Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
oxybenzone | [no description available] | medium | 1 | 1 | hydroxybenzophenone; monomethoxybenzene | dermatologic drug; environmental contaminant; protective agent; ultraviolet filter; xenobiotic |
octocrylene | [no description available] | medium | 2 | 1 | diarylmethane | |
avobenzone | [no description available] | medium | 6 | 3 | dihydrochalcones | |
bemotrizinol | [no description available] | medium | 2 | 0 | methoxybenzenes | |
triazoles | [no description available] | medium | 2 | 0 | 1,2,3-triazole | |
pyrimidine dimers | [no description available] | medium | 1 | 0 | | |
titanium | [no description available] | medium | 2 | 1 | titanium group element atom | |
2,2',4,4'-tetrahydroxybenzophenone | [no description available] | medium | 1 | 0 | | |
titanium dioxide | [no description available] | medium | 2 | 1 | titanium oxides | food colouring |
4-aminobenzoic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
oxalates | [no description available] | medium | 1 | 0 | | |
avobenzone, ecamsule, octocrilene drug combination | [no description available] | medium | 2 | 0 | | |
camphor, (+-)-isomer | [no description available] | medium | 11 | 2 | bornane monoterpenoid; cyclic monoterpene ketone | plant metabolite |
drometrizole | [no description available] | medium | 1 | 0 | triazoles | |
2-nitro-4-phenylenediamine | [no description available] | medium | 1 | 0 | C-nitro compound; primary amino compound | |
caffeine | [no description available] | medium | 1 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
sulisobenzone | [no description available] | medium | 1 | 0 | benzophenones | |
ensulizole | [no description available] | medium | 1 | 0 | benzimidazoles | |
disodium phenyl dibenzimidazole tetrasulfonate | [no description available] | medium | 1 | 0 | | |
urocanic acid | [no description available] | medium | 1 | 1 | urocanic acid | human metabolite |
octylmethoxycinnamate | [no description available] | medium | 3 | 2 | cinnamate ester | |
enzacamene | [no description available] | medium | 1 | 1 | | |
beta-thujaplicin | [no description available] | low | 0 | 0 | cyclic ketone; enol; monoterpenoid | antibacterial agent; antifungal agent; antineoplastic agent; antiplasmodial drug; plant metabolite |
moxisylyte | [no description available] | low | 0 | 0 | monoterpenoid | |
cantharidin | [no description available] | low | 0 | 0 | cyclic dicarboxylic anhydride; monoterpenoid | EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; herbicide |
linalool | [no description available] | low | 0 | 0 | monoterpenoid; tertiary alcohol | antimicrobial agent; fragrance; plant metabolite; volatile oil component |
thymol | [no description available] | low | 0 | 0 | monoterpenoid; phenols | volatile oil component |
citronellal | [no description available] | low | 0 | 0 | aldehyde; monoterpenoid | antifungal agent; metabolite |
linalyl acetate | [no description available] | low | 0 | 0 | acetate ester; monoterpenoid | |
menthyl anthranilate | [no description available] | low | 0 | 0 | monoterpenoid | |
citronellol | [no description available] | low | 0 | 0 | monoterpenoid | plant metabolite |
citronellyl acetate | [no description available] | low | 0 | 0 | acetate ester; monoterpenoid | plant metabolite |
beta-cyclocitral | [no description available] | low | 0 | 0 | monoterpenoid | bacterial metabolite |
citronellic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; monoterpenoid; monounsaturated fatty acid | flavouring agent; plant metabolite |
2-thymotic acid | [no description available] | low | 0 | 0 | monoterpenoid | |
Mecamylamine hydrochloride | [no description available] | low | 0 | 0 | monoterpenoid | |
moxisylyte hydrochloride | [no description available] | low | 0 | 0 | monoterpenoid | |
fencamfamine | [no description available] | low | 0 | 0 | monoterpenoid | |
bornaprine | [no description available] | low | 0 | 0 | monoterpenoid | |
nopinone | [no description available] | low | 0 | 0 | monoterpenoid | |
pinaverium | [no description available] | low | 0 | 0 | monoterpenoid | |
butibufen | [no description available] | low | 0 | 0 | monoterpenoid | |
