Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
3-phenylpropionic acid | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | antifungal agent; human metabolite; plant metabolite |
gamma-aminobutyric acid | [no description available] | high | 126 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid | human metabolite; neurotransmitter; Saccharomyces cerevisiae metabolite; signalling molecule |
acetic acid | [no description available] | medium | 10 | 0 | monocarboxylic acid | antimicrobial food preservative; Daphnia magna metabolite; food acidity regulator; protic solvent |
citric acid, anhydrous | [no description available] | high | 13 | 0 | tricarboxylic acid | antimicrobial agent; chelator; food acidity regulator; fundamental metabolite |
2-aminoacetaldehyde | [no description available] | medium | 1 | 0 | amino aldehyde; omega-aminoaldehyde | Escherichia coli metabolite |
phosphoglycolate | [no description available] | medium | 2 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hexachlorocyclohexane | [no description available] | medium | 3 | 0 | chlorocyclohexane | |
oxalic acid | [no description available] | high | 3 | 0 | alpha,omega-dicarboxylic acid | algal metabolite; human metabolite; plant metabolite |
phenol | [no description available] | high | 5 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
phenethylamine | [no description available] | medium | 1 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphoric acid | [no description available] | medium | 2 | 0 | phosphoric acids | algal metabolite; fertilizer; human metabolite; NMR chemical shift reference compound; solvent |
tryptamine | [no description available] | medium | 2 | 0 | aminoalkylindole; aralkylamino compound; indole alkaloid; tryptamines | human metabolite; mouse metabolite; plant metabolite |
phenytoin | [no description available] | medium | 13 | 0 | imidazolidine-2,4-dione | anticonvulsant; drug allergen; sodium channel blocker; teratogenic agent |
alprenolol | [no description available] | medium | 1 | 0 | secondary alcohol; secondary amino compound | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
amitriptyline | [no description available] | medium | 2 | 0 | carbotricyclic compound; tertiary amine | adrenergic uptake inhibitor; antidepressant; environmental contaminant; tropomyosin-related kinase B receptor agonist; xenobiotic |
apraclonidine | [no description available] | medium | 1 | 0 | dichlorobenzene; guanidines; imidazolines | alpha-adrenergic agonist; antiglaucoma drug; beta-adrenergic agonist; diagnostic agent; ophthalmology drug |
arecoline | [no description available] | medium | 1 | 0 | enoate ester; methyl ester; pyridine alkaloid; tetrahydropyridine | metabolite; muscarinic agonist |
astemizole | [no description available] | medium | 3 | 0 | benzimidazoles; piperidines | anti-allergic agent; anticoronaviral agent; H1-receptor antagonist |
bromazepam | [no description available] | medium | 1 | 0 | organic molecular entity | |
carbamazepine | [no description available] | medium | 14 | 0 | dibenzoazepine; ureas | analgesic; anticonvulsant; antimanic drug; drug allergen; EC 3.5.1.98 (histone deacetylase) inhibitor; environmental contaminant; glutamate transporter activator; mitogen; non-narcotic analgesic; sodium channel blocker; xenobiotic |
carbinoxamine | [no description available] | medium | 1 | 0 | monochlorobenzenes; pyridines; tertiary amino compound | anti-allergic agent; antiparkinson drug; H1-receptor antagonist; muscarinic antagonist |
carbofuran | [no description available] | medium | 1 | 0 | 1-benzofurans; carbamate ester | acaricide; agrochemical; avicide; carbamate insecticide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; nematicide |
chlorpheniramine | [no description available] | medium | 2 | 0 | monochlorobenzenes; pyridines; tertiary amino compound | anti-allergic agent; antidepressant; antipruritic drug; H1-receptor antagonist; histamine antagonist; serotonin uptake inhibitor |
chlorpromazine | [no description available] | medium | 6 | 0 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
clonidine | [no description available] | medium | 3 | 0 | clonidine; imidazoline | |
cycloleucine | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | EC 2.5.1.6 (methionine adenosyltransferase) inhibitor |
cyproheptadine | [no description available] | medium | 2 | 0 | piperidines; tertiary amine | anti-allergic agent; antipruritic drug; gastrointestinal drug; H1-receptor antagonist; serotonergic antagonist |
desipramine | [no description available] | medium | 7 | 0 | dibenzoazepine; secondary amino compound | adrenergic uptake inhibitor; alpha-adrenergic antagonist; antidepressant; cholinergic antagonist; drug allergen; EC 3.1.4.12 (sphingomyelin phosphodiesterase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; serotonin uptake inhibitor |
amphetamine | [no description available] | medium | 5 | 0 | primary amine | |
diazepam | [no description available] | medium | 2 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; environmental contaminant; sedative; xenobiotic |
diclofenac | [no description available] | medium | 4 | 0 | amino acid; aromatic amine; dichlorobenzene; monocarboxylic acid; secondary amino compound | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
ddt | [no description available] | medium | 2 | 0 | benzenoid aromatic compound; chlorophenylethane; monochlorobenzenes; organochlorine insecticide | bridged diphenyl acaricide; carcinogenic agent; endocrine disruptor; persistent organic pollutant |
valproic acid | [no description available] | medium | 13 | 0 | branched-chain fatty acid; branched-chain saturated fatty acid | anticonvulsant; antimanic drug; EC 3.5.1.98 (histone deacetylase) inhibitor; GABA agent; neuroprotective agent; psychotropic drug; teratogenic agent |
domperidone | [no description available] | medium | 1 | 0 | benzimidazoles; heteroarylpiperidine | antiemetic; dopaminergic antagonist |
doxepin | [no description available] | medium | 2 | 0 | dibenzooxepine; tertiary amino compound | antidepressant |
flurbiprofen | [no description available] | medium | 4 | 0 | fluorobiphenyl; monocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
fluspirilene | [no description available] | medium | 3 | 0 | diarylmethane | |
guanfacine | [no description available] | medium | 1 | 0 | acetamides | |
haloperidol | [no description available] | medium | 7 | 0 | aromatic ketone; hydroxypiperidine; monochlorobenzenes; organofluorine compound; tertiary alcohol | antidyskinesia agent; antiemetic; dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
ibuprofen | [no description available] | medium | 5 | 0 | monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; radical scavenger; xenobiotic |
ketanserin | [no description available] | medium | 2 | 0 | aromatic ketone; organofluorine compound; piperidines; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; cardiovascular drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; serotonergic antagonist |
lorazepam | [no description available] | medium | 1 | 0 | benzodiazepine | |
mescaline | [no description available] | medium | 1 | 0 | methoxybenzenes; phenethylamine alkaloid; primary amino compound | hallucinogen |
methadone | [no description available] | medium | 4 | 0 | benzenes; diarylmethane; ketone; tertiary amino compound | |
metharbital | [no description available] | medium | 1 | 0 | organic molecular entity | |
mianserin | [no description available] | medium | 4 | 0 | dibenzoazepine | adrenergic uptake inhibitor; alpha-adrenergic antagonist; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; geroprotector; H1-receptor antagonist; histamine agonist; sedative; serotonergic antagonist |
muscimol | [no description available] | medium | 12 | 0 | alkaloid; isoxazoles; primary amino compound | fungal metabolite; GABA agonist; oneirogen; psychotropic drug |
naphazoline | [no description available] | medium | 1 | 0 | naphthalenes | |
nisoxetine | [no description available] | medium | 1 | 0 | aromatic ether; secondary amino compound | adrenergic uptake inhibitor; antidepressant |
nomifensine | [no description available] | medium | 4 | 0 | isoquinolines | dopamine uptake inhibitor |
oxotremorine | [no description available] | medium | 3 | 0 | N-alkylpyrrolidine | |
oxymetazoline | [no description available] | medium | 1 | 0 | carboxamidine; imidazolines; phenols | alpha-adrenergic agonist; nasal decongestant; sympathomimetic agent; vasoconstrictor agent |
phenylbutazone | [no description available] | medium | 4 | 0 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
pipamperone | [no description available] | medium | 1 | 0 | aromatic ketone; bipiperidines; monocarboxylic acid amide; organofluorine compound; tertiary amino compound | dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
prazosin | [no description available] | medium | 4 | 0 | aromatic ether; furans; monocarboxylic acid amide; piperazines; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
propranolol | [no description available] | medium | 8 | 0 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
protriptyline | [no description available] | medium | 1 | 0 | carbotricyclic compound | antidepressant |
pyrilamine | [no description available] | medium | 1 | 0 | aromatic ether; ethylenediamine derivative | H1-receptor antagonist |
pyrimethamine | [no description available] | medium | 4 | 0 | aminopyrimidine; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
spiperone | [no description available] | medium | 3 | 0 | aromatic ketone; azaspiro compound; organofluorine compound; piperidines; tertiary amino compound | alpha-adrenergic antagonist; antipsychotic agent; dopaminergic antagonist; psychotropic drug; serotonergic antagonist |
thioridazine | [no description available] | medium | 2 | 0 | phenothiazines; piperidines | alpha-adrenergic antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
trimethoprim | [no description available] | medium | 8 | 0 | aminopyrimidine; methoxybenzenes | antibacterial drug; diuretic; drug allergen; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; environmental contaminant; xenobiotic |
wb 4101 | [no description available] | medium | 1 | 0 | aromatic ether; benzodioxine; secondary amino compound | alpha-adrenergic antagonist |
xylazine | [no description available] | medium | 1 | 0 | 1,3-thiazine; methylbenzene; secondary amino compound | alpha-adrenergic agonist; analgesic; emetic; muscle relaxant; sedative |
corticosterone | [no description available] | high | 3 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
lysergic acid diethylamide | [no description available] | medium | 1 | 0 | ergoline alkaloid; monocarboxylic acid amide; organic heterotetracyclic compound | dopamine agonist; hallucinogen; serotonergic agonist |
phentolamine | [no description available] | medium | 2 | 0 | imidazoles; phenols; substituted aniline; tertiary amino compound | alpha-adrenergic antagonist; vasodilator agent |
3,3',5-triiodothyroacetic acid | [no description available] | medium | 2 | 0 | | |
thyroxine | [no description available] | high | 34 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
carbachol | [no description available] | medium | 7 | 0 | ammonium salt; carbamate ester | cardiotonic drug; miotic; muscarinic agonist; nicotinic acetylcholine receptor agonist; non-narcotic analgesic |
aldosterone | [no description available] | high | 6 | 0 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
pilocarpine | [no description available] | medium | 9 | 0 | pilocarpine | antiglaucoma drug |
apomorphine | [no description available] | medium | 3 | 0 | aporphine alkaloid | alpha-adrenergic drug; antidyskinesia agent; antiparkinson drug; dopamine agonist; emetic; serotonergic drug |
piperoxan | [no description available] | medium | 1 | 0 | | |
carbaryl | [no description available] | medium | 2 | 0 | carbamate ester; naphthalenes | acaricide; agrochemical; carbamate insecticide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; plant growth retardant |
cytidine monophosphate | [no description available] | high | 4 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
medroxyprogesterone acetate | [no description available] | medium | 6 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; corticosteroid; steroid ester | adjuvant; androgen; antineoplastic agent; antioxidant; female contraceptive drug; inhibitor; progestin; synthetic oral contraceptive |
cordycepin | [no description available] | medium | 2 | 0 | 3'-deoxyribonucleoside; adenosines | antimetabolite; nucleoside antibiotic |
ethylamine | [no description available] | medium | 1 | 0 | primary aliphatic amine | human metabolite |
tetramethylammonium | [no description available] | medium | 3 | 0 | quaternary ammonium ion | |
mephobarbital | [no description available] | medium | 4 | 0 | barbiturates | anticonvulsant |
yohimbine | [no description available] | medium | 3 | 0 | methyl 17-hydroxy-20xi-yohimban-16-carboxylate | alpha-adrenergic antagonist; dopamine receptor D2 antagonist; serotonergic antagonist |
prenylamine | [no description available] | medium | 1 | 0 | diarylmethane | |
ketobemidone | [no description available] | medium | 1 | 0 | piperidines | |
cytisine | [no description available] | medium | 1 | 0 | alkaloid; bridged compound; lactam; organic heterotricyclic compound; secondary amino compound | nicotinic acetylcholine receptor agonist; phytotoxin; plant metabolite |
bufotenin | [no description available] | medium | 1 | 0 | tertiary amine; tryptamine alkaloid | coral metabolite; hallucinogen |
fructose-1,6-diphosphate | [no description available] | medium | 1 | 0 | D-fructofuranose 1,6-bisphosphate | mouse metabolite |
dihydrotestosterone | [no description available] | high | 5 | 0 | 17beta-hydroxy steroid; 17beta-hydroxyandrostan-3-one; 3-oxo-5alpha-steroid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
trimellitic acid | [no description available] | medium | 1 | 0 | tricarboxylic acid | |
pimozide | [no description available] | medium | 4 | 0 | benzimidazoles; heteroarylpiperidine; organofluorine compound | antidyskinesia agent; dopaminergic antagonist; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
benperidol | [no description available] | medium | 1 | 0 | aromatic ketone | |
benzetimide | [no description available] | medium | 1 | 0 | piperidines | |
acetylpyruvic acid | [no description available] | medium | 1 | 0 | beta-diketone; dioxo monocarboxylic acid | bacterial metabolite |
metoprine | [no description available] | medium | 1 | 0 | | |
coformycin | [no description available] | medium | 1 | 0 | coformycins | EC 3.5.4.4 (adenosine deaminase) inhibitor |
pizotyline | [no description available] | medium | 2 | 0 | benzocycloheptathiophene | histamine antagonist; muscarinic antagonist; serotonergic antagonist |
metergoline | [no description available] | medium | 1 | 0 | carbamate ester; ergoline alkaloid | dopamine agonist; geroprotector; serotonergic antagonist |
lofexidine | [no description available] | medium | 1 | 0 | aromatic ether; carboxamidine; dichlorobenzene; imidazoles | alpha-adrenergic agonist; antihypertensive agent |
5-(2-cyclohexylidene-ethyl)-5-ethylbarbiturate | [no description available] | medium | 1 | 0 | | |
timolol | [no description available] | medium | 2 | 0 | timolol | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist |
indoramin | [no description available] | medium | 1 | 0 | tryptamines | |
penfluridol | [no description available] | medium | 1 | 0 | diarylmethane | |
tiamenidine | [no description available] | medium | 1 | 0 | organochlorine compound | |
sufentanil | [no description available] | medium | 1 | 0 | anilide; ether; piperidines; thiophenes | anaesthesia adjuvant; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic |
carfentanil | [no description available] | medium | 1 | 0 | methyl ester; piperidines; tertiary amino compound; tertiary carboxamide | mu-opioid receptor agonist; opioid analgesic; tranquilizing drug |
fenclofenac | [no description available] | medium | 1 | 0 | aromatic ether | |
flutonidine | [no description available] | medium | 1 | 0 | | |
tutin | [no description available] | medium | 1 | 0 | gamma-lactone | |
nicotine | [no description available] | medium | 5 | 0 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
5,6-dihydrouridine | [no description available] | medium | 1 | 0 | uridines | biomarker |
methotrexate | [no description available] | medium | 27 | 0 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
naproxen | [no description available] | medium | 7 | 0 | methoxynaphthalene; monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
camphora | [no description available] | medium | 1 | 0 | camphor | |
atropine | [no description available] | medium | 4 | 0 | | |
ouabain | [no description available] | medium | 8 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
xylose 1-phosphate | [no description available] | medium | 1 | 0 | xylose phosphate | |
picrotoxinin | [no description available] | medium | 1 | 0 | epoxide; gamma-lactone; organic heteropentacyclic compound; picrotoxane sesquiterpenoid; tertiary alcohol | GABA antagonist; plant metabolite; serotonergic antagonist |
1-(5'-phospho-beta-d-ribofuranosyl)barbituric acid | [no description available] | medium | 1 | 0 | pyrimidine ribonucleoside 5'-monophosphate | |
etorphine | [no description available] | medium | 1 | 0 | alcohol; morphinane alkaloid | opioid analgesic; opioid receptor agonist; sedative |
dieldrin | [no description available] | medium | 2 | 0 | epoxide; organochlorine compound; organochlorine insecticide | carcinogenic agent; xenobiotic |
benztropine | [no description available] | medium | 1 | 0 | diarylmethane | |
cinnarizine | [no description available] | medium | 2 | 0 | diarylmethane; N-alkylpiperazine; olefinic compound | anti-allergic agent; antiemetic; calcium channel blocker; geroprotector; H1-receptor antagonist; histamine antagonist; muscarinic antagonist |
tamoxifen | [no description available] | medium | 7 | 0 | stilbenoid; tertiary amino compound | angiogenesis inhibitor; antineoplastic agent; bone density conservation agent; EC 1.2.3.1 (aldehyde oxidase) inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; estrogen antagonist; estrogen receptor antagonist; estrogen receptor modulator |
ketazocine | [no description available] | medium | 1 | 0 | | |
dinoprostone | [no description available] | high | 9 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
dinoprost | [no description available] | high | 4 | 0 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
alprostadil | [no description available] | high | 3 | 0 | prostaglandins E | anticoagulant; human metabolite; platelet aggregation inhibitor; vasodilator agent |
flupenthixol | [no description available] | medium | 2 | 0 | flupenthixol | dopaminergic antagonist |
triprolidine | [no description available] | medium | 1 | 0 | N-alkylpyrrolidine; olefinic compound; pyridines | H1-receptor antagonist |
guanabenz | [no description available] | medium | 1 | 0 | dichlorobenzene | |
2-amino-4-methoxy-3-butenoic acid | [no description available] | medium | 1 | 0 | | |
24,25-dihydroxyvitamin d 3 | [no description available] | medium | 1 | 0 | | |
1-methyl-d-lysergic acid butanolamide | [no description available] | medium | 1 | 0 | ergot alkaloid; monocarboxylic acid amide | serotonergic antagonist; sympatholytic agent; vasoconstrictor agent |
scopolamine hydrobromide | [no description available] | medium | 1 | 0 | | |
dicumarol | [no description available] | medium | 2 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; Hsp90 inhibitor; vitamin K antagonist |
warfarin | [no description available] | medium | 26 | 0 | benzenes; hydroxycoumarin; methyl ketone | |
warfarin | [no description available] | medium | 26 | 2 | benzenes; hydroxycoumarin; methyl ketone | |
clozapine | [no description available] | medium | 4 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine; organochlorine compound | adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; GABA antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; xenobiotic |
oxypurinol | [no description available] | medium | 2 | 0 | pyrazolopyrimidine | drug metabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor |
allopurinol | [no description available] | medium | 10 | 0 | nucleobase analogue; organic heterobicyclic compound | antimetabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor; gout suppressant; radical scavenger |
zidovudine | [no description available] | medium | 6 | 0 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
u 75875 | [no description available] | medium | 1 | 0 | | |
theophylline | [no description available] | medium | 12 | 0 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
acepromazine | [no description available] | medium | 1 | 0 | aromatic ketone; methyl ketone; phenothiazines; tertiary amino compound | phenothiazine antipsychotic drug |
adenosine monophosphate | [no description available] | high | 61 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | adenosine A1 receptor agonist; cofactor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.11 (fructose-bisphosphatase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
arginine | [no description available] | high | 46 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
framycetin | [no description available] | high | 7 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
citrulline | [no description available] | high | 10 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
malachite green | [no description available] | medium | 1 | 0 | organic chloride salt | antibacterial agent; antifungal drug; carcinogenic agent; environmental contaminant; fluorochrome; histological dye; teratogenic agent |
tobramycin | [no description available] | medium | 5 | 0 | amino cyclitol glycoside | antibacterial agent; antimicrobial agent; toxin |
neamine | [no description available] | medium | 1 | 0 | 2,6-dideoxy-alpha-D-glucoside; aminoglycoside | antibacterial agent |
paromomycin | [no description available] | medium | 3 | 0 | amino cyclitol glycoside; aminoglycoside antibiotic | anthelminthic drug; antibacterial drug; antiparasitic agent; antiprotozoal drug |
flavin mononucleotide | [no description available] | medium | 1 | 0 | flavin mononucleotide; vitamin B2 | bacterial metabolite; coenzyme; cofactor; human metabolite; mouse metabolite |
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoic acid | [no description available] | medium | 1 | 0 | biotins | |
benzbromarone | [no description available] | medium | 5 | 0 | 1-benzofurans; aromatic ketone | uricosuric drug |
9,10-phenanthrenequinone | [no description available] | medium | 1 | 0 | phenanthrenes | |
benzo(b)fluoranthene | [no description available] | medium | 2 | 0 | ortho- and peri-fused polycyclic arene | mutagen |
malononitrile dimer | [no description available] | medium | 1 | 0 | | |
toxoflavin | [no description available] | medium | 1 | 0 | carbonyl compound; pyrimidotriazine | antibacterial agent; antineoplastic agent; apoptosis inducer; bacterial metabolite; toxin; virulence factor; Wnt signalling inhibitor |
methyl fluorone black | [no description available] | medium | 2 | 0 | | |
6-hydroxydopa | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | |
desthiobiotin | [no description available] | medium | 117 | 0 | dethiobiotin | |
1,3,6-trimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione | [no description available] | medium | 1 | 0 | pyrimidotriazine | |
5-bromo-3-ethyl-1H-indole-2-carboxylic acid | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
2-(4-benzofuro[3,2-d]pyrimidinylthio)-1-thiophen-2-ylethanone | [no description available] | medium | 1 | 0 | benzofurans | |
3,5,5-trimethyl-2-sulfanylidene-1,6-dihydrobenzo[h]quinazolin-4-one | [no description available] | medium | 1 | 0 | quinazolines | |
2-amino-4-(4-chlorophenyl)-6-methyl-3-pyridinecarbonitrile | [no description available] | medium | 1 | 0 | phenylpyridine | |
1,6-dimethyl-3-(2-pyridinyl)pyrimido[5,4-e][1,2,4]triazine-5,7-dione | [no description available] | medium | 1 | 0 | pyrimidotriazine | |
1-(4-methyl-1-piperidinyl)-2-[(3-methyl-2-quinoxalinyl)thio]ethanone | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
N-[3-cyano-4-(4-methoxyphenyl)-5-methyl-2-thiophenyl]-2-methyl-3-pyrazolecarboxamide | [no description available] | medium | 1 | 0 | methoxybenzenes | |
2-(4-fluorophenyl)-3-(2-furanylmethyl)-10-methylpyrimido[4,5-b]quinoline-4,5-dione | [no description available] | medium | 1 | 0 | quinolines | |
6-(4-bromophenyl)-3-methyl-1-[2-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)pyrazolo[3,4-b]pyridine | [no description available] | medium | 1 | 0 | phenylpyridine | |
3-phenyl-2-sulfanylidene-1H-benzofuro[3,2-d]pyrimidin-4-one | [no description available] | medium | 1 | 0 | benzofurans | |
2-[(4-methylphenyl)sulfonylamino]acetic acid [2-(5-bromo-2-thiophenyl)-2-oxoethyl] ester | [no description available] | medium | 1 | 0 | alpha-amino acid ester | |
2-[(6-chloro-1H-benzimidazol-2-yl)thio]-N-(2,3-dihydro-1H-inden-5-yl)acetamide | [no description available] | medium | 1 | 0 | benzimidazoles | |
2-(4-benzofuro[3,2-d]pyrimidinylthio)-N-(3-methylphenyl)acetamide | [no description available] | medium | 1 | 0 | benzofurans | |
2-amino-7,7-dimethyl-4-(4-methylphenyl)-5-oxo-6,8-dihydro-4H-1-benzopyran-3-carbothioamide | [no description available] | medium | 1 | 0 | toluenes | |
1-(3-methyl-1-piperidinyl)-2-(2-quinoxalinylthio)ethanone | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
2-(5-bromo-2-thiophenyl)-N-(4-methyl-1-piperazinyl)-4-quinolinecarboxamide | [no description available] | medium | 1 | 0 | quinolines | |
3-(4-chloro-1,5-dimethyl-3-pyrazolyl)-4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione | [no description available] | medium | 1 | 0 | triazoles | |
2-(2-quinoxalinylthio)propanoic acid | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
ellagic acid | [no description available] | medium | 3 | 0 | catechols; cyclic ketone; lactone; organic heterotetracyclic compound; polyphenol | antioxidant; EC 1.14.18.1 (tyrosinase) inhibitor; EC 2.3.1.5 (arylamine N-acetyltransferase) inhibitor; EC 2.4.1.1 (glycogen phosphorylase) inhibitor; EC 2.5.1.18 (glutathione transferase) inhibitor; EC 2.7.1.127 (inositol-trisphosphate 3-kinase) inhibitor; EC 2.7.1.151 (inositol-polyphosphate multikinase) inhibitor; EC 2.7.4.6 (nucleoside-diphosphate kinase) inhibitor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; food additive; fungal metabolite; geroprotector; plant metabolite; skin lightening agent |
3-bromo-7-hydroxy-4,8-dimethyl-1-benzopyran-2-one | [no description available] | medium | 1 | 0 | hydroxycoumarin | |
3-(3-methylphenyl)-2-sulfanylidene-1H-benzofuro[3,2-d]pyrimidin-4-one | [no description available] | medium | 1 | 0 | benzofurans | |
6-(4-bromophenyl)-2-methyl-3-pyridinecarboxylic acid | [no description available] | medium | 1 | 0 | phenylpyridine | |
lissamine rhodamine b | [no description available] | medium | 1 | 0 | organic sodium salt | fluorescent probe; fluorochrome; histological dye |
methacycline monohydrochloride | [no description available] | medium | 3 | 0 | | |
ethylene dichloride | [no description available] | medium | 3 | 0 | chloroethanes | hepatotoxic agent; mutagen; non-polar solvent |
1,2,4-trichlorobenzene | [no description available] | medium | 1 | 0 | trichlorobenzene | |
benzene | [no description available] | medium | 4 | 0 | aromatic annulene; benzenes; volatile organic compound | carcinogenic agent; environmental contaminant; non-polar solvent |
octane | [no description available] | medium | 4 | 0 | alkane | xenobiotic |
naphthalene | [no description available] | medium | 1 | 0 | naphthalenes; ortho-fused bicyclic arene | apoptosis inhibitor; carcinogenic agent; environmental contaminant; mouse metabolite; plant metabolite; volatile oil component |
niacinamide | [no description available] | high | 68 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
orotic acid | [no description available] | high | 12 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
4-aminobenzoic acid | [no description available] | high | 36 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
phenanthrene | [no description available] | medium | 3 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon; phenanthrenes | environmental contaminant; mouse metabolite |
dimethyl sulfide | [no description available] | medium | 1 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
thiamine | [no description available] | high | 288 | 1 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thiamine | [no description available] | high | 288 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
toluene | [no description available] | medium | 3 | 0 | methylbenzene; toluenes; volatile organic compound | cholinergic antagonist; fuel additive; neurotoxin; non-polar solvent |
benzo(a)pyrene | [no description available] | high | 6 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mouse metabolite |
vitamin k 3 | [no description available] | medium | 4 | 0 | 1,4-naphthoquinones; vitamin K | angiogenesis inhibitor; antineoplastic agent; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; human urinary metabolite; nutraceutical |
4-dichlorobenzene | [no description available] | medium | 3 | 0 | dichlorobenzene | insecticide |
procaine | [no description available] | medium | 4 | 0 | benzoate ester; substituted aniline; tertiary amino compound | central nervous system depressant; drug allergen; local anaesthetic; peripheral nervous system drug |
1,2,5,6-dibenzanthracene | [no description available] | medium | 1 | 0 | ortho-fused polycyclic arene | mutagen |
carbon tetrachloride | [no description available] | medium | 5 | 0 | chlorocarbon; chloromethanes | hepatotoxic agent; refrigerant |
benz(a)anthracene | [no description available] | medium | 1 | 0 | ortho-fused polycyclic arene; tetraphenes | |
1,1,1-trichloroethane | [no description available] | medium | 1 | 0 | chloroethanes | polar solvent |
ethyl chloride | [no description available] | medium | 1 | 0 | chloroethanes | antipruritic drug; inhalation anaesthetic; local anaesthetic |
trichlorofluoromethane | [no description available] | medium | 1 | 0 | chlorofluorocarbon; halomethane | environmental contaminant; NMR chemical shift reference compound; NMR solvent; refrigerant |
pentachloroethane | [no description available] | medium | 1 | 0 | chloroethanes | non-polar solvent |
isopentane | [no description available] | medium | 1 | 0 | alkane | refrigerant |
trichloroethylene | [no description available] | medium | 4 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
1,1,2,2-tetrachloroethane | [no description available] | medium | 1 | 0 | chloroethanes | |
pantothenic acid | [no description available] | medium | 244 | 0 | pantothenic acid; vitamin B5 | antidote to curare poisoning; geroprotector; human blood serum metabolite |
pantothenic acid | [no description available] | medium | 244 | 2 | pantothenic acid; vitamin B5 | antidote to curare poisoning; geroprotector; human blood serum metabolite |
acenaphthene | [no description available] | medium | 1 | 0 | acenaphthenes | |
7,8-dimethyl-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione | [no description available] | medium | 1 | 0 | flavin | |
fluorene | [no description available] | medium | 2 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon | |
1,2,3-trichlorobenzene | [no description available] | medium | 1 | 0 | trichlorobenzene | |
hexamethylbenzene | [no description available] | medium | 1 | 0 | methylbenzene | |
1-methylnaphthalene | [no description available] | medium | 1 | 0 | methylnaphthalene | carcinogenic agent; plant metabolite |
1-chloronaphthalene | [no description available] | medium | 1 | 0 | | |
2-methylnaphthalene | [no description available] | medium | 1 | 0 | methylnaphthalene | |
2-chloronaphthalene | [no description available] | medium | 1 | 0 | | |
naphthacene | [no description available] | medium | 1 | 0 | acene; tetracenes | |
diphenyl | [no description available] | medium | 1 | 0 | aromatic fungicide; benzenes; biphenyls | antifungal agrochemical; antimicrobial food preservative |
2-xylene | [no description available] | medium | 1 | 0 | xylene | |
2-chlorotoluene | [no description available] | medium | 1 | 0 | | |
2-dichlorobenzene | [no description available] | medium | 1 | 0 | dichlorobenzene | hepatotoxic agent; metabolite |
pseudocumene | [no description available] | medium | 1 | 0 | trimethylbenzene | neurotoxin |
durene | [no description available] | medium | 1 | 0 | tetramethylbenzene | |
1,2,4,5-tetrachlorobenzene | [no description available] | medium | 1 | 0 | tetrachlorobenzene | |
tert-butylbenzene | [no description available] | medium | 1 | 0 | | |
cumene | [no description available] | medium | 1 | 0 | alkylbenzene | |
4-cymene | [no description available] | medium | 1 | 0 | monoterpene; toluenes | human urinary metabolite; plant metabolite; volatile oil component |
ethylbenzene | [no description available] | medium | 1 | 0 | alkylbenzene | |
1,2-dihydrostilbene | [no description available] | medium | 1 | 0 | diphenylethane | |
n-propylbenzene | [no description available] | medium | 1 | 0 | alkylbenzene | |
n-butylbenzene | [no description available] | medium | 1 | 0 | alkylbenzene | |
1,4-dibromobenzene | [no description available] | medium | 1 | 0 | dibromobenzene | |
4-xylene | [no description available] | medium | 1 | 0 | xylene | |
4-chlorotoluene | [no description available] | medium | 1 | 0 | monochlorobenzenes | |
ethylene dibromide | [no description available] | medium | 1 | 0 | bromoalkane; bromohydrocarbon | algal metabolite; carcinogenic agent; fumigant; marine metabolite; mouse metabolite; mutagen |
butane | [no description available] | medium | 1 | 0 | alkane; gas molecular entity | food propellant; refrigerant |
1-butene | [no description available] | medium | 1 | 0 | butene | |
2-methylpentane | [no description available] | medium | 1 | 0 | alkane | |
3-xylene | [no description available] | medium | 1 | 0 | xylene | |
mesitylene | [no description available] | medium | 1 | 0 | trimethylbenzene | |
1,3,5-trichlorobenzene | [no description available] | medium | 1 | 0 | trichlorobenzene | |
bromobenzene | [no description available] | medium | 3 | 0 | bromoarene; bromobenzenes; volatile organic compound | hepatotoxic agent; mouse metabolite; non-polar solvent |
chlorobenzene | [no description available] | medium | 1 | 0 | monochlorobenzenes | solvent |
pentane | [no description available] | medium | 2 | 0 | alkane; volatile organic compound | non-polar solvent; refrigerant |
1-pentene | [no description available] | medium | 1 | 0 | | |
butyl chloride | [no description available] | medium | 1 | 0 | | |
n-hexane | [no description available] | medium | 1 | 0 | alkane; volatile organic compound | neurotoxin; non-polar solvent |
cyclohexane | [no description available] | medium | 2 | 0 | cycloalkane; volatile organic compound | non-polar solvent |
cyclohexene | [no description available] | medium | 1 | 0 | cycloalkene | |
nonane | [no description available] | medium | 1 | 0 | alkane | plant metabolite; volatile oil component |
hexachlorobenzene | [no description available] | medium | 2 | 0 | aromatic fungicide; chlorobenzenes | antifungal agrochemical; carcinogenic agent; persistent organic pollutant |
anthracene | [no description available] | medium | 3 | 0 | acene; anthracenes; ortho-fused tricyclic hydrocarbon | |
n-heptane | [no description available] | medium | 1 | 0 | alkane; volatile organic compound | non-polar solvent; plant metabolite |
1,12-benzoperylene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene | |
benzo(e)pyrene | [no description available] | medium | 2 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mutagen |
perylene | [no description available] | medium | 6 | 0 | ortho- and peri-fused polycyclic arene; perylenes | |
benzo(j)fluoranthene | [no description available] | medium | 1 | 0 | naphthalenes | |
fluoranthene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene | |
benzo(k)fluoranthene | [no description available] | medium | 1 | 0 | naphthalenes | |
triphenylene | [no description available] | medium | 1 | 0 | ortho-fused polycyclic arene | |
chrysene | [no description available] | medium | 1 | 0 | ortho-fused polycyclic arene | plant metabolite |
dibenzo(aj)anthracene | [no description available] | medium | 1 | 0 | phenanthrenes | |
benzo(a)fluorene | [no description available] | medium | 1 | 0 | carbotetracyclic compound | |
benzo(b)fluorene | [no description available] | medium | 1 | 0 | carbotetracyclic compound | |
adamantane | [no description available] | medium | 11 | 0 | adamantanes; polycyclic alkane | |
cyclopentane | [no description available] | medium | 10 | 0 | cycloalkane; cyclopentanes; volatile organic compound | non-polar solvent |
cyclooctane | [no description available] | medium | 1 | 0 | | |
diethyl sulfide | [no description available] | medium | 1 | 0 | ethyl sulfide | |
fluorobenzenes | [no description available] | medium | 4 | 0 | monofluorobenzenes | NMR chemical shift reference compound |
cholanthrene | [no description available] | medium | 1 | 0 | | |
menadiol | [no description available] | medium | 1 | 0 | methylnaphthalenes; naphthalenediols; naphthohydroquinone | |
hemimellitene | [no description available] | medium | 1 | 0 | trimethylbenzene | neurotoxin; plant metabolite |
1-chloropropane | [no description available] | medium | 1 | 0 | | |
2,2,4-trimethylpentane | [no description available] | medium | 3 | 0 | alkane; volatile organic compound | fuel additive; nephrotoxin; non-polar solvent |
1,3-dichlorobenzene | [no description available] | medium | 1 | 0 | dichlorobenzene | |
1-chlorohexane | [no description available] | medium | 1 | 0 | | |
1,4-dimethylnaphthalene | [no description available] | medium | 1 | 0 | dimethylnaphthalene | |
2,6-dimethylnaphthalene | [no description available] | medium | 1 | 0 | dimethylnaphthalene | environmental contaminant |
1,2-dibromobenzene | [no description available] | medium | 1 | 0 | dibromobenzene | |
iodobenzene | [no description available] | medium | 1 | 0 | | |
1-hexene | [no description available] | medium | 1 | 0 | alkene | |
pentachlorobenzene | [no description available] | medium | 1 | 0 | pentachlorobenzenes | persistent organic pollutant |
2-methylanthracene | [no description available] | medium | 1 | 0 | | |
1,2,3,4-tetrachlorobenzene | [no description available] | medium | 1 | 0 | tetrachlorobenzene | |
1,2,3,5-tetrachlorobenzene | [no description available] | medium | 1 | 0 | tetrachlorobenzene | |
9-methylanthracene | [no description available] | medium | 1 | 0 | | |
9,10-dimethylanthracene | [no description available] | medium | 1 | 0 | | |
undecane | [no description available] | medium | 1 | 0 | alkane | |
d-alpha tocopherol | [no description available] | high | 50 | 0 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
6-methylchrysene | [no description available] | medium | 1 | 0 | carbopolycyclic compound | |
decane | [no description available] | medium | 1 | 0 | alkane | |
12-methylbenzanthracene | [no description available] | medium | 1 | 0 | | |
2-methylphenanthrene | [no description available] | medium | 1 | 0 | | |
7-methylbenzanthracene | [no description available] | medium | 1 | 0 | | |
5-methylchrysene | [no description available] | medium | 1 | 0 | carbopolycyclic compound | |
5,6-dimethylchrysene | [no description available] | medium | 1 | 0 | | |
7-ethylbenz(a)anthracene | [no description available] | medium | 1 | 0 | | |
tetrachloroethylene | [no description available] | medium | 2 | 0 | chlorocarbon; chloroethenes | nephrotoxic agent |
pyrene | [no description available] | medium | 6 | 0 | ortho- and peri-fused polycyclic arene | fluorescent probe; persistent organic pollutant |
2,3,4,5-tetrachlorobiphenyl | [no description available] | medium | 1 | 0 | tetrachlorobenzene; tetrachlorobiphenyl | |
2,5-dichlorobiphenyl | [no description available] | medium | 1 | 0 | dichlorobenzene; dichlorobiphenyl | |
2,4'-dichlorobiphenyl | [no description available] | medium | 1 | 0 | dichlorobiphenyl; monochlorobenzenes | |
2,4,6-trichlorobiphenyl | [no description available] | medium | 1 | 0 | | |
2-chlorobiphenyl | [no description available] | medium | 1 | 0 | monochlorobiphenyl | |
7-dehydrocholesterol | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; Delta(5),Delta(7)-sterol | human metabolite; mouse metabolite |
retinol | [no description available] | high | 66 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
vitamin d 2 | [no description available] | high | 6 | 0 | hydroxy seco-steroid; seco-ergostane; vitamin D | bone density conservation agent; nutraceutical; plant metabolite; rodenticide |
cholecalciferol | [no description available] | high | 6 | 0 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol; steroid hormone | geroprotector; human metabolite |
rutin | [no description available] | medium | 1 | 0 | disaccharide derivative; quercetin O-glucoside; rutinoside; tetrahydroxyflavone | antioxidant; metabolite |
vitamin k 1 | [no description available] | high | 2 | 0 | phylloquinones; vitamin K | cofactor; human metabolite; plant metabolite |
vitamin a2 | [no description available] | medium | 1 | 0 | retinoid; vitamin A | human xenobiotic metabolite; marine xenobiotic metabolite; mouse metabolite |
ascorbic acid | [no description available] | high | 116 | 0 | ascorbic acid; vitamin C | coenzyme; cofactor; flour treatment agent; food antioxidant; food colour retention agent; geroprotector; plant metabolite; skin lightening agent |
folic acid | [no description available] | high | 248 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
acetamide | [no description available] | medium | 1 | 0 | acetamides; carboximidic acid; monocarboxylic acid amide; N-acylammonia | |
adenine | [no description available] | high | 24 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allantoin | [no description available] | high | 2 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
quinacrine | [no description available] | medium | 1 | 0 | acridines; aromatic ether; organochlorine compound; tertiary amino compound | antimalarial; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor |
betaine | [no description available] | high | 3 | 0 | amino-acid betaine; glycine derivative | fundamental metabolite |
carnitine | [no description available] | high | 43 | 2 | amino-acid betaine | human metabolite; mouse metabolite |
carnitine | [no description available] | high | 43 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
salicylic acid | [no description available] | medium | 6 | 0 | monohydroxybenzoic acid | algal metabolite; antifungal agent; antiinfective agent; EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor; keratolytic drug; plant hormone; plant metabolite |
bupropion | [no description available] | medium | 1 | 0 | aromatic ketone; monochlorobenzenes; secondary amino compound | antidepressant; environmental contaminant; xenobiotic |
aminocaproic acid | [no description available] | medium | 4 | 0 | amino acid zwitterion; epsilon-amino acid; omega-amino fatty acid | antifibrinolytic drug; hematologic agent; metabolite |
creatine | [no description available] | high | 7 | 0 | glycine derivative; guanidines; zwitterion | geroprotector; human metabolite; mouse metabolite; neuroprotective agent; nutraceutical |
lactic acid | [no description available] | medium | 45 | 0 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
lactic acid | [no description available] | medium | 45 | 1 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
dimethyl sulfoxide | [no description available] | high | 8 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
formaldehyde | [no description available] | high | 34 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glycine | [no description available] | high | 54 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
glycerol | [no description available] | high | 15 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
hydroquinone | [no description available] | medium | 5 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
inositol | [no description available] | medium | 63 | 0 | cyclitol; hexol | |
niacin | [no description available] | high | 107 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
phenylacetic acid | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
pyrazinamide | [no description available] | medium | 3 | 0 | monocarboxylic acid amide; N-acylammonia; pyrazines | antitubercular agent; prodrug |
pyridoxal phosphate | [no description available] | high | 27 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | high | 180 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uracil | [no description available] | high | 9 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
urea | [no description available] | high | 55 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
catechin | [no description available] | medium | 1 | 0 | hydroxyflavan | |
menthol | [no description available] | medium | 1 | 0 | p-menthane monoterpenoid; secondary alcohol | volatile oil component |
acebutolol | [no description available] | medium | 1 | 0 | aromatic amide; ethanolamines; ether; monocarboxylic acid amide; propanolamine; secondary amino compound | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympathomimetic agent |
acetaminophen | [no description available] | medium | 5 | 0 | acetamides; phenols | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; cyclooxygenase 3 inhibitor; environmental contaminant; ferroptosis inducer; geroprotector; hepatotoxic agent; human blood serum metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
acetazolamide | [no description available] | medium | 4 | 0 | monocarboxylic acid amide; sulfonamide; thiadiazoles | anticonvulsant; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
acetohexamide | [no description available] | medium | 3 | 0 | acetophenones; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
acetohydroxamic acid | [no description available] | medium | 1 | 0 | acetohydroxamic acids; carbohydroximic acid | algal metabolite; EC 3.5.1.5 (urease) inhibitor |
albendazole | [no description available] | medium | 4 | 0 | aryl sulfide; benzimidazoles; benzimidazolylcarbamate fungicide; carbamate ester | anthelminthic drug; microtubule-destabilising agent; tubulin modulator |
albuterol | [no description available] | medium | 1 | 0 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
alfuzosin | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; quinazolines; tetrahydrofuranol | alpha-adrenergic antagonist; antihypertensive agent; antineoplastic agent |
amantadine | [no description available] | medium | 2 | 0 | adamantanes; primary aliphatic amine | analgesic; antiparkinson drug; antiviral drug; dopaminergic agent; NMDA receptor antagonist; non-narcotic analgesic |
ambroxol | [no description available] | medium | 1 | 0 | aromatic amine | |
aminoglutethimide | [no description available] | medium | 3 | 0 | dicarboximide; piperidones; substituted aniline | adrenergic agent; anticonvulsant; antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
pimagedine | [no description available] | medium | 4 | 0 | guanidines; one-carbon compound | EC 1.14.13.39 (nitric oxide synthase) inhibitor; EC 1.4.3.4 (monoamine oxidase) inhibitor |
amiodarone | [no description available] | medium | 3 | 0 | 1-benzofurans; aromatic ketone; organoiodine compound; tertiary amino compound | cardiovascular drug |
amlodipine | [no description available] | medium | 1 | 0 | dihydropyridine; ethyl ester; methyl ester; monochlorobenzenes; primary amino compound | antihypertensive agent; calcium channel blocker; vasodilator agent |
amobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
amsacrine | [no description available] | medium | 1 | 0 | acridines; aromatic ether; sulfonamide | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
anastrozole | [no description available] | medium | 1 | 0 | nitrile; triazoles | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
anethole trithione | [no description available] | medium | 1 | 0 | methoxybenzenes | |
anthralin | [no description available] | medium | 1 | 0 | anthracenes | antipsoriatic |
aspirin | [no description available] | medium | 5 | 0 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
atenolol | [no description available] | medium | 3 | 0 | ethanolamines; monocarboxylic acid amide; propanolamine | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; sympatholytic agent; xenobiotic |
azathioprine | [no description available] | medium | 3 | 0 | aryl sulfide; C-nitro compound; imidazoles; thiopurine | antimetabolite; antineoplastic agent; carcinogenic agent; DNA synthesis inhibitor; hepatotoxic agent; immunosuppressive agent; prodrug |
baclofen | [no description available] | medium | 1 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid; monochlorobenzenes; primary amino compound | central nervous system depressant; GABA agonist; muscle relaxant |
barbital | [no description available] | medium | 1 | 0 | barbiturates | drug allergen |
bendazac | [no description available] | medium | 1 | 0 | indazoles; monocarboxylic acid | non-steroidal anti-inflammatory drug; radical scavenger |
bicalutamide | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; monocarboxylic acid amide; monofluorobenzenes; nitrile; sulfone; tertiary alcohol | |
bay h 4502 | [no description available] | medium | 1 | 0 | biphenyls; imidazoles | |
bisoprolol | [no description available] | medium | 1 | 0 | secondary alcohol; secondary amine | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
bromisovalum | [no description available] | medium | 1 | 0 | N-acylurea; organobromine compound | |
brotizolam | [no description available] | medium | 1 | 0 | organic molecular entity | |
bumetanide | [no description available] | medium | 4 | 0 | amino acid; benzoic acids; sulfonamide | diuretic; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor |
bupivacaine | [no description available] | medium | 3 | 0 | aromatic amide; piperidinecarboxamide; tertiary amino compound | |
buspirone | [no description available] | medium | 4 | 0 | azaspiro compound; N-alkylpiperazine; N-arylpiperazine; organic heteropolycyclic compound; piperidones; pyrimidines | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
busulfan | [no description available] | medium | 3 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; insect sterilant; teratogenic agent |
butalbital | [no description available] | medium | 1 | 0 | barbiturates | analgesic; sedative |
caffeine | [no description available] | high | 7 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
verapamil | [no description available] | medium | 3 | 0 | aromatic ether; nitrile; polyether; tertiary amino compound | |
candesartan cilexetil | [no description available] | medium | 1 | 0 | biphenyls | |
carisoprodol | [no description available] | medium | 1 | 0 | carbamate ester | muscle relaxant |
carmustine | [no description available] | medium | 2 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
carprofen | [no description available] | medium | 1 | 0 | carbazoles; organochlorine compound | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug; photosensitizing agent |
carvedilol | [no description available] | medium | 1 | 0 | carbazoles; secondary alcohol; secondary amino compound | alpha-adrenergic antagonist; antihypertensive agent; beta-adrenergic antagonist; cardiovascular drug; vasodilator agent |
celecoxib | [no description available] | medium | 3 | 0 | organofluorine compound; pyrazoles; sulfonamide; toluenes | cyclooxygenase 2 inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
cetirizine | [no description available] | medium | 1 | 0 | ether; monocarboxylic acid; monochlorobenzenes; piperazines | anti-allergic agent; environmental contaminant; H1-receptor antagonist; xenobiotic |
chloral hydrate | [no description available] | medium | 1 | 0 | aldehyde hydrate; ethanediol; organochlorine compound | general anaesthetic; mouse metabolite; sedative; xenobiotic |
chlorambucil | [no description available] | medium | 2 | 0 | aromatic amine; monocarboxylic acid; nitrogen mustard; organochlorine compound; tertiary amino compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
chlordiazepoxide | [no description available] | medium | 1 | 0 | benzodiazepine | |
chlormezanone | [no description available] | medium | 1 | 0 | 1,3-thiazine; lactam; monochlorobenzenes; sulfone | antipsychotic agent; anxiolytic drug; muscle relaxant |
chloroquine | [no description available] | medium | 6 | 0 | aminoquinoline; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; antirheumatic drug; autophagy inhibitor; dermatologic drug |
chloroxylenol | [no description available] | medium | 1 | 0 | monochlorobenzenes; phenols | antiseptic drug; disinfectant; molluscicide |
chlorpropamide | [no description available] | medium | 3 | 0 | monochlorobenzenes; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
chlorzoxazone | [no description available] | medium | 3 | 0 | 1,3-benzoxazoles; heteroaryl hydroxy compound; organochlorine compound | muscle relaxant; sedative |
cimetidine | [no description available] | medium | 3 | 0 | aliphatic sulfide; guanidines; imidazoles; nitrile | adjuvant; analgesic; anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
cinoxacin | [no description available] | medium | 1 | 0 | cinnolines; oxacycle; oxo carboxylic acid | antibacterial drug; antiinfective agent |
ciprofibrate | [no description available] | medium | 3 | 0 | cyclopropanes; monocarboxylic acid; organochlorine compound | antilipemic drug |
ciprofloxacin | [no description available] | medium | 4 | 0 | aminoquinoline; cyclopropanes; fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone; zwitterion | antibacterial drug; antiinfective agent; antimicrobial agent; DNA synthesis inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; environmental contaminant; topoisomerase IV inhibitor; xenobiotic |
cisapride | [no description available] | medium | 3 | 0 | benzamides | |
citalopram | [no description available] | medium | 3 | 0 | 2-benzofurans; cyclic ether; nitrile; organofluorine compound; tertiary amino compound | |
clioquinol | [no description available] | medium | 2 | 0 | monohydroxyquinoline; organochlorine compound; organoiodine compound | antibacterial agent; antifungal agent; antimicrobial agent; antineoplastic agent; antiprotozoal drug; chelator; copper chelator |
clobazam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; GABA modulator |
clofazimine | [no description available] | medium | 1 | 0 | monochlorobenzenes; phenazines | dye; leprostatic drug; non-steroidal anti-inflammatory drug |
clofibrate | [no description available] | medium | 4 | 0 | aromatic ether; ethyl ester; monochlorobenzenes | anticholesteremic drug; antilipemic drug; geroprotector; PPARalpha agonist |
clomiphene | [no description available] | medium | 2 | 0 | tertiary amine | estrogen antagonist; estrogen receptor modulator |
clotiazepam | [no description available] | medium | 1 | 0 | organic molecular entity | |
clotrimazole | [no description available] | medium | 3 | 0 | conazole antifungal drug; imidazole antifungal drug; imidazoles; monochlorobenzenes | antiinfective agent; environmental contaminant; xenobiotic |
cyclandelate | [no description available] | medium | 1 | 0 | carboxylic ester; secondary alcohol | vasodilator agent |
danthron | [no description available] | medium | 1 | 0 | dihydroxyanthraquinone | apoptosis inducer; plant metabolite |
dapsone | [no description available] | medium | 4 | 0 | substituted aniline; sulfone | anti-inflammatory drug; antiinfective agent; antimalarial; leprostatic drug |
deferoxamine | [no description available] | medium | 7 | 0 | acyclic desferrioxamine | bacterial metabolite; ferroptosis inhibitor; iron chelator; siderophore |
eflornithine | [no description available] | medium | 2 | 0 | alpha-amino acid; fluoroamino acid | trypanocidal drug |
diazoxide | [no description available] | medium | 1 | 0 | benzothiadiazine; organochlorine compound; sulfone | antihypertensive agent; beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; diuretic; K-ATP channel agonist; sodium channel blocker; sympathomimetic agent; vasodilator agent |
diflunisal | [no description available] | medium | 3 | 0 | monohydroxybenzoic acid; organofluorine compound | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
diphenhydramine | [no description available] | medium | 1 | 0 | ether; tertiary amino compound | anti-allergic agent; antidyskinesia agent; antiemetic; antiparkinson drug; antipruritic drug; antitussive; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; oneirogen; sedative |
dipyridamole | [no description available] | medium | 4 | 0 | piperidines; pyrimidopyrimidine; tertiary amino compound; tetrol | adenosine phosphodiesterase inhibitor; EC 3.5.4.4 (adenosine deaminase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
disopyramide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; pyridines; tertiary amino compound | anti-arrhythmia drug |
disulfiram | [no description available] | medium | 2 | 0 | organic disulfide; organosulfur acaricide | angiogenesis inhibitor; antineoplastic agent; apoptosis inducer; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; EC 3.1.1.1 (carboxylesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; ferroptosis inducer; fungicide; NF-kappaB inhibitor |
droperidol | [no description available] | medium | 1 | 0 | aromatic ketone; benzimidazoles; organofluorine compound | anaesthesia adjuvant; antiemetic; dopaminergic antagonist; first generation antipsychotic |
econazole | [no description available] | medium | 2 | 0 | dichlorobenzene; ether; imidazoles; monochlorobenzenes | |
enflurane | [no description available] | medium | 1 | 0 | ether; organochlorine compound; organofluorine compound | anaesthetic |
enoxacin | [no description available] | medium | 1 | 0 | 1,8-naphthyridine derivative; amino acid; fluoroquinolone antibiotic; monocarboxylic acid; N-arylpiperazine; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor |
estazolam | [no description available] | medium | 1 | 0 | triazoles; triazolobenzodiazepine | anticonvulsant; anxiolytic drug; GABA modulator |
ethacrynic acid | [no description available] | medium | 1 | 0 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid | EC 2.5.1.18 (glutathione transferase) inhibitor; ion transport inhibitor; loop diuretic |
ethoxzolamide | [no description available] | medium | 1 | 0 | aromatic ether; benzothiazoles; sulfonamide | antiglaucoma drug; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
etodolac | [no description available] | medium | 1 | 0 | monocarboxylic acid; organic heterotricyclic compound | antipyretic; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
brl 42810 | [no description available] | medium | 1 | 0 | 2-aminopurines; acetate ester | antiviral drug; prodrug |
felbamate | [no description available] | medium | 3 | 0 | carbamate ester | anticonvulsant; neuroprotective agent |
felodipine | [no description available] | medium | 1 | 0 | dichlorobenzene; dihydropyridine; ethyl ester; methyl ester | anti-arrhythmia drug; antihypertensive agent; calcium channel blocker; vasodilator agent |
fenofibrate | [no description available] | medium | 3 | 0 | aromatic ether; chlorobenzophenone; isopropyl ester; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
fentanyl | [no description available] | medium | 1 | 0 | anilide; monocarboxylic acid amide; piperidines | adjuvant; anaesthesia adjuvant; anaesthetic; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic |
flecainide | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid amide; organofluorine compound; piperidines | anti-arrhythmia drug |
fluconazole | [no description available] | medium | 3 | 0 | conazole antifungal drug; difluorobenzene; tertiary alcohol; triazole antifungal drug | environmental contaminant; P450 inhibitor; xenobiotic |
flucytosine | [no description available] | medium | 4 | 0 | aminopyrimidine; nucleoside analogue; organofluorine compound; pyrimidine antifungal drug; pyrimidone | prodrug |
flufenamic acid | [no description available] | medium | 4 | 0 | aromatic amino acid; organofluorine compound | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
flumazenil | [no description available] | medium | 4 | 0 | ethyl ester; imidazobenzodiazepine; organofluorine compound | antidote to benzodiazepine poisoning; GABA antagonist |
flunitrazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; C-nitro compound; monofluorobenzenes | anxiolytic drug; GABAA receptor agonist; sedative |
fluorouracil | [no description available] | medium | 9 | 0 | nucleobase analogue; organofluorine compound | antimetabolite; antineoplastic agent; environmental contaminant; immunosuppressive agent; radiosensitizing agent; xenobiotic |
fluoxetine | [no description available] | medium | 5 | 0 | (trifluoromethyl)benzenes; aromatic ether; secondary amino compound | |
flutamide | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; monocarboxylic acid amide | androgen antagonist; antineoplastic agent |
fomepizole | [no description available] | medium | 1 | 0 | pyrazoles | antidote; EC 1.1.1.1 (alcohol dehydrogenase) inhibitor; protective agent |
furosemide | [no description available] | medium | 3 | 0 | chlorobenzoic acid; furans; sulfonamide | environmental contaminant; loop diuretic; xenobiotic |
gemfibrozil | [no description available] | medium | 3 | 0 | aromatic ether | antilipemic drug |
glafenine | [no description available] | medium | 3 | 0 | aminoquinoline; carboxylic ester; glycol; organochlorine compound; secondary amino compound | inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
