxybenzene; furofuran; lignan | plant metabolite |
nootkatol | [no description available] | low | 0 | 0 | 6-isopropenyl-4,4a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-ol | plant metabolite |
ergolide | [no description available] | low | 0 | 0 | acetate ester; cyclic ketone; gamma-lactone; organic heterotricyclic compound; sesquiterpene lactone | anti-inflammatory agent; antineoplastic agent; metabolite; NF-kappaB inhibitor; plant metabolite |
dihydroresveratrol | [no description available] | low | 0 | 0 | stilbenol | plant metabolite; xenobiotic metabolite |
glycitin | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones 7-O-beta-D-glucoside; hydroxyisoflavone; methoxyisoflavone; monosaccharide derivative | plant metabolite |
benzyl d-glucopyranoside | [no description available] | low | 0 | 0 | benzenes; beta-D-glucoside | plant metabolite |
chrysosplenol c | [no description available] | low | 0 | 0 | trihydroxyflavone; trimethoxyflavone | antineoplastic agent; antiviral agent; plant metabolite |
5-o-methyllicoricidin | [no description available] | low | 0 | 0 | aromatic ether; hydroxyisoflavans; methoxyisoflavan | antibacterial agent; plant metabolite |
(-)-gallocatechin gallate | [no description available] | low | 0 | 0 | catechin; gallate ester; polyphenol | antineoplastic agent; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; human xenobiotic metabolite; plant metabolite |
pronuciferine | [no description available] | low | 0 | 0 | aromatic ether; cyclic ketone; isoquinoline alkaloid; isoquinolines; organic heterotetracyclic compound | plant metabolite |
sandaracopimaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid; pimarane diterpenoid; tricyclic diterpenoid | plant metabolite |
erythritol | [no description available] | low | 0 | 0 | butane-1,2,3,4-tetrol | antioxidant; human metabolite; plant metabolite |
stigmastanol | [no description available] | low | 0 | 0 | 3-hydroxy steroid; phytosterols | anticholesteremic drug; plant metabolite |
vincaleukoblastine | [no description available] | low | 0 | 0 | acetate ester; indole alkaloid fundamental parent; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; tertiary alcohol; tertiary amino compound; vinca alkaloid | antineoplastic agent; immunosuppressive agent; microtubule-destabilising agent; plant metabolite |
3-octanone | [no description available] | low | 0 | 0 | dialkyl ketone | antifeedant; biomarker; fungal metabolite; human urinary metabolite; insect attractant; plant metabolite; toxin |
lanosterol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol; tetracyclic triterpenoid | bacterial metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
lupeol | [no description available] | low | 0 | 0 | pentacyclic triterpenoid; secondary alcohol | anti-inflammatory drug; plant metabolite |
noscapine | [no description available] | low | 0 | 0 | aromatic ether; benzylisoquinoline alkaloid; cyclic acetal; isobenzofuranone; organic heterobicyclic compound; organic heterotricyclic compound; tertiary amino compound | antineoplastic agent; antitussive; apoptosis inducer; plant metabolite |
aromaticin | [no description available] | low | 0 | 0 | cyclic ketone; gamma-lactone; organic heterotricyclic compound; sesquiterpene lactone | anti-inflammatory agent; metabolite; plant metabolite |
methyl 3,4-dihydroxybenzoate | [no description available] | low | 0 | 0 | catechols; methyl ester | antioxidant; neuroprotective agent; plant metabolite |
2-hydroxy-1,4-benzoxazin-3-one | [no description available] | low | 0 | 0 | benzoxazine; lactam; lactol | allelochemical; plant metabolite |
menthofuran | [no description available] | low | 0 | 0 | 1-benzofurans; monoterpenoid | nematicide; plant metabolite |
lariciresinol | [no description available] | low | 0 | 0 | aromatic ether; lignan; oxolanes; phenols; primary alcohol | antifungal agent; plant metabolite |
medicarpin | [no description available] | low | 0 | 0 | medicarpin | plant metabolite |
anthricin | [no description available] | low | 0 | 0 | furonaphthodioxole; gamma-lactone; lignan; methoxybenzenes | antineoplastic agent; apoptosis inducer; plant metabolite |
indole-3-acetonitrile | [no description available] | low | 0 | 0 | indoles; nitrile | auxin; human xenobiotic metabolite; plant hormone; plant metabolite |
taiwanin c | [no description available] | low | 0 | 0 | benzodioxoles; furonaphthodioxole; lignan | antineoplastic agent; plant metabolite; platelet aggregation inhibitor |
sampangine | [no description available] | low | 0 | 0 | alkaloid; organic heterotetracyclic compound | antifungal agent; plant metabolite |
isochamaejasmin | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavone | plant metabolite |
norbelladine | [no description available] | low | 0 | 0 | catechols; phenethylamine alkaloid; polyphenol; secondary amino compound | plant metabolite |
raffinose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; trisaccharide | mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
scopolin | [no description available] | low | 0 | 0 | beta-D-glucoside; coumarins; monosaccharide derivative | plant metabolite |
stachyose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; tetrasaccharide | mouse metabolite; plant metabolite |
isomaltulose | [no description available] | low | 0 | 0 | glycosylfructose | animal metabolite; plant metabolite; sweetening agent |
discretamine | [no description available] | low | 0 | 0 | berberine alkaloid; organic heterotetracyclic compound | EC 5.99.1.2 (DNA topoisomerase) inhibitor; plant metabolite |
pelargonidin | [no description available] | low | 0 | 0 | 5-hydroxyanthocyanidin | plant metabolite |
(+)-limonene | [no description available] | low | 0 | 0 | limonene | plant metabolite |
hygrine | [no description available] | low | 0 | 0 | 1-(1-methylpyrrolidin-2-yl)acetone; pyrrolidine alkaloid | plant metabolite |
canaline | [no description available] | low | 0 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid | antimetabolite; antineoplastic agent; phytogenic insecticide; plant metabolite |
sophoranone | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; dihydroxyflavanone | plant metabolite |
petunidin | [no description available] | low | 0 | 0 | 5-hydroxyanthocyanidin | plant metabolite |
glaucarubinone | [no description available] | low | 0 | 0 | carboxylic ester; organic heteropentacyclic compound; quassinoid; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone; tetrol | antimalarial; antineoplastic agent; geroprotector; plant metabolite |
helveticoside | [no description available] | low | 0 | 0 | 14beta-hydroxy steroid; 5beta-hydroxy steroid; cardenolide glycoside; digitoxoside; monosaccharide derivative; steroid aldehyde; steroid lactone | antineoplastic agent; apoptosis inducer; plant metabolite |
ginsenoside re | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | anti-inflammatory agent; antineoplastic agent; antioxidant; nephroprotective agent; neuroprotective agent; plant metabolite |
ginsenoside rf | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 20-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | antineoplastic agent; apoptosis inducer; plant metabolite |
3-o-(alpha-l-arabinopyranosyl)hederagenin | [no description available] | low | 0 | 0 | alpha-L-arabinopyranoside; hydroxy monocarboxylic acid; monosaccharide derivative; pentacyclic triterpenoid; triterpenoid saponin | plant metabolite |
notoginsenoside r1 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | antioxidant; apoptosis inducer; neuroprotective agent; phytoestrogen; plant metabolite |
2-(2-phenylethyl)chromone | [no description available] | low | 0 | 0 | benzenes; chromones | plant metabolite |
ferruginol | [no description available] | low | 0 | 0 | abietane diterpenoid; carbotricyclic compound; meroterpenoid; phenols | antibacterial agent; antineoplastic agent; plant metabolite; protective agent |
stevioside | [no description available] | low | 0 | 0 | beta-D-glucoside; bridged compound; diterpene glycoside; ent-kaurane diterpenoid; tetracyclic diterpenoid | anti-inflammatory agent; antineoplastic agent; antioxidant; hypoglycemic agent; plant metabolite; sweetening agent |
lenticin | [no description available] | low | 0 | 0 | amino-acid betaine; indole alkaloid; L-tryptophan derivative | fungal metabolite; plant metabolite; xenobiotic |
absynthin | [no description available] | low | 0 | 0 | organic heteroheptacyclic compound; sesquiterpene lactone; triterpenoid | anti-inflammatory agent; plant metabolite |
abyssinone i | [no description available] | low | 0 | 0 | monohydroxyflavanone; phenols | apoptosis inhibitor; plant metabolite |
afzelechin | [no description available] | low | 0 | 0 | catechin; tetrahydroxyflavan | EC 3.2.1.20 (alpha-glucosidase) inhibitor; plant metabolite |
asebogenin | [no description available] | low | 0 | 0 | dihydrochalcones | plant metabolite |
lactucin | [no description available] | low | 0 | 0 | azulenofuran; cyclic terpene ketone; enone; primary alcohol; secondary alcohol; sesquiterpene lactone | antimalarial; plant metabolite; sedative |
solavetivone | [no description available] | low | 0 | 0 | cyclic ketone; sesquiterpenoid; spiro compound | phytoalexin; plant metabolite |
thujopsene | [no description available] | low | 0 | 0 | thujopsene | plant metabolite |
agnuside | [no description available] | low | 0 | 0 | benzoate ester; beta-D-glucoside; cyclopentapyran; iridoid monoterpenoid; monosaccharide derivative; phenols; terpene glycoside | anti-inflammatory agent; cyclooxygenase 2 inhibitor; plant metabolite; pro-angiogenic agent |
dolichodial | [no description available] | low | 0 | 0 | dialdehyde; iridoid monoterpenoid; olefinic compound | animal metabolite; plant metabolite; volatile oil component |
theasinensin a | [no description available] | low | 0 | 0 | biflavonoid; gallate ester; proanthocyanidin | anti-inflammatory agent; anticoronaviral agent; apoptosis inducer; EC 3.2.1.20 (alpha-glucosidase) inhibitor; hepatoprotective agent; hypoglycemic agent; melanin synthesis inhibitor; plant metabolite |
5,6,7-trimethoxyflavone | [no description available] | low | 0 | 0 | trimethoxyflavone | anti-HSV-1 agent; plant metabolite |
ammodendrine | [no description available] | low | 0 | 0 | acetamides; N-acylpiperidine; piperidine alkaloid | plant metabolite; teratogenic agent |
carpaine | [no description available] | low | 0 | 0 | alkaloid; macrodiolide | cardiovascular drug; plant metabolite |
myosmine | [no description available] | low | 0 | 0 | pyridine alkaloid; pyrroline | EC 1.14.14.14 (aromatase) inhibitor; mutagen; plant metabolite |
dihydropinosylvin | [no description available] | low | 0 | 0 | diphenylethane; resorcinols | EC 1.14.18.1 (tyrosinase) inhibitor; plant metabolite |
mucronulatol | [no description available] | low | 0 | 0 | hydroxyisoflavans; methoxyisoflavan | antineoplastic agent; plant metabolite |
ononin | [no description available] | low | 0 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones 7-O-beta-D-glucoside; monosaccharide derivative | plant metabolite |
yatein | [no description available] | low | 0 | 0 | benzodioxoles; butan-4-olide; lignan; methoxybenzenes | plant metabolite |
solasodine | [no description available] | low | 0 | 0 | alkaloid antibiotic; azaspiro compound; hemiaminal ether; oxaspiro compound; sapogenin; steroid alkaloid | anticonvulsant; antifungal agent; antiinfective agent; antioxidant; antipyretic; antispermatogenic agent; apoptosis inducer; cardiotonic drug; central nervous system depressant; diuretic; immunomodulator; plant metabolite; teratogenic agent |
1-alpha-terpineol | [no description available] | low | 0 | 0 | alpha-terpineol | plant metabolite |
7-deoxyloganic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; beta-D-glucoside; cyclopentapyran; iridoid monoterpenoid; monosaccharide derivative; monoterpene glycoside | plant metabolite |
epiafzelechin | [no description available] | low | 0 | 0 | catechin | plant metabolite |
maleic acid | [no description available] | low | 0 | 0 | butenedioic acid | algal metabolite; mouse metabolite; plant metabolite |
e-z cinnamic acid | [no description available] | low | 0 | 0 | cinnamic acid | plant metabolite |
farnesol | [no description available] | low | 0 | 0 | farnesol | plant metabolite |
lycopene | [no description available] | low | 0 | 0 | acyclic carotene | antioxidant; plant metabolite |
benzoylecgonine | [no description available] | low | 0 | 0 | benzoate ester; tropane alkaloid | epitope; human xenobiotic metabolite; marine xenobiotic metabolite; plant metabolite |
zeatin | [no description available] | low | 0 | 0 | zeatin | plant metabolite |
gamma-sitosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; phytosterols | marine metabolite; plant metabolite |
costatolide | [no description available] | low | 0 | 0 | cyclic ether; delta-lactone; organic heterotetracyclic compound; secondary alcohol | HIV-1 reverse transcriptase inhibitor; plant metabolite |
euscaphic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid; triol | plant metabolite |
cinnamtannin b-1 | [no description available] | low | 0 | 0 | proanthocyanidin | cyclooxygenase 2 inhibitor; plant metabolite |
meso-dihydroguaiaretic acid | [no description available] | low | 0 | 0 | guaiacols; lignan | plant metabolite |
8-prenylnaringenin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; trihydroxyflavanone | plant metabolite; platelet aggregation inhibitor |
gancaonin I | [no description available] | low | 0 | 0 | 1-benzofurans; aromatic ether; resorcinols | antibacterial agent; plant metabolite |
6,8-diprenylgenistein | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | antibacterial agent; plant metabolite |
glycyrin | [no description available] | low | 0 | 0 | aromatic ether; coumarins; hydroxyisoflavans | antibacterial agent; metabolite; plant metabolite |
glyasperin D | [no description available] | low | 0 | 0 | aromatic ether; hydroxyisoflavans; methoxyisoflavan | plant metabolite |
licoricidin | [no description available] | low | 0 | 0 | aromatic ether; hydroxyisoflavans; methoxyisoflavan | antibacterial agent; plant metabolite |
pallidol | [no description available] | low | 0 | 0 | carbopolycyclic compound; polyphenol; stilbenoid | antifungal agent; antioxidant; plant metabolite |
egonol | [no description available] | low | 0 | 0 | 1-benzofurans; aromatic ether; benzodioxoles; primary alcohol | plant metabolite |
23-hydroxytormentic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid; tetrol | anti-inflammatory agent; plant metabolite |