safranal | [no description available] | low | 0 | 0 | monoterpenoid | |
verbenol | [no description available] | low | 0 | 0 | monoterpenoid | |
perillene | [no description available] | low | 0 | 0 | furans; monoterpenoid | fragrance; metabolite; semiochemical |
clotiazepam | [no description available] | low | 0 | 0 | monoterpenoid | |
carvacryl acetate | [no description available] | low | 0 | 0 | monoterpenoid | |
abnormal cannabidiol | [no description available] | low | 0 | 0 | monoterpenoid | |
isohumulone | [no description available] | low | 0 | 0 | monoterpenoid | |
chrysanthemol | [no description available] | low | 0 | 0 | cyclopropanes; homoallylic alcohol; monoterpenoid; primary alcohol | |
2-aminobicyclo(2,2,1)heptane-2-carboxylic acid | [no description available] | low | 0 | 0 | monoterpenoid | |
6-bromo-3-(bromomethyl)-7-methyl-2,3,7-trichloro-1-octene | [no description available] | low | 0 | 0 | monoterpenoid; organobromine compound; organochlorine compound | algal metabolite; antineoplastic agent; marine metabolite |
avasimibe | [no description available] | low | 0 | 0 | monoterpenoid | |
menthofuran | [no description available] | low | 0 | 0 | 1-benzofurans; monoterpenoid | nematicide; plant metabolite |
chrysanthenone | [no description available] | low | 0 | 0 | monoterpenoid | |
geraniol | [no description available] | low | 0 | 0 | 3,7-dimethylocta-2,6-dien-1-ol; monoterpenoid; primary alcohol | allergen; fragrance; plant metabolite; volatile oil component |
citral | [no description available] | low | 0 | 0 | enal; monoterpenoid; polyprenal | plant metabolite; volatile oil component |
LSM-32392 | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-4-methoxybenzenesulfonamide | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)benzenesulfonamide | [no description available] | low | 0 | 0 | monoterpenoid | |
2-(3-cyano-4,5,6-trimethyl-1H-pyridin-2-ylidene)propanedinitrile | [no description available] | low | 0 | 0 | monoterpenoid | |
4-propan-2-yl-N-(3-pyridinyl)benzamide | [no description available] | low | 0 | 0 | monoterpenoid | |
geranyl acetate | [no description available] | low | 0 | 0 | acetate ester; monoterpenoid | plant metabolite |
aurapten | [no description available] | low | 0 | 0 | coumarins; monoterpenoid | antihypertensive agent; antineoplastic agent; antioxidant; apoptosis inducer; dopaminergic agent; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor; gamma-secretase modulator; gastrointestinal drug; hepatoprotective agent; matrix metalloproteinase inhibitor; neuroprotective agent; plant metabolite; PPARalpha agonist; vulnerary |
4-propan-2-ylbenzenecarbothioamide | [no description available] | low | 0 | 0 | monoterpenoid | |
2-[4-(2-methylpropyl)phenyl]propanoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester | [no description available] | low | 0 | 0 | monoterpenoid | |
N'-[3-bicyclo[2.2.1]heptanyl(oxo)methyl]-3-chloro-1-benzothiophene-2-carbohydrazide | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(4-propan-2-ylphenyl)-3-bicyclo[2.2.1]heptanecarboxamide | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(5-bromo-2-pyridinyl)-2,2-dimethyl-3-(2-methylprop-1-enyl)-1-cyclopropanecarboxamide | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(3-bicyclo[2.2.1]heptanyl)-3-bromo-4-methoxybenzenesulfonamide | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(3-bicyclo[2.2.1]heptanyl)-4-chlorobenzenesulfonamide | [no description available] | low | 0 | 0 | monoterpenoid | |
1,7,7-trimethyl-4-[(2-methyl-2,3-dihydroindol-1-yl)-oxomethyl]-2-bicyclo[2.2.1]heptanone | [no description available] | low | 0 | 0 | monoterpenoid | |
1,7,7-trimethyl-N,N-bis(2-methylpropyl)-2-oxo-4-bicyclo[2.2.1]heptanecarboxamide | [no description available] | low | 0 | 0 | monoterpenoid | |
3-(2-furanyl)-3-(4-methylphenyl)-1-(4-morpholinyl)-1-propanone | [no description available] | low | 0 | 0 | monoterpenoid | |
1-[(6,6-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)methoxy]-3-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-propanol | [no description available] | low | 0 | 0 | monoterpenoid | |