gliclazide | [no description available] | medium | 3 | 0 | N-sulfonylurea | hypoglycemic agent; insulin secretagogue; radical scavenger |
glutethimide | [no description available] | medium | 3 | 0 | piperidines | |
glyburide | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-sulfonylurea | anti-arrhythmia drug; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor; hypoglycemic agent |
gossypol | [no description available] | medium | 1 | 0 | | |
guaiazulene | [no description available] | medium | 1 | 0 | sesquiterpene | |
fasudil | [no description available] | medium | 2 | 0 | isoquinolines; N-sulfonyldiazepane | antihypertensive agent; calcium channel blocker; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; geroprotector; neuroprotective agent; nootropic agent; vasodilator agent |
halothane | [no description available] | medium | 7 | 0 | haloalkane; organobromine compound; organochlorine compound; organofluorine compound | inhalation anaesthetic |
hexachlorophene | [no description available] | medium | 3 | 0 | bridged diphenyl fungicide; polyphenol; trichlorobenzene | acaricide; antibacterial agent; antifungal agrochemical; antiseptic drug |
miltefosine | [no description available] | medium | 1 | 0 | phosphocholines; phospholipid | anti-inflammatory agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antiprotozoal drug; apoptosis inducer; immunomodulator; protein kinase inhibitor |
hexestrol | [no description available] | medium | 1 | 0 | stilbenoid | |
hexetidine | [no description available] | medium | 1 | 0 | organic heteromonocyclic compound; organonitrogen heterocyclic compound | |
hexobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
hydralazine | [no description available] | medium | 4 | 0 | azaarene; hydrazines; ortho-fused heteroarene; phthalazines | antihypertensive agent; vasodilator agent |
hydrochlorothiazide | [no description available] | medium | 3 | 0 | benzothiadiazine; organochlorine compound; sulfonamide | antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
hydroxyurea | [no description available] | medium | 6 | 0 | one-carbon compound; ureas | antimetabolite; antimitotic; antineoplastic agent; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; genotoxin; immunomodulator; radical scavenger; teratogenic agent |
hydroxyzine | [no description available] | medium | 1 | 0 | hydroxyether; monochlorobenzenes; N-alkylpiperazine | anticoronaviral agent; antipruritic drug; anxiolytic drug; dermatologic drug; H1-receptor antagonist |
phenelzine | [no description available] | medium | 3 | 0 | primary amine | |
lidocaine | [no description available] | medium | 13 | 0 | benzenes; monocarboxylic acid amide; tertiary amino compound | anti-arrhythmia drug; drug allergen; environmental contaminant; local anaesthetic; xenobiotic |
alverine | [no description available] | medium | 1 | 0 | tertiary amine | antispasmodic drug |
idebenone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; primary alcohol | antioxidant; ferroptosis inhibitor |
ifosfamide | [no description available] | medium | 3 | 0 | ifosfamides | alkylating agent; antineoplastic agent; environmental contaminant; immunosuppressive agent; xenobiotic |
imipramine | [no description available] | medium | 1 | 0 | dibenzoazepine | adrenergic uptake inhibitor; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
amrinone | [no description available] | medium | 3 | 0 | bipyridines | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
indapamide | [no description available] | medium | 1 | 0 | indoles; organochlorine compound; sulfonamide | antihypertensive agent; diuretic |
indomethacin | [no description available] | medium | 6 | 0 | aromatic ether; indole-3-acetic acids; monochlorobenzenes; N-acylindole | analgesic; drug metabolite; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; gout suppressant; non-steroidal anti-inflammatory drug; xenobiotic metabolite; xenobiotic |
iohexol | [no description available] | medium | 1 | 0 | benzenedicarboxamide; organoiodine compound | environmental contaminant; radioopaque medium; xenobiotic |
iodipamide | [no description available] | medium | 1 | 0 | benzoic acids; organoiodine compound; secondary carboxamide | radioopaque medium |
iproniazid | [no description available] | medium | 3 | 0 | carbohydrazide; pyridines | |
avapro | [no description available] | medium | 3 | 0 | azaspiro compound; biphenylyltetrazole | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
isoflurane | [no description available] | medium | 2 | 0 | organofluorine compound | inhalation anaesthetic |
isoniazid | [no description available] | medium | 8 | 0 | carbohydrazide | antitubercular agent; drug allergen |
2-propanol | [no description available] | medium | 1 | 0 | secondary alcohol; secondary fatty alcohol | protic solvent |
isoproterenol | [no description available] | medium | 5 | 0 | catechols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; sympathomimetic agent |
isoxsuprine | [no description available] | medium | 1 | 0 | alkylbenzene | |
isradipine | [no description available] | medium | 1 | 0 | benzoxadiazole; dihydropyridine; isopropyl ester; methyl ester | |
itraconazole | [no description available] | medium | 1 | 0 | piperazines | |
ketamine | [no description available] | medium | 3 | 0 | cyclohexanones; monochlorobenzenes; secondary amino compound | analgesic; environmental contaminant; intravenous anaesthetic; neurotoxin; NMDA receptor antagonist; xenobiotic |
ketoconazole | [no description available] | medium | 4 | 0 | dichlorobenzene; dioxolane; ether; imidazoles; N-acylpiperazine; N-arylpiperazine | |
ketoprofen | [no description available] | medium | 4 | 0 | benzophenones; oxo monocarboxylic acid | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
khellin | [no description available] | medium | 1 | 0 | furanochromone; organic heterotricyclic compound; oxacycle | anti-asthmatic agent; bronchodilator agent; cardiovascular drug; vasodilator agent |
labetalol | [no description available] | medium | 3 | 0 | benzamides; benzenes; phenols; primary carboxamide; salicylamides; secondary alcohol; secondary amino compound | |
lamotrigine | [no description available] | medium | 1 | 0 | 1,2,4-triazines; dichlorobenzene; primary arylamine | anticonvulsant; antidepressant; antimanic drug; calcium channel blocker; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; excitatory amino acid antagonist; geroprotector; non-narcotic analgesic; xenobiotic |
lansoprazole | [no description available] | medium | 1 | 0 | benzimidazoles; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor |
beta-lapachone | [no description available] | medium | 1 | 0 | benzochromenone; orthoquinones | anti-inflammatory agent; antineoplastic agent; plant metabolite |
leflunomide | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; isoxazoles; monocarboxylic acid amide | antineoplastic agent; antiparasitic agent; EC 1.3.98.1 [dihydroorotate oxidase (fumarate)] inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; hepatotoxic agent; immunosuppressive agent; non-steroidal anti-inflammatory drug; prodrug; pyrimidine synthesis inhibitor; tyrosine kinase inhibitor |
lofepramine | [no description available] | medium | 1 | 0 | aromatic ketone; dibenzoazepine; monochlorobenzenes; tertiary amino compound | antidepressant |
lomustine | [no description available] | medium | 1 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
loperamide | [no description available] | medium | 2 | 0 | monocarboxylic acid amide; monochlorobenzenes; piperidines; tertiary alcohol | anticoronaviral agent; antidiarrhoeal drug; mu-opioid receptor agonist |
losartan | [no description available] | medium | 6 | 0 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
malathion | [no description available] | medium | 1 | 0 | diester; ethyl ester; organic thiophosphate | |
diisopropyl 1,3-dithiol-2-ylidenemalonate | [no description available] | medium | 1 | 0 | isopropyl ester | |
mazindol | [no description available] | medium | 1 | 0 | organic molecular entity | |
mebendazole | [no description available] | medium | 3 | 0 | aromatic ketone; benzimidazoles; carbamate ester | antinematodal drug; microtubule-destabilising agent; tubulin modulator |
meclizine | [no description available] | medium | 1 | 0 | diarylmethane | |
meclofenoxate | [no description available] | medium | 1 | 0 | monocarboxylic acid | |
mefenamic acid | [no description available] | medium | 3 | 0 | aminobenzoic acid; secondary amino compound | analgesic; antipyretic; antirheumatic drug; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
meperidine | [no description available] | medium | 1 | 0 | ethyl ester; piperidinecarboxylate ester; tertiary amino compound | antispasmodic drug; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
mephenytoin | [no description available] | medium | 1 | 0 | imidazolidine-2,4-dione | anticonvulsant |
mepivacaine | [no description available] | medium | 1 | 0 | piperidinecarboxamide | drug allergen; local anaesthetic |
meprobamate | [no description available] | medium | 3 | 0 | organic molecular entity | |
mesalamine | [no description available] | medium | 1 | 0 | amino acid; aromatic amine; monocarboxylic acid; monohydroxybenzoic acid; phenols | non-steroidal anti-inflammatory drug |
metformin | [no description available] | medium | 5 | 0 | guanidines | environmental contaminant; geroprotector; hypoglycemic agent; xenobiotic |
methoxsalen | [no description available] | medium | 3 | 0 | aromatic ether; psoralens | antineoplastic agent; cross-linking reagent; dermatologic drug; photosensitizing agent; plant metabolite |
methoxyflurane | [no description available] | medium | 1 | 0 | ether; organochlorine compound; organofluorine compound | hepatotoxic agent; inhalation anaesthetic; nephrotoxic agent; non-narcotic analgesic |
methyl salicylate | [no description available] | medium | 1 | 0 | benzoate ester; methyl ester; salicylates | flavouring agent; insect attractant; metabolite |
methylphenidate | [no description available] | medium | 3 | 0 | beta-amino acid ester; methyl ester; piperidines | |
methyprylon | [no description available] | medium | 1 | 0 | organic molecular entity | |
metoclopramide | [no description available] | medium | 1 | 0 | benzamides; monochlorobenzenes; substituted aniline; tertiary amino compound | antiemetic; dopaminergic antagonist; environmental contaminant; gastrointestinal drug; xenobiotic |
metoprolol | [no description available] | medium | 1 | 0 | aromatic ether; propanolamine; secondary alcohol; secondary amino compound | antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; geroprotector; xenobiotic |
metronidazole | [no description available] | medium | 6 | 0 | C-nitro compound; imidazoles; primary alcohol | antiamoebic agent; antibacterial drug; antimicrobial agent; antiparasitic agent; antitrichomonal drug; environmental contaminant; prodrug; radiosensitizing agent; xenobiotic |
metyrapone | [no description available] | medium | 2 | 0 | aromatic ketone | antimetabolite; diagnostic agent; EC 1.14.15.4 (steroid 11beta-monooxygenase) inhibitor |
miconazole | [no description available] | medium | 3 | 0 | dichlorobenzene; ether; imidazoles | |
midazolam | [no description available] | medium | 1 | 0 | imidazobenzodiazepine; monofluorobenzenes; organochlorine compound | anticonvulsant; antineoplastic agent; anxiolytic drug; apoptosis inducer; central nervous system depressant; GABAA receptor agonist; general anaesthetic; muscle relaxant; sedative |
minoxidil | [no description available] | medium | 4 | 0 | dialkylarylamine; tertiary amino compound | |
mirtazapine | [no description available] | medium | 1 | 0 | benzazepine; tetracyclic antidepressant | alpha-adrenergic antagonist; anxiolytic drug; H1-receptor antagonist; histamine antagonist; oneirogen; serotonergic antagonist |
mitotane | [no description available] | medium | 1 | 0 | diarylmethane | |
mitoxantrone | [no description available] | medium | 2 | 0 | dihydroxyanthraquinone | analgesic; antineoplastic agent |
modafinil | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; sulfoxide | |
moxisylyte | [no description available] | medium | 1 | 0 | monoterpenoid | |
deet | [no description available] | medium | 1 | 0 | benzamides; monocarboxylic acid amide | environmental contaminant; insect repellent; xenobiotic |
nabumetone | [no description available] | medium | 1 | 0 | methoxynaphthalene; methyl ketone | cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
nalidixic acid | [no description available] | medium | 4 | 0 | 1,8-naphthyridine derivative; monocarboxylic acid; quinolone antibiotic | antibacterial drug; antimicrobial agent; DNA synthesis inhibitor |
nefazodone | [no description available] | medium | 3 | 0 | aromatic ether; monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; triazoles | alpha-adrenergic antagonist; analgesic; antidepressant; serotonergic antagonist; serotonin uptake inhibitor |
nevirapine | [no description available] | medium | 2 | 0 | cyclopropanes; dipyridodiazepine | antiviral drug; HIV-1 reverse transcriptase inhibitor |
nialamide | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
niceritrol | [no description available] | medium | 1 | 0 | organic molecular entity | |
nifedipine | [no description available] | medium | 3 | 0 | C-nitro compound; dihydropyridine; methyl ester | calcium channel blocker; human metabolite; tocolytic agent; vasodilator agent |
niflumic acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; pyridines | |
nilutamide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; imidazolidinone | androgen antagonist; antineoplastic agent |
nimesulide | [no description available] | medium | 3 | 0 | aromatic ether; C-nitro compound; sulfonamide | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
nimodipine | [no description available] | medium | 4 | 0 | 2-methoxyethyl ester; C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; isopropyl ester | antihypertensive agent; calcium channel blocker; cardiovascular drug; vasodilator agent |
nisoldipine | [no description available] | medium | 3 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; methyl ester | |
nitrazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; C-nitro compound | anticonvulsant; antispasmodic drug; drug metabolite; GABA modulator; sedative |
nitrendipine | [no description available] | medium | 1 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; ethyl ester; methyl ester | antihypertensive agent; calcium channel blocker; geroprotector; vasodilator agent |
nitroglycerin | [no description available] | medium | 1 | 0 | nitroglycerol | explosive; muscle relaxant; nitric oxide donor; prodrug; tocolytic agent; vasodilator agent; xenobiotic |
nizatidine | [no description available] | medium | 1 | 0 | 1,3-thiazoles; C-nitro compound; carboxamidine; organic sulfide; tertiary amino compound | anti-ulcer drug; cholinergic drug; H2-receptor antagonist |
masoprocol | [no description available] | medium | 1 | 0 | catechols; lignan; tetrol | antioxidant; ferroptosis inhibitor; geroprotector; plant metabolite |
norfloxacin | [no description available] | medium | 1 | 0 | fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antibacterial drug; DNA synthesis inhibitor; environmental contaminant; xenobiotic |
nortriptyline | [no description available] | medium | 1 | 0 | organic tricyclic compound; secondary amine | adrenergic uptake inhibitor; analgesic; antidepressant; antineoplastic agent; apoptosis inducer; drug metabolite |
omeprazole | [no description available] | medium | 1 | 0 | aromatic ether; benzimidazoles; pyridines; sulfoxide | |
ondansetron | [no description available] | medium | 1 | 0 | carbazoles | |
orphenadrine | [no description available] | medium | 1 | 0 | ether; tertiary amino compound | antidyskinesia agent; antiparkinson drug; H1-receptor antagonist; muscarinic antagonist; muscle relaxant; NMDA receptor antagonist; parasympatholytic |
oxamniquine | [no description available] | medium | 1 | 0 | aromatic primary alcohol; C-nitro compound; quinolines; secondary amino compound | |
oxaprozin | [no description available] | medium | 3 | 0 | 1,3-oxazoles; monocarboxylic acid | analgesic; non-steroidal anti-inflammatory drug |
oxazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; organochlorine compound | anxiolytic drug; environmental contaminant; xenobiotic |
oxethazaine | [no description available] | medium | 1 | 0 | amino acid amide | |
oxprenolol | [no description available] | medium | 1 | 0 | aromatic ether | |
oxybenzone | [no description available] | medium | 1 | 0 | hydroxybenzophenone; monomethoxybenzene | dermatologic drug; environmental contaminant; protective agent; ultraviolet filter; xenobiotic |
oxyphenbutazone | [no description available] | medium | 1 | 0 | phenols; pyrazolidines | antimicrobial agent; antineoplastic agent; antipyretic; drug metabolite; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic metabolite |
aminosalicylic acid | [no description available] | medium | 6 | 0 | aminobenzoic acid; phenols | antitubercular agent |
pantoprazole | [no description available] | medium | 1 | 0 | aromatic ether; benzimidazoles; organofluorine compound; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; environmental contaminant; xenobiotic |
pemoline | [no description available] | medium | 3 | 0 | 1,3-oxazoles | central nervous system stimulant |
pentobarbital | [no description available] | medium | 4 | 0 | barbiturates | GABAA receptor agonist |
pentoxifylline | [no description available] | medium | 3 | 0 | oxopurine | |
perazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-methylpiperazine; phenothiazines | dopaminergic antagonist; phenothiazine antipsychotic drug |
perphenazine | [no description available] | medium | 2 | 0 | N-(2-hydroxyethyl)piperazine; N-alkylpiperazine; organochlorine compound; phenothiazines | antiemetic; dopaminergic antagonist; phenothiazine antipsychotic drug |
phenacetin | [no description available] | medium | 3 | 0 | acetamides; aromatic ether | cyclooxygenase 3 inhibitor; non-narcotic analgesic; peripheral nervous system drug |
phenobarbital | [no description available] | medium | 6 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
phenolphthalein | [no description available] | medium | 2 | 0 | phenols | |
phenoxybenzamine | [no description available] | medium | 1 | 0 | aromatic amine | |
moxonidine | [no description available] | medium | 1 | 0 | organohalogen compound; pyrimidines | |
pinacidil | [no description available] | medium | 3 | 0 | pyridines | |
pipemidic acid | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; N-arylpiperazine; pyridopyrimidine; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor |
piperazine | [no description available] | medium | 2 | 0 | azacycloalkane; piperazines; saturated organic heteromonocyclic parent | anthelminthic drug |
praziquantel | [no description available] | medium | 3 | 0 | isoquinolines | |
primaquine | [no description available] | medium | 1 | 0 | aminoquinoline; aromatic ether; N-substituted diamine | antimalarial |
primidone | [no description available] | medium | 6 | 0 | pyrimidone | anticonvulsant; environmental contaminant; xenobiotic |
probenecid | [no description available] | medium | 7 | 0 | benzoic acids; sulfonamide | uricosuric drug |
probucol | [no description available] | medium | 3 | 0 | dithioketal; polyphenol | anti-inflammatory drug; anticholesteremic drug; antilipemic drug; antioxidant; cardiovascular drug |
procainamide | [no description available] | medium | 1 | 0 | benzamides | anti-arrhythmia drug; platelet aggregation inhibitor; sodium channel blocker |
procarbazine | [no description available] | medium | 1 | 0 | benzamides; hydrazines | antineoplastic agent |
prochlorperazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-methylpiperazine; organochlorine compound; phenothiazines | alpha-adrenergic antagonist; antiemetic; cholinergic antagonist; dopamine receptor D2 antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; first generation antipsychotic |
promethazine | [no description available] | medium | 2 | 0 | phenothiazines; tertiary amine | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; H1-receptor antagonist; local anaesthetic; sedative |
propofol | [no description available] | medium | 3 | 0 | phenols | anticonvulsant; antiemetic; intravenous anaesthetic; radical scavenger; sedative |
pyridinolcarbamate | [no description available] | medium | 1 | 0 | pyridines | |
ranitidine | [no description available] | medium | 3 | 0 | aralkylamine | |
opc 12759 | [no description available] | medium | 1 | 0 | secondary carboxamide | |
riluzole | [no description available] | medium | 4 | 0 | benzothiazoles | |
risperidone | [no description available] | medium | 3 | 0 | 1,2-benzoxazoles; heteroarylpiperidine; organofluorine compound; pyridopyrimidine | alpha-adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; psychotropic drug; second generation antipsychotic; serotonergic antagonist |
rofecoxib | [no description available] | medium | 1 | 0 | butenolide; sulfone | analgesic; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
salicylamide | [no description available] | medium | 1 | 0 | phenols; salicylamides | antirheumatic drug; non-narcotic analgesic |
sevoflurane | [no description available] | medium | 1 | 0 | ether; organofluorine compound | central nervous system depressant; inhalation anaesthetic; platelet aggregation inhibitor |
sibutramine | [no description available] | medium | 1 | 0 | organochlorine compound; tertiary amino compound | anti-obesity agent; serotonin uptake inhibitor |
sulfadiazine | [no description available] | medium | 2 | 0 | pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; antiprotozoal drug; coccidiostat; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
sotalol | [no description available] | medium | 1 | 0 | ethanolamines; secondary alcohol; secondary amino compound; sulfonamide | anti-arrhythmia drug; beta-adrenergic antagonist; environmental contaminant; xenobiotic |
4-phenylbutyric acid, sodium salt | [no description available] | medium | 1 | 0 | organic sodium salt | EC 3.5.1.98 (histone deacetylase) inhibitor; geroprotector; neuroprotective agent; orphan drug; prodrug |
vorinostat | [no description available] | medium | 1 | 0 | dicarboxylic acid diamide; hydroxamic acid | antineoplastic agent; apoptosis inducer; EC 3.5.1.98 (histone deacetylase) inhibitor |
sulfadimethoxine | [no description available] | medium | 1 | 0 | aromatic ether; pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; drug allergen; environmental contaminant; xenobiotic |
sulfamerazine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen |
sulfameter | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent; leprostatic drug; renal agent |
sulfamethazine | [no description available] | medium | 3 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antibacterial drug; antiinfective agent; antimicrobial agent; carcinogenic agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; ligand; xenobiotic |
sulfamethizole | [no description available] | medium | 3 | 0 | sulfonamide antibiotic; sulfonamide; thiadiazoles | antiinfective agent; antimicrobial agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
sulfamethoxazole | [no description available] | medium | 2 | 0 | isoxazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; antiinfective agent; antimicrobial agent; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; epitope; P450 inhibitor; xenobiotic |
sulfanilamide | [no description available] | medium | 4 | 0 | substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; drug allergen; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
sulfaphenazole | [no description available] | medium | 1 | 0 | primary amino compound; pyrazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial drug; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 1.14.13.67 (quinine 3-monooxygenase) inhibitor; P450 inhibitor |
sulfapyridine | [no description available] | medium | 1 | 0 | pyridines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; dermatologic drug; drug allergen; environmental contaminant; xenobiotic |
sulfasalazine | [no description available] | medium | 3 | 0 | | |
sulfinpyrazone | [no description available] | medium | 3 | 0 | pyrazolidines; sulfoxide | uricosuric drug |
2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol | [no description available] | medium | 1 | 0 | alkylbenzene | |
sulpiride | [no description available] | medium | 1 | 0 | benzamides; N-alkylpyrrolidine; sulfonamide | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
suprofen | [no description available] | medium | 1 | 0 | aromatic ketone; monocarboxylic acid; thiophenes | antirheumatic drug; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
suramin | [no description available] | medium | 2 | 0 | naphthalenesulfonic acid; phenylureas; secondary carboxamide | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
gatifloxacin | [no description available] | medium | 3 | 0 | N-arylpiperazine; organofluorine compound; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antiinfective agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
tegafur | [no description available] | medium | 1 | 0 | organohalogen compound; pyrimidines | |
temazepam | [no description available] | medium | 1 | 0 | benzodiazepine | |
temozolomide | [no description available] | medium | 3 | 0 | imidazotetrazine; monocarboxylic acid amide; triazene derivative | alkylating agent; antineoplastic agent; prodrug |
temozolomide | [no description available] | medium | 3 | 1 | imidazotetrazine; monocarboxylic acid amide; triazene derivative | alkylating agent; antineoplastic agent; prodrug |
terbutaline | [no description available] | medium | 1 | 0 | phenylethanolamines; resorcinols | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; hypoglycemic agent; sympathomimetic agent; tocolytic agent |
terfenadine | [no description available] | medium | 3 | 0 | diarylmethane | |
tetracaine | [no description available] | medium | 2 | 0 | benzoate ester; tertiary amino compound | local anaesthetic |
thalidomide | [no description available] | medium | 3 | 0 | phthalimides; piperidones | |
thiabendazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; benzimidazole fungicide; benzimidazoles | antifungal agrochemical; antinematodal drug |
tiaprofenic acid | [no description available] | medium | 1 | 0 | aromatic ketone; monocarboxylic acid; thiophenes | drug allergen; non-steroidal anti-inflammatory drug |
ticlopidine | [no description available] | medium | 4 | 0 | monochlorobenzenes; thienopyridine | anticoagulant; fibrin modulating drug; hematologic agent; P2Y12 receptor antagonist; platelet aggregation inhibitor |
tiopronin | [no description available] | medium | 2 | 0 | N-acyl-amino acid | |
tizanidine | [no description available] | medium | 1 | 0 | benzothiadiazole; imidazoles | alpha-adrenergic agonist; muscle relaxant |
tolazamide | [no description available] | medium | 3 | 0 | N-sulfonylurea | hypoglycemic agent; potassium channel blocker |
tolbutamide | [no description available] | medium | 3 | 0 | N-sulfonylurea | human metabolite; hypoglycemic agent; insulin secretagogue; potassium channel blocker |
tolperisone | [no description available] | medium | 1 | 0 | aromatic ketone | |
ultram | [no description available] | medium | 1 | 0 | aromatic ether; tertiary alcohol; tertiary amino compound | |
tranexamic acid | [no description available] | medium | 1 | 0 | amino acid | |
trazodone | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; triazolopyridine | adrenergic antagonist; antidepressant; anxiolytic drug; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
triclosan | [no description available] | medium | 1 | 0 | aromatic ether; dichlorobenzene; monochlorobenzenes; phenols | antibacterial agent; antimalarial; drug allergen; EC 1.3.1.9 [enoyl-[acyl-carrier-protein] reductase (NADH)] inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; fungicide; persistent organic pollutant; xenobiotic |
triflupromazine | [no description available] | medium | 1 | 0 | organofluorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; first generation antipsychotic |
trimethadione | [no description available] | medium | 3 | 0 | oxazolidinone | anticonvulsant; geroprotector |
troglitazone | [no description available] | medium | 4 | 0 | chromanes; thiazolidinone | anticoagulant; anticonvulsant; antineoplastic agent; antioxidant; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; hypoglycemic agent; platelet aggregation inhibitor; vasodilator agent |
venlafaxine | [no description available] | medium | 1 | 0 | cyclohexanols; monomethoxybenzene; tertiary alcohol; tertiary amino compound | adrenergic uptake inhibitor; analgesic; antidepressant; dopamine uptake inhibitor; environmental contaminant; serotonin uptake inhibitor; xenobiotic |
vesnarinone | [no description available] | medium | 1 | 0 | organic molecular entity | |
vigabatrin | [no description available] | medium | 1 | 0 | gamma-amino acid | anticonvulsant; EC 2.6.1.19 (4-aminobutyrate--2-oxoglutarate transaminase) inhibitor |
ici 204,219 | [no description available] | medium | 3 | 0 | carbamate ester; indoles; N-sulfonylcarboxamide | anti-asthmatic agent; leukotriene antagonist |
zolpidem | [no description available] | medium | 3 | 0 | imidazopyridine | central nervous system depressant; GABA agonist; sedative |
guanidine hydrochloride | [no description available] | medium | 1 | 0 | one-carbon compound; organic chloride salt | protein denaturant |
hydrocortisone acetate | [no description available] | medium | 1 | 0 | cortisol ester; tertiary alpha-hydroxy ketone | |
cortisone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
mitomycin | [no description available] | medium | 3 | 0 | mitomycin | alkylating agent; antineoplastic agent |
prednisolone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
estriol | [no description available] | high | 2 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
reserpine | [no description available] | medium | 1 | 0 | alkaloid ester; methyl ester; yohimban alkaloid | adrenergic uptake inhibitor; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; first generation antipsychotic; plant metabolite; xenobiotic |
cephaloridine | [no description available] | medium | 3 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
sorbitol | [no description available] | high | 8 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
floxuridine | [no description available] | medium | 4 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; radiosensitizing agent |
piperonyl butoxide | [no description available] | medium | 1 | 0 | benzodioxoles | pesticide synergist |
bromouracil | [no description available] | medium | 2 | 0 | nucleobase analogue; pyrimidines | mutagen |
histamine dihydrochloride | [no description available] | medium | 1 | 0 | | |
dextroamphetamine | [no description available] | medium | 2 | 0 | 1-phenylpropan-2-amine | adrenergic agent; adrenergic uptake inhibitor; dopamine uptake inhibitor; dopaminergic agent; neurotoxin; sympathomimetic agent |
norethindrone acetate | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; acetate ester; terminal acetylenic compound | progestin; synthetic oral contraceptive |
spironolactone | [no description available] | medium | 4 | 0 | 3-oxo-Delta(4) steroid; oxaspiro compound; steroid lactone; thioester | aldosterone antagonist; antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
cyclobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
allobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
penicillamine | [no description available] | medium | 6 | 0 | non-proteinogenic alpha-amino acid; penicillamine | antirheumatic drug; chelator; copper chelator; drug allergen |
trichlorfon | [no description available] | medium | 1 | 0 | organic phosphonate; organochlorine compound; phosphonic ester | agrochemical; anthelminthic drug; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; insecticide |
prednisone | [no description available] | medium | 3 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; immunosuppressive agent; prodrug |
estrone | [no description available] | high | 7 | 0 | 17-oxo steroid; 3-hydroxy steroid; phenolic steroid; phenols | antineoplastic agent; bone density conservation agent; estrogen; human metabolite; mouse metabolite |
oxandrolone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo steroid; anabolic androgenic steroid; oxa-steroid | anabolic agent; androgen |
dehydroepiandrosterone | [no description available] | high | 3 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
nad | [no description available] | medium | 1 | 0 | NAD | geroprotector |
penicillin g | [no description available] | medium | 8 | 0 | penicillin allergen; penicillin | antibacterial drug; drug allergen; epitope |
triiodothyronine | [no description available] | high | 20 | 0 | 2-halophenol; amino acid zwitterion; iodophenol; iodothyronine | human metabolite; mouse metabolite; thyroid hormone |
chloramphenicol | [no description available] | high | 17 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
glutamine | [no description available] | high | 20 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
cetrimonium bromide | [no description available] | medium | 1 | 0 | organic bromide salt; quaternary ammonium salt | detergent; surfactant |
vincristine | [no description available] | medium | 1 | 0 | acetate ester; formamides; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; tertiary alcohol; tertiary amino compound; vinca alkaloid | antineoplastic agent; drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
physostigmine | [no description available] | medium | 4 | 0 | carbamate ester; indole alkaloid | antidote to curare poisoning; EC 3.1.1.8 (cholinesterase) inhibitor; miotic |
sucrose | [no description available] | high | 34 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
ethinyl estradiol | [no description available] | medium | 4 | 0 | 17-hydroxy steroid; 3-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
testosterone propionate | [no description available] | medium | 1 | 0 | steroid ester | |
aminopyrine | [no description available] | medium | 1 | 0 | pyrazolone; tertiary amino compound | antipyretic; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
methyltestosterone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; enone | anabolic agent; androgen; antineoplastic agent |
tetrabenazine | [no description available] | medium | 2 | 0 | benzoquinolizine; cyclic ketone; tertiary amino compound | |
cephalothin | [no description available] | medium | 1 | 0 | azabicycloalkene; beta-lactam antibiotic allergen; carboxylic acid; cephalosporin; semisynthetic derivative; thiophenes | antibacterial drug; antimicrobial agent |
uridine | [no description available] | high | 8 | 0 | uridines | drug metabolite; fundamental metabolite; human metabolite |
kanamycin a | [no description available] | medium | 3 | 0 | kanamycins | bacterial metabolite |
phenylephrine | [no description available] | medium | 1 | 0 | phenols; phenylethanolamines; secondary amino compound | alpha-adrenergic agonist; cardiotonic drug; mydriatic agent; nasal decongestant; protective agent; sympathomimetic agent; vasoconstrictor agent |
levodopa | [no description available] | high | 4 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
niridazole | [no description available] | medium | 2 | 0 | 1,3-thiazoles; C-nitro compound | |
lactose | [no description available] | medium | 24 | 0 | lactose | |
lactose | [no description available] | medium | 24 | 1 | lactose | |
methionine | [no description available] | high | 71 | 3 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
methionine | [no description available] | high | 71 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
Mebutamate | [no description available] | medium | 1 | 0 | organic molecular entity | |
colchicine | [no description available] | medium | 13 | 0 | alkaloid; colchicine | anti-inflammatory agent; gout suppressant; mutagen |
norethindrone | [no description available] | medium | 3 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound; tertiary alcohol | progestin; synthetic oral contraceptive |
norethynodrel | [no description available] | medium | 1 | 0 | oxo steroid | |
benziodarone | [no description available] | medium | 1 | 0 | aromatic ketone | |
ampicillin | [no description available] | medium | 5 | 0 | beta-lactam antibiotic; penicillin allergen; penicillin | antibacterial drug |
mannitol | [no description available] | high | 8 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
cytarabine | [no description available] | medium | 3 | 0 | beta-D-arabinoside; monosaccharide derivative; pyrimidine nucleoside | antimetabolite; antineoplastic agent; antiviral agent; immunosuppressive agent |
mestranol | [no description available] | medium | 3 | 0 | 17beta-hydroxy steroid; aromatic ether; terminal acetylenic compound | prodrug; xenoestrogen |
methaqualone | [no description available] | medium | 1 | 0 | quinazolines | GABA agonist; sedative |
trypan blue | [no description available] | medium | 1 | 0 | | |
tryptophan | [no description available] | high | 55 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
trichloroacetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
triamcinolone acetonide | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; cyclic ketal; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
allylpropymal | [no description available] | medium | 1 | 0 | barbiturates | |
butobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
dehydrocholic acid | [no description available] | medium | 1 | 0 | 12-oxo steroid; 3-oxo-5beta-steroid; 7-oxo steroid; oxo-5beta-cholanic acid | gastrointestinal drug |
methylprednisolone | [no description available] | medium | 2 | 0 | 6-methylprednisolone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antiemetic; environmental contaminant; neuroprotective agent; xenobiotic |
isosorbide dinitrate | [no description available] | medium | 3 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
synephrine | [no description available] | medium | 1 | 0 | ethanolamines; phenethylamine alkaloid; phenols | alpha-adrenergic agonist; plant metabolite |
benzoyl peroxide | [no description available] | medium | 1 | 0 | carbonyl compound | |
furan | [no description available] | medium | 4 | 0 | furans; mancude organic heteromonocyclic parent; monocyclic heteroarene | carcinogenic agent; hepatotoxic agent; Maillard reaction product |
ergotamine | [no description available] | medium | 1 | 0 | peptide ergot alkaloid | alpha-adrenergic agonist; mycotoxin; non-narcotic analgesic; oxytocic; serotonergic agonist; vasoconstrictor agent |
neostigmine bromide | [no description available] | medium | 1 | 0 | bromide salt | |
phenformin | [no description available] | medium | 1 | 0 | biguanides | antineoplastic agent; geroprotector; hypoglycemic agent |
trinitrotoluene | [no description available] | medium | 1 | 0 | trinitrotoluene | explosive |
pyrazolanthrone | [no description available] | medium | 1 | 0 | anthrapyrazole; aromatic ketone; cyclic ketone | antineoplastic agent; c-Jun N-terminal kinase inhibitor; geroprotector |
meglumine | [no description available] | medium | 1 | 0 | hexosamine; secondary amino compound | |
cinchophen | [no description available] | medium | 3 | 0 | quinolines | |
mequinol | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | metabolite |
quinestrol | [no description available] | medium | 1 | 0 | 17-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
dydrogesterone | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid | progestin |
ephedrine | [no description available] | medium | 1 | 0 | phenethylamine alkaloid; phenylethanolamines | bacterial metabolite; environmental contaminant; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
chlormadinone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
2,3-dimercaptosuccinic acid | [no description available] | medium | 1 | 0 | | |
evans blue | [no description available] | medium | 3 | 0 | organic sodium salt | fluorochrome; histological dye; sodium channel blocker; teratogenic agent |
testosterone enanthate | [no description available] | medium | 1 | 0 | heptanoate ester; sterol ester | androgen |
aminophylline | [no description available] | medium | 1 | 0 | mixture | bronchodilator agent; cardiotonic drug |
azacitidine | [no description available] | medium | 5 | 0 | N-glycosyl-1,3,5-triazine; nucleoside analogue | antineoplastic agent |
phenyramidol | [no description available] | medium | 1 | 0 | aminopyridine | |
carbutamide | [no description available] | medium | 1 | 0 | benzenes; sulfonamide | |
nandrolone decanoate | [no description available] | medium | 1 | 0 | steroid ester | |
bucladesine | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; butanamides; butyrate ester | agonist; cardiotonic drug; vasodilator agent |
betamethasone | [no description available] | medium | 3 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic agent; anti-inflammatory drug; immunosuppressive agent |
perflubron | [no description available] | medium | 1 | 0 | haloalkane; organobromine compound; perfluorinated compound | blood substitute; radioopaque medium |
cyproterone acetate | [no description available] | medium | 3 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; chlorinated steroid; steroid ester | androgen antagonist; geroprotector; progestin |
dextropropoxyphene | [no description available] | medium | 1 | 0 | 1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propanoate | mu-opioid receptor agonist; opioid analgesic |
glycyrrhetinic acid | [no description available] | medium | 1 | 0 | cyclic terpene ketone; hydroxy monocarboxylic acid; pentacyclic triterpenoid | immunomodulator; plant metabolite |
chenodeoxycholic acid | [no description available] | medium | 3 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
dihydralazine | [no description available] | medium | 1 | 0 | phthalazines | |
phenylpropanolamine | [no description available] | medium | 1 | 0 | amphetamines; phenethylamine alkaloid | plant metabolite |
dihydroergotamine | [no description available] | medium | 1 | 0 | ergot alkaloid; semisynthetic derivative | dopamine agonist; non-narcotic analgesic; serotonergic agonist; sympatholytic agent; vasoconstrictor agent |
podophyllotoxin | [no description available] | medium | 2 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antimitotic; antineoplastic agent; keratolytic drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
hesperidin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-methoxyflavanones; dihydroxyflavanone; disaccharide derivative; flavanone glycoside; monomethoxyflavanone; rutinoside | mutagen |
chlormethiazole | [no description available] | medium | 1 | 0 | thiazoles | |
methamphetamine | [no description available] | medium | 2 | 0 | amphetamines; secondary amine | central nervous system stimulant; environmental contaminant; neurotoxin; psychotropic drug; xenobiotic |
gentian violet | [no description available] | medium | 3 | 0 | organic chloride salt | anthelminthic drug; antibacterial agent; antifungal agent; antiseptic drug; histological dye |
hematoporphyrin | [no description available] | medium | 1 | 0 | | |
lactulose | [no description available] | medium | 1 | 0 | glycosylfructose | gastrointestinal drug; laxative |
megestrol acetate | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; steroid ester | antineoplastic agent; appetite enhancer; contraceptive drug; progestin; synthetic oral contraceptive |
acetylcysteine | [no description available] | high | 8 | 0 | acetylcysteine; L-cysteine derivative; N-acetyl-L-amino acid | antidote to paracetamol poisoning; antiinfective agent; antioxidant; antiviral drug; ferroptosis inhibitor; geroprotector; human metabolite; mucolytic; radical scavenger; vulnerary |
erythromycin stearate | [no description available] | medium | 1 | 0 | aminoglycoside | |
erythromycin | [no description available] | medium | 5 | 0 | cyclic ketone; erythromycin | |
vinblastine | [no description available] | medium | 1 | 0 | | |
estradiol valerate | [no description available] | medium | 1 | 0 | steroid ester | |
vancomycin | [no description available] | medium | 5 | 0 | glycopeptide | antibacterial drug; antimicrobial agent; bacterial metabolite |
dronabinol | [no description available] | medium | 2 | 0 | benzochromene; diterpenoid; phytocannabinoid; polyketide | cannabinoid receptor agonist; epitope; hallucinogen; metabolite; non-narcotic analgesic |
amiloride | [no description available] | medium | 5 | 0 | aromatic amine; guanidines; organochlorine compound; pyrazines | diuretic; sodium channel blocker |
sulfadoxine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide | antibacterial drug; antimalarial |
acadesine | [no description available] | medium | 1 | 0 | 1-ribosylimidazolecarboxamide; aminoimidazole; nucleoside analogue | antineoplastic agent; platelet aggregation inhibitor |
stavudine | [no description available] | medium | 3 | 0 | dihydrofuran; nucleoside analogue; organic molecular entity | antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
doxifluridine | [no description available] | medium | 1 | 0 | organofluorine compound; pyrimidine 5'-deoxyribonucleoside | antimetabolite; antineoplastic agent; prodrug |
iproclozide | [no description available] | medium | 1 | 0 | aromatic ether | |
streptomycin | [no description available] | medium | 9 | 0 | antibiotic antifungal drug; antibiotic fungicide; streptomycins | antibacterial drug; antifungal agrochemical; antimicrobial agent; antimicrobial drug; bacterial metabolite; protein synthesis inhibitor |
cladribine | [no description available] | medium | 4 | 0 | organochlorine compound; purine 2'-deoxyribonucleoside | antineoplastic agent; immunosuppressive agent |
carbenicillin disodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
dehydroemetine | [no description available] | medium | 1 | 0 | aromatic ether; isoquinolines; pyridoisoquinoline | antileishmanial agent; antimalarial; antiprotozoal drug |
benorilate | [no description available] | medium | 1 | 0 | carbonyl compound | |
trimetazidine | [no description available] | medium | 1 | 0 | aromatic amine | |
floxacillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
vidarabine | [no description available] | medium | 3 | 0 | beta-D-arabinoside; purine nucleoside | antineoplastic agent; bacterial metabolite; nucleoside antibiotic |
tiadenol | [no description available] | medium | 1 | 0 | aliphatic sulfide | |
zalcitabine | [no description available] | medium | 3 | 0 | pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
camptothecin | [no description available] | medium | 18 | 0 | delta-lactone; pyranoindolizinoquinoline; quinoline alkaloid; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; genotoxin; plant metabolite |
stanozolol | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; anabolic androgenic steroid; organic heteropentacyclic compound; tertiary alcohol | anabolic agent; androgen |
clodronic acid | [no description available] | medium | 2 | 0 | 1,1-bis(phosphonic acid); one-carbon compound; organochlorine compound | antineoplastic agent; bone density conservation agent |
xipamide | [no description available] | medium | 1 | 0 | benzamides | |
selegiline | [no description available] | medium | 1 | 0 | selegiline; terminal acetylenic compound | geroprotector |
levamisole | [no description available] | medium | 1 | 0 | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | antinematodal drug; antirheumatic drug; EC 3.1.3.1 (alkaline phosphatase) inhibitor; immunological adjuvant; immunomodulator |
thiamphenicol | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; sulfone | antimicrobial agent; immunosuppressive agent |
isosorbide-5-mononitrate | [no description available] | medium | 1 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
danazol | [no description available] | medium | 3 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | anti-estrogen; estrogen antagonist; geroprotector |
daunorubicin | [no description available] | medium | 2 | 0 | aminoglycoside antibiotic; anthracycline; p-quinones; tetracenequinones | antineoplastic agent; bacterial metabolite |
carbimazole | [no description available] | medium | 1 | 0 | 1,3-dihydroimidazole-2-thiones; carbamate ester | antithyroid drug; prodrug |
bromocriptine | [no description available] | medium | 2 | 0 | indole alkaloid | antidyskinesia agent; antiparkinson drug; dopamine agonist; hormone antagonist |
triamcinolone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 16alpha-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
oxyphenisatin | [no description available] | medium | 1 | 0 | indoles | |
ursodeoxycholic acid | [no description available] | medium | 3 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
butachlor | [no description available] | medium | 1 | 0 | aromatic amide; organochlorine compound; tertiary carboxamide | environmental contaminant; herbicide; xenobiotic |
rose bengal b disodium salt | [no description available] | medium | 1 | 0 | | |
glutamic acid | [no description available] | high | 89 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
cefazolin | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; cephalosporin; tetrazoles; thiadiazoles | antibacterial drug |
amoxicillin | [no description available] | medium | 3 | 0 | penicillin allergen; penicillin | antibacterial drug |
nicergoline | [no description available] | medium | 1 | 0 | organic heterotetracyclic compound; organonitrogen heterocyclic compound | |
oxcarbazepine | [no description available] | medium | 1 | 0 | cyclic ketone; dibenzoazepine | anticonvulsant; drug allergen |
amineptin | [no description available] | medium | 1 | 0 | amino acid; carbocyclic fatty acid; carbotricyclic compound; secondary amino compound | antidepressant; dopamine uptake inhibitor |
pirprofen | [no description available] | medium | 3 | 0 | pyrroline | |
paclitaxel | [no description available] | high | 25 | 0 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
etoposide | [no description available] | medium | 7 | 0 | beta-D-glucoside; furonaphthodioxole; organic heterotetracyclic compound | antineoplastic agent; DNA synthesis inhibitor |
dobutamine | [no description available] | medium | 1 | 0 | catecholamine; secondary amine | beta-adrenergic agonist; cardiotonic drug; sympathomimetic agent |
ribavirin | [no description available] | medium | 4 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide | anticoronaviral agent; antiinfective agent; antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
amikacin | [no description available] | medium | 3 | 0 | alpha-D-glucoside; amino cyclitol glycoside; aminoglycoside; carboxamide | antibacterial drug; antimicrobial agent; nephrotoxin |
ticrynafen | [no description available] | medium | 3 | 0 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid; thiophenes | antihypertensive agent; hepatotoxic agent; loop diuretic |
methyldopa | [no description available] | medium | 3 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | alpha-adrenergic agonist; antihypertensive agent; hapten; peripheral nervous system drug; sympatholytic agent |
bezafibrate | [no description available] | medium | 4 | 0 | aromatic ether; monocarboxylic acid amide; monocarboxylic acid; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
sq-11725 | [no description available] | medium | 3 | 0 | | |
diltiazem | [no description available] | medium | 1 | 0 | 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate | antihypertensive agent; calcium channel blocker; vasodilator agent |
benoxaprofen | [no description available] | medium | 3 | 0 | 1,3-benzoxazoles; monocarboxylic acid; monochlorobenzenes | antipsoriatic; antipyretic; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; hepatotoxic agent; nephrotoxin; non-narcotic analgesic; non-steroidal anti-inflammatory drug; protein kinase C agonist |
permethrin | [no description available] | medium | 4 | 0 | cyclopropanecarboxylate ester; cyclopropanes | agrochemical; ectoparasiticide; pyrethroid ester acaricide; pyrethroid ester insecticide; scabicide |
pirfenidone | [no description available] | medium | 1 | 0 | pyridone | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
desogestrel | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | contraceptive drug; progestin; synthetic oral contraceptive |
muzolimine | [no description available] | medium | 1 | 0 | dichlorobenzene | |
epirubicin | [no description available] | medium | 4 | 0 | aminoglycoside; anthracycline antibiotic; anthracycline; deoxy hexoside; monosaccharide derivative; p-quinones; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | antimicrobial agent; antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
desflurane | [no description available] | medium | 1 | 0 | organofluorine compound | inhalation anaesthetic |
piperacillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
paroxetine | [no description available] | medium | 3 | 0 | aromatic ether; benzodioxoles; organofluorine compound; piperidines | antidepressant; anxiolytic drug; hepatotoxic agent; P450 inhibitor; serotonin uptake inhibitor |
captopril | [no description available] | medium | 5 | 0 | alkanethiol; L-proline derivative; N-acylpyrrolidine; pyrrolidinemonocarboxylic acid | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
cefoperazone | [no description available] | medium | 1 | 0 | cephalosporin | antibacterial drug |
foscarnet sodium | [no description available] | medium | 1 | 0 | one-carbon compound; organic sodium salt | antiviral drug |
moxalactam | [no description available] | medium | 1 | 0 | cephalosporin; oxacephem | antibacterial drug |
nicorandil | [no description available] | medium | 1 | 0 | nitrate ester; pyridinecarboxamide | potassium channel opener; vasodilator agent |
cefadroxil anhydrous | [no description available] | medium | 3 | 0 | cephalosporin | antibacterial drug |
encainide | [no description available] | medium | 1 | 0 | benzamides; piperidines | anti-arrhythmia drug; sodium channel blocker |
cefaclor anhydrous | [no description available] | medium | 1 | 0 | cephalosporin | antibacterial drug; drug allergen |
miglustat | [no description available] | medium | 1 | 0 | piperidines; tertiary amino compound | anti-HIV agent; EC 2.4.1.80 (ceramide glucosyltransferase) inhibitor |
cefotetan | [no description available] | medium | 3 | 0 | | |
lovastatin | [no description available] | medium | 2 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | anticholesteremic drug; antineoplastic agent; Aspergillus metabolite; prodrug |
enoximone | [no description available] | medium | 1 | 0 | aromatic ketone | |
piritrexim | [no description available] | medium | 1 | 0 | | |
simvastatin | [no description available] | medium | 3 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; statin (semi-synthetic) | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; ferroptosis inducer; geroprotector; prodrug |
pravastatin | [no description available] | medium | 2 | 0 | 3-hydroxy carboxylic acid; carbobicyclic compound; carboxylic ester; hydroxy monocarboxylic acid; secondary alcohol; statin (semi-synthetic) | anticholesteremic drug; environmental contaminant; metabolite; xenobiotic |
atomoxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | adrenergic uptake inhibitor; antidepressant |
quinapril | [no description available] | medium | 3 | 0 | dicarboxylic acid monoester; ethyl ester; isoquinolines; tertiary carboxamide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
gepirone | [no description available] | medium | 1 | 0 | N-arylpiperazine | |
mifepristone | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; acetylenic compound; tertiary amino compound | abortifacient; contraceptive drug; hormone antagonist; synthetic oral contraceptive |
sparfloxacin | [no description available] | medium | 1 | 0 | fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | |
zileuton | [no description available] | medium | 3 | 0 | 1-benzothiophenes; ureas | anti-asthmatic drug; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; ferroptosis inhibitor; leukotriene antagonist; non-steroidal anti-inflammatory drug |
clopidogrel | [no description available] | medium | 2 | 0 | methyl ester; monochlorobenzenes; thienopyridine | anticoagulant; P2Y12 receptor antagonist; platelet aggregation inhibitor |
cidofovir anhydrous | [no description available] | medium | 1 | 0 | phosphonic acids; pyrimidone | anti-HIV agent; antineoplastic agent; antiviral drug; photosensitizing agent |
bromfenac | [no description available] | medium | 3 | 0 | aromatic amino acid; benzophenones; organobromine compound; substituted aniline | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
atorvastatin | [no description available] | medium | 3 | 0 | aromatic amide; dihydroxy monocarboxylic acid; monofluorobenzenes; pyrroles; statin (synthetic) | environmental contaminant; xenobiotic |
lamivudine | [no description available] | medium | 3 | 0 | monothioacetal; nucleoside analogue; oxacycle; primary alcohol | allergen; anti-HBV agent; antiviral drug; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor; HIV-1 reverse transcriptase inhibitor; prodrug |
duloxetine | [no description available] | medium | 1 | 0 | duloxetine | |
irinotecan | [no description available] | medium | 4 | 0 | carbamate ester; delta-lactone; N-acylpiperidine; pyranoindolizinoquinoline; ring assembly; tertiary alcohol; tertiary amino compound | antineoplastic agent; apoptosis inducer; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
valsartan | [no description available] | medium | 3 | 0 | biphenylyltetrazole; monocarboxylic acid amide; monocarboxylic acid | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
adefovir dipivoxil | [no description available] | medium | 1 | 0 | 6-aminopurines; carbonate ester; ether; organic phosphonate | antiviral drug; DNA synthesis inhibitor; HIV-1 reverse transcriptase inhibitor; nephrotoxic agent; prodrug |
capecitabine | [no description available] | medium | 1 | 0 | carbamate ester; cytidines; organofluorine compound | antimetabolite; antineoplastic agent; prodrug |
adenosine | [no description available] | high | 31 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
halofuginone | [no description available] | medium | 1 | 0 | quinazolines | |
ortho-cept | [no description available] | medium | 1 | 0 | | |
cefprozil | [no description available] | medium | 1 | 0 | cephalosporin; semisynthetic derivative | antibacterial drug |
4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol | [no description available] | medium | 1 | 0 | stilbenoid | |
efavirenz | [no description available] | medium | 2 | 0 | acetylenic compound; benzoxazine; cyclopropanes; organochlorine compound; organofluorine compound | antiviral drug; HIV-1 reverse transcriptase inhibitor |
nelfinavir | [no description available] | medium | 1 | 0 | aryl sulfide; benzamides; organic heterobicyclic compound; phenols; secondary alcohol; tertiary amino compound | antineoplastic agent; HIV protease inhibitor |
doxapram hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | central nervous system stimulant |
1,5-anhydroglucitol | [no description available] | medium | 1 | 0 | anhydro sugar | human metabolite |
betulinic acid | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-HIV agent; anti-inflammatory agent; antimalarial; antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; plant metabolite |
amprenavir | [no description available] | medium | 1 | 0 | carbamate ester; sulfonamide; tetrahydrofuryl ester | antiviral drug; HIV protease inhibitor |
glutathione disulfide | [no description available] | high | 4 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
bendamustine | [no description available] | medium | 1 | 0 | benzimidazoles | |
erdosteine | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
mizolastine | [no description available] | medium | 1 | 0 | benzimidazoles | |
intoplicine | [no description available] | medium | 1 | 0 | pyridoindole | |
telmisartan | [no description available] | medium | 3 | 0 | benzimidazoles; biphenyls; carboxybiphenyl | angiotensin receptor antagonist; antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; environmental contaminant; xenobiotic |
dexfenfluramine | [no description available] | medium | 1 | 0 | fenfluramine | appetite depressant; serotonergic agonist; serotonin uptake inhibitor |
2-methoxyestradiol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
medetomidine | [no description available] | medium | 1 | 0 | imidazoles | |
sertraline | [no description available] | medium | 3 | 0 | dichlorobenzene; secondary amino compound; tetralins | antidepressant; serotonin uptake inhibitor |
picosulfate sodium | [no description available] | medium | 1 | 0 | aryl sulfate; pyridines | |
dienogest | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; aliphatic nitrile; steroid hormone | progesterone receptor agonist; progestin; synthetic oral contraceptive |
morphazinamide | [no description available] | medium | 1 | 0 | morpholines; pyrazines; secondary carboxamide | |
dexrazoxane | [no description available] | medium | 1 | 0 | razoxane | antineoplastic agent; cardiovascular drug; chelator; immunosuppressive agent |
voriconazole | [no description available] | medium | 1 | 0 | conazole antifungal drug; difluorobenzene; pyrimidines; tertiary alcohol; triazole antifungal drug | P450 inhibitor |
cyclobutyrol | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid | bile therapy drug |
