Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
idoxuridine | [no description available] | medium | 8 | 0 | organoiodine compound; pyrimidine 2'-deoxyribonucleoside | antiviral drug; DNA synthesis inhibitor |
cytidine triphosphate | [no description available] | medium | 33 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
deoxycytidine | [no description available] | medium | 23 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | medium | 16 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine triphosphate | [no description available] | medium | 90 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | medium | 90 | 1 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
ibacitabine | [no description available] | medium | 1 | 0 | pyrimidine 2'-deoxyribonucleoside | |
2'-deoxycytidine 5'-triphosphate | [no description available] | high | 143 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | high | 143 | 1 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
5-amino-2'-deoxyuridine | [no description available] | medium | 1 | 0 | | |
n(3)-ethylthymidine | [no description available] | medium | 1 | 0 | | |
5-propyl-2'-deoxyuridine | [no description available] | medium | 1 | 0 | | |
5-cyano-2'-deoxyuridine | [no description available] | medium | 1 | 0 | | |
9-beta-d-arabinofuranosylguanosine 5'-triphosphate | [no description available] | medium | 1 | 0 | | |
zidovudine triphosphate | [no description available] | medium | 18 | 0 | | |
zalcitabine | [no description available] | medium | 5 | 0 | pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
2',3'-dideoxyadenosine triphosphate | [no description available] | medium | 3 | 0 | purine deoxyribonucleoside triphosphate | |
stavudine triphosphate | [no description available] | medium | 5 | 0 | | |
2',3'-dideoxyuridine-5'-triphosphate | [no description available] | medium | 1 | 0 | | |
3'-fluorothymidine-5'-triphosphate | [no description available] | medium | 2 | 0 | | |
lamivudine triphosphate | [no description available] | medium | 3 | 0 | | |
2'-deoxyguanosine 5'-phosphate | [no description available] | medium | 3 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine triphosphate | [no description available] | medium | 93 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxyguanosine triphosphate | [no description available] | medium | 93 | 1 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
acyclovir triphosphate | [no description available] | medium | 3 | 0 | | |
acyclovir monophosphate | [no description available] | medium | 1 | 0 | | |
3'-azido-3'-deoxythymidine 5'phosphate | [no description available] | medium | 1 | 0 | | |
stavudine | [no description available] | medium | 8 | 0 | dihydrofuran; nucleoside analogue; organic molecular entity | antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
zidovudine | [no description available] | medium | 46 | 0 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
zidovudine | [no description available] | medium | 46 | 1 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
lamivudine | [no description available] | medium | 3 | 0 | monothioacetal; nucleoside analogue; oxacycle; primary alcohol | allergen; anti-HBV agent; antiviral drug; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor; HIV-1 reverse transcriptase inhibitor; prodrug |
emtricitabine | [no description available] | medium | 3 | 0 | monothioacetal; nucleoside analogue; organofluorine compound; pyrimidone | antiviral drug; HIV-1 reverse transcriptase inhibitor |
emtricitabine | [no description available] | medium | 3 | 1 | monothioacetal; nucleoside analogue; organofluorine compound; pyrimidone | antiviral drug; HIV-1 reverse transcriptase inhibitor |
2',3'-dideoxycytidine 5'-triphosphate | [no description available] | medium | 1 | 0 | | |
3'-azido-2',3'-dideoxyadenosine | [no description available] | medium | 1 | 0 | | |
tenofovir diphosphate | [no description available] | medium | 1 | 0 | | |
tenofovir disoproxil fumarate | [no description available] | medium | 1 | 0 | fumarate salt | antiviral drug; HIV-1 reverse transcriptase inhibitor; prodrug |
didanosine | [no description available] | medium | 1 | 0 | purine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor; geroprotector; HIV-1 reverse transcriptase inhibitor |
3'-azido-2',3'-dideoxyguanosine | [no description available] | medium | 1 | 0 | | |
carbovir triphosphate | [no description available] | medium | 2 | 0 | organic triphosphate | |
2',3'-dideoxythymidine triphosphate | [no description available] | medium | 9 | 0 | pyrimidine 2',3'-dideoxyribonucleoside 5'-triphosphate; thymidine phosphate | |
gamma-aminobutyric acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid | human metabolite; neurotransmitter; Saccharomyces cerevisiae metabolite; signalling molecule |
phenol | [no description available] | medium | 1 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
acetohydroxamic acid | [no description available] | medium | 1 | 0 | acetohydroxamic acids; carbohydroximic acid | algal metabolite; EC 3.5.1.5 (urease) inhibitor |
celecoxib | [no description available] | medium | 1 | 0 | organofluorine compound; pyrazoles; sulfonamide; toluenes | cyclooxygenase 2 inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
haloperidol | [no description available] | medium | 1 | 0 | aromatic ketone; hydroxypiperidine; monochlorobenzenes; organofluorine compound; tertiary alcohol | antidyskinesia agent; antiemetic; dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
losartan | [no description available] | medium | 1 | 0 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
nimesulide | [no description available] | medium | 1 | 0 | aromatic ether; C-nitro compound; sulfonamide | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
pd 153035 | [no description available] | medium | 1 | 0 | aromatic amine; aromatic ether; bromobenzenes; quinazolines; secondary amino compound | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; epidermal growth factor receptor antagonist |
trifluperidol | [no description available] | medium | 1 | 0 | aromatic ketone | |
venlafaxine | [no description available] | medium | 1 | 0 | cyclohexanols; monomethoxybenzene; tertiary alcohol; tertiary amino compound | adrenergic uptake inhibitor; analgesic; antidepressant; dopamine uptake inhibitor; environmental contaminant; serotonin uptake inhibitor; xenobiotic |
estrone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-hydroxy steroid; phenolic steroid; phenols | antineoplastic agent; bone density conservation agent; estrogen; human metabolite; mouse metabolite |
nifenalol | [no description available] | medium | 1 | 0 | C-nitro compound | |
glutamic acid | [no description available] | medium | 3 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
5,6,7,8-tetrahydro-1-naphthol | [no description available] | medium | 1 | 0 | tetralins | |
dmp 323 | [no description available] | medium | 1 | 0 | diazepanone; ureas | anti-HIV agent; metabolite |
estrone 3-methyl ether | [no description available] | medium | 1 | 0 | | |
sc 58125 | [no description available] | medium | 1 | 0 | organofluorine compound; pyrazoles; sulfone | antineoplastic agent; cyclooxygenase 2 inhibitor |
bmy 45778 | [no description available] | medium | 1 | 0 | bisoxazole | partial prostacyclin agonist |
exp7711 | [no description available] | medium | 1 | 0 | | |
bmy 42393 | [no description available] | medium | 1 | 0 | | |
mk 996 | [no description available] | medium | 1 | 0 | | |
ezetimibe | [no description available] | medium | 1 | 0 | azetidines; beta-lactam; organofluorine compound | anticholesteremic drug; antilipemic drug; antimetabolite |
l 158809 | [no description available] | medium | 1 | 0 | | |
telaprevir | [no description available] | medium | 1 | 0 | cyclopentapyrrole; cyclopropanes; oligopeptide; pyrazines | antiviral drug; hepatitis C protease inhibitor; peptidomimetic |
chaetomellic acid a | [no description available] | medium | 1 | 0 | | |
ophiocordin | [no description available] | medium | 1 | 0 | | |
upf 596 | [no description available] | medium | 1 | 0 | | |
iloprost | [no description available] | medium | 1 | 0 | carbobicyclic compound; monocarboxylic acid; secondary alcohol | platelet aggregation inhibitor; vasodilator agent |
way 133537 | [no description available] | medium | 1 | 0 | | |
dpc 423 | [no description available] | medium | 1 | 0 | | |
snap 6201 | [no description available] | medium | 1 | 0 | | |
guanosine diphosphate | [no description available] | medium | 9 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
aphidicolin | [no description available] | medium | 15 | 0 | tetracyclic diterpenoid | antimicrobial agent; antimitotic; antineoplastic agent; antiviral drug; apoptosis inducer; Aspergillus metabolite; DNA synthesis inhibitor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; fungal metabolite |
alovudine | [no description available] | medium | 2 | 0 | pyrimidine 2',3'-dideoxyribonucleoside | |
rhamnose | [no description available] | medium | 2 | 0 | L-rhamnose | |
deoxyuridine triphosphate | [no description available] | high | 28 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
deoxyuridine triphosphate | [no description available] | high | 28 | 1 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
folic acid | [no description available] | medium | 17 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
uracil | [no description available] | medium | 13 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
5-carboxytetramethylrhodamine succinimidyl ester | [no description available] | medium | 1 | 0 | | |
5-ethynyl-2'-deoxyuridylic acid | [no description available] | medium | 1 | 0 | | |
plumbagin | [no description available] | medium | 1 | 0 | hydroxy-1,4-naphthoquinone; phenols | anticoagulant; antineoplastic agent; immunological adjuvant; metabolite |
naphthoquinones | [no description available] | medium | 1 | 0 | | |
8-hydroxyadenine | [no description available] | medium | 1 | 0 | 6-aminopurines; heteroaryl hydroxy compound; nucleobase analogue; oxopurine | bacterial metabolite; human metabolite |
adenine | [no description available] | medium | 8 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
raltitrexed | [no description available] | medium | 8 | 0 | N-acyl-amino acid | |
thiophenes | [no description available] | medium | 8 | 0 | mancude organic heteromonocyclic parent; monocyclic heteroarene; thiophenes; volatile organic compound | non-polar solvent |
quinazolines | [no description available] | medium | 9 | 0 | azaarene; mancude organic heterobicyclic parent; ortho-fused heteroarene; quinazolines | |
fluorine | [no description available] | medium | 1 | 0 | diatomic fluorine; gas molecular entity | NMR chemical shift reference compound |
fluorouracil | [no description available] | medium | 18 | 1 | nucleobase analogue; organofluorine compound | antimetabolite; antineoplastic agent; environmental contaminant; immunosuppressive agent; radiosensitizing agent; xenobiotic |
metformin | [no description available] | medium | 1 | 0 | guanidines | environmental contaminant; geroprotector; hypoglycemic agent; xenobiotic |
gemcitabine | [no description available] | medium | 4 | 0 | organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; environmental contaminant; immunosuppressive agent; photosensitizing agent; prodrug; radiosensitizing agent; xenobiotic |
lysine | [no description available] | medium | 5 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
guanosine | [no description available] | medium | 2 | 0 | guanosines; purines D-ribonucleoside | fundamental metabolite |
sarcosine | [no description available] | medium | 1 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
5,6,7,8-tetrahydrofolic acid | [no description available] | medium | 1 | 0 | tetrahydrofolic acid | |
leucine | [no description available] | medium | 8 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
selenium | [no description available] | medium | 2 | 0 | chalcogen; nonmetal atom | micronutrient |
decitabine | [no description available] | medium | 2 | 0 | 2'-deoxyribonucleoside | |
pyridazine | [no description available] | medium | 1 | 0 | diazine; pyridazines | |
guanosine triphosphate | [no description available] | medium | 26 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
singlet oxygen | [no description available] | medium | 1 | 0 | chalcogen; monoatomic oxygen; nonmetal atom | macronutrient |
hydrazine | [no description available] | medium | 1 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
catechin | [no description available] | medium | 1 | 0 | catechin | antioxidant; plant metabolite |
methotrexate | [no description available] | medium | 16 | 0 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
d-alpha tocopherol | [no description available] | medium | 1 | 0 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
deoxyguanosine | [no description available] | medium | 10 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
manganese | [no description available] | medium | 6 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
7-methylguanine | [no description available] | medium | 1 | 0 | 7-methylguanine | |
guanine | [no description available] | medium | 19 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
tyrosine | [no description available] | medium | 7 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
fluorescein-5-isothiocyanate | [no description available] | medium | 2 | 0 | fluorescein isothiocyanate | |
thymidine | [no description available] | medium | 86 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
phosphocreatine | [no description available] | medium | 1 | 0 | phosphagen; phosphoamino acid | human metabolite; mouse metabolite |
oligomycin a | [no description available] | medium | 1 | 0 | antibiotic antifungal agent; diketone; oligomycin; pentol | antineoplastic agent; EC 3.6.3.14 (H(+)-transporting two-sector ATPase) inhibitor; nematicide |
thymidine monophosphate | [no description available] | medium | 31 | 0 | thymidine 5'-monophosphate | fundamental metabolite |
carbonyl cyanide m-chlorophenyl hydrazone | [no description available] | medium | 1 | 0 | hydrazone; monochlorobenzenes; nitrile | antibacterial agent; geroprotector; ionophore |