licocoumarone | [no description available] | low | 0 | 0 | 1-benzofurans; aromatic ether; resorcinols | antibacterial agent; apoptosis inducer; EC 1.4.3.4 (monoamine oxidase) inhibitor; plant metabolite |
likviriton | [no description available] | low | 0 | 0 | beta-D-glucoside; flavanone glycoside; monohydroxyflavanone; monosaccharide derivative | anti-inflammatory agent; anticoronaviral agent; plant metabolite |
sodium benzoate | [no description available] | low | 0 | 0 | organic sodium salt | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
3-mercaptohexanol | [no description available] | low | 0 | 0 | alkanethiol; primary alcohol | flavouring agent; plant metabolite; Saccharomyces cerevisiae metabolite |
3'-methoxyflavone | [no description available] | low | 0 | 0 | 3'-methoxyflavones | plant metabolite |
piperlactam s | [no description available] | low | 0 | 0 | alkaloid; aromatic ether; gamma-lactam; organic heterotetracyclic compound; phenols | anti-inflammatory agent; antioxidant; plant metabolite |
piperyline | [no description available] | low | 0 | 0 | benzodioxoles; N-acylpyrrolidine; pyrrolidine alkaloid; tertiary carboxamide | antifungal agent; apoptosis inducer; plant metabolite |
crotonic acid | [no description available] | low | 0 | 0 | 2-butenoic acid | plant metabolite |
methyl cinnamate | [no description available] | low | 0 | 0 | methyl cinnamate | antibacterial agent; fungal metabolite; nematicide; plant metabolite |
2,4-hexadienal | [no description available] | low | 0 | 0 | hexadienal; polyunsaturated fatty aldehyde; volatile organic compound | flavouring agent; plant metabolite |
geraniol | [no description available] | low | 0 | 0 | 3,7-dimethylocta-2,6-dien-1-ol; monoterpenoid; primary alcohol | allergen; fragrance; plant metabolite; volatile oil component |
epipinoresinol | [no description available] | low | 0 | 0 | pinoresinol | marine metabolite; plant metabolite |
sinapinic acid | [no description available] | low | 0 | 0 | sinapic acid | MALDI matrix material; plant metabolite |
citral | [no description available] | low | 0 | 0 | enal; monoterpenoid; polyprenal | plant metabolite; volatile oil component |
squalene | [no description available] | low | 0 | 0 | triterpene | human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
coumestan | [no description available] | low | 0 | 0 | coumestans; delta-lactone | phytoestrogen; plant metabolite |
antofine | [no description available] | low | 0 | 0 | alkaloid antibiotic; alkaloid; aromatic ether; organic heteropentacyclic compound | angiogenesis inhibitor; anti-inflammatory agent; antimicrobial agent; antineoplastic agent; antiviral agent; phytotoxin; plant metabolite |
p-hydroxycinnamaldehyde | [no description available] | low | 0 | 0 | cinnamaldehydes | apoptosis inducer; EC 1.14.13.39 (nitric oxide synthase) inhibitor; plant metabolite |
n-methylproline | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-proline derivative; tertiary amino compound | human metabolite; plant metabolite |
vedelianin | [no description available] | low | 0 | 0 | cyclic ether; organic heterotricyclic compound; resorcinols; stilbenoid | antineoplastic agent; plant metabolite |
pedilstatin | [no description available] | low | 0 | 0 | acetate ester; phorbol ester; primary allylic alcohol | plant metabolite |
nerol | [no description available] | low | 0 | 0 | 3,7-dimethylocta-2,6-dien-1-ol | fragrance; plant metabolite; volatile oil component |
cannabidiol | [no description available] | low | 0 | 0 | olefinic compound; phytocannabinoid; resorcinols | antimicrobial agent; plant metabolite |
dehydrovomifoliol | [no description available] | low | 0 | 0 | dehydrovomifoliol | plant metabolite |
isoeugenol | [no description available] | low | 0 | 0 | isoeugenol | plant metabolite |
huperzine a | [no description available] | low | 0 | 0 | organic heterotricyclic compound; primary amino compound; pyridone; sesquiterpene alkaloid | EC 3.1.1.7 (acetylcholinesterase) inhibitor; neuroprotective agent; nootropic agent; plant metabolite |
nootkatone | [no description available] | low | 0 | 0 | carbobicyclic compound; enone; sesquiterpenoid | fragrance; insect repellent; plant metabolite |
geranyl acetate | [no description available] | low | 0 | 0 | acetate ester; monoterpenoid | plant metabolite |
coniferyl alcohol | [no description available] | low | 0 | 0 | guaiacols; phenylpropanoid | animal metabolite; monolignol; mouse metabolite; pheromone; plant metabolite; volatile oil component |
geranylacetone | [no description available] | low | 0 | 0 | monoterpene ketone | flavouring agent; fragrance; plant metabolite; volatile oil component |
goitrin | [no description available] | low | 0 | 0 | 5-ethenyl-1,3-oxazolidine-2-thione | antiviral agent; plant metabolite |
7-deacetylgedunin | [no description available] | low | 0 | 0 | cyclic terpene ketone; delta-lactone; enone; epoxide; furans; limonoid; pentacyclic triterpenoid | anti-inflammatory agent; antimalarial; metabolite; plant metabolite |
manool | [no description available] | low | 0 | 0 | labdane diterpenoid; tertiary alcohol | antibacterial agent; antineoplastic agent; plant metabolite |
2-oxindole-3-acetic acid | [no description available] | low | 0 | 0 | indole-3-acetic acids; monocarboxylic acid; oxindoles | plant metabolite |
bigelovin | [no description available] | low | 0 | 0 | acetate ester; cyclic ketone; gamma-lactone; organic heterotricyclic compound; sesquiterpene lactone | antineoplastic agent; apoptosis inducer; immunomodulator; plant metabolite |
cyclanoline | [no description available] | low | 0 | 0 | berberine alkaloid; quaternary ammonium ion | EC 3.1.1.7 (acetylcholinesterase) inhibitor; plant metabolite |
sideroxylin | [no description available] | low | 0 | 0 | dihydroxyflavone; monomethoxyflavone | plant metabolite |
ladanein | [no description available] | low | 0 | 0 | dihydroxyflavone; dimethoxyflavone | antiviral agent; plant metabolite; radical scavenger |
t-muurolol | [no description available] | low | 0 | 0 | cadinane sesquiterpenoid; carbobicyclic compound; octahydronaphthalenes; tertiary alcohol | bacterial metabolite; fungicide; marine metabolite; plant metabolite; volatile oil component |
alpha-carotene | [no description available] | low | 0 | 0 | carotenoid beta-end derivative; cyclic carotene | plant metabolite; provitamin A |
citramalate | [no description available] | low | 0 | 0 | dicarboxylic acid dianion | human metabolite; plant metabolite |
fraxin | [no description available] | low | 0 | 0 | aromatic ether; beta-D-glucoside; hydroxycoumarin | anti-inflammatory agent; hepatoprotective agent; plant metabolite |
decaprenoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; methyl-branched fatty acid; monoterpenoid; polyunsaturated fatty acid | antifungal agent; EC 1.14.18.1 (tyrosinase) inhibitor; melanin synthesis inhibitor; pheromone; plant metabolite |
gallocatechin-3-gallate | [no description available] | low | 0 | 0 | catechin; gallate ester; polyphenol | plant metabolite |
coniferin | [no description available] | low | 0 | 0 | aromatic ether; cinnamyl alcohol beta-D-glucoside; monosaccharide derivative | plant metabolite |
gibberellin a1 | [no description available] | low | 0 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone | plant metabolite |
leukotriene a4 | [no description available] | low | 0 | 0 | epoxy fatty acid; leukotriene; long-chain fatty acid; oxylipin; polyunsaturated fatty acid | human metabolite; mouse metabolite; plant metabolite |
sinapine | [no description available] | low | 0 | 0 | acylcholine | antioxidant; photosynthetic electron-transport chain inhibitor; plant metabolite |
trans-phytol | [no description available] | low | 0 | 0 | diterpenoid; long-chain primary fatty alcohol | algal metabolite; plant metabolite; schistosomicide drug |
linoleic acid | [no description available] | low | 0 | 0 | octadecadienoic acid; omega-6 fatty acid | algal metabolite; Daphnia galeata metabolite; plant metabolite |
beta carotene | [no description available] | low | 0 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
leukotriene b4 | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; hydroxy polyunsaturated fatty acid; leukotriene; long-chain fatty acid | human metabolite; mouse metabolite; plant metabolite; vasoconstrictor agent |
coniferaldehyde | [no description available] | low | 0 | 0 | cinnamaldehydes; guaiacols; phenylpropanoid | antifungal agent; plant metabolite |
herbacetin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antilipemic drug; antineoplastic agent; apoptosis inducer; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 4.1.1.17 (ornithine decarboxylase) inhibitor; plant metabolite |
5'-o-caffeoylquinic acid | [no description available] | low | 0 | 0 | cinnamate ester; cyclitol carboxylic acid | plant metabolite |
luteolin-7-glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside; glycosyloxyflavone; monosaccharide derivative; trihydroxyflavone | antioxidant; plant metabolite |
gossypetin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; hexahydroxyflavone | plant metabolite |
ayanin | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | plant metabolite |
apiin | [no description available] | low | 0 | 0 | beta-D-glucoside; dihydroxyflavone; glycosyloxyflavone | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; plant metabolite |
(all-e) phytoene | [no description available] | low | 0 | 0 | phytoene | plant metabolite |
vitamin d 2 | [no description available] | low | 0 | 0 | hydroxy seco-steroid; seco-ergostane; vitamin D | bone density conservation agent; nutraceutical; plant metabolite; rodenticide |
stigmasterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; phytosterols; stigmastane sterol | plant metabolite |
sinapaldehyde | [no description available] | low | 0 | 0 | cinnamaldehydes; dimethoxybenzene; phenols | antifungal agent; plant metabolite |
3-methylkaempferol | [no description available] | low | 0 | 0 | monomethoxyflavone; trihydroxyflavone | plant metabolite |
abscisic acid | [no description available] | low | 0 | 0 | 2-cis-abscisic acid | plant hormone; plant metabolite |
gamma-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-6 fatty acid | human metabolite; mouse metabolite; plant metabolite |
petroselinic acid | [no description available] | low | 0 | 0 | octadec-6-enoic acid | plant metabolite |
cyclobenzaprine | [no description available] | low | 0 | 0 | 9,11,13-octadecatrienoic acid | antineoplastic agent; plant metabolite |
jasmonic acid | [no description available] | low | 0 | 0 | oxo monocarboxylic acid | jasmonates; plant metabolite |
2-hexenal, z-isomer | [no description available] | low | 0 | 0 | 2-hexenal | antibacterial agent; flavouring agent; plant metabolite |
aureusidin | [no description available] | low | 0 | 0 | hydroxyaurone | plant metabolite |
antheraxanthin | [no description available] | low | 0 | 0 | epoxycarotenol | biological pigment; marine metabolite; plant metabolite |
capsanthin | [no description available] | low | 0 | 0 | carotenone | plant metabolite |
gardenia yellow | [no description available] | low | 0 | 0 | diester; disaccharide derivative; diterpenoid | antioxidant; food colouring; histological dye; plant metabolite |
cryptoxanthins | [no description available] | low | 0 | 0 | carotenol | antioxidant; biomarker; plant metabolite; provitamin A |
lutein | [no description available] | low | 0 | 0 | carotenol | food colouring; plant metabolite |
hispidol | [no description available] | low | 0 | 0 | hydroxyaurone | plant metabolite |
isobutrin | [no description available] | low | 0 | 0 | beta-D-glucoside; chalcones; monosaccharide derivative; phenols | anti-inflammatory agent; hepatoprotective agent; plant metabolite |
cassaine | [no description available] | low | 0 | 0 | enoate ester; organic hydroxy compound; tertiary amino compound; tricyclic diterpenoid | antihypertensive agent; cardiotonic drug; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; local anaesthetic; plant metabolite; poison |
okanin | [no description available] | low | 0 | 0 | benzenetriol; chalcones | plant metabolite |
cucurbitacin i | [no description available] | low | 0 | 0 | cucurbitacin; tertiary alpha-hydroxy ketone | antineoplastic agent; plant metabolite |
brassicasterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | algal metabolite; animal metabolite; biomarker; EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor; human metabolite; marine metabolite; plant metabolite; sterol biosynthesis inhibitor |
esculetin | [no description available] | low | 0 | 0 | hydroxycoumarin | antioxidant; plant metabolite; ultraviolet filter |
eupatolide | [no description available] | low | 0 | 0 | gamma-lactone; germacranolide; homoallylic alcohol; secondary alcohol | antineoplastic agent; plant metabolite |
oleuropein | [no description available] | low | 0 | 0 | beta-D-glucoside; catechols; diester; methyl ester; pyrans; secoiridoid glycoside | anti-inflammatory agent; antihypertensive agent; antineoplastic agent; antioxidant; apoptosis inducer; NF-kappaB inhibitor; nutraceutical; plant metabolite; radical scavenger |
amentoflavone | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavone; ring assembly | angiogenesis inhibitor; antiviral agent; cathepsin B inhibitor; P450 inhibitor; plant metabolite |
apigenin dimethylether | [no description available] | low | 0 | 0 | dimethoxyflavone; monohydroxyflavone | plant metabolite |
axillarin | [no description available] | low | 0 | 0 | dimethoxyflavone; tetrahydroxyflavone | plant metabolite |
azaleatin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | plant metabolite |
chrysosplenetin b | [no description available] | low | 0 | 0 | dihydroxyflavone; tetramethoxyflavone | antiviral agent; plant metabolite |
gossypin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; glycosyloxyflavone; monosaccharide derivative; pentahydroxyflavone | neuroprotective agent; plant metabolite |
hispidulin | [no description available] | low | 0 | 0 | monomethoxyflavone; trihydroxyflavone | anti-inflammatory agent; anticonvulsant; antineoplastic agent; antioxidant; apoptosis inducer; plant metabolite |
euxanthone | [no description available] | low | 0 | 0 | phenols; xanthones | metabolite; plant metabolite |
gartanin | [no description available] | low | 0 | 0 | polyphenol; xanthones | antineoplastic agent; plant metabolite |
gentiacaulein | [no description available] | low | 0 | 0 | aromatic ether; polyphenol; xanthones | plant metabolite |
gentisein | [no description available] | low | 0 | 0 | polyphenol; xanthones | plant metabolite |
gentisin | [no description available] | low | 0 | 0 | aromatic ether; polyphenol; xanthones | plant metabolite |