terlipressin | [no description available] | medium | 1 | 0 | polypeptide | |
isoflavone | [no description available] | medium | 1 | 0 | isoflavones | |
clevudine | [no description available] | medium | 1 | 0 | | |
tetrandrine | [no description available] | medium | 1 | 0 | bisbenzylisoquinoline alkaloid; isoquinolines | |
rosiglitazone | [no description available] | medium | 3 | 0 | aminopyridine; thiazolidinediones | EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; insulin-sensitizing drug |
clarithromycin | [no description available] | medium | 3 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; protein synthesis inhibitor; xenobiotic |
lopinavir | [no description available] | medium | 1 | 0 | amphetamines; dicarboxylic acid diamide | anticoronaviral agent; antiviral drug; HIV protease inhibitor |
sr141716 | [no description available] | medium | 1 | 0 | amidopiperidine; carbohydrazide; dichlorobenzene; monochlorobenzenes; pyrazoles | anti-obesity agent; appetite depressant; CB1 receptor antagonist |
bosentan anhydrous | [no description available] | medium | 3 | 0 | primary alcohol; pyrimidines; sulfonamide | antihypertensive agent; endothelin receptor antagonist |
selenomethionine | [no description available] | medium | 1 | 0 | amino acid zwitterion; selenomethionine | plant metabolite |
perindopril | [no description available] | medium | 1 | 0 | alpha-amino acid ester; dicarboxylic acid monoester; ethyl ester; organic heterobicyclic compound | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
fingolimod | [no description available] | medium | 1 | 0 | aminodiol; primary amino compound | antineoplastic agent; CB1 receptor antagonist; immunosuppressive agent; prodrug; sphingosine-1-phosphate receptor agonist |
ecteinascidin 743 | [no description available] | medium | 1 | 0 | acetate ester; azaspiro compound; bridged compound; hemiaminal; isoquinoline alkaloid; lactone; organic heteropolycyclic compound; organic sulfide; oxaspiro compound; polyphenol; tertiary amino compound | alkylating agent; angiogenesis modulating agent; anti-inflammatory agent; antineoplastic agent; marine metabolite |
nitisinone | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; cyclohexanones; mesotrione | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor |
marimastat | [no description available] | medium | 1 | 0 | hydroxamic acid; secondary carboxamide | antineoplastic agent; matrix metalloproteinase inhibitor |
clofarabine | [no description available] | medium | 1 | 0 | adenosines; organofluorine compound | antimetabolite; antineoplastic agent |
mitiglinide | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | |
imatinib mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | anticoronaviral agent; antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
gefitinib | [no description available] | medium | 3 | 0 | aromatic ether; monochlorobenzenes; monofluorobenzenes; morpholines; quinazolines; secondary amino compound; tertiary amino compound | antineoplastic agent; epidermal growth factor receptor antagonist |
gefitinib | [no description available] | medium | 3 | 1 | aromatic ether; monochlorobenzenes; monofluorobenzenes; morpholines; quinazolines; secondary amino compound; tertiary amino compound | antineoplastic agent; epidermal growth factor receptor antagonist |
n(6)-(3-iodobenzyl)-5'-n-methylcarboxamidoadenosine | [no description available] | medium | 1 | 0 | adenosines; monocarboxylic acid amide; organoiodine compound | adenosine A3 receptor agonist |
antiprimod | [no description available] | medium | 1 | 0 | | |
sulbactam | [no description available] | medium | 1 | 0 | penicillanic acids | |
olmesartan medoxomil | [no description available] | medium | 1 | 0 | biphenyls | |
ilomastat | [no description available] | medium | 2 | 0 | hydroxamic acid; L-tryptophan derivative; N-acyl-amino acid | anti-inflammatory agent; antibacterial agent; antineoplastic agent; EC 3.4.24.24 (gelatinase A) inhibitor; neuroprotective agent |
docetaxel | [no description available] | medium | 1 | 0 | hydrate; secondary alpha-hydroxy ketone | antineoplastic agent |
atazanavir | [no description available] | medium | 1 | 0 | carbohydrazide | antiviral drug; HIV protease inhibitor |
levofloxacin | [no description available] | medium | 3 | 0 | 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid; fluoroquinolone antibiotic; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; topoisomerase IV inhibitor |
ezetimibe | [no description available] | medium | 2 | 0 | azetidines; beta-lactam; organofluorine compound | anticholesteremic drug; antilipemic drug; antimetabolite |
cariporide | [no description available] | medium | 1 | 0 | | |
tezosentan | [no description available] | medium | 1 | 0 | | |
moxifloxacin | [no description available] | medium | 1 | 0 | aromatic ether; cyclopropanes; fluoroquinolone antibiotic; pyrrolidinopiperidine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antibacterial drug |
jtt 501 | [no description available] | medium | 1 | 0 | | |
cyc 202 | [no description available] | medium | 1 | 0 | 2,6-diaminopurines | antiviral drug; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
avasimibe | [no description available] | medium | 1 | 0 | monoterpenoid | |
troleandomycin | [no description available] | medium | 3 | 0 | acetate ester; epoxide; macrolide antibiotic; monosaccharide derivative; polyketide; semisynthetic derivative | EC 1.14.13.97 (taurochenodeoxycholate 6alpha-hydroxylase) inhibitor; xenobiotic |
deferasirox | [no description available] | medium | 1 | 0 | benzoic acids; monocarboxylic acid; phenols; triazoles | iron chelator |
tbc-11251 | [no description available] | medium | 1 | 0 | benzodioxoles | |
sitosterol, (3beta)-isomer | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C29-steroid; phytosterols; stigmastane sterol | anticholesteremic drug; antioxidant; mouse metabolite; plant metabolite; sterol methyltransferase inhibitor |
benzarone | [no description available] | medium | 1 | 0 | 1-benzofurans | |
estramustine | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; carbamate ester; organochlorine compound | alkylating agent; antineoplastic agent; radiation protective agent |
noscapine | [no description available] | medium | 1 | 0 | aromatic ether; benzylisoquinoline alkaloid; cyclic acetal; isobenzofuranone; organic heterobicyclic compound; organic heterotricyclic compound; tertiary amino compound | antineoplastic agent; antitussive; apoptosis inducer; plant metabolite |
homoharringtonine | [no description available] | medium | 1 | 0 | alkaloid ester; enol ether; organic heteropentacyclic compound; tertiary alcohol | anticoronaviral agent; antineoplastic agent; apoptosis inducer; protein synthesis inhibitor |
o-(chloroacetylcarbamoyl)fumagillol | [no description available] | medium | 2 | 0 | carbamate ester; organochlorine compound; semisynthetic derivative; sesquiterpenoid; spiro-epoxide | angiogenesis inhibitor; antineoplastic agent; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; methionine aminopeptidase 2 inhibitor; retinoic acid receptor alpha antagonist |
bortezomib | [no description available] | medium | 1 | 0 | amino acid amide; L-phenylalanine derivative; pyrazines | antineoplastic agent; antiprotozoal drug; protease inhibitor; proteasome inhibitor |
ritonavir | [no description available] | medium | 4 | 0 | 1,3-thiazoles; carbamate ester; carboxamide; L-valine derivative; ureas | antiviral drug; environmental contaminant; HIV protease inhibitor; xenobiotic |
nexavar | [no description available] | medium | 1 | 0 | organosulfonate salt | |
glucosamine | [no description available] | high | 8 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
quinidine | [no description available] | medium | 3 | 0 | cinchona alkaloid | alpha-adrenergic antagonist; anti-arrhythmia drug; antimalarial; drug allergen; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor; muscarinic antagonist; P450 inhibitor; potassium channel blocker; sodium channel blocker |
meropenem | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; carbapenemcarboxylic acid; organic sulfide; pyrrolidinecarboxamide | antibacterial agent; antibacterial drug; drug allergen |
griseofulvin | [no description available] | medium | 5 | 0 | 1-benzofurans; antibiotic antifungal drug; benzofuran antifungal drug; organochlorine compound; oxaspiro compound | antibacterial agent; Penicillium metabolite |
digitoxin | [no description available] | medium | 1 | 0 | cardenolide glycoside | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor |
saquinavir | [no description available] | medium | 2 | 0 | L-asparagine derivative; quinolines | antiviral drug; HIV protease inhibitor |
netilmicin | [no description available] | medium | 1 | 0 | | |
trimethaphan camsylate | [no description available] | medium | 1 | 0 | | |
erythromycin estolate | [no description available] | medium | 3 | 0 | aminoglycoside sulfate salt; erythromycin derivative | enzyme inhibitor |
cyclopamine | [no description available] | medium | 1 | 0 | piperidines | glioma-associated oncogene inhibitor |
devazepide | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; indolecarboxamide | antineoplastic agent; apoptosis inducer; cholecystokinin antagonist; gastrointestinal drug |
tolterodine | [no description available] | medium | 1 | 0 | tertiary amine | antispasmodic drug; muscarinic antagonist; muscle relaxant |
doxorubicin hydrochloride | [no description available] | medium | 3 | 0 | anthracycline | |
erythromycin ethylsuccinate | [no description available] | medium | 1 | 0 | cyclic ketone; erythromycin derivative; ethyl ester; succinate ester | |
ao 128 | [no description available] | medium | 1 | 0 | organic molecular entity | |
acarbose | [no description available] | medium | 1 | 0 | amino cyclitol; glycoside | |
tretinoin | [no description available] | high | 12 | 0 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
alpha-D-fructofuranose 1,6-bisphosphate | [no description available] | medium | 1 | 0 | D-fructofuranose 1,6-bisphosphate | |
docosahexaenoate | [no description available] | medium | 1 | 0 | docosahexaenoic acid; omega-3 fatty acid | algal metabolite; antineoplastic agent; Daphnia tenebrosa metabolite; human metabolite; mouse metabolite; nutraceutical |
oleic acid | [no description available] | high | 21 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
tacrolimus | [no description available] | medium | 7 | 0 | macrolide lactam | bacterial metabolite; immunosuppressive agent |
cerivastatin | [no description available] | medium | 4 | 0 | dihydroxy monocarboxylic acid; pyridines; statin (synthetic) | |
rosuvastatin | [no description available] | medium | 1 | 0 | dihydroxy monocarboxylic acid; monofluorobenzenes; pyrimidines; statin (synthetic); sulfonamide | anti-inflammatory agent; antilipemic drug; cardioprotective agent; CETP inhibitor; environmental contaminant; xenobiotic |
cocaine | [no description available] | high | 8 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
eicosapentaenoic acid | [no description available] | high | 2 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
mycophenolic acid | [no description available] | medium | 1 | 0 | 2-benzofurans; gamma-lactone; monocarboxylic acid; phenols | anticoronaviral agent; antimicrobial agent; antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; environmental contaminant; immunosuppressive agent; mycotoxin; Penicillium metabolite; xenobiotic |
clindamycin | [no description available] | medium | 2 | 0 | | |
fosfomycin | [no description available] | medium | 1 | 0 | epoxide; phosphonic acids | antimicrobial agent; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor |
zithromax | [no description available] | medium | 4 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; xenobiotic |
drf 2725 | [no description available] | medium | 3 | 0 | | |
diethylstilbestrol | [no description available] | medium | 10 | 0 | olefinic compound; polyphenol | antifungal agent; antineoplastic agent; autophagy inducer; calcium channel blocker; carcinogenic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; endocrine disruptor; xenoestrogen |
alitretinoin | [no description available] | medium | 1 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; metabolite; retinoid X receptor agonist |
decitabine | [no description available] | medium | 1 | 0 | 2'-deoxyribonucleoside | |
teniposide | [no description available] | medium | 1 | 0 | aromatic ether; beta-D-glucoside; cyclic acetal; furonaphthodioxole; gamma-lactone; monosaccharide derivative; phenols; thiophenes | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
dactinomycin | [no description available] | medium | 23 | 0 | actinomycin | mutagen |
tiazofurin | [no description available] | medium | 1 | 0 | 1,3-thiazoles; C-glycosyl compound; monocarboxylic acid amide | antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; prodrug |
melphalan | [no description available] | medium | 1 | 0 | L-phenylalanine derivative; nitrogen mustard; non-proteinogenic L-alpha-amino acid; organochlorine compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
tenofovir | [no description available] | medium | 1 | 0 | nucleoside analogue; phosphonic acids | antiviral drug; drug metabolite; HIV-1 reverse transcriptase inhibitor |
rubitecan | [no description available] | medium | 1 | 0 | C-nitro compound; delta-lactone; pyranoindolizinoquinoline; semisynthetic derivative; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
micafungin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; echinocandin | antiinfective agent |
riboflavin | [no description available] | high | 196 | 2 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
riboflavin | [no description available] | high | 196 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
sodium bicarbonate | [no description available] | medium | 6 | 0 | one-carbon compound; organic sodium salt | antacid; food anticaking agent |
sodium acetate, anhydrous | [no description available] | medium | 2 | 0 | organic sodium salt | NMR chemical shift reference compound |
sodium benzoate | [no description available] | medium | 2 | 0 | organic sodium salt | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
dipyrone | [no description available] | medium | 1 | 0 | organic sodium salt | anti-inflammatory agent; antipyretic; antirheumatic drug; cyclooxygenase 3 inhibitor; non-narcotic analgesic; peripheral nervous system drug; prodrug |
ditiocarb sodium | [no description available] | medium | 1 | 0 | organic molecular entity | |
carbenoxolone | [no description available] | medium | 1 | 0 | | |
discodermolide | [no description available] | medium | 1 | 0 | diterpenoid | |
cannabidiol | [no description available] | medium | 2 | 0 | olefinic compound; phytocannabinoid; resorcinols | antimicrobial agent; plant metabolite |
propylthiouracil | [no description available] | medium | 1 | 0 | pyrimidinethione | antidote to paracetamol poisoning; antimetabolite; antioxidant; antithyroid drug; carcinogenic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; hormone antagonist |
prothionamide | [no description available] | medium | 1 | 0 | pyridines | |
etomidate | [no description available] | medium | 1 | 0 | ethyl ester; imidazoles | intravenous anaesthetic; sedative |
mercaptopurine | [no description available] | medium | 3 | 0 | aryl thiol; purines; thiocarbonyl compound | anticoronaviral agent; antimetabolite; antineoplastic agent |
methimazole | [no description available] | medium | 4 | 0 | 1,3-dihydroimidazole-2-thiones | antithyroid drug |
sulindac | [no description available] | medium | 3 | 0 | monocarboxylic acid; organofluorine compound; sulfoxide | analgesic; antineoplastic agent; antipyretic; apoptosis inducer; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug; tocolytic agent |
capsaicin | [no description available] | medium | 9 | 0 | capsaicinoid | non-narcotic analgesic; TRPV1 agonist; voltage-gated sodium channel blocker |
terbinafine | [no description available] | medium | 1 | 0 | acetylenic compound; allylamine antifungal drug; enyne; naphthalenes; tertiary amine | EC 1.14.13.132 (squalene monooxygenase) inhibitor; P450 inhibitor; sterol biosynthesis inhibitor |
thioguanine anhydrous | [no description available] | medium | 3 | 0 | 2-aminopurines | anticoronaviral agent; antimetabolite; antineoplastic agent |
tacrine hydrochloride | [no description available] | medium | 1 | 0 | | |
sodium propionate | [no description available] | medium | 1 | 0 | organic sodium salt | antifungal drug; food preservative |
digoxin | [no description available] | medium | 24 | 0 | cardenolide glycoside; steroid saponin | anti-arrhythmia drug; cardiotonic drug; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; epitope |
streptozocin | [no description available] | medium | 3 | 0 | | |
ethionamide | [no description available] | medium | 1 | 0 | pyridines; thiocarboxamide | antilipemic drug; antitubercular agent; fatty acid synthesis inhibitor; leprostatic drug; prodrug |
fusidic acid | [no description available] | medium | 1 | 0 | 11alpha-hydroxy steroid; 3alpha-hydroxy steroid; alpha,beta-unsaturated monocarboxylic acid; steroid acid; steroid antibiotic; sterol ester | EC 2.7.1.33 (pantothenate kinase) inhibitor; Escherichia coli metabolite; protein synthesis inhibitor |
estrone sulfate | [no description available] | medium | 1 | 0 | 17-oxo steroid; steroid sulfate | human metabolite; mouse metabolite |
hmr 3647 | [no description available] | medium | 3 | 0 | | |
toremifene | [no description available] | medium | 1 | 0 | aromatic ether; organochlorine compound; tertiary amine | antineoplastic agent; bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
telaprevir | [no description available] | medium | 1 | 0 | cyclopentapyrrole; cyclopropanes; oligopeptide; pyrazines | antiviral drug; hepatitis C protease inhibitor; peptidomimetic |
droloxifene | [no description available] | medium | 1 | 0 | stilbenoid | |
or 1259 | [no description available] | medium | 1 | 0 | hydrazone; nitrile; pyridazinone | anti-arrhythmia drug; cardiotonic drug; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; vasodilator agent |
gestodene | [no description available] | medium | 1 | 0 | steroid | estrogen |
orlistat | [no description available] | medium | 3 | 0 | beta-lactone; carboxylic ester; formamides; L-leucine derivative | anti-obesity agent; bacterial metabolite; EC 2.3.1.85 (fatty acid synthase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor |
idoxifene | [no description available] | medium | 1 | 0 | stilbenoid | |
zd 6474 | [no description available] | medium | 1 | 0 | aromatic ether; organobromine compound; organofluorine compound; piperidines; quinazolines; secondary amine | antineoplastic agent; tyrosine kinase inhibitor |
silybin | [no description available] | medium | 1 | 0 | | |
chloramine-t | [no description available] | medium | 3 | 0 | organic sodium salt | allergen; antifouling biocide; disinfectant |
flosequinan | [no description available] | medium | 1 | 0 | quinolines | |
tolcapone | [no description available] | medium | 3 | 0 | 2-nitrophenols; benzophenones; catechols | antiparkinson drug; EC 2.1.1.6 (catechol O-methyltransferase) inhibitor |
calcitriol | [no description available] | high | 2 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
beta carotene | [no description available] | high | 2 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
amphotericin b | [no description available] | medium | 5 | 0 | antibiotic antifungal drug; macrolide antibiotic; polyene antibiotic | antiamoebic agent; antiprotozoal drug; bacterial metabolite |
clavulanic acid | [no description available] | medium | 1 | 0 | oxapenam | antibacterial drug; anxiolytic drug; bacterial metabolite; EC 3.5.2.6 (beta-lactamase) inhibitor |
pulmicort | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic acetal; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; bronchodilator agent; drug allergen |
oxymetholone | [no description available] | medium | 1 | 0 | | |
montelukast | [no description available] | medium | 3 | 0 | aliphatic sulfide; monocarboxylic acid; quinolines | anti-arrhythmia drug; anti-asthmatic drug; leukotriene antagonist |
mycophenolate mofetil | [no description available] | medium | 1 | 0 | carboxylic ester; ether; gamma-lactone; phenols; tertiary amino compound | anticoronaviral agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; immunosuppressive agent; prodrug |
entacapone | [no description available] | medium | 3 | 0 | 2-nitrophenols; catechols; monocarboxylic acid amide; nitrile | antidyskinesia agent; antiparkinson drug; central nervous system drug; EC 2.1.1.6 (catechol O-methyltransferase) inhibitor |
astaxanthine | [no description available] | medium | 1 | 0 | carotenol; carotenone | animal metabolite; anticoagulant; antioxidant; food colouring; plant metabolite |
diosmin | [no description available] | medium | 1 | 0 | dihydroxyflavanone; disaccharide derivative; glycosyloxyflavone; monomethoxyflavone; rutinoside | anti-inflammatory agent; antioxidant |
cynarine | [no description available] | medium | 1 | 0 | alkyl caffeate ester; quinic acid | plant metabolite |
sdz psc 833 | [no description available] | medium | 1 | 0 | homodetic cyclic peptide | |
coenzyme q10 | [no description available] | medium | 5 | 0 | ubiquinones | antioxidant; ferroptosis inhibitor; human metabolite |
tranilast | [no description available] | medium | 1 | 0 | amidobenzoic acid; cinnamamides; dimethoxybenzene; secondary carboxamide | anti-allergic agent; anti-asthmatic drug; antineoplastic agent; aryl hydrocarbon receptor agonist; calcium channel blocker; hepatoprotective agent; nephroprotective agent |
etretinate | [no description available] | medium | 1 | 0 | enoate ester; ethyl ester; retinoid | keratolytic drug |
isotretinoin | [no description available] | medium | 5 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; teratogenic agent |
misoprostol | [no description available] | medium | 1 | 0 | | |
ozagrel | [no description available] | medium | 1 | 0 | cinnamic acids | |
pitavastatin | [no description available] | medium | 1 | 0 | cyclopropanes; dihydroxy monocarboxylic acid; monofluorobenzenes; quinolines; statin (synthetic) | antioxidant |
alatrofloxacin mesylate | [no description available] | medium | 1 | 0 | | |
codeine | [no description available] | medium | 1 | 0 | morphinane alkaloid; organic heteropentacyclic compound | antitussive; drug allergen; environmental contaminant; opioid analgesic; opioid receptor agonist; prodrug; xenobiotic |
cyclosporine | [no description available] | medium | 3 | 0 | homodetic cyclic peptide | anti-asthmatic drug; anticoronaviral agent; antifungal agent; antirheumatic drug; carcinogenic agent; dermatologic drug; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; geroprotector; immunosuppressive agent; metabolite |
natamycin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; dicarboxylic acid monoester; epoxide; macrolide antibiotic; monosaccharide derivative; polyene antibiotic | antifungal agrochemical; antimicrobial food preservative; apoptosis inducer; bacterial metabolite; ophthalmology drug |
acitretin | [no description available] | medium | 3 | 0 | acitretin; alpha,beta-unsaturated monocarboxylic acid; retinoid | keratolytic drug |
dothiepin | [no description available] | medium | 1 | 0 | dothiepin | |
levetiracetam | [no description available] | medium | 1 | 0 | pyrrolidin-2-ones | anticonvulsant; environmental contaminant; xenobiotic |
nalorphine | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
naloxone | [no description available] | medium | 5 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary alcohol | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
oxymorphone | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
sirolimus | [no description available] | medium | 4 | 0 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
topiramate | [no description available] | medium | 2 | 0 | cyclic ketal; ketohexose derivative; sulfamate ester | anticonvulsant; sodium channel blocker |
alvocidib | [no description available] | medium | 1 | 0 | dihydroxyflavone; hydroxypiperidine; monochlorobenzenes; tertiary amino compound | antineoplastic agent; antirheumatic drug; apoptosis inducer; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
seocalcitol | [no description available] | medium | 1 | 0 | | |
fenretinide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; retinoid | antineoplastic agent; antioxidant |
geldanamycin | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; ansamycin; carbamate ester; organic heterobicyclic compound | antimicrobial agent; antineoplastic agent; antiviral agent; cysteine protease inhibitor; Hsp90 inhibitor |
morphine | [no description available] | medium | 5 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary amino compound | anaesthetic; drug allergen; environmental contaminant; geroprotector; mu-opioid receptor agonist; opioid analgesic; plant metabolite; vasodilator agent; xenobiotic |
demycarosylturimycin h | [no description available] | medium | 1 | 0 | | |
iloprost | [no description available] | medium | 2 | 0 | carbobicyclic compound; monocarboxylic acid; secondary alcohol | platelet aggregation inhibitor; vasodilator agent |
vinorelbine | [no description available] | medium | 1 | 0 | acetate ester; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; ring assembly; vinca alkaloid | antineoplastic agent; photosensitizing agent |
furazolidone | [no description available] | medium | 3 | 0 | | |
fluvoxamine | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; 5-methoxyvalerophenone O-(2-aminoethyl)oxime | antidepressant; anxiolytic drug; serotonin uptake inhibitor |
semaxinib | [no description available] | medium | 1 | 0 | olefinic compound; oxindoles; pyrroles | angiogenesis modulating agent; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; vascular endothelial growth factor receptor antagonist |
orantinib | [no description available] | medium | 1 | 0 | | |
(6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | [no description available] | medium | 2 | 0 | dihydroxy monocarboxylic acid; indoles; organofluorine compound | |
molsidomine | [no description available] | medium | 1 | 0 | ethyl ester; morpholines; oxadiazole; zwitterion | antioxidant; apoptosis inhibitor; cardioprotective agent; nitric oxide donor; vasodilator agent |
naltrexone | [no description available] | medium | 6 | 0 | cyclopropanes; morphinane-like compound; organic heteropentacyclic compound | antidote to opioid poisoning; central nervous system depressant; environmental contaminant; mu-opioid receptor antagonist; xenobiotic |
dextromethorphan | [no description available] | medium | 1 | 0 | 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene | antitussive; environmental contaminant; neurotoxin; NMDA receptor antagonist; oneirogen; prodrug; xenobiotic |
cefixime | [no description available] | medium | 1 | 0 | cephalosporin | antibacterial drug; drug allergen |
lisinopril | [no description available] | medium | 5 | 0 | dipeptide | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
ramipril | [no description available] | medium | 2 | 0 | azabicycloalkane; cyclopentapyrrole; dicarboxylic acid monoester; dipeptide; ethyl ester | bradykinin receptor B2 agonist; cardioprotective agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; matrix metalloproteinase inhibitor; prodrug |
indinavir sulfate | [no description available] | medium | 1 | 0 | dicarboxylic acid diamide; N-(2-hydroxyethyl)piperazine; piperazinecarboxamide | HIV protease inhibitor |
enalapril | [no description available] | medium | 3 | 0 | dicarboxylic acid monoester; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; geroprotector; prodrug |
nitrofurazone | [no description available] | medium | 1 | 0 | | |
bleomycin | [no description available] | medium | 1 | 0 | bleomycin | antineoplastic agent; metabolite |
enalaprilat anhydrous | [no description available] | medium | 2 | 0 | dicarboxylic acid; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
imidapril | [no description available] | medium | 1 | 0 | dicarboxylic acid monoester; dipeptide; ethyl ester; imidazolidines; N-acylurea; secondary amino compound | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
sulindac sulfone | [no description available] | medium | 1 | 0 | monocarboxylic acid; organofluorine compound; sulfone | apoptosis inducer; cyclooxygenase 2 inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor |
ximelagatran | [no description available] | medium | 2 | 0 | amidoxime; azetidines; carboxamide; ethyl ester; hydroxylamines; secondary amino compound; secondary carboxamide; tertiary carboxamide | anticoagulant; EC 3.4.21.5 (thrombin) inhibitor; prodrug; serine protease inhibitor |
ceftriaxone | [no description available] | medium | 1 | 0 | 1,2,4-triazines; 1,3-thiazoles; cephalosporin; oxime O-ether | antibacterial drug; drug allergen; EC 3.5.2.6 (beta-lactamase) inhibitor |
trandolapril | [no description available] | medium | 1 | 0 | dicarboxylic acid monoester; dipeptide; ethyl ester; organic heterobicyclic compound; secondary amino compound; tertiary carboxamide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
guanabenz acetate | [no description available] | medium | 1 | 0 | dichlorobenzene | geroprotector |
famotidine | [no description available] | medium | 3 | 0 | 1,3-thiazoles; guanidines; sulfonamide | anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
cefotaxime | [no description available] | medium | 1 | 0 | 1,3-thiazoles; cephalosporin; oxime O-ether | antibacterial drug; drug allergen |
aztreonam | [no description available] | medium | 3 | 0 | beta-lactam antibiotic allergen; monobactam | antibacterial drug; drug allergen; EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor |
proguanil | [no description available] | medium | 1 | 0 | biguanides; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
rifamycin sv | [no description available] | medium | 1 | 0 | acetate ester; cyclic ketal; lactam; macrocycle; organic heterotetracyclic compound; polyphenol; rifamycins | antimicrobial agent; antitubercular agent; bacterial metabolite |
epoprostenol sodium | [no description available] | medium | 1 | 0 | prostanoid | |
ixabepilone | [no description available] | medium | 1 | 0 | 1,3-thiazoles; beta-hydroxy ketone; epoxide; lactam; macrocycle | antineoplastic agent; microtubule-destabilising agent |
azlocillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin; semisynthetic derivative | antibacterial drug |
dantrolene sodium | [no description available] | medium | 3 | 0 | | |
nitrofurantoin | [no description available] | medium | 3 | 0 | imidazolidine-2,4-dione; nitrofuran antibiotic; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic | antibacterial drug; antiinfective agent; hepatotoxic agent |
nifurtimox | [no description available] | medium | 1 | 0 | nitrofuran antibiotic | |
roxithromycin | [no description available] | medium | 1 | 0 | roxithromycin | environmental contaminant; xenobiotic |
beraprost | [no description available] | medium | 1 | 0 | enyne; monocarboxylic acid; organic heterotricyclic compound; secondary alcohol; secondary allylic alcohol | anti-inflammatory agent; antihypertensive agent; platelet aggregation inhibitor; prostaglandin receptor agonist; vasodilator agent |
lanreotide | [no description available] | medium | 1 | 0 | | |
lu 208075 | [no description available] | medium | 1 | 0 | diarylmethane | |
acetylcarnitine | [no description available] | medium | 1 | 0 | O-acetylcarnitine; saturated fatty acyl-L-carnitine | human metabolite; Saccharomyces cerevisiae metabolite |
nifurtoinol | [no description available] | medium | 1 | 0 | hydrazone; imidazolidine-2,4-dione; nitrofuran antibiotic; organonitrogen heterocyclic antibiotic | antibacterial drug; antiinfective agent; hepatotoxic agent |
fosinopril | [no description available] | medium | 1 | 0 | | |
eflucimibe | [no description available] | medium | 1 | 0 | | |
etomoxir | [no description available] | medium | 1 | 0 | aromatic ether | |
pentagastrin | [no description available] | medium | 2 | 0 | organic molecular entity | |
gentamicin sulfate | [no description available] | medium | 2 | 0 | | |
azd 6244 | [no description available] | medium | 1 | 0 | benzimidazoles; bromobenzenes; hydroxamic acid ester; monochlorobenzenes; organofluorine compound; secondary amino compound | anticoronaviral agent; antineoplastic agent; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor |
vinflunine | [no description available] | medium | 1 | 0 | acetate ester; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; semisynthetic derivative; vinca alkaloid | antineoplastic agent |
baci-im | [no description available] | medium | 3 | 0 | homodetic cyclic peptide; polypeptide; zwitterion | antibacterial agent; antimicrobial agent |
pf 03491390 | [no description available] | medium | 1 | 0 | | |
amodiaquine hydrochloride | [no description available] | medium | 1 | 0 | | |
tannins | [no description available] | medium | 1 | 0 | tannin | |
mesna | [no description available] | medium | 3 | 0 | organosulfonic acid | |
cerivastatin sodium | [no description available] | medium | 1 | 0 | organic sodium salt; statin (synthetic) | |
monensin | [no description available] | medium | 1 | 0 | | |
oxacillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
sodium diatrizoate | [no description available] | medium | 1 | 0 | organic sodium salt; organoiodine compound | radioopaque medium |
novobiocin | [no description available] | medium | 3 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
tetracycline | [no description available] | medium | 7 | 0 | | |
chlortetracycline | [no description available] | medium | 5 | 0 | | |
oxytetracycline, anhydrous | [no description available] | medium | 6 | 0 | | |
minocycline | [no description available] | medium | 1 | 0 | | |
piroxicam | [no description available] | medium | 3 | 0 | benzothiazine; monocarboxylic acid amide; pyridines | analgesic; antirheumatic drug; cyclooxygenase 1 inhibitor; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
acenocoumarol | [no description available] | medium | 3 | 0 | C-nitro compound; hydroxycoumarin; methyl ketone | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
mobic | [no description available] | medium | 2 | 0 | 1,3-thiazoles; benzothiazine; monocarboxylic acid amide | analgesic; antirheumatic drug; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
mobiflex | [no description available] | medium | 1 | 0 | heteroaryl hydroxy compound; monocarboxylic acid amide; pyridines; thienothiazine | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
phenprocoumon | [no description available] | medium | 1 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
rolitetracycline | [no description available] | medium | 1 | 0 | | |
lornoxicam | [no description available] | medium | 1 | 0 | heteroaryl hydroxy compound; monocarboxylic acid amide; organochlorine compound; pyridines; thienothiazine | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
ajmaline | [no description available] | medium | 1 | 0 | | |
entecavir | [no description available] | medium | 1 | 0 | 2-aminopurines; oxopurine; primary alcohol; secondary alcohol | antiviral drug; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
acyclovir | [no description available] | medium | 3 | 0 | 2-aminopurines; oxopurine | antimetabolite; antiviral drug |
inosine | [no description available] | high | 2 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
rifampin | [no description available] | high | 5 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
dacarbazine | [no description available] | medium | 4 | 0 | dacarbazine | |
dacarbazine | [no description available] | medium | 4 | 1 | dacarbazine | |
didanosine | [no description available] | medium | 3 | 0 | purine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor; geroprotector; HIV-1 reverse transcriptase inhibitor |
ganciclovir | [no description available] | medium | 3 | 0 | 2-aminopurines; oxopurine | antiinfective agent; antiviral drug |
sildenafil | [no description available] | medium | 1 | 0 | piperazines; pyrazolopyrimidine; sulfonamide | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
olanzapine | [no description available] | medium | 1 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine | antiemetic; dopaminergic antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; serotonin uptake inhibitor |
penciclovir | [no description available] | medium | 1 | 0 | 2-aminopurines; propane-1,3-diols | antiviral drug |
raltitrexed | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
leucovorin | [no description available] | medium | 1 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
alanosine | [no description available] | medium | 1 | 0 | | |
tirapazamine | [no description available] | medium | 1 | 0 | aromatic amine; benzotriazines; N-oxide | antibacterial agent; antineoplastic agent; apoptosis inducer |
rifabutin | [no description available] | medium | 3 | 0 | | |
ethylene glycol | [no description available] | high | 8 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
melatonin | [no description available] | high | 8 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
2,4-dinitrophenol | [no description available] | medium | 7 | 0 | dinitrophenol | allergen; antiseptic drug; bacterial xenobiotic metabolite; geroprotector; oxidative phosphorylation inhibitor |
3-methylcholanthrene | [no description available] | medium | 2 | 0 | ortho- and peri-fused polycyclic arene | aryl hydrocarbon receptor agonist; carcinogenic agent |
tacrine | [no description available] | medium | 2 | 0 | acridines; aromatic amine | EC 3.1.1.7 (acetylcholinesterase) inhibitor |
amoxapine | [no description available] | medium | 2 | 0 | dibenzooxazepine | adrenergic uptake inhibitor; antidepressant; dopaminergic antagonist; geroprotector; serotonin uptake inhibitor |
bithionol | [no description available] | medium | 2 | 0 | aryl sulfide; bridged diphenyl antifungal drug; bridged diphenyl fungicide; dichlorobenzene; organochlorine pesticide; polyphenol | antifungal agrochemical; antiplatyhelmintic drug |
candesartan | [no description available] | medium | 2 | 0 | benzimidazolecarboxylic acid; biphenylyltetrazole | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
ciclopirox | [no description available] | medium | 2 | 0 | cyclic hydroxamic acid; hydroxypyridone antifungal drug; pyridone | antibacterial agent; antiseborrheic |
ciglitazone | [no description available] | medium | 2 | 0 | aromatic ether; thiazolidinone | antineoplastic agent; insulin-sensitizing drug |
clomipramine | [no description available] | medium | 2 | 0 | dibenzoazepine | anticoronaviral agent; antidepressant; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; serotonergic antagonist; serotonergic drug; serotonin uptake inhibitor |
cromolyn | [no description available] | medium | 2 | 0 | chromones; dicarboxylic acid | anti-asthmatic drug; calcium channel blocker |
diethylcarbamazine | [no description available] | medium | 2 | 0 | N-carbamoylpiperazine; N-methylpiperazine | |
dimercaprol | [no description available] | medium | 2 | 0 | dithiol; primary alcohol | chelator |
donepezil | [no description available] | medium | 3 | 0 | aromatic ether; indanones; piperidines; racemate | EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; nootropic agent |
ethosuximide | [no description available] | medium | 3 | 0 | dicarboximide; pyrrolidinone | anticonvulsant; geroprotector; T-type calcium channel blocker |
carbonyl cyanide p-trifluoromethoxyphenylhydrazone | [no description available] | medium | 2 | 0 | aromatic ether; hydrazone; nitrile; organofluorine compound | ATP synthase inhibitor; geroprotector; ionophore |
fexofenadine | [no description available] | medium | 2 | 0 | piperidines; tertiary amine | anti-allergic agent; H1-receptor antagonist |
fipexide | [no description available] | medium | 2 | 0 | benzodioxoles | |
foscarnet | [no description available] | medium | 3 | 0 | carboxylic acid; one-carbon compound; phosphonic acids | antiviral drug; geroprotector; HIV-1 reverse transcriptase inhibitor; sodium-dependent Pi-transporter inhibitor |
gabapentin | [no description available] | medium | 2 | 0 | gamma-amino acid | anticonvulsant; calcium channel blocker; environmental contaminant; xenobiotic |
glimepiride | [no description available] | medium | 2 | 0 | sulfonamide | |
hycanthone | [no description available] | medium | 2 | 0 | thioxanthenes | mutagen; schistosomicide drug |
isocarboxazid | [no description available] | medium | 2 | 0 | benzenes | |
ketotifen | [no description available] | medium | 2 | 0 | cyclic ketone; olefinic compound; organic heterotricyclic compound; organosulfur heterocyclic compound; piperidines; tertiary amino compound | anti-asthmatic drug; H1-receptor antagonist |
maprotiline | [no description available] | medium | 2 | 0 | anthracenes | |
meclofenamate sodium anhydrous | [no description available] | medium | 2 | 0 | organic sodium salt | |
memantine | [no description available] | medium | 2 | 0 | adamantanes; primary aliphatic amine | antidepressant; antiparkinson drug; dopaminergic agent; neuroprotective agent; NMDA receptor antagonist |
methapyrilene | [no description available] | medium | 2 | 0 | ethylenediamine derivative | anti-allergic agent; carcinogenic agent; H1-receptor antagonist; sedative |
nocodazole | [no description available] | medium | 5 | 0 | aromatic ketone; benzimidazoles; carbamate ester; thiophenes | antimitotic; antineoplastic agent; microtubule-destabilising agent; tubulin modulator |
metolazone | [no description available] | medium | 2 | 0 | organochlorine compound; quinazolines; sulfonamide | antihypertensive agent; diuretic; ion transport inhibitor |
oxibendazole | [no description available] | medium | 2 | 0 | benzimidazoles; carbamate ester | |
pamidronate | [no description available] | medium | 2 | 0 | phosphonoacetic acid | |
pargyline | [no description available] | medium | 3 | 0 | aromatic amine | |
perhexiline | [no description available] | medium | 2 | 0 | piperidines | cardiovascular drug |
pindolol | [no description available] | medium | 2 | 0 | indoles; secondary amine | antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; serotonergic antagonist; vasodilator agent |
pioglitazone | [no description available] | medium | 4 | 0 | aromatic ether; pyridines; thiazolidinediones | antidepressant; cardioprotective agent; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; geroprotector; hypoglycemic agent; insulin-sensitizing drug; PPARgamma agonist; xenobiotic |
raloxifene | [no description available] | medium | 2 | 0 | 1-benzothiophenes; aromatic ketone; N-oxyethylpiperidine; phenols | bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
sulfabenzamide | [no description available] | medium | 2 | 0 | benzenes; sulfonamide antibiotic; sulfonamide | antibacterial drug; antimicrobial drug |
sumatriptan | [no description available] | medium | 2 | 0 | sulfonamide; tryptamines | serotonergic agonist; vasoconstrictor agent |
tolmetin | [no description available] | medium | 2 | 0 | aromatic ketone; monocarboxylic acid; pyrroles | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
trifluoperazine | [no description available] | medium | 2 | 0 | N-alkylpiperazine; N-methylpiperazine; organofluorine compound; phenothiazines | antiemetic; calmodulin antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; phenothiazine antipsychotic drug |
pirinixic acid | [no description available] | medium | 1 | 0 | aryl sulfide; organochlorine compound; pyrimidines | |
zomepirac | [no description available] | medium | 2 | 0 | aromatic ketone; monocarboxylic acid; monochlorobenzenes; pyrroles | cardiovascular drug; non-steroidal anti-inflammatory drug |
oxyphenonium | [no description available] | medium | 2 | 0 | acylcholine | |
isoproterenol hydrochloride | [no description available] | medium | 2 | 0 | catechols | |
promazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
2-acetylaminofluorene | [no description available] | medium | 6 | 0 | 2-acetamidofluorenes | antimitotic; carcinogenic agent; epitope; mutagen |
idoxuridine | [no description available] | medium | 5 | 0 | organoiodine compound; pyrimidine 2'-deoxyribonucleoside | antiviral drug; DNA synthesis inhibitor |
isonicotinic acid | [no description available] | medium | 1 | 0 | pyridinemonocarboxylic acid | algal metabolite; human metabolite |
promethazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; geroprotector; H1-receptor antagonist; local anaesthetic; sedative |
acetylcholine chloride | [no description available] | medium | 2 | 0 | quaternary ammonium salt | |
methoxamine hydrochloride | [no description available] | medium | 2 | 0 | dimethoxybenzene | |
dimethylnitrosamine | [no description available] | medium | 2 | 0 | nitrosamine | geroprotector; mutagen |
primaquine phosphate | [no description available] | medium | 2 | 0 | | |
gallamine triethiodide | [no description available] | medium | 2 | 0 | | |
uracil mustard | [no description available] | medium | 2 | 0 | aminouracil; nitrogen mustard | |
chloroform | [no description available] | medium | 8 | 0 | chloromethanes; one-carbon compound | carcinogenic agent; central nervous system drug; inhalation anaesthetic; non-polar solvent; refrigerant |
dimethylformamide | [no description available] | medium | 5 | 0 | formamides; volatile organic compound | geroprotector; hepatotoxic agent; polar aprotic solvent |
tromethamine | [no description available] | medium | 4 | 0 | primary amino compound; triol | buffer |
cyclizine | [no description available] | medium | 2 | 0 | N-alkylpiperazine | antiemetic; central nervous system depressant; cholinergic antagonist; H1-receptor antagonist; local anaesthetic |
rotenone | [no description available] | medium | 3 | 0 | organic heteropentacyclic compound; rotenones | antineoplastic agent; metabolite; mitochondrial NADH:ubiquinone reductase inhibitor; phytogenic insecticide; piscicide; toxin |
hexachlorobutadiene | [no description available] | medium | 1 | 0 | organochlorine compound | |
phenothiazine | [no description available] | medium | 2 | 0 | phenothiazine | ferroptosis inhibitor; plant metabolite; radical scavenger |
2-bromophenol | [no description available] | medium | 2 | 0 | bromophenol | marine metabolite |
3-dinitrobenzene | [no description available] | medium | 1 | 0 | dinitrobenzene | neurotoxin |
pyridostigmine bromide | [no description available] | medium | 2 | 0 | pyridinium salt | |
4,4'-diaminodiphenylmethane | [no description available] | medium | 2 | 0 | aromatic amine | allergen; carcinogenic agent |
phenylisothiocyanate | [no description available] | medium | 2 | 0 | isothiocyanate | allergen; reagent |
4-bromophenol | [no description available] | medium | 2 | 0 | bromophenol | human urinary metabolite; human xenobiotic metabolite; marine metabolite; mouse metabolite; persistent organic pollutant; rat metabolite |
2-bromoethylamine | [no description available] | medium | 2 | 0 | | |
allyl alcohol | [no description available] | medium | 2 | 0 | primary allylic alcohol; propenol | antibacterial agent; fungicide; herbicide; insecticide; plant metabolite |
imipramine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antidepressant |
edrophonium chloride | [no description available] | medium | 2 | 0 | chloride salt; quaternary ammonium salt | antidote; diagnostic agent; EC 3.1.1.8 (cholinesterase) inhibitor |
di-n-pentyl phthalate | [no description available] | medium | 2 | 0 | diester; phthalate ester | plasticiser |
phenazopyridine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | carcinogenic agent; local anaesthetic; non-narcotic analgesic |
tetrracaine hydrochloride | [no description available] | medium | 2 | 0 | benzoate ester | |
diphenhydramine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride; organoammonium salt | anti-allergic agent; antiemetic; antiparkinson drug; antipruritic drug; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; sedative |
tripelennamine hydrochloride | [no description available] | medium | 2 | 0 | | |
ethynodiol diacetate | [no description available] | medium | 2 | 0 | steroid ester; terminal acetylenic compound | contraceptive drug; estrogen receptor modulator; synthetic oral contraceptive |
hydrazine | [no description available] | medium | 39 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
monocrotaline | [no description available] | medium | 2 | 0 | pyrrolizidine alkaloid | |
pseudoephedrine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | plant metabolite |
procarbazine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antineoplastic agent |
lithocholic acid | [no description available] | high | 3 | 0 | bile acid; C24-steroid; monohydroxy-5beta-cholanic acid | geroprotector; human metabolite; mouse metabolite |
amitriptyline hydrochloride | [no description available] | medium | 2 | 0 | organic tricyclic compound | |
1-naphthylisothiocyanate | [no description available] | medium | 2 | 0 | isothiocyanate | insecticide |
isoxsuprine hydrochloride | [no description available] | medium | 2 | 0 | alkylbenzene | |
betaine hydrochloride | [no description available] | medium | 2 | 0 | | |
3-hydroxyacetanilide | [no description available] | medium | 2 | 0 | acetamides; phenols | non-narcotic analgesic |
methoxyacetic acid | [no description available] | medium | 2 | 0 | ether; monocarboxylic acid | antineoplastic agent; apoptosis inducer; human xenobiotic metabolite; mutagen |
cyproheptadine hydrochloride (anhydrous) | [no description available] | medium | 2 | 0 | hydrochloride | |
pregnenolone carbonitrile | [no description available] | medium | 1 | 0 | aliphatic nitrile | |
ibufenac | [no description available] | medium | 2 | 0 | monocarboxylic acid | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; hepatotoxic agent; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
2,3,7,8-tetrachlorodibenzodioxine | [no description available] | medium | 1 | 0 | polychlorinated dibenzodioxine | |
paraquat | [no description available] | medium | 6 | 0 | organic cation | geroprotector; herbicide |
clonidine hydrochloride | [no description available] | medium | 2 | 0 | dichlorobenzene | |
ethylene dimethanesulfonate | [no description available] | medium | 2 | 0 | | |
mexiletine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-arrhythmia drug |
beclomethasone dipropionate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; corticosteroid; enone; glucocorticoid; propanoate ester; steroid ester | anti-arrhythmia drug; anti-asthmatic drug; anti-inflammatory drug; prodrug |
metoclopramide hydrochloride | [no description available] | medium | 2 | 0 | | |
carbendazim | [no description available] | medium | 2 | 0 | benzimidazole fungicide; benzimidazoles; benzimidazolylcarbamate fungicide; carbamate ester | antifungal agrochemical; antinematodal drug; metabolite; microtubule-destabilising agent |
ethionine | [no description available] | medium | 10 | 0 | S-ethylhomocysteine | antimetabolite; carcinogenic agent |
disopyramide phosphate | [no description available] | medium | 2 | 0 | organoammonium phosphate | |
butylated hydroxytoluene | [no description available] | medium | 3 | 0 | phenols | antioxidant; ferroptosis inhibitor; food additive; geroprotector |
moricizine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-arrhythmia drug |
serentil | [no description available] | medium | 2 | 0 | organosulfonate salt | dopaminergic antagonist; first generation antipsychotic |
propafenone hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anti-arrhythmia drug |
carbidopa | [no description available] | medium | 2 | 0 | catechols; hydrate; hydrazines; monocarboxylic acid | antidyskinesia agent; antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
cephradine | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; cephalosporin | antibacterial drug |
nonachlazine | [no description available] | medium | 1 | 0 | | |
flecainide acetate | [no description available] | medium | 2 | 0 | acetate salt | anti-arrhythmia drug |
nicardipine hydrochloride | [no description available] | medium | 2 | 0 | dihydropyridine | geroprotector |
indacrinone | [no description available] | medium | 2 | 0 | | |
butoconazole nitrate | [no description available] | medium | 2 | 0 | aryl sulfide; conazole antifungal drug; imidazole antifungal drug; imidazoles; organic nitrate salt | |
fialuridine | [no description available] | medium | 2 | 0 | | |
mitoxantrone hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antineoplastic agent |
bambuterol | [no description available] | medium | 2 | 0 | carbamate ester; phenylethanolamines | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; prodrug; sympathomimetic agent; tocolytic agent |
atomoxetine | [no description available] | medium | 2 | 0 | aromatic ether; secondary amino compound; toluenes | adrenergic uptake inhibitor; antidepressant; environmental contaminant; xenobiotic |
alpidem | [no description available] | medium | 2 | 0 | imidazoles | |
temafloxacin | [no description available] | medium | 2 | 0 | amino acid; monocarboxylic acid; N-arylpiperazine; organofluorine compound; quinolone antibiotic; quinolone; secondary amino compound; tertiary amino compound | |
clinafloxacin | [no description available] | medium | 2 | 0 | quinolines | |
mibefradil | [no description available] | medium | 2 | 0 | tetralins | T-type calcium channel blocker |
tasosartan | [no description available] | medium | 2 | 0 | biphenyls | |
saquinavir monomethanesulfonate | [no description available] | medium | 2 | 0 | organic molecular entity | |
allyl formate | [no description available] | medium | 2 | 0 | | |
desferrioxamine b mesylate | [no description available] | medium | 2 | 0 | methanesulfonate salt | antidote; ferroptosis inhibitor; iron chelator |
bupropion hydrochloride | [no description available] | medium | 2 | 0 | aromatic ketone | |
trazodone hydrochloride | [no description available] | medium | 24 | 0 | hydrochloride | adrenergic antagonist; antidepressant; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
trovafloxacin | [no description available] | medium | 2 | 0 | | |
verapamil hydrochloride | [no description available] | medium | 2 | 0 | | |
ciprofloxacin hydrochloride anhydrous | [no description available] | medium | 2 | 0 | hydrochloride | antibacterial drug; antiinfective agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; topoisomerase IV inhibitor |
amantadine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antiviral agent; dopamine agonist; NMDA receptor antagonist |
dobutamine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | beta-adrenergic agonist; cardiotonic drug; sympathomimetic agent |
iopamidol | [no description available] | medium | 2 | 0 | benzenedicarboxamide; organoiodine compound; pentol | environmental contaminant; radioopaque medium; xenobiotic |
sulconazole, mononitrate, (+-)-isomer | [no description available] | medium | 2 | 0 | conazole antifungal drug; imidazole antifungal drug; organic nitrate salt | |
trimethobenzamide monohydrochloride | [no description available] | medium | 2 | 0 | | |
amiloride hydrochloride | [no description available] | medium | 2 | 0 | hydrate | diuretic; sodium channel blocker |
econazole nitrate | [no description available] | medium | 2 | 0 | | |
lomefloxacin hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antimicrobial agent; antitubercular agent; photosensitizing agent |
flunoxaprofen | [no description available] | medium | 2 | 0 | 1,3-benzoxazoles; monocarboxylic acid; organofluorine compound | antirheumatic drug; hepatotoxic agent; non-steroidal anti-inflammatory drug; protein kinase C agonist |
tianeptine | [no description available] | medium | 3 | 0 | dibenzothiazepine; monocarboxylic acid; organochlorine compound | |
loperamide hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | anticoronaviral agent; antidiarrhoeal drug; mu-opioid receptor agonist |
grepafloxacin | [no description available] | medium | 2 | 0 | fluoroquinolone antibiotic; quinolines; quinolone antibiotic | |
2-naphthylisothiocyanate | [no description available] | medium | 2 | 0 | | |
chloroquine diphosphate | [no description available] | medium | 2 | 0 | | |
orphenadrine citrate | [no description available] | medium | 2 | 0 | citrate salt | H1-receptor antagonist; muscarinic antagonist; muscle relaxant; NMDA receptor antagonist; parasympatholytic |
ketorolac tromethamine | [no description available] | medium | 2 | 0 | organoammonium salt | analgesic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor |
n-(3,5-dichlorophenyl)succinimide | [no description available] | medium | 2 | 0 | pyrrolidines | |
phentolamine mesylate | [no description available] | medium | 2 | 0 | | |
oxybutynin hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
1-cyano-2-hydroxy-3-butene | [no description available] | medium | 1 | 0 | secondary alcohol | |
cordium | [no description available] | medium | 2 | 0 | hydrate; hydrochloride | |
dilevalol | [no description available] | medium | 1 | 0 | 2-hydroxy-5-{1-hydroxy-2-[(4-phenylbutan-2-yl)amino]ethyl}benzamide | |
nsc-141549 | [no description available] | medium | 2 | 0 | | |
aflatoxin b1 | [no description available] | high | 7 | 0 | aflatoxin; aromatic ether; aromatic ketone | carcinogenic agent; human metabolite |
fludrocortisone acetate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; fluorinated steroid; mineralocorticoid; tertiary alpha-hydroxy ketone | |
vincristine sulfate | [no description available] | medium | 2 | 0 | organic sulfate salt | antineoplastic agent; geroprotector |
acivicin | [no description available] | medium | 2 | 0 | isoxazoles; non-proteinogenic L-alpha-amino acid; organochlorine compound | antileishmanial agent; antimetabolite; antimicrobial agent; antineoplastic agent; EC 2.3.2.2 (gamma-glutamyltransferase) inhibitor; glutamine antagonist; metabolite |
puromycin | [no description available] | medium | 19 | 0 | puromycins | antiinfective agent; antimicrobial agent; antineoplastic agent; EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor; EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor; nucleoside antibiotic; protein synthesis inhibitor |
(+)-limonene | [no description available] | medium | 2 | 0 | limonene | plant metabolite |
cefoxitin | [no description available] | medium | 3 | 0 | beta-lactam antibiotic allergen; cephalosporin; cephamycin; semisynthetic derivative | antibacterial drug |
moxalactam disodium | [no description available] | medium | 2 | 0 | | |
abacavir | [no description available] | medium | 2 | 0 | 2,6-diaminopurines | antiviral drug; drug allergen; HIV-1 reverse transcriptase inhibitor |
mometasone furoate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 2-furoate ester; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; organochlorine compound; steroid ester | anti-allergic agent; anti-inflammatory drug |
nortriptyline hydrochloride | [no description available] | medium | 2 | 0 | organic tricyclic compound | geroprotector |
kanamycin sulfate | [no description available] | medium | 2 | 0 | aminoglycoside sulfate salt | antibacterial drug; geroprotector |
paromomycin sulfate | [no description available] | medium | 2 | 0 | | |
chloramphenicol palmitate | [no description available] | medium | 2 | 0 | hexadecanoate ester | |
calcium pantothenate | [no description available] | medium | 2 | 0 | polymer | |
maleic acid | [no description available] | medium | 3 | 0 | butenedioic acid | algal metabolite; mouse metabolite; plant metabolite |
cyanoginosin lr | [no description available] | medium | 4 | 0 | microcystin | bacterial metabolite; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; environmental contaminant; xenobiotic |
azaserine | [no description available] | medium | 6 | 0 | carboxylic ester; diazo compound; L-serine derivative; non-proteinogenic L-alpha-amino acid | antifungal agent; antimetabolite; antimicrobial agent; antineoplastic agent; glutamine antagonist; immunosuppressive agent; metabolite |
arsenic trioxide | [no description available] | medium | 2 | 0 | arsenic oxide | antineoplastic agent; insecticide |
idarubicin hydrochloride | [no description available] | medium | 2 | 0 | anthracycline | |
carbenoxolone sodium | [no description available] | medium | 4 | 0 | triterpenoid | |
thiothixene | [no description available] | medium | 2 | 0 | N-methylpiperazine | anticoronaviral agent |
(1R,2S)-tranylcypromine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | |
thioacetamide | [no description available] | medium | 2 | 0 | thiocarboxamide | hepatotoxic agent |
quinine | [no description available] | medium | 3 | 0 | cinchona alkaloid | antimalarial; muscle relaxant; non-narcotic analgesic |
retinol palmitate | [no description available] | medium | 2 | 0 | all-trans-retinyl ester; retinyl palmitate | antioxidant; Escherichia coli metabolite; human xenobiotic metabolite |
eprosartan | [no description available] | medium | 2 | 0 | dicarboxylic acid; imidazoles; thiophenes | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
timolol maleate | [no description available] | medium | 2 | 0 | maleate salt | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist |
brompheniramine maleate | [no description available] | medium | 2 | 0 | maleate salt | anti-allergic agent |
chlorpheniramine maleate | [no description available] | medium | 2 | 0 | organic molecular entity | |
clemastine fumarate | [no description available] | medium | 2 | 0 | fumarate salt | anti-allergic agent; antipruritic drug; H1-receptor antagonist; muscarinic antagonist |
methylergonovine maleate | [no description available] | medium | 2 | 0 | ergoline alkaloid | geroprotector |