potassium cyanide | [no description available] | medium | 1 | 0 | cyanide salt; one-carbon compound; potassium salt | EC 1.15.1.1 (superoxide dismutase) inhibitor; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; neurotoxin |
oligomycins | [no description available] | medium | 1 | 0 | | |
acetyl phosphate | [no description available] | medium | 1 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
benzo(a)pyrene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mouse metabolite |
triphosphoric acid | [no description available] | medium | 6 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | |
deoxyglucose | [no description available] | medium | 1 | 0 | | |
uridine diphosphate glucose | [no description available] | medium | 2 | 0 | UDP-D-glucose | fundamental metabolite |
6-deoxyglucose | [no description available] | medium | 1 | 0 | quinovose | |
tenofovir | [no description available] | medium | 1 | 1 | nucleoside analogue; phosphonic acids | antiviral drug; drug metabolite; HIV-1 reverse transcriptase inhibitor |
warfarin | [no description available] | medium | 1 | 0 | benzenes; hydroxycoumarin; methyl ketone | |
n-(2-(1-maleimidyl)ethyl)-7-(diethylamino)coumarin-3-carboxamide | [no description available] | medium | 1 | 0 | | |
phosphorus | [no description available] | medium | 3 | 0 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
inosine triphosphate | [no description available] | medium | 4 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine monophosphate | [no description available] | medium | 2 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | medium | 7 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
homocysteine | [no description available] | medium | 4 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
uridine triphosphate | [no description available] | medium | 30 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
rhodium | [no description available] | medium | 2 | 0 | cobalt group element atom | |
2-aminopurine | [no description available] | medium | 8 | 0 | 2-aminopurines; nucleobase analogue | antimetabolite |
arginine | [no description available] | medium | 4 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
serine | [no description available] | medium | 2 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nadp | [no description available] | medium | 3 | 0 | | |
cytidine | [no description available] | medium | 10 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uridine monophosphate | [no description available] | medium | 2 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine | [no description available] | medium | 9 | 0 | uridines | drug metabolite; fundamental metabolite; human metabolite |
D-fructopyranose | [no description available] | medium | 1 | 0 | cyclic hemiketal; D-fructose; fructopyranose | sweetening agent |
floxuridine | [no description available] | medium | 15 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; radiosensitizing agent |
pyrophosphate | [no description available] | medium | 10 | 0 | diphosphate ion | |
pyrene | [no description available] | medium | 1 | 0 | ortho- and peri-fused polycyclic arene | fluorescent probe; persistent organic pollutant |
cyclen | [no description available] | medium | 1 | 0 | azacycloalkane; crown amine; saturated organic heteromonocyclic parent | |
cobamamide | [no description available] | medium | 1 | 0 | | |
o-(6)-methylguanine | [no description available] | medium | 4 | 0 | methylguanine | mutagen |
nevirapine | [no description available] | medium | 4 | 0 | cyclopropanes; dipyridodiazepine | antiviral drug; HIV-1 reverse transcriptase inhibitor |
purine | [no description available] | medium | 1 | 0 | purine | |
gold | [no description available] | medium | 1 | 0 | copper group element atom; elemental gold | |
mercury | [no description available] | medium | 2 | 0 | elemental mercury; zinc group element atom | neurotoxin |
difluorotoluene | [no description available] | medium | 1 | 0 | | |
toluene | [no description available] | medium | 3 | 0 | methylbenzene; toluenes; volatile organic compound | cholinergic antagonist; fuel additive; neurotoxin; non-polar solvent |
biotin | [no description available] | medium | 7 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
azides | [no description available] | medium | 3 | 0 | pseudohalide anion | mitochondrial respiratory-chain inhibitor |
glycine | [no description available] | medium | 5 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
pemetrexed | [no description available] | medium | 2 | 0 | N-acyl-L-glutamic acid; pyrrolopyrimidine | antimetabolite; antineoplastic agent; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; EC 2.1.1.45 (thymidylate synthase) inhibitor; EC 2.1.2.2 (phosphoribosylglycinamide formyltransferase) inhibitor |
uridine diphosphate n-acetylgalactosamine | [no description available] | medium | 1 | 0 | nucleotide-sugar oxoanion | human metabolite |
acetylgalactosamine | [no description available] | medium | 1 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
n-acetylgalactosamine-1-phosphate | [no description available] | medium | 1 | 0 | D-galactosamine 1-phosphate | human metabolite |
diphosphoric acid | [no description available] | medium | 2 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | Escherichia coli metabolite |
4-biphenylamine | [no description available] | medium | 1 | 0 | aminobiphenyl | carcinogenic agent |
2-acetylaminofluorene | [no description available] | medium | 1 | 0 | 2-acetamidofluorenes | antimitotic; carcinogenic agent; epitope; mutagen |
2-aminofluorene | [no description available] | medium | 1 | 0 | | |
thymine | [no description available] | medium | 7 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
7-methyl-diguanosine triphosphate | [no description available] | medium | 1 | 0 | | |
phosphoenolpyruvate | [no description available] | medium | 1 | 0 | carboxyalkyl phosphate; monocarboxylic acid | fundamental metabolite |
azodicarbonamide | [no description available] | medium | 1 | 0 | organic molecular entity | |
hydroxyurea | [no description available] | medium | 31 | 1 | one-carbon compound; ureas | antimetabolite; antimitotic; antineoplastic agent; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; genotoxin; immunomodulator; radical scavenger; teratogenic agent |
tryptophan | [no description available] | medium | 5 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
oligonucleotides | [no description available] | medium | 19 | 0 | | |
isoguanine | [no description available] | medium | 2 | 0 | oxopurine | |
aspartic acid | [no description available] | medium | 8 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
asparagine | [no description available] | medium | 3 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | medium | 9 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
cysteine | [no description available] | medium | 2 | 0 | cysteinium | fundamental metabolite |
carbene | [no description available] | medium | 1 | 0 | carbene; methanediyl | |
methane | [no description available] | medium | 1 | 0 | alkane; gas molecular entity; mononuclear parent hydride; one-carbon compound | bacterial metabolite; fossil fuel; greenhouse gas |
galactose | [no description available] | medium | 3 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
8-hydroxy-2'-deoxyguanosine | [no description available] | medium | 1 | 0 | guanosines | biomarker |
glucose-1-phosphate | [no description available] | medium | 3 | 0 | D-glucopyranose 1-phosphate | |
urea | [no description available] | medium | 2 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thymidine 5'-diphosphate | [no description available] | high | 5 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
phenyl acetate | [no description available] | medium | 1 | 0 | benzenes; phenyl acetates | |
4-hydroxymercuribenzoate | [no description available] | medium | 1 | 0 | | |
mercaptoethanol | [no description available] | medium | 2 | 0 | alkanethiol; primary alcohol | geroprotector |
edetic acid | [no description available] | medium | 3 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
cyclopentane | [no description available] | medium | 1 | 0 | cycloalkane; cyclopentanes; volatile organic compound | non-polar solvent |
erythrosine | [no description available] | medium | 4 | 0 | | |
erythrose | [no description available] | medium | 1 | 0 | erythrose | plant metabolite |
tetrahydrouridine | [no description available] | medium | 3 | 0 | | |
bromodeoxyuridine triphosphate | [no description available] | medium | 6 | 0 | | |
alanine | [no description available] | medium | 4 | 0 | alanine zwitterion; alanine; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; fundamental metabolite |
phenylalanine | [no description available] | medium | 3 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
pentobarbital | [no description available] | medium | 1 | 0 | barbiturates | GABAA receptor agonist |
pyrimidine | [no description available] | medium | 1 | 0 | diazine; pyrimidines | Daphnia magna metabolite |
adenosine | [no description available] | medium | 3 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
threonine | [no description available] | medium | 1 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
8-hydroxyguanine | [no description available] | medium | 2 | 0 | oxopurine | |
8-oxodeoxyguanosine triphosphate | [no description available] | medium | 1 | 0 | purine 2'-deoxyribonucleoside 5'-triphosphate | mutagen |
8-hydroxyguanosine triphosphate | [no description available] | medium | 1 | 0 | | |
o(6)-methyl-2'-deoxyguanosine | [no description available] | medium | 1 | 0 | purine 2'-deoxyribonucleoside | |
methylnitrosourea | [no description available] | medium | 1 | 0 | N-nitrosoureas | alkylating agent; carcinogenic agent; mutagen; teratogenic agent |
methionine | [no description available] | medium | 2 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
hydroxyl radical | [no description available] | medium | 2 | 0 | oxygen hydride; oxygen radical; reactive oxygen species | |
isoleucine | [no description available] | medium | 2 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
acyclovir | [no description available] | medium | 3 | 0 | 2-aminopurines; oxopurine | antimetabolite; antiviral drug |
valine | [no description available] | medium | 2 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
glutamine | [no description available] | medium | 1 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
piperidines | [no description available] | medium | 1 | 0 | | |
piperidine | [no description available] | medium | 1 | 0 | azacycloalkane; piperidines; saturated organic heteromonocyclic parent; secondary amine | base; catalyst; human metabolite; non-polar solvent; plant metabolite; protic solvent; reagent |
isocytosine | [no description available] | medium | 1 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | |
cytosine | [no description available] | medium | 3 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-thiothymidine | [no description available] | medium | 1 | 0 | | |
boron | [no description available] | medium | 1 | 0 | boron group element atom; metalloid atom; nonmetal atom | micronutrient |
3,4,5-trihydroxybenzamidoxime | [no description available] | medium | 1 | 0 | benzenetriol | |
gallic acid | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | antineoplastic agent; antioxidant; apoptosis inducer; astringent; cyclooxygenase 2 inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; geroprotector; human xenobiotic metabolite; plant metabolite |
dihydroxyphenylalanine | [no description available] | medium | 1 | 0 | hydroxyphenylalanine; non-proteinogenic alpha-amino acid; tyrosine derivative | human metabolite |
1,n(6)-ethenodeoxyadenosine | [no description available] | medium | 1 | 0 | purines | |
n-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | medium | 1 | 0 | | |
methoxyamine | [no description available] | medium | 1 | 0 | organooxygen compound | |
aminopterin | [no description available] | medium | 1 | 0 | dicarboxylic acid | EC 1.5.1.3 (dihydrofolate reductase) inhibitor; mutagen |
sulfanilamide | [no description available] | medium | 1 | 0 | substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; drug allergen; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
inosine diphosphate | [no description available] | medium | 1 | 0 | inosine phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite |
xanthosine 5'-triphosphate | [no description available] | medium | 1 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
phosphorus radioisotopes | [no description available] | medium | 12 | 0 | | |
delavirdine | [no description available] | medium | 1 | 0 | aminopyridine; indolecarboxamide; N-acylpiperazine; sulfonamide | antiviral drug; HIV-1 reverse transcriptase inhibitor |
efavirenz | [no description available] | medium | 2 | 0 | acetylenic compound; benzoxazine; cyclopropanes; organochlorine compound; organofluorine compound | antiviral drug; HIV-1 reverse transcriptase inhibitor |
betaine | [no description available] | medium | 1 | 0 | amino-acid betaine; glycine derivative | fundamental metabolite |
bromodeoxyuridine | [no description available] | medium | 10 | 0 | pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent |
adenosine diphosphate | [no description available] | medium | 4 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
cytarabine | [no description available] | medium | 18 | 0 | beta-D-arabinoside; monosaccharide derivative; pyrimidine nucleoside | antimetabolite; antineoplastic agent; antiviral agent; immunosuppressive agent |
brivudine | [no description available] | medium | 2 | 0 | | |
carbonyl cyanide p-trifluoromethoxyphenylhydrazone | [no description available] | medium | 1 | 0 | aromatic ether; hydrazone; nitrile; organofluorine compound | ATP synthase inhibitor; geroprotector; ionophore |
phorbolol myristate acetate | [no description available] | medium | 1 | 0 | | |
fura-2 | [no description available] | medium | 1 | 0 | | |
tetradecanoylphorbol acetate | [no description available] | medium | 3 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
ryanodine | [no description available] | medium | 1 | 0 | | |
fura-pe3 | [no description available] | medium | 1 | 0 | | |
2'-deoxyadenosine 5'-o-(1-thiotriphosphate) | [no description available] | medium | 1 | 0 | | |