N-(2,4,6-trimethylphenyl)-3-bicyclo[2.2.1]heptanecarboxamide | [no description available] | low | 0 | 0 | monoterpenoid | |
2-[2-methoxyethyl-(1-oxo-2-thiophen-2-ylethyl)amino]-N-[(4-methoxyphenyl)methyl]-2-(4-propan-2-ylphenyl)acetamide | [no description available] | low | 0 | 0 | monoterpenoid | |
LSM-18934 | [no description available] | low | 0 | 0 | monoterpenoid | |
LSM-16579 | [no description available] | low | 0 | 0 | monoterpenoid | |
1,7,7-trimethyl-N'-(4-nitrophenyl)-2-oxo-4-bicyclo[2.2.1]heptanecarbohydrazide | [no description available] | low | 0 | 0 | monoterpenoid | |
LSM-16386 | [no description available] | low | 0 | 0 | monoterpenoid | |
metoxibutropate | [no description available] | low | 0 | 0 | monoterpenoid | |
LSM-1646 | [no description available] | low | 0 | 0 | monoterpenoid | |
decaprenoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; methyl-branched fatty acid; monoterpenoid; polyunsaturated fatty acid | antifungal agent; EC 1.14.18.1 (tyrosinase) inhibitor; melanin synthesis inhibitor; pheromone; plant metabolite |
sm 10902 | [no description available] | low | 0 | 0 | monoterpenoid | |
cicaprost | [no description available] | low | 0 | 0 | monoterpenoid | |
s 145 | [no description available] | low | 0 | 0 | monoterpenoid | |
decaprenoic acid | [no description available] | low | 0 | 0 | monoterpenoid | |
gsk 4716 | [no description available] | low | 0 | 0 | monoterpenoid | |
8-hydroxygeraniol | [no description available] | low | 0 | 0 | diol; monoterpenoid; prenols | |
pinocamphone | [no description available] | low | 0 | 0 | monoterpenoid | |
bornyl acetate | [no description available] | low | 0 | 0 | acetate ester; monoterpenoid | |
reparixin | [no description available] | low | 0 | 0 | monoterpenoid | |
cannabidivarin | [no description available] | low | 0 | 0 | monoterpenoid | |
myrigalone a | [no description available] | low | 0 | 0 | monoterpenoid | |
N-[(4S)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]benzamide | [no description available] | low | 0 | 0 | monoterpenoid | |
ro 6-4563 | [no description available] | low | 0 | 0 | monoterpenoid | |
hericenone c | [no description available] | low | 0 | 0 | monoterpenoid | |
1-[1-(4-butan-2-ylphenyl)ethyl]-3-[(4-fluorophenyl)methyl]thiourea | [no description available] | low | 0 | 0 | monoterpenoid | |
1-[(4-fluorophenyl)methyl]-3-[1-(4-propan-2-ylphenyl)propyl]thiourea | [no description available] | low | 0 | 0 | monoterpenoid | |
[[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-phenylphosphoryl]benzene | [no description available] | low | 0 | 0 | monoterpenoid | |
(2R)-N2-[2-(4-bicyclo[2.2.1]heptanyl)ethyl]-N1-[(2R,3R)-3-methyl-1-(methylamino)pentan-2-yl]hexane-1,2-diamine | [no description available] | low | 0 | 0 | monoterpenoid | |
paeoniflorigenone | [no description available] | low | 0 | 0 | alicyclic ketone; benzoate ester; bridged compound; cyclic acetal; lactol; monoterpenoid | neuromuscular agent; plant metabolite |
myrtecaine | [no description available] | low | 0 | 0 | monoterpenoid | |
aurintricarboxylic acid | [no description available] | medium | 5 | 0 | monohydroxybenzoic acid; quinomethanes; tricarboxylic acid | fluorochrome; histological dye; insulin-like growth factor receptor 1 antagonist |
cycloheximide | [no description available] | high | 27 | 0 | antibiotic fungicide; cyclic ketone; dicarboximide; piperidine antibiotic; piperidones; secondary alcohol | anticoronaviral agent; bacterial metabolite; ferroptosis inhibitor; neuroprotective agent; protein synthesis inhibitor |
ra vii | [no description available] | medium | 1 | 0 | | |
jasplakinolide | [no description available] | medium | 1 | 0 | cyclodepsipeptide; phenols | actin polymerisation inducer; animal metabolite; antifungal agent; antineoplastic agent; apoptosis inducer; marine metabolite; neuroprotective agent |
eledoisin | [no description available] | medium | 1 | 0 | peptide | |
salicylic acid | [no description available] | medium | 8 | 0 | monohydroxybenzoic acid | algal metabolite; antifungal agent; antiinfective agent; EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor; keratolytic drug; plant hormone; plant metabolite |