estradiol-17 beta-glucuronide | [no description available] | medium | 2 | 0 | 3-hydroxy steroid; steroid glucosiduronic acid | |
cis-flupenthixol dihydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | geroprotector |
phenoxybenzamine hydrochloride | [no description available] | medium | 2 | 0 | organic molecular entity | |
ly 163892 | [no description available] | medium | 2 | 0 | carbacephem; zwitterion | antibacterial drug; antimicrobial agent |
nalmefene | [no description available] | medium | 2 | 0 | morphinane alkaloid | |
octylmethoxycinnamate | [no description available] | medium | 2 | 0 | cinnamate ester | |
benazepril | [no description available] | medium | 2 | 0 | benzazepine; dicarboxylic acid monoester; ethyl ester; lactam | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
vinblastine sulfate | [no description available] | medium | 2 | 0 | | |
trientine hydrochloride | [no description available] | medium | 2 | 0 | | |
dextromethorphan hydrobromide | [no description available] | medium | 2 | 0 | hydrate; hydrobromide | |
ceftazidime | [no description available] | medium | 2 | 0 | cephalosporin; oxime O-ether | antibacterial drug; drug allergen; EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor |
fenoterol | [no description available] | medium | 2 | 0 | hydrobromide | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
enclomiphene citrate | [no description available] | medium | 1 | 0 | | |
diphenoxylate hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | antidiarrhoeal drug |
ergonovine maleate | [no description available] | medium | 2 | 0 | maleate salt | diagnostic agent; oxytocic |
ursodoxicoltaurine | [no description available] | medium | 1 | 0 | bile acid taurine conjugate | anti-inflammatory agent; apoptosis inhibitor; bone density conservation agent; cardioprotective agent; human metabolite; neuroprotective agent |
molindone hydrochloride | [no description available] | medium | 2 | 0 | indoles | |
cytidine diphosphate choline | [no description available] | medium | 2 | 0 | nucleotide-(amino alcohol)s; phosphocholines | human metabolite; mouse metabolite; neuroprotective agent; psychotropic drug; Saccharomyces cerevisiae metabolite |
clindamycin hydrochloride | [no description available] | medium | 2 | 0 | S-glycosyl compound | |
quinine sulfate | [no description available] | medium | 2 | 0 | hydrate | |
cefotiam hydrochloride | [no description available] | medium | 2 | 0 | | |
potassium aminobenzoate | [no description available] | medium | 2 | 0 | | |
methicillin sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
nafcillin sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
penicillin g sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
cefamandole nafate | [no description available] | medium | 2 | 0 | organic sodium salt | antibacterial drug |
cephapirin sodium | [no description available] | medium | 2 | 0 | cephalosporin; organic sodium salt | antibacterial drug |
sodium cephalothin | [no description available] | medium | 2 | 0 | organic sodium salt | |
dicloxacillin sodium | [no description available] | medium | 2 | 0 | hydrate | |
azlocillin sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
isoxicam | [no description available] | medium | 2 | 0 | benzothiazine; isoxazoles; monocarboxylic acid amide | antirheumatic drug; non-steroidal anti-inflammatory drug |
chlortetracycline hydrochloride | [no description available] | medium | 2 | 0 | | |
minocycline hydrochloride | [no description available] | medium | 2 | 0 | | |
demeclocycline hydrochloride | [no description available] | medium | 2 | 0 | | |
citrovorum factor | [no description available] | medium | 2 | 0 | tetrahydrofolic acid | |
4-aminophenol | [no description available] | medium | 3 | 0 | aminophenol | allergen; metabolite |
sulfobromophthalein | [no description available] | medium | 1 | 0 | 2-benzofurans; organobromine compound; organosulfonic acid; phenols | dye |
telenzepine | [no description available] | medium | 1 | 0 | benzodiazepine | |
diquat | [no description available] | medium | 1 | 0 | organic cation | defoliant; herbicide |
n-pentanoic acid | [no description available] | medium | 5 | 0 | short-chain fatty acid; straight-chain saturated fatty acid | plant metabolite |
tolrestat | [no description available] | medium | 1 | 0 | naphthalenes | EC 1.1.1.21 (aldehyde reductase) inhibitor |
diltiazem hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antihypertensive agent; calcium channel blocker; vasodilator agent |
cox 189 | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; organochlorine compound; organofluorine compound; secondary amino compound | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
olmesartan | [no description available] | medium | 1 | 0 | biphenylyltetrazole | angiotensin receptor antagonist; antihypertensive agent |
lapatinib | [no description available] | medium | 1 | 0 | furans; organochlorine compound; organofluorine compound; quinazolines | antineoplastic agent; tyrosine kinase inhibitor |
taurolithocholic acid | [no description available] | medium | 1 | 0 | bile acid taurine conjugate; monocarboxylic acid amide | human metabolite |
indinavir sulfate | [no description available] | medium | 1 | 0 | azaheterocycle sulfate salt | |
ampicillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
sudoxicam | [no description available] | medium | 1 | 0 | | |
jcc 76 | [no description available] | medium | 1 | 0 | | |
adenosine diphosphate | [no description available] | high | 34 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
cytidine | [no description available] | high | 6 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
beta-D-ribopyranose | [no description available] | medium | 2 | 0 | D-ribopyranose | |
(4-tert-Butyl-phenoxy)-acetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | |
2-(4-hydroxyphenyl)-5,6,7,8-tetrahydroxy-4H-1-benzopyran-4-one | [no description available] | medium | 1 | 0 | pentahydroxyflavone | |
1-Anilino-9,10-dioxo-2-anthroic acid | [no description available] | medium | 1 | 0 | anthracenes | |
4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methylamino]benzoic acid | [no description available] | medium | 1 | 0 | oxopurine | |
3-(3-pyridinyl)propanoic acid | [no description available] | medium | 1 | 0 | pyridines | |
myricitrin | [no description available] | medium | 1 | 0 | alpha-L-rhamnoside; glycosyloxyflavone; monosaccharide derivative; pentahydroxyflavone | anti-allergic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; plant metabolite |
5,6-dichloro-1H-imidazo[4,5-b]pyrazine-2-carboxylic acid | [no description available] | medium | 1 | 0 | imidazopyrazine | |
streptovaricin c | [no description available] | medium | 2 | 0 | | |
galloflavin | [no description available] | medium | 1 | 0 | | |
1-naphthylphenylamine | [no description available] | medium | 1 | 0 | naphthalenes | |
2-isobutyl-3-methoxypyrazine | [no description available] | medium | 1 | 0 | | |
enterobactin | [no description available] | medium | 1 | 0 | catechols; crown compound; macrotriolide; polyphenol | bacterial metabolite; siderophore |
sinefungin | [no description available] | medium | 3 | 0 | adenosines; non-proteinogenic alpha-amino acid | antifungal agent; antimicrobial agent |
6-phosphogluconic acid | [no description available] | medium | 1 | 0 | gluconic acid phosphate | fundamental metabolite |
2-(sec-butyl)-4,5-dihydrothiazole | [no description available] | medium | 1 | 0 | | |
pnu 142372 | [no description available] | medium | 1 | 0 | | |
pnu 107859 | [no description available] | medium | 1 | 0 | | |
4-[4-(4-fluorophenyl)-2-(4-methylsulfonylphenyl)-1H-imidazol-5-yl]pyridine | [no description available] | medium | 1 | 0 | imidazoles | |
rocaglamide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; monomethoxybenzene; organic heterotricyclic compound | antileishmanial agent; antineoplastic agent; metabolite |
aglafoline | [no description available] | medium | 1 | 0 | methyl ester; organic heterotricyclic compound | metabolite; platelet aggregation inhibitor |
rocagloic acid | [no description available] | medium | 1 | 0 | | |
episilvestrol | [no description available] | medium | 1 | 0 | dioxanes; ether; methyl ester; organic heterotricyclic compound | antineoplastic agent; metabolite |
ebselen | [no description available] | medium | 1 | 0 | benzoselenazole | anti-inflammatory drug; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; EC 3.1.3.25 (inositol-phosphate phosphatase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 3.5.4.1 (cytosine deaminase) inhibitor; EC 5.1.3.2 (UDP-glucose 4-epimerase) inhibitor; enzyme mimic; ferroptosis inhibitor; genotoxin; hepatoprotective agent; neuroprotective agent; radical scavenger |
tert-butylhydroperoxide | [no description available] | medium | 1 | 0 | alkyl hydroperoxide | antibacterial agent; oxidising agent |
diphenyldiselenide | [no description available] | medium | 1 | 0 | | |
2-tert-butylhydroquinone | [no description available] | medium | 1 | 0 | hydroquinones | food antioxidant |
benzyloxycarbonylleucyl-leucyl-leucine aldehyde | [no description available] | medium | 4 | 0 | amino aldehyde; carbamate ester; tripeptide | proteasome inhibitor |
pyrophosphate | [no description available] | medium | 4 | 0 | diphosphate ion | |
phytic acid | [no description available] | medium | 2 | 0 | inositol phosphate | |
diphosphoric acid | [no description available] | medium | 1 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | Escherichia coli metabolite |
cadaverine | [no description available] | medium | 22 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
gold | [no description available] | medium | 362 | 0 | copper group element atom; elemental gold | |
thionine | [no description available] | medium | 5 | 0 | | |
chitosan | [no description available] | medium | 29 | 1 | | |
7,8-diaminopelargonic acid | [no description available] | medium | 15 | 0 | amino fatty acid; amino monocarboxylic acid | |
hydrogen sulfide | [no description available] | medium | 16 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
cysteine | [no description available] | medium | 238 | 0 | cysteinium | fundamental metabolite |
3-phenoxybenzoic acid | [no description available] | medium | 1 | 0 | phenoxybenzoic acid | human xenobiotic metabolite; marine xenobiotic metabolite |
caseins | [no description available] | medium | 36 | 0 | | |
1,2,4-triazole | [no description available] | medium | 1 | 0 | 1,2,4-triazole | |
triazoles | [no description available] | medium | 8 | 0 | 1,2,3-triazole | |
eosine yellowish-(ys) | [no description available] | medium | 8 | 0 | organic sodium salt; organobromine compound | fluorochrome; histological dye |
tyramine | [no description available] | medium | 90 | 1 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
aflatoxin m1 | [no description available] | medium | 1 | 0 | aflatoxin; aromatic ether; aromatic ketone; tertiary alcohol | Aspergillus metabolite; human xenobiotic metabolite; mammalian metabolite |
ochratoxin a | [no description available] | medium | 6 | 0 | isochromanes; monocarboxylic acid amide; N-acyl-L-phenylalanine; organochlorine compound; phenylalanine derivative | Aspergillus metabolite; calcium channel blocker; carcinogenic agent; mycotoxin; nephrotoxin; Penicillium metabolite; teratogenic agent |
europium | [no description available] | medium | 47 | 0 | f-block element atom; lanthanoid atom | |
phytochlorin | [no description available] | medium | 2 | 0 | | |
D-fructopyranose | [no description available] | medium | 16 | 0 | cyclic hemiketal; D-fructose; fructopyranose | sweetening agent |
2,3,4,5,6-pentafluorophenol | [no description available] | medium | 1 | 0 | | |
5-methylcytosine | [no description available] | medium | 8 | 0 | methylcytosine; pyrimidines | human metabolite |
4-aminophenylphosphate | [no description available] | medium | 3 | 0 | | |
iminobiotin | [no description available] | medium | 11 | 0 | | |
brusatol | [no description available] | medium | 1 | 0 | triterpenoid | |
docetaxel anhydrous | [no description available] | medium | 4 | 0 | secondary alpha-hydroxy ketone; tetracyclic diterpenoid | antimalarial; antineoplastic agent; photosensitizing agent |
clay | [no description available] | medium | 1 | 0 | | |
lignin | [no description available] | medium | 3 | 0 | | |
transferrin | [no description available] | medium | 45 | 0 | | |
patulin | [no description available] | medium | 1 | 0 | furopyran; gamma-lactone; lactol | antimicrobial agent; Aspergillus metabolite; carcinogenic agent; mutagen; mycotoxin; Penicillium metabolite |
vitamin k semiquinone radical | [no description available] | medium | 41 | 1 | | |
platinum | [no description available] | medium | 16 | 0 | elemental platinum; nickel group element atom; platinum group metal atom | |
propionic acid | [no description available] | medium | 9 | 0 | saturated fatty acid; short-chain fatty acid | antifungal drug |
artenimol | [no description available] | medium | 1 | 0 | | |
transforming growth factor beta | [no description available] | medium | 12 | 0 | | |
thiophenes | [no description available] | medium | 25 | 0 | mancude organic heteromonocyclic parent; monocyclic heteroarene; thiophenes; volatile organic compound | non-polar solvent |
benzothiophene | [no description available] | medium | 1 | 0 | 1-benzothiophenes; benzothiophene | |
serine | [no description available] | medium | 54 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
fucose | [no description available] | medium | 10 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
iodine | [no description available] | medium | 7 | 0 | diatomic iodine | nutrient |
azides | [no description available] | medium | 137 | 0 | pseudohalide anion | mitochondrial respiratory-chain inhibitor |
silicon | [no description available] | medium | 60 | 0 | carbon group element atom; metalloid atom; nonmetal atom | |
oligonucleotides | [no description available] | medium | 154 | 0 | | |
zinc oxide | [no description available] | medium | 10 | 0 | zinc molecular entity | |
nickel | [no description available] | medium | 33 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
interleukin-8 | [no description available] | medium | 9 | 0 | | |
erythrosine | [no description available] | medium | 150 | 0 | | |
durapatite | [no description available] | medium | 6 | 0 | | |
hypochlorous acid | [no description available] | medium | 2 | 0 | chlorine oxoacid; reactive oxygen species | EC 2.5.1.18 (glutathione transferase) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite |
o-(biotinylcarbazoylmethyl)hydroxylamine | [no description available] | medium | 11 | 0 | | |
alanine | [no description available] | medium | 53 | 0 | alanine zwitterion; alanine; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; fundamental metabolite |
1,2-diaminobenzene | [no description available] | medium | 2 | 0 | phenylenediamine | hydrogen donor |
5-hydroxymethylcytosine | [no description available] | medium | 5 | 0 | aminopyrimidine; aromatic primary alcohol; nucleobase analogue; pyrimidone | human metabolite; mouse metabolite |
osmium tetroxide | [no description available] | medium | 3 | 0 | osmium coordination entity | fixative; histological dye; oxidising agent; poison |
dexpanthenol | [no description available] | medium | 2 | 1 | amino alcohol; monocarboxylic acid amide | cholinergic drug; provitamin |
silver | [no description available] | medium | 77 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
lysine | [no description available] | medium | 245 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
acetyl coenzyme a | [no description available] | medium | 46 | 0 | acyl-CoA | acyl donor; coenzyme; effector; fundamental metabolite |
iridium | [no description available] | medium | 9 | 0 | cobalt group element atom; platinum group metal atom | |
singlet oxygen | [no description available] | medium | 6 | 0 | chalcogen; monoatomic oxygen; nonmetal atom | macronutrient |
imidazolidines | [no description available] | medium | 2 | 0 | azacycloalkane; imidazolidines; saturated organic heteromonocyclic parent | |
titanium | [no description available] | medium | 14 | 0 | titanium group element atom | |
curcumin | [no description available] | medium | 10 | 0 | aromatic ether; beta-diketone; diarylheptanoid; enone; polyphenol | anti-inflammatory agent; antifungal agent; antineoplastic agent; biological pigment; contraceptive drug; dye; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; EC 1.8.1.9 (thioredoxin reductase) inhibitor; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; flavouring agent; food colouring; geroprotector; hepatoprotective agent; immunomodulator; iron chelator; ligand; lipoxygenase inhibitor; metabolite; neuroprotective agent; nutraceutical; radical scavenger |
methane | [no description available] | medium | 44 | 0 | alkane; gas molecular entity; mononuclear parent hydride; one-carbon compound | bacterial metabolite; fossil fuel; greenhouse gas |
ruthenium | [no description available] | medium | 24 | 0 | iron group element atom; platinum group metal atom | |
molybdenum | [no description available] | medium | 9 | 0 | chromium group element atom | micronutrient |
laccase | [no description available] | medium | 1 | 0 | | |
quercetin | [no description available] | medium | 5 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | antibacterial agent; antineoplastic agent; antioxidant; Aurora kinase inhibitor; chelator; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; geroprotector; phytoestrogen; plant metabolite; protein kinase inhibitor; radical scavenger |
dynorphins | [no description available] | medium | 8 | 0 | | |
muramidase | [no description available] | medium | 35 | 0 | | |
6-carboxyfluorescein | [no description available] | medium | 10 | 0 | monocarboxylic acid | |
tyrosine | [no description available] | medium | 68 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
hexanoic acid | [no description available] | medium | 1 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | human metabolite; plant metabolite |
2,2-bis(bromomethyl)-1,3-propanediol | [no description available] | medium | 5 | 0 | primary alcohol | |
hematoxylin | [no description available] | medium | 5 | 0 | organic heterotetracyclic compound; oxacycle; polyphenol; tertiary alcohol | histological dye; plant metabolite |
raffinose | [no description available] | medium | 2 | 0 | raffinose family oligosaccharide; trisaccharide | mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
flavin-adenine dinucleotide | [no description available] | medium | 8 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
spermine | [no description available] | medium | 7 | 0 | polyazaalkane; tetramine | antioxidant; fundamental metabolite; immunosuppressive agent |
guanosine | [no description available] | medium | 9 | 0 | guanosines; purines D-ribonucleoside | fundamental metabolite |
guanosine tetraphosphate | [no description available] | medium | 1 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
quinone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones | cofactor; human xenobiotic metabolite; mouse metabolite |
naphthoquinones | [no description available] | medium | 6 | 0 | | |
1,2-naphthoquinone-4-sulfonate | [no description available] | medium | 1 | 0 | arenesulfonic acid; naphthalenone | colorimetric reagent |
digoxigenin | [no description available] | medium | 172 | 0 | 12beta-hydroxy steroid; 14beta-hydroxy steroid; 3beta-hydroxy steroid; 3beta-sterol | hapten; plant metabolite |
ozone | [no description available] | medium | 3 | 0 | elemental molecule; gas molecular entity; reactive oxygen species; triatomic oxygen | antiseptic drug; disinfectant; electrophilic reagent; greenhouse gas; mutagen; oxidising agent; tracer |
dimaprit | [no description available] | medium | 1 | 0 | imidothiocarbamic ester | |
nucleoside q | [no description available] | medium | 1 | 0 | 7-deazaguanine ribonucleoside | |
azelaic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | antibacterial agent; antineoplastic agent; dermatologic drug; plant metabolite |
leukotriene b4 | [no description available] | medium | 2 | 0 | dihydroxy monocarboxylic acid; hydroxy polyunsaturated fatty acid; leukotriene; long-chain fatty acid | human metabolite; mouse metabolite; plant metabolite; vasoconstrictor agent |
leupeptins | [no description available] | medium | 5 | 0 | | |
pyruvic acid | [no description available] | medium | 30 | 0 | 2-oxo monocarboxylic acid | cofactor; fundamental metabolite |
arsenic | [no description available] | medium | 13 | 0 | metalloid atom; pnictogen | micronutrient |
s-nitrosoglutathione | [no description available] | medium | 12 | 0 | glutathione derivative; nitrosothio compound | bronchodilator agent; nitric oxide donor; platelet aggregation inhibitor; signalling molecule |
ajoene | [no description available] | medium | 1 | 0 | sulfoxide | |
pyrroles | [no description available] | medium | 22 | 0 | pyrrole; secondary amine | |
lead | [no description available] | medium | 5 | 0 | carbon group element atom; elemental lead; metal atom | neurotoxin |
thiouridine | [no description available] | medium | 6 | 0 | nucleoside analogue; thiouridine | affinity label; antimetabolite |
2-thioribothymidine | [no description available] | medium | 1 | 0 | thiouridine | |
2-thiouridine | [no description available] | medium | 1 | 0 | nucleoside analogue; thiouridine | |
2-aminoisobutyric acid | [no description available] | medium | 1 | 0 | 2,2-dialkylglycine zwitterion; 2,2-dialkylglycine | |
nitrogen dioxide | [no description available] | medium | 1 | 0 | nitrogen oxide | |
coenzyme a | [no description available] | medium | 114 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
tiglyl-coenzyme a | [no description available] | medium | 3 | 0 | 2-enoyl-CoA; monounsaturated fatty acyl-CoA | |
alpha-synuclein | [no description available] | medium | 4 | 0 | | |
mercury | [no description available] | medium | 3 | 0 | elemental mercury; zinc group element atom | neurotoxin |
histamine | [no description available] | medium | 8 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
naphthalimides | [no description available] | medium | 3 | 0 | | |
phenylalanine | [no description available] | medium | 27 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
myelin basic protein | [no description available] | medium | 13 | 0 | | |
ethyl hexanoate | [no description available] | medium | 2 | 0 | fatty acid ethyl ester; hexanoate ester | metabolite |
isoamyl acetate | [no description available] | medium | 1 | 0 | acetate ester | metabolite; Saccharomyces cerevisiae metabolite |
1,7-phenanthroline | [no description available] | medium | 16 | 0 | phenanthroline | |
prizes | [no description available] | medium | 1 | 0 | carboxamidine; monochloropyridine; nitrile | environmental contaminant; neonicotinoid insectide; xenobiotic |
cysteinesulfenic acid | [no description available] | medium | 3 | 0 | L-cysteine derivative; non-proteinogenic L-alpha-amino acid | |
cytosine | [no description available] | medium | 18 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
fluorescein | [no description available] | medium | 102 | 0 | 2-benzofurans; gamma-lactone; organic heteropentacyclic compound; oxaspiro compound; polyphenol; xanthene dye | fluorescent dye; radioopaque medium |
diazinon | [no description available] | medium | 1 | 0 | organic thiophosphate; pyrimidines | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; nematicide; xenobiotic |
beta-hydroxyisovaleric acid | [no description available] | medium | 37 | 0 | 3-hydroxy monocarboxylic acid | human metabolite |
beta-hydroxyisovaleric acid | [no description available] | medium | 37 | 3 | 3-hydroxy monocarboxylic acid | human metabolite |
valerates | [no description available] | medium | 48 | 3 | short-chain fatty acid anion; straight-chain saturated fatty acid anion | plant metabolite |
sofosbuvir | [no description available] | medium | 1 | 0 | aminopyrimidine; aromatic carboxylic acid; nucleobase analogue; pyrimidone | metabolite |
fluorescein-5-isothiocyanate | [no description available] | medium | 142 | 0 | fluorescein isothiocyanate | |
resveratrol | [no description available] | medium | 3 | 0 | resveratrol | antioxidant; phytoalexin; plant metabolite; quorum sensing inhibitor; radical scavenger |
heme | [no description available] | medium | 18 | 0 | | |
alpha-hydroxyglutarate | [no description available] | medium | 1 | 0 | 2-hydroxydicarboxylic acid; dicarboxylic fatty acid | metabolite; mouse metabolite |
nad | [no description available] | medium | 49 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
thiamine pyrophosphate | [no description available] | medium | 10 | 0 | organic chloride salt; vitamin B1 | |
kynurenic acid | [no description available] | medium | 1 | 0 | monohydroxyquinoline; quinolinemonocarboxylic acid | G-protein-coupled receptor agonist; human metabolite; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist; Saccharomyces cerevisiae metabolite |
kynurenine | [no description available] | medium | 2 | 0 | aromatic ketone; non-proteinogenic alpha-amino acid; substituted aniline | human metabolite |
cadmium | [no description available] | medium | 9 | 0 | cadmium molecular entity; zinc group element atom | |
manganese | [no description available] | medium | 37 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
2-iminobiotin | [no description available] | medium | 43 | 2 | | |
calixarenes | [no description available] | medium | 4 | 0 | | |
calix(4)arene | [no description available] | medium | 3 | 0 | | |
deoxyuridine | [no description available] | medium | 4 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
sybr green ii | [no description available] | medium | 1 | 0 | | |
1,2-oleoylphosphatidylcholine | [no description available] | medium | 15 | 0 | phosphatidylcholine(1+) | |
1,2-dioleoyloxy-3-(trimethylammonium)propane | [no description available] | medium | 1 | 0 | | |
distearoyl phosphatidylglycerol | [no description available] | medium | 1 | 0 | phosphatidylglycerol | |
1,2-dioleoyl-sn-glycero-3-phosphoglycerol | [no description available] | medium | 2 | 0 | 1,2-diacyl-sn-glycero-3-phospho-(1'-sn-glycerol) | |
phosphatidylcholines | [no description available] | medium | 52 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
1,2-dipalmitoylphosphatidylcholine | [no description available] | medium | 7 | 0 | | |
phthalimide | [no description available] | medium | 2 | 0 | phthalimides | |
styrene | [no description available] | medium | 2 | 0 | styrenes; vinylarene; volatile organic compound | mouse metabolite; mutagen; plant metabolite |
catechin | [no description available] | medium | 2 | 0 | catechin | antioxidant; plant metabolite |
3-hydroxybutyric acid | [no description available] | medium | 6 | 1 | (omega-1)-hydroxy fatty acid; 3-hydroxy monocarboxylic acid; hydroxybutyric acid | human metabolite |
phycocyanobilin | [no description available] | medium | 1 | 0 | | |
ferulic acid | [no description available] | medium | 1 | 0 | ferulic acids | anti-inflammatory agent; antioxidant; apoptosis inhibitor; cardioprotective agent; MALDI matrix material; plant metabolite |
pf 00299804 | [no description available] | medium | 1 | 0 | enamide; monochlorobenzenes; monofluorobenzenes; piperidines; quinazolines; secondary amino compound; secondary carboxamide; tertiary amino compound | antineoplastic agent; epidermal growth factor receptor antagonist |
proanthocyanidin | [no description available] | medium | 1 | 0 | | |
procyanidin | [no description available] | medium | 1 | 0 | proanthocyanidin | |
fluorides | [no description available] | medium | 10 | 0 | halide anion; monoatomic fluorine | |
methylacetylene | [no description available] | medium | 1 | 0 | alkyne; gas molecular entity; terminal acetylenic compound | |
homoserine | [no description available] | medium | 2 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
4-thiouracil | [no description available] | medium | 2 | 0 | | |
thiouracil | [no description available] | medium | 2 | 0 | nucleobase analogue; thiocarbonyl compound | antithyroid drug; metabolite |
phthalocyanine | [no description available] | medium | 4 | 0 | phthalocyanines; tetrapyrrole fundamental parent | |
5-(biotinamido)pentylamine | [no description available] | medium | 35 | 0 | | |
aluminum | [no description available] | medium | 7 | 0 | boron group element atom; elemental aluminium; metal atom | |
abscisic acid | [no description available] | medium | 5 | 0 | 2-trans-abscisic acid | |
3,3'-dithiobis(sulfosuccinimidyl propionate) | [no description available] | medium | 1 | 0 | | |
carbocyanines | [no description available] | medium | 91 | 0 | cyanine dye; organic iodide salt | fluorochrome |
carbon monoxide | [no description available] | medium | 5 | 0 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
kainic acid | [no description available] | medium | 7 | 0 | dicarboxylic acid; L-proline derivative; non-proteinogenic L-alpha-amino acid; pyrrolidinecarboxylic acid | antinematodal drug; excitatory amino acid agonist |
1,4,7,10-tetraazacyclododecane- 1,4,7,10-tetraacetic acid | [no description available] | medium | 15 | 0 | azamacrocycle | chelator; copper chelator |
1,4,7-triazacyclononane-n,n',n''-triacetic acid | [no description available] | medium | 1 | 0 | | |
betadex | [no description available] | medium | 14 | 1 | cyclodextrin | |
sybr green i | [no description available] | medium | 8 | 0 | benzothiazolium ion; cyanine dye; quinolines; tertiary amine | fluorescent dye |
dioleoyl phosphatidylethanolamine | [no description available] | medium | 2 | 0 | phosphatidylethanolamine | |
piperidines | [no description available] | medium | 10 | 0 | | |
yil 781 | [no description available] | medium | 1 | 0 | | |
3,3',5,5'-tetramethylbenzidine | [no description available] | medium | 13 | 0 | | |
berberine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; berberine alkaloid; botanical anti-fungal agent; organic heteropentacyclic compound | antilipemic drug; antineoplastic agent; antioxidant; EC 1.1.1.141 [15-hydroxyprostaglandin dehydrogenase (NAD(+))] inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.13.11.52 (indoleamine 2,3-dioxygenase) inhibitor; EC 1.21.3.3 (reticuline oxidase) inhibitor; EC 2.1.1.116 [3'-hydroxy-N-methyl-(S)-coclaurine 4'-O-methyltransferase] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.11.10 (IkappaB kinase) inhibitor; EC 3.1.1.4 (phospholipase A2) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor; EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; geroprotector; hypoglycemic agent; metabolite; potassium channel blocker |
lucifer yellow | [no description available] | medium | 73 | 0 | organic lithium salt | fluorochrome |
cellulose | [no description available] | medium | 24 | 0 | glycoside | |
thrombin aptamer | [no description available] | medium | 7 | 0 | | |
amiclenomycin | [no description available] | medium | 5 | 0 | | |
acetylgalactosamine | [no description available] | medium | 11 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
n-hydroxysuccinimide | [no description available] | medium | 20 | 0 | | |
iodoacetamide | [no description available] | medium | 13 | 0 | | |
biotin hydrazide | [no description available] | medium | 43 | 0 | | |
zearalenone | [no description available] | medium | 3 | 0 | macrolide; resorcinols | fungal metabolite; mycoestrogen |
caffeine citrate | [no description available] | medium | 1 | 0 | | |
finasteride | [no description available] | medium | 2 | 0 | 3-oxo steroid; aza-steroid; delta-lactam | androgen antagonist; antihyperplasia drug; EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor |
guanosine monophosphate | [no description available] | medium | 4 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
2-anilinonaphthalene-6-sulfonic acid | [no description available] | medium | 4 | 0 | | |
carbodiimides | [no description available] | medium | 18 | 0 | carbodiimide | |
c-peptide | [no description available] | medium | 1 | 0 | | |
sodium citrate, anhydrous | [no description available] | medium | 1 | 0 | organic sodium salt | anticoagulant; flavouring agent |
silver nitrate | [no description available] | medium | 3 | 0 | inorganic nitrate salt; silver salt | astringent |
victoria blue b | [no description available] | medium | 1 | 0 | iminium salt; organic chloride salt | fluorochrome; histological dye |
cadmium sulfide | [no description available] | medium | 6 | 0 | cadmium molecular entity | |
thioctic acid | [no description available] | medium | 66 | 0 | dithiolanes; heterocyclic fatty acid; thia fatty acid | fundamental metabolite; geroprotector |
dihydrolipoic acid | [no description available] | medium | 3 | 0 | thio-fatty acid | antioxidant; human metabolite; neuroprotective agent |
ecdysone | [no description available] | medium | 3 | 0 | 14alpha-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; 6-oxo steroid; ecdysteroid | prohormone |
ecdysterone | [no description available] | medium | 1 | 0 | 14alpha-hydroxy steroid; 20-hydroxy steroid; 22-hydroxy steroid; 25-hydroxy steroid; 2beta-hydroxy steroid; 3beta-sterol; ecdysteroid; phytoecdysteroid | animal metabolite; plant metabolite |
fibrinogen | [no description available] | medium | 27 | 0 | iditol | fungal metabolite |
pyrithione | [no description available] | medium | 1 | 0 | monohydroxypyridine; pyridinethione | ionophore |
tannins | [no description available] | medium | 2 | 0 | | |
gallic acid | [no description available] | medium | 2 | 0 | trihydroxybenzoic acid | antineoplastic agent; antioxidant; apoptosis inducer; astringent; cyclooxygenase 2 inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; geroprotector; human xenobiotic metabolite; plant metabolite |
fumonisin b1 | [no description available] | medium | 2 | 0 | diester; fumonisin; primary amino compound; triol | carcinogenic agent; metabolite |
tetraphenylporphine | [no description available] | medium | 2 | 0 | | |
biotinyltyramide | [no description available] | medium | 60 | 1 | | |
ectoine | [no description available] | medium | 1 | 0 | 1,4,5,6-tetrahydropyrimidines; carboxamidine; monocarboxylic acid; zwitterion | osmolyte |
chlorcyclizine | [no description available] | medium | 1 | 0 | diarylmethane | |
diazomethane | [no description available] | medium | 14 | 0 | diazo compound | alkylating agent; antineoplastic agent; carcinogenic agent; poison |
geranyl pyrophosphate | [no description available] | medium | 1 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
vitamin b 6 | [no description available] | medium | 31 | 1 | | |
3-hydroxybutanal | [no description available] | medium | 1 | 0 | | |
pyrrolidine | [no description available] | medium | 1 | 0 | azacycloalkane; pyrrolidines; saturated organic heteromonocyclic parent | |
4-nitrobenzaldehyde | [no description available] | medium | 2 | 0 | benzaldehydes; C-nitro compound | |
acetone | [no description available] | medium | 6 | 0 | ketone body; methyl ketone; propanones; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; human metabolite; polar aprotic solvent |
ponceau s | [no description available] | medium | 2 | 0 | organic sodium salt; organosulfonate salt | fluorochrome; histological dye |
maytansine | [no description available] | medium | 1 | 0 | alpha-amino acid ester; carbamate ester; epoxide; maytansinoid; organic heterotetracyclic compound; organochlorine compound | antimicrobial agent; antimitotic; antineoplastic agent; plant metabolite; tubulin modulator |
n-acryloyl-tris(hydroxymethyl)aminomethane | [no description available] | medium | 1 | 0 | | |
edetic acid | [no description available] | medium | 27 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
organophosphonates | [no description available] | medium | 6 | 0 | divalent inorganic anion; phosphite ion | |
sepharose | [no description available] | medium | 88 | 0 | | |
d-biotin-d-sulfoxide | [no description available] | medium | 18 | 0 | biotins; sulfoxide | metabolite |
celastrol | [no description available] | medium | 1 | 0 | monocarboxylic acid; pentacyclic triterpenoid | anti-inflammatory drug; antineoplastic agent; antioxidant; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Hsp90 inhibitor; metabolite |
s-adenosylmethionine | [no description available] | medium | 26 | 0 | organic cation; sulfonium compound | coenzyme; cofactor; human metabolite; micronutrient; Mycoplasma genitalium metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
ovalbumin | [no description available] | medium | 205 | 0 | | |
bromodeoxyuridine | [no description available] | medium | 29 | 0 | pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent |
thymidine | [no description available] | medium | 16 | 1 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
chlorpyrifos | [no description available] | medium | 4 | 0 | chloropyridine; organic thiophosphate | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; insecticide; xenobiotic |
phenylsaligenin cyclic phosphate | [no description available] | medium | 1 | 0 | | |
o,o-diethyl o-3,5,6-trichloro-2-pyridyl phosphate | [no description available] | medium | 3 | 0 | | |
biotinyl-6-aminocaproic acid n-hydroxysuccinimide ester | [no description available] | medium | 10 | 0 | | |
cyanine dye 3 | [no description available] | medium | 26 | 0 | | |
fluorine | [no description available] | medium | 5 | 0 | diatomic fluorine; gas molecular entity | NMR chemical shift reference compound |
titanium dioxide | [no description available] | medium | 7 | 0 | titanium oxides | food colouring |
vitamin b 12 | [no description available] | medium | 151 | 0 | | |
beta-escin | [no description available] | medium | 6 | 0 | | |
chrysin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; dihydroxyflavone | anti-inflammatory agent; antineoplastic agent; antioxidant; EC 2.7.11.18 (myosin-light-chain kinase) inhibitor; hepatoprotective agent; plant metabolite |
succinyl-coenzyme a | [no description available] | medium | 1 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
glutaryl-coenzyme a | [no description available] | medium | 4 | 0 | glutaryl-CoAs | mouse metabolite |
alpha-ketoadipic acid | [no description available] | medium | 1 | 0 | oxo dicarboxylic acid | human urinary metabolite; mouse metabolite |
aluminum oxide | [no description available] | medium | 5 | 0 | | |
carbonates | [no description available] | medium | 9 | 0 | carbon oxoanion | |
mannose | [no description available] | medium | 23 | 0 | D-aldohexose; D-mannose; mannopyranose | metabolite |
gadolinium | [no description available] | medium | 13 | 0 | f-block element atom; lanthanoid atom | |
diethylenetriamine | [no description available] | medium | 2 | 0 | polyazaalkane; triamine | |
trioxsalen | [no description available] | medium | 2 | 0 | psoralens | dermatologic drug; photosensitizing agent |
fullerene c60 | [no description available] | medium | 4 | 0 | fullerene | geroprotector |
phenoxy radical | [no description available] | medium | 1 | 0 | organic radical | |
epidermal growth factor | [no description available] | medium | 43 | 0 | | |
neuropeptide y | [no description available] | medium | 18 | 0 | | |
fluoroacetyl-coenzyme a | [no description available] | medium | 1 | 0 | haloacyl-CoA | |
5-carboxytetramethylrhodamine succinimidyl ester | [no description available] | medium | 4 | 0 | | |
indium | [no description available] | medium | 3 | 0 | boron group element atom | |
indium trichloride | [no description available] | medium | 1 | 0 | | |
indium | [no description available] | medium | 2 | 0 | | |
sulfur dioxide | [no description available] | medium | 1 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
4,6-dinitro-o-cresol | [no description available] | medium | 1 | 0 | dinitrophenol acaricide; hydroxytoluene; nitrotoluene | dinitrophenol insecticide; fungicide; herbicide |
pyridoxal | [no description available] | medium | 8 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
n-acetylneuraminic acid | [no description available] | medium | 16 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | medium | 2 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
protoporphyrin ix | [no description available] | medium | 2 | 0 | | |
sodium dodecyl sulfate | [no description available] | medium | 25 | 0 | organic sodium salt | detergent; protein denaturant |
propidium | [no description available] | medium | 5 | 0 | phenanthridines; quaternary ammonium ion | fluorochrome; intercalator |
propidium monoazide | [no description available] | medium | 1 | 0 | | |
4,4-difluoro-4-bora-3a,4a-diaza-s-indacene | [no description available] | medium | 10 | 0 | BODIPY compound | |
ornithine | [no description available] | medium | 9 | 0 | non-proteinogenic L-alpha-amino acid; ornithine | algal metabolite; hepatoprotective agent; mouse metabolite |
bisnorbiotin | [no description available] | medium | 23 | 1 | heterocyclic fatty acid | |
histidine | [no description available] | medium | 60 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
morpholine | [no description available] | medium | 1 | 0 | morpholines; saturated organic heteromonocyclic parent | NMR chemical shift reference compound |
osmium | [no description available] | medium | 1 | 0 | iron group element atom; platinum group metal atom | |
maleimide | [no description available] | medium | 40 | 0 | dicarboximide; maleimides | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
adhesamine | [no description available] | medium | 1 | 0 | | |
fluorexon | [no description available] | medium | 4 | 0 | xanthene dye | fluorochrome |
colfosceril palmitate | [no description available] | medium | 1 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:0 | mouse metabolite; surfactant |
cytochrome c-t | [no description available] | medium | 12 | 0 | | |
1,2-dipalmitoylphosphatidylglycerol | [no description available] | medium | 2 | 0 | phosphatidylglycerol | |
acetoacetic acid | [no description available] | medium | 6 | 0 | 3-oxo fatty acid; ketone body | metabolite |
3-nitrotyrosine | [no description available] | medium | 8 | 0 | 2-nitrophenols; C-nitro compound; nitrotyrosine; non-proteinogenic alpha-amino acid | |
4-hydroxy-2-nonenal | [no description available] | medium | 5 | 0 | 4-hydroxynon-2-enal; 4-hydroxynonenal | |
acetovanillone | [no description available] | medium | 2 | 0 | acetophenones; aromatic ketone; methyl ketone | antirheumatic drug; EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug; plant metabolite |
hydroxide ion | [no description available] | medium | 2 | 0 | oxygen hydride | mouse metabolite |
tyrosine | [no description available] | medium | 1 | 0 | alpha-amino-acid radical | |
3-n-butylphthalide | [no description available] | medium | 1 | 0 | benzofurans | |
endothelin-1 | [no description available] | medium | 5 | 0 | | |
benzofurans | [no description available] | medium | 4 | 0 | | |
stannic oxide | [no description available] | medium | 5 | 0 | tin oxide | |
nitrilotriacetic acid | [no description available] | medium | 12 | 0 | NTA; tricarboxylic acid | carcinogenic agent; nephrotoxic agent |
nickel nitrilotriacetic acid | [no description available] | medium | 2 | 0 | | |
tetrodotoxin | [no description available] | medium | 19 | 0 | azatetracycloalkane; oxatetracycloalkane; quinazoline alkaloid | animal metabolite; bacterial metabolite; marine metabolite; neurotoxin; voltage-gated sodium channel blocker |
cerium | [no description available] | medium | 2 | 0 | f-block element atom; lanthanoid atom | |
anisole | [no description available] | medium | 1 | 0 | monomethoxybenzene | plant metabolite |
phosphorus radioisotopes | [no description available] | medium | 45 | 0 | | |
alizarin | [no description available] | medium | 1 | 0 | dihydroxyanthraquinone | chromophore; dye; plant metabolite |
palmitic acid | [no description available] | medium | 11 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 1.1.1.189 (prostaglandin-E2 9-reductase) inhibitor; plant metabolite |
glucuronic acid | [no description available] | medium | 6 | 0 | D-glucuronic acid | algal metabolite |
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | [no description available] | medium | 1 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; phosphoantigen |
elastin | [no description available] | medium | 3 | 0 | oligopeptide | |
beauverolides | [no description available] | medium | 2 | 0 | | |
gadolinium 1,4,7,10-tetraazacyclododecane-n,n',n'',n'''-tetraacetate | [no description available] | medium | 2 | 0 | | |
2',3'-dideoxyuridine-5'-triphosphate | [no description available] | medium | 1 | 0 | | |
s-adenosylmethionine | [no description available] | medium | 5 | 0 | sulfonium betaine | human metabolite |
s-adenosylmethionine | [no description available] | medium | 5 | 1 | sulfonium betaine | human metabolite |
picric acid | [no description available] | medium | 1 | 0 | C-nitro compound | antiseptic drug; explosive; fixative |
methoxyamine | [no description available] | medium | 2 | 0 | organooxygen compound | |
mocetinostat | [no description available] | medium | 62 | 1 | aminopyrimidine; benzamides; pyridines; secondary amino compound; secondary carboxamide; substituted aniline | antineoplastic agent; apoptosis inducer; autophagy inducer; cardioprotective agent; EC 3.5.1.98 (histone deacetylase) inhibitor; hepatotoxic agent |
guanidine thiocyanate | [no description available] | medium | 1 | 0 | | |
cyclosporine | [no description available] | medium | 7 | 1 | | |
zinc methionine | [no description available] | medium | 2 | 2 | | |
thiazole orange | [no description available] | medium | 5 | 0 | cyanine dye | fluorochrome |
pentetic acid | [no description available] | medium | 32 | 1 | pentacarboxylic acid | copper chelator |
gadolinium dtpa | [no description available] | medium | 8 | 0 | gadolinium coordination entity | MRI contrast agent |
n-methyladenosine | [no description available] | medium | 2 | 0 | methyladenosine | |
potassium cyanide | [no description available] | medium | 2 | 0 | cyanide salt; one-carbon compound; potassium salt | EC 1.15.1.1 (superoxide dismutase) inhibitor; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; neurotoxin |
cycloheximide | [no description available] | medium | 22 | 0 | antibiotic fungicide; cyclic ketone; dicarboximide; piperidine antibiotic; piperidones; secondary alcohol | anticoronaviral agent; bacterial metabolite; ferroptosis inhibitor; neuroprotective agent; protein synthesis inhibitor |
anisomycin | [no description available] | medium | 1 | 0 | monohydroxypyrrolidine; organonitrogen heterocyclic antibiotic | anticoronaviral agent; antimicrobial agent; antineoplastic agent; antiparasitic agent; bacterial metabolite; DNA synthesis inhibitor; protein synthesis inhibitor |
3,3'-diaminobenzidine | [no description available] | medium | 30 | 1 | biphenyls; substituted aniline | histological dye |
tetramethylrhodamine | [no description available] | medium | 14 | 0 | xanthene dye | |
dithiothreitol | [no description available] | medium | 21 | 0 | 1,4-dimercaptobutane-2,3-diol; butanediols; dithiol; glycol; thiol | chelator; human metabolite; reducing agent |
heparitin sulfate | [no description available] | medium | 13 | 0 | | |
myristyl alcohol | [no description available] | medium | 1 | 0 | long-chain primary fatty alcohol; tetradecanol | pheromone; plant metabolite; volatile oil component |
biotin tyramine | [no description available] | medium | 5 | 0 | | |
octopamine | [no description available] | medium | 2 | 0 | phenylethanolamines; tyramines | neurotransmitter |
glycogen | [no description available] | medium | 12 | 0 | | |
glucagon | [no description available] | medium | 13 | 0 | peptide hormone | |
cgp 52432 | [no description available] | medium | 2 | 0 | dichlorobenzene | |
natriuretic peptide, brain | [no description available] | medium | 6 | 0 | polypeptide | |
biocytin | [no description available] | medium | 114 | 0 | azabicycloalkane; L-alpha-amino acid zwitterion; L-lysine derivative; monocarboxylic acid amide; non-proteinogenic L-alpha-amino acid; thiabicycloalkane; ureas | mouse metabolite |
pimeloyl-coenzyme a | [no description available] | medium | 15 | 0 | omega-carboxyacyl-CoA | metabolite |
cyclic gmp | [no description available] | medium | 22 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
glycosides | [no description available] | medium | 14 | 0 | | |
fondaparinux | [no description available] | medium | 6 | 1 | amino sugar; oligosaccharide sulfate; pentasaccharide derivative | anticoagulant |
sanorg 34006 | [no description available] | medium | 9 | 2 | | |
idrabiotaparinux | [no description available] | medium | 16 | 5 | | |
carbidopa | [no description available] | medium | 1 | 0 | | |
carbidopa, levodopa drug combination | [no description available] | medium | 1 | 0 | | |
acetylglucosamine | [no description available] | medium | 21 | 0 | N-acetyl-D-glucosamine | epitope |
4-aminopiperidine | [no description available] | medium | 1 | 0 | | |
zd 7288 | [no description available] | medium | 3 | 0 | | |
cardiovascular agents | [no description available] | medium | 1 | 0 | | |
rhenium | [no description available] | medium | 10 | 1 | manganese group element atom | |
fluorophosphate | [no description available] | medium | 1 | 0 | fluorine molecular entity; phosphoric acid derivative | |
alizarin red s | [no description available] | medium | 2 | 0 | organic sodium salt; organosulfonate salt | histological dye |
hydrogen sulfite | [no description available] | medium | 2 | 0 | sulfur oxoanion | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
sulfites | [no description available] | medium | 7 | 0 | divalent inorganic anion; sulfur oxide; sulfur oxoanion | |
1-anilino-8-naphthalenesulfonate | [no description available] | medium | 10 | 0 | aminonaphthalene; naphthalenesulfonic acid | fluorescent probe |
titanium nitride (tin) | [no description available] | medium | 1 | 0 | | |
glycyl-arginyl-glycyl-aspartyl-serine | [no description available] | medium | 1 | 0 | | |
bismuth | [no description available] | medium | 6 | 0 | metal atom; pnictogen | |
molybdenum disulfide | [no description available] | medium | 2 | 0 | sulfide salt | |
vanadates | [no description available] | medium | 4 | 0 | trivalent inorganic anion; vanadium oxoanion | EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor |
bismuth orthovanadate | [no description available] | medium | 1 | 0 | | |
aflatoxin b | [no description available] | medium | 1 | 0 | aflatoxin | |
cadmium chloride | [no description available] | medium | 2 | 0 | cadmium coordination entity | |
oxidopamine | [no description available] | medium | 5 | 0 | benzenetriol; catecholamine; primary amino compound | drug metabolite; human metabolite; neurotoxin |
dimyristoylphosphatidylglycerol | [no description available] | medium | 2 | 0 | | |
monensin | [no description available] | medium | 6 | 0 | cyclic hemiketal; monocarboxylic acid; polyether antibiotic; spiroketal | antifungal agent; coccidiostat; ionophore |
limestone | [no description available] | medium | 7 | 0 | calcium salt; carbonate salt; inorganic calcium salt; one-carbon compound | antacid; fertilizer; food colouring; food firming agent |
phenyl acetate | [no description available] | medium | 67 | 0 | benzenes; phenyl acetates | |
glycocholic acid | [no description available] | medium | 1 | 0 | bile acid glycine conjugate | human metabolite |
iodouracil | [no description available] | medium | 1 | 0 | | |
concanavalin a | [no description available] | medium | 45 | 0 | | |
acetylcarnitine | [no description available] | medium | 4 | 0 | O-acylcarnitine | human metabolite |
ubiquinone | [no description available] | medium | 11 | 0 | | |
yttrium radioisotopes | [no description available] | medium | 32 | 10 | | |
pyrrolysine | [no description available] | medium | 1 | 0 | amino acid zwitterion; N(6)-acyl-L-lysine; proteinogenic amino acid; pyrrolysine | |
quadricyclane | [no description available] | medium | 1 | 0 | | |
haba | [no description available] | medium | 18 | 0 | | |
perylenediimide | [no description available] | medium | 2 | 0 | dicarboximide; organic heteropolycyclic compound | fluorochrome |
1,2-dielaidoylphosphatidylethanolamine | [no description available] | medium | 4 | 0 | | |
n-tert-butylhydroxylamine | [no description available] | medium | 1 | 0 | | |
2'-deoxyadenosine | [no description available] | medium | 2 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
oxaloacetic acid | [no description available] | medium | 5 | 0 | C4-dicarboxylic acid; oxo dicarboxylic acid | geroprotector; metabolite |
oxantel pamoate | [no description available] | medium | 1 | 0 | naphthoic acid | |
pyrantel pamoate | [no description available] | medium | 1 | 0 | organic molecular entity | |
dextrothyroxine | [no description available] | medium | 2 | 0 | | |
tribendimidine | [no description available] | medium | 1 | 0 | | |
biotinyl n-hydroxysuccinimide ester | [no description available] | medium | 51 | 0 | | |
4-chloro-7-nitrobenzofurazan | [no description available] | medium | 1 | 0 | benzoxadiazole; C-nitro compound; organochlorine compound | EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.6.1.3 (adenosinetriphosphatase) inhibitor; fluorescent probe; fluorochrome |
1-palmitoyl-2-(12-((7-nitro-2,1,3-benzoxadiazol-4-yl)amino)dodecanoyl)phosphatidylcholine | [no description available] | medium | 1 | 0 | | |
Dihydrotanshinone I | [no description available] | medium | 1 | 0 | abietane diterpenoid | anticoronaviral agent |
glycolic acid | [no description available] | medium | 1 | 0 | 2-hydroxy monocarboxylic acid; primary alcohol | keratolytic drug; metabolite |
phenanthrenes | [no description available] | medium | 4 | 0 | | |
palladium | [no description available] | medium | 10 | 0 | metal allergen; nickel group element atom; platinum group metal atom | |
copper gluconate | [no description available] | medium | 4 | 0 | organic molecular entity | |
gluconic acid | [no description available] | medium | 2 | 0 | gluconic acid | chelator; Penicillium metabolite |
glycylhistidine | [no description available] | medium | 1 | 0 | dipeptide zwitterion; dipeptide | metabolite |
phalloidine | [no description available] | medium | 13 | 0 | homodetic cyclic peptide | |
glucose, (beta-d)-isomer | [no description available] | medium | 6 | 0 | D-glucopyranose | epitope; mouse metabolite |
protocatechuic acid | [no description available] | medium | 3 | 0 | catechols; dihydroxybenzoic acid | antineoplastic agent; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor; human xenobiotic metabolite; plant metabolite |
kaempferol | [no description available] | medium | 2 | 0 | 7-hydroxyflavonol; flavonols; tetrahydroxyflavone | antibacterial agent; geroprotector; human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; plant metabolite |
quercitrin | [no description available] | medium | 1 | 0 | alpha-L-rhamnoside; monosaccharide derivative; quercetin O-glycoside; tetrahydroxyflavone | antileishmanial agent; antioxidant; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.14.18.1 (tyrosinase) inhibitor; plant metabolite |
chromium histidinate | [no description available] | medium | 1 | 0 | | |
9-mercaptodethiobiotin | [no description available] | medium | 6 | 0 | imidazolidinone; monocarboxylic acid; thiol; ureas | Escherichia coli metabolite |
zinc sulfate | [no description available] | medium | 1 | 0 | metal sulfate; zinc molecular entity | fertilizer |
taurine | [no description available] | medium | 4 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
hypotaurine | [no description available] | medium | 1 | 0 | aminosulfinic acid; zwitterion | human metabolite; metabolite; mouse metabolite |
beta-alanine | [no description available] | medium | 3 | 0 | amino acid zwitterion; beta-amino acid | agonist; fundamental metabolite; human metabolite; inhibitor; neurotransmitter |
st 1481 | [no description available] | medium | 1 | 0 | | |
galactose | [no description available] | medium | 29 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
peroxynitrous acid | [no description available] | medium | 4 | 0 | nitrogen oxoacid | |
linsidomine | [no description available] | medium | 1 | 0 | morpholines | |
tetradecanoylphorbol acetate | [no description available] | medium | 15 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
glycerophosphoinositol 4,5-bisphosphate | [no description available] | medium | 3 | 0 | | |
n-formylmethionine leucyl-phenylalanine | [no description available] | medium | 3 | 0 | tripeptide | |
dapi | [no description available] | medium | 22 | 0 | indoles | fluorochrome |
mechlorethamine | [no description available] | medium | 3 | 0 | nitrogen mustard; organochlorine compound | alkylating agent |
lactobionic acid | [no description available] | medium | 1 | 0 | disaccharide | antioxidant |
5-ethynyl-2'-deoxyuridine | [no description available] | medium | 2 | 0 | | |
n-(2-hydroxypropyl)methacrylamide | [no description available] | medium | 3 | 0 | | |
5-bromouridine | [no description available] | medium | 1 | 0 | uridines | mutagen |
eniluracil | [no description available] | medium | 1 | 0 | pyrimidone | |
rhodamine b | [no description available] | medium | 5 | 0 | organic chloride salt; xanthene dye | fluorescent probe; fluorochrome; histological dye |
mycobacidin | [no description available] | medium | 9 | 0 | | |
thiazolidines | [no description available] | medium | 12 | 0 | thiazolidine | |
thiocyanate | [no description available] | medium | 1 | 0 | pseudohalide anion; sulfur molecular entity | human metabolite |
glycidyl methacrylate | [no description available] | medium | 2 | 0 | enoate ester; epoxide | |
artemisinin | [no description available] | medium | 2 | 0 | organic peroxide; sesquiterpene lactone | antimalarial; plant metabolite |
4-mercaptobenzoate | [no description available] | medium | 1 | 0 | | |
pyrimidine dimers | [no description available] | medium | 5 | 0 | | |
nephrin | [no description available] | medium | 1 | 0 | | |
kemptide | [no description available] | medium | 1 | 0 | | |
rtki cpd | [no description available] | medium | 2 | 0 | | |
quinazolines | [no description available] | medium | 8 | 1 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; quinazolines | |
losartan potassium | [no description available] | medium | 14 | 0 | | |
lactamide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; secondary alcohol | |
clenbuterol | [no description available] | medium | 2 | 0 | amino alcohol; dichlorobenzene; ethanolamines; primary arylamine; secondary amino compound; substituted aniline | beta-adrenergic agonist; bronchodilator agent; sympathomimetic agent |
homocysteine | [no description available] | medium | 7 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
triiodothyronine | [no description available] | medium | 1 | 0 | tetrahydrothiophenes; thiolactone | human metabolite |
sulfur | [no description available] | medium | 46 | 0 | chalcogen; nonmetal atom | macronutrient |
orabase | [no description available] | medium | 2 | 0 | | |
boron | [no description available] | medium | 4 | 0 | boron group element atom; metalloid atom; nonmetal atom | micronutrient |
fluorosulfonic acid | [no description available] | medium | 1 | 0 | sulfur oxoacid | NMR solvent |
1,2-diphytanoylphosphatidylcholine | [no description available] | medium | 1 | 0 | | |
Harringtonine | [no description available] | medium | 1 | 0 | alkaloid | |
pyridine-2-carboxaldehyde | [no description available] | medium | 1 | 0 | pyridinecarbaldehyde | |
guanine | [no description available] | medium | 10 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
8-hydroxyguanine | [no description available] | medium | 2 | 0 | oxopurine | |
aminoflavone | [no description available] | medium | 1 | 0 | | |
nutlin-3a | [no description available] | medium | 1 | 0 | stilbenoid | |
nile red | [no description available] | medium | 2 | 0 | aromatic amine; cyclic ketone; organic heterotetracyclic compound; tertiary amino compound | fluorochrome; histological dye |
tetramethylrhodamine isothiocyanate | [no description available] | medium | 6 | 0 | | |
n-(4-(7-(diethylamino)-4-methylcoumarin-3-yl))maleimide | [no description available] | medium | 1 | 0 | | |
glucagon-like peptide 1 | [no description available] | medium | 4 | 0 | | |
cobalt | [no description available] | medium | 22 | 0 | cobalt group element atom; metal allergen | micronutrient |
laponite | [no description available] | medium | 1 | 0 | | |
n1'-carboxybiotin | [no description available] | medium | 17 | 0 | | |
dimethylsulfonioacetate | [no description available] | medium | 1 | 0 | sulfonium betaine | |
phosphorylcholine | [no description available] | medium | 6 | 0 | phosphocholines | allergen; epitope; hapten; human metabolite; mouse metabolite |
biotinamide | [no description available] | high | 22 | 0 | biotins; monocarboxylic acid amide | human metabolite |
tryptophanhydroxamate | [no description available] | medium | 1 | 0 | | |
acrylic acid | [no description available] | medium | 13 | 0 | alpha,beta-unsaturated monocarboxylic acid | metabolite |
fmrfamide | [no description available] | medium | 4 | 0 | | |
hydroxylamine | [no description available] | medium | 8 | 0 | hydroxylamines | algal metabolite; bacterial xenobiotic metabolite; EC 1.1.3.13 (alcohol oxidase) inhibitor; EC 4.2.1.22 (cystathionine beta-synthase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; nitric oxide donor; nucleophilic reagent |
deoxycytidine | [no description available] | medium | 5 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
coumarin | [no description available] | medium | 4 | 0 | coumarins | fluorescent dye; human metabolite; plant metabolite |