ascorbic acid | [no description available] | medium | 1 | 0 | ascorbic acid; vitamin C | coenzyme; cofactor; flour treatment agent; food antioxidant; food colour retention agent; geroprotector; plant metabolite; skin lightening agent |
amanitins | [no description available] | medium | 2 | 0 | | |
ethylmaleimide | [no description available] | medium | 5 | 0 | maleimides | anticoronaviral agent; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.1.1 (hexokinase) inhibitor |
phosphonoacetic acid | [no description available] | medium | 3 | 0 | monocarboxylic acid; phosphonic acids | antiviral agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor |
5-(2-bromovinyl)-2'-deoxyuridine-5'-triphosphate | [no description available] | medium | 2 | 0 | | |
trifluridine | [no description available] | medium | 1 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; EC 2.1.1.45 (thymidylate synthase) inhibitor |
guanosine monophosphate | [no description available] | medium | 1 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
1-beta-d-arabinofuranosylcytosine 5'-monophosphate | [no description available] | medium | 1 | 0 | | |
ethyl methanesulfonate | [no description available] | medium | 4 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; genotoxin; mutagen; teratogenic agent |
butyric acid | [no description available] | medium | 1 | 0 | fatty acid 4:0; straight-chain saturated fatty acid | human urinary metabolite; Mycoplasma genitalium metabolite |
metaperiodate | [no description available] | medium | 1 | 0 | iodine oxoacid | |
beta, gamma-methylenedeoxythymidine 5'-triphosphate | [no description available] | medium | 2 | 0 | | |
adenosine 5'-o-(3-thiotriphosphate) | [no description available] | medium | 2 | 0 | nucleoside triphosphate analogue | |
2'-deoxy-5'-adenosine monophosphate | [no description available] | medium | 3 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | fundamental metabolite |
o(6)-methyldeoxyguanylic acid | [no description available] | medium | 1 | 0 | | |
dipyridamole | [no description available] | medium | 4 | 0 | piperidines; pyrimidopyrimidine; tertiary amino compound; tetrol | adenosine phosphodiesterase inhibitor; EC 3.5.4.4 (adenosine deaminase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
spermidine | [no description available] | medium | 2 | 0 | polyazaalkane; triamine | autophagy inducer; fundamental metabolite; geroprotector |
putrescine | [no description available] | medium | 1 | 0 | alkane-alpha,omega-diamine | antioxidant; fundamental metabolite |
ornithine | [no description available] | medium | 1 | 0 | non-proteinogenic L-alpha-amino acid; ornithine | algal metabolite; hepatoprotective agent; mouse metabolite |
alpha-hydrazinoornithine | [no description available] | medium | 1 | 0 | | |
nitrosochloramphenicol | [no description available] | medium | 1 | 0 | | |
nad | [no description available] | medium | 2 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
chloramphenicol | [no description available] | medium | 1 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
inosine dialdehyde | [no description available] | medium | 1 | 0 | | |
2,3-dihydro-1h-imidazo(1,2-b)pyrazole | [no description available] | medium | 1 | 0 | | |
inosine | [no description available] | medium | 2 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4-methyl-5-amino-1-formylisoquinoline thiosemicarbazone | [no description available] | medium | 1 | 0 | | |
nickel | [no description available] | medium | 1 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
dimethyl sulfate | [no description available] | medium | 1 | 0 | alkyl sulfate | alkylating agent; immunosuppressive agent |
pentostatin | [no description available] | medium | 2 | 0 | coformycins | antimetabolite; antineoplastic agent; Aspergillus metabolite; bacterial metabolite; EC 3.5.4.4 (adenosine deaminase) inhibitor |
coformycin | [no description available] | medium | 1 | 0 | coformycins | EC 3.5.4.4 (adenosine deaminase) inhibitor |
formic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid | antibacterial agent; astringent; metabolite; protic solvent; solvent |
concanavalin a | [no description available] | medium | 1 | 0 | | |
5-methyldeoxycytidine triphosphate | [no description available] | medium | 1 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | |
ammonium sulfate | [no description available] | medium | 1 | 0 | ammonium salt; inorganic sulfate salt | fertilizer |
glycerol | [no description available] | medium | 2 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
ferric chloride | [no description available] | medium | 1 | 0 | iron coordination entity | astringent; Lewis acid |
ferrous chloride | [no description available] | medium | 1 | 0 | iron coordination entity | |
chlorine | [no description available] | medium | 1 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
5'-amino-2',5'-dideoxythymidine | [no description available] | medium | 4 | 0 | | |
lysophosphatidylcholines | [no description available] | medium | 2 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine | |
ribavirin | [no description available] | medium | 3 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide | anticoronaviral agent; antiinfective agent; antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
5-iodo-2'-deoxyuridine triphosphate | [no description available] | medium | 2 | 0 | | |
thymine arabinoside | [no description available] | medium | 1 | 0 | N-glycosyl compound | |
methionine sulfoximine | [no description available] | medium | 1 | 0 | methionine derivative; non-proteinogenic alpha-amino acid; sulfoximide | |
buthionine sulfoximine | [no description available] | medium | 1 | 0 | diastereoisomeric mixture; homocysteines; non-proteinogenic alpha-amino acid; sulfoximide | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor; ferroptosis inducer |
carbostyril | [no description available] | medium | 1 | 0 | monohydroxyquinoline; quinolone | bacterial xenobiotic metabolite |
3'-anthraniloyl-2'-deoxy-atp | [no description available] | medium | 1 | 0 | | |
carboxin | [no description available] | medium | 1 | 0 | anilide fungicide; anilide; enamide; organosulfur heterocyclic compound; oxacycle; secondary carboxamide | antifungal agrochemical; EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor |
nsc 615985 | [no description available] | medium | 1 | 0 | | |
ici 198583 | [no description available] | medium | 3 | 0 | | |
2'-deoxyuridylic acid | [no description available] | medium | 10 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
5-(saenta-x8)fluorescein | [no description available] | medium | 1 | 0 | | |
digoxigenin | [no description available] | medium | 4 | 0 | 12beta-hydroxy steroid; 14beta-hydroxy steroid; 3beta-hydroxy steroid; 3beta-sterol | hapten; plant metabolite |
ag 331 | [no description available] | medium | 1 | 0 | | |
ouabain | [no description available] | medium | 1 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
ganciclovir | [no description available] | medium | 1 | 0 | 2-aminopurines; oxopurine | antiinfective agent; antiviral drug |
cladribine | [no description available] | medium | 1 | 0 | organochlorine compound; purine 2'-deoxyribonucleoside | antineoplastic agent; immunosuppressive agent |
arabinofuranosyluracil | [no description available] | medium | 1 | 0 | | |
fialuridine | [no description available] | medium | 1 | 0 | | |
methylnitronitrosoguanidine | [no description available] | medium | 6 | 0 | nitroso compound | alkylating agent |
orotic acid | [no description available] | medium | 1 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
thioguanine anhydrous | [no description available] | medium | 3 | 0 | 2-aminopurines | anticoronaviral agent; antimetabolite; antineoplastic agent |
5-methyl-2-pyrimidinone | [no description available] | medium | 1 | 0 | | |
pyrimidinones | [no description available] | medium | 1 | 0 | | |
4-nitrophenylphosphate | [no description available] | medium | 1 | 0 | aryl phosphate | mouse metabolite |
4-methylumbelliferyl phosphate | [no description available] | medium | 1 | 0 | | |
adamantane | [no description available] | medium | 2 | 0 | adamantanes; polycyclic alkane | |
hymecromone | [no description available] | medium | 1 | 0 | hydroxycoumarin | antineoplastic agent; hyaluronic acid synthesis inhibitor |
nitrophenols | [no description available] | medium | 1 | 0 | | |
3-(2'-spiroadamantane)-4-methoxy-4-(3''-phosphoryloxy)phenyl-1,2-dioxetane | [no description available] | medium | 1 | 0 | | |
o(6)-benzylguanine | [no description available] | medium | 1 | 0 | | |
methyl methanesulfonate | [no description available] | medium | 2 | 0 | methanesulfonate ester | alkylating agent; apoptosis inducer; carcinogenic agent; genotoxin; mutagen |
durapatite | [no description available] | medium | 1 | 0 | | |
s-adenosylhomocysteine | [no description available] | medium | 1 | 0 | adenosines; amino acid zwitterion; homocysteine derivative; homocysteines; organic sulfide | cofactor; EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor; EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor; epitope; fundamental metabolite |
s-adenosylmethionine | [no description available] | medium | 1 | 0 | organic cation; sulfonium compound | coenzyme; cofactor; human metabolite; micronutrient; Mycoplasma genitalium metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
thiazoles | [no description available] | medium | 1 | 0 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
thiazole orange | [no description available] | medium | 1 | 0 | cyanine dye | fluorochrome |
brequinar | [no description available] | medium | 1 | 0 | biphenyls; monocarboxylic acid; monofluorobenzenes; quinolinemonocarboxylic acid | anticoronaviral agent; antimetabolite; antineoplastic agent; antiviral agent; EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor; immunosuppressive agent; pyrimidine synthesis inhibitor |
ribose | [no description available] | medium | 2 | 0 | D-ribose; ribopyranose | |
pyrazofurin | [no description available] | medium | 1 | 0 | C-glycosyl compound; pyrazoles | antimetabolite; antimicrobial agent; antineoplastic agent; EC 4.1.1.23 (orotidine-5'-phosphate decarboxylase) inhibitor |
exo-n-(2-(4-azidotetrafluorobenzamido)ethyl)-deoxycytidine-5'-triphosphate | [no description available] | medium | 1 | 0 | | |
racivir | [no description available] | medium | 1 | 0 | | |
linoleic acid | [no description available] | medium | 1 | 0 | octadecadienoic acid; omega-6 fatty acid | algal metabolite; Daphnia galeata metabolite; plant metabolite |
bisbenzimidazole | [no description available] | medium | 1 | 0 | bibenzimidazole; N-methylpiperazine | anthelminthic drug; fluorochrome |
dapi | [no description available] | medium | 1 | 0 | indoles | fluorochrome |
stallimycin | [no description available] | medium | 1 | 0 | | |
netropsin | [no description available] | medium | 1 | 0 | | |
diminazene aceturate | [no description available] | medium | 1 | 0 | N-acetylglycinate salt | antiparasitic agent; trypanocidal drug |
diminazene | [no description available] | medium | 1 | 0 | carboxamidine; triazene derivative | antiparasitic agent; trypanocidal drug |
lexitropsin | [no description available] | medium | 1 | 0 | | |
2',3'-dideoxyguanosine 5'-triphosphate | [no description available] | medium | 2 | 0 | | |
emetine | [no description available] | medium | 2 | 0 | isoquinoline alkaloid; pyridoisoquinoline | antiamoebic agent; anticoronaviral agent; antiinfective agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; expectorant; plant metabolite; protein synthesis inhibitor |
2',3'-dideoxyadenosine 5'-phosphate | [no description available] | medium | 1 | 0 | | |
3-deazaguanine | [no description available] | medium | 1 | 0 | | |
adenylyl imidodiphosphate | [no description available] | medium | 2 | 0 | adenosine 5'-phosphate | |
inositol 1,4,5-trisphosphate | [no description available] | medium | 1 | 0 | myo-inositol trisphosphate | mouse metabolite |
alpha,beta-methyleneadenosine 5'-triphosphate | [no description available] | medium | 1 | 0 | nucleoside triphosphate analogue | |
3'-o-(4-benzoyl)benzoyladenosine 5'-triphosphate | [no description available] | medium | 1 | 0 | purine ribonucleoside triphosphate | |
5'-adenylyl (beta,gamma-methylene)diphosphonate | [no description available] | medium | 1 | 0 | nucleoside triphosphate analogue | |
adp beta s | [no description available] | medium | 1 | 0 | | |
thallium | [no description available] | medium | 1 | 0 | boron group element atom | |
barium | [no description available] | medium | 1 | 0 | alkaline earth metal atom; elemental barium | |
diazoxide | [no description available] | medium | 1 | 0 | benzothiadiazine; organochlorine compound; sulfone | antihypertensive agent; beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; diuretic; K-ATP channel agonist; sodium channel blocker; sympathomimetic agent; vasodilator agent |
glyburide | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-sulfonylurea | anti-arrhythmia drug; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor; hypoglycemic agent |
chromium | [no description available] | medium | 1 | 0 | chromium group element atom; metal allergen | micronutrient |
vitamin b 12 | [no description available] | medium | 1 | 0 | | |
malondialdehyde | [no description available] | medium | 1 | 0 | dialdehyde | biomarker |
5-formyl-2'-deoxyuridine | [no description available] | medium | 1 | 0 | | |
5-hydroxy-2'-deoxycytidine | [no description available] | medium | 1 | 0 | | |
hypoxanthine | [no description available] | medium | 4 | 0 | nucleobase analogue; oxopurine; purine nucleobase | fundamental metabolite |
levoleucovorin | [no description available] | medium | 3 | 0 | 5-formyltetrahydrofolic acid | antineoplastic agent; metabolite |
camptothecin | [no description available] | medium | 1 | 0 | delta-lactone; pyranoindolizinoquinoline; quinoline alkaloid; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; genotoxin; plant metabolite |
irinotecan | [no description available] | medium | 1 | 0 | carbamate ester; delta-lactone; N-acylpiperidine; pyranoindolizinoquinoline; ring assembly; tertiary alcohol; tertiary amino compound | antineoplastic agent; apoptosis inducer; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
uridine diphosphate | [no description available] | medium | 2 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