bupropion | [no description available] | medium | 3 | 0 | aromatic ketone; monochlorobenzenes; secondary amino compound | antidepressant; environmental contaminant; xenobiotic |
phenytoin | [no description available] | medium | 3 | 0 | imidazolidine-2,4-dione | anticonvulsant; drug allergen; sodium channel blocker; teratogenic agent |
acebutolol | [no description available] | medium | 2 | 0 | aromatic amide; ethanolamines; ether; monocarboxylic acid amide; propanolamine; secondary amino compound | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympathomimetic agent |
acetaminophen | [no description available] | medium | 5 | 0 | acetamides; phenols | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; cyclooxygenase 3 inhibitor; environmental contaminant; ferroptosis inducer; geroprotector; hepatotoxic agent; human blood serum metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
alprenolol | [no description available] | medium | 3 | 0 | secondary alcohol; secondary amino compound | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
antipyrine | [no description available] | medium | 5 | 0 | pyrazolone | antipyretic; cyclooxygenase 3 inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
antipyrine | [no description available] | medium | 5 | 1 | pyrazolone | antipyretic; cyclooxygenase 3 inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
aspirin | [no description available] | medium | 6 | 0 | benzoic acids; phenyl acetates; salicylates | anticoagulant; antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; EC 1.1.1.188 (prostaglandin-F synthase) inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; plant activator; platelet aggregation inhibitor; prostaglandin antagonist; teratogenic agent |
atenolol | [no description available] | medium | 3 | 0 | ethanolamines; monocarboxylic acid amide; propanolamine | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; sympatholytic agent; xenobiotic |
bumetanide | [no description available] | medium | 4 | 0 | amino acid; benzoic acids; sulfonamide | diuretic; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor |
caffeine | [no description available] | medium | 5 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
verapamil | [no description available] | medium | 8 | 0 | aromatic ether; nitrile; polyether; tertiary amino compound | |
carbamazepine | [no description available] | medium | 5 | 0 | dibenzoazepine; ureas | analgesic; anticonvulsant; antimanic drug; drug allergen; EC 3.5.1.98 (histone deacetylase) inhibitor; environmental contaminant; glutamate transporter activator; mitogen; non-narcotic analgesic; sodium channel blocker; xenobiotic |
chlorpromazine | [no description available] | medium | 7 | 0 | organochlorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; phenothiazine antipsychotic drug |
chlorpropamide | [no description available] | medium | 5 | 0 | monochlorobenzenes; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
cimetidine | [no description available] | medium | 5 | 0 | aliphatic sulfide; guanidines; imidazoles; nitrile | adjuvant; analgesic; anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
ciprofloxacin | [no description available] | medium | 49 | 0 | aminoquinoline; cyclopropanes; fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone; zwitterion | antibacterial drug; antiinfective agent; antimicrobial agent; DNA synthesis inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; environmental contaminant; topoisomerase IV inhibitor; xenobiotic |
clofibrate | [no description available] | medium | 5 | 0 | aromatic ether; ethyl ester; monochlorobenzenes | anticholesteremic drug; antilipemic drug; geroprotector; PPARalpha agonist |
clonidine | [no description available] | medium | 2 | 0 | clonidine; imidazoline | |
clotrimazole | [no description available] | medium | 6 | 0 | conazole antifungal drug; imidazole antifungal drug; imidazoles; monochlorobenzenes | antiinfective agent; environmental contaminant; xenobiotic |
cromolyn | [no description available] | medium | 2 | 0 | chromones; dicarboxylic acid | anti-asthmatic drug; calcium channel blocker |