isogentisin | [no description available] | low | 0 | 0 | aromatic ether; polyphenol; xanthones | EC 1.4.3.4 (monoamine oxidase) inhibitor; plant metabolite |
hyperoside | [no description available] | low | 0 | 0 | beta-D-galactoside; monosaccharide derivative; quercetin O-glycoside; tetrahydroxyflavone | hepatoprotective agent; plant metabolite |
mangiferin | [no description available] | low | 0 | 0 | C-glycosyl compound; xanthones | anti-inflammatory agent; antioxidant; hypoglycemic agent; plant metabolite |
mangostin | [no description available] | low | 0 | 0 | aromatic ether; phenols; xanthones | antimicrobial agent; antineoplastic agent; antioxidant; plant metabolite |
1,8-dihydroxy-3,7-dimethoxyxanthone | [no description available] | low | 0 | 0 | aromatic ether; polyphenol; xanthones | plant metabolite |
norathyriol | [no description available] | low | 0 | 0 | polyphenol; xanthones | antineoplastic agent; EC 2.7.11.13 (protein kinase C) inhibitor; plant metabolite |
1,2,8-trihydroxy-6-methoxyxanthone | [no description available] | low | 0 | 0 | aromatic ether; polyphenol; xanthones | antioxidant; plant metabolite |
kuwanon g | [no description available] | low | 0 | 0 | resorcinols; tetrahydroxyflavone | anti-inflammatory agent; plant metabolite |
kuwanon h | [no description available] | low | 0 | 0 | resorcinols; tetrahydroxyflavone | plant metabolite |
morusin | [no description available] | low | 0 | 0 | extended flavonoid; trihydroxyflavone | antineoplastic agent; plant metabolite |
myricitrin | [no description available] | low | 0 | 0 | alpha-L-rhamnoside; glycosyloxyflavone; monosaccharide derivative; pentahydroxyflavone | anti-allergic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; plant metabolite |
pachypodol | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | antiemetic; plant metabolite |
quercetagetin | [no description available] | low | 0 | 0 | flavonols; hexahydroxyflavone | antioxidant; antiviral agent; plant metabolite |
robinin | [no description available] | low | 0 | 0 | dihydroxyflavone; glycosyloxyflavone | plant metabolite |
santin | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | plant metabolite |
7-hydroxy-6,4'-dimethoxyisoflavone | [no description available] | low | 0 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones | plant metabolite |
pterostilbene | [no description available] | low | 0 | 0 | diether; methoxybenzenes; stilbenol | anti-inflammatory agent; antineoplastic agent; antioxidant; apoptosis inducer; hypoglycemic agent; neuroprotective agent; neurotransmitter; plant metabolite; radical scavenger |
genistein-8-c-glucoside | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones; C-glycosyl compound | plant metabolite |
5-o-caffeoylshikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; carboxylic ester; catechols; cyclohexenecarboxylic acid | plant metabolite |
cynarine | [no description available] | low | 0 | 0 | alkyl caffeate ester; quinic acid | plant metabolite |
iridin | [no description available] | low | 0 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones 7-O-beta-D-glucoside; hydroxyisoflavone; monosaccharide derivative | plant metabolite |
orobol | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | anti-inflammatory agent; fungal metabolite; plant metabolite; radical scavenger |
psi-baptigenin | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones; benzodioxoles | antiprotozoal drug; plant metabolite |
psoralidin | [no description available] | low | 0 | 0 | coumestans; delta-lactone; polyphenol | estrogen receptor agonist; plant metabolite |
puerarin | [no description available] | low | 0 | 0 | C-glycosyl compound; hydroxyisoflavone | plant metabolite |
tectoridin | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones 7-O-beta-D-glucoside; hydroxyisoflavone; methoxyisoflavone; monosaccharide derivative | plant metabolite |
tectorigenin | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones; methoxyisoflavone | anti-inflammatory agent; plant metabolite |
wighteone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | antifungal agent; plant metabolite |
maytansine | [no description available] | low | 0 | 0 | alpha-amino acid ester; carbamate ester; epoxide; maytansinoid; organic heterotetracyclic compound; organochlorine compound | antimicrobial agent; antimitotic; antineoplastic agent; plant metabolite; tubulin modulator |
savinin | [no description available] | low | 0 | 0 | benzodioxoles; gamma-lactone; lignan | anti-inflammatory agent; anticoronaviral agent; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; plant metabolite; T-cell proliferation inhibitor |
tectochrysin | [no description available] | low | 0 | 0 | monohydroxyflavone; monomethoxyflavone | antidiarrhoeal drug; antineoplastic agent; plant metabolite |
2'-hydroxygenistein | [no description available] | low | 0 | 0 | hydroxyisoflavone | plant metabolite |
astragalin | [no description available] | low | 0 | 0 | beta-D-glucoside; kaempferol O-glucoside; monosaccharide derivative; trihydroxyflavone | plant metabolite; trypanocidal drug |
cinnamyl acetate | [no description available] | low | 0 | 0 | acetate ester | plant metabolite |
kaempferol-3-o-galactoside | [no description available] | low | 0 | 0 | beta-D-galactoside; glycosyloxyflavone; monosaccharide derivative; trihydroxyflavone | antifungal agent; plant metabolite |
kaempferol 3-o-sophoroside | [no description available] | low | 0 | 0 | sophoroside; trihydroxyflavone | plant metabolite |
quercetin-3-o-sophoroside | [no description available] | low | 0 | 0 | sophoroside; tetrahydroxyflavone | antioxidant; plant metabolite |
ethyl linoleate | [no description available] | low | 0 | 0 | long-chain fatty acid ethyl ester | anti-inflammatory agent; plant metabolite |
plaunotol | [no description available] | low | 0 | 0 | diterpenoid; primary alcohol | anti-ulcer drug; antibacterial agent; antineoplastic agent; apoptosis inducer; nephroprotective agent; plant metabolite; vulnerary |
sofalcone | [no description available] | low | 0 | 0 | aromatic ether; chalcones; monocarboxylic acid | anti-ulcer drug; antibacterial agent; gastrointestinal drug; plant metabolite |
xanthoxin | [no description available] | low | 0 | 0 | apo carotenoid sesquiterpenoid; enal | plant growth retardant; plant metabolite |
tocotrienol, alpha | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | ferroptosis inhibitor; human metabolite; neuroprotective agent; plant metabolite |
tocotrienol, beta | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | antineoplastic agent; apoptosis inducer; plant metabolite |
gamma-tocotrienol | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | antineoplastic agent; antioxidant; apoptosis inducer; hepatoprotective agent; plant metabolite; radiation protective agent |
tocotrienol, delta | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | anti-inflammatory agent; antineoplastic agent; apoptosis inducer; bone density conservation agent; NF-kappaB inhibitor; plant metabolite; radiation protective agent; Saccharomyces cerevisiae metabolite |
4-hydroxychalcone | [no description available] | low | 0 | 0 | chalcones; phenols | antihypertensive agent; plant metabolite |
9-hydroxy-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | HODE; octadecadienoic acid | human metabolite; metabolite; mouse metabolite; plant metabolite |
2-heptenal | [no description available] | low | 0 | 0 | enal; medium-chain fatty aldehyde; monounsaturated fatty aldehyde | plant metabolite; uremic toxin |
2-nonenal, (trans)-isomer | [no description available] | low | 0 | 0 | enal; medium-chain fatty aldehyde; monounsaturated fatty aldehyde | plant metabolite |
oleylamide | [no description available] | low | 0 | 0 | primary fatty amide | human metabolite; plant metabolite |
1-monooleoyl-rac-glycerol | [no description available] | low | 0 | 0 | 1-acylglycerol 18:1; monooleoylglycerol | plant metabolite |
monolinolein | [no description available] | low | 0 | 0 | 1-acylglycerol 18:2; rac-1-monoacylglycerol | antiviral agent; human metabolite; plant metabolite |
methyl linoleate | [no description available] | low | 0 | 0 | fatty acid methyl ester | plant metabolite |
vitamin k 1 | [no description available] | low | 0 | 0 | phylloquinones; vitamin K | cofactor; human metabolite; plant metabolite |
delta(3)-hexadecenoic acid | [no description available] | low | 0 | 0 | hexadecenoic acid | plant metabolite |
stearidonic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; octadecatetraenoic acid; omega-3 fatty acid | Daphnia galeata metabolite; mouse metabolite; plant metabolite |
juniperonic acid | [no description available] | low | 0 | 0 | icosatetraenoic acid | plant metabolite |
casticin | [no description available] | low | 0 | 0 | dihydroxyflavone; tetramethoxyflavone | apoptosis inducer; plant metabolite |
rosmarinic acid | [no description available] | low | 0 | 0 | carboxylic ester; monocarboxylic acid; phenylpropanoid; polyphenol | antioxidant; EC 1.1.1.21 (aldehyde reductase) inhibitor; non-steroidal anti-inflammatory drug; peripheral nervous system drug; plant metabolite; serine proteinase inhibitor |
cannabigerol | [no description available] | low | 0 | 0 | phytocannabinoid; resorcinols | anti-inflammatory agent; antibacterial agent; antioxidant; appetite enhancer; cannabinoid receptor agonist; neuroprotective agent; plant metabolite |
centaureidin | [no description available] | low | 0 | 0 | trihydroxyflavone; trimethoxyflavone | antineoplastic agent; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; plant metabolite |
cinnamyl alcohol | [no description available] | low | 0 | 0 | cinnamyl alcohol | plant metabolite |
7-demethylsuberosin | [no description available] | low | 0 | 0 | hydroxycoumarin | plant metabolite |
kaempferol 3-o-rhamnoside | [no description available] | low | 0 | 0 | glycosyloxyflavone; monosaccharide derivative; trihydroxyflavone | anti-inflammatory agent; antibacterial agent; plant metabolite |
syringin | [no description available] | low | 0 | 0 | beta-D-glucoside; dimethoxybenzene; monosaccharide derivative; primary alcohol | hepatoprotective agent; plant metabolite |
3,3'-di-o-methylquercetin | [no description available] | low | 0 | 0 | 3'-methoxyflavones; dimethoxyflavone; trihydroxyflavone | antibacterial agent; antineoplastic agent; apoptosis inducer; plant metabolite |
glycitein | [no description available] | low | 0 | 0 | 7-hydroxyisoflavone; methoxyisoflavone | fungal metabolite; phytoestrogen; plant metabolite |
glycycoumarin | [no description available] | low | 0 | 0 | aromatic ether; coumarins; resorcinols | antispasmodic drug; plant metabolite |
quadrangularin a | [no description available] | low | 0 | 0 | indanes; polyphenol; stilbenoid | antioxidant; plant metabolite |
isoginkgetin | [no description available] | low | 0 | 0 | aromatic ether; biflavonoid | antineoplastic agent; EC 3.4.24.35 (gelatinase B) inhibitor; plant metabolite |
isomangiferin | [no description available] | low | 0 | 0 | C-glycosyl compound; polyphenol; xanthones | anti-HSV-1 agent; plant metabolite |
isosalipurposide | [no description available] | low | 0 | 0 | beta-D-glucoside; chalcones; monosaccharide derivative; resorcinols | antioxidant; plant metabolite |
kaempferol-3-o-rutinoside | [no description available] | low | 0 | 0 | disaccharide derivative; kaempferol O-glucoside; rutinoside; trihydroxyflavone | metabolite; plant metabolite; radical scavenger |
luteolin 4'-o-glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside; glycosyloxyflavone; monosaccharide derivative; trihydroxyflavone | plant metabolite |
methyl linolenate | [no description available] | low | 0 | 0 | fatty acid methyl ester | insect attractant; plant metabolite |
3'-o-methylorobol | [no description available] | low | 0 | 0 | hydroxyisoflavone; methoxyisoflavone | plant metabolite |
1,3,6-trihydroxy-2-methyl-9,10-anthraquinone | [no description available] | low | 0 | 0 | trihydroxyanthraquinone | plant metabolite |
cudraflavone c | [no description available] | low | 0 | 0 | tetrahydroxyflavone | antibacterial agent; antineoplastic agent; plant metabolite |
muromonab-cd3 | [no description available] | low | 0 | 0 | extended flavonoid; pyranochromane; trihydroxyflavone | anti-inflammatory agent; plant metabolite |
neobavaisoflavone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; plant metabolite; platelet aggregation inhibitor |
neoglycyrol | [no description available] | low | 0 | 0 | aromatic ether; coumestans; delta-lactone; polyphenol | antineoplastic agent; plant metabolite |
beta-ocimene | [no description available] | low | 0 | 0 | beta-ocimene | plant metabolite |
ombuine | [no description available] | low | 0 | 0 | dimethoxyflavone; flavonols; trihydroxyflavone | anti-inflammatory agent; plant metabolite |
osthenol | [no description available] | low | 0 | 0 | hydroxycoumarin | antifungal agent; plant metabolite |
5,7-dihydroxy-4',6-dimethoxyflavone | [no description available] | low | 0 | 0 | dihydroxyflavone; dimethoxyflavone | plant metabolite |
tiliroside | [no description available] | low | 0 | 0 | cinnamate ester; glycosyloxyflavone; monosaccharide derivative; trihydroxyflavone | plant metabolite |
spiraeoside | [no description available] | low | 0 | 0 | beta-D-glucoside; flavonols; monosaccharide derivative; quercetin O-glucoside; tetrahydroxyflavone | antineoplastic agent; antioxidant; plant metabolite |
rhamnazin | [no description available] | low | 0 | 0 | aromatic ether; dimethoxyflavone; phenols; trihydroxyflavone | antineoplastic agent; plant metabolite |
kaempferol-7-methyl ether | [no description available] | low | 0 | 0 | flavonols; monomethoxyflavone; trihydroxyflavone | plant metabolite |
oridonin | [no description available] | low | 0 | 0 | cyclic hemiketal; enone; ent-kaurane diterpenoid; organic heteropentacyclic compound; secondary alcohol | angiogenesis inhibitor; anti-asthmatic agent; antibacterial agent; antineoplastic agent; apoptosis inducer; plant metabolite |
7,8-dimethylalloxazine | [no description available] | low | 0 | 0 | 7,8-dimethylbenzo[g]pteridine-2,4-dione | plant metabolite |
ergothioneine | [no description available] | low | 0 | 0 | 1,3-dihydroimidazole-2-thiones; amino-acid betaine; L-histidine derivative; sulfur-containing amino acid | antioxidant; chelator; fungal metabolite; plant metabolite; xenobiotic metabolite |
ermanin | [no description available] | low | 0 | 0 | dihydroxyflavone; dimethoxyflavone | anti-inflammatory agent; antimycobacterial drug; antineoplastic agent; apoptosis inducer; plant metabolite |
5-hydroxy-3,3',4',7-tetramethoxyflavone | [no description available] | low | 0 | 0 | 3'-methoxyflavones; monohydroxyflavone; tetramethoxyflavone | plant metabolite |