sq-23377 | [no description available] | medium | 1 | 0 | cyclic ether; enol; polyunsaturated fatty acid; very long-chain fatty acid | calcium ionophore; metabolite |
thromboxane a2 | [no description available] | medium | 1 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
leucine methyl ester | [no description available] | medium | 1 | 0 | alpha-amino acid ester; L-leucine derivative; methyl ester | |
2-(4-amylcinnamoyl)amino-4-chlorobenzoic acid | [no description available] | medium | 1 | 0 | | |
beta-alanine | [no description available] | medium | 1 | 0 | amino acid zwitterion; beta-amino acid | agonist; fundamental metabolite; human metabolite; inhibitor; neurotransmitter |
dideoxyadenosine | [no description available] | medium | 2 | 0 | adenosines; purine 2',3'-dideoxyribonucleoside | EC 3.5.4.4 (adenosine deaminase) inhibitor; EC 4.6.1.1 (adenylate cyclase) inhibitor |
potassium chloride | [no description available] | medium | 3 | 0 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
5-fluoropyrimidine | [no description available] | medium | 1 | 0 | | |
6-deoxytalose | [no description available] | medium | 1 | 0 | | |
galactose | [no description available] | medium | 1 | 0 | | |
deoxyinosine | [no description available] | medium | 1 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
zidovudine triphosphate | [no description available] | medium | 1 | 0 | | |
sodium hydroxide | [no description available] | medium | 1 | 0 | alkali metal hydroxide | |
isocarbostyril | [no description available] | medium | 1 | 0 | isoquinolines | |
mesoxalic acid | [no description available] | medium | 1 | 0 | oxo dicarboxylic acid | |
7,8-dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide | [no description available] | medium | 1 | 0 | epoxide | intercalator |
tsao-t | [no description available] | medium | 1 | 0 | | |
1-(2',5'-bis-o-(tert-butyldimethylsilylribofuranosyl)-3-n-methylthymine)-3'-spiro-5''-(4''-amino-1'',2''-oxathiole-2'',2''-dioxide) | [no description available] | medium | 1 | 0 | | |
3-hydroxypicolinic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; monohydroxypyridine | MALDI matrix material |
phosphoramidic acid | [no description available] | medium | 1 | 0 | phosphoric acid derivative | |
boranes | [no description available] | medium | 1 | 0 | boranes; mononuclear parent hydride | |
2,2'-dipyridyl | [no description available] | medium | 1 | 0 | bipyridine | chelator; ferroptosis inhibitor |
ruthenium | [no description available] | medium | 1 | 0 | iron group element atom; platinum group metal atom | |
osmium | [no description available] | medium | 1 | 0 | iron group element atom; platinum group metal atom | |
sodium bicarbonate | [no description available] | medium | 1 | 0 | one-carbon compound; organic sodium salt | antacid; food anticaking agent |
tretinoin | [no description available] | medium | 1 | 0 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
beta carotene | [no description available] | medium | 1 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
retinaldehyde | [no description available] | medium | 1 | 0 | retinal; vitamin A | gap junctional intercellular communication inhibitor; human metabolite; mouse metabolite |
retinol | [no description available] | medium | 1 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
fucoxanthin | [no description available] | medium | 1 | 0 | | |
astaxanthine | [no description available] | medium | 1 | 0 | carotenol; carotenone | animal metabolite; anticoagulant; antioxidant; food colouring; plant metabolite |
zinc sulfate | [no description available] | medium | 1 | 0 | metal sulfate; zinc molecular entity | fertilizer |
adenosine monophosphate | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | adenosine A1 receptor agonist; cofactor; EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.11 (fructose-bisphosphatase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
azelastine | [no description available] | medium | 1 | 0 | monochlorobenzenes; phthalazines; tertiary amino compound | anti-allergic agent; anti-asthmatic drug; bronchodilator agent; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; H1-receptor antagonist; platelet aggregation inhibitor |
carboplatin | [no description available] | medium | 1 | 0 | | |
daunosamine | [no description available] | medium | 1 | 0 | | |
cyanogen bromide | [no description available] | medium | 1 | 0 | | |
5-methoxymethyl-2'-deoxyuridine | [no description available] | medium | 1 | 0 | | |
potassium phosphate | [no description available] | medium | 1 | 0 | inorganic phosphate salt; inorganic potassium salt | |
fazarabine | [no description available] | medium | 1 | 0 | N-glycosyl-1,3,5-triazine; nucleoside analogue | antineoplastic agent |
azacitidine | [no description available] | medium | 2 | 0 | N-glycosyl-1,3,5-triazine; nucleoside analogue | antineoplastic agent |
methylphosphonic acid | [no description available] | medium | 1 | 0 | one-carbon compound; phosphonic acids | |
dimethyl sulfoxide | [no description available] | medium | 1 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
lometrexol | [no description available] | medium | 1 | 0 | | |
dihydrofolate | [no description available] | medium | 1 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
arabinofuranosylcytosine triphosphate | [no description available] | medium | 6 | 0 | | |
etoposide | [no description available] | medium | 1 | 0 | beta-D-glucoside; furonaphthodioxole; organic heterotetracyclic compound | antineoplastic agent; DNA synthesis inhibitor |
2,4-diamino-5-adamantyl-6-methylpyrimidine | [no description available] | medium | 1 | 0 | | |
n-hexadecane | [no description available] | medium | 1 | 0 | long-chain alkane | non-polar solvent; plant metabolite; volatile oil component |
histidine | [no description available] | medium | 5 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
o-4-methylthymine | [no description available] | medium | 2 | 0 | aromatic ether; methylthymine | human metabolite |
4-ethylthymine | [no description available] | medium | 2 | 0 | | |
carbazilquinone | [no description available] | medium | 1 | 0 | organic molecular entity | |
azaguanine | [no description available] | medium | 2 | 0 | nucleobase analogue; triazolopyrimidines | antimetabolite; antineoplastic agent; EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor |
2,6-diaminopurine | [no description available] | medium | 1 | 0 | 2,6-diaminopurines; primary amino compound | antineoplastic agent |
5-(n,n-hexamethylene)amiloride | [no description available] | medium | 1 | 0 | aromatic amine; azepanes; guanidines; monocarboxylic acid amide; organochlorine compound; pyrazines | antineoplastic agent; apoptosis inducer; odorant receptor antagonist; sodium channel blocker |
amiloride | [no description available] | medium | 1 | 0 | aromatic amine; guanidines; organochlorine compound; pyrazines | diuretic; sodium channel blocker |
ethylisopropylamiloride | [no description available] | medium | 1 | 0 | aromatic amine; guanidines; monocarboxylic acid amide; organochlorine compound; pyrazines; tertiary amino compound | anti-arrhythmia drug; neuroprotective agent; sodium channel blocker |
5-aza-2'-deoxycytidine-5'-monophosphate | [no description available] | medium | 1 | 0 | | |
baicalein | [no description available] | medium | 1 | 0 | trihydroxyflavone | angiogenesis inhibitor; anti-inflammatory agent; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.31 (arachidonate 12-lipoxygenase) inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 4.1.1.17 (ornithine decarboxylase) inhibitor; ferroptosis inhibitor; geroprotector; hormone antagonist; plant metabolite; prostaglandin antagonist; radical scavenger |
diadenosine tetraphosphate | [no description available] | medium | 3 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
pyridoxal phosphate | [no description available] | medium | 1 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
fluocinolone acetonide | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic ketal; fluorinated steroid; glucocorticoid; organic heteropentacyclic compound; primary alpha-hydroxy ketone | anti-inflammatory drug; antipruritic drug |
fluocinolone | [no description available] | medium | 1 | 0 | fluorinated steroid | |
metoprine | [no description available] | medium | 1 | 0 | | |
5,8-dideazaisofolic acid | [no description available] | medium | 1 | 0 | | |
pyrimethamine | [no description available] | medium | 1 | 0 | aminopyrimidine; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
3-((3-cholamidopropyl)dimethylammonium)-1-propanesulfonate | [no description available] | medium | 1 | 0 | 1,1-diunsubstituted alkanesulfonate | |
etretinate | [no description available] | medium | 2 | 0 | enoate ester; ethyl ester; retinoid | keratolytic drug |
anthralin | [no description available] | medium | 1 | 0 | anthracenes | antipsoriatic |
o(4)-methylthymidine triphosphate | [no description available] | medium | 2 | 0 | | |
epidermal growth factor | [no description available] | medium | 1 | 0 | | |
phenobarbital | [no description available] | medium | 1 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
p(1),p(5)-di(adenosine-5'-)pentaphosphate | [no description available] | medium | 1 | 0 | organophosphate oxoanion | |
9-(2-hydroxy-3-nonyl)adenine | [no description available] | medium | 1 | 0 | | |
tretazicar | [no description available] | medium | 1 | 0 | | |
caffeine | [no description available] | medium | 1 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
parabactin | [no description available] | medium | 1 | 0 | | |
oxazoles | [no description available] | medium | 1 | 0 | 1,3-oxazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
monoisopropanolamine | [no description available] | low | 0 | 0 | amino alcohol; secondary alcohol | Escherichia coli metabolite |
dihydro-3-coumaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid | Escherichia coli metabolite; human xenobiotic metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
5,6,7,8-tetrahydropteridine | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
acetaldehyde | [no description available] | low | 0 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
allantoin | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
arsenic acid | [no description available] | low | 0 | 0 | arsenic oxoacid | Escherichia coli metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
carbamic acid | [no description available] | low | 0 | 0 | carbon oxoacid; one-carbon compound; organonitrogen compound | Escherichia coli metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
choline | [no description available] | low | 0 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
2-aminoacetaldehyde | [no description available] | low | 0 | 0 | amino aldehyde; omega-aminoaldehyde | Escherichia coli metabolite |
2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; amino acid zwitterion; beta-amino acid; diamino acid; non-proteinogenic alpha-amino acid | Escherichia coli metabolite |
octanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
hydrogen sulfide | [no description available] | low | 0 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
oxaluric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; ureas | Escherichia coli metabolite |
n(1)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; metabolite |
propionaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; propanals | Escherichia coli metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
diacetyl | [no description available] | low | 0 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1,4-dihydroxy-2-naphthoic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; naphthalenediols; naphthohydroquinone; naphthoic acid | Escherichia coli metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
formaldehyde | [no description available] | low | 0 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydrogen cyanide | [no description available] | low | 0 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
hydrogen carbonate | [no description available] | low | 0 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
toxopyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
thiocyanic acid | [no description available] | low | 0 | 0 | hydracid; one-carbon compound; organosulfur compound | Escherichia coli metabolite |
hydroquinone | [no description available] | low | 0 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
iminoaspartic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; ketimine | Escherichia coli metabolite |
indole | [no description available] | low | 0 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
pyruvaldehyde | [no description available] | low | 0 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
methanol | [no description available] | low | 0 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
niacinamide | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
niacin | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
hydroxypyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
oxamic acid | [no description available] | low | 0 | 0 | dicarboxylic acid monoamide | Escherichia coli metabolite |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
quinolinic acid | [no description available] | low | 0 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
dimethyl sulfide | [no description available] | low | 0 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
sulfur dioxide | [no description available] | low | 0 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
taurine | [no description available] | low | 0 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
thiamine | [no description available] | low | 0 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
trimethyloxamine | [no description available] | low | 0 | 0 | tertiary amine oxide | Escherichia coli metabolite; metabolite; osmolyte |
trimethylamine | [no description available] | low | 0 | 0 | methylamines; tertiary amine | Escherichia coli metabolite; human xenobiotic metabolite |
uric acid | [no description available] | low | 0 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
beta-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
4-cresol | [no description available] | low | 0 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
tyramine | [no description available] | low | 0 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