desipramine | [no description available] | medium | 4 | 0 | dibenzoazepine; secondary amino compound | adrenergic uptake inhibitor; alpha-adrenergic antagonist; antidepressant; cholinergic antagonist; drug allergen; EC 3.1.4.12 (sphingomyelin phosphodiesterase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; serotonin uptake inhibitor |
droperidol | [no description available] | medium | 2 | 0 | aromatic ketone; benzimidazoles; organofluorine compound | anaesthesia adjuvant; antiemetic; dopaminergic antagonist; first generation antipsychotic |
ebselen | [no description available] | medium | 1 | 0 | benzoselenazole | anti-inflammatory drug; antibacterial agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antioxidant; apoptosis inducer; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; EC 3.1.3.25 (inositol-phosphate phosphatase) inhibitor; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; EC 3.5.4.1 (cytosine deaminase) inhibitor; EC 5.1.3.2 (UDP-glucose 4-epimerase) inhibitor; enzyme mimic; ferroptosis inhibitor; genotoxin; hepatoprotective agent; neuroprotective agent; radical scavenger |
flucytosine | [no description available] | medium | 3 | 0 | aminopyrimidine; nucleoside analogue; organofluorine compound; pyrimidine antifungal drug; pyrimidone | prodrug |
furosemide | [no description available] | medium | 7 | 0 | chlorobenzoic acid; furans; sulfonamide | environmental contaminant; loop diuretic; xenobiotic |
glyburide | [no description available] | medium | 7 | 0 | monochlorobenzenes; N-sulfonylurea | anti-arrhythmia drug; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor; hypoglycemic agent |
hydrochlorothiazide | [no description available] | medium | 4 | 0 | benzothiadiazine; organochlorine compound; sulfonamide | antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
lidocaine | [no description available] | medium | 6 | 0 | benzenes; monocarboxylic acid amide; tertiary amino compound | anti-arrhythmia drug; drug allergen; environmental contaminant; local anaesthetic; xenobiotic |
imipramine | [no description available] | medium | 5 | 0 | dibenzoazepine | adrenergic uptake inhibitor; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
indomethacin | [no description available] | medium | 5 | 0 | aromatic ether; indole-3-acetic acids; monochlorobenzenes; N-acylindole | analgesic; drug metabolite; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; gout suppressant; non-steroidal anti-inflammatory drug; xenobiotic metabolite; xenobiotic |
itraconazole | [no description available] | medium | 5 | 0 | piperazines | |
ketoconazole | [no description available] | medium | 16 | 0 | dichlorobenzene; dioxolane; ether; imidazoles; N-acylpiperazine; N-arylpiperazine | |
ketoconazole | [no description available] | medium | 16 | 1 | dichlorobenzene; dioxolane; ether; imidazoles; N-acylpiperazine; N-arylpiperazine | |
ketoprofen | [no description available] | medium | 3 | 0 | benzophenones; oxo monocarboxylic acid | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
labetalol | [no description available] | medium | 3 | 0 | benzamides; benzenes; phenols; primary carboxamide; salicylamides; secondary alcohol; secondary amino compound | |
lamotrigine | [no description available] | medium | 3 | 0 | 1,2,4-triazines; dichlorobenzene; primary arylamine | anticonvulsant; antidepressant; antimanic drug; calcium channel blocker; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; excitatory amino acid antagonist; geroprotector; non-narcotic analgesic; xenobiotic |
metoprolol | [no description available] | medium | 5 | 0 | aromatic ether; propanolamine; secondary alcohol; secondary amino compound | antihypertensive agent; beta-adrenergic antagonist; environmental contaminant; geroprotector; xenobiotic |
norfloxacin | [no description available] | medium | 10 | 0 | fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antibacterial drug; DNA synthesis inhibitor; environmental contaminant; xenobiotic |
ondansetron | [no description available] | medium | 4 | 0 | carbazoles | |
oxprenolol | [no description available] | medium | 2 | 0 | aromatic ether | |