methyl 2,5-dihydroxycinnamate | [no description available] | low | 0 | 0 | cinnamate ester; hydroquinones; methyl ester | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; geroprotector; human urinary metabolite; plant metabolite |
methyl ferulate | [no description available] | low | 0 | 0 | cinnamate ester; guaiacols; methyl ester | plant metabolite |
lichexanthone | [no description available] | low | 0 | 0 | aromatic ether; phenols; xanthones | plant metabolite |
glyceryl behenate | [no description available] | low | 0 | 0 | 1-monoglyceride; fatty acid ester | antineoplastic agent; plant metabolite |
ethyl oleate | [no description available] | low | 0 | 0 | long-chain fatty acid ethyl ester | acaricide; plant metabolite |
2-pentenal | [no description available] | low | 0 | 0 | 2-pentenal | plant metabolite |
erucyl amide | [no description available] | low | 0 | 0 | 13-docosenamide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite; mammalian metabolite; plant metabolite; rat metabolite |
beta-damascenone | [no description available] | low | 0 | 0 | apo carotenoid monoterpenoid; cyclic monoterpene ketone; enone | fragrance; plant metabolite; volatile oil component |
piperic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; benzodioxoles | plant metabolite |
pipercallosidine | [no description available] | low | 0 | 0 | alkaloid; benzodioxoles; enamide; secondary carboxamide | apoptosis inducer; metabolite; plant metabolite |
dehydrodiconiferyl alcohol | [no description available] | low | 0 | 0 | 1-benzofurans; guaiacols; guaiacyl lignin; primary alcohol | anti-inflammatory agent; plant metabolite |
noreugenin | [no description available] | low | 0 | 0 | chromones; resorcinols | plant metabolite |
decussatin | [no description available] | low | 0 | 0 | aromatic ether; phenols; xanthones | plant metabolite |
beta-aminopropionitrile fumarate (2:1) | [no description available] | low | 0 | 0 | fumarate salt | antineoplastic agent; antirheumatic drug; collagen cross-linking inhibitor; plant metabolite |
gamma-mangostin | [no description available] | low | 0 | 0 | phenols; xanthones | antineoplastic agent; plant metabolite; protein kinase inhibitor |
irigenin | [no description available] | low | 0 | 0 | 4'-methoxyisoflavones; hydroxyisoflavone | plant metabolite |
5,4'-dihydroxy-7,3'-dimethoxyflavone | [no description available] | low | 0 | 0 | dihydroxyflavone; dimethoxyflavone | anti-allergic agent; anti-inflammatory agent; antibacterial agent; antioxidant; melanin synthesis inhibitor; plant metabolite |
1,7-dihydroxy-4-methoxyxanthone | [no description available] | low | 0 | 0 | aromatic ether; phenols; xanthones | metabolite; plant metabolite |
tetrahydroxycurcumin | [no description available] | low | 0 | 0 | beta-diketone; catechols; diarylheptanoid; enone; polyphenol | anti-inflammatory agent; neuroprotective agent; plant metabolite |
semilicoisoflavone b | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | EC 1.1.1.21 (aldehyde reductase) inhibitor; plant metabolite |
lespenefril | [no description available] | low | 0 | 0 | alpha-L-rhamnoside; dihydroxyflavone; glycosyloxyflavone; monosaccharide derivative; polyphenol | anti-inflammatory agent; antidepressant; antineoplastic agent; apoptosis inducer; bone density conservation agent; hypoglycemic agent; immunomodulator; plant metabolite |
quercetin 3-sambubioside | [no description available] | low | 0 | 0 | disaccharide derivative; quercetin O-glucoside; tetrahydroxyflavone | antioxidant; plant metabolite |
baohuoside i | [no description available] | low | 0 | 0 | glycosyloxyflavone | anti-inflammatory agent; antineoplastic agent; apoptosis inducer; plant metabolite |
avicularin | [no description available] | low | 0 | 0 | alpha-L-arabinofuranoside; monosaccharide derivative; quercetin O-glycoside; tetrahydroxyflavone | hepatoprotective agent; plant metabolite |
ochnaflavone | [no description available] | low | 0 | 0 | aromatic ether; biflavonoid; hydroxyflavone | anti-inflammatory agent; antiatherogenic agent; antibacterial agent; EC 3.1.1.4 (phospholipase A2) inhibitor; leukotriene antagonist; plant metabolite |
isowighteone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | plant metabolite |
triolein | [no description available] | low | 0 | 0 | triglyceride | Caenorhabditis elegans metabolite; plant metabolite |
resiniferatoxin | [no description available] | low | 0 | 0 | carboxylic ester; diterpenoid; enone; monomethoxybenzene; organic heteropentacyclic compound; ortho ester; phenols; tertiary alpha-hydroxy ketone | analgesic; neurotoxin; plant metabolite; TRPV1 agonist |
lyoniside | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative; steroid saponin | plant metabolite |
4-hydroxycordoin | [no description available] | low | 0 | 0 | aromatic ether; chalcones; polyphenol | anti-inflammatory agent; antibacterial agent; plant metabolite |
n-feruloylserotonin | [no description available] | low | 0 | 0 | aromatic ether; cinnamamides; hydroxyindoles; phenols; secondary carboxamide | plant metabolite |
zosteric acid | [no description available] | low | 0 | 0 | aryl sulfate; cinnamic acids | antifouling biocide; plant metabolite |
eupomatenoid 6 | [no description available] | low | 0 | 0 | benzofurans; phenols | anti-inflammatory agent; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; NF-kappaB inhibitor; plant metabolite |
amaranthin betacyanin | [no description available] | low | 0 | 0 | disaccharide derivative; indoles; olefinic compound; tetrahydropyridine | biological pigment; plant metabolite |
mevalonolactone | [no description available] | low | 0 | 0 | 4-hydroxy-4-methyloxan-2-one | fungal metabolite; plant metabolite |
coronardine | [no description available] | low | 0 | 0 | alkaloid ester; methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound | antileishmanial agent; antineoplastic agent; apoptosis inducer; plant metabolite |
columbianadin | [no description available] | low | 0 | 0 | alpha,beta-unsaturated carboxylic ester; furanocoumarin | anti-inflammatory agent; antineoplastic agent; apoptosis inducer; hepatoprotective agent; plant metabolite; rat metabolite |
germacrone | [no description available] | low | 0 | 0 | germacrane sesquiterpenoid; olefinic compound | androgen antagonist; anti-inflammatory agent; antifeedant; antifungal agent; antimicrobial agent; antineoplastic agent; antioxidant; antitussive; antiviral agent; apoptosis inducer; autophagy inducer; hepatoprotective agent; insecticide; neuroprotective agent; plant metabolite; volatile oil component |
salannin | [no description available] | low | 0 | 0 | acetate ester; furans; limonoid; methyl ester; organic heteropentacyclic compound | antifeedant; insect growth regulator; plant metabolite |
thunberginol f | [no description available] | low | 0 | 0 | catechols; gamma-lactone; isobenzofuranone | metabolite; plant metabolite |
9-hydroxy-10,12,15-octadecatrienoic acid | [no description available] | low | 0 | 0 | 9-HOTrE | plant metabolite |
valerenic acid | [no description available] | low | 0 | 0 | carbobicyclic compound; monocarboxylic acid; sesquiterpenoid | GABA modulator; plant metabolite; sedative; volatile oil component |
zeatin riboside | [no description available] | low | 0 | 0 | 9-ribosylzeatin; nucleoside analogue | cytokinin; plant metabolite |
acuminatin | [no description available] | low | 0 | 0 | 1-benzofurans; dimethoxybenzene; neolignan; olefinic compound; ring assembly | fungal metabolite; plant metabolite |
cucurbitacin I 2-O-beta-D-glucopyranoside | [no description available] | low | 0 | 0 | beta-D-glucoside; cucurbitacin; monosaccharide derivative; tertiary alpha-hydroxy ketone; triterpenoid saponin | plant metabolite |
perflubron | [no description available] | low | 0 | 0 | 2-acyl-4-prenylphloroglucinol; chalcones | plant metabolite |
tuberonic acid | [no description available] | low | 0 | 0 | cyclopentanones; homoallylic alcohol; oxo monocarboxylic acid; primary alcohol | jasmonates; plant metabolite |
salvianolic acid B | [no description available] | low | 0 | 0 | 1-benzofurans; catechols; dicarboxylic acid; enoate ester; polyphenol | anti-inflammatory agent; antidepressant; antineoplastic agent; antioxidant; apoptosis inducer; autophagy inhibitor; cardioprotective agent; hepatoprotective agent; hypoglycemic agent; neuroprotective agent; osteogenesis regulator; plant metabolite |
trilobatin | [no description available] | low | 0 | 0 | aryl beta-D-glucoside; dihydrochalcones; monosaccharide derivative | anti-inflammatory agent; antioxidant; plant metabolite; sweetening agent |
2',4',6'-trihydroxychalcone | [no description available] | low | 0 | 0 | chalcones | antifungal agent; plant metabolite |
nyasol | [no description available] | low | 0 | 0 | 1,3-bis(p-hydroxyphenyl)pentane-1,4-diene | plant metabolite |
ginsenoside rb2 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | antiviral agent; hypoglycemic agent; plant metabolite |
yunaconitine | [no description available] | low | 0 | 0 | acetate ester; aromatic ether; benzoate ester; bridged compound; diterpene alkaloid; organic heteropolycyclic compound; polyether; secondary alcohol; tertiary alcohol; tertiary amino compound | antifeedant; human urinary metabolite; phytotoxin; plant metabolite; xenobiotic |
3-tyrosine | [no description available] | low | 0 | 0 | hydroxyphenylalanine; L-alpha-amino acid zwitterion; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; phenols | plant metabolite |
3-O-feruloyl-D-quinic acid | [no description available] | low | 0 | 0 | enoate ester; quinic acid | plant metabolite |
ginsenoside f1 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; 6alpha-hydroxy steroid; beta-D-glucoside; ginsenoside; tetracyclic triterpenoid | apoptosis inhibitor; plant metabolite |
capsiate | [no description available] | low | 0 | 0 | carboxylic ester; monomethoxybenzene; phenols | angiogenesis inhibitor; anti-allergic agent; anti-inflammatory agent; antioxidant; capsaicin receptor agonist; hypoglycemic agent; plant metabolite |
p-coumaric acid glucoside | [no description available] | low | 0 | 0 | 4-O-beta-D-glucosyl-4-coumaric acid | plant metabolite |
ginsenoside m1 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; ginsenoside; tetracyclic triterpenoid | anti-allergic agent; anti-inflammatory agent; antineoplastic agent; hepatoprotective agent; plant metabolite |
nicotianamine | [no description available] | low | 0 | 0 | amino acid zwitterion; nicotianamine | chelator; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; plant metabolite |
ginsenoside rb1 | [no description available] | low | 0 | 0 | ginsenoside; glycoside; tetracyclic triterpenoid | anti-inflammatory drug; anti-obesity agent; apoptosis inhibitor; neuroprotective agent; plant metabolite; radical scavenger |
6''-o-malonyldaidzin | [no description available] | low | 0 | 0 | glycosyloxyisoflavone; hydroxyisoflavone; malonate ester; monosaccharide derivative | plant metabolite |
ginsenoside f2 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; beta-D-glucoside; ginsenoside; tetracyclic triterpenoid | antineoplastic agent; apoptosis inducer; plant metabolite |
ginsenoside rg3 | [no description available] | low | 0 | 0 | ginsenoside; glycoside; tetracyclic triterpenoid | angiogenesis modulating agent; antineoplastic agent; apoptosis inducer; plant metabolite |
4alpha-methylergosta-8,24(28)-dien-3,7,11-trione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 3-oxo steroid; 7-oxo steroid; ergostanoid; monocarboxylic acid; steroid acid | anti-inflammatory agent; antineoplastic agent; plant metabolite |
hetacillin | [no description available] | low | 0 | 0 | guaiacols; lignan; oxolanes; polyphenol; tetrol | plant metabolite |
kaempferol 7-o-glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside; flavonols; kaempferol O-glucoside; monosaccharide derivative; trihydroxyflavone | metabolite; plant metabolite; radical scavenger |
3-epi-fagomine | [no description available] | low | 0 | 0 | amino monosaccharide; hydroxypiperidine; primary alcohol; secondary alcohol; secondary amino compound; triol | EC 3.2.1.10 (oligo-1,6-glucosidase) inhibitor; EC 3.2.1.23 (beta-galactosidase) inhibitor; plant metabolite |
akuammicine | [no description available] | low | 0 | 0 | methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound; tertiary amino compound | plant metabolite |
demethylzeylasteral | [no description available] | low | 0 | 0 | arenecarbaldehyde; benzenediols; carbopolycyclic compound; cyclic ketone; enone; oxo monocarboxylic acid | anti-inflammatory agent; EC 2.4.1.17 (glucuronosyltransferase) inhibitor; immunosuppressive agent; nephroprotective agent; plant metabolite |
alpha-cadinol | [no description available] | low | 0 | 0 | cadinane sesquiterpenoid; carbobicyclic compound; octahydronaphthalenes; tertiary alcohol | fungicide; plant metabolite; volatile oil component |
11-hydroxysugiol | [no description available] | low | 0 | 0 | abietane diterpenoid; carbotricyclic compound; catechols; cyclic terpene ketone; meroterpenoid | EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; plant metabolite |
triptohypol C | [no description available] | low | 0 | 0 | benzenediols; monocarboxylic acid; pentacyclic triterpenoid | apoptosis inducer; plant metabolite |
trilobacin | [no description available] | low | 0 | 0 | butenolide; polyketide; triol | antineoplastic agent; plant metabolite |
2',4'-dihydroxy-6'-methoxy-3',5'-dimethylchalcone | [no description available] | low | 0 | 0 | chalcones; monomethoxybenzene; resorcinols | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; plant metabolite |
1,7-bis(4-hydroxyphenyl)-1,4,6-heptatrien-3-one | [no description available] | low | 0 | 0 | diarylheptanoid; enone; phenols | plant metabolite |
6-deacetylnimbin | [no description available] | low | 0 | 0 | cyclic terpene ketone; diester; enone; furans; limonoid; methyl ester; tetracyclic triterpenoid | antifeedant; insect growth regulator; plant metabolite |
1,7-bis(4-hydroxyphenyl)hepta-4E-6E-dien-3-one | [no description available] | low | 0 | 0 | diarylheptanoid; enone; phenols | plant metabolite |
2,3-dihydro-3beta-methoxy withaferin A | [no description available] | low | 0 | 0 | 27-hydroxy steroid; 4-hydroxy steroid; delta-lactone; epoxy steroid; ergostanoid; primary alcohol; secondary alcohol; withanolide | metabolite; plant metabolite |
azadirone | [no description available] | low | 0 | 0 | acetate ester; cyclic terpene ketone; furans; limonoid; tetracyclic triterpenoid | antineoplastic agent; antiplasmodial drug; plant metabolite |