sorbitol | [no description available] | low | 0 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
sucrose | [no description available] | low | 0 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
mannitol | [no description available] | low | 0 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
methanesulfonic acid | [no description available] | low | 0 | 0 | alkanesulfonic acid; one-carbon compound | Escherichia coli metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
framycetin | [no description available] | low | 0 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
shikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
homoserine | [no description available] | low | 0 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
fucose | [no description available] | low | 0 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
1,3,4-butanetriol | [no description available] | low | 0 | 0 | triol | bacterial xenobiotic metabolite; Escherichia coli metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
silver | [no description available] | low | 0 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
molybdate ion | [no description available] | low | 0 | 0 | divalent inorganic anion; molybdenum oxoanion | Escherichia coli metabolite |
myrmicacin | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; medium-chain fatty acid | antimitotic; Escherichia coli metabolite |
phosphotyrosine | [no description available] | low | 0 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid; O(4)-phosphotyrosine | Escherichia coli metabolite; immunogen |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
aica ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
glutathione disulfide | [no description available] | low | 0 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
n-(3-aminopropyl)cadaverine | [no description available] | low | 0 | 0 | polyazaalkane; triamine | Escherichia coli metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
hydracrylic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
D-serine | [no description available] | low | 0 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
D-tyrosine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; tyrosine | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
coenzyme a | [no description available] | low | 0 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
L-2-aminoadipic acid | [no description available] | low | 0 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
3'-uridylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 3'-monophosphate; uridine phosphate | Escherichia coli metabolite |
2',3'-cyclic amp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
2,5-diketogluconic acid | [no description available] | low | 0 | 0 | diketoaldonic acid | Escherichia coli metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
selenodiglutathione | [no description available] | low | 0 | 0 | glutathione derivative; thioselenide | Escherichia coli metabolite; metabolite |
2-deoxyglucose-6-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | Escherichia coli metabolite; Mycoplasma genitalium metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
thymidine diphosphate-l-rhamnose | [no description available] | low | 0 | 0 | dTDP-L-rhamnose | Escherichia coli metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
trehalose-6-phosphate | [no description available] | low | 0 | 0 | trehalose phosphate | Escherichia coli metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
aerobactin | [no description available] | low | 0 | 0 | L-lysine derivative | Escherichia coli metabolite; siderophore; virulence factor |
lipid x | [no description available] | low | 0 | 0 | N-acyl-D-glucosamine 1-phosphate | Escherichia coli metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glutamate-1-semialdehyde | [no description available] | low | 0 | 0 | 5-oxo monocarboxylic acid; amino acid zwitterion; gamma-amino acid; glutamic semialdehyde | Escherichia coli metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
proline | [no description available] | low | 0 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
o-phosphohomoserine | [no description available] | low | 0 | 0 | O-phosphorylhomoserine | Escherichia coli metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
2,3-dihydroxybenzoylserine | [no description available] | low | 0 | 0 | L-serine derivative | Escherichia coli metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
beta-aspartyl phosphate | [no description available] | low | 0 | 0 | aminoacyl phosphate; L-aspartic acid derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
abrine | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-methyl-L-alpha-amino acid zwitterion; N-methyl-L-alpha-amino acid | Escherichia coli metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-deoxy-d-arabino-heptulosonate-7-phosphate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
glucosamine 1-phosphate | [no description available] | low | 0 | 0 | glucosamine phosphate | Escherichia coli metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
9-mercaptodethiobiotin | [no description available] | low | 0 | 0 | imidazolidinone; monocarboxylic acid; thiol; ureas | Escherichia coli metabolite |
idonic acid | [no description available] | low | 0 | 0 | idonic acid | Escherichia coli metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxythreonine | [no description available] | low | 0 | 0 | amino acid zwitterion; hydroxy-amino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite |
2-oxo-3-deoxygalactonic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
arabinose | [no description available] | low | 0 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
glucosamine | [no description available] | low | 0 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
ribose 1-phosphate | [no description available] | low | 0 | 0 | D-ribose 1-phosphate | Escherichia coli metabolite |
diaminopimelic acid | [no description available] | low | 0 | 0 | 2,6-diaminopimelic acid; amino acid zwitterion | Escherichia coli metabolite |
3-dehydroquinic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 4-hydroxy monocarboxylic acid; 4-oxo monocarboxylic acid; 5-hydroxy monocarboxylic acid; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
o-succinylhomoserine | [no description available] | low | 0 | 0 | hemisuccinate; o-succinylhomoserine | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
cysteinylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
tartaric acid | [no description available] | low | 0 | 0 | tartaric acid | Escherichia coli metabolite |
s-ribosyl-l-homocysteine | [no description available] | low | 0 | 0 | S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | Escherichia coli metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | [no description available] | low | 0 | 0 | diadenosyl pentaphosphate | Escherichia coli metabolite; vasoconstrictor agent |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
glutathionylspermidine | [no description available] | low | 0 | 0 | glutathione derivative | Escherichia coli metabolite |
arbutin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
2-c-methylerythritol 4-phosphate | [no description available] | low | 0 | 0 | tetritol phosphate | Escherichia coli metabolite |
1-deoxy-d-xylulose 5-phosphate | [no description available] | low | 0 | 0 | xylulose phosphate | Escherichia coli metabolite |
c(alpha)-formylglycine | [no description available] | low | 0 | 0 | 3-oxoalanine; amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
palmitoleic acid | [no description available] | low | 0 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
oleic acid | [no description available] | low | 0 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
riboflavin | [no description available] | low | 0 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
sucrose-6-phosphate | [no description available] | low | 0 | 0 | disaccharide phosphate | Escherichia coli metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
fusidic acid | [no description available] | low | 0 | 0 | 11alpha-hydroxy steroid; 3alpha-hydroxy steroid; alpha,beta-unsaturated monocarboxylic acid; steroid acid; steroid antibiotic; sterol ester | EC 2.7.1.33 (pantothenate kinase) inhibitor; Escherichia coli metabolite; protein synthesis inhibitor |
iminoglycine | [no description available] | low | 0 | 0 | dehydroamino acid; imine; zwitterion | Escherichia coli metabolite |
2-keto-3-deoxy-6-phosphogluconate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
formyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | [no description available] | low | 0 | 0 | lipid As | Escherichia coli metabolite |
phosphothreonine | [no description available] | low | 0 | 0 | L-threonine derivative; non-proteinogenic L-alpha-amino acid; O-phosphoamino acid | Escherichia coli metabolite |
maleamic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dicarboxylic acid monoamide | bacterial xenobiotic metabolite; Escherichia coli metabolite |
retinol palmitate | [no description available] | low | 0 | 0 | all-trans-retinyl ester; retinyl palmitate | antioxidant; Escherichia coli metabolite; human xenobiotic metabolite |
canthaxanthin | [no description available] | low | 0 | 0 | carotenone | biological pigment; Escherichia coli metabolite; food colouring; fungal metabolite |
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; phosphoantigen |
menaquinone 7 | [no description available] | low | 0 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
5-ketogluconic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
menaquinone 9 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite |
allolactose | [no description available] | low | 0 | 0 | glycosylglucose | Escherichia coli metabolite |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
1-deoxy-2-pentulose | [no description available] | low | 0 | 0 | deoxypentose | Escherichia coli metabolite |
fructosyl-lysine | [no description available] | low | 0 | 0 | fructosamine; glyco-amino acid | Escherichia coli metabolite |
lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid A; tetradecanoate ester | Escherichia coli metabolite |
methionine sulfoxide | [no description available] | low | 0 | 0 | amino acid zwitterion; L-methionine S-oxide | Escherichia coli metabolite |
(S)-4,5-dihydroxypentane-2,3-dione | [no description available] | low | 0 | 0 | alpha-diketone; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
kdo2-lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid As; tetradecanoate ester | Escherichia coli metabolite |
oxalyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
novobiocin | [no description available] | low | 0 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
cyclic gmp | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
queuine | [no description available] | low | 0 | 0 | pyrrolopyrimidine | Escherichia coli metabolite |
3'-guanylic acid | [no description available] | low | 0 | 0 | guanosine 3'-phosphate; purine ribonucleoside 3'-monophosphate | Escherichia coli metabolite |
2',3'-cyclic gmp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
rifampin | [no description available] | low | 0 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
leucovorin | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
colibactin | [no description available] | low | 0 | 0 | 1,3-thiazoles; azaspiro compound; polyketide; pyrroline; secondary carboxamide | alkylating agent; carcinogenic agent; Escherichia coli metabolite; genotoxin |
alpha-hydroxyglutarate | [no description available] | low | 0 | 0 | 2-hydroxydicarboxylic acid; dicarboxylic fatty acid | metabolite; mouse metabolite |
alpha-ketoadipic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | human urinary metabolite; mouse metabolite |
3-hydroxyanthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; monohydroxybenzoic acid | human metabolite; mouse metabolite |
n-carbamoyl-beta-alanine | [no description available] | low | 0 | 0 | beta-alanine derivative | metabolite; mouse metabolite |
4-hydroxybenzaldehyde | [no description available] | low | 0 | 0 | hydroxybenzaldehyde | EC 1.14.17.1 (dopamine beta-monooxygenase) inhibitor; mouse metabolite; plant metabolite |
4-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols | fungal metabolite; human metabolite; mouse metabolite; plant metabolite |
isocaproaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde | human metabolite; mouse metabolite |
ethylene glycol | [no description available] | low | 0 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
allantoic acid | [no description available] | low | 0 | 0 | ureas | mouse metabolite; plant metabolite |
ammonium hydroxide | [no description available] | low | 0 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
anthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid | human metabolite; mouse metabolite |
hydrobromic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
1-butanol | [no description available] | low | 0 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
carbon monoxide | [no description available] | low | 0 | 0 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
carnitine | [no description available] | low | 0 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
hydrochloric acid | [no description available] | low | 0 | 0 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
aminoethylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; primary amino compound; zwitterion | human metabolite; metabolite; mouse metabolite |
1,2-dihydroxy-1,2-dihydronaphthalene | [no description available] | low | 0 | 0 | dihydronaphthalenes; naphthalenediols | bacterial xenobiotic metabolite; mouse metabolite |
trimethylenediamine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | human metabolite; mouse metabolite; reagent |
n(1)-methylnicotinamide | [no description available] | low | 0 | 0 | pyridinium ion | algal metabolite; anti-inflammatory agent; human urinary metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
phosphonoacetaldehyde | [no description available] | low | 0 | 0 | phosphonic acids | mouse metabolite |
gamma-guanidinobutyric acid | [no description available] | low | 0 | 0 | guanidines; monocarboxylic acid; zwitterion | fungal metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