oxyphenbutazone | [no description available] | medium | 2 | 0 | phenols; pyrazolidines | antimicrobial agent; antineoplastic agent; antipyretic; drug metabolite; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic metabolite |
phenylbutazone | [no description available] | medium | 3 | 0 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
pindolol | [no description available] | medium | 3 | 0 | indoles; secondary amine | antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist; serotonergic antagonist; vasodilator agent |
prazosin | [no description available] | medium | 5 | 0 | aromatic ether; furans; monocarboxylic acid amide; piperazines; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor |
procaine | [no description available] | medium | 2 | 0 | benzoate ester; substituted aniline; tertiary amino compound | central nervous system depressant; drug allergen; local anaesthetic; peripheral nervous system drug |
promazine | [no description available] | medium | 1 | 0 | phenothiazines; tertiary amine | antiemetic; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; muscarinic antagonist; phenothiazine antipsychotic drug; serotonergic antagonist |
propranolol | [no description available] | medium | 10 | 0 | naphthalenes; propanolamine; secondary amine | anti-arrhythmia drug; antihypertensive agent; anxiolytic drug; beta-adrenergic antagonist; environmental contaminant; human blood serum metabolite; vasodilator agent; xenobiotic |
ranitidine | [no description available] | medium | 5 | 0 | aralkylamine | |
sotalol | [no description available] | medium | 5 | 0 | ethanolamines; secondary alcohol; secondary amino compound; sulfonamide | anti-arrhythmia drug; beta-adrenergic antagonist; environmental contaminant; xenobiotic |
sulfaphenazole | [no description available] | medium | 2 | 0 | primary amino compound; pyrazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial drug; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 1.14.13.67 (quinine 3-monooxygenase) inhibitor; P450 inhibitor |
sulfasalazine | [no description available] | medium | 7 | 0 | | |
sumatriptan | [no description available] | medium | 3 | 0 | sulfonamide; tryptamines | serotonergic agonist; vasoconstrictor agent |
terazosin | [no description available] | medium | 3 | 0 | furans; piperazines; primary amino compound; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; antineoplastic agent |
tetracaine | [no description available] | medium | 2 | 0 | benzoate ester; tertiary amino compound | local anaesthetic |
tolazamide | [no description available] | medium | 2 | 0 | N-sulfonylurea | hypoglycemic agent; potassium channel blocker |
tolbutamide | [no description available] | medium | 5 | 0 | N-sulfonylurea | human metabolite; hypoglycemic agent; insulin secretagogue; potassium channel blocker |
triflupromazine | [no description available] | medium | 2 | 0 | organofluorine compound; phenothiazines; tertiary amine | anticoronaviral agent; antiemetic; dopaminergic antagonist; first generation antipsychotic |
trimethoprim | [no description available] | medium | 36 | 0 | aminopyrimidine; methoxybenzenes | antibacterial drug; diuretic; drug allergen; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; environmental contaminant; xenobiotic |
trimethoprim | [no description available] | medium | 36 | 1 | aminopyrimidine; methoxybenzenes | antibacterial drug; diuretic; drug allergen; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; environmental contaminant; xenobiotic |
prednisolone | [no description available] | medium | 25 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
prednisolone | [no description available] | medium | 25 | 2 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; drug metabolite; environmental contaminant; immunosuppressive agent; xenobiotic |
chloramphenicol | [no description available] | high | 129 | 7 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
chloramphenicol | [no description available] | high | 129 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
tryptophan | [no description available] | high | 5 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