dihydroartemisinic acid | [no description available] | low | 0 | 0 | carbobicyclic compound; monocarboxylic acid; octahydronaphthalenes; sesquiterpenoid | plant metabolite |
atractyligenine | [no description available] | low | 0 | 0 | carbotetracyclic compound; dihydroxy monocarboxylic acid; ent-kaurane diterpenoid; tetracyclic diterpenoid | plant metabolite |
dihydrogenistin | [no description available] | low | 0 | 0 | beta-D-glucoside; hydroxyisoflavanone; monosaccharide derivative | plant metabolite |
n-benzylhexadecanamide | [no description available] | low | 0 | 0 | macamide; secondary carboxamide | EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor; neuroprotective agent; plant metabolite |
triphosphate | [no description available] | low | 0 | 0 | aldehyde; indole alkaloid; organic heteropentacyclic compound | plant metabolite |
aspalathin | [no description available] | low | 0 | 0 | C-glycosyl compound; catechols; dihydrochalcones; polyketide; polyphenol | antioxidant; EC 1.17.3.2 (xanthine oxidase) inhibitor; hypoglycemic agent; plant metabolite |
glyceryl ferulate | [no description available] | low | 0 | 0 | 1-monoglyceride; aromatic ether; enoate ester; phenols | antioxidant; plant metabolite; ultraviolet filter |
obolactone | [no description available] | low | 0 | 0 | 2-pyranones; 4-pyranones | antineoplastic agent; plant metabolite |
quinine | [no description available] | low | 0 | 0 | Aspidosperma alkaloid; epoxide; methyl ester; monoterpenoid indole alkaloid; organic heterohexacyclic compound | plant metabolite |
alpha-onocerin | [no description available] | low | 0 | 0 | diol; olefinic compound; secondary alcohol; triterpenoid | plant metabolite |
kalopanax saponin b | [no description available] | low | 0 | 0 | carboxylic ester; pentacyclic triterpenoid; triterpenoid saponin | anti-inflammatory agent; plant metabolite |
ginsenoside rd | [no description available] | low | 0 | 0 | beta-D-glucoside; ginsenoside; tetracyclic triterpenoid | anti-inflammatory drug; apoptosis inducer; immunosuppressive agent; neuroprotective agent; plant metabolite; vulnerary |
(+)-dehydrodiconiferyl alcohol | [no description available] | low | 0 | 0 | dehydrodiconiferyl alcohol | antioxidant; plant metabolite |
viridiflorol | [no description available] | low | 0 | 0 | carbotricyclic compound; sesquiterpenoid; tertiary alcohol | anti-inflammatory agent; antifeedant; antimycobacterial drug; plant metabolite; volatile oil component |
gedunin | [no description available] | low | 0 | 0 | acetate ester; enone; epoxide; furans; lactone; limonoid; organic heteropentacyclic compound; pentacyclic triterpenoid | antimalarial; antineoplastic agent; Hsp90 inhibitor; plant metabolite |
morelloflavone | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavanone; hydroxyflavone | plant metabolite |
2alpha,3beta-dihydroxy-20(29)-lupen-28-oic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; pentacyclic triterpenoid | plant metabolite |
azadiradione | [no description available] | low | 0 | 0 | acetate ester; cyclic terpene ketone; furans; limonoid; tetracyclic triterpenoid | anti-inflammatory agent; antimycobacterial drug; plant metabolite |
(-)-pinoresinol | [no description available] | low | 0 | 0 | pinoresinol | plant metabolite |
oplodiol | [no description available] | low | 0 | 0 | carbobicyclic compound; octahydronaphthalenes; secondary alcohol; sesquiterpenoid; tertiary alcohol | plant metabolite |
roburic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; olefinic compound; tetracyclic triterpenoid | plant metabolite |
ginsenoside rc | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | hypoglycemic agent; plant metabolite |
ginsenoside rh1 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; ginsenoside; tetracyclic triterpenoid | plant metabolite |
ginsenoside rb3 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | antidepressant; antioxidant; cardioprotective agent; neuroprotective agent; NMDA receptor antagonist; plant metabolite |
5,7-dihydroxy-2-methyl-8-(4-(3-hydroxy-1-methyl)-piperidinyl)-4h-1-benzopyran-4-one | [no description available] | low | 0 | 0 | alkaloid; chromones; hydroxypiperidine; resorcinols; tertiary amino compound | anti-inflammatory agent; anti-ulcer drug; anticholesteremic drug; antileishmanial agent; antineoplastic agent; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor; fungal metabolite; plant metabolite |
astragaloside IV | [no description available] | low | 0 | 0 | pentacyclic triterpenoid; triterpenoid saponin | anti-inflammatory agent; antioxidant; EC 4.2.1.1 (carbonic anhydrase) inhibitor; neuroprotective agent; plant metabolite; pro-angiogenic agent |
1-O-feruloyl-beta-D-glucose | [no description available] | low | 0 | 0 | aromatic ether; beta-D-glucoside; cinnamate ester; phenols | antioxidant; plant metabolite |
astragaloside ii | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative; oxolanes; pentacyclic triterpenoid; triterpenoid saponin | plant metabolite |
ligstroside | [no description available] | low | 0 | 0 | beta-D-glucoside; diester; methyl ester; phenols; pyrans; secoiridoid glycoside | antineoplastic agent; plant metabolite |
23-hydroxyursolic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; pentacyclic triterpenoid | plant metabolite |
dihydroconiferyl alcohol glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside; monomethoxybenzene; monosaccharide derivative; primary alcohol | plant metabolite |
oroxylin a-7-o-glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; glycosyloxyflavone; monohydroxyflavone; monomethoxyflavone; monosaccharide derivative | plant metabolite |
5-deoxystrigol | [no description available] | low | 0 | 0 | indenofuran; strigolactone | plant metabolite |
2,3-dihydrowithaferin A | [no description available] | low | 0 | 0 | 27-hydroxy steroid; 4-hydroxy steroid; delta-lactone; epoxy steroid; ergostanoid; primary alcohol; secondary alcohol; withanolide | plant metabolite |
vibsanin b | [no description available] | low | 0 | 0 | cyclic terpene ketone; enone; tertiary alcohol; vibsane diterpenoid | plant growth retardant; plant metabolite |
malonylgenistin | [no description available] | low | 0 | 0 | beta-D-glucoside; glycosyloxyisoflavone; hydroxyisoflavone; malonate ester; monosaccharide derivative | plant metabolite |
adonixanthin | [no description available] | low | 0 | 0 | carotenone; cyclic ketone; secondary alcohol | algal metabolite; animal metabolite; antineoplastic agent; bacterial metabolite; marine metabolite; plant metabolite |
niga-ichigoside f1 | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative; pentacyclic triterpenoid; tetrol; triterpenoid saponin | plant metabolite |
cinnamtannin a2 | [no description available] | low | 0 | 0 | proanthocyanidin | plant metabolite |
benzoylaconine | [no description available] | low | 0 | 0 | benzoate ester; bridged compound; diterpene alkaloid; organic heteropolycyclic compound; polyether; secondary alcohol; tertiary alcohol; tertiary amino compound; tetrol | phytotoxin; plant metabolite |
miltiradiene | [no description available] | low | 0 | 0 | abietadiene; carbotricyclic compound | plant metabolite |
tricin 4'-o-(threo-beta-guaiacylglyceryl) ether | [no description available] | low | 0 | 0 | dimethoxybenzene; flavonolignan; polyphenol; primary alcohol; secondary alcohol | plant metabolite |
triptotriterpenic acid a | [no description available] | low | 0 | 0 | diol; hydroxy monocarboxylic acid; pentacyclic triterpenoid | plant metabolite |
cycloeucalenone | [no description available] | low | 0 | 0 | 3-oxo-5alpha-steroid; cyclic terpene ketone; pentacyclic triterpenoid | plant metabolite |
deoxyaconitine | [no description available] | low | 0 | 0 | acetate ester; benzoate ester; bridged compound; diol; diterpene alkaloid; organic heteropolycyclic compound; polyether; secondary alcohol; tertiary amino compound | plant metabolite |
ginsenoside rg2 | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 20-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | anticoagulant; cardioprotective agent; plant metabolite |
cauloside D | [no description available] | low | 0 | 0 | carboxylic ester; pentacyclic triterpenoid; triterpenoid saponin | anti-inflammatory agent; plant metabolite |
oxypaeoniflora | [no description available] | low | 0 | 0 | 4-hydroxybenzoate ester; beta-D-glucoside; bridged compound; cyclic acetal; lactol; monoterpene glycoside | plant metabolite |
5,7-dihydroxy-3-(3-hydroxy-4-methoxybenzyl)-6-methoxychroman-4-one | [no description available] | low | 0 | 0 | aromatic ether; homoisoflavonoid; polyphenol | angiogenesis modulating agent; plant metabolite |
vindolinine | [no description available] | low | 0 | 0 | methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound; tertiary amino compound | plant metabolite |
rubusoside | [no description available] | low | 0 | 0 | beta-D-glucoside; bridged compound; steviol glycoside; tetracyclic diterpenoid | plant metabolite; sweetening agent |
madecassoside | [no description available] | low | 0 | 0 | carboxylic ester; pentacyclic triterpenoid; trisaccharide derivative; triterpenoid saponin | anti-inflammatory agent; antioxidant; antirheumatic drug; plant metabolite; vulnerary |
benzoylmesaconine | [no description available] | low | 0 | 0 | benzoate ester; bridged compound; diterpene alkaloid; organic heteropolycyclic compound; polyether; secondary alcohol; tertiary alcohol; tertiary amino compound; tetrol | analgesic; antiinfective agent; plant metabolite |
albiflorin | [no description available] | low | 0 | 0 | benzoate ester; beta-D-glucoside; bridged compound; gamma-lactone; monoterpene glycoside; secondary alcohol | neuroprotective agent; plant metabolite |
6-tuliposide b | [no description available] | low | 0 | 0 | 6-O-acyl-D-glucose; enoate ester | antibacterial agent; antifungal agent; plant metabolite |
quercetin 3-o-glucoside-7-o-rhamnoside | [no description available] | low | 0 | 0 | beta-D-glucoside; quercetin O-glucoside; trihydroxyflavone | plant metabolite; trypanocidal drug |
10-nonacosanol | [no description available] | low | 0 | 0 | secondary fatty alcohol; ultra-long-chain fatty alcohol | plant metabolite |
(E)-sinapaldehyde 4-O-beta-D-glucopyranoside | [no description available] | low | 0 | 0 | beta-D-glucoside; cinnamaldehydes; dimethoxybenzene; monosaccharide derivative | plant metabolite |
1-(4-hydroxyphenyl)-7-phenyl-(6E)-hept-6-en-3-one | [no description available] | low | 0 | 0 | diarylheptanoid; ketone; phenols | plant metabolite |
kurarinol | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; monomethoxyflavanone; trihydroxyflavanone | anti-inflammatory agent; antioxidant; plant metabolite |
2,3-dihydro-3beta-O-sulfate withaferin A | [no description available] | low | 0 | 0 | 27-hydroxy steroid; 4-hydroxy steroid; delta-lactone; epoxy steroid; ergostanoid; primary alcohol; steroid sulfate; withanolide | antineoplastic agent; metabolite; plant metabolite |
gypenoside XVII | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | plant metabolite |
euonine | [no description available] | low | 0 | 0 | acetate ester; dihydroagarofuran sesquiterpenoid; macrolide; pyridine alkaloid; sesquiterpene alkaloid | immunosuppressive agent; insecticide; plant metabolite |
picrinine | [no description available] | low | 0 | 0 | alkaloid ester; indole alkaloid; methyl ester; organic heteropentacyclic compound; polycyclic ether | analgesic; anti-asthmatic agent; anti-inflammatory agent; antitussive; plant metabolite |
(20R)-ginsenoside Rg3 | [no description available] | low | 0 | 0 | ginsenoside; glycoside; tetracyclic triterpenoid | antioxidant; plant metabolite |
epoxyazadiradione | [no description available] | low | 0 | 0 | acetate ester; cyclic terpene ketone; epoxide; furans; limonoid; pentacyclic triterpenoid | anti-inflammatory agent; insecticide; plant metabolite |
n-(2-(5-methoxy-2-oxo-2,3-dihydro-1h-indol-3-yl)ethyl)acetamide | [no description available] | low | 0 | 0 | acetamides; hydroxyindoles; tryptamines | antineoplastic agent; apoptosis inducer; plant metabolite |
orobanchol | [no description available] | low | 0 | 0 | indenofuran; secondary alcohol; strigolactone | plant metabolite |
oleuropein aglycone | [no description available] | low | 0 | 0 | catechols; diester; lactol; methyl ester; pyrans; secoiridoid | anti-inflammatory agent; antioxidant; mTOR inhibitor; neuroprotective agent; plant metabolite; TRPA1 channel agonist |
stemmadenine | [no description available] | low | 0 | 0 | Aspidosperma alkaloid; methyl ester; monoterpenoid indole alkaloid; organic heterotetracyclic compound; primary alcohol | plant metabolite |
capilliposide b | [no description available] | low | 0 | 0 | alpha-L-arabinopyranoside; bridged compound; cyclic ether; diol; hexacyclic triterpenoid; hexanoate ester; lactol; secondary alcohol; tetrasaccharide derivative; triterpenoid saponin | antineoplastic agent; plant metabolite |
paeoniflorigenone | [no description available] | low | 0 | 0 | alicyclic ketone; benzoate ester; bridged compound; cyclic acetal; lactol; monoterpenoid | neuromuscular agent; plant metabolite |
maysin | [no description available] | low | 0 | 0 | disaccharide derivative; flavone C-glycoside; secondary alpha-hydroxy ketone; tetrahydroxyflavone | insecticide; neuroprotective agent; plant metabolite |
cryptocaryol a | [no description available] | low | 0 | 0 | 2-pyranones; pentol | plant metabolite |
gypenoside LXXV | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; beta-D-glucoside; disaccharide derivative; ginsenoside; tetracyclic triterpenoid | plant metabolite |
chrysopine | [no description available] | low | 0 | 0 | amino acid opine; carboxamide; delta-lactone; secondary amino compound; spiroketal; triol | plant metabolite |
ebc-46 | [no description available] | low | 0 | 0 | diester; diterpenoid; organic heteropentacyclic compound; phorbol ester | antineoplastic agent; plant metabolite; protein kinase C agonist |
wilforgine | [no description available] | low | 0 | 0 | acetate ester; dihydroagarofuran sesquiterpenoid; furans; macrocyclic lactone; organic heteropentacyclic compound; pyridine alkaloid | plant metabolite |
dehydrotomatine | [no description available] | low | 0 | 0 | alkaloid antibiotic; glycoside; steroid alkaloid; tetrasaccharide derivative | antifungal agent; phytotoxin; plant metabolite |
biliatresone | [no description available] | low | 0 | 0 | aromatic ether; aromatic ketone; benzodioxoles; enone; phenols | plant metabolite; toxin |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
hippuric acid | [no description available] | low | 0 | 0 | N-acylglycine | human blood serum metabolite; uremic toxin |