alpha-keto-delta-guanidinovaleric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
creatine | [no description available] | low | 0 | 0 | glycine derivative; guanidines; zwitterion | geroprotector; human metabolite; mouse metabolite; neuroprotective agent; nutraceutical |
diethyl phosphate | [no description available] | low | 0 | 0 | dialkyl phosphate | human xenobiotic metabolite; mouse metabolite |
o,o-diethyl phosphorothionate | [no description available] | low | 0 | 0 | organic thiophosphate | human xenobiotic metabolite; mouse metabolite |
dihydrolipoamide | [no description available] | low | 0 | 0 | dithiol; monocarboxylic acid amide | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dimethylglycine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-methyl-amino acid; N-methylglycines | Daphnia magna metabolite; human metabolite; mouse metabolite |
glycocyamine | [no description available] | low | 0 | 0 | guanidinoacetic acids; zwitterion | bacterial metabolite; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
carbonic acid | [no description available] | low | 0 | 0 | carbon oxoacid; chalcocarbonic acid | mouse metabolite |
histamine | [no description available] | low | 0 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
hydantoin-5-propionic acid | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; monocarboxylic acid | metabolite; mouse metabolite |
indole-3-acetaldehyde | [no description available] | low | 0 | 0 | indoleacetaldehyde | bacterial metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
indoleacetic acid | [no description available] | low | 0 | 0 | indole-3-acetic acids; monocarboxylic acid | auxin; human metabolite; mouse metabolite; plant hormone; plant metabolite |
lactaldehyde | [no description available] | low | 0 | 0 | hydroxyaldehyde; propanals | mouse metabolite |
melatonin | [no description available] | low | 0 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
n-acetylserotonin | [no description available] | low | 0 | 0 | acetamides; N-acylserotonin; phenols | antioxidant; human metabolite; mouse metabolite; tropomyosin-related kinase B receptor agonist |
naphthalene | [no description available] | low | 0 | 0 | naphthalenes; ortho-fused bicyclic arene | apoptosis inhibitor; carcinogenic agent; environmental contaminant; mouse metabolite; plant metabolite; volatile oil component |
hydroxide ion | [no description available] | low | 0 | 0 | oxygen hydride | mouse metabolite |
4-nitrophenol | [no description available] | low | 0 | 0 | 4-nitrophenols | human xenobiotic metabolite; mouse metabolite |
hexadecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
parathion | [no description available] | low | 0 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; avicide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; mouse metabolite |
phenanthrene | [no description available] | low | 0 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon; phenanthrenes | environmental contaminant; mouse metabolite |
phosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines | allergen; epitope; hapten; human metabolite; mouse metabolite |
phosphorylethanolamine | [no description available] | low | 0 | 0 | phosphoethanolamine; primary amino compound | algal metabolite; human metabolite; mouse metabolite |
propylene glycol | [no description available] | low | 0 | 0 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
tryptamine | [no description available] | low | 0 | 0 | aminoalkylindole; aralkylamino compound; indole alkaloid; tryptamines | human metabolite; mouse metabolite; plant metabolite |
perillic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | antineoplastic agent; human metabolite; mouse metabolite |
homovanillic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid | human metabolite; mouse metabolite |
hydroxyindoleacetic acid | [no description available] | low | 0 | 0 | indole-3-acetic acids | drug metabolite; human metabolite; mouse metabolite |
5-methoxytryptamine | [no description available] | low | 0 | 0 | aromatic ether; primary amino compound; tryptamines | 5-hydroxytryptamine 2A receptor agonist; 5-hydroxytryptamine 2B receptor agonist; 5-hydroxytryptamine 2C receptor agonist; antioxidant; cardioprotective agent; human metabolite; mouse metabolite; neuroprotective agent; radiation protective agent; serotonergic agonist |
6-hydroxymelatonin | [no description available] | low | 0 | 0 | acetamides; tryptamines | metabolite; mouse metabolite |
adrenic acid | [no description available] | low | 0 | 0 | docosatetraenoic acid | mouse metabolite |
chloral hydrate | [no description available] | low | 0 | 0 | aldehyde hydrate; ethanediol; organochlorine compound | general anaesthetic; mouse metabolite; sedative; xenobiotic |
2,5-dihydroxybenzoic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; fungal metabolite; human metabolite; MALDI matrix material; mouse metabolite |
tele-methylhistamine | [no description available] | low | 0 | 0 | imidazoles; primary amino compound | human metabolite; mouse metabolite |
quinone | [no description available] | low | 0 | 0 | 1,4-benzoquinones | cofactor; human xenobiotic metabolite; mouse metabolite |
1,7-dimethylxanthine | [no description available] | low | 0 | 0 | dimethylxanthine | central nervous system stimulant; human blood serum metabolite; human xenobiotic metabolite; mouse metabolite |
theobromine | [no description available] | low | 0 | 0 | dimethylxanthine | adenosine receptor antagonist; bronchodilator agent; food component; human blood serum metabolite; mouse metabolite; plant metabolite; vasodilator agent |
corticosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
estriol | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
hydroxyproline | [no description available] | low | 0 | 0 | 4-hydroxyproline; L-alpha-amino acid zwitterion | human metabolite; mouse metabolite; plant metabolite |
thyroxine | [no description available] | low | 0 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
aldosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
androsterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid; C19-steroid | androgen; anticonvulsant; human blood serum metabolite; human metabolite; human urinary metabolite; mouse metabolite; pheromone |
etiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid | human metabolite; mouse metabolite |
dehydroepiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
triiodothyronine | [no description available] | low | 0 | 0 | 2-halophenol; amino acid zwitterion; iodophenol; iodothyronine | human metabolite; mouse metabolite; thyroid hormone |
levodopa | [no description available] | low | 0 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
cysteamine | [no description available] | low | 0 | 0 | amine; thiol | geroprotector; human metabolite; mouse metabolite; radiation protective agent |
androstenedione | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
desoxycorticosterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; mineralocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
1-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
2-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
17-alpha-hydroxyprogesterone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
methylamine | [no description available] | low | 0 | 0 | methylamines; one-carbon compound; primary aliphatic amine | mouse metabolite |
ethylene oxide | [no description available] | low | 0 | 0 | gas molecular entity; oxacycle; saturated organic heteromonocyclic parent | allergen; mouse metabolite; mutagen |
vinylidene chloride | [no description available] | low | 0 | 0 | chloroethenes | carcinogenic agent; mouse metabolite; mutagen |
trichloroacetaldehyde | [no description available] | low | 0 | 0 | aldehyde; organochlorine compound | mouse metabolite |
trichloroacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
gibberellic acid | [no description available] | low | 0 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone; organic heteropentacyclic compound | mouse metabolite; plant metabolite |
trichloroethylene | [no description available] | low | 0 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
pyridoxic acid | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | human urinary metabolite; mouse metabolite |
1-nitronaphthalene | [no description available] | low | 0 | 0 | mononitronaphthalene | environmental contaminant; mouse metabolite |
beta-glucono-1,5-lactone | [no description available] | low | 0 | 0 | aldono-1,5-lactone; gluconolactone | animal metabolite; mouse metabolite |
2-naphthoic acid | [no description available] | low | 0 | 0 | naphthoic acid | mouse metabolite; xenobiotic metabolite |
methylphenyl carbinol | [no description available] | low | 0 | 0 | aromatic alcohol | mouse metabolite |
4-hydroxyacetophenone | [no description available] | low | 0 | 0 | monohydroxyacetophenone | fungal metabolite; mouse metabolite; plant metabolite |
styrene | [no description available] | low | 0 | 0 | styrenes; vinylarene; volatile organic compound | mouse metabolite; mutagen; plant metabolite |
2-phenylacetamide | [no description available] | low | 0 | 0 | monocarboxylic acid amide | mouse metabolite |
4-bromophenol | [no description available] | low | 0 | 0 | bromophenol | human urinary metabolite; human xenobiotic metabolite; marine metabolite; mouse metabolite; persistent organic pollutant; rat metabolite |
ethylene dibromide | [no description available] | low | 0 | 0 | bromoalkane; bromohydrocarbon | algal metabolite; carcinogenic agent; fumigant; marine metabolite; mouse metabolite; mutagen |
bromobenzene | [no description available] | low | 0 | 0 | bromoarene; bromobenzenes; volatile organic compound | hepatotoxic agent; mouse metabolite; non-polar solvent |
2-heptanone | [no description available] | low | 0 | 0 | dialkyl ketone; methyl ketone | mouse metabolite; pheromone |
2,2,2-trichloroethanol | [no description available] | low | 0 | 0 | chloroethanol | mouse metabolite |
2-naphthol | [no description available] | low | 0 | 0 | naphthol | antinematodal drug; genotoxin; human urinary metabolite; human xenobiotic metabolite; mouse metabolite; radical scavenger |
pregnenolone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; C21-steroid | human metabolite; mouse metabolite |
20-alpha-dihydroprogesterone | [no description available] | low | 0 | 0 | 20-hydroxypregn-4-en-3-one | human metabolite; mouse metabolite |
D-proline | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; proline | mouse metabolite |
diiodotyrosine | [no description available] | low | 0 | 0 | diiodotyrosine; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite |
paraoxon | [no description available] | low | 0 | 0 | aryl dialkyl phosphate; organophosphate insecticide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; mouse metabolite |
aminoimidazole carboxamide | [no description available] | low | 0 | 0 | aminoimidazole; monocarboxylic acid amide | mouse metabolite |
methyl-4-tyramine | [no description available] | low | 0 | 0 | tyramines | mouse metabolite |
lithocholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; monohydroxy-5beta-cholanic acid | geroprotector; human metabolite; mouse metabolite |
chenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
fructose-1,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 1,6-bisphosphate | mouse metabolite |
androstenediol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid | androgen; human metabolite; mouse metabolite; radiation protective agent |
dihydrotestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 17beta-hydroxyandrostan-3-one; 3-oxo-5alpha-steroid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
hydroxyhydroquinone | [no description available] | low | 0 | 0 | benzenetriol | mouse metabolite |
18-hydroxycorticosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 18-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo steroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
1,2-dihydroxynaphthalene | [no description available] | low | 0 | 0 | naphthalenediol | mouse metabolite |
2-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; phenols | human metabolite; mouse metabolite |
propiolaldehyde | [no description available] | low | 0 | 0 | terminal acetylenic compound; ynal | mouse metabolite |
dehydroepiandrosterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite; mouse metabolite |
phenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
n-cyclohexylformamide | [no description available] | low | 0 | 0 | alicyclic compound; formamides | mouse metabolite |
cytidine diphosphate choline | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphocholines | human metabolite; mouse metabolite; neuroprotective agent; psychotropic drug; Saccharomyces cerevisiae metabolite |
dihydroferulic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid; phenylpropanoid | antioxidant; human xenobiotic metabolite; mouse metabolite; plant metabolite |
perillaldehyde | [no description available] | low | 0 | 0 | aldehyde; olefinic compound | human metabolite; mouse metabolite; volatile oil component |
uridine diphosphate galactose | [no description available] | low | 0 | 0 | UDP-D-galactose | mouse metabolite |
1-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite |
hydroiodic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
iron | [no description available] | low | 0 | 0 | divalent metal cation; iron cation; monoatomic dication | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
trichloroepoxyethane | [no description available] | low | 0 | 0 | epoxide | mouse metabolite |
ursodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
cyromazine | [no description available] | low | 0 | 0 | triamino-1,3,5-triazine | mouse metabolite; triazine insecticide |
glucose, (beta-d)-isomer | [no description available] | low | 0 | 0 | D-glucopyranose | epitope; mouse metabolite |
n-acetylaspartic acid | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N-acyl-L-aspartic acid | antioxidant; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
homocitrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; L-lysine derivative; non-proteinogenic L-alpha-amino acid; ureas | human metabolite; mouse metabolite |
obtusifoliol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol | mouse metabolite; plant metabolite |