methylprednisolone | [no description available] | medium | 6 | 0 | 6-methylprednisolone; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antiemetic; environmental contaminant; neuroprotective agent; xenobiotic |
penicillin v | [no description available] | medium | 7 | 0 | penicillin allergen; penicillin | |
camptothecin | [no description available] | medium | 4 | 0 | delta-lactone; pyranoindolizinoquinoline; quinoline alkaloid; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; genotoxin; plant metabolite |
cephalexin | [no description available] | medium | 5 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
amoxicillin | [no description available] | medium | 18 | 0 | penicillin allergen; penicillin | antibacterial drug |
amoxicillin | [no description available] | medium | 18 | 1 | penicillin allergen; penicillin | antibacterial drug |
timolol | [no description available] | medium | 5 | 0 | timolol | anti-arrhythmia drug; antiglaucoma drug; antihypertensive agent; beta-adrenergic antagonist |
zidovudine | [no description available] | medium | 8 | 0 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
zidovudine | [no description available] | medium | 8 | 1 | azide; pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
etoposide | [no description available] | medium | 5 | 0 | beta-D-glucoside; furonaphthodioxole; organic heterotetracyclic compound | antineoplastic agent; DNA synthesis inhibitor |
sq-11725 | [no description available] | medium | 2 | 0 | | |
captopril | [no description available] | medium | 4 | 0 | alkanethiol; L-proline derivative; N-acylpyrrolidine; pyrrolidinemonocarboxylic acid | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
dansylglycine | [no description available] | medium | 1 | 0 | | |
methotrexate | [no description available] | medium | 7 | 0 | dicarboxylic acid; monocarboxylic acid amide; pteridines | abortifacient; antimetabolite; antineoplastic agent; antirheumatic drug; dermatologic drug; DNA synthesis inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; immunosuppressive agent |
levofloxacin | [no description available] | medium | 11 | 0 | 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid; fluoroquinolone antibiotic; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; topoisomerase IV inhibitor |
naproxen | [no description available] | medium | 5 | 0 | methoxynaphthalene; monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; gout suppressant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
quinidine | [no description available] | medium | 5 | 0 | cinchona alkaloid | alpha-adrenergic antagonist; anti-arrhythmia drug; antimalarial; drug allergen; EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor; EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor; muscarinic antagonist; P450 inhibitor; potassium channel blocker; sodium channel blocker |
digitoxin | [no description available] | medium | 4 | 0 | cardenolide glycoside | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor |
propylthiouracil | [no description available] | medium | 3 | 0 | pyrimidinethione | antidote to paracetamol poisoning; antimetabolite; antioxidant; antithyroid drug; carcinogenic agent; EC 1.14.13.39 (nitric oxide synthase) inhibitor; hormone antagonist |
terbinafine | [no description available] | medium | 2 | 0 | acetylenic compound; allylamine antifungal drug; enyne; naphthalenes; tertiary amine | EC 1.14.13.132 (squalene monooxygenase) inhibitor; P450 inhibitor; sterol biosynthesis inhibitor |
quinine | [no description available] | medium | 4 | 0 | cinchona alkaloid | antimalarial; muscle relaxant; non-narcotic analgesic |
acrivastine | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; N-alkylpyrrolidine; olefinic compound; pyridines | H1-receptor antagonist |
cefuroxime | [no description available] | medium | 3 | 0 | 3-(carbamoyloxymethyl)cephalosporin; furans; oxime O-ether | drug allergen |
cci 15641 | [no description available] | medium | 2 | 0 | cephalosporin | |
scopolamine hydrobromide | [no description available] | medium | 1 | 0 | | |
novobiocin | [no description available] | high | 51 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