gemcitabine | [no description available] | medium | 2 | 0 | organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; environmental contaminant; immunosuppressive agent; photosensitizing agent; prodrug; radiosensitizing agent; xenobiotic |
beta-endorphin | [no description available] | medium | 9 | 0 | | |
leptin | [no description available] | medium | 5 | 0 | | |
lactoferrin | [no description available] | medium | 13 | 0 | | |
rhodium | [no description available] | medium | 9 | 0 | cobalt group element atom | |
dabigatran | [no description available] | medium | 4 | 0 | aromatic amide; benzimidazoles; beta-alanine derivative; carboxamidine; pyridines | anticoagulant; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; EC 3.4.21.5 (thrombin) inhibitor |
rivaroxaban | [no description available] | medium | 3 | 0 | aromatic amide; lactam; monocarboxylic acid amide; morpholines; organochlorine compound; oxazolidinone; thiophenes | anticoagulant; EC 3.4.21.6 (coagulation factor Xa) inhibitor |
thiazoles | [no description available] | medium | 30 | 0 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
apixaban | [no description available] | medium | 4 | 0 | aromatic ether; lactam; piperidones; pyrazolopyridine | anticoagulant; EC 3.4.21.6 (coagulation factor Xa) inhibitor |
edoxaban | [no description available] | medium | 3 | 0 | chloropyridine; monocarboxylic acid amide; tertiary amino compound; thiazolopyridine | anticoagulant; EC 3.4.21.6 (coagulation factor Xa) inhibitor; platelet aggregation inhibitor |
ethylene diurea | [no description available] | medium | 1 | 0 | | |
kiss1 protein, human | [no description available] | medium | 1 | 0 | | |
zirconium | [no description available] | medium | 1 | 0 | titanium group element atom | |
3,4-dihydroxyphenylglycol | [no description available] | medium | 1 | 0 | catechols; tetrol | metabolite; mouse metabolite |
fg 9041 | [no description available] | medium | 6 | 0 | quinoxaline derivative | |
methoxyhydroxyphenylglycol | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | |
bicuculline methiodide | [no description available] | medium | 3 | 0 | | |
bicuculline | [no description available] | medium | 16 | 0 | benzylisoquinoline alkaloid; isoquinoline alkaloid; isoquinolines | agrochemical; central nervous system stimulant; GABA-gated chloride channel antagonist; GABAA receptor antagonist; neurotoxin |
quinoxalines | [no description available] | medium | 12 | 0 | mancude organic heterobicyclic parent; naphthyridine; ortho-fused heteroarene | |
ezogabine | [no description available] | medium | 1 | 0 | carbamate ester; organofluorine compound; secondary amino compound; substituted aniline | anticonvulsant; potassium channel modulator |
nitroaniline | [no description available] | medium | 1 | 0 | | |
s-nitroso-n-acetylpenicillamine | [no description available] | medium | 5 | 0 | nitroso compound; nitrosothio compound | nitric oxide donor; vasodilator agent |
carbamates | [no description available] | medium | 16 | 0 | amino-acid anion | |
xe 991, anthracenone | [no description available] | medium | 1 | 0 | anthracenes | |
1,3-dihydroxy-4,4,5,5-tetramethyl-2-(4-carboxyphenyl)tetrahydroimidazole | [no description available] | medium | 1 | 0 | benzoic acid; imidazolines; organic radical | apoptosis inhibitor; radical scavenger |
methyl methanethiosulfonate | [no description available] | medium | 2 | 0 | sulfonic acid derivative; thiosulfonate ester | metabolite |
methyl methanesulfonate | [no description available] | medium | 6 | 0 | methanesulfonate ester | alkylating agent; apoptosis inducer; carcinogenic agent; genotoxin; mutagen |
methanethiosulfonate | [no description available] | medium | 6 | 0 | | |
arginyl-glycyl-aspartic acid | [no description available] | medium | 20 | 0 | oligopeptide | |
1,3-bis(bis(pyridin-2-ylmethyl)amino)propan-2-ol | [no description available] | medium | 3 | 0 | | |
indolebutyric acid | [no description available] | medium | 2 | 0 | indol-3-yl carboxylic acid | auxin; plant hormone; plant metabolite |
sk&f 81297 | [no description available] | medium | 1 | 0 | benzazepine | |
2,10,11-trihydroxy-n-n-propylnoraporphine | [no description available] | medium | 1 | 0 | | |
cyclen | [no description available] | medium | 2 | 0 | azacycloalkane; crown amine; saturated organic heteromonocyclic parent | |
substance p | [no description available] | medium | 23 | 0 | peptide | neurokinin-1 receptor agonist; neurotransmitter; vasodilator agent |
terbium | [no description available] | medium | 8 | 0 | f-block element atom; lanthanoid atom | |
mannosamine | [no description available] | medium | 3 | 0 | D-mannosamine | |
sr 95531 | [no description available] | medium | 4 | 0 | methoxybenzenes | |
naratriptan | [no description available] | medium | 1 | 0 | heteroarylpiperidine; sulfonamide; tryptamines | serotonergic agonist; vasoconstrictor agent |
stilbenes | [no description available] | medium | 4 | 0 | stilbene | |
decanoic acid | [no description available] | medium | 2 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; anti-inflammatory agent; antibacterial agent; human metabolite; plant metabolite; volatile oil component |
1-ethynylpyrene | [no description available] | medium | 2 | 0 | | |
epoxomicin | [no description available] | medium | 1 | 0 | morpholines; tripeptide | proteasome inhibitor |
carbamylhydrazine | [no description available] | medium | 1 | 0 | carbohydrazide; monocarboxylic acid amide; one-carbon compound; ureas | |
n-biotinoyl-n'-iodoacetylethylenediamine | [no description available] | medium | 6 | 0 | | |
toxin ii (anemonia sulcata) | [no description available] | medium | 1 | 0 | | |
selenomethionine | [no description available] | medium | 1 | 0 | selenoamino acid; selenomethionines | plant metabolite |
methanol | [no description available] | medium | 14 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
go 6976 | [no description available] | medium | 1 | 0 | indolocarbazole; organic heterohexacyclic compound | EC 2.7.11.13 (protein kinase C) inhibitor |
dalteparin | [no description available] | medium | 3 | 2 | | |
paxilline | [no description available] | medium | 1 | 0 | diterpene alkaloid; enone; organic heterohexacyclic compound; terpenoid indole alkaloid; tertiary alcohol | anticonvulsant; Aspergillus metabolite; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor; genotoxin; geroprotector; mycotoxin; Penicillium metabolite; potassium channel blocker |
erythritol | [no description available] | medium | 2 | 0 | butane-1,2,3,4-tetrol | antioxidant; human metabolite; plant metabolite |
maculosin | [no description available] | medium | 1 | 0 | dipeptide; homodetic cyclic peptide; phenols; pyrrolopyrazine | metabolite |
2-c-methylerythritol 4-phosphate | [no description available] | medium | 1 | 0 | tetritol phosphate | Escherichia coli metabolite |
thapsigargin | [no description available] | medium | 2 | 0 | butyrate ester; organic heterotricyclic compound; sesquiterpene lactone | calcium channel blocker; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor |
agar | [no description available] | medium | 10 | 0 | | |
carbene | [no description available] | medium | 3 | 0 | carbene; methanediyl | |
phenylnitrene | [no description available] | medium | 1 | 0 | | |
deuterium oxide | [no description available] | medium | 1 | 0 | deuterated compound; water | NMR solvent |
2-chlorotrityl chloride | [no description available] | medium | 1 | 0 | | |
malic acid | [no description available] | medium | 3 | 0 | 2-hydroxydicarboxylic acid; C4-dicarboxylic acid | food acidity regulator; fundamental metabolite |
fumaric acid | [no description available] | medium | 1 | 0 | butenedioic acid | food acidity regulator; fundamental metabolite; geroprotector |
fumarates | [no description available] | medium | 3 | 0 | butenedioate; C4-dicarboxylate | human metabolite; metabolite; Saccharomyces cerevisiae metabolite |
luminol | [no description available] | medium | 20 | 0 | | |
indium arsenide | [no description available] | medium | 1 | 0 | | |
pyocyanine | [no description available] | medium | 1 | 0 | iminium betaine; phenazines | antibacterial agent; bacterial metabolite; biological pigment; virulence factor |
phosphoramidite | [no description available] | medium | 6 | 0 | | |
e 64 | [no description available] | medium | 3 | 0 | dicarboxylic acid monoamide; epoxy monocarboxylic acid; guanidines; L-leucine derivative; zwitterion | antimalarial; antiparasitic agent; protease inhibitor |
leucine | [no description available] | medium | 51 | 1 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
s-nitrosocysteine | [no description available] | medium | 10 | 0 | L-cysteine derivative; nitrosothio compound | hematologic agent; platelet aggregation inhibitor; vasodilator agent |
carnosine | [no description available] | medium | 1 | 0 | amino acid zwitterion; dipeptide | anticonvulsant; antineoplastic agent; antioxidant; Daphnia magna metabolite; geroprotector; human metabolite; mouse metabolite; neuroprotective agent |
n-biotinylaminoethyl methanethiosulfonate | [no description available] | medium | 10 | 0 | | |
glutaric acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | Daphnia magna metabolite; human metabolite |
asparagine | [no description available] | medium | 20 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
bathocuproine | [no description available] | medium | 1 | 0 | | |
thiophene-3-boronic acid | [no description available] | medium | 1 | 0 | | |
dimyristoylphosphatidylcholine | [no description available] | medium | 8 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine; phosphatidylcholine 28:0; tetradecanoate ester | antigen; mouse metabolite |
silicon nitride | [no description available] | medium | 7 | 0 | | |
palmitoyl chloride | [no description available] | medium | 1 | 0 | | |
ethylenediamine | [no description available] | medium | 6 | 0 | alkane-alpha,omega-diamine | GABA agonist |
sulfosuccinimidyl-2-(biotinamido)ethyl-1,3-dithiopropionate | [no description available] | medium | 6 | 0 | | |
bisphenol a | [no description available] | medium | 3 | 0 | bisphenol | endocrine disruptor; environmental contaminant; xenobiotic; xenoestrogen |
choline | [no description available] | medium | 52 | 1 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
tetrabromobisphenol a | [no description available] | medium | 1 | 0 | brominated flame retardant; bromobisphenol | |
hepes | [no description available] | medium | 2 | 0 | HEPES; organosulfonic acid | |
lycopene | [no description available] | medium | 1 | 0 | acyclic carotene | antioxidant; plant metabolite |
succinic acid | [no description available] | medium | 10 | 0 | alpha,omega-dicarboxylic acid; C4-dicarboxylic acid | anti-ulcer drug; fundamental metabolite; micronutrient; nutraceutical; radiation protective agent |
mafenide | [no description available] | medium | 1 | 0 | aromatic amine | |
oseltamivir | [no description available] | medium | 2 | 0 | acetamides; amino acid ester; cyclohexenecarboxylate ester; primary amino compound | antiviral drug; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; environmental contaminant; prodrug; xenobiotic |
selenium | [no description available] | medium | 18 | 0 | chalcogen; nonmetal atom | micronutrient |
5-fluorotryptophan | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid; organofluorine compound; tryptophan derivative | |
6-fluorotryptophan | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
n-methylaspartate | [no description available] | medium | 13 | 0 | amino dicarboxylic acid; D-alpha-amino acid; D-aspartic acid derivative; secondary amino compound | neurotransmitter agent |
urethane | [no description available] | medium | 3 | 0 | carbamate ester | fungal metabolite; mutagen |
thymine | [no description available] | medium | 4 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
n,n'-methylenebisacrylamide | [no description available] | medium | 1 | 0 | | |
benzophenone | [no description available] | medium | 7 | 0 | benzophenones | photosensitizing agent; plant metabolite |
biotin methyl ester | [no description available] | medium | 4 | 0 | | |
c.i. 42510 | [no description available] | medium | 7 | 0 | | |
coomassie brilliant blue | [no description available] | medium | 3 | 0 | | |
thymosin beta(4) | [no description available] | medium | 1 | 0 | | |
thymosin | [no description available] | medium | 2 | 0 | | |
erlotinib hydrochloride | [no description available] | medium | 1 | 1 | hydrochloride; terminal acetylenic compound | antineoplastic agent; protein kinase inhibitor |
thulium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
yttrium | [no description available] | medium | 3 | 0 | d-block element atom; rare earth metal atom; scandium group element atom | |
ytterbium | [no description available] | medium | 3 | 0 | f-block element atom; lanthanoid atom | |
n-methylisatoic anhydride | [no description available] | medium | 1 | 0 | benzoxazine | |
2-azahypoxanthine | [no description available] | medium | 1 | 0 | | |
sulfuryl fluoride | [no description available] | medium | 1 | 0 | sulfuryl halide | fumigant insecticide |
tellurium | [no description available] | medium | 7 | 0 | chalcogen; metalloid atom | |
cadmium telluride | [no description available] | medium | 5 | 0 | | |
diadenosine tetraphosphate | [no description available] | medium | 3 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
spliceosomal peptide p140 | [no description available] | medium | 1 | 0 | | |
guanosine triphosphate | [no description available] | medium | 17 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
guanosine diphosphate | [no description available] | medium | 6 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
lysophosphatidylcholines | [no description available] | medium | 5 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine | |
lead sulfide | [no description available] | medium | 1 | 0 | | |
4-mercaptophenylboronic acid | [no description available] | medium | 1 | 0 | | |
tris(2,3-dibromopropyl)isocyanurate | [no description available] | medium | 1 | 0 | | |
ferrous chloride | [no description available] | medium | 1 | 0 | iron coordination entity | |
deoxyguanosine | [no description available] | medium | 8 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
8-hydroxy-2'-deoxyguanosine | [no description available] | medium | 4 | 0 | guanosines | biomarker |
n-(1-(2,3-dioleyloxy)propyl)-n,n,n-trimethylammonium chloride | [no description available] | medium | 1 | 0 | | |
dichlorvos | [no description available] | medium | 2 | 0 | alkenyl phosphate; dialkyl phosphate; organochlorine acaricide; organophosphate insecticide | anthelminthic drug; antibacterial agent; antifungal agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor |
h 89 | [no description available] | medium | 1 | 0 | N-[2-(4-bromocinnamylamino)ethyl]isoquinoline-5-sulfonamide | |
malonyl coenzyme a | [no description available] | medium | 12 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
3-(2-carboxypiperazin-4-yl)propyl-1-phosphonic acid | [no description available] | medium | 3 | 0 | | |
6-cyano-7-nitroquinoxaline-2,3-dione | [no description available] | medium | 12 | 0 | quinoxaline derivative | |
macrosphelide a | [no description available] | medium | 1 | 0 | | |
3-hydroxyisovalerylcarnitine | [no description available] | medium | 10 | 0 | O-acylcarnitine | human metabolite |
3-hydroxyisovalerylcarnitine | [no description available] | medium | 10 | 2 | O-acylcarnitine | human metabolite |
alpha-chymotrypsin | [no description available] | medium | 24 | 0 | | |
oxamic acid | [no description available] | medium | 2 | 0 | dicarboxylic acid monoamide | Escherichia coli metabolite |
cholesterol alpha-oxide | [no description available] | medium | 1 | 0 | 3beta-hydroxy steroid; epoxy steroid; oxysterol | |
azidohomoalanine | [no description available] | medium | 3 | 0 | | |
strontium | [no description available] | medium | 1 | 0 | alkaline earth metal atom | |
n-hexadecane | [no description available] | medium | 1 | 0 | long-chain alkane | non-polar solvent; plant metabolite; volatile oil component |
magnesium sulfate | [no description available] | medium | 6 | 0 | magnesium salt; metal sulfate; organic magnesium salt | anaesthetic; analgesic; anti-arrhythmia drug; anticonvulsant; calcium channel blocker; cardiovascular drug; fertilizer; tocolytic agent |
potassium chloride | [no description available] | medium | 13 | 0 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
2-naphthylamine | [no description available] | medium | 2 | 0 | naphthylamine | carcinogenic agent |
vasoactive intestinal peptide | [no description available] | medium | 11 | 0 | | |
texas red | [no description available] | medium | 16 | 0 | organic heteroheptacyclic compound | fluorochrome |
xanthenes | [no description available] | medium | 19 | 0 | xanthene | |
dimethyl phthalate | [no description available] | medium | 1 | 0 | diester; methyl ester; phthalate ester | |
8-hydroxy-2-(di-n-propylamino)tetralin | [no description available] | medium | 3 | 0 | phenols; tertiary amino compound; tetralins | serotonergic antagonist |
7-keto-8-aminopelargonic acid | [no description available] | medium | 13 | 0 | 7-oxo monocarboxylic acid; amino acid zwitterion; amino acid | Saccharomyces cerevisiae metabolite |
osw 1 | [no description available] | medium | 2 | 0 | | |
propionylcarnitine | [no description available] | medium | 2 | 0 | O-acylcarnitine | analgesic; antirheumatic drug; cardiotonic drug; human metabolite; peripheral nervous system drug |
ficusin | [no description available] | medium | 7 | 0 | psoralens | plant metabolite |
gamma-glycidoxypropyltrimethoxysilane | [no description available] | medium | 1 | 0 | | |
oridonin | [no description available] | medium | 1 | 0 | | |
allatostatin 1 | [no description available] | medium | 2 | 0 | | |
allatotropin | [no description available] | medium | 1 | 0 | | |
zinc chloride | [no description available] | medium | 2 | 0 | inorganic chloride; zinc molecular entity | astringent; disinfectant; EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor; Lewis acid |
copper sulfate | [no description available] | medium | 1 | 0 | metal sulfate | emetic; fertilizer; sensitiser |
egtazic acid | [no description available] | medium | 1 | 0 | diether; tertiary amino compound; tetracarboxylic acid | chelator |
chlorine | [no description available] | medium | 17 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
amyloid beta-peptides | [no description available] | medium | 2 | 0 | | |
technetium | [no description available] | medium | 17 | 0 | manganese group element atom | |
1-palmitoyl-2-oleoylphosphatidylcholine | [no description available] | medium | 6 | 0 | | |
1-palmitoyl-2-oleoylglycero-3-phosphoserine | [no description available] | medium | 1 | 0 | 3-sn-phosphatidyl-L-serine | |
isatoic anhydride | [no description available] | medium | 1 | 0 | | |
pyridine | [no description available] | medium | 6 | 0 | azaarene; mancude organic heteromonocyclic parent; monocyclic heteroarene; pyridines | environmental contaminant; NMR chemical shift reference compound |
15-deoxy-delta(12,14)-prostaglandin j2 | [no description available] | medium | 1 | 0 | prostaglandins J | electrophilic reagent; insulin-sensitizing drug; metabolite |
prostaglandin d2 | [no description available] | medium | 2 | 0 | prostaglandins D | human metabolite; mouse metabolite |
4-cyano-4'-pentylbiphenyl | [no description available] | medium | 3 | 0 | | |
dimedone | [no description available] | medium | 4 | 0 | | |
tiletamine hydrochloride | [no description available] | medium | 6 | 0 | | |
1,2-dipalmitoyl-3-phosphatidylethanolamine | [no description available] | medium | 8 | 0 | | |
cyanoacetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | |
sodium sulfide | [no description available] | medium | 5 | 0 | | |
methylsulfonyl benzothiazole | [no description available] | medium | 1 | 0 | | |
neocuproine | [no description available] | medium | 1 | 0 | phenanthrolines | chelator; copper chelator |
gyy 4137 | [no description available] | medium | 1 | 0 | organic molecular entity | |
tetraphenylborate | [no description available] | medium | 1 | 0 | | |
acetylene | [no description available] | medium | 4 | 0 | alkyne; gas molecular entity; terminal acetylenic compound | |
beta-lactams | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; beta-lactam | |
hydroxyl radical | [no description available] | medium | 3 | 0 | oxygen hydride; oxygen radical; reactive oxygen species | |
dichlororibofuranosylbenzimidazole | [no description available] | medium | 2 | 0 | | |
deoxyuridine triphosphate | [no description available] | medium | 25 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
benzeneboronic acid | [no description available] | medium | 1 | 0 | boronic acids | |
Alexa Fluor 555 | [no description available] | medium | 1 | 0 | xanthenes | fluorochrome |
atto655 | [no description available] | medium | 1 | 0 | | |
iodine | [no description available] | medium | 4 | 0 | halide anion; monoatomic iodine | human metabolite |
1,2-naphthoquinone | [no description available] | medium | 1 | 0 | 1,2-naphthoquinones | aryl hydrocarbon receptor agonist; carcinogenic agent |
1,4-naphthoquinone | [no description available] | medium | 2 | 0 | 1,4-naphthoquinones | |
methylene blue | [no description available] | medium | 5 | 0 | organic chloride salt | acid-base indicator; antidepressant; antimalarial; antimicrobial agent; antioxidant; cardioprotective agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 4.6.1.2 (guanylate cyclase) inhibitor; fluorochrome; histological dye; neuroprotective agent; physical tracer |
phosphonoacetamide | [no description available] | medium | 1 | 0 | | |
hydrogen carbonate | [no description available] | medium | 49 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-adenylyl (beta,gamma-methylene)diphosphonate | [no description available] | medium | 1 | 0 | nucleoside triphosphate analogue | |
tricalcium phosphate | [no description available] | medium | 8 | 0 | calcium phosphate | |
imidacloprid | [no description available] | medium | 1 | 0 | imidacloprid; imidazolidines; monochloropyridine | environmental contaminant; genotoxin; neonicotinoid insectide; nicotinic acetylcholine receptor agonist; xenobiotic |
8-azidoadenosine 5'-triphosphate | [no description available] | medium | 1 | 0 | | |
trientine | [no description available] | medium | 1 | 0 | polyazaalkane; tetramine | copper chelator |
aspartic acid | [no description available] | medium | 61 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
entecavir | [no description available] | medium | 1 | 0 | benzamides; N-acylpiperidine | |
n-(6-(biotinamido)hexyl)-3'-(2'-pyridyldithio)propionamide | [no description available] | medium | 5 | 0 | | |
deanol | [no description available] | medium | 1 | 0 | ethanolamines; tertiary amine | curing agent; radical scavenger |
bisabolol | [no description available] | medium | 1 | 0 | | |
sesquiterpenes | [no description available] | medium | 7 | 0 | | |
benzoylphenylalanine | [no description available] | medium | 6 | 0 | 2-(benzoylamino)-3-phenylpropanoic acid; N-acyl-L-phenylalanine | |
bicyclo(2.2.2)octane | [no description available] | medium | 1 | 0 | | |
gibberellins | [no description available] | medium | 3 | 0 | | |
lupane | [no description available] | medium | 1 | 0 | | |
triethylene glycol | [no description available] | medium | 4 | 0 | diol; poly(ethylene glycol); primary alcohol | plasticiser |
digitonin | [no description available] | medium | 4 | 0 | | |
arsenic trioxide | [no description available] | medium | 1 | 0 | | |
xanthurenic acid | [no description available] | medium | 1 | 0 | dihydroxyquinoline; quinolinemonocarboxylic acid | animal metabolite; iron chelator; metabotropic glutamate receptor agonist; vesicular glutamate transport inhibitor |
tartronic acid | [no description available] | medium | 1 | 0 | dicarboxylic acid; dicarboxylic fatty acid | plant metabolite |
xanthine | [no description available] | medium | 2 | 0 | xanthine | Saccharomyces cerevisiae metabolite |
hydracrylic acid | [no description available] | medium | 7 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
hydracrylic acid | [no description available] | medium | 7 | 1 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
isopropyl thiogalactoside | [no description available] | medium | 3 | 0 | S-glycosyl compound | |
tubercidin | [no description available] | medium | 1 | 0 | antibiotic antifungal agent; N-glycosylpyrrolopyrimidine; ribonucleoside | antimetabolite; antineoplastic agent; bacterial metabolite |
monomethyl auristatin e | [no description available] | medium | 2 | 0 | | |
win 18446 | [no description available] | medium | 1 | 0 | organochlorine compound; secondary carboxamide | EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor |
sphingosine | [no description available] | medium | 4 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
pirlimycin | [no description available] | medium | 1 | 0 | | |
1-palmitoyl-2-linoleoylphosphatidylcholine | [no description available] | medium | 1 | 0 | | |
silvestrol | [no description available] | medium | 1 | 0 | dioxanes; ether; methyl ester; organic heterotricyclic compound | antineoplastic agent; metabolite |
dithionite | [no description available] | medium | 3 | 0 | sulfur oxide; sulfur oxoanion | |
3-aminobenzeneboronic acid | [no description available] | medium | 2 | 0 | | |
1-butanol | [no description available] | medium | 2 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
hexafluorobenzene | [no description available] | medium | 1 | 0 | fluorobenzenes; fluorocarbon | NMR chemical shift reference compound |
simethicone | [no description available] | medium | 1 | 0 | | |
lysyllysine | [no description available] | medium | 1 | 0 | dipeptide | Mycoplasma genitalium metabolite |
casein kinase ii | [no description available] | medium | 3 | 0 | | |
gusperimus | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
filipin | [no description available] | medium | 1 | 0 | | |
cytochalasin d | [no description available] | medium | 6 | 0 | | |
ammonium chloride | [no description available] | medium | 11 | 0 | ammonium salt; inorganic chloride | ferroptosis inhibitor |
echinocandin b | [no description available] | medium | 1 | 0 | | |
6-(n-(4-aminobutyl)-n-ethyl)amino-2,3-dihydrophthalazine-1,4-dione | [no description available] | medium | 3 | 0 | phthalazines | |
nadp | [no description available] | medium | 22 | 0 | | |
aminoacetonitrile | [no description available] | medium | 1 | 0 | | |
tris(2-carboxyethyl)phosphine | [no description available] | medium | 3 | 0 | phosphine derivative; tricarboxylic acid | reducing agent |
dodecylamine | [no description available] | medium | 1 | 0 | primary aliphatic amine | |
benzylaminopurine | [no description available] | medium | 1 | 0 | 6-aminopurines | cytokinin; plant metabolite |
s-adenosylhomocysteine | [no description available] | medium | 2 | 0 | adenosines; amino acid zwitterion; homocysteine derivative; homocysteines; organic sulfide | cofactor; EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor; EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor; epitope; fundamental metabolite |
oxytocin | [no description available] | medium | 11 | 0 | heterodetic cyclic peptide; peptide hormone | oxytocic; vasodilator agent |
carbazole | [no description available] | medium | 1 | 0 | carbazole | |
thiocysteine | [no description available] | medium | 1 | 0 | amino acid zwitterion; S-substituted L-cysteine | human metabolite; mouse metabolite |
cyanates | [no description available] | medium | 8 | 0 | | |
semapimod | [no description available] | medium | 1 | 0 | | |
chalcone | [no description available] | medium | 1 | 0 | chalcone | EC 3.2.1.1 (alpha-amylase) inhibitor |
threonine | [no description available] | medium | 22 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
isoleucine | [no description available] | medium | 12 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
adenylosuccinate | [no description available] | medium | 1 | 0 | | |
valine | [no description available] | medium | 15 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
4-azidobenzylcarazolol | [no description available] | medium | 1 | 0 | | |
myristic acid | [no description available] | medium | 5 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite |
tak 779 | [no description available] | medium | 1 | 0 | | |
docusate sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
vanadium | [no description available] | medium | 2 | 0 | elemental vanadium; vanadium group element atom | micronutrient |
chromium | [no description available] | medium | 12 | 2 | chromium group element atom; metal allergen | micronutrient |
photobiotin | [no description available] | medium | 36 | 0 | | |
dihydro-beta-erythroidine | [no description available] | medium | 1 | 0 | delta-lactone; organic heterotetracyclic compound; tertiary amino compound | nicotinic antagonist |
nandrolone | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; anabolic androgenic steroid | human metabolite |
niclosamide | [no description available] | medium | 1 | 0 | benzamides; C-nitro compound; monochlorobenzenes; salicylanilides; secondary carboxamide | anthelminthic drug; anticoronaviral agent; antiparasitic agent; apoptosis inducer; molluscicide; piscicide; STAT3 inhibitor |
poloxalene | [no description available] | medium | 2 | 0 | epoxide | |
sodium bisulfide | [no description available] | medium | 1 | 0 | | |
g(m1) ganglioside | [no description available] | medium | 16 | 0 | alpha-N-acetylneuraminosyl-(2->3)-[beta-D-galactosyl-(1->3)-N-acetyl-beta-D-galactosaminyl-(1->4)]-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-N-acylsphingosine; sialotetraosylceramide | |
azobenzene | [no description available] | medium | 3 | 0 | azobenzenes | |
maleic anhydride | [no description available] | medium | 2 | 0 | cyclic dicarboxylic anhydride; furans | allergen |
xenon | [no description available] | medium | 4 | 0 | monoatomic xenon; noble gas atom; p-block element atom | |
4,4'-diisothiocyanostilbene-2,2'-disulfonic acid | [no description available] | medium | 3 | 0 | | |
phosphorus | [no description available] | medium | 18 | 0 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
5,6-dihydroorotate | [no description available] | medium | 1 | 0 | monocarboxylic acid; N-acylurea; pyrimidinemonocarboxylic acid; secondary amide | |
pyrimidine | [no description available] | medium | 3 | 0 | diazine; pyrimidines | Daphnia magna metabolite |
biotin sulfone | [no description available] | medium | 10 | 0 | biotins; sulfone | metabolite |
buthionine sulfoximine | [no description available] | medium | 2 | 0 | diastereoisomeric mixture; homocysteines; non-proteinogenic alpha-amino acid; sulfoximide | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
tariquidar | [no description available] | medium | 2 | 0 | benzamides | |
lipofectamine | [no description available] | medium | 1 | 0 | | |
1-naphthylamine | [no description available] | medium | 1 | 0 | naphthylamine | human xenobiotic metabolite |
4-amino-1,8-naphthalimide | [no description available] | medium | 1 | 0 | benzoisoquinoline; dicarboximide | |
carbostyril | [no description available] | medium | 3 | 0 | monohydroxyquinoline; quinolone | bacterial xenobiotic metabolite |
sudan black b | [no description available] | medium | 1 | 0 | azobenzenes; bis(azo) compound; perimidines | histological dye |
tungsten | [no description available] | medium | 3 | 0 | chromium group element atom | micronutrient |
zeolites | [no description available] | medium | 1 | 0 | | |
terephthalic acid | [no description available] | medium | 1 | 0 | benzenedicarboxylic acid | |
enbucrilate | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; nitrile | |
5,7-dihydroxy-6-methoxy-2-phenylchromen-4-one | [no description available] | medium | 1 | 0 | dihydroxyflavone; monomethoxyflavone | antineoplastic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor |
enkephalin, leucine | [no description available] | medium | 15 | 0 | pentapeptide; peptide zwitterion | analgesic; delta-opioid receptor agonist; human metabolite; mu-opioid receptor agonist; neurotransmitter; rat metabolite |
gallium | [no description available] | medium | 3 | 0 | boron group element atom | |
gallium phosphide | [no description available] | medium | 1 | 0 | | |
beta-methylcrotonylglycine | [no description available] | medium | 10 | 0 | N-acylglycine | metabolite |
bradykinin | [no description available] | medium | 7 | 0 | oligopeptide | human blood serum metabolite; vasodilator agent |
fibrin | [no description available] | medium | 5 | 0 | peptide | |
cyclam | [no description available] | medium | 4 | 0 | azacycloalkane; crown amine; saturated organic heteromonocyclic parent | |
gallium nitride | [no description available] | medium | 2 | 0 | | |
deuterium | [no description available] | medium | 8 | 0 | dihydrogen | |
hydrogen | [no description available] | medium | 12 | 0 | elemental hydrogen; elemental molecule; gas molecular entity | antioxidant; electron donor; food packaging gas; fuel; human metabolite |
fluorescamine | [no description available] | medium | 3 | 0 | | |
torcetrapib | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; carbamate ester; quinolines | anticholesteremic drug; CETP inhibitor |
eosine-5-isothiocyanate | [no description available] | medium | 2 | 0 | isothiocyanate; organobromine compound | |
cystinylglycine | [no description available] | medium | 1 | 0 | | |
dithionitrobenzoic acid | [no description available] | medium | 4 | 0 | nitrobenzoic acid; organic disulfide | indicator |
cystine | [no description available] | medium | 14 | 0 | | |
monobromobimane | [no description available] | medium | 1 | 0 | organobromine compound; pyrazolopyrazole | fluorochrome |
undecanoic acid | [no description available] | medium | 1 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antifungal agent; human metabolite |
jasmonic acid | [no description available] | medium | 3 | 0 | oxo monocarboxylic acid | jasmonates; plant metabolite |
amyloid beta-peptides | [no description available] | medium | 6 | 0 | | |
galactosamine | [no description available] | medium | 2 | 0 | D-galactosamine; primary amino compound | toxin |
soman | [no description available] | medium | 3 | 0 | phosphonic ester | |
sarin | [no description available] | medium | 2 | 0 | fluorine molecular entity; phosphinic ester | |
isoflurophate | [no description available] | medium | 4 | 0 | dialkyl phosphate | |
mtt formazan | [no description available] | medium | 1 | 0 | | |
formazans | [no description available] | medium | 1 | 0 | | |
phenylacetylene | [no description available] | medium | 1 | 0 | benzenes | |
phenylazide | [no description available] | medium | 1 | 0 | | |
n-methyl-3,4-methylenedioxyamphetamine | [no description available] | medium | 1 | 0 | amphetamines; benzodioxoles | neurotoxin |
biotin-11-dutp | [no description available] | medium | 27 | 0 | | |
ethyl acetate | [no description available] | medium | 1 | 0 | acetate ester; ethyl ester; volatile organic compound | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor; metabolite; polar aprotic solvent; Saccharomyces cerevisiae metabolite |
thiazolyl blue | [no description available] | medium | 5 | 0 | organic bromide salt | colorimetric reagent; dye |
bromosuccinimide | [no description available] | medium | 2 | 0 | dicarboximide; organobromine compound; pyrrolidinone | reagent |
trioctyl phosphine oxide | [no description available] | medium | 3 | 0 | | |
diepoxybutane | [no description available] | medium | 1 | 0 | epoxide | mutagen |
gentamicin | [no description available] | medium | 5 | 0 | | |
antibiotic g 418 | [no description available] | medium | 1 | 0 | | |
cysteamine | [no description available] | medium | 5 | 0 | amine; thiol | geroprotector; human metabolite; mouse metabolite; radiation protective agent |
alpha-Neup5Ac-(2->3)-beta-D-Galp-(1->4)-[alpha-L-Fucp-(1->3)]-D-GlcpNAc | [no description available] | medium | 7 | 0 | amino tetrasaccharide; glucosamine oligosaccharide | epitope |
exenatide | [no description available] | medium | 2 | 0 | | |
alpha-cyano-4-hydroxycinnamate | [no description available] | medium | 1 | 0 | | |
metribolone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo steroid; anabolic androgenic steroid | androgen |
qx-314 | [no description available] | medium | 4 | 0 | monocarboxylic acid amide | local anaesthetic |
2,3-dioxo-6-nitro-7-sulfamoylbenzo(f)quinoxaline | [no description available] | medium | 4 | 0 | naphthalenes; sulfonic acid derivative | |
nile blue | [no description available] | medium | 1 | 0 | | |
calcitonin | [no description available] | medium | 2 | 0 | | |
ferrous gluconate | [no description available] | medium | 1 | 0 | | |
tetraethylammonium | [no description available] | medium | 3 | 0 | quaternary ammonium ion | |
guanosine 5'-o-(3-thiotriphosphate) | [no description available] | medium | 10 | 0 | nucleoside triphosphate analogue | |
guanosine 5'-o-(2-thiotriphosphate) | [no description available] | medium | 1 | 0 | | |
acetonitrile | [no description available] | medium | 3 | 0 | aliphatic nitrile; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; NMR chemical shift reference compound; polar aprotic solvent |
pqq cofactor | [no description available] | medium | 2 | 0 | orthoquinones; pyrroloquinoline cofactor; tricarboxylic acid | anti-inflammatory agent; antioxidant; cofactor; water-soluble vitamin (role) |
2-amino-5-phosphonovalerate | [no description available] | medium | 10 | 0 | non-proteinogenic alpha-amino acid | NMDA receptor antagonist |
tyrosyl-1,2,3,4-tetrahydro-3-isoquinolinecarbonyl-phenylalanyl-phenylalanine | [no description available] | medium | 1 | 0 | | |
n-(4-dimethylamino-3,5-dinitrophenyl)maleimide | [no description available] | medium | 1 | 0 | | |
bleomycetin | [no description available] | medium | 1 | 0 | | |
gadolinium oxide | [no description available] | medium | 1 | 0 | | |
nitroxyl | [no description available] | medium | 1 | 0 | nitrogen oxoacid | |
brefeldin a | [no description available] | medium | 3 | 0 | macrolide antibiotic | Penicillium metabolite |
carboxy phosphate | [no description available] | medium | 3 | 0 | acyclic mixed acid anhydride; one-carbon compound; organic phosphate | |
metaperiodate | [no description available] | medium | 14 | 0 | iodine oxoacid | |
aniline | [no description available] | medium | 1 | 0 | anilines; primary arylamine | |
metaperiodate | [no description available] | medium | 7 | 0 | iodine oxoanion; monovalent inorganic anion | |
2,4-dinitrophenylhydrazine | [no description available] | medium | 1 | 0 | C-nitro compound; phenylhydrazines | reagent |
sodium borohydride | [no description available] | medium | 2 | 0 | inorganic sodium salt; metal tetrahydridoborate | |
dityrosine | [no description available] | medium | 1 | 0 | biphenyls; non-proteinogenic alpha-amino acid; tyrosine derivative | biomarker |
astatine | [no description available] | medium | 6 | 0 | elemental astatine | |
dodecaborate | [no description available] | medium | 1 | 0 | | |
ibotenic acid | [no description available] | medium | 4 | 0 | non-proteinogenic alpha-amino acid | neurotoxin |
neurotensin | [no description available] | medium | 5 | 0 | peptide hormone | human metabolite; mitogen; neurotransmitter; vulnerary |
cyanuric chloride | [no description available] | medium | 1 | 0 | chloro-1,3,5-triazine; organochlorine compound | cross-linking reagent |
endomorphin 2 | [no description available] | medium | 2 | 0 | | |
endomorphin 1 | [no description available] | medium | 1 | 0 | oligopeptide | |
cobaltous chloride | [no description available] | medium | 3 | 0 | cobalt salt; inorganic chloride | allergen; calcium channel blocker; sensitiser; two-colour indicator |
rolipram | [no description available] | medium | 1 | 0 | pyrrolidin-2-ones | antidepressant; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
ammonium hydroxide | [no description available] | medium | 23 | 1 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
bacteriochlorophylls | [no description available] | medium | 1 | 0 | | |
nitrogenase | [no description available] | medium | 2 | 0 | | |
2,2'-dipyridyl | [no description available] | medium | 10 | 0 | bipyridine | chelator; ferroptosis inhibitor |
tris(2,2'-bipyridine)ruthenium iii | [no description available] | medium | 1 | 0 | | |
thiophenol | [no description available] | medium | 1 | 0 | aryl thiol | |
2-naphthalenethiol | [no description available] | medium | 1 | 0 | naphthalenes | |
4-aminothiophenol | [no description available] | medium | 1 | 0 | | |
17-alpha-hydroxyprogesterone | [no description available] | medium | 2 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
benzoxazoles | [no description available] | medium | 2 | 0 | 1,3-benzoxazoles; mancude organic heterobicyclic parent | |
1,1'-((4,4,7,7-tetramethyl)-4,7-diazaundecamethylene)bis-4-(3-methyl-2,3-dihydro(benzo-1,3-oxazole)-2-methylidine)quinolinium, tetraiodide | [no description available] | medium | 2 | 0 | cyanine dye; organic iodide salt | fluorochrome |
n-methyldiethanolamine | [no description available] | medium | 1 | 0 | | |
n-iodoacetyl-n'-biotinylhexylenediamine | [no description available] | medium | 7 | 0 | | |
1-biotinamido-4-(4'-(maleimidomethyl)cyclohexanecarboxamido)butane | [no description available] | medium | 7 | 0 | | |
tetranitromethane | [no description available] | medium | 2 | 0 | organonitrogen compound | |
8-bromocyclic gmp | [no description available] | medium | 5 | 0 | 3',5'-cyclic purine nucleotide; organobromine compound | muscle relaxant; protein kinase G agonist |
biotin-16-dutp | [no description available] | medium | 12 | 0 | | |
picrotoxin | [no description available] | medium | 5 | 0 | | |
3-(trimethoxysilyl)propyldimethyloctadecylammonium | [no description available] | medium | 1 | 0 | | |
tetrahydrofuran | [no description available] | medium | 5 | 0 | cyclic ether; oxolanes; saturated organic heteromonocyclic parent; volatile organic compound | polar aprotic solvent |
carbadox | [no description available] | medium | 1 | 0 | quinoxaline derivative | |
cellulase | [no description available] | medium | 2 | 0 | cellotriose | |
latrunculin a | [no description available] | medium | 1 | 0 | cyclic hemiketal; macrolide; oxabicycloalkane; thiazolidinone | actin polymerisation inhibitor; metabolite; toxin |
2-amino-4-phosphonobutyric acid | [no description available] | medium | 2 | 0 | | |
sulfosuccinimidyl 6-(biotinamido)hexanoate | [no description available] | medium | 26 | 0 | | |
6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | [no description available] | medium | 1 | 0 | chromanol; monocarboxylic acid; phenols | antioxidant; ferroptosis inhibitor; neuroprotective agent; radical scavenger; Wnt signalling inhibitor |
rhodamine 110 | [no description available] | medium | 1 | 0 | | |
saxitoxin | [no description available] | medium | 1 | 0 | alkaloid; carbamate ester; guanidines; ketone hydrate; paralytic shellfish toxin; pyrrolopurine | cyanotoxin; marine metabolite; neurotoxin; sodium channel blocker; toxin |
1,2-distearoylphosphatidylethanolamine | [no description available] | medium | 6 | 0 | phosphatidylethanolamine zwitterion; phosphatidylethanolamine | human metabolite |
angiotensin ii | [no description available] | medium | 13 | 0 | amino acid zwitterion; angiotensin II | human metabolite |
ramiprilat | [no description available] | medium | 1 | 0 | azabicycloalkane; cyclopentapyrrole; dicarboxylic acid; dipeptide | bradykinin receptor B2 agonist; cardioprotective agent; drug metabolite; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; matrix metalloproteinase inhibitor |
betrixaban | [no description available] | medium | 1 | 0 | benzamides; guanidines; monochloropyridine; monomethoxybenzene; secondary carboxamide | anticoagulant; EC 3.4.21.6 (coagulation factor Xa) inhibitor |
4-aminopyridine | [no description available] | medium | 3 | 0 | aminopyridine; aromatic amine | avicide; orphan drug; potassium channel blocker |
thioflavin t | [no description available] | medium | 1 | 0 | organic chloride salt | fluorochrome; geroprotector; histological dye |
n-acetylpenicillamine | [no description available] | medium | 1 | 0 | N-acetyl-D-amino acid | |
prostaglandin a1 | [no description available] | medium | 1 | 0 | prostaglandins A | |
8-bromo cyclic adenosine monophosphate | [no description available] | medium | 4 | 0 | 3',5'-cyclic purine nucleotide; adenyl ribonucleotide; organobromine compound | antidepressant; protein kinase agonist |
neodymium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
sinapinic acid | [no description available] | medium | 1 | 0 | sinapic acid | MALDI matrix material; plant metabolite |
nitrites | [no description available] | medium | 7 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | human metabolite |
nitroblue tetrazolium | [no description available] | medium | 6 | 0 | organic cation | |
tris(2,2'-bipyridine)ruthenium(II) | [no description available] | medium | 2 | 0 | ruthenium coordination entity | fluorochrome |
atrazine | [no description available] | medium | 2 | 0 | chloro-1,3,5-triazine; diamino-1,3,5-triazine | environmental contaminant; herbicide; xenobiotic |
paraoxon | [no description available] | medium | 3 | 0 | aryl dialkyl phosphate; organophosphate insecticide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; mouse metabolite |
soraphen a | [no description available] | medium | 1 | 0 | cyclic hemiketal; ether; macrolide; olefinic compound | bacterial metabolite; EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor; teratogenic agent |
n-isopropylacrylamide | [no description available] | medium | 3 | 0 | | |
2-aminoethylmethacrylate | [no description available] | medium | 1 | 0 | enoate ester | |
8-bromoadenosine-3',5'-cyclic monophosphorothioate | [no description available] | medium | 1 | 0 | | |
pituitrin | [no description available] | medium | 18 | 0 | | |
niobium | [no description available] | medium | 2 | 0 | vanadium group element atom | |
lithium niobate | [no description available] | medium | 1 | 0 | | |
alkenes | [no description available] | medium | 6 | 0 | | |
phosphocreatine | [no description available] | medium | 3 | 0 | phosphagen; phosphoamino acid | human metabolite; mouse metabolite |
cyanogen bromide | [no description available] | medium | 12 | 0 | | |
chondroitin sulfates | [no description available] | medium | 9 | 0 | | |
cyclofenil | [no description available] | medium | 1 | 0 | organic molecular entity | |
ethyl isocyanate | [no description available] | medium | 1 | 0 | isocyanates | |
n-methylacetamide-oxotremorine m | [no description available] | medium | 2 | 0 | | |
oxybiotin | [no description available] | medium | 20 | 0 | | |
imidazole | [no description available] | medium | 2 | 0 | imidazole | |
11-octadecenoic acid | [no description available] | medium | 1 | 0 | vaccenic acid | |
xanthopterin | [no description available] | medium | 2 | 0 | | |
thiophane | [no description available] | medium | 4 | 0 | saturated organic heteromonocyclic parent; tetrahydrothiophenes | |
p-dimethylaminoazobenzene | [no description available] | medium | 12 | 0 | azobenzenes | |
nk 2761 | [no description available] | medium | 1 | 0 | | |
rhodanine | [no description available] | medium | 1 | 0 | thiazolidinone | |
tin(iv) chlorin e6 | [no description available] | medium | 1 | 0 | | |
coronatine | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
4-dimethylaminobenzenediazonium fluoroborate | [no description available] | medium | 1 | 0 | organic tetrafluoroborate salt | |
melitten | [no description available] | medium | 5 | 0 | | |
(3-mercaptopropyl)trimethoxysilane | [no description available] | medium | 4 | 0 | | |
perchlorate | [no description available] | medium | 1 | 0 | chlorine oxoanion; monovalent inorganic anion | |
papaverine | [no description available] | medium | 2 | 0 | benzylisoquinoline alkaloid; dimethoxybenzene; isoquinolines | antispasmodic drug; vasodilator agent |
divinyl sulfone | [no description available] | medium | 3 | 0 | sulfone | cross-linking reagent |
acridine orange | [no description available] | medium | 2 | 0 | aminoacridines; aromatic amine; tertiary amino compound | fluorochrome; histological dye |
staurosporine | [no description available] | medium | 10 | 0 | ammonium ion derivative | |
biphenylylacetic acid | [no description available] | medium | 1 | 0 | | |
itraconazole | [no description available] | medium | 1 | 0 | aromatic ether; conazole antifungal drug; cyclic ketal; dichlorobenzene; dioxolane; N-arylpiperazine; triazole antifungal drug; triazoles | EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor; Hedgehog signaling pathway inhibitor; P450 inhibitor |
barium chloride | [no description available] | medium | 2 | 0 | barium salt; inorganic chloride | potassium channel blocker |
succinimidyl carbonate | [no description available] | medium | 1 | 0 | | |
3-mercaptopropanol | [no description available] | medium | 1 | 0 | | |
11-mercaptoundecanoic acid | [no description available] | medium | 2 | 0 | | |
dehydroalanine | [no description available] | medium | 1 | 0 | 2,3-dehydroamino acid; alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion; enamine; non-proteinogenic alpha-amino acid | alkylating agent; human metabolite; mouse metabolite |
strychnine | [no description available] | medium | 6 | 0 | monoterpenoid indole alkaloid; organic heteroheptacyclic compound | avicide; cholinergic antagonist; glycine receptor antagonist; neurotransmitter agent; rodenticide |
bromochloroacetic acid | [no description available] | medium | 26 | 0 | 2-bromocarboxylic acid; monocarboxylic acid; organochlorine compound | |
androsterone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid; C19-steroid | androgen; anticonvulsant; human blood serum metabolite; human metabolite; human urinary metabolite; mouse metabolite; pheromone |
copper | [no description available] | medium | 1 | 0 | copper cation; monoatomic monocation | cofactor |
propionyl-coenzyme a | [no description available] | medium | 9 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
butyryl-coenzyme a | [no description available] | medium | 2 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
g(m3) ganglioside | [no description available] | medium | 4 | 0 | alpha-N-acetylneuraminyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-ceramide; sialodiosylceramide; sialotriaosylceramide | mouse metabolite |
alpha-aminopyridine | [no description available] | medium | 4 | 0 | | |
methacrylamide | [no description available] | medium | 1 | 0 | acrylamides; primary carboxamide | |
biotinyl-n-hydroxysulfosuccinimide ester | [no description available] | medium | 12 | 0 | | |
arabinose | [no description available] | medium | 2 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
stachyose | [no description available] | medium | 1 | 0 | raffinose family oligosaccharide; tetrasaccharide | mouse metabolite; plant metabolite |
calpain | [no description available] | medium | 4 | 0 | | |
schweinfurthin f | [no description available] | medium | 1 | 0 | cyclic ether; organic heterotricyclic compound; resorcinols; stilbenoid | metabolite |
dithiol | [no description available] | medium | 1 | 0 | | |
gpgp | [no description available] | medium | 1 | 0 | | |
glycidyl nitrate | [no description available] | medium | 4 | 0 | | |
phosphine | [no description available] | medium | 5 | 0 | mononuclear parent hydride; phosphanes; phosphine | carcinogenic agent; fumigant insecticide |
phosphoramidic acid | [no description available] | medium | 4 | 0 | phosphoric acid derivative | |
spermidine | [no description available] | medium | 2 | 0 | polyazaalkane; triamine | autophagy inducer; fundamental metabolite; geroprotector |
adenosine diphosphate ribose | [no description available] | medium | 6 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
thiourea | [no description available] | medium | 6 | 0 | one-carbon compound; thioureas; ureas | antioxidant; chromophore |
butyric acid | [no description available] | medium | 3 | 0 | fatty acid 4:0; straight-chain saturated fatty acid | human urinary metabolite; Mycoplasma genitalium metabolite |
imidazolone | [no description available] | medium | 1 | 0 | organonitrogen heterocyclic compound | |
gala peptide | [no description available] | medium | 2 | 0 | | |
8-hydroxyguanosine | [no description available] | medium | 1 | 0 | purine nucleoside | |
fluorodeoxyglucose f18 | [no description available] | medium | 2 | 0 | 2-deoxy-2-((18)F)fluoro-D-glucose; 2-deoxy-2-fluoro-aldehydo-D-glucose | |
oxazoles | [no description available] | medium | 3 | 0 | 1,3-oxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
dimethoate | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; organic thiophosphate | acaricide; agrochemical; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; insecticide; xenobiotic |
fura-2 | [no description available] | medium | 2 | 0 | | |
diamide | [no description available] | medium | 1 | 0 | 1,1'-azobis(N,N-dimethylformamide) | |
n-hydroxysuccinimide s-acetylthioacetate | [no description available] | medium | 2 | 0 | | |
sulfosuccinimidyl 4-(n-maleimidomethyl)cyclohexane-1-carboxylate | [no description available] | medium | 1 | 0 | | |
mannans | [no description available] | medium | 8 | 1 | | |
xylose | [no description available] | medium | 4 | 0 | D-xylose | |
divinyl benzene | [no description available] | medium | 1 | 0 | styrenes | |
sorbose | [no description available] | medium | 1 | 0 | L-sorbose; sorbopyranose | |
proline | [no description available] | medium | 16 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
provitamin c | [no description available] | medium | 1 | 0 | hexose | |
phosphotyrosine | [no description available] | medium | 8 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid; O(4)-phosphotyrosine | Escherichia coli metabolite; immunogen |
phosphothreonine | [no description available] | medium | 1 | 0 | L-threonine derivative; non-proteinogenic L-alpha-amino acid; O-phosphoamino acid | Escherichia coli metabolite |
phosphorylethanolamine | [no description available] | medium | 1 | 0 | phosphoethanolamine; primary amino compound | algal metabolite; human metabolite; mouse metabolite |
1,4-benzoquinoneimine | [no description available] | medium | 1 | 0 | quinone imine | |
firefly luciferin | [no description available] | medium | 2 | 0 | 1,3-thiazolemonocarboxylic acid; benzothiazoles; imidothioate | luciferin |
methacrylic acid | [no description available] | medium | 2 | 0 | alpha,beta-unsaturated monocarboxylic acid | |
acrylamide | [no description available] | medium | 3 | 0 | acrylamides; N-acylammonia; primary carboxamide | alkylating agent; carcinogenic agent; Maillard reaction product; mutagen; neurotoxin |
thymoquinone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones | adjuvant; anti-inflammatory agent; antidepressant; antineoplastic agent; antioxidant; cardioprotective agent; plant metabolite |
chelerythrine | [no description available] | medium | 3 | 0 | benzophenanthridine alkaloid; organic cation | antibacterial agent; antineoplastic agent; EC 2.7.11.13 (protein kinase C) inhibitor |
tirofiban | [no description available] | medium | 1 | 0 | L-tyrosine derivative; piperidines; sulfonamide | anticoagulant; fibrin modulating drug; platelet glycoprotein-IIb/IIIa receptor antagonist |
n'-formylkynurenine | [no description available] | medium | 1 | 0 | amino acid zwitterion; N-formylkynurenine; non-proteinogenic amino acid derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1,2-distearoyllecithin | [no description available] | medium | 3 | 0 | | |
hexaminecobalt (iii) trichloride | [no description available] | medium | 1 | 0 | | |
5-hydroxytryptophan | [no description available] | medium | 1 | 0 | hydroxytryptophan | human metabolite; neurotransmitter |
3-acryloxypropyltrimethoxysilane | [no description available] | medium | 1 | 0 | | |
3,3'-dioctadecylindocarbocyanine | [no description available] | medium | 10 | 0 | Cy5 dye; indolium ion | fluorochrome |
melamine formaldehyde | [no description available] | medium | 1 | 0 | | |
sodium tellurite | [no description available] | medium | 1 | 0 | | |
2,6-dichlorobenzamide | [no description available] | medium | 1 | 0 | benzamides; dichlorobenzene | herbicide; marine xenobiotic metabolite |
thymidine 5'-triphosphate | [no description available] | medium | 7 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
noladin ether | [no description available] | medium | 1 | 0 | 2-alkylglycerol; endocannabinoid; monoalkylglycerol | |
glyceryl 2-arachidonate | [no description available] | medium | 2 | 0 | 2-acylglycerol 20:4; endocannabinoid | human metabolite |
anandamide | [no description available] | medium | 4 | 0 | endocannabinoid; N-acylethanolamine 20:4 | human blood serum metabolite; neurotransmitter; vasodilator agent |
gymnodimine | [no description available] | medium | 2 | 0 | | |
8-nitroguanosine 3',5'-cyclic monophosphate | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; C-nitro compound | biomarker; Brassica napus metabolite; human metabolite; signalling molecule |
sansalvamide a | [no description available] | medium | 1 | 0 | | |
n-acetylmethionine | [no description available] | medium | 1 | 0 | L-methionine derivative; N-acetyl-L-amino acid; N-acetylmethionine | nutraceutical |
tetraethoxysilane | [no description available] | medium | 1 | 0 | | |
dysprosium | [no description available] | medium | 2 | 0 | f-block element atom; lanthanoid atom | |
nitrates | [no description available] | medium | 14 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | |
magnesium nitrate | [no description available] | medium | 1 | 0 | inorganic nitrate salt; magnesium salt | fertilizer |
dansyl chloride | [no description available] | medium | 1 | 0 | aminonaphthalene; sulfonic acid derivative | |
pimonidazole | [no description available] | medium | 1 | 0 | | |
azomycin | [no description available] | medium | 2 | 0 | C-nitro compound; imidazoles | antitubercular agent |
urapidil | [no description available] | medium | 1 | 0 | piperazines | |
2-(1-piperazinyl)-4-amino-6,7-dimethoxyquinazoline | [no description available] | medium | 1 | 0 | | |
flavin mononucleotide | [no description available] | medium | 7 | 0 | | |
cyanuric acid | [no description available] | medium | 1 | 0 | 1,3,5-triazinanes; 1,3,5-triazines; heteroaryl hydroxy compound | xenobiotic |
melamine | [no description available] | medium | 1 | 0 | triamino-1,3,5-triazine | xenobiotic metabolite |
dehydroxymethylepoxyquinomicin | [no description available] | medium | 1 | 0 | | |
rhamnose | [no description available] | medium | 2 | 0 | L-rhamnose | |
edetic acid | [no description available] | medium | 1 | 0 | | |
beta-solamarine | [no description available] | medium | 1 | 0 | steroid saponin | |
aplyronine a | [no description available] | medium | 1 | 0 | | |
phosphonoacetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid; phosphonic acids | antiviral agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor |
lactacystin | [no description available] | medium | 1 | 0 | lactam; S-substituted L-cysteine | |
hymecromone | [no description available] | medium | 6 | 0 | hydroxycoumarin | antineoplastic agent; hyaluronic acid synthesis inhibitor |
2'-(4-methylumbelliferyl)-alpha-d-n-acetylneuraminic acid | [no description available] | medium | 1 | 0 | | |
s-(1,2-dichlorovinyl)cysteine | [no description available] | medium | 1 | 0 | S-(1,2-dichlorovinyl)-L-cysteine | |
s-(1,2-dichlorovinyl)-l-cysteine sulfoxide | [no description available] | medium | 1 | 0 | | |
succinylsulfathiazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles | |
inositol-1,3,4,5-tetrakisphosphate | [no description available] | medium | 1 | 0 | inositol phosphate | |
bisbenzimidazole | [no description available] | medium | 3 | 0 | bibenzimidazole; N-methylpiperazine | anthelminthic drug; fluorochrome |
deguelin | [no description available] | medium | 1 | 0 | aromatic ether; diether; organic heteropentacyclic compound; rotenones | angiogenesis inhibitor; anti-inflammatory agent; antineoplastic agent; antiviral agent; apoptosis inducer; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; mitochondrial NADH:ubiquinone reductase inhibitor; plant metabolite |
fenamic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; secondary amino compound | membrane transport modulator |
5-iodoacetamidofluorescein | [no description available] | medium | 3 | 0 | | |
catechol | [no description available] | medium | 1 | 0 | catechols | allelochemical; genotoxin; plant metabolite |
dihydroxyphenylalanine | [no description available] | medium | 3 | 0 | hydroxyphenylalanine; non-proteinogenic alpha-amino acid; tyrosine derivative | human metabolite |
triphenylphosphine | [no description available] | medium | 1 | 0 | benzenes; tertiary phosphine | NMR chemical shift reference compound; reducing agent |
leucyl-aspartyl-valine | [no description available] | medium | 1 | 0 | oligopeptide | |
cholecystokinin | [no description available] | medium | 10 | 0 | | |
epigallocatechin gallate | [no description available] | medium | 1 | 0 | flavans; gallate ester; polyphenol | antineoplastic agent; antioxidant; apoptosis inducer; geroprotector; Hsp90 inhibitor; neuroprotective agent; plant metabolite |
lactoferricin b | [no description available] | medium | 1 | 0 | | |
guanosine 5'-monophosphorothioate | [no description available] | medium | 1 | 0 | | |
bis(3',5')-cyclic diguanylic acid | [no description available] | medium | 1 | 0 | cyclic purine dinucleotide; guanyl ribonucleotide | immunomodulator; signalling molecule |
hypericin | [no description available] | medium | 1 | 0 | | |
cascade blue | [no description available] | medium | 1 | 0 | aminonaphthalene | fluorochrome |