3-methoxytyramine | [no description available] | low | 0 | 0 | monomethoxybenzene; phenols; phenylethylamine; primary amino compound | biomarker; human blood serum metabolite; human urinary metabolite |
caprolactam | [no description available] | low | 0 | 0 | caprolactams | human blood serum metabolite |
4-hexanolide | [no description available] | low | 0 | 0 | butan-4-olide | human blood serum metabolite |
n-myristoylglycine | [no description available] | low | 0 | 0 | fatty amide; N-acylglycine | human blood serum metabolite; human urinary metabolite |
21-deoxycortisol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy-C21-steroid; deoxycortisol; tertiary alpha-hydroxy ketone | human blood serum metabolite; mouse metabolite |
aspartyl-phenylalanine | [no description available] | low | 0 | 0 | dipeptide | human blood serum metabolite; human xenobiotic metabolite |
ribavirin 5'-diphosphate | [no description available] | low | 0 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide; ribose monophosphate | antiviral agent; drug metabolite; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; human blood serum metabolite |
1-hydroxymethylmidazolam | [no description available] | low | 0 | 0 | aromatic primary alcohol; imidazobenzodiazepine; monofluorobenzenes; organochlorine compound | drug metabolite; human blood serum metabolite; human urinary metabolite |
24-hydroxycholesterol | [no description available] | low | 0 | 0 | 24-hydroxycholesterol | biomarker; human blood serum metabolite; mouse metabolite |
ribavirin 5'-triphosphate | [no description available] | low | 0 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide; ribose triphosphate | antiviral agent; drug metabolite; EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor; eukaryotic initiation factor 4F inhibitor; human blood serum metabolite |
dopamine 3-o-sulfate | [no description available] | low | 0 | 0 | aryl sulfate; phenols; primary amino compound; zwitterion | human blood serum metabolite; human urinary metabolite |
dopamine 4-o-sulfate | [no description available] | low | 0 | 0 | aryl sulfate; phenols; primary amino compound; zwitterion | human blood serum metabolite; human urinary metabolite |
4-hydroxymidazolam | [no description available] | low | 0 | 0 | imidazobenzodiazepine; monofluorobenzenes; organic hydroxy compound; organochlorine compound | drug metabolite; human blood serum metabolite; human urinary metabolite |
1-hydroxymethylmidazolam glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; imidazobenzodiazepine; monofluorobenzenes; monosaccharide derivative; organochlorine compound | drug metabolite; human blood serum metabolite; human urinary metabolite |
4-hydroxyhippuric acid | [no description available] | low | 0 | 0 | N-acylglycine | human blood serum metabolite |
alpha-ketocaproic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; medium-chain fatty acid; oxo fatty acid; straight-chain fatty acid | human blood serum metabolite |
acetyltaurine | [no description available] | low | 0 | 0 | acetamides; organosulfonic acid | human blood serum metabolite; human urinary metabolite |
3-hydroxyglutaric acid | [no description available] | low | 0 | 0 | 3-hydroxy carboxylic acid; alpha,omega-dicarboxylic acid | human blood serum metabolite; human urinary metabolite |
7-oxodehydroepiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; 7-oxo steroid; androstanoid | human blood serum metabolite; nutraceutical; prohormone |
deoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human blood serum metabolite |
epietiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; animal metabolite; human blood serum metabolite; mouse metabolite; rat metabolite |
palmitoleic acid | [no description available] | low | 0 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
histidyl-proline diketopiperazine | [no description available] | low | 0 | 0 | dipeptide; homodetic cyclic peptide; imidazoles; pyrrolopyrazine | anti-inflammatory agent; dopamine uptake inhibitor; human blood serum metabolite |
20-carboxyleukotriene b4 | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; hydroxy carboxylic acid; leukotriene | human blood serum metabolite; human urinary metabolite |
9,10,13-trihydroxy-11-octadecenoic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; monounsaturated fatty acid; straight-chain fatty acid; TriHOME | human blood serum metabolite |
n-palmitoylsphingosine | [no description available] | low | 0 | 0 | Cer(d34:1); N-acylsphingosine; N-palmitoyl-sphingoid base | human blood serum metabolite; Mycoplasma genitalium metabolite |
menaquinone 7 | [no description available] | low | 0 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
ethyl arachidonate | [no description available] | low | 0 | 0 | long-chain fatty acid ethyl ester | human blood serum metabolite; human xenobiotic metabolite |
phenylalanylphenylalanine | [no description available] | low | 0 | 0 | dipeptide; L-aminoacyl-L-amino acid zwitterion | human blood serum metabolite; Mycoplasma genitalium metabolite |
glycoursodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid glycine conjugate; N-acylglycine | human blood serum metabolite; neuroprotective agent |
apelin-12 peptide | [no description available] | low | 0 | 0 | oligopeptide | biomarker; human blood serum metabolite; human metabolite; neuroprotective agent |
alpha-hydroxyglutarate | [no description available] | low | 0 | 0 | 2-hydroxydicarboxylic acid; dicarboxylic fatty acid | metabolite; mouse metabolite |
alpha-ketoadipic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | human urinary metabolite; mouse metabolite |
3-hydroxyanthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; monohydroxybenzoic acid | human metabolite; mouse metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
n-carbamoyl-beta-alanine | [no description available] | low | 0 | 0 | beta-alanine derivative | metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
isocaproaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde | human metabolite; mouse metabolite |
ethylene glycol | [no description available] | low | 0 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
anthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid | human metabolite; mouse metabolite |
hydrobromic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
carnitine | [no description available] | low | 0 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
hydrochloric acid | [no description available] | low | 0 | 0 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
aminoethylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; primary amino compound; zwitterion | human metabolite; metabolite; mouse metabolite |
1,2-dihydroxy-1,2-dihydronaphthalene | [no description available] | low | 0 | 0 | dihydronaphthalenes; naphthalenediols | bacterial xenobiotic metabolite; mouse metabolite |
4-nitrophenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
trimethylenediamine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | human metabolite; mouse metabolite; reagent |
phosphonoacetaldehyde | [no description available] | low | 0 | 0 | phosphonic acids | mouse metabolite |
gamma-guanidinobutyric acid | [no description available] | low | 0 | 0 | guanidines; monocarboxylic acid; zwitterion | fungal metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
alpha-keto-delta-guanidinovaleric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
diethyl phosphate | [no description available] | low | 0 | 0 | dialkyl phosphate | human xenobiotic metabolite; mouse metabolite |
o,o-diethyl phosphorothionate | [no description available] | low | 0 | 0 | organic thiophosphate | human xenobiotic metabolite; mouse metabolite |
dihydrolipoamide | [no description available] | low | 0 | 0 | dithiol; monocarboxylic acid amide | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dimethylglycine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-methyl-amino acid; N-methylglycines | Daphnia magna metabolite; human metabolite; mouse metabolite |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glycocyamine | [no description available] | low | 0 | 0 | guanidinoacetic acids; zwitterion | bacterial metabolite; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
carbonic acid | [no description available] | low | 0 | 0 | carbon oxoacid; chalcocarbonic acid | mouse metabolite |
hydantoin-5-propionic acid | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; monocarboxylic acid | metabolite; mouse metabolite |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
indole-3-acetaldehyde | [no description available] | low | 0 | 0 | indoleacetaldehyde | bacterial metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
lactaldehyde | [no description available] | low | 0 | 0 | hydroxyaldehyde; propanals | mouse metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxide ion | [no description available] | low | 0 | 0 | oxygen hydride | mouse metabolite |
orotic acid | [no description available] | low | 0 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
4-nitrophenol | [no description available] | low | 0 | 0 | 4-nitrophenols | human xenobiotic metabolite; mouse metabolite |
hexadecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
parathion | [no description available] | low | 0 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; avicide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; mouse metabolite |
phenanthrene | [no description available] | low | 0 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon; phenanthrenes | environmental contaminant; mouse metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines | allergen; epitope; hapten; human metabolite; mouse metabolite |
phosphorylethanolamine | [no description available] | low | 0 | 0 | phosphoethanolamine; primary amino compound | algal metabolite; human metabolite; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
perillic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | antineoplastic agent; human metabolite; mouse metabolite |
5-methoxytryptamine | [no description available] | low | 0 | 0 | aromatic ether; primary amino compound; tryptamines | 5-hydroxytryptamine 2A receptor agonist; 5-hydroxytryptamine 2B receptor agonist; 5-hydroxytryptamine 2C receptor agonist; antioxidant; cardioprotective agent; human metabolite; mouse metabolite; neuroprotective agent; radiation protective agent; serotonergic agonist |
adrenic acid | [no description available] | low | 0 | 0 | docosatetraenoic acid | mouse metabolite |
benzo(a)pyrene | [no description available] | low | 0 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mouse metabolite |
chloral hydrate | [no description available] | low | 0 | 0 | aldehyde hydrate; ethanediol; organochlorine compound | general anaesthetic; mouse metabolite; sedative; xenobiotic |
2,5-dihydroxybenzoic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; fungal metabolite; human metabolite; MALDI matrix material; mouse metabolite |
tele-methylhistamine | [no description available] | low | 0 | 0 | imidazoles; primary amino compound | human metabolite; mouse metabolite |
estriol | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
thyroxine | [no description available] | low | 0 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
etiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid | human metabolite; mouse metabolite |
dehydroepiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
triiodothyronine | [no description available] | low | 0 | 0 | 2-halophenol; amino acid zwitterion; iodophenol; iodothyronine | human metabolite; mouse metabolite; thyroid hormone |
uridine monophosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
cysteamine | [no description available] | low | 0 | 0 | amine; thiol | geroprotector; human metabolite; mouse metabolite; radiation protective agent |
cytidine monophosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
uridine triphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
desoxycorticosterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; mineralocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
cytidine triphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
1-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
2-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
methylamine | [no description available] | low | 0 | 0 | methylamines; one-carbon compound; primary aliphatic amine | mouse metabolite |
ethylene oxide | [no description available] | low | 0 | 0 | gas molecular entity; oxacycle; saturated organic heteromonocyclic parent | allergen; mouse metabolite; mutagen |
vinylidene chloride | [no description available] | low | 0 | 0 | chloroethenes | carcinogenic agent; mouse metabolite; mutagen |
trichloroacetaldehyde | [no description available] | low | 0 | 0 | aldehyde; organochlorine compound | mouse metabolite |
trichloroacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
trichloroethylene | [no description available] | low | 0 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
pyridoxic acid | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | human urinary metabolite; mouse metabolite |
1-nitronaphthalene | [no description available] | low | 0 | 0 | mononitronaphthalene | environmental contaminant; mouse metabolite |
beta-glucono-1,5-lactone | [no description available] | low | 0 | 0 | aldono-1,5-lactone; gluconolactone | animal metabolite; mouse metabolite |
2-naphthoic acid | [no description available] | low | 0 | 0 | naphthoic acid | mouse metabolite; xenobiotic metabolite |
methylphenyl carbinol | [no description available] | low | 0 | 0 | aromatic alcohol | mouse metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-phenylacetamide | [no description available] | low | 0 | 0 | monocarboxylic acid amide | mouse metabolite |
4-bromophenol | [no description available] | low | 0 | 0 | bromophenol | human urinary metabolite; human xenobiotic metabolite; marine metabolite; mouse metabolite; persistent organic pollutant; rat metabolite |
ethylene dibromide | [no description available] | low | 0 | 0 | bromoalkane; bromohydrocarbon | algal metabolite; carcinogenic agent; fumigant; marine metabolite; mouse metabolite; mutagen |
bromobenzene | [no description available] | low | 0 | 0 | bromoarene; bromobenzenes; volatile organic compound | hepatotoxic agent; mouse metabolite; non-polar solvent |
2-heptanone | [no description available] | low | 0 | 0 | dialkyl ketone; methyl ketone | mouse metabolite; pheromone |
2,2,2-trichloroethanol | [no description available] | low | 0 | 0 | chloroethanol | mouse metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-naphthol | [no description available] | low | 0 | 0 | naphthol | antinematodal drug; genotoxin; human urinary metabolite; human xenobiotic metabolite; mouse metabolite; radical scavenger |