lathosterol | [no description available] | low | 0 | 0 | 3beta-sterol; C27-steroid; cholestanoid; Delta(7)-sterol | human metabolite; mouse metabolite |
2-methoxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
cystine | [no description available] | low | 0 | 0 | cystine zwitterion; cystine; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetylglycine | [no description available] | low | 0 | 0 | monocarboxylic acid amide; monocarboxylic acid; N-acylglycine | human metabolite; mouse metabolite |
hordenine | [no description available] | low | 0 | 0 | phenethylamine alkaloid | human metabolite; mouse metabolite |
7-methylxanthine | [no description available] | low | 0 | 0 | oxopurine; purine alkaloid | human xenobiotic metabolite; mouse metabolite; plant metabolite |
glutaurine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; L-glutamine derivative; sulfonic acid | anticonvulsant; anxiolytic drug; hormone; human metabolite; mammalian metabolite; mouse metabolite |
n'-methyl-2-pyridone-5-carboxamide | [no description available] | low | 0 | 0 | methylpyridines; pyridinecarboxamide; pyridone | metabolite; mouse metabolite |
1-methyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
cyclopropylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | mouse metabolite |
5-hydroxymethylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol; nucleobase analogue; pyrimidone | human metabolite; mouse metabolite |
2,5-dihydroxybenzaldehyde | [no description available] | low | 0 | 0 | dihydroxybenzaldehyde | human metabolite; mouse metabolite; Penicillium metabolite |
6-hydroxynicotinic acid | [no description available] | low | 0 | 0 | monohydroxypyridine | Arabidopsis thaliana metabolite; human urinary metabolite; mouse metabolite |
2-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite; xenobiotic metabolite |
hydroxyindoleacetaldehyde | [no description available] | low | 0 | 0 | hydroxyindoles; indoleacetaldehyde | human metabolite; mouse metabolite |
xanthurenic acid 8-methyl ether | [no description available] | low | 0 | 0 | aromatic ether; monohydroxyquinoline; quinolinemonocarboxylic acid | carcinogenic agent; metabolite; mouse metabolite |
glucose | [no description available] | low | 0 | 0 | D-glucopyranose | mouse metabolite |
1,3,7-trimethylurate | [no description available] | low | 0 | 0 | oxopurine | human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; mouse metabolite |
1-methylxanthine | [no description available] | low | 0 | 0 | 1-methylxanthine | mouse metabolite |
3,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | metabolite; mouse metabolite |
biocytin | [no description available] | low | 0 | 0 | azabicycloalkane; L-alpha-amino acid zwitterion; L-lysine derivative; monocarboxylic acid amide; non-proteinogenic L-alpha-amino acid; thiabicycloalkane; ureas | mouse metabolite |
d-aspartic acid | [no description available] | low | 0 | 0 | aspartic acid; D-alpha-amino acid | mouse metabolite |
3,4-dihydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; catechols | antioxidant; drug metabolite; human metabolite; mouse metabolite |
17-alpha-hydroxypregnenolone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; hydroxypregnenolone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
mephentermine | [no description available] | low | 0 | 0 | 2-aminooctadecane-1,3-diol | EC 2.7.11.13 (protein kinase C) inhibitor; human metabolite; mouse metabolite |
3,4-dihydroxyphenylglycol | [no description available] | low | 0 | 0 | catechols; tetrol | metabolite; mouse metabolite |
1,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
24-methylenecholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol | mouse metabolite |
2,8-dihydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; diol; heteroaryl hydroxy compound; oxopurine | human urinary metabolite; mammalian metabolite; mouse metabolite; nephrotoxic agent |
5beta-pregnane-3,20-dione | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-5beta-steroid; C21-steroid | human metabolite; mouse metabolite |
zymosterol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
21-deoxycortisol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy-C21-steroid; deoxycortisol; tertiary alpha-hydroxy ketone | human blood serum metabolite; mouse metabolite |
5,6-dihydrothymine | [no description available] | low | 0 | 0 | pyrimidone | human metabolite; metabolite; mouse metabolite |
imidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | metabolite; mouse metabolite |
1-hydroxyphenanthrene | [no description available] | low | 0 | 0 | phenanthrol | mouse metabolite |
2,5-dihydroxypyridine | [no description available] | low | 0 | 0 | dihydroxypyridine | mouse metabolite |
cerium | [no description available] | low | 0 | 0 | cholesteryl ester | mouse metabolite |
zymostenol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite |
16-hydroxydehydroepiandrosterone | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid; secondary alpha-hydroxy ketone | human metabolite; mouse metabolite |
6,6-dimethyl-2-methylenebicyclo(3.1.1)heptan-3-ol | [no description available] | low | 0 | 0 | carbobicyclic compound; pinane monoterpenoid; secondary alcohol | GABA modulator; mouse metabolite; plant metabolite; volatile oil component |
hydrogen sulfite | [no description available] | low | 0 | 0 | sulfur oxoanion | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ecgonine methyl ester | [no description available] | low | 0 | 0 | methyl ester; tertiary amino compound; tropane alkaloid | analgesic; central nervous system depressant; metabolite; mouse metabolite; opioid analgesic; peripheral nervous system drug |
2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | low | 0 | 0 | hydroxylamine; imidazopyridine | carcinogenic agent; genotoxin; human xenobiotic metabolite; mouse metabolite; mutagen; neurotoxin; rat metabolite |
fructose 2,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 2,6-bisphosphate | human metabolite; mouse metabolite |
cholest-5-en-3 beta,7 alpha-diol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid; oxysterol | mouse metabolite |
hypotaurine | [no description available] | low | 0 | 0 | aminosulfinic acid; zwitterion | human metabolite; metabolite; mouse metabolite |
s-chloromethylglutathione | [no description available] | low | 0 | 0 | organochlorine compound; S-substituted glutathione | alkylating agent; bacterial xenobiotic metabolite; mouse metabolite |
5-acetylamino-6-formylamino-3-methyluracil | [no description available] | low | 0 | 0 | formamidopyrimidine | mouse metabolite |
anserine | [no description available] | low | 0 | 0 | beta-alanine derivative; dipeptide; zwitterion | animal metabolite; mouse metabolite |
5,6-dihydroxyindole | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
androsterone glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; metabolite; mouse metabolite |
estrone-3-glucuronide | [no description available] | low | 0 | 0 | 17-oxo steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
5,6-dihydroxy-2-indolylcarboxylic acid | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
inositol-3,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
(20s)-20-hydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | human metabolite; mouse metabolite |
24-hydroxycholesterol | [no description available] | low | 0 | 0 | 24-hydroxycholesterol | biomarker; human blood serum metabolite; mouse metabolite |
phytosphingosine | [no description available] | low | 0 | 0 | amino alcohol; sphingoid; triol | mouse metabolite; Saccharomyces cerevisiae metabolite |
n-acetylputrescine | [no description available] | low | 0 | 0 | N-monoacetylalkane-alpha,omega-diamine; N-substituted putrescine | metabolite; mouse metabolite |
cdp ethanolamine | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphoethanolamine | mouse metabolite |
7 alpha-hydroxy-4-cholesten-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; 7alpha-hydroxy steroid; cholestanoid | human metabolite; mouse metabolite |
27-hydroxycholesterol | [no description available] | low | 0 | 0 | 26-hydroxycholesterol | apoptosis inducer; human metabolite; mouse metabolite; neuroprotective agent |
dehydroalanine | [no description available] | low | 0 | 0 | 2,3-dehydroamino acid; alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion; enamine; non-proteinogenic alpha-amino acid | alkylating agent; human metabolite; mouse metabolite |
1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 30:0; tetradecanoate ester | mouse metabolite |
d-glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; D-alpha-amino acid; glutamine | mouse metabolite |
diquafosol | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-tetraphosphate; uridine 5'-phosphate | mouse metabolite; P2Y2 receptor agonist |
19-hydroxytestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 19-hydroxy steroid; 3-oxo-Delta(4) steroid | mouse metabolite |
2-hydroxy-1,4-benzoquinone | [no description available] | low | 0 | 0 | monohydroxy-1,4-benzoquinones | mouse metabolite |
3,4-dihydroxyphenylglycolaldehyde | [no description available] | low | 0 | 0 | catechols; hydroxyaldehyde | human metabolite; mouse metabolite; neurotoxin |
androsterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; androstanoid; steroid sulfate | human metabolite; mouse metabolite |
3,7,12-trihydroxycoprostane | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
saccharopine | [no description available] | low | 0 | 0 | amino acid opine; L-lysine derivative | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allysine | [no description available] | low | 0 | 0 | allysine; amino acid zwitterion; aminoadipate semialdehyde; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
beta-ureidoisobutyric acid | [no description available] | low | 0 | 0 | ureidocarboxylic acid | human metabolite; mouse metabolite |
kynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; kynurenine; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydromethylthionine | [no description available] | low | 0 | 0 | aromatic amine; phenothiazines; tertiary amino compound | bacterial xenobiotic metabolite; fluorochrome; mouse metabolite; rat metabolite |
5-hydroxykynuramine | [no description available] | low | 0 | 0 | hydroxykynurenamine; primary amino compound | mouse metabolite |
thiocysteine | [no description available] | low | 0 | 0 | amino acid zwitterion; S-substituted L-cysteine | human metabolite; mouse metabolite |
diadenosine triphosphate | [no description available] | low | 0 | 0 | diadenosyl triphosphate | mouse metabolite |
isovaleryl-coenzyme a | [no description available] | low | 0 | 0 | methylbutanoyl-CoA; short-chain fatty acyl-CoA | mouse metabolite |
4,4-dimethyl-5-alpha-cholesta-(8,24)-dien-3-beta-ol | [no description available] | low | 0 | 0 | 3beta-sterol | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
campesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C28-steroid; phytosterols | mouse metabolite |
cholestane-3,7,12,26-tetrol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 26-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
cholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
sitosterol, (3beta)-isomer | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C29-steroid; phytosterols; stigmastane sterol | anticholesteremic drug; antioxidant; mouse metabolite; plant metabolite; sterol methyltransferase inhibitor |
cortisone | [no description available] | low | 0 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
androstane-3,17-dione, (5alpha)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5alpha-steroid; androstane-3,17-dione | mouse metabolite |
cholesteryl palmitate | [no description available] | low | 0 | 0 | cholesteryl ester | human metabolite; mouse metabolite |
lanosterol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol; tetracyclic triterpenoid | bacterial metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
21-hydroxypregnenolone | [no description available] | low | 0 | 0 | 21-hydroxy steroid; hydroxypregnenolone; primary alpha-hydroxy ketone | mouse metabolite |
2-hydroxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 2-hydroxy steroid | carcinogenic agent; human metabolite; metabolite; mouse metabolite; prodrug |
epietiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; animal metabolite; human blood serum metabolite; mouse metabolite; rat metabolite |
5-hydroxyisourate | [no description available] | low | 0 | 0 | oxopurine | human metabolite; mouse metabolite |
19-hydroxy-4-androstene-3,17-dione | [no description available] | low | 0 | 0 | 17-oxo steroid; 19-hydroxy steroid; 3-oxo steroid; androstanoid | mouse metabolite |
taurochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid taurine conjugate | human metabolite; mouse metabolite |
glyceraldehyde 3-phosphate | [no description available] | low | 0 | 0 | glyceraldehyde 3-phosphate | mouse metabolite |
ribulose 5-phosphate | [no description available] | low | 0 | 0 | ribulose 5-phosphate | mouse metabolite |
isomaltose | [no description available] | low | 0 | 0 | glycosylglucose | human metabolite; metabolite; mouse metabolite |
n-acetylneuraminic acid | [no description available] | low | 0 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
carnosine | [no description available] | low | 0 | 0 | amino acid zwitterion; dipeptide | anticonvulsant; antineoplastic agent; antioxidant; Daphnia magna metabolite; geroprotector; human metabolite; mouse metabolite; neuroprotective agent |
raffinose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; trisaccharide | mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
5-hydroxytryptophan | [no description available] | low | 0 | 0 | 5-hydroxytryptophan; amino acid zwitterion; hydroxy-L-tryptophan; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; plant metabolite |
dopaquinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; amino acid zwitterion; L-phenylalanine derivative | human metabolite; mouse metabolite |
pantetheine | [no description available] | low | 0 | 0 | pantetheines; thiol | human metabolite; metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | epitope; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | mouse metabolite |
5-diphosphomevalonic acid | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | human metabolite; mouse metabolite |