n-vinyl-2-pyrrolidinone | [no description available] | medium | 2 | 0 | pyrrolidin-2-ones | |
4-hydroxyazobenzene | [no description available] | medium | 1 | 0 | | |
2-methacryloyloxyethyl phosphorylcholine | [no description available] | medium | 1 | 0 | | |
ractopamine | [no description available] | medium | 1 | 0 | benzyl alcohols; polyphenol; secondary alcohol; secondary amino compound | |
cesium | [no description available] | medium | 3 | 0 | alkali metal atom | |
2-amino-3-ketobutyrate | [no description available] | medium | 1 | 0 | 3-oxo monocarboxylic acid; non-proteinogenic alpha-amino acid | |
2,2'-azino-di-(3-ethylbenzothiazoline)-6-sulfonic acid | [no description available] | medium | 1 | 0 | | |
tranylcypromine | [no description available] | medium | 1 | 0 | 2-phenylcyclopropan-1-amine | |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine | [no description available] | medium | 1 | 0 | 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine | antihypertensive agent; beta-adrenergic antagonist; bronchoconstrictor agent; hematologic agent; vasodilator agent |
12-o-retinoylphorbol-13-acetate | [no description available] | medium | 1 | 0 | | |
vanoxerine | [no description available] | medium | 1 | 0 | ether; N-alkylpiperazine; organofluorine compound; tertiary amino compound | dopamine uptake inhibitor |
cystamine | [no description available] | medium | 2 | 0 | organic disulfide; primary amino compound | EC 2.3.2.13 (protein-glutamine gamma-glutamyltransferase) inhibitor |
2-naphthol | [no description available] | medium | 3 | 0 | naphthol | antinematodal drug; genotoxin; human urinary metabolite; human xenobiotic metabolite; mouse metabolite; radical scavenger |
quinone methide | [no description available] | medium | 1 | 0 | quinomethane | |
sincalide | [no description available] | medium | 2 | 0 | oligopeptide | |
u 69593 | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; N-alkylpyrrolidine; organic heterobicyclic compound; oxaspiro compound | anti-inflammatory agent; diuretic; kappa-opioid receptor agonist |
peptones | [no description available] | medium | 9 | 0 | | |
1,1-dimethylheptyl-11-hydroxytetrahydrocannabinol | [no description available] | medium | 1 | 0 | | |
hu 308 | [no description available] | medium | 1 | 0 | aromatic ether; bridged compound; carbobicyclic compound; primary allylic alcohol; synthetic cannabinoid | anti-inflammatory agent; antihypertensive agent; apoptosis inhibitor; bone density conservation agent; CB2 receptor agonist |
ricinoleic acid | [no description available] | medium | 1 | 0 | (9Z)-12-hydroxyoctadec-9-enoic acid | |
12-hydroxy stearic acid | [no description available] | medium | 1 | 0 | hydroxyoctadecanoic acid; secondary alcohol | bacterial xenobiotic metabolite; plant metabolite |
fadrozole | [no description available] | medium | 1 | 0 | imidazopyridine | |
benzamide | [no description available] | medium | 1 | 0 | benzamides | |
cyclin d1 | [no description available] | medium | 3 | 0 | | |
acrolein | [no description available] | medium | 2 | 0 | enal | herbicide; human xenobiotic metabolite; toxin |
tempo | [no description available] | medium | 1 | 0 | aminoxyls; piperidines | catalyst; ferroptosis inhibitor; radical scavenger |
3-methylglutarylcarnitine | [no description available] | medium | 1 | 0 | O-methylglutarylcarnitine | metabolite |
diphthamide | [no description available] | medium | 1 | 0 | quaternary ammonium ion | |
peptide elongation factor 2 | [no description available] | medium | 3 | 0 | | |
sch 23390 | [no description available] | medium | 1 | 0 | benzazepine | |
triphenyltetrazolium | [no description available] | medium | 1 | 0 | organic cation | |
dimethylphenylpiperazinium iodide | [no description available] | medium | 2 | 0 | N-arylpiperazine; organic iodide salt; piperazinium salt; quaternary ammonium salt | nicotinic acetylcholine receptor agonist |
vanillic acid | [no description available] | medium | 1 | 0 | methoxybenzoic acid; monohydroxybenzoic acid | plant metabolite |
nonivamide | [no description available] | medium | 1 | 0 | capsaicinoid; phenols | lachrymator |
bay-k-8644 | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; C-nitro compound; dihydropyridine; methyl ester | |
duramycin | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide; macrocycle | antimicrobial agent; apoptosis inducer; bacterial metabolite |
obelin | [no description available] | medium | 1 | 0 | | |
preproenkephalin | [no description available] | medium | 3 | 0 | | |
vicine | [no description available] | medium | 1 | 0 | glycoside | |
pyrimidinones | [no description available] | medium | 1 | 0 | | |
ferric chloride | [no description available] | medium | 3 | 0 | iron coordination entity | astringent; Lewis acid |
methylene chloride | [no description available] | medium | 1 | 0 | chloromethanes; volatile organic compound | carcinogenic agent; polar aprotic solvent; refrigerant |
trifluoromethanesulfonic acid | [no description available] | medium | 1 | 0 | one-carbon compound; perfluoroalkanesulfonic acid | |
4-o-alpha-d-galactopyranosyl-d-galactose | [no description available] | medium | 1 | 0 | O-acyl carbohydrate | |
ethylene oxide | [no description available] | medium | 1 | 0 | gas molecular entity; oxacycle; saturated organic heteromonocyclic parent | allergen; mouse metabolite; mutagen |
diethyl phthalate | [no description available] | medium | 1 | 0 | diester; ethyl ester; phthalate ester | neurotoxin; plasticiser; teratogenic agent |
raloxifene hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
picolinic acid | [no description available] | medium | 8 | 0 | pyridinemonocarboxylic acid | human metabolite; MALDI matrix material |
picolinic acid | [no description available] | medium | 8 | 3 | pyridinemonocarboxylic acid | human metabolite; MALDI matrix material |
malondialdehyde | [no description available] | medium | 2 | 0 | dialdehyde | biomarker |
1-hexanol | [no description available] | medium | 3 | 0 | hexanol; primary alcohol | alarm pheromone; antibacterial agent; fragrance; plant metabolite |
2-mercaptoacetate | [no description available] | medium | 1 | 0 | monocarboxylic acid anion | |
mercaptoethanol | [no description available] | medium | 12 | 0 | alkanethiol; primary alcohol | geroprotector |
stearic acid | [no description available] | medium | 2 | 0 | long-chain fatty acid; saturated fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; human metabolite; plant metabolite |
methyl levulinate | [no description available] | medium | 1 | 0 | oxo carboxylic acid | |
2,5-anhydromannitol | [no description available] | medium | 1 | 0 | | |
isoserine | [no description available] | medium | 1 | 0 | | |
lewis x antigen | [no description available] | medium | 3 | 0 | | |
cathepsin g | [no description available] | medium | 3 | 0 | | |
atrial natriuretic factor | [no description available] | medium | 4 | 0 | polypeptide | |
phenylhydrazine | [no description available] | medium | 4 | 0 | phenylhydrazines | xenobiotic |
inosine diphosphate | [no description available] | medium | 1 | 0 | inosine phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite |
edotreotide | [no description available] | medium | 1 | 0 | | |
leptomycin b | [no description available] | medium | 1 | 0 | | |
callystatin a | [no description available] | medium | 1 | 0 | diterpenoid | |
valtrate | [no description available] | medium | 1 | 0 | fatty acid ester | |
iridoids | [no description available] | medium | 1 | 0 | | |
lithium sulfate | [no description available] | medium | 1 | 0 | metal sulfate | antidepressant |
fluorescein 5-maleimide | [no description available] | medium | 1 | 0 | | |
aurintricarboxylic acid | [no description available] | medium | 2 | 0 | monohydroxybenzoic acid; quinomethanes; tricarboxylic acid | fluorochrome; histological dye; insulin-like growth factor receptor 1 antagonist |
molybdenum cofactor | [no description available] | medium | 3 | 0 | Mo-molybdopterin cofactor; organophosphate oxoanion | |
pteridines | [no description available] | medium | 4 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; pteridines | |
sodium azide | [no description available] | medium | 2 | 0 | inorganic sodium salt | antibacterial agent; explosive; mitochondrial respiratory-chain inhibitor; mutagen |
deoxyglucose | [no description available] | medium | 6 | 0 | | |
dizocilpine maleate | [no description available] | medium | 2 | 0 | maleate salt; tetracyclic antidepressant | anaesthetic; anticonvulsant; neuroprotective agent; nicotinic antagonist; NMDA receptor antagonist |
guanidine | [no description available] | medium | 14 | 0 | carboxamidine; guanidines; one-carbon compound | |
panepoxydone | [no description available] | medium | 1 | 0 | | |
anticodon | [no description available] | medium | 2 | 0 | | |
4-nitrophenylalanine | [no description available] | medium | 1 | 0 | C-nitro compound | |
fumaramide | [no description available] | medium | 1 | 0 | | |
5-deazariboflavin | [no description available] | medium | 1 | 0 | | |
5'-deoxyadenosine | [no description available] | medium | 2 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
n-amylamine | [no description available] | medium | 1 | 0 | primary aliphatic amine | |
cresyl violet | [no description available] | medium | 5 | 0 | | |
tanespimycin | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; ansamycin; carbamate ester; organic heterobicyclic compound; secondary amino compound | antineoplastic agent; apoptosis inducer; Hsp90 inhibitor |
geldanamycin | [no description available] | medium | 1 | 0 | | |
methylmalonyl-coenzyme a | [no description available] | medium | 6 | 0 | | |
bafilomycin a1 | [no description available] | medium | 1 | 0 | cyclic hemiketal; macrolide antibiotic; oxanes | apoptosis inducer; autophagy inhibitor; bacterial metabolite; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.14 (H(+)-transporting two-sector ATPase) inhibitor; ferroptosis inhibitor; fungicide; potassium ionophore; toxin |
cholic acid | [no description available] | medium | 1 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
11-dehydro-thromboxane b2 | [no description available] | medium | 1 | 0 | thromboxane | human metabolite |
thromboxane b2 | [no description available] | medium | 2 | 0 | thromboxanes B | human metabolite; mouse metabolite |
5-bromo-2',3'-dideoxyuridine | [no description available] | medium | 1 | 0 | | |
bathophenanthroline | [no description available] | medium | 1 | 0 | benzenes; phenanthrolines | chelator |
haloxyfop | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid; organochlorine compound; organofluorine compound; pyridines | |
sulfamonomethoxine | [no description available] | medium | 1 | 0 | benzenes; sulfonamide | |
phosphoadenosine phosphosulfate | [no description available] | medium | 1 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
sulfaton | [no description available] | medium | 1 | 0 | | |
holmium | [no description available] | medium | 2 | 0 | f-block element atom; lanthanoid atom | |
tantalum | [no description available] | medium | 1 | 0 | vanadium group element atom | |
tantalum oxide | [no description available] | medium | 1 | 0 | | |
gramicidin a | [no description available] | medium | 10 | 0 | | |
carboxypeptidase b | [no description available] | medium | 2 | 0 | | |
adenosine 5'-o-(3-thiotriphosphate) | [no description available] | medium | 4 | 0 | nucleoside triphosphate analogue | |
4-hydroxy-5-nitrophenyl acetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid anion | |
nitrophenols | [no description available] | medium | 7 | 0 | | |
sodium cyanide | [no description available] | medium | 2 | 0 | cyanide salt; one-carbon compound; sodium salt | EC 1.15.1.1 (superoxide dismutase) inhibitor |
11-hydroxyandrostenedione | [no description available] | medium | 1 | 0 | 3-hydroxy steroid | androgen |
androstenedione | [no description available] | medium | 2 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
oxophenylarsine | [no description available] | medium | 2 | 0 | arsine oxides | antineoplastic agent; apoptosis inducer; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor |
phorboxazole a | [no description available] | medium | 1 | 0 | | |
ethyldimethylaminopropyl carbodiimide | [no description available] | medium | 2 | 0 | | |
echistatin | [no description available] | medium | 3 | 0 | | |
8-((4-chlorophenyl)thio)cyclic-3',5'-amp | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; adenyl ribonucleotide; aryl sulfide; organochlorine compound | protein kinase agonist |
acridines | [no description available] | medium | 7 | 0 | acridines; mancude organic heterotricyclic parent; polycyclic heteroarene | genotoxin |
2-methoxy-2,4-diphenyl-3(2h)-furanone | [no description available] | medium | 1 | 0 | | |
7-hydroxystaurosporine | [no description available] | medium | 1 | 0 | | |
sodium selenite | [no description available] | medium | 1 | 0 | inorganic sodium salt; selenite salt | nutraceutical |
barium sulfate | [no description available] | medium | 1 | 0 | barium salt; inorganic barium salt; metal sulfate | radioopaque medium |
guaiacol | [no description available] | medium | 1 | 0 | guaiacols | disinfectant; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; expectorant; plant metabolite |
fr dental filling | [no description available] | medium | 1 | 0 | | |
4-(4-diethylaminostyryl)-n-methylpyridinium | [no description available] | medium | 1 | 0 | organic iodide salt; pyridinium salt | fluorochrome |
cobrotoxin | [no description available] | medium | 2 | 0 | | |
anabaseine | [no description available] | medium | 1 | 0 | bipyridines | |
anabasine | [no description available] | medium | 1 | 0 | anabasine | |
tubocurarine | [no description available] | medium | 3 | 0 | bisbenzylisoquinoline alkaloid | drug allergen; muscle relaxant; nicotinic antagonist |
alpha-cobratoxin | [no description available] | medium | 1 | 0 | | |
dehydroascorbic acid | [no description available] | medium | 2 | 0 | dehydroascorbic acid; vitamin C | coenzyme; mouse metabolite |
lutetium | [no description available] | medium | 4 | 0 | d-block element atom; lanthanoid atom | |
dcg 04 | [no description available] | medium | 2 | 0 | | |
sulfathiazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
phthalylsulfathiazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; dicarboxylic acid monoamide; sulfonamide antibiotic; sulfonamide | |
phytomonic acid | [no description available] | medium | 2 | 0 | carbocyclic fatty acid; long-chain fatty acid; saturated fatty acid | |
cortisone | [no description available] | medium | 3 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
pteropterin | [no description available] | medium | 1 | 0 | | |
purine | [no description available] | medium | 8 | 0 | purine | |
aminopterin | [no description available] | medium | 3 | 0 | dicarboxylic acid | EC 1.5.1.3 (dihydrofolate reductase) inhibitor; mutagen |
ribose | [no description available] | medium | 5 | 0 | D-ribose; ribopyranose | |
4-aminoimidazole | [no description available] | medium | 1 | 0 | aminoimidazole | |
cobamamide | [no description available] | medium | 2 | 0 | | |
intrinsic factor | [no description available] | medium | 2 | 0 | | |
acid phosphatase | [no description available] | medium | 9 | 0 | | |
pantethine | [no description available] | medium | 1 | 0 | organic disulfide | coenzyme; nutraceutical |
pantetheine | [no description available] | medium | 3 | 0 | pantetheines; thiol | human metabolite; metabolite; mouse metabolite |
benzoic acid | [no description available] | medium | 1 | 0 | benzoic acids | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
2-methylbutanoic acid | [no description available] | medium | 1 | 0 | methylbutyric acid | bacterial metabolite; human metabolite |
cellobiose | [no description available] | medium | 1 | 0 | cellobiose | epitope |
acebutolol | [no description available] | medium | 7 | 0 | alpha-D-glucosyl-(1->4)-D-mannopyranose | |
levoleucovorin | [no description available] | medium | 7 | 0 | 5-formyltetrahydrofolic acid | antineoplastic agent; metabolite |
pyridoxamine | [no description available] | medium | 2 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
casein hydrolysate | [no description available] | medium | 2 | 0 | | |
oxythiamine | [no description available] | medium | 1 | 0 | 1,3-thiazolium cation | antimetabolite; vitamin B1 antagonist |
pyrithiamine | [no description available] | medium | 1 | 0 | | |
putrescine | [no description available] | medium | 5 | 0 | alkane-alpha,omega-diamine | antioxidant; fundamental metabolite |
hydroxocobalamin | [no description available] | medium | 1 | 0 | | |
sulfisoxazole | [no description available] | medium | 1 | 0 | isoxazoles; sulfonamide antibiotic; sulfonamide | antibacterial drug; drug allergen |
pentadecanoic acid | [no description available] | medium | 2 | 0 | long-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; Daphnia magna metabolite; food component; human blood serum metabolite; plant metabolite |
10-octadecenoic acid | [no description available] | medium | 1 | 0 | | |
malonic acid | [no description available] | medium | 5 | 0 | alpha,omega-dicarboxylic acid | human metabolite |
caprylates | [no description available] | medium | 2 | 0 | fatty acid anion 8:0; straight-chain saturated fatty acid anion | human metabolite; Saccharomyces cerevisiae metabolite |
nicotinic acid adenine dinucleotide | [no description available] | medium | 1 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
isovaleryl-coenzyme a | [no description available] | medium | 1 | 0 | methylbutanoyl-CoA; short-chain fatty acyl-CoA | mouse metabolite |
carbonic acid | [no description available] | medium | 1 | 0 | carbon oxoacid; chalcocarbonic acid | mouse metabolite |
carboplatin | [no description available] | medium | 1 | 0 | | |
iodixanol | [no description available] | medium | 2 | 0 | organoiodine compound | radioopaque medium |
pd 98059 | [no description available] | medium | 1 | 0 | aromatic amine; monomethoxyflavone | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; geroprotector |
2-(4-morpholinyl)-8-phenyl-4h-1-benzopyran-4-one | [no description available] | medium | 1 | 0 | chromones; morpholines; organochlorine compound | autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector |
n-glycolylneuraminic acid | [no description available] | medium | 1 | 0 | N-acylneuraminic acid | |
cetyltrimethylammonium ion | [no description available] | medium | 4 | 0 | quaternary ammonium ion | |
2-pentanone | [no description available] | medium | 1 | 0 | methyl ketone; pentanone | plant metabolite |
db293 | [no description available] | medium | 1 | 0 | | |
omega-agatoxin iva | [no description available] | medium | 1 | 0 | | |
naloxonazine | [no description available] | medium | 1 | 0 | | |
norbinaltorphimine | [no description available] | medium | 1 | 0 | isoquinolines | |
glutaminase | [no description available] | medium | 4 | 0 | | |
lithium | [no description available] | medium | 3 | 0 | alkali metal atom | |
aspidophytine | [no description available] | medium | 1 | 0 | | |
oxalates | [no description available] | medium | 10 | 0 | | |
2-nitrophenylgalactoside | [no description available] | medium | 2 | 0 | | |
nitrophenylgalactosides | [no description available] | medium | 2 | 0 | beta-D-galactoside; C-nitro compound | chromogenic compound |
latrunculin b | [no description available] | medium | 1 | 0 | cyclic hemiketal; macrolide; oxabicycloalkane; thiazolidinone | actin polymerisation inhibitor; metabolite; toxin |
angiogenin | [no description available] | medium | 1 | 0 | | |
hydrochloric acid | [no description available] | medium | 5 | 0 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
n,n-carbonyldiimidazole | [no description available] | medium | 3 | 0 | | |
afimoxifene | [no description available] | medium | 1 | 0 | phenols; tertiary amino compound | antineoplastic agent; estrogen receptor antagonist; metabolite |
6-hydroxyl-1,6-dihydropurine ribonucleoside | [no description available] | medium | 1 | 0 | | |
promethium | [no description available] | medium | 1 | 0 | f-block element atom; lanthanoid atom | |
oxazolidine | [no description available] | medium | 1 | 0 | oxazolidine | |
5'-s-(2-aminoethyl)-n(6)-(4-nitrobenzyl)-5'-thioadenosine | [no description available] | medium | 1 | 0 | | |
2'-deoxyadenosine triphosphate | [no description available] | medium | 4 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyribose | [no description available] | medium | 1 | 0 | deoxypentose | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nsc 520594 | [no description available] | medium | 1 | 0 | | |
2'-deoxy-7-deazaguanosine triphosphate | [no description available] | medium | 1 | 0 | | |
osmium tetroxide-2,2'-bipyridine | [no description available] | medium | 1 | 0 | | |
beta-glucono-1,5-lactone | [no description available] | medium | 1 | 0 | aldono-1,5-lactone; gluconolactone | animal metabolite; mouse metabolite |
aziridine | [no description available] | medium | 1 | 0 | azacycloalkane; aziridines; saturated organic heteromonocyclic parent | alkylating agent |
mefloquine | [no description available] | medium | 2 | 0 | | |
sphingosine kinase | [no description available] | medium | 2 | 0 | | |
glyceraldehyde 3-phosphate | [no description available] | medium | 1 | 0 | glyceraldehyde 3-phosphate | mouse metabolite |
iodoacetic acid | [no description available] | medium | 3 | 0 | haloacetic acid; organoiodine compound | alkylating agent |
dicyclohexylcarbodiimide | [no description available] | medium | 1 | 0 | carbodiimide | ATP synthase inhibitor; cross-linking reagent; peptide coupling reagent |
3-((4-azidophenyl)dithio)propionic n-hydroxysuccinimide | [no description available] | medium | 1 | 0 | | |
5-bromo-4-chloro-3-indoxyl phosphate | [no description available] | medium | 4 | 0 | aryl phosphate; indoles; organobromine compound; organochlorine compound | chromogenic compound |
dermatan sulfate | [no description available] | medium | 2 | 0 | amino disaccharide; glycosylgalactose derivative; iduronic acids; oligosaccharide sulfate | |
sulfan blue | [no description available] | medium | 3 | 0 | organic molecular entity | |
oleanolic acid | [no description available] | medium | 2 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | plant metabolite |
prostaglandin a2 | [no description available] | medium | 2 | 0 | prostaglandins A | human metabolite |
bombykal | [no description available] | medium | 1 | 0 | | |
pentadecanal | [no description available] | medium | 1 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | antimicrobial agent; plant metabolite; volatile oil component |
tolonium chloride | [no description available] | medium | 3 | 0 | | |
n-methyl-dl-aspartic acid | [no description available] | medium | 1 | 0 | aspartic acid derivative | |
retinaldehyde | [no description available] | medium | 1 | 0 | retinal; vitamin A | gap junctional intercellular communication inhibitor; human metabolite; mouse metabolite |
fr 901464 | [no description available] | medium | 1 | 0 | | |
cobra cardiotoxin proteins | [no description available] | medium | 1 | 0 | | |
niobium pentoxide | [no description available] | medium | 1 | 0 | | |
phosmidosine | [no description available] | medium | 1 | 0 | | |
indoxyl phosphate | [no description available] | medium | 1 | 0 | | |
bradykinin (1-5) | [no description available] | medium | 1 | 0 | | |
cysteic acid | [no description available] | medium | 1 | 0 | alanine derivative; amino sulfonic acid; carboxyalkanesulfonic acid; cysteine derivative; non-proteinogenic alpha-amino acid | animal metabolite |
castasterone | [no description available] | medium | 1 | 0 | 22-hydroxy steroid; 23-hydroxy steroid; 2alpha-hydroxy steroid; 3alpha-hydroxy steroid; 6-oxo steroid; brassinosteroid | plant growth stimulator |
brassinolide | [no description available] | medium | 1 | 0 | 22-hydroxy steroid; 23-hydroxy steroid; 2alpha-hydroxy steroid; 3alpha-hydroxy steroid; brassinosteroid | plant growth stimulator; plant hormone |
3-(2'-deoxyribofuranosyl)pyrimido(1,2-a)purin-10(3h)-one | [no description available] | medium | 1 | 0 | | |
uridine diphosphate | [no description available] | medium | 1 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
ng-nitroarginine methyl ester | [no description available] | medium | 7 | 0 | alpha-amino acid ester; L-arginine derivative; methyl ester; N-nitro compound | EC 1.14.13.39 (nitric oxide synthase) inhibitor |
sq-23377 | [no description available] | medium | 2 | 0 | cyclic ether; enol; polyunsaturated fatty acid; very long-chain fatty acid | calcium ionophore; metabolite |
ethylmaleimide | [no description available] | medium | 11 | 0 | maleimides | anticoronaviral agent; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.1.1 (hexokinase) inhibitor |
indoleacetic acid | [no description available] | medium | 1 | 0 | indole-3-acetic acids; monocarboxylic acid | auxin; human metabolite; mouse metabolite; plant hormone; plant metabolite |
cesium chloride | [no description available] | medium | 2 | 0 | inorganic caesium salt; inorganic chloride | phase-transfer catalyst; vasoconstrictor agent |
oxyquinoline | [no description available] | medium | 1 | 0 | monohydroxyquinoline | antibacterial agent; antifungal agrochemical; antiseptic drug; iron chelator |
indium oxine | [no description available] | medium | 1 | 0 | | |
2,4,5-trihydroxypentanoic acid gamma-lactone | [no description available] | medium | 1 | 0 | ribonolactone | metabolite |
n-(3-(aminomethyl)benzyl)acetamidine | [no description available] | medium | 1 | 0 | aralkylamine; carboxamidine; primary amino compound | angiogenesis inhibitor; EC 1.14.13.39 (nitric oxide synthase) inhibitor; geroprotector |
1,2-dihexanoylphosphatidylethanolamine | [no description available] | medium | 1 | 0 | | |
lysophosphatidylserine | [no description available] | medium | 1 | 0 | 1-acyl-sn-glycero-3-phosphoserine | |
thromboplastin | [no description available] | medium | 4 | 0 | | |
boric acid | [no description available] | medium | 1 | 0 | boric acids | astringent |
formic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | antibacterial agent; astringent; metabolite; protic solvent; solvent |
methylamine | [no description available] | medium | 2 | 0 | methylamines; one-carbon compound; primary aliphatic amine | mouse metabolite |
3-(4-carboxybenzoyl)-2-quinolinecarboxaldehyde | [no description available] | medium | 2 | 0 | benzoic acids; quinolines | fluorochrome |
propane | [no description available] | medium | 1 | 0 | alkane; gas molecular entity | food propellant |
2-nitropropane | [no description available] | medium | 1 | 0 | secondary nitroalkane | carcinogenic agent; hepatotoxic agent; polar aprotic solvent; xenobiotic |
dinitrobenzenes | [no description available] | medium | 6 | 0 | | |
arvanil | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | |
eptifibatide | [no description available] | medium | 1 | 0 | homodetic cyclic peptide; macrocycle; organic disulfide | anticoagulant; platelet aggregation inhibitor |
nystatin a1 | [no description available] | medium | 2 | 0 | nystatins | |
hyaluronoglucosaminidase | [no description available] | medium | 9 | 0 | | |
methylazoxymethanol acetate | [no description available] | medium | 1 | 0 | azoxy compound | |
uridine triphosphate | [no description available] | medium | 15 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine triphosphate | [no description available] | medium | 3 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
(3S,5S,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | [no description available] | medium | 1 | 0 | (6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | |
neutral red | [no description available] | medium | 1 | 0 | hydrochloride | acid-base indicator; dye; two-colour indicator |
3,3',4,5'-tetrahydroxystilbene | [no description available] | medium | 1 | 0 | catechols; polyphenol; resorcinols; stilbenol | antineoplastic agent; apoptosis inducer; geroprotector; hypoglycemic agent; plant metabolite; protein kinase inhibitor; tyrosine kinase inhibitor |
wortmannin | [no description available] | medium | 2 | 0 | acetate ester; cyclic ketone; delta-lactone; organic heteropentacyclic compound | anticoronaviral agent; antineoplastic agent; autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector; Penicillium metabolite; radiosensitizing agent |
calcimycin | [no description available] | medium | 6 | 0 | benzoxazole | |
carbocyanine dye diic12(3) | [no description available] | medium | 1 | 0 | | |
tissue plasminogen activator | [no description available] | medium | 2 | 0 | alpha-amino acid | |
isoprene | [no description available] | medium | 4 | 0 | alkadiene; hemiterpene; volatile organic compound | plant metabolite |
proglumide | [no description available] | medium | 1 | 0 | benzamides; dicarboxylic acid monoamide; glutamine derivative; racemate | anti-ulcer drug; cholecystokinin antagonist; cholinergic antagonist; delta-opioid receptor agonist; drug metabolite; gastrointestinal drug; opioid analgesic; xenobiotic metabolite |
lorglumide | [no description available] | medium | 1 | 0 | benzamides; dicarboxylic acid monoamide; dichlorobenzene; glutamic acid derivative | |
2-amino-6-(2-thienyl)purine | [no description available] | medium | 1 | 0 | | |
3-mercaptohexanol | [no description available] | medium | 1 | 0 | alkanethiol; primary alcohol | flavouring agent; plant metabolite; Saccharomyces cerevisiae metabolite |
(3-dimyristyloxypropyl)(dimethyl)(hydroxyethyl)ammonium | [no description available] | medium | 1 | 0 | | |
y 27632 | [no description available] | medium | 1 | 0 | aromatic amide | |
lissamine rhodamine b | [no description available] | medium | 4 | 0 | | |
mercuric chloride | [no description available] | medium | 3 | 0 | mercury coordination entity | sensitiser |
(3h)2-carbomethoxy-3-(4-fluorophenyl)tropane | [no description available] | medium | 1 | 0 | | |
lead radioisotopes | [no description available] | medium | 1 | 0 | | |
dansyl phosphatidylethanolamine | [no description available] | medium | 1 | 0 | | |
citronellol | [no description available] | medium | 1 | 0 | monoterpenoid | plant metabolite |
isovaleric acid | [no description available] | medium | 1 | 0 | branched-chain saturated fatty acid; methylbutyric acid; short-chain fatty acid | mammalian metabolite; plant metabolite |
cortodoxone | [no description available] | medium | 1 | 0 | deoxycortisol; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
glyceryl behenate | [no description available] | medium | 1 | 0 | 1-monoglyceride; fatty acid ester | antineoplastic agent; plant metabolite |
stearylamine | [no description available] | medium | 1 | 0 | primary aliphatic amine | film-forming compound |
c.i. direct blue 1 | [no description available] | medium | 1 | 0 | | |
chymosin | [no description available] | medium | 1 | 0 | | |
tripropylamine | [no description available] | medium | 1 | 0 | tertiary amine | |
methanesulfonic acid | [no description available] | medium | 1 | 0 | alkanesulfonic acid; one-carbon compound | Escherichia coli metabolite |
alpha-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid | [no description available] | medium | 2 | 0 | non-proteinogenic alpha-amino acid | |
n-acetyl-s-(n-methylcarbamoyl)cysteine | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
c.i. fluorescent brightening agent 28 | [no description available] | medium | 3 | 0 | | |
8-oxo-dado | [no description available] | medium | 1 | 0 | | |
samarium | [no description available] | medium | 4 | 0 | f-block element atom; lanthanoid atom | |
colforsin | [no description available] | medium | 3 | 0 | acetate ester; cyclic ketone; labdane diterpenoid; organic heterotricyclic compound; tertiary alpha-hydroxy ketone; triol | adenylate cyclase agonist; anti-HIV agent; antihypertensive agent; plant metabolite; platelet aggregation inhibitor; protein kinase A agonist |
kn 93 | [no description available] | medium | 2 | 0 | monochlorobenzenes; monomethoxybenzene; primary alcohol; sulfonamide; tertiary amino compound | EC 2.7.11.17 (Ca(2+)/calmodulin-dependent protein kinase) inhibitor; geroprotector |
methylselenic acid | [no description available] | medium | 1 | 0 | one-carbon compound; organoselenium compound | antineoplastic agent; EC 3.5.1.98 (histone deacetylase) inhibitor; human xenobiotic metabolite |
benzyloxycarbonylvalyl-alanyl-aspartyl fluoromethyl ketone | [no description available] | medium | 2 | 0 | | |
p-chloroamphetamine | [no description available] | medium | 1 | 0 | | |
hoe 33342 | [no description available] | medium | 3 | 0 | | |
5-carboxamidotryptamine | [no description available] | medium | 1 | 0 | tryptamines | |
rg108 | [no description available] | medium | 1 | 0 | indolyl carboxylic acid | |
phosphoserine | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid; O-phosphoamino acid; serine derivative | human metabolite |
dimethylaminopropanol | [no description available] | medium | 1 | 0 | | |
peoniflorin | [no description available] | medium | 1 | 0 | | |
1-(5-isoquinolinesulfonyl)-2-methylpiperazine | [no description available] | medium | 2 | 0 | isoquinolines; N-sulfonylpiperazine | EC 2.7.11.13 (protein kinase C) inhibitor |
4-aminophenyl-beta-galactoside | [no description available] | medium | 1 | 0 | | |
ephrin-a5 | [no description available] | medium | 1 | 0 | | |
iberiotoxin | [no description available] | medium | 1 | 0 | | |
omega-n-methylarginine | [no description available] | medium | 2 | 0 | amino acid zwitterion; arginine derivative; guanidines; L-arginine derivative; non-proteinogenic L-alpha-amino acid | |
heroin | [no description available] | medium | 1 | 0 | morphinane alkaloid | mu-opioid receptor agonist; opioid analgesic; prodrug |
enkephalin, ala(2)-mephe(4)-gly(5)- | [no description available] | medium | 1 | 0 | | |
true blue | [no description available] | medium | 1 | 0 | | |
sb 202190 | [no description available] | medium | 1 | 0 | imidazoles; organofluorine compound; phenols; pyridines | apoptosis inducer; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor |
resorcinol | [no description available] | medium | 1 | 0 | benzenediol; phenolic donor; resorcinols | erythropoietin inhibitor; sensitiser |
fucosyl gm1 ganglioside | [no description available] | medium | 1 | 0 | | |
2'-deoxycytidine 5'-triphosphate | [no description available] | medium | 4 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-(4-dihexadecylaminostyryl)-n-methylpyridium | [no description available] | medium | 2 | 0 | pyridinium ion; tertiary amine | fluorochrome |
pd 123319 | [no description available] | medium | 1 | 0 | imidazopyridine | angiotensin receptor antagonist; endothelin receptor antagonist; vasoconstrictor agent |
acetaldehyde | [no description available] | medium | 2 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
propylene glycol | [no description available] | medium | 1 | 0 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
norrisolide | [no description available] | medium | 1 | 0 | | |
methylmethacrylate | [no description available] | medium | 1 | 0 | enoate ester; methyl ester | allergen; polymerisation monomer |
sodium cyanoborohydride | [no description available] | medium | 1 | 0 | | |
5'-(4-fluorosulfonylbenzoyl)adenosine | [no description available] | medium | 1 | 0 | | |
3-((3-cholamidopropyl)dimethylammonium)-1-propanesulfonate | [no description available] | medium | 4 | 0 | 1,1-diunsubstituted alkanesulfonate | |
microcystin | [no description available] | medium | 2 | 0 | peptide | |
2-nitrophenylhydrazine | [no description available] | medium | 1 | 0 | | |
16-mercaptohexadecanoic acid | [no description available] | medium | 1 | 0 | | |
octanoic acid | [no description available] | medium | 1 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
lipoxin a4 | [no description available] | medium | 1 | 0 | hydroxy polyunsaturated fatty acid; lipoxin; long-chain fatty acid | human metabolite; metabolite |
farnesyl pyrophosphate | [no description available] | medium | 2 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
ethylene sulfide | [no description available] | medium | 1 | 0 | organosulfur heterocyclic compound; saturated organic heteromonocyclic parent | |
va 061 | [no description available] | medium | 1 | 0 | | |
benzyl alcohol | [no description available] | medium | 1 | 0 | benzyl alcohols | antioxidant; fragrance; metabolite; solvent |
glutaral | [no description available] | medium | 14 | 0 | dialdehyde | cross-linking reagent; disinfectant; fixative |
monodansylcadaverine | [no description available] | medium | 4 | 0 | aminonaphthalene; primary amino compound; sulfonamide; tertiary amino compound | EC 2.3.2.13 (protein-glutamine gamma-glutamyltransferase) inhibitor; fluorochrome; protective agent |
triphosphoric acid | [no description available] | medium | 1 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | |
lissamine rhodamine b sulfonyl chloride | [no description available] | medium | 1 | 0 | | |
n-(4-aminobutyl)-5-chloro-2-naphthalenesulfonamide | [no description available] | medium | 1 | 0 | naphthalenes; organochlorine compound; primary amino compound; sulfonamide | |
sphingosine 1-phosphate | [no description available] | medium | 1 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
dimethylglycine | [no description available] | medium | 1 | 0 | amino acid zwitterion; N-methyl-amino acid; N-methylglycines | Daphnia magna metabolite; human metabolite; mouse metabolite |
sarcosine | [no description available] | medium | 1 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
sodium pertechnetate tc 99m | [no description available] | medium | 1 | 0 | | |
4-(n-maleimido)benzyltrimethylammonium | [no description available] | medium | 1 | 0 | | |
1,5-i-aedans | [no description available] | medium | 1 | 0 | aminonaphthalenesulfonic acid | fluorescent probe |
phenyl isocyanate | [no description available] | medium | 1 | 0 | benzenes; isocyanates | allergen; hapten |
5,6,7,8-tetrahydrofolic acid | [no description available] | medium | 1 | 0 | tetrahydrofolic acid | |
bacteriochlorophylls | [no description available] | medium | 2 | 0 | bacteriochlorophyll; methyl ester | |
nbi 31772 | [no description available] | medium | 1 | 0 | aromatic ketone; benzenediols; hydroxy monocarboxylic acid; isoquinolines; tetrol | insulin-like growth factor-binding protein inhibitor |
5,7-dihydroxytryptamine | [no description available] | medium | 3 | 0 | | |
qx-222 | [no description available] | medium | 1 | 0 | amino acid amide | |
hesperadin | [no description available] | medium | 1 | 0 | | |
globotriaosylceramide | [no description available] | medium | 1 | 0 | | |
sizofiran | [no description available] | medium | 1 | 0 | | |
laminaran | [no description available] | medium | 1 | 0 | | |
epiglucan | [no description available] | medium | 2 | 0 | | |
pseudouridine | [no description available] | medium | 1 | 0 | pseudouridines | fundamental metabolite |
hexacyanoferrate iii | [no description available] | medium | 1 | 0 | | |
4-aminophenylalanine | [no description available] | medium | 1 | 0 | 4-aminophenylalanine; amino acid zwitterion | |
involucrin | [no description available] | medium | 1 | 0 | | |
6-(bromomethylene)tetrahydro-3-(1-naphthaleneyl)-2h-pyran-2-one | [no description available] | medium | 1 | 0 | naphthalenes | |
meclofenamic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; organochlorine compound; secondary amino compound | analgesic; anticonvulsant; antineoplastic agent; antipyretic; antirheumatic drug; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
arginyl-glycyl-aspartyl-serine | [no description available] | medium | 1 | 0 | | |
linezolid | [no description available] | medium | 1 | 0 | acetamides; morpholines; organofluorine compound; oxazolidinone | antibacterial drug; protein synthesis inhibitor |
oxazolidin-2-one | [no description available] | medium | 1 | 0 | carbamate ester; oxazolidinone | metabolite |
gibberellic acid | [no description available] | medium | 1 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone; organic heteropentacyclic compound | mouse metabolite; plant metabolite |
pateamine a | [no description available] | medium | 1 | 0 | 1,3-thiazoles; macrodiolide; olefinic compound; primary amino compound; tertiary amino compound | antineoplastic agent; antiviral agent; eukaryotic initiation factor 4F inhibitor; marine metabolite |
avrainvillamide | [no description available] | medium | 1 | 0 | 1-benzopyran | |
flag peptide | [no description available] | medium | 2 | 0 | peptide | |
1,4-cyclohexadiene | [no description available] | medium | 1 | 0 | cyclohexadiene | |
sodium hydroxide | [no description available] | medium | 3 | 0 | alkali metal hydroxide | |
2'-hydroxy-5,9-dimethyl-2-allyl-6,7-benzomorphan | [no description available] | medium | 1 | 0 | | |
phenazocine | [no description available] | medium | 1 | 0 | | |
urb 597 | [no description available] | medium | 1 | 0 | biphenyls | |
oxadiazoles | [no description available] | medium | 1 | 0 | | |
1h-(1,2,4)oxadiazolo(4,3-a)quinoxalin-1-one | [no description available] | medium | 1 | 0 | oxadiazoloquinoxaline | EC 4.6.1.2 (guanylate cyclase) inhibitor |
glucosaminic acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; gluconic acid derivative | bacterial metabolite |
1,2-dilauroylphosphatidylethanolamine | [no description available] | medium | 1 | 0 | | |
kahalalide f | [no description available] | medium | 1 | 0 | | |
carbamyl phosphate | [no description available] | medium | 2 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
dichloroacetic anhydride | [no description available] | medium | 1 | 0 | | |
2,2-dichloroacetyl chloride | [no description available] | medium | 1 | 0 | acyl chloride | hapten |
metallothionein | [no description available] | medium | 4 | 0 | | |
2-deoxy-2,3-dehydro-n-acetylneuraminic acid | [no description available] | medium | 1 | 0 | N-acetylneuraminic acids | |
biotinyl-4-nitrophenyl ester | [no description available] | medium | 5 | 0 | | |
epolactaene | [no description available] | medium | 1 | 0 | | |
4-aminophenyldichloroarsine | [no description available] | medium | 1 | 0 | | |
1,2-ethanedithiol | [no description available] | medium | 1 | 0 | | |
4-aminophenylarsenoxide | [no description available] | medium | 1 | 0 | | |
bardoxolone methyl | [no description available] | medium | 1 | 0 | cyclohexenones | |
diprenorphine | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
enkephalin, d-penicillamine (2,5)- | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide | delta-opioid receptor agonist |
methylphosphonic acid | [no description available] | medium | 2 | 0 | one-carbon compound; phosphonic acids | |
polyethylene glycol 300 | [no description available] | medium | 1 | 0 | poly(ethylene glycol) | |
2,3,4,6-tetrachlorophenol | [no description available] | medium | 2 | 0 | tetrachlorophenol | xenobiotic metabolite |
4-amino-2,6-dichlorophenol | [no description available] | medium | 2 | 0 | | |
pentanal | [no description available] | medium | 1 | 0 | saturated fatty aldehyde | plant metabolite |
glycolipids | [no description available] | medium | 10 | 0 | | |
methylmalonic acid | [no description available] | medium | 17 | 0 | C4-dicarboxylic acid | human metabolite |
gastrins | [no description available] | medium | 6 | 0 | | |
inosine triphosphate | [no description available] | medium | 2 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
1-methyl-3-isobutylxanthine | [no description available] | medium | 1 | 0 | 3-isobutyl-1-methylxanthine | |
8,11,14-eicosatrienoic acid | [no description available] | medium | 1 | 0 | fatty acid 20:3; long-chain fatty acid | fungal metabolite; human metabolite; nutraceutical |
docosapentaenoic acid | [no description available] | medium | 1 | 0 | docosapentaenoic acid; omega-3 fatty acid | algal metabolite; human metabolite |
bucladesine | [no description available] | medium | 5 | 0 | 3',5'-cyclic purine nucleotide | |
acth, biotinyl- | [no description available] | medium | 3 | 0 | | |
glutaconic acid | [no description available] | medium | 2 | 0 | glutaconic acid | |
thiocystine | [no description available] | medium | 1 | 0 | | |
cephalexin | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
3-amino-9-ethylcarbazole | [no description available] | medium | 1 | 0 | carbazoles | |
thomsen-friedenreich antigen | [no description available] | medium | 4 | 0 | | |
5'-methylthioadenosine | [no description available] | medium | 1 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ergothioneine | [no description available] | medium | 1 | 0 | 1,3-dihydroimidazole-2-thiones; amino-acid betaine; L-histidine derivative; sulfur-containing amino acid | antioxidant; chelator; fungal metabolite; plant metabolite; xenobiotic metabolite |
msh, 4-nle-7-phe-alpha- | [no description available] | medium | 2 | 0 | polypeptide | dermatologic drug |
zinostatin | [no description available] | medium | 4 | 0 | | |
sodium nitrite | [no description available] | medium | 2 | 0 | inorganic sodium salt; nitrite salt | antidote to cyanide poisoning; antihypertensive agent; antimicrobial food preservative; food antioxidant; poison |
tungstic(vi) acid | [no description available] | medium | 1 | 0 | tungsten coordination entity | |
n-(7-dimethylamino-4-methylcoumarinyl)maleimide | [no description available] | medium | 1 | 0 | | |
1-carboxyglutamic acid | [no description available] | medium | 1 | 0 | | |
candicidin | [no description available] | medium | 1 | 0 | macrolide antibiotic; polyene antibiotic | antifungal drug; bacterial metabolite |
phloretic acid | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid | plant metabolite |
sodium sulfate | [no description available] | medium | 1 | 0 | inorganic sodium salt | |
arsanilic acid | [no description available] | medium | 1 | 0 | organoarsonic acid | |
hydroxyproline | [no description available] | medium | 3 | 0 | 4-hydroxyproline; L-alpha-amino acid zwitterion | human metabolite; mouse metabolite; plant metabolite |
3-hydroxy-2-methylvalerate | [no description available] | medium | 1 | 0 | hydroxy fatty acid | |
2-methylcitric acid | [no description available] | medium | 2 | 0 | tricarboxylic acid | |
caloreen | [no description available] | medium | 1 | 0 | | |
phenylglyoxal | [no description available] | medium | 1 | 0 | phenylacetaldehydes | |
3-(2'-spiroadamantane)-4-methoxy-4-(3''-phosphoryloxy)phenyl-1,2-dioxetane | [no description available] | medium | 5 | 0 | | |
ammonium sulfate | [no description available] | medium | 13 | 0 | ammonium salt; inorganic sulfate salt | fertilizer |
calcium phosphate, dibasic, anhydrous | [no description available] | medium | 1 | 0 | calcium phosphate | |
calcium phosphate, monobasic, anhydrous | [no description available] | medium | 1 | 0 | calcium phosphate | fertilizer |
calcium pyrophosphate | [no description available] | medium | 1 | 0 | | |
valinomycin | [no description available] | medium | 8 | 0 | cyclodepsipeptide; macrocycle | antimicrobial agent; antiviral agent; bacterial metabolite; potassium ionophore |
bromodeoxyuridine triphosphate | [no description available] | medium | 1 | 0 | | |
1,2-dihydroxybenzene-3,5-disulfonic acid disodium salt | [no description available] | medium | 1 | 0 | organosulfur compound; sulfonic acid derivative | |
cholera toxin, b subunit (50-64) | [no description available] | medium | 1 | 0 | | |
ethidium | [no description available] | medium | 4 | 0 | phenanthridines | fluorochrome; intercalator |
methenamine | [no description available] | medium | 1 | 0 | polyazaalkane; polycyclic cage; tetramine | antibacterial drug |
peptide t | [no description available] | medium | 1 | 0 | | |
hen egg lysozyme peptide (46-61) | [no description available] | medium | 1 | 0 | | |
nitrous acid | [no description available] | medium | 2 | 0 | nitrogen oxoacid | |
chromomycin a3 | [no description available] | medium | 1 | 0 | | |
neuromedin c | [no description available] | medium | 1 | 0 | | |
sodium tungstate(vi) | [no description available] | medium | 1 | 0 | inorganic sodium salt | reagent |
12-hydroxy-5,8,10,14-eicosatetraenoic acid | [no description available] | medium | 4 | 0 | | |
4-(3-(biotinylaminohexamethylenaminocarbonyl)propanoylaminomethyl)-2-methyl-1,3-dithiolane-2-yl-(ala(7))phalloidin | [no description available] | medium | 9 | 0 | | |
1,2-didecanoylglycerol | [no description available] | medium | 1 | 0 | 1,2-diglyceride; decanoate ester | |
succinyl-alanylalanyl-prolyl-phenylalanine chloromethylketone | [no description available] | medium | 1 | 0 | | |
bis(sulfosuccinimidyl)suberate | [no description available] | medium | 2 | 0 | | |
5,11-methenyltetrahydrohomofolate | [no description available] | medium | 1 | 0 | | |
penicillanic acid | [no description available] | medium | 2 | 0 | penicillanic acids | |
phencyclidine | [no description available] | medium | 2 | 0 | benzenes; piperidines | anaesthetic; neurotoxin; NMDA receptor antagonist; psychotropic drug |
tyrosyl-arginyl-phenylalanyl-lysinamide | [no description available] | medium | 3 | 0 | | |
arginine glutamate | [no description available] | medium | 1 | 0 | glutamic acid derivative | |
ammonium acetate | [no description available] | medium | 2 | 0 | acetate salt; ammonium salt | buffer; food acidity regulator |
succinyl-alanyl-alanyl-prolyl-phenylalanine-4-nitroanilide | [no description available] | medium | 1 | 0 | | |
sodium borate | [no description available] | medium | 1 | 0 | | |
dinitrofluorobenzene | [no description available] | medium | 4 | 0 | C-nitro compound; organofluorine compound | agrochemical; allergen; chromatographic reagent; EC 2.7.3.2 (creatine kinase) inhibitor; protein-sequencing agent; spectrophotometric reagent |
transforming growth factor alpha | [no description available] | medium | 2 | 0 | | |
1,2-dioxetane | [no description available] | medium | 4 | 0 | | |
s-2-aminoethyl cysteine | [no description available] | medium | 2 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid | EC 5.4.3.2 (lysine 2,3-aminomutase) inhibitor; metabolite; protein synthesis inhibitor |
pyrrolidonecarboxylic acid | [no description available] | medium | 2 | 0 | 5-oxoproline; L-proline derivative; non-proteinogenic L-alpha-amino acid | algal metabolite |
pyridoxamine phosphate | [no description available] | medium | 1 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
peptide nucleic acid, t10-lysine | [no description available] | medium | 1 | 0 | | |
5-methyldeoxycytidine | [no description available] | medium | 1 | 0 | 2'-deoxycytidine | |
lanthiopeptin | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide; L-cysteine thioether; macrocycle; type B lantibiotic | |
trehalose | [no description available] | medium | 1 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
biuret | [no description available] | medium | 1 | 0 | condensed ureas | |
bicinchoninic acid | [no description available] | medium | 1 | 0 | | |
phorbol 12,13-dibutyrate | [no description available] | medium | 1 | 0 | butyrate ester; phorbol ester; tertiary alpha-hydroxy ketone | |
cytochalasin b | [no description available] | medium | 4 | 0 | cytochalasin; lactam; lactone; organic heterotricyclic compound | actin polymerisation inhibitor; metabolite; mycotoxin; platelet aggregation inhibitor |
pyruvaldehyde | [no description available] | medium | 1 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
diacetyldichlorofluorescein | [no description available] | medium | 1 | 0 | | |
n-glycolylneuraminyllactosylceramide | [no description available] | medium | 2 | 0 | sialotriaosylceramide | tumour antigen |
rhodamine 123 | [no description available] | medium | 1 | 0 | organic cation; xanthene dye | fluorochrome |
ammonium nickel sulfate | [no description available] | medium | 1 | 0 | ammonium salt; metal sulfate; nickel coordination entity | |
delphinidin | [no description available] | medium | 11 | 0 | anthocyanidin chloride | |
cis-vaccenic acid | [no description available] | medium | 1 | 0 | vaccenic acid | |
palmitoleic acid | [no description available] | medium | 2 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
systemin | [no description available] | medium | 1 | 0 | | |
motilin | [no description available] | medium | 1 | 0 | | |
enkephalin, methionine | [no description available] | medium | 2 | 0 | | |
penicillin v | [no description available] | medium | 2 | 0 | penicillin allergen; penicillin | |
psychosine | [no description available] | medium | 1 | 0 | glycosylsphingoid | human metabolite |
guanylyl imidodiphosphate | [no description available] | medium | 2 | 0 | nucleoside triphosphate analogue | |
somatostatin 28, leu(8)-trp(22)-iodo-tyr(25)- | [no description available] | medium | 1 | 0 | | |
somatostatin, tyr(11)- | [no description available] | medium | 1 | 0 | | |
dynorphin (1-8) | [no description available] | medium | 1 | 0 | | |
hypoxanthine | [no description available] | medium | 2 | 0 | nucleobase analogue; oxopurine; purine nucleobase | fundamental metabolite |
pyrazines | [no description available] | medium | 2 | 0 | diazine; pyrazines | Daphnia magna metabolite |
org 2766 | [no description available] | medium | 1 | 0 | | |
swainsonine | [no description available] | medium | 3 | 0 | indolizidine alkaloid | antineoplastic agent; EC 3.2.1.114 (mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase) inhibitor; immunological adjuvant; plant metabolite |
4-methylumbelliferyl phosphate | [no description available] | medium | 3 | 0 | | |
crotonyl-coenzyme a | [no description available] | medium | 1 | 0 | but-2-enoyl-CoA | |
1,2-dilauroylphosphatidylcholine | [no description available] | medium | 1 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine(1+) | |
eledoisin | [no description available] | medium | 1 | 0 | peptide | |
lipid a | [no description available] | medium | 4 | 0 | dodecanoate ester; lipid A; tetradecanoate ester | Escherichia coli metabolite |
cord factors | [no description available] | medium | 1 | 0 | | |
omega-conotoxin (conus magus) | [no description available] | medium | 1 | 0 | | |
s6c sarafotoxin | [no description available] | medium | 1 | 0 | | |
arginine vasopressin | [no description available] | medium | 12 | 0 | vasopressin | cardiovascular drug; hematologic agent; mitogen |
n,n,n',n'-tetramethylbenzidine | [no description available] | medium | 1 | 0 | | |
isometamidium chloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
benzyloxycarbonylarginyl-arginine 4-methylcoumarin-7-ylamide | [no description available] | medium | 1 | 0 | | |
benzyloxycarbonyl-phenylalanylarginine-4-methylcoumaryl-7-amide | [no description available] | medium | 1 | 0 | | |
brine | [no description available] | medium | 1 | 0 | | |
4-(n,n-dimethylaminoazobenzene)-4'-isothiocyanate | [no description available] | medium | 1 | 0 | | |
n-acetyltryptophanamide | [no description available] | medium | 1 | 0 | acetamides; L-tryptophan derivative; primary carboxamide; secondary carboxamide | |
1,2-dihydroxybenzene-3,5-disulfonic acid disodium salt | [no description available] | medium | 1 | 0 | organic molecular entity | |
4-nitrophenylphosphate | [no description available] | medium | 2 | 0 | aryl phosphate | mouse metabolite |
attophos | [no description available] | medium | 1 | 0 | | |
fibrinopeptide a | [no description available] | medium | 1 | 0 | | |
endothelin (16-21) | [no description available] | medium | 1 | 0 | peptide | |
1,3,4,6-tetrachloro-3 alpha,6 alpha-diphenylglycoluril | [no description available] | medium | 3 | 0 | | |
dimethylacetamide | [no description available] | medium | 1 | 0 | acetamides; monocarboxylic acid amide | human metabolite |
n-succinimidyl propionate | [no description available] | medium | 1 | 0 | | |
zidovudine triphosphate | [no description available] | medium | 1 | 0 | | |
ammonium hydroxide | [no description available] | medium | 2 | 0 | inorganic hydroxy compound | food acidity regulator |
4-iodophenol | [no description available] | medium | 3 | 0 | iodophenol | |
potassium iodide | [no description available] | medium | 1 | 0 | potassium salt | expectorant; radical scavenger |
tebufenozide | [no description available] | medium | 1 | 0 | carbohydrazide | ecdysone agonist; environmental contaminant; xenobiotic |
ristocetin | [no description available] | medium | 1 | 0 | glycopeptide; heterodetic cyclic peptide; macrocycle; tetrasaccharide derivative | antibacterial drug; antimicrobial agent; bacterial metabolite; platelet-activating factor receptor agonist |
thiodigalactoside | [no description available] | medium | 1 | 0 | | |
2-n-(4-(1-azitrifluoroethyl)benzoyl)-1,3-bis-(mannos-4-yloxy)-2-propylamine | [no description available] | medium | 2 | 0 | | |
cdw17 antigen | [no description available] | medium | 1 | 0 | | |
2-chloroadenosine | [no description available] | medium | 1 | 0 | purine nucleoside | |
2-chloro-3'-deoxyadenosine | [no description available] | medium | 1 | 0 | | |
formycins | [no description available] | medium | 1 | 0 | | |
formycin 5'-phosphate | [no description available] | medium | 1 | 0 | | |
methyl parathion | [no description available] | medium | 1 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; antifungal agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; environmental contaminant; genotoxin |
thromboxane a2 | [no description available] | medium | 1 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
sulotroban | [no description available] | medium | 1 | 0 | | |
15-hydroxy-11 alpha,9 alpha-(epoxymethano)prosta-5,13-dienoic acid | [no description available] | medium | 1 | 0 | | |
sq 29548 | [no description available] | medium | 1 | 0 | | |
2,4-dichlorophenoxyacetic acid | [no description available] | medium | 3 | 0 | chlorophenoxyacetic acid; dichlorobenzene | agrochemical; defoliant; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; environmental contaminant; phenoxy herbicide; synthetic auxin |
pentylenetetrazole | [no description available] | medium | 1 | 0 | organic heterobicyclic compound; organonitrogen heterocyclic compound | |
chromomycins | [no description available] | medium | 1 | 0 | | |
5-bromouridine triphosphate | [no description available] | medium | 1 | 0 | organobromine compound; pyrimidine ribonucleoside 5'-triphosphate | |
gadolinium chloride | [no description available] | medium | 1 | 0 | gadolinium coordination entity | TRP channel blocker |
alendronate | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid); primary amino compound | bone density conservation agent; EC 2.5.1.1 (dimethylallyltranstransferase) inhibitor |
salicylates | [no description available] | medium | 2 | 0 | monohydroxybenzoate | plant metabolite |
camphor, (+-)-isomer | [no description available] | medium | 1 | 0 | bornane monoterpenoid; cyclic monoterpene ketone | plant metabolite |
benzamidine | [no description available] | medium | 2 | 0 | benzenes; carboxamidine | serine protease inhibitor |
rmp 7 | [no description available] | medium | 1 | 0 | | |
thrombin receptor peptide (42-55) | [no description available] | medium | 1 | 0 | | |
tetramethylrhodamine iodoacetamide | [no description available] | medium | 1 | 0 | | |
adenosine-3',5'-cyclic phosphorothioate | [no description available] | medium | 1 | 0 | nucleoside 3',5'-cyclic phosphorothioate | |
ethylene glycolylbis(succinimidyl succinate) | [no description available] | medium | 1 | 0 | | |
methyl malonate | [no description available] | medium | 1 | 0 | | |
benzoylecgonine | [no description available] | medium | 1 | 0 | benzoate ester; tropane alkaloid | epitope; human xenobiotic metabolite; marine xenobiotic metabolite; plant metabolite |
digitoxigenin | [no description available] | medium | 1 | 0 | 14beta-hydroxy steroid; 3beta-hydroxy steroid | |
prostaglandins b | [no description available] | medium | 1 | 0 | | |
prostaglandin b2 | [no description available] | medium | 1 | 0 | prostaglandins B | human metabolite |
3-(2'-(spiro-5-chloroadamantane))-4-methoxy-4-(3''-phosphoryloxy)phenyl-1,2-dioxetane | [no description available] | medium | 1 | 0 | | |
beta-naltrexamine | [no description available] | medium | 1 | 0 | | |
nitroarginine | [no description available] | medium | 2 | 0 | guanidines; L-arginine derivative; N-nitro compound; non-proteinogenic L-alpha-amino acid | |
iothalamic acid | [no description available] | medium | 1 | 0 | organic molecular entity | |
7-methylguanosine | [no description available] | medium | 1 | 0 | methylguanosine; organic cation | metabolite |
1-monooleoyl-rac-glycerol | [no description available] | medium | 1 | 0 | 1-acylglycerol 18:1; monooleoylglycerol | plant metabolite |
n-4-nitrobenzo-2-oxa-1,3-diazoledipalmitoyl phosphatidylethanolamine | [no description available] | medium | 1 | 0 | | |
cytidylyl-3'-5'-guanosine | [no description available] | medium | 1 | 0 | (3'->5')-dinucleotide | |
lithium chloride | [no description available] | medium | 2 | 0 | inorganic chloride; lithium salt | antimanic drug; geroprotector |
fructose-1,6-diphosphate | [no description available] | medium | 2 | 0 | | |
1-octanol | [no description available] | medium | 3 | 0 | octanol; primary alcohol | antifungal agent; bacterial metabolite; fuel additive; kairomone; plant metabolite |
n-acetylmannosamine | [no description available] | medium | 1 | 0 | | |
cgp 52411 | [no description available] | medium | 2 | 0 | phthalimides | geroprotector; tyrosine kinase inhibitor |
pd 153035 | [no description available] | medium | 1 | 0 | aromatic amine; aromatic ether; bromobenzenes; quinazolines; secondary amino compound | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; epidermal growth factor receptor antagonist |
iminodiacetic acid | [no description available] | medium | 1 | 0 | amino dicarboxylic acid; glycine derivative; non-proteinogenic alpha-amino acid | chelator |