pregnenolone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; C21-steroid | human metabolite; mouse metabolite |
20-alpha-dihydroprogesterone | [no description available] | low | 0 | 0 | 20-hydroxypregn-4-en-3-one | human metabolite; mouse metabolite |
D-proline | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; proline | mouse metabolite |
diiodotyrosine | [no description available] | low | 0 | 0 | diiodotyrosine; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite |
paraoxon | [no description available] | low | 0 | 0 | aryl dialkyl phosphate; organophosphate insecticide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; mouse metabolite |
methyl-4-tyramine | [no description available] | low | 0 | 0 | tyramines | mouse metabolite |
lithocholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; monohydroxy-5beta-cholanic acid | geroprotector; human metabolite; mouse metabolite |
chenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
fructose-1,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 1,6-bisphosphate | mouse metabolite |
androstenediol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid | androgen; human metabolite; mouse metabolite; radiation protective agent |
hydroxyhydroquinone | [no description available] | low | 0 | 0 | benzenetriol | mouse metabolite |
18-hydroxycorticosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 18-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo steroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
1,2-dihydroxynaphthalene | [no description available] | low | 0 | 0 | naphthalenediol | mouse metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
2-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; phenols | human metabolite; mouse metabolite |
propiolaldehyde | [no description available] | low | 0 | 0 | terminal acetylenic compound; ynal | mouse metabolite |
dehydroepiandrosterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite; mouse metabolite |
phenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
n-cyclohexylformamide | [no description available] | low | 0 | 0 | alicyclic compound; formamides | mouse metabolite |
deoxycytidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cytidine diphosphate choline | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphocholines | human metabolite; mouse metabolite; neuroprotective agent; psychotropic drug; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
perillaldehyde | [no description available] | low | 0 | 0 | aldehyde; olefinic compound | human metabolite; mouse metabolite; volatile oil component |
fucose | [no description available] | low | 0 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate galactose | [no description available] | low | 0 | 0 | UDP-D-galactose | mouse metabolite |
1-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
hydroiodic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
iron | [no description available] | low | 0 | 0 | divalent metal cation; iron cation; monoatomic dication | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
trichloroepoxyethane | [no description available] | low | 0 | 0 | epoxide | mouse metabolite |
ursodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
acetylgalactosamine | [no description available] | low | 0 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cyromazine | [no description available] | low | 0 | 0 | triamino-1,3,5-triazine | mouse metabolite; triazine insecticide |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
n-acetylaspartic acid | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N-acyl-L-aspartic acid | antioxidant; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
homocitrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; L-lysine derivative; non-proteinogenic L-alpha-amino acid; ureas | human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
glutathione disulfide | [no description available] | low | 0 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
lathosterol | [no description available] | low | 0 | 0 | 3beta-sterol; C27-steroid; cholestanoid; Delta(7)-sterol | human metabolite; mouse metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
cystine | [no description available] | low | 0 | 0 | cystine zwitterion; cystine; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetylglycine | [no description available] | low | 0 | 0 | monocarboxylic acid amide; monocarboxylic acid; N-acylglycine | human metabolite; mouse metabolite |
hordenine | [no description available] | low | 0 | 0 | phenethylamine alkaloid | human metabolite; mouse metabolite |
glutaurine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; L-glutamine derivative; sulfonic acid | anticonvulsant; anxiolytic drug; hormone; human metabolite; mammalian metabolite; mouse metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
n'-methyl-2-pyridone-5-carboxamide | [no description available] | low | 0 | 0 | methylpyridines; pyridinecarboxamide; pyridone | metabolite; mouse metabolite |
cyclopropylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | mouse metabolite |
5-hydroxymethylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol; nucleobase analogue; pyrimidone | human metabolite; mouse metabolite |
2,5-dihydroxybenzaldehyde | [no description available] | low | 0 | 0 | dihydroxybenzaldehyde | human metabolite; mouse metabolite; Penicillium metabolite |
6-hydroxynicotinic acid | [no description available] | low | 0 | 0 | monohydroxypyridine | Arabidopsis thaliana metabolite; human urinary metabolite; mouse metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
2-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite; xenobiotic metabolite |
hydroxyindoleacetaldehyde | [no description available] | low | 0 | 0 | hydroxyindoles; indoleacetaldehyde | human metabolite; mouse metabolite |
xanthurenic acid 8-methyl ether | [no description available] | low | 0 | 0 | aromatic ether; monohydroxyquinoline; quinolinemonocarboxylic acid | carcinogenic agent; metabolite; mouse metabolite |
glucose | [no description available] | low | 0 | 0 | D-glucopyranose | mouse metabolite |
biocytin | [no description available] | low | 0 | 0 | azabicycloalkane; L-alpha-amino acid zwitterion; L-lysine derivative; monocarboxylic acid amide; non-proteinogenic L-alpha-amino acid; thiabicycloalkane; ureas | mouse metabolite |
d-aspartic acid | [no description available] | low | 0 | 0 | aspartic acid; D-alpha-amino acid | mouse metabolite |
3,4-dihydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; catechols | antioxidant; drug metabolite; human metabolite; mouse metabolite |
17-alpha-hydroxypregnenolone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; hydroxypregnenolone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
3,4-dihydroxyphenylglycol | [no description available] | low | 0 | 0 | catechols; tetrol | metabolite; mouse metabolite |
24-methylenecholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol | mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
2,8-dihydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; diol; heteroaryl hydroxy compound; oxopurine | human urinary metabolite; mammalian metabolite; mouse metabolite; nephrotoxic agent |
5beta-pregnane-3,20-dione | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-5beta-steroid; C21-steroid | human metabolite; mouse metabolite |
zymosterol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5,6-dihydrothymine | [no description available] | low | 0 | 0 | pyrimidone | human metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
imidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | metabolite; mouse metabolite |
1-hydroxyphenanthrene | [no description available] | low | 0 | 0 | phenanthrol | mouse metabolite |
2,5-dihydroxypyridine | [no description available] | low | 0 | 0 | dihydroxypyridine | mouse metabolite |
cerium | [no description available] | low | 0 | 0 | cholesteryl ester | mouse metabolite |
zymostenol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite |
16-hydroxydehydroepiandrosterone | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid; secondary alpha-hydroxy ketone | human metabolite; mouse metabolite |
hydrogen sulfite | [no description available] | low | 0 | 0 | sulfur oxoanion | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ecgonine methyl ester | [no description available] | low | 0 | 0 | methyl ester; tertiary amino compound; tropane alkaloid | analgesic; central nervous system depressant; metabolite; mouse metabolite; opioid analgesic; peripheral nervous system drug |
2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | low | 0 | 0 | hydroxylamine; imidazopyridine | carcinogenic agent; genotoxin; human xenobiotic metabolite; mouse metabolite; mutagen; neurotoxin; rat metabolite |
fructose 2,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 2,6-bisphosphate | human metabolite; mouse metabolite |
cholest-5-en-3 beta,7 alpha-diol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid; oxysterol | mouse metabolite |
s-chloromethylglutathione | [no description available] | low | 0 | 0 | organochlorine compound; S-substituted glutathione | alkylating agent; bacterial xenobiotic metabolite; mouse metabolite |
5-acetylamino-6-formylamino-3-methyluracil | [no description available] | low | 0 | 0 | formamidopyrimidine | mouse metabolite |
anserine | [no description available] | low | 0 | 0 | beta-alanine derivative; dipeptide; zwitterion | animal metabolite; mouse metabolite |
5,6-dihydroxyindole | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
androsterone glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; metabolite; mouse metabolite |
estrone-3-glucuronide | [no description available] | low | 0 | 0 | 17-oxo steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
5,6-dihydroxy-2-indolylcarboxylic acid | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
inositol-3,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
(20s)-20-hydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | human metabolite; mouse metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
n-acetylputrescine | [no description available] | low | 0 | 0 | N-monoacetylalkane-alpha,omega-diamine; N-substituted putrescine | metabolite; mouse metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cdp ethanolamine | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphoethanolamine | mouse metabolite |
7 alpha-hydroxy-4-cholesten-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; 7alpha-hydroxy steroid; cholestanoid | human metabolite; mouse metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
27-hydroxycholesterol | [no description available] | low | 0 | 0 | 26-hydroxycholesterol | apoptosis inducer; human metabolite; mouse metabolite; neuroprotective agent |
dehydroalanine | [no description available] | low | 0 | 0 | 2,3-dehydroamino acid; alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion; enamine; non-proteinogenic alpha-amino acid | alkylating agent; human metabolite; mouse metabolite |
1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 30:0; tetradecanoate ester | mouse metabolite |
proline | [no description available] | low | 0 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
d-glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; D-alpha-amino acid; glutamine | mouse metabolite |
diquafosol | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-tetraphosphate; uridine 5'-phosphate | mouse metabolite; P2Y2 receptor agonist |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
19-hydroxytestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 19-hydroxy steroid; 3-oxo-Delta(4) steroid | mouse metabolite |
2-hydroxy-1,4-benzoquinone | [no description available] | low | 0 | 0 | monohydroxy-1,4-benzoquinones | mouse metabolite |
3,4-dihydroxyphenylglycolaldehyde | [no description available] | low | 0 | 0 | catechols; hydroxyaldehyde | human metabolite; mouse metabolite; neurotoxin |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
androsterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; androstanoid; steroid sulfate | human metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
3,7,12-trihydroxycoprostane | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
saccharopine | [no description available] | low | 0 | 0 | amino acid opine; L-lysine derivative | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allysine | [no description available] | low | 0 | 0 | allysine; amino acid zwitterion; aminoadipate semialdehyde; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
beta-ureidoisobutyric acid | [no description available] | low | 0 | 0 | ureidocarboxylic acid | human metabolite; mouse metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
kynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; kynurenine; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
hydromethylthionine | [no description available] | low | 0 | 0 | aromatic amine; phenothiazines; tertiary amino compound | bacterial xenobiotic metabolite; fluorochrome; mouse metabolite; rat metabolite |
5-hydroxykynuramine | [no description available] | low | 0 | 0 | hydroxykynurenamine; primary amino compound | mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
thiocysteine | [no description available] | low | 0 | 0 | amino acid zwitterion; S-substituted L-cysteine | human metabolite; mouse metabolite |
diadenosine triphosphate | [no description available] | low | 0 | 0 | diadenosyl triphosphate | mouse metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
isovaleryl-coenzyme a | [no description available] | low | 0 | 0 | methylbutanoyl-CoA; short-chain fatty acyl-CoA | mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4,4-dimethyl-5-alpha-cholesta-(8,24)-dien-3-beta-ol | [no description available] | low | 0 | 0 | 3beta-sterol | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
biotin | [no description available] | low | 0 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
campesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C28-steroid; phytosterols | mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cholestane-3,7,12,26-tetrol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 26-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
androstane-3,17-dione, (5alpha)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5alpha-steroid; androstane-3,17-dione | mouse metabolite |
cholesteryl palmitate | [no description available] | low | 0 | 0 | cholesteryl ester | human metabolite; mouse metabolite |