7-dehydrocholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; Delta(5),Delta(7)-sterol | human metabolite; mouse metabolite |
stachyose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; tetrasaccharide | mouse metabolite; plant metabolite |
desmosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C27-steroid; cholestanoid | human metabolite; mouse metabolite |
monoiodotyrosine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-tyrosine derivative; monoiodotyrosine; non-proteinogenic L-alpha-amino acid | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; human metabolite; mouse metabolite |
n'-formylkynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-formylkynurenine; non-proteinogenic amino acid derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ketodihydrosphingosine | [no description available] | low | 0 | 0 | 2-amino-1-hydroxyoctadecan-3-one | mouse metabolite |
nicotinamide-beta-riboside | [no description available] | low | 0 | 0 | N-glycosylnicotinamide; pyridine nucleoside | geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
androstane-3,17-dione, (5beta)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5beta-steroid; androstane-3,17-dione | mouse metabolite |
trimethyllysine | [no description available] | low | 0 | 0 | alpha-amino-acid cation | human metabolite; mouse metabolite |
inositol 3,4-bisphosphate | [no description available] | low | 0 | 0 | myo-inositol bisphosphate | human metabolite; mouse metabolite |
24,25-dihydrolanosterol | [no description available] | low | 0 | 0 | 3beta-sterol; tetracyclic triterpenoid | human metabolite; mouse metabolite |
2-methoxyestrone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-hydroxy steroid; alicyclic ketone; aromatic ether; phenolic steroid; phenols | human metabolite; mouse metabolite |
dehydroascorbic acid | [no description available] | low | 0 | 0 | dehydroascorbic acid; vitamin C | coenzyme; mouse metabolite |
cortodoxone | [no description available] | low | 0 | 0 | deoxycortisol; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
estradiol-3-glucuronide | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
beta-sulfopyruvic acid | [no description available] | low | 0 | 0 | carboxyalkanesulfonic acid | mouse metabolite |
acetyl adenylate | [no description available] | low | 0 | 0 | 5'-acylphosphoadenosin | human metabolite; mouse metabolite |
2-hydroxypropylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; secondary alcohol | mouse metabolite |
4,4-dimethylcholesta-8,14,24-trienol | [no description available] | low | 0 | 0 | 3beta-sterol; Delta(14) steroid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inositol-1,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
maleic acid | [no description available] | low | 0 | 0 | butenedioic acid | algal metabolite; mouse metabolite; plant metabolite |
arachidonic acid | [no description available] | low | 0 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
prostaglandin h2 | [no description available] | low | 0 | 0 | olefinic compound; oxylipin; prostaglandins H; secondary alcohol | mouse metabolite |
3-hydroxy-3-methylglutaryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxy-3-methylglutaryl-CoA; 3-hydroxy fatty acyl-CoA | human metabolite; mouse metabolite |
docosahexaenoate | [no description available] | low | 0 | 0 | docosahexaenoic acid; omega-3 fatty acid | algal metabolite; antineoplastic agent; Daphnia tenebrosa metabolite; human metabolite; mouse metabolite; nutraceutical |
cocaine | [no description available] | low | 0 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
eicosapentaenoic acid | [no description available] | low | 0 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
geranylgeranyl pyrophosphate | [no description available] | low | 0 | 0 | geranylgeranyl diphosphate | mouse metabolite |
cytidine monophosphate n-acetylneuraminic acid | [no description available] | low | 0 | 0 | CMP-N-acyl-beta-neuraminic acid | mouse metabolite |
prostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins D | human metabolite; mouse metabolite |
colfosceril palmitate | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:0 | mouse metabolite; surfactant |
lyso-pc | [no description available] | low | 0 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine; lysophosphatidylcholine 16:0 | mouse metabolite |
trans-4-coumaric acid | [no description available] | low | 0 | 0 | 4-coumaric acid | food component; mouse metabolite; plant metabolite |
squalene | [no description available] | low | 0 | 0 | triterpene | human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
flavin mononucleotide | [no description available] | low | 0 | 0 | flavin mononucleotide; vitamin B2 | bacterial metabolite; coenzyme; cofactor; human metabolite; mouse metabolite |
3-hydroxybutyryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxyacyl-CoA; hydroxybutanoyl-CoA | mouse metabolite |
dihydrosphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite |
caffeic acid | [no description available] | low | 0 | 0 | caffeic acid | geroprotector; mouse metabolite |
coniferyl alcohol | [no description available] | low | 0 | 0 | guaiacols; phenylpropanoid | animal metabolite; monolignol; mouse metabolite; pheromone; plant metabolite; volatile oil component |
estrone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | human metabolite; mouse metabolite |
raphanusamic acid | [no description available] | low | 0 | 0 | thiazolidinemonocarboxylic acid | Arabidopsis thaliana metabolite; mouse metabolite; xenobiotic metabolite |
isobutyryl-coenzyme a | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-CoA; short-chain fatty acyl-CoA | human metabolite; mouse metabolite |
dihydroxycoprostane | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
glutaryl-coenzyme a | [no description available] | low | 0 | 0 | glutaryl-CoAs | mouse metabolite |
sphingosine | [no description available] | low | 0 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
bilirubin | [no description available] | low | 0 | 0 | biladienes; dicarboxylic acid | antioxidant; human metabolite; mouse metabolite |
dinoprostone | [no description available] | low | 0 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
dinoprost | [no description available] | low | 0 | 0 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
leukotriene a4 | [no description available] | low | 0 | 0 | epoxy fatty acid; leukotriene; long-chain fatty acid; oxylipin; polyunsaturated fatty acid | human metabolite; mouse metabolite; plant metabolite |
calcitriol | [no description available] | low | 0 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
11-cis-retinal | [no description available] | low | 0 | 0 | retinal | chromophore; human metabolite; mouse metabolite |
leukotriene b4 | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; hydroxy polyunsaturated fatty acid; leukotriene; long-chain fatty acid | human metabolite; mouse metabolite; plant metabolite; vasoconstrictor agent |
leukotriene c4 | [no description available] | low | 0 | 0 | leukotriene | bronchoconstrictor agent; human metabolite; mouse metabolite |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,11Z,13E)-15-HETE | human metabolite; mouse metabolite |
5-hydroxy-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE | human metabolite; mouse metabolite |
arachidonic acid 5-hydroperoxide | [no description available] | low | 0 | 0 | 5-HPETE | mouse metabolite |
leukotriene d4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin g2 | [no description available] | low | 0 | 0 | prostaglandins G | human metabolite; mouse metabolite |
6-ketoprostaglandin f1 alpha | [no description available] | low | 0 | 0 | prostaglandins Falpha | human metabolite; mouse metabolite |
arachidonic acid omega-9 hydroperoxide | [no description available] | low | 0 | 0 | HPETE | mouse metabolite |
15-hydroperoxy-5,8,11,13-eicosatetraenoic acid, (s)-(e,z,z,z)-isomer | [no description available] | low | 0 | 0 | 15-HPETE | mouse metabolite |
gamma-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-6 fatty acid | human metabolite; mouse metabolite; plant metabolite |
alpha-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-3 fatty acid | micronutrient; mouse metabolite; nutraceutical |
1-palmitoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-palmitoyl-2-oleoylglycerol | mouse metabolite |
epoprostenol | [no description available] | low | 0 | 0 | prostaglandins I | mouse metabolite |
9-hydroxy-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | HODE; octadecadienoic acid | human metabolite; metabolite; mouse metabolite; plant metabolite |
thromboxane b2 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
thromboxane b3 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
11,12-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET | mouse metabolite |
14,15-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET; diol; secondary allylic alcohol | mouse metabolite |
20-hydroxy-5,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE; hydroxy monocarboxylic acid | human metabolite; mouse metabolite |
5-oxo-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite; immunomodulator; mouse metabolite |
5,6-epoxy-8,11,14-eicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
8,9-epoxyeicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
1-palmitoyl-2-oleoylphosphatidylethanolamine, (z & r)-isomer | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphoethanolamine; phosphatidylethanolamine 34:1 zwitterion; phosphatidylethanolamine | mouse metabolite |
sphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
cholesteryl oleate | [no description available] | low | 0 | 0 | CE(18:1); cholesteryl octadec-9-enoate | mouse metabolite |
calcifediol | [no description available] | low | 0 | 0 | D3 vitamins; diol; hydroxycalciol | bone density conservation agent; human metabolite; metabolite; mouse metabolite; nutraceutical |
hyodeoxycholic acid | [no description available] | low | 0 | 0 | 5beta-cholanic acids; 6alpha,20xi-murideoxycholic acid; bile acid; C24-steroid | human metabolite; mouse metabolite |
cerium | [no description available] | low | 0 | 0 | CE(18:2); cholesteryl octadeca-9,12-dienoate | human metabolite; mouse metabolite |
11-dehydrocorticosterone | [no description available] | low | 0 | 0 | 11-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
stearidonic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; octadecatetraenoic acid; omega-3 fatty acid | Daphnia galeata metabolite; mouse metabolite; plant metabolite |
trilinolein | [no description available] | low | 0 | 0 | 1,2-diacyl-3-linoleoylglycerol; 1,3-diacyl-2-linoleoylglycerol; linoleoyl containing 1,2,3-triacyl-sn-glycerol; TG(18:2/18:2/18:2); triglyceride | mouse metabolite |
dimyristoylphosphatidylcholine | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine; phosphatidylcholine 28:0; tetradecanoate ester | antigen; mouse metabolite |
2,3-oxidosqualene | [no description available] | low | 0 | 0 | 2,3-epoxysqualene | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyribose | [no description available] | low | 0 | 0 | deoxypentose | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
monodehydroascorbate | [no description available] | low | 0 | 0 | organic radical | mouse metabolite |
vitamin a2 | [no description available] | low | 0 | 0 | retinoid; vitamin A | human xenobiotic metabolite; marine xenobiotic metabolite; mouse metabolite |
1,2-dioleoylphosphatidylserine | [no description available] | low | 0 | 0 | phosphatidylserine(18:1/18:1) | mouse metabolite |
5-hydroxy-6,8,11,14,17-eicosapentaenoic acid | [no description available] | low | 0 | 0 | HEPE | mouse metabolite |
1-stearoyl-2-linoleoylphosphatidylcholine | [no description available] | low | 0 | 0 | phosphatidylcholine 36:2 | mouse metabolite |
1-stearoyl-2-linoleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; diacylglycerol 36:2 | mouse metabolite |
1-palmitoyl-2-docosahexaenoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | phosphatidylcholine 38:6 | mouse metabolite |
13(S)-HODE | [no description available] | low | 0 | 0 | HODE | antineoplastic agent; human xenobiotic metabolite; mouse metabolite |
1-stearoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-stearoyl-2-oleoylglycerol; diacylglycerol 36:1 | mouse metabolite |
1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-palmitoleoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:1 | mouse metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid | metabolite; mouse metabolite |
n-stearoylsphingomyelin | [no description available] | low | 0 | 0 | sphingomyelin 36:1; sphingomyelin d18:1 | mouse metabolite |
20,22-dihydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 22-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; oxysterol | human metabolite; mouse metabolite |
cholesteryl arachidonate | [no description available] | low | 0 | 0 | cholesteryl icosatetraenoate | antibacterial agent; mouse metabolite |
acryloyl-coenzyme a | [no description available] | low | 0 | 0 | 2-enoyl-CoA; monounsaturated fatty acyl-CoA | mouse metabolite |
samarium | [no description available] | low | 0 | 0 | sphingomyelin d18:1/16:0 | mouse metabolite |
n-palmitoylgalactosylsphingosine | [no description available] | low | 0 | 0 | HexCer(d18:1/16:0); N-acyl-beta-D-galactosylsphingosine | mouse metabolite |
palmitoylcarnitine | [no description available] | low | 0 | 0 | O-palmitoylcarnitine; saturated fatty acyl-L-carnitine | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; human metabolite; mouse metabolite |
prosomatostatin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone | fungal metabolite; mouse metabolite; rat metabolite |
phosphatidylcholines | [no description available] | low | 0 | 0 | phosphatidylcholine 40:6 | mouse metabolite |
2-ketoarginine | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
cyclosporine | [no description available] | low | 0 | 0 | keto-disaccharide | mouse metabolite |
g(m3) ganglioside | [no description available] | low | 0 | 0 | alpha-N-acetylneuraminyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-ceramide; sialodiosylceramide; sialotriaosylceramide | mouse metabolite |
dyspropterin | [no description available] | low | 0 | 0 | biopterins; tetrahydropterin | human metabolite; metabolite; mouse metabolite |