5-((4,6-dichloro-1,3,5-triazin-2-yl)amino)fluorescein | [no description available] | medium | 1 | 0 | | |
fumagillin | [no description available] | medium | 1 | 0 | antibiotic antifungal drug; carboxylic ester; dicarboxylic acid monoester; meroterpenoid; organooxygen heterocyclic antibiotic; spiro-epoxide | angiogenesis inhibitor; antibacterial drug; antimicrobial agent; antiprotozoal drug; fungal metabolite; methionine aminopeptidase 2 inhibitor |
ovalicin | [no description available] | medium | 1 | 0 | | |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | medium | 2 | 0 | | |
gyki 52466 | [no description available] | medium | 1 | 0 | benzodiazepine | |
topotecan | [no description available] | medium | 1 | 0 | pyranoindolizinoquinoline | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor |
hexamethonium | [no description available] | medium | 2 | 0 | quaternary ammonium salt | |
sanguinarine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; benzophenanthridine alkaloid; botanical anti-fungal agent | |
nogalamycin | [no description available] | medium | 1 | 0 | | |
2,3-dimethoxy-1,4-naphthoquinone | [no description available] | medium | 1 | 0 | 1,4-naphthoquinones | |
pyrrolidine dithiocarbamate | [no description available] | medium | 1 | 0 | dithiocarbamic acids; pyrrolidines | anticonvulsant; antineoplastic agent; geroprotector; neuroprotective agent; NF-kappaB inhibitor; radical scavenger |
potassium phosphate | [no description available] | medium | 2 | 0 | inorganic phosphate salt; inorganic potassium salt | |
asbestos, crocidolite | [no description available] | medium | 1 | 0 | | |
monoisoamyl-2,3-dimercaptosuccinate | [no description available] | medium | 1 | 0 | | |
succimer | [no description available] | medium | 1 | 0 | dicarboxylic acid; dithiol; sulfur-containing carboxylic acid | chelator |
arachidonic acid | [no description available] | medium | 4 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
amanitins | [no description available] | medium | 4 | 0 | | |
s-methylisothiopseudouronium | [no description available] | medium | 1 | 0 | | |
etiron | [no description available] | medium | 1 | 0 | | |
isothiuronium | [no description available] | medium | 1 | 0 | | |
n(g)-iminoethylornithine | [no description available] | medium | 1 | 0 | L-alpha-amino acid | |
s-methylthiocitrulline | [no description available] | medium | 1 | 0 | imidothiocarbamic ester; L-arginine derivative; L-ornithine derivative; non-proteinogenic L-alpha-amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; neuroprotective agent |
diethylhexyl phthalate | [no description available] | medium | 1 | 0 | diester; phthalate ester | androstane receptor agonist; apoptosis inhibitor; plasticiser |
3,3'-dipropyl-2,2'-thiadicarbocyanine | [no description available] | medium | 1 | 0 | | |
alx40 4c | [no description available] | medium | 1 | 0 | | |
vasotocin | [no description available] | medium | 3 | 0 | | |
4-methylumbelliferyl-galactopyranoside | [no description available] | medium | 2 | 0 | beta-D-galactoside; coumarins; monosaccharide derivative | chromogenic compound |
glycoluril | [no description available] | medium | 1 | 0 | azabicycloalkane; ureas | |
tropolone | [no description available] | medium | 1 | 0 | alpha-hydroxy ketone; cyclic ketone; enol | bacterial metabolite; fungicide; toxin |
beta-thujaplicin | [no description available] | medium | 1 | 0 | cyclic ketone; enol; monoterpenoid | antibacterial agent; antifungal agent; antineoplastic agent; antiplasmodial drug; plant metabolite |
transportan | [no description available] | medium | 1 | 0 | | |
mastoparan | [no description available] | medium | 1 | 0 | mastoparans; peptidyl amide | antimicrobial agent |
eosine i bluish | [no description available] | medium | 1 | 0 | organic sodium salt | fluorescent dye; histological dye |
phenyl-n-tert-butylnitrone | [no description available] | medium | 2 | 0 | | |
simazine | [no description available] | medium | 1 | 0 | chloro-1,3,5-triazine; diamino-1,3,5-triazine | environmental contaminant; herbicide; xenobiotic |
argininamide | [no description available] | medium | 1 | 0 | amino acid amide; guanidines; L-arginine derivative | |
sebacic acid | [no description available] | medium | 1 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite; plant metabolite |
keratan sulfate | [no description available] | medium | 2 | 0 | | |
alanylalanine | [no description available] | medium | 1 | 0 | dipeptide | |
1,1'-dipropyl-3,3,3',3'-tetramethylindocarbocyanine | [no description available] | medium | 1 | 0 | | |
n(6)-cyclohexyladenosine | [no description available] | medium | 2 | 0 | | |
sym-trinitrobenzene | [no description available] | medium | 1 | 0 | trinitrobenzene | explosive |
n-acetylaspartic acid | [no description available] | medium | 1 | 0 | N-acetyl-L-amino acid; N-acyl-L-aspartic acid | antioxidant; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
dithiobis(succinimidylpropionate) | [no description available] | medium | 1 | 0 | | |
2-amino-5,6-dihydro-6-methyl-4h-1,3-thiazine | [no description available] | medium | 1 | 0 | 1,3-thiazine | |
uric acid | [no description available] | medium | 2 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
1,2-dioctanoylglycerol | [no description available] | medium | 2 | 0 | | |
piperidine | [no description available] | medium | 2 | 0 | azacycloalkane; piperidines; saturated organic heteromonocyclic parent; secondary amine | base; catalyst; human metabolite; non-polar solvent; plant metabolite; protic solvent; reagent |
4-acetamido-4'-isothiocyanatostilbene-2,2'-disulfonic acid | [no description available] | medium | 2 | 0 | stilbenoid | |
o-phthalaldehyde | [no description available] | medium | 1 | 0 | benzaldehydes; dialdehyde | epitope |
3-mercaptopropionic acid | [no description available] | medium | 2 | 0 | mercaptopropanoic acid | algal metabolite |
eponemycin | [no description available] | medium | 1 | 0 | | |
dihydroeponemycin | [no description available] | medium | 1 | 0 | | |
tyrosyl-alanyl-glycine | [no description available] | medium | 1 | 0 | | |
technetium tc 99m mertiatide | [no description available] | medium | 1 | 0 | | |
glyoxal | [no description available] | medium | 2 | 0 | dialdehyde | agrochemical; allergen; pesticide; plant growth regulator |
triolein | [no description available] | medium | 1 | 0 | triglyceride | Caenorhabditis elegans metabolite; plant metabolite |
aluminum fluoride | [no description available] | medium | 1 | 0 | aluminium coordination entity | |
4-carboxyfluorescein | [no description available] | medium | 1 | 0 | monocarboxylic acid | fluorochrome |
allosamidin | [no description available] | medium | 1 | 0 | | |
aminoethylphosphonic acid | [no description available] | medium | 1 | 0 | phosphonic acids; primary amino compound; zwitterion | human metabolite; metabolite; mouse metabolite |
1-(aminoethyl)phosphonic acid | [no description available] | medium | 1 | 0 | phosphonoacetic acid | |
ganglio-n-triaosylceramide | [no description available] | medium | 2 | 0 | | |
1-bromohexane | [no description available] | medium | 1 | 0 | | |
adenylyl imidodiphosphate | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate | |
p(3)-1-(2-nitro)phenylethyladenosine 5'-triphosphate | [no description available] | medium | 1 | 0 | | |
etidronate | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid) | antineoplastic agent; bone density conservation agent; chelator |
n-(mercaptoacetyl)glycine | [no description available] | medium | 1 | 0 | | |
deamino arginine vasopressin | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide | diagnostic agent; renal agent; vasopressin receptor agonist |
1-pyrenebutyrate | [no description available] | medium | 1 | 0 | | |
6-carboxyfluorescein diacetate | [no description available] | medium | 1 | 0 | | |
7-hydroxycoumarin-3-carboxylic acid | [no description available] | medium | 1 | 0 | | |
7-nitroindazole | [no description available] | medium | 1 | 0 | | |
indazoles | [no description available] | medium | 1 | 0 | indazole | |
5-fluorouridine | [no description available] | medium | 1 | 0 | organofluorine compound; uridines | mutagen |
ethyl methanesulfonate | [no description available] | medium | 2 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; genotoxin; mutagen; teratogenic agent |
technetium tc 99m exametazime | [no description available] | medium | 3 | 0 | | |
prostaglandin f1 | [no description available] | medium | 1 | 0 | prostaglandins Falpha | human metabolite |
phenylarsonous acid | [no description available] | medium | 1 | 0 | arsonous acids | |
ryanodine | [no description available] | medium | 1 | 0 | | |
delta-philanthotoxin | [no description available] | medium | 1 | 0 | | |
acrylodan | [no description available] | medium | 1 | 0 | | |
hoe 694 | [no description available] | medium | 1 | 0 | | |
alcian blue | [no description available] | medium | 1 | 0 | | |
1-methyladenine | [no description available] | medium | 1 | 0 | | |
mibolerone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid | anabolic agent; androgen |
norgestrel | [no description available] | medium | 1 | 0 | | |
clobetasol | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; fluorinated steroid; glucocorticoid; tertiary alpha-hydroxy ketone | anti-inflammatory drug; SMO receptor agonist |
deflazacort | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
proctolin | [no description available] | medium | 1 | 0 | | |
phenylalanyl-leucyl-arginyl phenylalaninamide | [no description available] | medium | 1 | 0 | | |
uranyl acetate | [no description available] | medium | 1 | 0 | | |
hexadecylamine | [no description available] | medium | 1 | 0 | alkylamine | |
n-azidoacetylmannosamine | [no description available] | medium | 1 | 0 | | |
barium | [no description available] | medium | 2 | 0 | alkaline earth metal atom; elemental barium | |
linoleic acid | [no description available] | medium | 4 | 0 | octadecadienoic acid; omega-6 fatty acid | algal metabolite; Daphnia galeata metabolite; plant metabolite |
2-(trifluoromethyl)acrylic acid | [no description available] | medium | 1 | 0 | | |
ethylene dimethacrylate | [no description available] | medium | 1 | 0 | enoate ester | allergen; cross-linking reagent; polymerisation monomer |
alpha-linolenic acid | [no description available] | medium | 2 | 0 | linolenic acid; omega-3 fatty acid | micronutrient; mouse metabolite; nutraceutical |
hexamethyldisiloxane | [no description available] | medium | 1 | 0 | organosiloxane | |
angiotensinogen | [no description available] | medium | 1 | 0 | | |
molybdopterin guanine dinucleotide | [no description available] | medium | 1 | 0 | | |
oleylamide | [no description available] | medium | 1 | 0 | primary fatty amide | human metabolite; plant metabolite |
gliclazide | [no description available] | medium | 1 | 0 | | |
s-ethyl glutathione | [no description available] | medium | 1 | 0 | oligopeptide | |
4,7-bis(chlorosulfophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid | [no description available] | medium | 8 | 0 | | |
2-azidoadenosine | [no description available] | medium | 1 | 0 | | |
nuclear yellow | [no description available] | medium | 1 | 0 | | |
technetium tc 99m pentetate | [no description available] | medium | 1 | 0 | | |
maitotoxin | [no description available] | medium | 1 | 0 | | |
quisqualic acid | [no description available] | medium | 1 | 0 | non-proteinogenic alpha-amino acid | |
alpha,beta-methyleneadenosine 5'-triphosphate | [no description available] | medium | 1 | 0 | nucleoside triphosphate analogue | |
4-(n-(s-glutathionylacetyl)amino)phenylarsenoxide | [no description available] | medium | 2 | 0 | glutathione derivative | |
halichondrin b | [no description available] | medium | 1 | 0 | furopyran | |
er-086526 | [no description available] | medium | 1 | 0 | cyclic ketal; cyclic ketone; macrocycle; polycyclic ether; polyether; primary amino compound | antineoplastic agent; microtubule-destabilising agent |
cellulose triacetate | [no description available] | medium | 1 | 0 | | |
cyclopentenone | [no description available] | medium | 1 | 0 | alicyclic ketone; enone | Hsp70 inducer |
octadecane | [no description available] | medium | 1 | 0 | long-chain alkane | bacterial metabolite; plant metabolite |
sr 142801 | [no description available] | medium | 1 | 0 | | |
senktide | [no description available] | medium | 1 | 0 | | |
sr 140333 | [no description available] | medium | 1 | 0 | | |
quinuclidines | [no description available] | medium | 1 | 0 | quinuclidines; saturated organic heterobicyclic parent | |
quinolinic acid | [no description available] | medium | 1 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
succinoglycan | [no description available] | medium | 1 | 0 | | |
antimycin | [no description available] | medium | 1 | 0 | | |
antimycin a | [no description available] | medium | 3 | 0 | amidobenzoic acid | |
etorphine | [no description available] | medium | 1 | 0 | | |
chapso | [no description available] | medium | 1 | 0 | | |
1-phenylimidazole | [no description available] | medium | 1 | 0 | | |
hexaamminecobalt(ii) | [no description available] | medium | 1 | 0 | | |
phenylalanyl-prolyl-arginine methyl chloride | [no description available] | medium | 1 | 0 | | |
phosphoribosyl-n-formylglycineamide | [no description available] | medium | 1 | 0 | | |
indole-3-acetaldehyde | [no description available] | medium | 1 | 0 | indoleacetaldehyde | bacterial metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pkh 26 | [no description available] | medium | 1 | 0 | | |
kinetin | [no description available] | medium | 1 | 0 | 6-aminopurines; furans | cytokinin; geroprotector |
15-crown-5 | [no description available] | medium | 1 | 0 | crown ether; saturated organic heteromonocyclic parent | |
n-hydroxysulfosuccinimide | [no description available] | medium | 1 | 0 | | |
1-naphthaleneacetic acid | [no description available] | medium | 1 | 0 | naphthylacetic acid | synthetic auxin |
3,5,6-trichloro-2-pyridinol | [no description available] | medium | 1 | 0 | chloropyridine; hydroxypyridine; pyridone | human urinary metabolite; human xenobiotic metabolite; marine xenobiotic metabolite |
uridine diphosphate galactose | [no description available] | medium | 1 | 0 | UDP-D-galactose | mouse metabolite |
uridine diphosphate n-acetylglucosamine | [no description available] | medium | 1 | 0 | | |
acid citrate dextrose | [no description available] | medium | 1 | 0 | | |
2-cyano-n-((ethylamino)carbonyl)-2-(methoxyimino)acetamide | [no description available] | medium | 1 | 0 | | |
baicalein | [no description available] | medium | 1 | 0 | trihydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.31 (arachidonate 12-lipoxygenase) inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 4.1.1.17 (ornithine decarboxylase) inhibitor; ferroptosis inhibitor; geroprotector; hormone antagonist; plant metabolite; prostaglandin antagonist; radical scavenger |
4-(4-dimethylaminophenylazo)benzoic acid | [no description available] | medium | 1 | 0 | | |
dihydrokainate | [no description available] | medium | 1 | 0 | dicarboxylic acid | |
n-succinimidyl 3-(trimethylstannyl)benzoate | [no description available] | medium | 1 | 0 | | |
5-bromo-4-chloro-3-indolyl beta-galactoside | [no description available] | medium | 1 | 0 | beta-D-galactoside; D-aldohexose derivative; indolyl carbohydrate; organobromine compound; organochlorine compound | chromogenic compound |
1,2-cyclohexanedione | [no description available] | medium | 1 | 0 | cyclohexanedione | |
gastrin-releasing peptide | [no description available] | medium | 3 | 0 | | |
diethylenetriaminetetraacetic acid | [no description available] | medium | 1 | 0 | | |
cholesterylamine | [no description available] | medium | 1 | 0 | | |
parthenolide | [no description available] | medium | 1 | 0 | germacranolide | |
alamethicin | [no description available] | medium | 1 | 0 | | |
sorbic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; sorbic acid | |
1,3-dibromo-5,5-dimethylhydantoin | [no description available] | medium | 1 | 0 | | |
bromine | [no description available] | medium | 1 | 0 | diatomic bromine | |
hydantoins | [no description available] | medium | 2 | 0 | imidazolidine-2,4-dione | |
mevalonic acid | [no description available] | medium | 3 | 0 | 3,5-dihydroxy-3-methylpentanoic acid | |
3-(n-maleimidopropionyl)biocytin | [no description available] | medium | 3 | 0 | peptide | |
kojic acid | [no description available] | medium | 1 | 0 | 4-pyranones; enol; primary alcohol | Aspergillus metabolite; EC 1.10.3.1 (catechol oxidase) inhibitor; EC 1.10.3.2 (laccase) inhibitor; EC 1.13.11.24 (quercetin 2,3-dioxygenase) inhibitor; EC 1.14.18.1 (tyrosinase) inhibitor; EC 1.4.3.3 (D-amino-acid oxidase) inhibitor; NF-kappaB inhibitor; skin lightening agent |
methicillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
cloxacillin | [no description available] | medium | 2 | 0 | penicillin allergen; penicillin; semisynthetic derivative | antibacterial agent; antibacterial drug |
phenylmethylsulfonyl fluoride | [no description available] | medium | 2 | 0 | acyl fluoride | serine proteinase inhibitor |
phosphoenolpyruvate | [no description available] | medium | 6 | 0 | carboxyalkyl phosphate; monocarboxylic acid | fundamental metabolite |
cephalosporin c | [no description available] | medium | 1 | 0 | cephalosporin | fungal metabolite |
uranium | [no description available] | medium | 2 | 0 | actinoid atom; f-block element atom; monoatomic uranium | |
chlorates | [no description available] | medium | 3 | 0 | chlorine oxoanion; monovalent inorganic anion | |
nitrosoguanidines | [no description available] | medium | 3 | 0 | | |
cystathionine | [no description available] | medium | 1 | 0 | cysteine derivative | |
diuron | [no description available] | medium | 2 | 0 | 3-(3,4-substituted-phenyl)-1,1-dimethylurea; dichlorobenzene | environmental contaminant; mitochondrial respiratory-chain inhibitor; photosystem-II inhibitor; urea herbicide; xenobiotic |
hydroxylysine | [no description available] | medium | 1 | 0 | 5-hydroxylysine; hydroxy-L-lysine | human metabolite |
lysyl-aspartyl-glutamyl-leucine | [no description available] | medium | 1 | 0 | | |
dodecyloctaethyleneglycol monoether | [no description available] | medium | 1 | 0 | hydroxypolyether | |
1,2-dimyristoylphosphatidylethanolamine | [no description available] | medium | 3 | 0 | | |
docusate | [no description available] | medium | 1 | 0 | diester; organosulfonic acid | |
cholesteryl oleate | [no description available] | medium | 1 | 0 | CE(18:1); cholesteryl octadec-9-enoate | mouse metabolite |
thymidine monophosphate | [no description available] | medium | 1 | 0 | thymidine 5'-monophosphate | fundamental metabolite |
4-phenylphenol | [no description available] | medium | 1 | 0 | hydroxybiphenyls | |
6-hydroxybenzothiazole | [no description available] | medium | 1 | 0 | | |
18-hydroxycorticosterone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 18-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo steroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
18-oxocortisol | [no description available] | medium | 1 | 0 | | |
idazoxan | [no description available] | medium | 1 | 0 | benzodioxine; imidazolines | alpha-adrenergic antagonist |
n-(1-naphthyl)ethylenediamine | [no description available] | medium | 1 | 0 | N-substituted diamine | |
diethyl pyrocarbonate | [no description available] | medium | 1 | 0 | acyclic carboxylic anhydride | |
elaidic acid | [no description available] | medium | 1 | 0 | octadec-9-enoic acid | food component |
15-keto-13,14-dihydroprostaglandin e2 | [no description available] | medium | 1 | 0 | prostaglandins E | |
15-keto-13,14-dihydroprostaglandin f2alpha | [no description available] | medium | 2 | 0 | ketone; prostaglandins Falpha | metabolite |
leupeptin | [no description available] | medium | 2 | 0 | aldehyde; tripeptide | bacterial metabolite; calpain inhibitor; cathepsin B inhibitor; EC 3.4.21.4 (trypsin) inhibitor; serine protease inhibitor |
3-iodoaniline | [no description available] | medium | 1 | 0 | | |
3-bromoaniline | [no description available] | medium | 1 | 0 | | |
benzoylarginine nitroanilide | [no description available] | medium | 1 | 0 | | |
agmatine | [no description available] | medium | 1 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
1-methyl-4-phenyl-1,2,3,6-tetrahydropyridine | [no description available] | medium | 1 | 0 | methylpyridines; phenylpyridine; tetrahydropyridine | neurotoxin |
angiotensin i | [no description available] | medium | 2 | 0 | angiotensin; peptide zwitterion | human metabolite; neurotransmitter agent |
uridine monophosphate | [no description available] | medium | 1 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phenylenediamine | [no description available] | medium | 1 | 0 | phenylenediamine | allergen; dye; hapten; reagent |
forssman glycolipid | [no description available] | medium | 1 | 0 | | |
europium cryptate | [no description available] | medium | 1 | 0 | | |
2'-deoxyuridylic acid | [no description available] | medium | 1 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
btm 1042 | [no description available] | medium | 1 | 0 | | |
cymantrene | [no description available] | medium | 1 | 0 | | |
trinitrobenzenesulfonic acid | [no description available] | medium | 1 | 0 | arenesulfonic acid; C-nitro compound | epitope; explosive; reagent |
methylnitronitrosoguanidine | [no description available] | medium | 2 | 0 | nitroso compound | alkylating agent |
thimerosal | [no description available] | medium | 1 | 0 | alkylmercury compound | antifungal drug; antiseptic drug; disinfectant; drug allergen |
cotinine | [no description available] | medium | 1 | 0 | N-alkylpyrrolidine; pyridines; pyrrolidin-2-ones; pyrrolidine alkaloid | antidepressant; biomarker; human xenobiotic metabolite; plant metabolite |
emetine | [no description available] | medium | 1 | 0 | isoquinoline alkaloid; pyridoisoquinoline | antiamoebic agent; anticoronaviral agent; antiinfective agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; expectorant; plant metabolite; protein synthesis inhibitor |
rimorphin | [no description available] | medium | 1 | 0 | | |
formamide | [no description available] | medium | 1 | 0 | carboximidic acid; formamides; monocarboxylic acid amide; one-carbon compound | solvent |
cerulenin | [no description available] | medium | 1 | 0 | epoxide; monocarboxylic acid amide | antifungal agent; antiinfective agent; antilipemic drug; antimetabolite; antimicrobial agent; fatty acid synthesis inhibitor |
dynorphins | [no description available] | medium | 1 | 0 | | |
succinic anhydride | [no description available] | medium | 1 | 0 | cyclic dicarboxylic anhydride; tetrahydrofurandione | |
acetoxyacetylaminofluorene | [no description available] | medium | 1 | 0 | 2-acetamidofluorenes | carcinogenic agent; mutagen |
4-toluenesulfinic acid | [no description available] | medium | 1 | 0 | | |
11-cis-retinal | [no description available] | medium | 1 | 0 | retinal | chromophore; human metabolite; mouse metabolite |
sodium fluoride | [no description available] | medium | 1 | 0 | fluoride salt | mutagen |
galactose | [no description available] | medium | 1 | 0 | | |
sk&f-38393 | [no description available] | medium | 1 | 0 | benzazepine; catechols; secondary amino compound | |
1h-3-benzazepin-7-ol, 8-bromo-2,3,4,5-tetrahydro-3-methyl-5-phenyl- | [no description available] | medium | 1 | 0 | benzazepine | |
sodium bisulfite | [no description available] | medium | 4 | 0 | inorganic sodium salt; sulfite salt | allergen; food antioxidant; food colour retention agent; mutagen; reducing agent |
hydroxysuccinimidyl-4-azidobenzoate | [no description available] | medium | 1 | 0 | | |
sch 23982 | [no description available] | medium | 1 | 0 | | |
lhrh, biotin-lys(6)- | [no description available] | medium | 3 | 0 | | |
buserelin | [no description available] | medium | 1 | 0 | oligopeptide | |
mast cell degranulating peptide | [no description available] | medium | 1 | 0 | | |
lypressin | [no description available] | medium | 1 | 0 | cyclic peptide | |
corticotropin-like intermediate lobe peptide | [no description available] | medium | 1 | 0 | | |
azetidyl-2-carboxylic acid | [no description available] | medium | 1 | 0 | azetidine-2-carboxylic acid | |
4-hydroxymercuribenzoate | [no description available] | medium | 1 | 0 | | |
lipoyl-4-aminobenzoic acid | [no description available] | medium | 1 | 0 | | |
4-aminobenzoic acid | [no description available] | medium | 2 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
3-maleimidobenzoyl n-hydroxysuccinimide | [no description available] | medium | 1 | 0 | | |
n-succinimidyl 3-(2-pyridyldithio)propionate | [no description available] | medium | 1 | 0 | | |
l 451167 | [no description available] | medium | 1 | 0 | | |
carbobenzoxycarbonyl-l-phenylalanyl-l-alanine-d-diazomethane | [no description available] | medium | 1 | 0 | | |
4-nitrobenzenesulfonyl fluoride | [no description available] | medium | 1 | 0 | | |
epitestosterone | [no description available] | medium | 1 | 0 | 17alpha-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen antagonist; human metabolite |
polygalacturonic acid | [no description available] | medium | 1 | 0 | D-galacturonic acid | |
butylhydroxybutylnitrosamine | [no description available] | medium | 1 | 0 | nitrosamine; primary alcohol | carcinogenic agent |
hydroxyethyl methacrylate | [no description available] | medium | 1 | 0 | enoate ester | allergen; polymerisation monomer |
angelicin | [no description available] | medium | 1 | 0 | furanocoumarin | |
mezlocillin | [no description available] | medium | 2 | 0 | | |
succinic dihydrazide | [no description available] | medium | 1 | 0 | | |
gamma-linolenic acid | [no description available] | medium | 1 | 0 | linolenic acid; omega-6 fatty acid | human metabolite; mouse metabolite; plant metabolite |
adenosine kinase | [no description available] | medium | 1 | 0 | | |
streptothricins | [no description available] | medium | 1 | 0 | | |
allylamine | [no description available] | medium | 1 | 0 | alkylamine | |
flumethasone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
glycidol | [no description available] | medium | 1 | 0 | epoxide; primary alcohol | |
hexamethylene bisacetamide | [no description available] | medium | 1 | 0 | acetamides | |
benzethonium | [no description available] | medium | 1 | 0 | alkylbenzene | |
methylbenzethonium chloride | [no description available] | medium | 1 | 0 | alkylbenzene | |
isoluminol | [no description available] | medium | 1 | 0 | | |
w 7 | [no description available] | medium | 1 | 0 | | |
octamethylenediamine | [no description available] | medium | 1 | 0 | alkane-alpha,omega-diamine | |
4-bromo-2,3-dioxobutyl-coenzyme a | [no description available] | medium | 1 | 0 | | |
methionine sulfoximine | [no description available] | medium | 1 | 0 | methionine derivative; non-proteinogenic alpha-amino acid; sulfoximide | |
4-deoxypyridoxine | [no description available] | medium | 1 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine | metabolite |
n-succinimidyl-3-(4-hydroxyphenyl)propionate | [no description available] | medium | 1 | 0 | | |
fructose 2,6-diphosphate | [no description available] | medium | 1 | 0 | D-fructofuranose 2,6-bisphosphate | human metabolite; mouse metabolite |
enkephalin, leucine-2-alanine | [no description available] | medium | 1 | 0 | | |
3-methyladenine | [no description available] | medium | 1 | 0 | | |
4-chloro-1-naphthol | [no description available] | medium | 2 | 0 | | |
epsilon-dinitrophenyllysine | [no description available] | medium | 1 | 0 | N(6)-(2,4-dinitrophenyl)lysine | |
1,2,7,8-diepoxyoctane | [no description available] | medium | 1 | 0 | epoxide | mutagen |
p-chloromercuribenzoic acid | [no description available] | medium | 1 | 0 | chlorine molecular entity; mercuribenzoic acid | |
1-pyrenyldiazomethane | [no description available] | medium | 1 | 0 | | |
sodium iodide | [no description available] | medium | 1 | 0 | inorganic sodium salt; iodide salt | |
chlorophyll a | [no description available] | medium | 3 | 0 | chlorophyll; methyl ester | cofactor |
1-propanol | [no description available] | medium | 2 | 0 | propan-1-ols; short-chain primary fatty alcohol | metabolite; protic solvent |
bromoacetate | [no description available] | medium | 1 | 0 | carboxylic acid; organohalogen compound | |
6-ketoprostaglandin f1 alpha | [no description available] | medium | 1 | 0 | prostaglandins Falpha | human metabolite; mouse metabolite |
p-azobenzenearsonate | [no description available] | medium | 1 | 0 | | |
methylnitrosourea | [no description available] | medium | 2 | 0 | N-nitrosoureas | alkylating agent; carcinogenic agent; mutagen; teratogenic agent |
9-diazomethylanthracene | [no description available] | medium | 1 | 0 | | |
molybdate ion | [no description available] | medium | 1 | 0 | divalent inorganic anion; molybdenum oxoanion | Escherichia coli metabolite |
pelargonic acid | [no description available] | medium | 2 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | algal metabolite; antifeedant; Daphnia magna metabolite; plant metabolite |
4-biphenylamine | [no description available] | medium | 1 | 0 | aminobiphenyl | carcinogenic agent |
o(6)-methyl-2'-deoxyguanosine | [no description available] | medium | 1 | 0 | purine 2'-deoxyribonucleoside | |
4-(n-methyl-n-nitrosamino)-1-(3-pyridyl)-1-butanone | [no description available] | medium | 1 | 0 | nitrosamine; pyridines | |
methyl red | [no description available] | medium | 1 | 0 | | |
phytosterols | [no description available] | medium | 1 | 0 | | |
2,6-dichloroindophenol | [no description available] | medium | 1 | 0 | dichlorobenzene; quinone imine | |
campesterol | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C28-steroid; phytosterols | mouse metabolite |
methylcellulose | [no description available] | medium | 1 | 0 | | |
homocystine | [no description available] | medium | 2 | 0 | amino acid zwitterion; homocystines | human metabolite |
methandrostenolone | [no description available] | medium | 1 | 0 | organic molecular entity | |
octadecyl palmitate | [no description available] | medium | 1 | 0 | hexadecanoate ester; wax ester | coral metabolite; cosmetic |
cyanides | [no description available] | medium | 4 | 0 | pseudohalide anion | EC 1.9.3.1 (cytochrome c oxidase) inhibitor |
chlorine | [no description available] | medium | 2 | 0 | diatomic chlorine; gas molecular entity | bleaching agent |
thiosulfates | [no description available] | medium | 2 | 0 | divalent inorganic anion; sulfur oxide; sulfur oxoanion | human metabolite |
n-pentanol | [no description available] | medium | 2 | 0 | pentanol; short-chain primary fatty alcohol | human metabolite; plant metabolite |
furazolidone | [no description available] | medium | 1 | 0 | nitrofuran antibiotic; oxazolidines | antibacterial drug; antiinfective agent; antitrichomonal drug; EC 1.4.3.4 (monoamine oxidase) inhibitor |
rubidium | [no description available] | medium | 1 | 0 | alkali metal atom | |
canavanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; non-proteinogenic L-alpha-amino acid | phytogenic insecticide; plant metabolite |
fusarium | [no description available] | medium | 7 | 0 | | |
sabinene | [no description available] | medium | 3 | 0 | thujene | plant metabolite |
isomethyleugenol | [no description available] | medium | 25 | 0 | isomethyleugenol | |
1-((3,5-dichloro)-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone | [no description available] | medium | 7 | 0 | dichlorobenzene; differentiation-inducing factor; monomethoxybenzene; resorcinols | eukaryotic metabolite; signalling molecule |
cinidon-ethyl | [no description available] | medium | 1 | 0 | ethyl ester; isoindoles; monochlorobenzenes | herbicide |
guaifenesin | [no description available] | medium | 4 | 0 | methoxybenzenes | |
jaw | [no description available] | medium | 8 | 0 | indolecarboxamide | |
inositol 3-phosphate | [no description available] | medium | 2 | 0 | | |
fomesafen | [no description available] | medium | 9 | 0 | aromatic ether; C-nitro compound; monochlorobenzenes; N-sulfonylcarboxamide; organofluorine compound; phenols | agrochemical; EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor; herbicide |
s,n,n'-tripropylthiocarbamate | [no description available] | medium | 4 | 0 | tertiary amine | |
egg white | [no description available] | medium | 53 | 0 | | |
benzothiazide | [no description available] | medium | 5 | 0 | benzothiadiazine; sulfonamide | antihypertensive agent; diuretic |
torpedo | [no description available] | medium | 12 | 0 | | |
eye | [no description available] | medium | 5 | 0 | | |
trolamine salicylate | [no description available] | medium | 2 | 0 | | |
foxes | [no description available] | medium | 1 | 0 | | |
propiconazole | [no description available] | medium | 1 | 0 | conazole fungicide; cyclic ketal; dichlorobenzene; triazole fungicide; triazoles | antifungal agrochemical; EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor; environmental contaminant; xenobiotic |
zinc oxide | [no description available] | medium | 1 | 0 | | |
clove | [no description available] | medium | 1 | 0 | | |
hypericum | [no description available] | medium | 1 | 0 | penicillanic acids | |
exudates | [no description available] | medium | 1 | 0 | | |
sodium ethylxanthate | [no description available] | medium | 1 | 0 | | |
berlition | [no description available] | low | 0 | 0 | dithiolanes; heterocyclic fatty acid; lipoic acid; thia fatty acid | cofactor; nutraceutical; prosthetic group |
4'-phosphopantetheine | [no description available] | low | 0 | 0 | pantetheine 4'-phosphate | prosthetic group |
7-mercaptoheptanoylthreonine phosphate | [no description available] | low | 0 | 0 | L-threonine derivative | coenzyme |
sapropterin | [no description available] | low | 0 | 0 | 5,6,7,8-tetrahydrobiopterin | coenzyme; cofactor; diagnostic agent; human metabolite |
sapropterin dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride | coenzyme; diagnostic agent |
glycocyamine | [no description available] | low | 0 | 0 | guanidinoacetic acids; zwitterion | bacterial metabolite; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
benphothiamine | [no description available] | low | 0 | 0 | aminopyrimidine; formamides; organic phosphate; thioester | antioxidant; immunological adjuvant; nutraceutical; protective agent; provitamin B1 |
calcium gluconate | [no description available] | low | 0 | 0 | calcium salt | nutraceutical |
levocarnitine | [no description available] | low | 0 | 0 | carnitine | antilipemic drug; nootropic agent; nutraceutical; Saccharomyces cerevisiae metabolite; water-soluble vitamin (role) |
calcium citrate | [no description available] | low | 0 | 0 | organic calcium salt | flavouring agent; food additive; food preservative; nutraceutical |
manganese chloride | [no description available] | low | 0 | 0 | hydrate; inorganic chloride; manganese coordination entity | MRI contrast agent; nutraceutical |
ferric citrate | [no description available] | low | 0 | 0 | iron chelate | anti-anaemic agent; nutraceutical |
aspartame | [no description available] | low | 0 | 0 | carboxylic acid; dipeptide zwitterion; dipeptide; methyl ester | apoptosis inhibitor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; environmental contaminant; micronutrient; nutraceutical; sweetening agent; xenobiotic |
7-oxodehydroepiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; 7-oxo steroid; androstanoid | human blood serum metabolite; nutraceutical; prohormone |
oleuropein | [no description available] | low | 0 | 0 | beta-D-glucoside; catechols; diester; methyl ester; pyrans; secoiridoid glycoside | anti-inflammatory agent; antihypertensive agent; antineoplastic agent; antioxidant; apoptosis inducer; NF-kappaB inhibitor; nutraceutical; plant metabolite; radical scavenger |
calcifediol | [no description available] | low | 0 | 0 | D3 vitamins; diol; hydroxycalciol | bone density conservation agent; human metabolite; metabolite; mouse metabolite; nutraceutical |
25-hydroxyvitamin d 2 | [no description available] | low | 0 | 0 | hydroxycalciol; seco-ergostane; vitamin D | bone density conservation agent; human xenobiotic metabolite; nutraceutical |
1,25-dihydroxyergocalciferol | [no description available] | low | 0 | 0 | hydroxycalciol; seco-ergostane; vitamin D | bone density conservation agent; human xenobiotic metabolite; nutraceutical |
chromium tripicolinate | [no description available] | low | 0 | 0 | chromium coordination entity | anti-obesity agent; geroprotector; hypoglycemic agent; nutraceutical |
2-oxo-3-methylvalerate | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; branched-chain keto acid | human metabolite |
alpha-ketoisovalerate | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; branched-chain keto acid | human metabolite; Saccharomyces cerevisiae metabolite |
2,3-diphosphoglycerate | [no description available] | low | 0 | 0 | bisphosphoglyceric acid; tetronic acid derivative | human metabolite |
2-keto-4-methylvalerate | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; branched-chain keto acid | algal metabolite; human metabolite |
3-hydroxyanthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; monohydroxybenzoic acid | human metabolite; mouse metabolite |
3-hydroxykynurenine | [no description available] | low | 0 | 0 | hydroxykynurenine | human metabolite |
3-oxoadipic acid | [no description available] | low | 0 | 0 | dicarboxylic fatty acid; oxo dicarboxylic acid | bacterial xenobiotic metabolite; human metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
4-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols | fungal metabolite; human metabolite; mouse metabolite; plant metabolite |
isocaproaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde | human metabolite; mouse metabolite |
5-aminovaleric acid | [no description available] | low | 0 | 0 | amino acid zwitterion; delta-amino acid; omega-amino fatty acid | human metabolite |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
anthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid | human metabolite; mouse metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
trimethylenediamine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | human metabolite; mouse metabolite; reagent |
pyrrolidonecarboxylic acid | [no description available] | low | 0 | 0 | oxoproline; pyrrolidin-2-ones; pyrrolidinemonocarboxylic acid | human metabolite |
3,4-dihydroxyphenylacetic acid | [no description available] | low | 0 | 0 | catechols; dihydroxyphenylacetic acid | human metabolite |
alpha-keto-delta-guanidinovaleric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
dihydrolipoamide | [no description available] | low | 0 | 0 | dithiol; monocarboxylic acid amide | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
alpha-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | algal metabolite; human metabolite |
glycolaldehyde | [no description available] | low | 0 | 0 | glycolaldehydes | fundamental metabolite; human metabolite |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydrogen cyanide | [no description available] | low | 0 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
homogentisic acid | [no description available] | low | 0 | 0 | dihydroxyphenylacetic acid; hydroquinones | human metabolite; plant metabolite |
itaconic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid; olefinic compound | fungal metabolite; human metabolite |
potassium | [no description available] | low | 0 | 0 | alkali metal cation; elemental potassium; monoatomic monocation; monovalent inorganic cation | cofactor; human metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
methylmercaptan | [no description available] | low | 0 | 0 | alkanethiol | human metabolite; Saccharomyces cerevisiae metabolite |
n-acetylserotonin | [no description available] | low | 0 | 0 | acetamides; N-acylserotonin; phenols | antioxidant; human metabolite; mouse metabolite; tropomyosin-related kinase B receptor agonist |
n-methylphenylethanolamine | [no description available] | low | 0 | 0 | alkaloid; phenylethanolamines | human metabolite; plant metabolite |
n'-acetylspermine | [no description available] | low | 0 | 0 | acetamides; acetylspermine | human metabolite |
hydroxypyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
4-hydroxyphenylpyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; phenols | human metabolite |
hexadecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-hydroxyphenethylamine | [no description available] | low | 0 | 0 | phenylethanolamines | human metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
vanilmandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; aromatic ether; phenols | human metabolite |
perillic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | antineoplastic agent; human metabolite; mouse metabolite |
meglutol | [no description available] | low | 0 | 0 | 3-hydroxy carboxylic acid; dicarboxylic acid; tertiary alcohol | anticholesteremic drug; antimetabolite; EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; human metabolite; plant metabolite |
homovanillic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid | human metabolite; mouse metabolite |
3-hydroxy-4-methoxyphenethylamine | [no description available] | low | 0 | 0 | monomethoxybenzene; phenols; phenylethylamine; primary amino compound | human metabolite; rat metabolite |
hydroxyindoleacetic acid | [no description available] | low | 0 | 0 | indole-3-acetic acids | drug metabolite; human metabolite; mouse metabolite |
5-methoxytryptamine | [no description available] | low | 0 | 0 | aromatic ether; primary amino compound; tryptamines | 5-hydroxytryptamine 2A receptor agonist; 5-hydroxytryptamine 2B receptor agonist; 5-hydroxytryptamine 2C receptor agonist; antioxidant; cardioprotective agent; human metabolite; mouse metabolite; neuroprotective agent; radiation protective agent; serotonergic agonist |
cetyl alcohol | [no description available] | low | 0 | 0 | hexadecanol; long-chain primary fatty alcohol | algal metabolite; flavouring agent; human metabolite; plant metabolite |
4-cresol | [no description available] | low | 0 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
debrisoquin | [no description available] | low | 0 | 0 | carboxamidine; isoquinolines | adrenergic agent; antihypertensive agent; human metabolite; sympatholytic agent |
nordazepam | [no description available] | low | 0 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; GABA modulator; human metabolite; sedative |
2,5-dihydroxybenzoic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; fungal metabolite; human metabolite; MALDI matrix material; mouse metabolite |
tele-methylhistamine | [no description available] | low | 0 | 0 | imidazoles; primary amino compound | human metabolite; mouse metabolite |
indolepropionic acid | [no description available] | low | 0 | 0 | indol-3-yl carboxylic acid | auxin; human metabolite; plant metabolite |
3-phenyllactic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid | human metabolite |
2-amino-3-phosphonopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; non-proteinogenic alpha-amino acid; phosphonic acids | human metabolite; metabotropic glutamate receptor antagonist |
2-phenylglycine | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid | human metabolite |
succinylacetone | [no description available] | low | 0 | 0 | beta-diketone; dioxo monocarboxylic acid | human metabolite |
retinoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; retinoid | human metabolite |
cysteine | [no description available] | low | 0 | 0 | cysteine zwitterion; cysteine; L-alpha-amino acid; proteinogenic amino acid; serine family amino acid | EC 4.3.1.3 (histidine ammonia-lyase) inhibitor; flour treatment agent; human metabolite |
etiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid | human metabolite; mouse metabolite |
desoxycorticosterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; mineralocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
taurocholic acid | [no description available] | low | 0 | 0 | amino sulfonic acid; bile acid taurine conjugate | human metabolite |
skatole | [no description available] | low | 0 | 0 | methylindole | human metabolite; mammalian metabolite |
quinaldic acid | [no description available] | low | 0 | 0 | quinolinemonocarboxylic acid | human metabolite; Saccharomyces cerevisiae metabolite |
3-methylpentane | [no description available] | low | 0 | 0 | alkane; volatile organic compound | allelochemical; human metabolite; non-polar solvent |
methylcyclopentane | [no description available] | low | 0 | 0 | cycloalkane; volatile organic compound | human metabolite; plant metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
1-phenethylamine | [no description available] | low | 0 | 0 | phenylethylamine | human metabolite |
isethionic acid | [no description available] | low | 0 | 0 | alkanesulfonic acid | human metabolite |
methylcyclohexane | [no description available] | low | 0 | 0 | cycloalkane; volatile organic compound | aprotic solvent; human metabolite; plant metabolite |
1-tridecanol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; tridecanol | bacterial metabolite; human metabolite; plant metabolite |
stearyl alcohol | [no description available] | low | 0 | 0 | long-chain primary fatty alcohol; octadecanol | algal metabolite; human metabolite; plant metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
isopropyl palmitate | [no description available] | low | 0 | 0 | fatty acid ester; isopropyl ester | human metabolite |
pregnenolone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; C21-steroid | human metabolite; mouse metabolite |
20-alpha-dihydroprogesterone | [no description available] | low | 0 | 0 | 20-hydroxypregn-4-en-3-one | human metabolite; mouse metabolite |
homoarginine | [no description available] | low | 0 | 0 | homoarginine; L-lysine derivative; non-proteinogenic L-alpha-amino acid | biomarker; EC 3.1.3.1 (alkaline phosphatase) inhibitor; human metabolite; rat metabolite; xenobiotic metabolite |
dibenzo(a,l)pyrene | [no description available] | low | 0 | 0 | ortho- and peri-fused polycyclic arene | human metabolite; mutagen |
diiodotyrosine | [no description available] | low | 0 | 0 | diiodotyrosine; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite |
3-methoxytyrosine | [no description available] | low | 0 | 0 | aromatic L-alpha-amino acid zwitterion; L-tyrosine derivative; monomethoxybenzene; non-proteinogenic L-alpha-amino acid | human metabolite |
4-hydroxyphenyllactic acid | [no description available] | low | 0 | 0 | 2-hydroxy carboxylic acid; phenols | bacterial metabolite; human metabolite |
4-methylcatechol | [no description available] | low | 0 | 0 | methylcatechol | antioxidant; carcinogenic agent; hapten; human metabolite; plant metabolite |
ninhydrin | [no description available] | low | 0 | 0 | aromatic ketone; beta-diketone; indanones; ketone hydrate | colour indicator; human metabolite |
indican | [no description available] | low | 0 | 0 | aryl sulfate; indoles | human metabolite |
suberic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
hexadecanedioic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
androstenediol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid | androgen; human metabolite; mouse metabolite; radiation protective agent |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
aceturic acid | [no description available] | low | 0 | 0 | N-acetyl-amino acid; N-acylglycine | human metabolite |
glycylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | human metabolite |
lignoceric acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; very long-chain fatty acid | Daphnia tenebrosa metabolite; human metabolite; plant metabolite; volatile oil component |
2-hydroxybutyric acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; hydroxybutyric acid | algal metabolite; human metabolite |
3-methylhexane | [no description available] | low | 0 | 0 | alkane; volatile organic compound | human metabolite |
ethylmalonic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
2-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; phenols | human metabolite; mouse metabolite |
5-methyl-2-furfural | [no description available] | low | 0 | 0 | aldehyde; furans | EC 2.2.1.6 (acetolactate synthase) inhibitor; flavouring agent; human metabolite; Maillard reaction product |
2-hexanol | [no description available] | low | 0 | 0 | hexanol; secondary alcohol | human metabolite; plant metabolite; semiochemical |
1,1,3,3-tetramethylurea | [no description available] | low | 0 | 0 | ureas | human metabolite |
glycochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid glycine conjugate | human metabolite |
isocaproic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; medium-chain fatty acid; methyl-branched fatty acid | human metabolite |
dehydroepiandrosterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite; mouse metabolite |
dodecanedioic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; dicarboxylic fatty acid | EC 1.1.1.1 (alcohol dehydrogenase) inhibitor; human metabolite |
cytidine diphosphate choline | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphocholines | human metabolite; mouse metabolite; neuroprotective agent; psychotropic drug; Saccharomyces cerevisiae metabolite |
1-pentene-3-one | [no description available] | low | 0 | 0 | enone | flavouring agent; genotoxin; human metabolite; plant metabolite |
5 alpha-androstane-3 alpha,17 beta-diol | [no description available] | low | 0 | 0 | androstane-3alpha,17beta-diol | Daphnia magna metabolite; human metabolite |
9,10-epoxystearic acid | [no description available] | low | 0 | 0 | epoxystearic acid | human metabolite |
5-hydroxyindole | [no description available] | low | 0 | 0 | hydroxyindoles | human metabolite |
beta-hydroxymyristic acid | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; 3-hydroxy monocarboxylic acid; long-chain fatty acid | bacterial metabolite; human metabolite |
perillaldehyde | [no description available] | low | 0 | 0 | aldehyde; olefinic compound | human metabolite; mouse metabolite; volatile oil component |
tricosanoic acid | [no description available] | low | 0 | 0 | straight-chain saturated fatty acid; very long-chain fatty acid | Daphnia magna metabolite; human metabolite; plant metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
tetrahydropapaveroline | [no description available] | low | 0 | 0 | benzylisoquinoline alkaloid; benzyltetrahydroisoquinoline; isoquinolinol | human metabolite |
cyclic cmp | [no description available] | low | 0 | 0 | 3',5'-cyclic pyrimidine nucleotide | human metabolite |
furoylglycine | [no description available] | low | 0 | 0 | furans; N-acylglycine | human metabolite |
3,3',5'-triiodothyronine | [no description available] | low | 0 | 0 | iodothyronine | human metabolite |
limonene | [no description available] | low | 0 | 0 | cycloalkene; p-menthadiene | human metabolite |
urobilinogen | [no description available] | low | 0 | 0 | bilanes | human metabolite |
estetrol | [no description available] | low | 0 | 0 | 15alpha-hydroxy steroid; 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid; steroid hormone | estrogen receptor agonist; estrogen; human metabolite; human xenobiotic metabolite; oral contraceptive |
iron | [no description available] | low | 0 | 0 | divalent metal cation; iron cation; monoatomic dication | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1-methyladenosine | [no description available] | low | 0 | 0 | methyladenosine | human metabolite |
nonanal | [no description available] | low | 0 | 0 | medium-chain fatty aldehyde; n-alkanal; saturated fatty aldehyde | human metabolite; plant metabolite |
pregnanolone | [no description available] | low | 0 | 0 | 3-hydroxy-5beta-pregnan-20-one; 3alpha-hydroxy steroid | human metabolite; intravenous anaesthetic; sedative |
norsalsolinol | [no description available] | low | 0 | 0 | isoquinolinol | animal metabolite; apoptosis inducer; human metabolite; marine metabolite |
2-methyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline | [no description available] | low | 0 | 0 | isoquinolinol; tertiary amino compound | human metabolite; neurotoxin; rat metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-methylhistidine | [no description available] | low | 0 | 0 | L-histidine derivative; non-proteinogenic L-alpha-amino acid; zwitterion | human metabolite; Saccharomyces cerevisiae metabolite |
homocitrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; L-lysine derivative; non-proteinogenic L-alpha-amino acid; ureas | human metabolite; mouse metabolite |
cholesteryl sulfate | [no description available] | low | 0 | 0 | steroid sulfate | human metabolite |
25-hydroxycholesterol | [no description available] | low | 0 | 0 | 25-hydroxy steroid; oxysterol | human metabolite |
aica ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
n-acetylserine | [no description available] | low | 0 | 0 | acetyl-L-serine; N-acetyl-L-amino acid | human metabolite |
o-4-methylthymine | [no description available] | low | 0 | 0 | aromatic ether; methylthymine | human metabolite |
tetraiodothyroacetic acid | [no description available] | low | 0 | 0 | 2-halophenol; aromatic ether; iodophenol; monocarboxylic acid | apoptosis inducer; human metabolite; thyroid hormone |
lathosterol | [no description available] | low | 0 | 0 | 3beta-sterol; C27-steroid; cholestanoid; Delta(7)-sterol | human metabolite; mouse metabolite |
omega-aminocaprylic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; omega-amino fatty acid | human metabolite |
parabanic acid | [no description available] | low | 0 | 0 | hydracid; imidazolidinone | human metabolite |
n-acetyl-l-arginine | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid | human metabolite |
cystine | [no description available] | low | 0 | 0 | cystine zwitterion; cystine; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
6-methyladenine | [no description available] | low | 0 | 0 | 6-alkylaminopurine; methyladenine | human metabolite |
phenylacetylglycine | [no description available] | low | 0 | 0 | monocarboxylic acid amide; monocarboxylic acid; N-acylglycine | human metabolite; mouse metabolite |
hordenine | [no description available] | low | 0 | 0 | phenethylamine alkaloid | human metabolite; mouse metabolite |
4-methoxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid; aromatic ether; phenols | estrogen; human metabolite; rat metabolite |
glutaurine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; L-glutamine derivative; sulfonic acid | anticonvulsant; anxiolytic drug; hormone; human metabolite; mammalian metabolite; mouse metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
n-acetylhistamine | [no description available] | low | 0 | 0 | acetamides; imidazoles | human metabolite |
indole-3-carboxylic acid | [no description available] | low | 0 | 0 | indol-3-yl carboxylic acid | bacterial metabolite; human metabolite |
n-acetylglutamic acid | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N-acyl-L-glutamic acid | human metabolite; Saccharomyces cerevisiae metabolite |
2,5-dihydroxybenzaldehyde | [no description available] | low | 0 | 0 | dihydroxybenzaldehyde | human metabolite; mouse metabolite; Penicillium metabolite |
D-serine | [no description available] | low | 0 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
2-ketopentanoic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; oxopentanoic acid | human metabolite |
hydroxyindoleacetaldehyde | [no description available] | low | 0 | 0 | hydroxyindoles; indoleacetaldehyde | human metabolite; mouse metabolite |
leucylleucine | [no description available] | low | 0 | 0 | dipeptide; L-aminoacyl-L-amino acid zwitterion | human metabolite; Mycoplasma genitalium metabolite |
5-hydroxymethyluracil | [no description available] | low | 0 | 0 | primary alcohol; pyrimidone | human metabolite |
12-hydroxydodecanoic acid | [no description available] | low | 0 | 0 | omega-hydroxy-medium-chain fatty acid | human metabolite |
decane-1,2-diol | [no description available] | low | 0 | 0 | glycol; volatile organic compound | anti-inflammatory agent; antioxidant; human metabolite |
4-nitrophenyl sulfate | [no description available] | low | 0 | 0 | aryl sulfate; C-nitro compound | human metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
3,4-dihydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; catechols | antioxidant; drug metabolite; human metabolite; mouse metabolite |
3-hydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; phenols | human metabolite |
n-acetylalanine | [no description available] | low | 0 | 0 | L-alanine derivative; N-acetyl-L-amino acid | human metabolite; Saccharomyces cerevisiae metabolite |
17-alpha-hydroxypregnenolone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; hydroxypregnenolone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
cholest-4-en-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; cholestanoid | human metabolite; plant metabolite |
mephentermine | [no description available] | low | 0 | 0 | 2-aminooctadecane-1,3-diol | EC 2.7.11.13 (protein kinase C) inhibitor; human metabolite; mouse metabolite |
2-pinene oxide | [no description available] | low | 0 | 0 | epoxide; pinane monoterpenoid | bacterial xenobiotic metabolite; fragrance; human metabolite |
1-methylhistidine | [no description available] | low | 0 | 0 | L-histidine derivative; non-proteinogenic L-alpha-amino acid; zwitterion | human metabolite |
3-hydroxybutyric acid | [no description available] | low | 0 | 0 | 3-hydroxybutyric acid; ketone body | fungal metabolite; human metabolite; pheromone |
L-2-aminoadipic acid | [no description available] | low | 0 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
testosterone acetate | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; androstanoid; sterol ester | human metabolite |
phenylacetylglutamine | [no description available] | low | 0 | 0 | N(2)-phenylacetylglutamine | human metabolite |
5beta-pregnane-3,20-dione | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-5beta-steroid; C21-steroid | human metabolite; mouse metabolite |
zymosterol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
brexanolone | [no description available] | low | 0 | 0 | 3-hydroxy-5alpha-pregnan-20-one | antidepressant; GABA modulator; human metabolite; intravenous anaesthetic; sedative |
5-alpha-dihydroprogesterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-5alpha-steroid; C21-steroid hormone | human metabolite; progestogen |
n-epsilon-acetyllysine | [no description available] | low | 0 | 0 | acetyl-L-lysine; amino acid zwitterion; N(6)-acyl-L-lysine | human metabolite |
2-hydroxyhexadecanoic acid | [no description available] | low | 0 | 0 | 2-hydroxy fatty acid; hydroxypalmitic acid | human metabolite |
19-oxo-delta(4) androstene-3,17-dione | [no description available] | low | 0 | 0 | 17-oxo steroid; 19-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid; steroid aldehyde | human metabolite |
gamma-glutamylglutamate | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
indole-3-lactic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; indol-3-yl carboxylic acid | human metabolite |
n(alpha)-acetyllysine | [no description available] | low | 0 | 0 | acetyl-L-lysine; amino acid zwitterion | human metabolite |
glycyl-l-phenylalanine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | human metabolite; metabolite |
5,6-dihydrothymine | [no description available] | low | 0 | 0 | pyrimidone | human metabolite; metabolite; mouse metabolite |
gamma-glutamyltyrosine | [no description available] | low | 0 | 0 | dicarboxylic acid; dipeptide; phenols; primary amino compound; secondary carboxamide | human metabolite |
cholest-5-ene-3 beta,26-diol | [no description available] | low | 0 | 0 | 26-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite |
2-hydroxyisovaleric acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid | human metabolite |
aminomalonic acid | [no description available] | low | 0 | 0 | amino dicarboxylic acid | Daphnia magna metabolite; human metabolite |
zymostenol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite |
16-hydroxydehydroepiandrosterone | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid; secondary alpha-hydroxy ketone | human metabolite; mouse metabolite |
cortisol 21-sulfate | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; cortisol ester; steroid sulfate; tertiary alpha-hydroxy ketone | human metabolite |
aflatoxin b1-2,3-oxide | [no description available] | low | 0 | 0 | aflatoxin | human metabolite |
pregnenolone sulfate | [no description available] | low | 0 | 0 | steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite |
3,3'-diiodothyronine | [no description available] | low | 0 | 0 | 3,3'-diiodothyronine; amino acid zwitterion | human metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
testosterone 17-glucosiduronate | [no description available] | low | 0 | 0 | 3-oxo steroid; beta-D-glucosiduronic acid; enone; steroid glucosiduronic acid | human metabolite |
3-chloro-L-tyrosine | [no description available] | low | 0 | 0 | chloroamino acid; L-alpha-amino acid zwitterion; L-tyrosine derivative; monochlorobenzenes; non-proteinogenic L-alpha-amino acid | biomarker; human metabolite |
androsterone glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; metabolite; mouse metabolite |
selenomethylselenocysteine | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid; selenocysteines | antineoplastic agent; human metabolite |
1,5(10)-estradiene-3,4,17-trione | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(1) steroid; orthoquinones | human metabolite |