21-hydroxypregnenolone | [no description available] | low | 0 | 0 | 21-hydroxy steroid; hydroxypregnenolone; primary alpha-hydroxy ketone | mouse metabolite |
2-hydroxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 2-hydroxy steroid | carcinogenic agent; human metabolite; metabolite; mouse metabolite; prodrug |
5-hydroxyisourate | [no description available] | low | 0 | 0 | oxopurine | human metabolite; mouse metabolite |
19-hydroxy-4-androstene-3,17-dione | [no description available] | low | 0 | 0 | 17-oxo steroid; 19-hydroxy steroid; 3-oxo steroid; androstanoid | mouse metabolite |
taurochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid taurine conjugate | human metabolite; mouse metabolite |
glyceraldehyde 3-phosphate | [no description available] | low | 0 | 0 | glyceraldehyde 3-phosphate | mouse metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose 5-phosphate | [no description available] | low | 0 | 0 | ribulose 5-phosphate | mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
isomaltose | [no description available] | low | 0 | 0 | glycosylglucose | human metabolite; metabolite; mouse metabolite |
arabinose | [no description available] | low | 0 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
n-acetylneuraminic acid | [no description available] | low | 0 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
glucosamine | [no description available] | low | 0 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
carnosine | [no description available] | low | 0 | 0 | amino acid zwitterion; dipeptide | anticonvulsant; antineoplastic agent; antioxidant; Daphnia magna metabolite; geroprotector; human metabolite; mouse metabolite; neuroprotective agent |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
dopaquinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; amino acid zwitterion; L-phenylalanine derivative | human metabolite; mouse metabolite |
pantetheine | [no description available] | low | 0 | 0 | pantetheines; thiol | human metabolite; metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | epitope; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | mouse metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
5-diphosphomevalonic acid | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | human metabolite; mouse metabolite |
7-dehydrocholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; Delta(5),Delta(7)-sterol | human metabolite; mouse metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
inositol 1,4,5-trisphosphate | [no description available] | low | 0 | 0 | myo-inositol trisphosphate | mouse metabolite |
desmosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C27-steroid; cholestanoid | human metabolite; mouse metabolite |
n'-formylkynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-formylkynurenine; non-proteinogenic amino acid derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ketodihydrosphingosine | [no description available] | low | 0 | 0 | 2-amino-1-hydroxyoctadecan-3-one | mouse metabolite |
nicotinamide-beta-riboside | [no description available] | low | 0 | 0 | N-glycosylnicotinamide; pyridine nucleoside | geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
androstane-3,17-dione, (5beta)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5beta-steroid; androstane-3,17-dione | mouse metabolite |
trimethyllysine | [no description available] | low | 0 | 0 | alpha-amino-acid cation | human metabolite; mouse metabolite |
inositol 3,4-bisphosphate | [no description available] | low | 0 | 0 | myo-inositol bisphosphate | human metabolite; mouse metabolite |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
24,25-dihydrolanosterol | [no description available] | low | 0 | 0 | 3beta-sterol; tetracyclic triterpenoid | human metabolite; mouse metabolite |
2-methoxyestrone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-hydroxy steroid; alicyclic ketone; aromatic ether; phenolic steroid; phenols | human metabolite; mouse metabolite |
dehydroascorbic acid | [no description available] | low | 0 | 0 | dehydroascorbic acid; vitamin C | coenzyme; mouse metabolite |
estradiol-3-glucuronide | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
beta-sulfopyruvic acid | [no description available] | low | 0 | 0 | carboxyalkanesulfonic acid | mouse metabolite |
acetyl adenylate | [no description available] | low | 0 | 0 | 5'-acylphosphoadenosin | human metabolite; mouse metabolite |
2-hydroxypropylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; secondary alcohol | mouse metabolite |
4,4-dimethylcholesta-8,14,24-trienol | [no description available] | low | 0 | 0 | 3beta-sterol; Delta(14) steroid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inositol-1,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
prostaglandin h2 | [no description available] | low | 0 | 0 | olefinic compound; oxylipin; prostaglandins H; secondary alcohol | mouse metabolite |
3-hydroxy-3-methylglutaryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxy-3-methylglutaryl-CoA; 3-hydroxy fatty acyl-CoA | human metabolite; mouse metabolite |
docosahexaenoate | [no description available] | low | 0 | 0 | docosahexaenoic acid; omega-3 fatty acid | algal metabolite; antineoplastic agent; Daphnia tenebrosa metabolite; human metabolite; mouse metabolite; nutraceutical |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
eicosapentaenoic acid | [no description available] | low | 0 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
geranylgeranyl pyrophosphate | [no description available] | low | 0 | 0 | geranylgeranyl diphosphate | mouse metabolite |
cytidine monophosphate n-acetylneuraminic acid | [no description available] | low | 0 | 0 | CMP-N-acyl-beta-neuraminic acid | mouse metabolite |
prostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins D | human metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
colfosceril palmitate | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:0 | mouse metabolite; surfactant |
lyso-pc | [no description available] | low | 0 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine; lysophosphatidylcholine 16:0 | mouse metabolite |
retinaldehyde | [no description available] | low | 0 | 0 | retinal; vitamin A | gap junctional intercellular communication inhibitor; human metabolite; mouse metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
flavin mononucleotide | [no description available] | low | 0 | 0 | flavin mononucleotide; vitamin B2 | bacterial metabolite; coenzyme; cofactor; human metabolite; mouse metabolite |
3-hydroxybutyryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxyacyl-CoA; hydroxybutanoyl-CoA | mouse metabolite |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
dihydrosphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
estrone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | human metabolite; mouse metabolite |
raphanusamic acid | [no description available] | low | 0 | 0 | thiazolidinemonocarboxylic acid | Arabidopsis thaliana metabolite; mouse metabolite; xenobiotic metabolite |
isobutyryl-coenzyme a | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-CoA; short-chain fatty acyl-CoA | human metabolite; mouse metabolite |
dihydroxycoprostane | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
glutaryl-coenzyme a | [no description available] | low | 0 | 0 | glutaryl-CoAs | mouse metabolite |
11-cis-retinal | [no description available] | low | 0 | 0 | retinal | chromophore; human metabolite; mouse metabolite |
leukotriene c4 | [no description available] | low | 0 | 0 | leukotriene | bronchoconstrictor agent; human metabolite; mouse metabolite |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,11Z,13E)-15-HETE | human metabolite; mouse metabolite |
5-hydroxy-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE | human metabolite; mouse metabolite |
arachidonic acid 5-hydroperoxide | [no description available] | low | 0 | 0 | 5-HPETE | mouse metabolite |
leukotriene d4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin g2 | [no description available] | low | 0 | 0 | prostaglandins G | human metabolite; mouse metabolite |
arachidonic acid omega-9 hydroperoxide | [no description available] | low | 0 | 0 | HPETE | mouse metabolite |
15-hydroperoxy-5,8,11,13-eicosatetraenoic acid, (s)-(e,z,z,z)-isomer | [no description available] | low | 0 | 0 | 15-HPETE | mouse metabolite |
alpha-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-3 fatty acid | micronutrient; mouse metabolite; nutraceutical |
1-palmitoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-palmitoyl-2-oleoylglycerol | mouse metabolite |
epoprostenol | [no description available] | low | 0 | 0 | prostaglandins I | mouse metabolite |
thromboxane b3 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
11,12-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET | mouse metabolite |
14,15-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET; diol; secondary allylic alcohol | mouse metabolite |
20-hydroxy-5,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE; hydroxy monocarboxylic acid | human metabolite; mouse metabolite |
5-oxo-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite; immunomodulator; mouse metabolite |
5,6-epoxy-8,11,14-eicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
8,9-epoxyeicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
1-palmitoyl-2-oleoylphosphatidylethanolamine, (z & r)-isomer | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphoethanolamine; phosphatidylethanolamine 34:1 zwitterion; phosphatidylethanolamine | mouse metabolite |
cholesteryl oleate | [no description available] | low | 0 | 0 | CE(18:1); cholesteryl octadec-9-enoate | mouse metabolite |
calcifediol | [no description available] | low | 0 | 0 | D3 vitamins; diol; hydroxycalciol | bone density conservation agent; human metabolite; metabolite; mouse metabolite; nutraceutical |
hyodeoxycholic acid | [no description available] | low | 0 | 0 | 5beta-cholanic acids; 6alpha,20xi-murideoxycholic acid; bile acid; C24-steroid | human metabolite; mouse metabolite |
cerium | [no description available] | low | 0 | 0 | CE(18:2); cholesteryl octadeca-9,12-dienoate | human metabolite; mouse metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
11-dehydrocorticosterone | [no description available] | low | 0 | 0 | 11-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
trilinolein | [no description available] | low | 0 | 0 | 1,2-diacyl-3-linoleoylglycerol; 1,3-diacyl-2-linoleoylglycerol; linoleoyl containing 1,2,3-triacyl-sn-glycerol; TG(18:2/18:2/18:2); triglyceride | mouse metabolite |
dimyristoylphosphatidylcholine | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine; phosphatidylcholine 28:0; tetradecanoate ester | antigen; mouse metabolite |
2,3-oxidosqualene | [no description available] | low | 0 | 0 | 2,3-epoxysqualene | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyribose | [no description available] | low | 0 | 0 | deoxypentose | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
monodehydroascorbate | [no description available] | low | 0 | 0 | organic radical | mouse metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
vitamin a2 | [no description available] | low | 0 | 0 | retinoid; vitamin A | human xenobiotic metabolite; marine xenobiotic metabolite; mouse metabolite |
1,2-dioleoylphosphatidylserine | [no description available] | low | 0 | 0 | phosphatidylserine(18:1/18:1) | mouse metabolite |
5-hydroxy-6,8,11,14,17-eicosapentaenoic acid | [no description available] | low | 0 | 0 | HEPE | mouse metabolite |
1-stearoyl-2-linoleoylphosphatidylcholine | [no description available] | low | 0 | 0 | phosphatidylcholine 36:2 | mouse metabolite |
1-stearoyl-2-linoleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; diacylglycerol 36:2 | mouse metabolite |
1-palmitoyl-2-docosahexaenoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | phosphatidylcholine 38:6 | mouse metabolite |
13(S)-HODE | [no description available] | low | 0 | 0 | HODE | antineoplastic agent; human xenobiotic metabolite; mouse metabolite |
1-stearoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-stearoyl-2-oleoylglycerol; diacylglycerol 36:1 | mouse metabolite |
1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-palmitoleoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:1 | mouse metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid | metabolite; mouse metabolite |
n-stearoylsphingomyelin | [no description available] | low | 0 | 0 | sphingomyelin 36:1; sphingomyelin d18:1 | mouse metabolite |
20,22-dihydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 22-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; oxysterol | human metabolite; mouse metabolite |
cholesteryl arachidonate | [no description available] | low | 0 | 0 | cholesteryl icosatetraenoate | antibacterial agent; mouse metabolite |
acryloyl-coenzyme a | [no description available] | low | 0 | 0 | 2-enoyl-CoA; monounsaturated fatty acyl-CoA | mouse metabolite |
samarium | [no description available] | low | 0 | 0 | sphingomyelin d18:1/16:0 | mouse metabolite |
n-palmitoylgalactosylsphingosine | [no description available] | low | 0 | 0 | HexCer(d18:1/16:0); N-acyl-beta-D-galactosylsphingosine | mouse metabolite |
palmitoylcarnitine | [no description available] | low | 0 | 0 | O-palmitoylcarnitine; saturated fatty acyl-L-carnitine | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; human metabolite; mouse metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
prosomatostatin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone | fungal metabolite; mouse metabolite; rat metabolite |
phosphatidylcholines | [no description available] | low | 0 | 0 | phosphatidylcholine 40:6 | mouse metabolite |
2-ketoarginine | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
cyclosporine | [no description available] | low | 0 | 0 | keto-disaccharide | mouse metabolite |
g(m3) ganglioside | [no description available] | low | 0 | 0 | alpha-N-acetylneuraminyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-ceramide; sialodiosylceramide; sialotriaosylceramide | mouse metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine monophosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
guanosine triphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
guanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
inosine triphosphate | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
dyspropterin | [no description available] | low | 0 | 0 | biopterins; tetrahydropterin | human metabolite; metabolite; mouse metabolite |
leucovorin | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
lisofylline | [no description available] | low | 0 | 0 | dimethylxanthine; secondary alcohol | |