s-sulphocysteine | [no description available] | low | 0 | 0 | organic thiosulfate; S-substituted L-cysteine | human metabolite; plant metabolite |
estrone-3-glucuronide | [no description available] | low | 0 | 0 | 17-oxo steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
1-hydroxyethyl radical | [no description available] | low | 0 | 0 | organic anion | human metabolite; Saccharomyces cerevisiae metabolite |
(20s)-20-hydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | human metabolite; mouse metabolite |
deoxyhypusine | [no description available] | low | 0 | 0 | L-lysine derivative; non-proteinogenic L-alpha-amino acid | human metabolite |
3,7,12-trihydroxycoprostanic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; cholestanoic acid; hydroxy monocarboxylic acid | human metabolite |
triiodothyronine sulfate | [no description available] | low | 0 | 0 | aryl sulfate; O-sulfoamino acid | human metabolite |
3,7,12-trihydroxycholestan-26-oic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; hydroxy monocarboxylic acid; steroid acid | human metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
7 alpha-hydroxy-4-cholesten-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; 7alpha-hydroxy steroid; cholestanoid | human metabolite; mouse metabolite |
pristanic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; long-chain fatty acid; methyl-branched fatty acid | human metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
27-hydroxycholesterol | [no description available] | low | 0 | 0 | 26-hydroxycholesterol | apoptosis inducer; human metabolite; mouse metabolite; neuroprotective agent |
3-carboxy-4-methyl-5-propyl-2-furanpropionic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; furoic acid | human metabolite; uremic toxin |
hypothiocyanite ion | [no description available] | low | 0 | 0 | one-carbon compound; sulfur oxoacid | antibacterial agent; antifungal agent; antiviral agent; human metabolite; oxidising agent; rat metabolite |
3-c-methylerythritol | [no description available] | low | 0 | 0 | tetritol | human metabolite |
succinylacetoacetate | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid; beta-diketone | human metabolite |
isoursodeoxycholic acid | [no description available] | low | 0 | 0 | dihydroxy-5beta-cholanic acid | human metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
kinetensin | [no description available] | low | 0 | 0 | oligopeptide | histamine releasing agent; human metabolite |
estra-1(10),4-diene-2,3,17-trione | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; orthoquinones | human metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
n-methylserotonin | [no description available] | low | 0 | 0 | phenols; tryptamines | human metabolite; plant metabolite |
gamma-glutamylglutamine | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
3,4-dihydroxybutanoic acid | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; omega-hydroxy-short-chain fatty acid | human metabolite |
n-palmitoylglycine | [no description available] | low | 0 | 0 | fatty amide; N-acylglycine 16:0 | human metabolite; marine metabolite |
gamma-glutamyl-leucine | [no description available] | low | 0 | 0 | glutamyl-L-amino acid | human metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
3,4-dihydroxyphenylglycolaldehyde | [no description available] | low | 0 | 0 | catechols; hydroxyaldehyde | human metabolite; mouse metabolite; neurotoxin |
androsterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; androstanoid; steroid sulfate | human metabolite; mouse metabolite |
3,7,12-trihydroxycoprostane | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
saccharopine | [no description available] | low | 0 | 0 | amino acid opine; L-lysine derivative | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allysine | [no description available] | low | 0 | 0 | allysine; amino acid zwitterion; aminoadipate semialdehyde; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
allocholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; allo-bile acid; C24-steroid | human metabolite; marine metabolite; rat metabolite |
beta-ureidoisobutyric acid | [no description available] | low | 0 | 0 | ureidocarboxylic acid | human metabolite; mouse metabolite |
kynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; kynurenine; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nicotinate ribonucleoside | [no description available] | low | 0 | 0 | ammonium betaine | human metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
4,4-dimethyl-5-alpha-cholesta-(8,24)-dien-3-beta-ol | [no description available] | low | 0 | 0 | 3beta-sterol | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
bradykinin, des-phe(8)-des-arg(9)- | [no description available] | low | 0 | 0 | oligopeptide | human metabolite; rat metabolite |
isobutyryl-1-carnitine | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-L-carnitine; O-isobutyrylcarnitine; saturated fatty acyl-L-carnitine | human metabolite |
threitol | [no description available] | low | 0 | 0 | threitol | human metabolite |
aceglutamide | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N(2)-acetylglutamine; N(2)-acyl-L-glutamine | human metabolite |
isospaglumic acid | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-ethylhydracrylic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; hydroxy fatty acid; short-chain fatty acid | human metabolite |
2-methyl-3-oxovaleric acid | [no description available] | low | 0 | 0 | 3-oxo monocarboxylic acid | human metabolite |
monoacetylcadaverine | [no description available] | low | 0 | 0 | acetamides; N-substituted cadaverine; primary amino compound; secondary carboxamide | human metabolite |
beta-citrylglutamic acid | [no description available] | low | 0 | 0 | N-acyl-L-glutamic acid; tetracarboxylic acid | human metabolite; iron chelator |
maltotriose | [no description available] | low | 0 | 0 | maltotriose trisaccharide | human metabolite |
cholestane-3,7,12,26-tetrol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 26-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
beta-leucine | [no description available] | low | 0 | 0 | beta-amino acid | human metabolite |
2-methylbutyrylglycine | [no description available] | low | 0 | 0 | N-acylglycine | human metabolite |
neurotensin (1-8) | [no description available] | low | 0 | 0 | peptide zwitterion; peptide | human metabolite |
5 alpha-androstane-3 beta,17 beta-diol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy steroid; androstane-3,17-diol | Daphnia magna metabolite; human metabolite |
cholesteryl palmitate | [no description available] | low | 0 | 0 | cholesteryl ester | human metabolite; mouse metabolite |
lanosterol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol; tetracyclic triterpenoid | bacterial metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2-hydroxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 2-hydroxy steroid | carcinogenic agent; human metabolite; metabolite; mouse metabolite; prodrug |
5-hydroxyisourate | [no description available] | low | 0 | 0 | oxopurine | human metabolite; mouse metabolite |
5-formyluracil | [no description available] | low | 0 | 0 | aldehyde; nucleobase analogue; pyrimidone | human metabolite; mutagen |
taurochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid taurine conjugate | human metabolite; mouse metabolite |
isomaltose | [no description available] | low | 0 | 0 | glycosylglucose | human metabolite; metabolite; mouse metabolite |
glucosamine 6-phosphate | [no description available] | low | 0 | 0 | 2-amino-2-deoxy-D-glucopyranose 6-phosphate | human metabolite; Saccharomyces cerevisiae metabolite |
5-hydroxytryptophan | [no description available] | low | 0 | 0 | 5-hydroxytryptophan; amino acid zwitterion; hydroxy-L-tryptophan; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; plant metabolite |
dopaquinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; amino acid zwitterion; L-phenylalanine derivative | human metabolite; mouse metabolite |
tryptophanamide | [no description available] | low | 0 | 0 | amino acid amide; tryptophan derivative | human metabolite |
5-diphosphomevalonic acid | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | human metabolite; mouse metabolite |
cysteinylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
desmosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C27-steroid; cholestanoid | human metabolite; mouse metabolite |
monoiodotyrosine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-tyrosine derivative; monoiodotyrosine; non-proteinogenic L-alpha-amino acid | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; human metabolite; mouse metabolite |
fuculose 1-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | human metabolite |
nicotinamide-beta-riboside | [no description available] | low | 0 | 0 | N-glycosylnicotinamide; pyridine nucleoside | geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
trimethyllysine | [no description available] | low | 0 | 0 | alpha-amino-acid cation | human metabolite; mouse metabolite |
inositol 3,4-bisphosphate | [no description available] | low | 0 | 0 | myo-inositol bisphosphate | human metabolite; mouse metabolite |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
24,25-dihydrolanosterol | [no description available] | low | 0 | 0 | 3beta-sterol; tetracyclic triterpenoid | human metabolite; mouse metabolite |
2-hydroxyestrone | [no description available] | low | 0 | 0 | 2-hydroxy steroid; catechols | human metabolite |
2-methoxyestrone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-hydroxy steroid; alicyclic ketone; aromatic ether; phenolic steroid; phenols | human metabolite; mouse metabolite |
estradiol-3-glucuronide | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
acetyl adenylate | [no description available] | low | 0 | 0 | 5'-acylphosphoadenosin | human metabolite; mouse metabolite |
epiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; human metabolite |
4,4-dimethylcholesta-8,14,24-trienol | [no description available] | low | 0 | 0 | 3beta-sterol; Delta(14) steroid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
enkephalin, methionine | [no description available] | low | 0 | 0 | pentapeptide; peptide zwitterion | analgesic; antineoplastic agent; delta-opioid receptor agonist; human metabolite; mu-opioid receptor agonist |
7-ketolithocholic acid | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; bile acid; monohydroxy-5beta-cholanic acid; oxo-5beta-cholanic acid | human metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-hydroxy-3-methylglutaryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxy-3-methylglutaryl-CoA; 3-hydroxy fatty acyl-CoA | human metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
tetragastrin | [no description available] | low | 0 | 0 | peptidyl amide; tetrapeptide | anxiogenic; human metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
tyrosine o-sulfate | [no description available] | low | 0 | 0 | aryl sulfate; L-tyrosine derivative; O-sulfoamino acid | human metabolite |
squalene | [no description available] | low | 0 | 0 | triterpene | human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
thyrotropin-releasing hormone | [no description available] | low | 0 | 0 | peptide hormone; tripeptide | human metabolite |
n-methylproline | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-proline derivative; tertiary amino compound | human metabolite; plant metabolite |
citraconic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; dicarboxylic fatty acid | human metabolite |
mannose 1-phosphate | [no description available] | low | 0 | 0 | mannose phosphate | fundamental metabolite; human metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
urocanic acid | [no description available] | low | 0 | 0 | urocanic acid | human metabolite |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
cholesterol acetate | [no description available] | low | 0 | 0 | acetate ester; cholesteryl ester | human metabolite |
1,6-anhydro-beta-glucopyranose | [no description available] | low | 0 | 0 | anhydrohexose | Arabidopsis thaliana metabolite; biomarker; human metabolite |
glycylvaline | [no description available] | low | 0 | 0 | dipeptide | human metabolite |
sodium taurodeoxycholate | [no description available] | low | 0 | 0 | bile acid taurine conjugate | human metabolite |
glycodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid glycine conjugate | human metabolite |
isobutyryl-coenzyme a | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-CoA; short-chain fatty acyl-CoA | human metabolite; mouse metabolite |
galactaric acid | [no description available] | low | 0 | 0 | hexaric acid | human metabolite |
dihydroxycoprostane | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
angiotensin i, ile(5)- | [no description available] | low | 0 | 0 | angiotensin; peptide zwitterion | human metabolite; neurotransmitter agent |
fructosyl-glycine | [no description available] | low | 0 | 0 | fructosamine; glycine derivative; glyco-amino acid | human metabolite |
arachidoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | human metabolite |
lignoceroyl-coenzyme a | [no description available] | low | 0 | 0 | very long-chain fatty acyl-CoA | human metabolite; Saccharomyces cerevisiae metabolite |
5-hydroxybenzimidazole | [no description available] | low | 0 | 0 | benzimidazoles; phenols | bacterial metabolite; human metabolite; rat metabolite |
n-carbamylglutamate | [no description available] | low | 0 | 0 | glutamic acid derivative; ureas | human metabolite |
citramalate | [no description available] | low | 0 | 0 | dicarboxylic acid dianion | human metabolite; plant metabolite |
4-cresol sulfate | [no description available] | low | 0 | 0 | aryl sulfate | gut flora metabolite; human metabolite; uremic toxin |
bilirubin | [no description available] | low | 0 | 0 | biladienes; dicarboxylic acid | antioxidant; human metabolite; mouse metabolite |
leukotriene a4 | [no description available] | low | 0 | 0 | epoxy fatty acid; leukotriene; long-chain fatty acid; oxylipin; polyunsaturated fatty acid | human metabolite; mouse metabolite; plant metabolite |
prostaglandin b1 | [no description available] | low | 0 | 0 | prostaglandins B | human metabolite |
ubiquinone 9 | [no description available] | low | 0 | 0 | ubiquinones | antioxidant; human metabolite |
leukotriene c4 | [no description available] | low | 0 | 0 | leukotriene | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin f2beta | [no description available] | low | 0 | 0 | prostaglandins Fbeta | human metabolite |
15-keto-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,11Z,13E)-15-HETE | human metabolite; mouse metabolite |
5-hydroxy-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE | human metabolite; mouse metabolite |
leukotriene d4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin g2 | [no description available] | low | 0 | 0 | prostaglandins G | human metabolite; mouse metabolite |
9-deoxy-delta-9-prostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins J | human metabolite |
prostaglandin e3 | [no description available] | low | 0 | 0 | prostaglandins E | human metabolite |
leukotriene f-4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | human metabolite |
previtamin d(3) | [no description available] | low | 0 | 0 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol | human metabolite |
brassicasterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | algal metabolite; animal metabolite; biomarker; EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor; human metabolite; marine metabolite; plant metabolite; sterol biosynthesis inhibitor |
retinoyl beta-glucuronide | [no description available] | low | 0 | 0 | glucuronic acids; retinoid | human metabolite |
prostaglandin d3 | [no description available] | low | 0 | 0 | prostaglandins D | human metabolite |
tocotrienol, alpha | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | ferroptosis inhibitor; human metabolite; neuroprotective agent; plant metabolite |
11-ketotestosterone | [no description available] | low | 0 | 0 | 11-oxo steroid; 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; human metabolite; marine xenobiotic metabolite |
menatetrenone | [no description available] | low | 0 | 0 | menaquinone | anti-inflammatory agent; antioxidant; bone density conservation agent; human metabolite; neuroprotective agent |
phthioic acid | [no description available] | low | 0 | 0 | branched-chain saturated fatty acid; fatty acid 26:0; methyl-branched fatty acid; very long-chain fatty acid | Aspergillus metabolite; human metabolite |
2-decenoic acid | [no description available] | low | 0 | 0 | 2-decenoic acid | human metabolite |
9,11-linoleic acid | [no description available] | low | 0 | 0 | octadeca-9,11-dienoic acid | anti-inflammatory agent; antiatherogenic agent; antineoplastic agent; apoptosis inducer; bacterial xenobiotic metabolite; human metabolite |
9-hydroxy-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | HODE; octadecadienoic acid | human metabolite; metabolite; mouse metabolite; plant metabolite |
17-phenyltrinorprostaglandin e2 | [no description available] | low | 0 | 0 | alicyclic ketone; beta-hydroxy ketone; hydroxy monocarboxylic acid; olefinic compound; oxo monocarboxylic acid; prostanoid; secondary alcohol | human metabolite; prostaglandin receptor agonist |
thromboxane b3 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
12-hydroxy-5,8,10,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,10E,14Z)-12-hydroxyicosatetraenoic acid; HETE | human metabolite; pro-angiogenic agent |
20-hydroxy-5,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE; hydroxy monocarboxylic acid | human metabolite; mouse metabolite |
5-oxo-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite; immunomodulator; mouse metabolite |
8-isoprostaglandin e2 | [no description available] | low | 0 | 0 | cyclic ketone; diol; prostanoid; secondary alcohol | bronchoconstrictor agent; human metabolite; rat metabolite; vasoconstrictor agent |
monolinolein | [no description available] | low | 0 | 0 | 1-acylglycerol 18:2; rac-1-monoacylglycerol | antiviral agent; human metabolite; plant metabolite |
1,25-dihydroxy-24-oxo-vitamin d3 | [no description available] | low | 0 | 0 | hydroxycalciol; oxocalciol; tertiary alpha-hydroxy ketone | human metabolite |
hyodeoxycholic acid | [no description available] | low | 0 | 0 | 5beta-cholanic acids; 6alpha,20xi-murideoxycholic acid; bile acid; C24-steroid | human metabolite; mouse metabolite |
cerium | [no description available] | low | 0 | 0 | CE(18:2); cholesteryl octadeca-9,12-dienoate | human metabolite; mouse metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
11-dehydrocorticosterone | [no description available] | low | 0 | 0 | 11-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
1-butyl oleate | [no description available] | low | 0 | 0 | fatty acid ester | human metabolite |
8-hydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; heteroaryl hydroxy compound; nucleobase analogue; oxopurine | bacterial metabolite; human metabolite |
erucyl amide | [no description available] | low | 0 | 0 | 13-docosenamide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; human metabolite; mammalian metabolite; plant metabolite; rat metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
2,3-oxidosqualene | [no description available] | low | 0 | 0 | 2,3-epoxysqualene | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-keto-4-hydroxyglutarate | [no description available] | low | 0 | 0 | oxo dicarboxylate | human metabolite; Saccharomyces cerevisiae metabolite |
iditol | [no description available] | low | 0 | 0 | iditol | fungal metabolite; human metabolite |
glutamate | [no description available] | low | 0 | 0 | glutamate(1-); polar amino acid zwitterion | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor; human metabolite; Saccharomyces cerevisiae metabolite |
cerotate | [no description available] | low | 0 | 0 | fatty acid anion 26:0; omega-methyl fatty acid anion; very long-chain fatty acid anion | human metabolite; Saccharomyces cerevisiae metabolite |
adenosine triphosphate | [no description available] | low | 0 | 0 | nucleoside 5'-triphoshate(4-) | cofactor; fundamental metabolite; human metabolite |
3-methylbutyrylcarnitine | [no description available] | low | 0 | 0 | C5-acylcarnitine | human metabolite |
hexanoylcarnitine | [no description available] | low | 0 | 0 | hexanoate ester; O-acylcarnitine | human metabolite |
linoleamide | [no description available] | low | 0 | 0 | primary fatty amide | human metabolite |
13-cis-retinal | [no description available] | low | 0 | 0 | retinal | human metabolite |
4-hydroxyretinoic acid | [no description available] | low | 0 | 0 | retinoid; secondary allylic alcohol | human metabolite |
4-oxo-2-nonenal | [no description available] | low | 0 | 0 | enal; enone | human metabolite |
20,22-dihydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 22-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; oxysterol | human metabolite; mouse metabolite |
biotinate | [no description available] | medium | 0 | 0 | monocarboxylic acid anion; vitamin B7 | cofactor; human metabolite; Saccharomyces cerevisiae metabolite |
6 beta-hydroxycortisol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; 6beta-hydroxy steroid; C21-steroid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mammalian metabolite; probe |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
gamma-glutamylvaline | [no description available] | low | 0 | 0 | glutamyl-L-amino acid | human metabolite |
ophthalmic acid | [no description available] | low | 0 | 0 | L-glutamine derivative | biomarker; human metabolite |
adenosine diphosphate | [no description available] | low | 0 | 0 | nucleoside 5'-diphosphate(3-) | fundamental metabolite; human metabolite |
cyclic amp | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
1,23,25-trihydroxyvitamin d3 | [no description available] | low | 0 | 0 | D3 vitamins; hydroxy seco-steroid; hydroxycalciol; tetrol | human metabolite |
arachidonoylserotonin | [no description available] | low | 0 | 0 | N-acylserotonin; phenols | anti-inflammatory agent; anticonvulsant; antioxidant; capsaicin receptor antagonist; EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor; human metabolite; signalling molecule |
homocarnosine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; homocarnosine; L-histidine derivative; N-acyl-L-alpha-amino acid anion; N-acyl-L-alpha-amino acid | human metabolite |
3-hydroxyproline | [no description available] | low | 0 | 0 | 3-hydroxyproline; amino acid zwitterion; D-proline derivative | bacterial metabolite; human metabolite |
octanoylcarnitine | [no description available] | low | 0 | 0 | O-octanoylcarnitine; saturated fatty acyl-L-carnitine | human metabolite |
palmitoylcarnitine | [no description available] | low | 0 | 0 | O-palmitoylcarnitine; saturated fatty acyl-L-carnitine | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; human metabolite; mouse metabolite |
cyclic 3',5'-thymidine monophosphate | [no description available] | low | 0 | 0 | 3',5'-cyclic pyrimidine nucleotide | human metabolite |
pristanal | [no description available] | low | 0 | 0 | 2-methyl-branched fatty aldehyde; saturated fatty aldehyde | human metabolite |
lanosten-3-ol-32-al | [no description available] | low | 0 | 0 | 14alpha-formyl steroid; 3beta-sterol; tetracyclic triterpenoid | human metabolite |
thiamine pyrophosphate | [no description available] | low | 0 | 0 | organophosphate oxoanion; vitamin B1 | human metabolite; Saccharomyces cerevisiae metabolite |
adenosine monophosphate | [no description available] | low | 0 | 0 | nucleoside 5'-monophosphate(2-) | cofactor; fundamental metabolite; human metabolite |
cob(ii)alamin | [no description available] | low | 0 | 0 | cobalamin | cofactor; human metabolite |
nociceptin | [no description available] | low | 0 | 0 | organic molecular entity; polypeptide | human metabolite; rat metabolite |
3-hydroxy-3-methyl-hexanoic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; volatile organic compound | human metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | nucleoside 5'-diphosphate(3-) | human metabolite; Saccharomyces cerevisiae metabolite |
n-acetylgalactosamine-1-phosphate | [no description available] | low | 0 | 0 | D-galactosamine 1-phosphate | human metabolite |
1-phospho-5-s-methylthioribulose | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
10-nitro-oleic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; monounsaturated fatty acid; nitro fatty acid | human metabolite |
ticrynafen | [no description available] | low | 0 | 0 | monocarboxylic acid anion; organophosphate oxoanion | human metabolite |
s-(1,2-dicarboxyethyl)cysteine | [no description available] | low | 0 | 0 | L-cysteine thioether; tricarboxylic acid | human metabolite; Maillard reaction product |
apelin-13 peptide | [no description available] | low | 0 | 0 | oligopeptide | antihypertensive agent; autophagy inhibitor; biomarker; human metabolite; neuroprotective agent |
p-Glu-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-Phe | [no description available] | low | 0 | 0 | polypeptide | apoptosis inhibitor; human metabolite; neuroprotective agent |
taurolithocholic acid 3-sulfate | [no description available] | low | 0 | 0 | steroid sulfate oxoanion | human metabolite |
inositol 1,3,4-trisphosphate | [no description available] | low | 0 | 0 | inositol phosphate oxoanion | human metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
2-ketoarginine | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
adenosine diphosphate glucose | [no description available] | low | 0 | 0 | NDP-alpha-D-glucose(2-); ribonucleoside 5'-diphosphate-alpha-D-glucose(2-) | human metabolite |
nicotinate mononucleotide | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
oleoylcarnitine | [no description available] | low | 0 | 0 | monounsaturated fatty acyl-L-carnitine | glycine transporter 2 inhibitor; human metabolite |
uridine diphosphate n-acetylgalactosamine | [no description available] | low | 0 | 0 | nucleotide-sugar oxoanion | human metabolite |
6-phosphogluconolactone | [no description available] | low | 0 | 0 | organophosphate oxoanion | human metabolite; Saccharomyces cerevisiae metabolite |
angiotensin i | [no description available] | low | 0 | 0 | angiotensin; peptide zwitterion | antihypertensive agent; cardioprotective agent; human metabolite; rat metabolite |
9-PAHSA | [no description available] | low | 0 | 0 | FAHFA; long-chain fatty acid | anti-inflammatory agent; human metabolite; hypoglycemic agent |
lugdunin | [no description available] | low | 0 | 0 | homodetic cyclic peptide; indoles; macrocycle; peptide antibiotic; thiazolidines | human metabolite; rat metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
dyspropterin | [no description available] | low | 0 | 0 | biopterins; tetrahydropterin | human metabolite; metabolite; mouse metabolite |
n(2),n(2)-dimethylguanosine | [no description available] | low | 0 | 0 | methylguanosine | human metabolite |
creatinine | [no description available] | low | 0 | 0 | imidazolidinone; lactam | diagnostic agent; human metabolite |
apelin-12 peptide | [no description available] | low | 0 | 0 | oligopeptide | biomarker; human blood serum metabolite; human metabolite; neuroprotective agent |
n(1)-methylnicotinamide | [no description available] | low | 0 | 0 | pyridinium ion | algal metabolite; anti-inflammatory agent; human urinary metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
gamma-guanidinobutyric acid | [no description available] | low | 0 | 0 | guanidines; monocarboxylic acid; zwitterion | fungal metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
diacetyl | [no description available] | low | 0 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
toxopyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
indol-3-yl pyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; indol-3-yl carboxylic acid | plant metabolite; Saccharomyces cerevisiae metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
phenylethyl alcohol | [no description available] | low | 0 | 0 | benzenes; primary alcohol | Aspergillus metabolite; fragrance; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite |
isobutyl alcohol | [no description available] | low | 0 | 0 | alkyl alcohol; primary alcohol | Saccharomyces cerevisiae metabolite |
isobutyraldehyde | [no description available] | low | 0 | 0 | 2-methyl-branched fatty aldehyde; propanals | Saccharomyces cerevisiae metabolite |
2-furoic acid | [no description available] | low | 0 | 0 | furoic acid | bacterial xenobiotic metabolite; human xenobiotic metabolite; inhibitor; plant metabolite; Saccharomyces cerevisiae metabolite |
2-methylbutanal | [no description available] | low | 0 | 0 | 2-methyl-branched fatty aldehyde; methylbutanal | plant metabolite; Saccharomyces cerevisiae metabolite; volatile oil component |
2-phenylethyl acetate | [no description available] | low | 0 | 0 | acetate ester | metabolite; Saccharomyces cerevisiae metabolite |
propargyl alcohol | [no description available] | low | 0 | 0 | propynol; terminal acetylenic compound; volatile organic compound | antifungal agent; Saccharomyces cerevisiae metabolite |
isobutyl acetate | [no description available] | low | 0 | 0 | acetate ester | Saccharomyces cerevisiae metabolite |
2-methylbutanol | [no description available] | low | 0 | 0 | alkyl alcohol; primary alcohol | Saccharomyces cerevisiae metabolite |
shikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
methionol | [no description available] | low | 0 | 0 | aliphatic sulfide; methyl sulfide | Saccharomyces cerevisiae metabolite |
tryptophol | [no description available] | low | 0 | 0 | indolyl alcohol | auxin; plant metabolite; Saccharomyces cerevisiae metabolite |
isovalerylaldehyde | [no description available] | low | 0 | 0 | methylbutanal | flavouring agent; plant metabolite; Saccharomyces cerevisiae metabolite; volatile oil component |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
isopentyl alcohol | [no description available] | low | 0 | 0 | alkyl alcohol; primary alcohol; volatile organic compound | antifungal agent; Saccharomyces cerevisiae metabolite; xenobiotic metabolite |
4-hydroxy-2-ethyl-5-methyl-3(2h)-furanone | [no description available] | low | 0 | 0 | cyclic ketone; enol; furans | Saccharomyces cerevisiae metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
copper histidine | [no description available] | low | 0 | 0 | D-alpha-amino acid; histidine; polar amino acid zwitterion | Saccharomyces cerevisiae metabolite |
4-methyl-4-sulfanylpentan-2-one | [no description available] | low | 0 | 0 | alkanethiol; methyl ketone | plant metabolite; Saccharomyces cerevisiae metabolite |
poly-o-acetylserine | [no description available] | low | 0 | 0 | acetate ester; acetyl-L-serine; amino acid zwitterion | bacterial metabolite; Saccharomyces cerevisiae metabolite |
phytosphingosine | [no description available] | low | 0 | 0 | amino alcohol; sphingoid; triol | mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxy cyclic amp | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide | Saccharomyces cerevisiae metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxythreonine | [no description available] | low | 0 | 0 | amino acid zwitterion; hydroxy-amino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
pantolactone | [no description available] | low | 0 | 0 | butan-4-olide | Saccharomyces cerevisiae metabolite |
o-succinylhomoserine | [no description available] | low | 0 | 0 | hemisuccinate; o-succinylhomoserine | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
D-leucine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; leucine | bacterial metabolite; Saccharomyces cerevisiae metabolite |
fecosterol | [no description available] | low | 0 | 0 | 3beta-sterol | Saccharomyces cerevisiae metabolite |
ergosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | fungal metabolite; Saccharomyces cerevisiae metabolite |
3-mercaptohexyl acetate | [no description available] | low | 0 | 0 | acetate ester; alkanethiol | Saccharomyces cerevisiae metabolite |
tocotrienol, delta | [no description available] | low | 0 | 0 | tocotrienol; vitamin E | anti-inflammatory agent; antineoplastic agent; apoptosis inducer; bone density conservation agent; NF-kappaB inhibitor; plant metabolite; radiation protective agent; Saccharomyces cerevisiae metabolite |
ubiquinone 6 | [no description available] | low | 0 | 0 | ubiquinones | Saccharomyces cerevisiae metabolite |
3-dehydroshikimate | [no description available] | low | 0 | 0 | monocarboxylic acid anion | Saccharomyces cerevisiae metabolite |
d-ribo-phytosphingosine-1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | Saccharomyces cerevisiae metabolite |
6-hydroxymethyl-7,8-dihydropterin | [no description available] | low | 0 | 0 | dihydropterin | Saccharomyces cerevisiae metabolite |
cyclic imp | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide; nucleoside 3',5'-cyclic phosphate | mammalian metabolite; Saccharomyces cerevisiae metabolite |
5,6,7,8-tetrahydrofolic acid | [no description available] | low | 0 | 0 | tetrahydrofolic acid | Saccharomyces cerevisiae metabolite |
monoisopropanolamine | [no description available] | low | 0 | 0 | amino alcohol; secondary alcohol | Escherichia coli metabolite |
dihydro-3-coumaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid | Escherichia coli metabolite; human xenobiotic metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
5,6,7,8-tetrahydropteridine | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
arsenic acid | [no description available] | low | 0 | 0 | arsenic oxoacid | Escherichia coli metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
carbamic acid | [no description available] | low | 0 | 0 | carbon oxoacid; one-carbon compound; organonitrogen compound | Escherichia coli metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; amino acid zwitterion; beta-amino acid; diamino acid; non-proteinogenic alpha-amino acid | Escherichia coli metabolite |
oxaluric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; ureas | Escherichia coli metabolite |
n(1)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; metabolite |
propionaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; propanals | Escherichia coli metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
1,4-dihydroxy-2-naphthoic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; naphthalenediols; naphthohydroquinone; naphthoic acid | Escherichia coli metabolite |
thiocyanic acid | [no description available] | low | 0 | 0 | hydracid; one-carbon compound; organosulfur compound | Escherichia coli metabolite |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
iminoaspartic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; ketimine | Escherichia coli metabolite |
indole | [no description available] | low | 0 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
trimethyloxamine | [no description available] | low | 0 | 0 | tertiary amine oxide | Escherichia coli metabolite; metabolite; osmolyte |
trimethylamine | [no description available] | low | 0 | 0 | methylamines; tertiary amine | Escherichia coli metabolite; human xenobiotic metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
beta-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
1,3,4-butanetriol | [no description available] | low | 0 | 0 | triol | bacterial xenobiotic metabolite; Escherichia coli metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
myrmicacin | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; medium-chain fatty acid | antimitotic; Escherichia coli metabolite |
n-(3-aminopropyl)cadaverine | [no description available] | low | 0 | 0 | polyazaalkane; triamine | Escherichia coli metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
D-tyrosine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; tyrosine | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
3'-uridylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 3'-monophosphate; uridine phosphate | Escherichia coli metabolite |
2',3'-cyclic amp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
2,5-diketogluconic acid | [no description available] | low | 0 | 0 | diketoaldonic acid | Escherichia coli metabolite |
selenodiglutathione | [no description available] | low | 0 | 0 | glutathione derivative; thioselenide | Escherichia coli metabolite; metabolite |
2-deoxyglucose-6-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | Escherichia coli metabolite; Mycoplasma genitalium metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
thymidine diphosphate-l-rhamnose | [no description available] | low | 0 | 0 | dTDP-L-rhamnose | Escherichia coli metabolite |
trehalose-6-phosphate | [no description available] | low | 0 | 0 | trehalose phosphate | Escherichia coli metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
aerobactin | [no description available] | low | 0 | 0 | L-lysine derivative | Escherichia coli metabolite; siderophore; virulence factor |
lipid x | [no description available] | low | 0 | 0 | N-acyl-D-glucosamine 1-phosphate | Escherichia coli metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
glutamate-1-semialdehyde | [no description available] | low | 0 | 0 | 5-oxo monocarboxylic acid; amino acid zwitterion; gamma-amino acid; glutamic semialdehyde | Escherichia coli metabolite |
o-phosphohomoserine | [no description available] | low | 0 | 0 | O-phosphorylhomoserine | Escherichia coli metabolite |
2,3-dihydroxybenzoylserine | [no description available] | low | 0 | 0 | L-serine derivative | Escherichia coli metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
beta-aspartyl phosphate | [no description available] | low | 0 | 0 | aminoacyl phosphate; L-aspartic acid derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
abrine | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-methyl-L-alpha-amino acid zwitterion; N-methyl-L-alpha-amino acid | Escherichia coli metabolite |
3-deoxy-d-arabino-heptulosonate-7-phosphate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
glucosamine 1-phosphate | [no description available] | low | 0 | 0 | glucosamine phosphate | Escherichia coli metabolite |
idonic acid | [no description available] | low | 0 | 0 | idonic acid | Escherichia coli metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite |
2-oxo-3-deoxygalactonic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
ribose 1-phosphate | [no description available] | low | 0 | 0 | D-ribose 1-phosphate | Escherichia coli metabolite |
diaminopimelic acid | [no description available] | low | 0 | 0 | 2,6-diaminopimelic acid; amino acid zwitterion | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
3-dehydroquinic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 4-hydroxy monocarboxylic acid; 4-oxo monocarboxylic acid; 5-hydroxy monocarboxylic acid; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
tartaric acid | [no description available] | low | 0 | 0 | tartaric acid | Escherichia coli metabolite |
s-ribosyl-l-homocysteine | [no description available] | low | 0 | 0 | S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | Escherichia coli metabolite |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | [no description available] | low | 0 | 0 | diadenosyl pentaphosphate | Escherichia coli metabolite; vasoconstrictor agent |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
glutathionylspermidine | [no description available] | low | 0 | 0 | glutathione derivative | Escherichia coli metabolite |
arbutin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
1-deoxy-d-xylulose 5-phosphate | [no description available] | low | 0 | 0 | xylulose phosphate | Escherichia coli metabolite |
c(alpha)-formylglycine | [no description available] | low | 0 | 0 | 3-oxoalanine; amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
sucrose-6-phosphate | [no description available] | low | 0 | 0 | disaccharide phosphate | Escherichia coli metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
iminoglycine | [no description available] | low | 0 | 0 | dehydroamino acid; imine; zwitterion | Escherichia coli metabolite |
2-keto-3-deoxy-6-phosphogluconate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
formyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | [no description available] | low | 0 | 0 | lipid As | Escherichia coli metabolite |
maleamic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dicarboxylic acid monoamide | bacterial xenobiotic metabolite; Escherichia coli metabolite |
canthaxanthin | [no description available] | low | 0 | 0 | carotenone | biological pigment; Escherichia coli metabolite; food colouring; fungal metabolite |
menaquinone 7 | [no description available] | low | 0 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
5-ketogluconic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
menaquinone 9 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite |
allolactose | [no description available] | low | 0 | 0 | glycosylglucose | Escherichia coli metabolite |
1-deoxy-2-pentulose | [no description available] | low | 0 | 0 | deoxypentose | Escherichia coli metabolite |
fructosyl-lysine | [no description available] | low | 0 | 0 | fructosamine; glyco-amino acid | Escherichia coli metabolite |
methionine sulfoxide | [no description available] | low | 0 | 0 | amino acid zwitterion; L-methionine S-oxide | Escherichia coli metabolite |
(S)-4,5-dihydroxypentane-2,3-dione | [no description available] | low | 0 | 0 | alpha-diketone; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
kdo2-lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid As; tetradecanoate ester | Escherichia coli metabolite |
oxalyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
queuine | [no description available] | low | 0 | 0 | pyrrolopyrimidine | Escherichia coli metabolite |
3'-guanylic acid | [no description available] | low | 0 | 0 | guanosine 3'-phosphate; purine ribonucleoside 3'-monophosphate | Escherichia coli metabolite |
2',3'-cyclic gmp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
colibactin | [no description available] | low | 0 | 0 | 1,3-thiazoles; azaspiro compound; polyketide; pyrroline; secondary carboxamide | alkylating agent; carcinogenic agent; Escherichia coli metabolite; genotoxin |
n-carbamoyl-beta-alanine | [no description available] | low | 0 | 0 | beta-alanine derivative | metabolite; mouse metabolite |
4-hydroxybenzaldehyde | [no description available] | low | 0 | 0 | hydroxybenzaldehyde | EC 1.14.17.1 (dopamine beta-monooxygenase) inhibitor; mouse metabolite; plant metabolite |
allantoic acid | [no description available] | low | 0 | 0 | ureas | mouse metabolite; plant metabolite |
hydrobromic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
1,2-dihydroxy-1,2-dihydronaphthalene | [no description available] | low | 0 | 0 | dihydronaphthalenes; naphthalenediols | bacterial xenobiotic metabolite; mouse metabolite |
phosphonoacetaldehyde | [no description available] | low | 0 | 0 | phosphonic acids | mouse metabolite |
diethyl phosphate | [no description available] | low | 0 | 0 | dialkyl phosphate | human xenobiotic metabolite; mouse metabolite |
o,o-diethyl phosphorothionate | [no description available] | low | 0 | 0 | organic thiophosphate | human xenobiotic metabolite; mouse metabolite |
hydantoin-5-propionic acid | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; monocarboxylic acid | metabolite; mouse metabolite |
lactaldehyde | [no description available] | low | 0 | 0 | hydroxyaldehyde; propanals | mouse metabolite |
4-nitrophenol | [no description available] | low | 0 | 0 | 4-nitrophenols | human xenobiotic metabolite; mouse metabolite |
parathion | [no description available] | low | 0 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; avicide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; mouse metabolite |
6-hydroxymelatonin | [no description available] | low | 0 | 0 | acetamides; tryptamines | metabolite; mouse metabolite |
adrenic acid | [no description available] | low | 0 | 0 | docosatetraenoic acid | mouse metabolite |
1,7-dimethylxanthine | [no description available] | low | 0 | 0 | dimethylxanthine | central nervous system stimulant; human blood serum metabolite; human xenobiotic metabolite; mouse metabolite |
theobromine | [no description available] | low | 0 | 0 | dimethylxanthine | adenosine receptor antagonist; bronchodilator agent; food component; human blood serum metabolite; mouse metabolite; plant metabolite; vasodilator agent |
1-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
2-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
vinylidene chloride | [no description available] | low | 0 | 0 | chloroethenes | carcinogenic agent; mouse metabolite; mutagen |
trichloroacetaldehyde | [no description available] | low | 0 | 0 | aldehyde; organochlorine compound | mouse metabolite |
pyridoxic acid | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | human urinary metabolite; mouse metabolite |
1-nitronaphthalene | [no description available] | low | 0 | 0 | mononitronaphthalene | environmental contaminant; mouse metabolite |
2-naphthoic acid | [no description available] | low | 0 | 0 | naphthoic acid | mouse metabolite; xenobiotic metabolite |
methylphenyl carbinol | [no description available] | low | 0 | 0 | aromatic alcohol | mouse metabolite |
4-hydroxyacetophenone | [no description available] | low | 0 | 0 | monohydroxyacetophenone | fungal metabolite; mouse metabolite; plant metabolite |
2-phenylacetamide | [no description available] | low | 0 | 0 | monocarboxylic acid amide | mouse metabolite |
2-heptanone | [no description available] | low | 0 | 0 | dialkyl ketone; methyl ketone | mouse metabolite; pheromone |
2,2,2-trichloroethanol | [no description available] | low | 0 | 0 | chloroethanol | mouse metabolite |
D-proline | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; proline | mouse metabolite |
aminoimidazole carboxamide | [no description available] | low | 0 | 0 | aminoimidazole; monocarboxylic acid amide | mouse metabolite |
methyl-4-tyramine | [no description available] | low | 0 | 0 | tyramines | mouse metabolite |
hydroxyhydroquinone | [no description available] | low | 0 | 0 | benzenetriol | mouse metabolite |
1,2-dihydroxynaphthalene | [no description available] | low | 0 | 0 | naphthalenediol | mouse metabolite |
propiolaldehyde | [no description available] | low | 0 | 0 | terminal acetylenic compound; ynal | mouse metabolite |
phenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
n-cyclohexylformamide | [no description available] | low | 0 | 0 | alicyclic compound; formamides | mouse metabolite |
dihydroferulic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid; phenylpropanoid | antioxidant; human xenobiotic metabolite; mouse metabolite; plant metabolite |
1-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite |
hydroiodic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
trichloroepoxyethane | [no description available] | low | 0 | 0 | epoxide | mouse metabolite |
cyromazine | [no description available] | low | 0 | 0 | triamino-1,3,5-triazine | mouse metabolite; triazine insecticide |
obtusifoliol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol | mouse metabolite; plant metabolite |
7-methylxanthine | [no description available] | low | 0 | 0 | oxopurine; purine alkaloid | human xenobiotic metabolite; mouse metabolite; plant metabolite |
n'-methyl-2-pyridone-5-carboxamide | [no description available] | low | 0 | 0 | methylpyridines; pyridinecarboxamide; pyridone | metabolite; mouse metabolite |
1-methyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
cyclopropylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | mouse metabolite |
6-hydroxynicotinic acid | [no description available] | low | 0 | 0 | monohydroxypyridine | Arabidopsis thaliana metabolite; human urinary metabolite; mouse metabolite |
2-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite; xenobiotic metabolite |
xanthurenic acid 8-methyl ether | [no description available] | low | 0 | 0 | aromatic ether; monohydroxyquinoline; quinolinemonocarboxylic acid | carcinogenic agent; metabolite; mouse metabolite |
glucose | [no description available] | low | 0 | 0 | D-glucopyranose | mouse metabolite |
1,3,7-trimethylurate | [no description available] | low | 0 | 0 | oxopurine | human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; mouse metabolite |
1-methylxanthine | [no description available] | low | 0 | 0 | 1-methylxanthine | mouse metabolite |
3,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | metabolite; mouse metabolite |
d-aspartic acid | [no description available] | low | 0 | 0 | aspartic acid; D-alpha-amino acid | mouse metabolite |
1,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
24-methylenecholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol | mouse metabolite |
2,8-dihydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; diol; heteroaryl hydroxy compound; oxopurine | human urinary metabolite; mammalian metabolite; mouse metabolite; nephrotoxic agent |
21-deoxycortisol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy-C21-steroid; deoxycortisol; tertiary alpha-hydroxy ketone | human blood serum metabolite; mouse metabolite |
imidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | metabolite; mouse metabolite |
1-hydroxyphenanthrene | [no description available] | low | 0 | 0 | phenanthrol | mouse metabolite |
2,5-dihydroxypyridine | [no description available] | low | 0 | 0 | dihydroxypyridine | mouse metabolite |
cerium | [no description available] | low | 0 | 0 | cholesteryl ester | mouse metabolite |
6,6-dimethyl-2-methylenebicyclo(3.1.1)heptan-3-ol | [no description available] | low | 0 | 0 | carbobicyclic compound; pinane monoterpenoid; secondary alcohol | GABA modulator; mouse metabolite; plant metabolite; volatile oil component |
ecgonine methyl ester | [no description available] | low | 0 | 0 | methyl ester; tertiary amino compound; tropane alkaloid | analgesic; central nervous system depressant; metabolite; mouse metabolite; opioid analgesic; peripheral nervous system drug |
2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | low | 0 | 0 | hydroxylamine; imidazopyridine | carcinogenic agent; genotoxin; human xenobiotic metabolite; mouse metabolite; mutagen; neurotoxin; rat metabolite |
cholest-5-en-3 beta,7 alpha-diol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid; oxysterol | mouse metabolite |
s-chloromethylglutathione | [no description available] | low | 0 | 0 | organochlorine compound; S-substituted glutathione | alkylating agent; bacterial xenobiotic metabolite; mouse metabolite |
5-acetylamino-6-formylamino-3-methyluracil | [no description available] | low | 0 | 0 | formamidopyrimidine | mouse metabolite |
anserine | [no description available] | low | 0 | 0 | beta-alanine derivative; dipeptide; zwitterion | animal metabolite; mouse metabolite |
5,6-dihydroxyindole | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
5,6-dihydroxy-2-indolylcarboxylic acid | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
inositol-3,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
24-hydroxycholesterol | [no description available] | low | 0 | 0 | 24-hydroxycholesterol | biomarker; human blood serum metabolite; mouse metabolite |
n-acetylputrescine | [no description available] | low | 0 | 0 | N-monoacetylalkane-alpha,omega-diamine; N-substituted putrescine | metabolite; mouse metabolite |
cdp ethanolamine | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphoethanolamine | mouse metabolite |
1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 30:0; tetradecanoate ester | mouse metabolite |
d-glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; D-alpha-amino acid; glutamine | mouse metabolite |
diquafosol | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-tetraphosphate; uridine 5'-phosphate | mouse metabolite; P2Y2 receptor agonist |
19-hydroxytestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 19-hydroxy steroid; 3-oxo-Delta(4) steroid | mouse metabolite |
2-hydroxy-1,4-benzoquinone | [no description available] | low | 0 | 0 | monohydroxy-1,4-benzoquinones | mouse metabolite |
hydromethylthionine | [no description available] | low | 0 | 0 | aromatic amine; phenothiazines; tertiary amino compound | bacterial xenobiotic metabolite; fluorochrome; mouse metabolite; rat metabolite |
5-hydroxykynuramine | [no description available] | low | 0 | 0 | hydroxykynurenamine; primary amino compound | mouse metabolite |
diadenosine triphosphate | [no description available] | low | 0 | 0 | diadenosyl triphosphate | mouse metabolite |
androstane-3,17-dione, (5alpha)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5alpha-steroid; androstane-3,17-dione | mouse metabolite |
21-hydroxypregnenolone | [no description available] | low | 0 | 0 | 21-hydroxy steroid; hydroxypregnenolone; primary alpha-hydroxy ketone | mouse metabolite |
epietiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; animal metabolite; human blood serum metabolite; mouse metabolite; rat metabolite |
19-hydroxy-4-androstene-3,17-dione | [no description available] | low | 0 | 0 | 17-oxo steroid; 19-hydroxy steroid; 3-oxo steroid; androstanoid | mouse metabolite |
ribulose 5-phosphate | [no description available] | low | 0 | 0 | ribulose 5-phosphate | mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | epitope; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | mouse metabolite |
inositol 1,4,5-trisphosphate | [no description available] | low | 0 | 0 | myo-inositol trisphosphate | mouse metabolite |
ketodihydrosphingosine | [no description available] | low | 0 | 0 | 2-amino-1-hydroxyoctadecan-3-one | mouse metabolite |
androstane-3,17-dione, (5beta)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5beta-steroid; androstane-3,17-dione | mouse metabolite |
beta-sulfopyruvic acid | [no description available] | low | 0 | 0 | carboxyalkanesulfonic acid | mouse metabolite |
2-hydroxypropylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; secondary alcohol | mouse metabolite |
inositol-1,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
prostaglandin h2 | [no description available] | low | 0 | 0 | olefinic compound; oxylipin; prostaglandins H; secondary alcohol | mouse metabolite |
geranylgeranyl pyrophosphate | [no description available] | low | 0 | 0 | geranylgeranyl diphosphate | mouse metabolite |
cytidine monophosphate n-acetylneuraminic acid | [no description available] | low | 0 | 0 | CMP-N-acyl-beta-neuraminic acid | mouse metabolite |
lyso-pc | [no description available] | low | 0 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine; lysophosphatidylcholine 16:0 | mouse metabolite |
trans-4-coumaric acid | [no description available] | low | 0 | 0 | 4-coumaric acid | food component; mouse metabolite; plant metabolite |
3-hydroxybutyryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxyacyl-CoA; hydroxybutanoyl-CoA | mouse metabolite |
dihydrosphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite |
caffeic acid | [no description available] | low | 0 | 0 | caffeic acid | geroprotector; mouse metabolite |
coniferyl alcohol | [no description available] | low | 0 | 0 | guaiacols; phenylpropanoid | animal metabolite; monolignol; mouse metabolite; pheromone; plant metabolite; volatile oil component |
raphanusamic acid | [no description available] | low | 0 | 0 | thiazolidinemonocarboxylic acid | Arabidopsis thaliana metabolite; mouse metabolite; xenobiotic metabolite |
arachidonic acid 5-hydroperoxide | [no description available] | low | 0 | 0 | 5-HPETE | mouse metabolite |
arachidonic acid omega-9 hydroperoxide | [no description available] | low | 0 | 0 | HPETE | mouse metabolite |
15-hydroperoxy-5,8,11,13-eicosatetraenoic acid, (s)-(e,z,z,z)-isomer | [no description available] | low | 0 | 0 | 15-HPETE | mouse metabolite |
1-palmitoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-palmitoyl-2-oleoylglycerol | mouse metabolite |
epoprostenol | [no description available] | low | 0 | 0 | prostaglandins I | mouse metabolite |
11,12-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET | mouse metabolite |
14,15-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET; diol; secondary allylic alcohol | mouse metabolite |
5,6-epoxy-8,11,14-eicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
8,9-epoxyeicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
1-palmitoyl-2-oleoylphosphatidylethanolamine, (z & r)-isomer | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphoethanolamine; phosphatidylethanolamine 34:1 zwitterion; phosphatidylethanolamine | mouse metabolite |
stearidonic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; octadecatetraenoic acid; omega-3 fatty acid | Daphnia galeata metabolite; mouse metabolite; plant metabolite |
trilinolein | [no description available] | low | 0 | 0 | 1,2-diacyl-3-linoleoylglycerol; 1,3-diacyl-2-linoleoylglycerol; linoleoyl containing 1,2,3-triacyl-sn-glycerol; TG(18:2/18:2/18:2); triglyceride | mouse metabolite |
monodehydroascorbate | [no description available] | low | 0 | 0 | organic radical | mouse metabolite |
1,2-dioleoylphosphatidylserine | [no description available] | low | 0 | 0 | phosphatidylserine(18:1/18:1) | mouse metabolite |
5-hydroxy-6,8,11,14,17-eicosapentaenoic acid | [no description available] | low | 0 | 0 | HEPE | mouse metabolite |
1-stearoyl-2-linoleoylphosphatidylcholine | [no description available] | low | 0 | 0 | phosphatidylcholine 36:2 | mouse metabolite |
1-stearoyl-2-linoleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; diacylglycerol 36:2 | mouse metabolite |
1-palmitoyl-2-docosahexaenoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | phosphatidylcholine 38:6 | mouse metabolite |
13(S)-HODE | [no description available] | low | 0 | 0 | HODE | antineoplastic agent; human xenobiotic metabolite; mouse metabolite |
1-stearoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-stearoyl-2-oleoylglycerol; diacylglycerol 36:1 | mouse metabolite |
1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-palmitoleoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:1 | mouse metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid | metabolite; mouse metabolite |
n-stearoylsphingomyelin | [no description available] | low | 0 | 0 | sphingomyelin 36:1; sphingomyelin d18:1 | mouse metabolite |
cholesteryl arachidonate | [no description available] | low | 0 | 0 | cholesteryl icosatetraenoate | antibacterial agent; mouse metabolite |
acryloyl-coenzyme a | [no description available] | low | 0 | 0 | 2-enoyl-CoA; monounsaturated fatty acyl-CoA | mouse metabolite |
samarium | [no description available] | low | 0 | 0 | sphingomyelin d18:1/16:0 | mouse metabolite |
n-palmitoylgalactosylsphingosine | [no description available] | low | 0 | 0 | HexCer(d18:1/16:0); N-acyl-beta-D-galactosylsphingosine | mouse metabolite |
prosomatostatin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone | fungal metabolite; mouse metabolite; rat metabolite |
phosphatidylcholines | [no description available] | low | 0 | 0 | phosphatidylcholine 40:6 | mouse metabolite |
cyclosporine | [no description available] | low | 0 | 0 | keto-disaccharide | mouse metabolite |
2,3-dimethoxy-5-methyl-6-decyl-1,4-benzoquinone | [no description available] | low | 0 | 0 | 1,4-benzoquinones | cofactor |
zeaxanthin | [no description available] | low | 0 | 0 | carotenol | antioxidant; bacterial metabolite; cofactor |
echinenone | [no description available] | low | 0 | 0 | carotenone | animal metabolite; bacterial metabolite; cofactor; marine metabolite |
chlorophyll b | [no description available] | low | 0 | 0 | chlorophyll | cofactor |
3'-hydroxyechinenone | [no description available] | low | 0 | 0 | carotenone; enone; secondary alcohol | bacterial metabolite; biological pigment; cofactor |
bacillithiol | [no description available] | low | 0 | 0 | glycoside; monosaccharide derivative; thiol | antioxidant; bacterial metabolite; cofactor |
alpha-ketoglutaric acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | fundamental metabolite |
betaine hydrochloride | [no description available] | low | 0 | 0 | quaternary ammonium ion | fundamental metabolite |
cysteine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; polar amino acid; sulfur-containing amino acid | fundamental metabolite |
alanine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion | fundamental metabolite |
3-phosphoglycerate | [no description available] | low | 0 | 0 | monophosphoglyceric acid; tetronic acid derivative | algal metabolite; fundamental metabolite |
glyceraldehyde | [no description available] | low | 0 | 0 | aldotriose | fundamental metabolite |
glyceric acid | [no description available] | low | 0 | 0 | trionic acid | fundamental metabolite |
phenylpyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid | chromogenic compound; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; fundamental metabolite |
isocitric acid | [no description available] | low | 0 | 0 | secondary alcohol; tricarboxylic acid | fundamental metabolite |
nadp | [no description available] | low | 0 | 0 | NADP | fundamental metabolite |
uridine diphosphate glucose | [no description available] | low | 0 | 0 | UDP-D-glucose | fundamental metabolite |
2'-deoxy-5'-adenosine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | fundamental metabolite |
uridine diphosphate xylose | [no description available] | low | 0 | 0 | UDP-sugar | fundamental metabolite |
serum p-component | [no description available] | low | 0 | 0 | citrate anion; tricarboxylic acid trianion | fundamental metabolite |
aconitic acid | [no description available] | low | 0 | 0 | aconitic acid | fundamental metabolite |