tetracycline | [no description available] | medium | 111 | 0 | | |
tetracycline | [no description available] | medium | 111 | 1 | | |
minocycline | [no description available] | medium | 15 | 0 | | |
warfarin | [no description available] | medium | 8 | 0 | benzenes; hydroxycoumarin; methyl ketone | |
sancycline | [no description available] | medium | 1 | 0 | | |
nalidixic acid | [no description available] | medium | 11 | 0 | 1,8-naphthyridine derivative; monocarboxylic acid; quinolone antibiotic | antibacterial drug; antimicrobial agent; DNA synthesis inhibitor |
streptomycin | [no description available] | high | 68 | 0 | antibiotic antifungal drug; antibiotic fungicide; streptomycins | antibacterial drug; antifungal agrochemical; antimicrobial agent; antimicrobial drug; bacterial metabolite; protein synthesis inhibitor |
actinonin | [no description available] | medium | 1 | 0 | | |
mupirocin | [no description available] | high | 62 | 7 | alpha,beta-unsaturated carboxylic ester; epoxide; monocarboxylic acid; oxanes; secondary alcohol; triol | antibacterial drug; bacterial metabolite; protein synthesis inhibitor |
mupirocin | [no description available] | high | 62 | 0 | alpha,beta-unsaturated carboxylic ester; epoxide; monocarboxylic acid; oxanes; secondary alcohol; triol | antibacterial drug; bacterial metabolite; protein synthesis inhibitor |
rifampin | [no description available] | high | 155 | 2 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
rifampin | [no description available] | high | 155 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
carbonyl cyanide m-chlorophenyl hydrazone | [no description available] | medium | 4 | 0 | hydrazone; monochlorobenzenes; nitrile | antibacterial agent; geroprotector; ionophore |
reserpine | [no description available] | medium | 8 | 0 | alkaloid ester; methyl ester; yohimban alkaloid | adrenergic uptake inhibitor; antihypertensive agent; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; first generation antipsychotic; plant metabolite; xenobiotic |
kanamycin a | [no description available] | medium | 47 | 0 | kanamycins | bacterial metabolite |
ampicillin | [no description available] | medium | 32 | 0 | beta-lactam antibiotic; penicillin allergen; penicillin | antibacterial drug |
taurocholic acid | [no description available] | medium | 10 | 0 | amino sulfonic acid; bile acid taurine conjugate | human metabolite |
gentian violet | [no description available] | medium | 5 | 0 | organic chloride salt | anthelminthic drug; antibacterial agent; antifungal agent; antiseptic drug; histological dye |
erythromycin | [no description available] | medium | 136 | 0 | cyclic ketone; erythromycin | |
erythromycin | [no description available] | medium | 136 | 2 | cyclic ketone; erythromycin | |
ethidium bromide | [no description available] | medium | 5 | 0 | organic bromide salt | geroprotector; intercalator; trypanocidal drug |
oleandomycin | [no description available] | medium | 2 | 0 | oleandomycins | |
cholic acid | [no description available] | high | 6 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
sodium dodecyl sulfate | [no description available] | medium | 8 | 0 | organic sodium salt | detergent; protein denaturant |
sodium dodecyl sulfate | [no description available] | medium | 8 | 1 | organic sodium salt | detergent; protein denaturant |
tylosin | [no description available] | medium | 2 | 0 | aldehyde; disaccharide derivative; enone; leucomycin; macrolide antibiotic; monosaccharide derivative | allergen; bacterial metabolite; environmental contaminant; xenobiotic |
josamycin | [no description available] | medium | 1 | 0 | acetate ester; aldehyde; disaccharide derivative; glycoside; macrolide antibiotic; tertiary alcohol; tertiary amino compound | antibacterial drug; metabolite |
dirithromycin | [no description available] | medium | 1 | 0 | macrolide antibiotic | prodrug |
roxithromycin | [no description available] | medium | 4 | 0 | roxithromycin | environmental contaminant; xenobiotic |
pyrazinamide | [no description available] | medium | 4 | 0 | monocarboxylic acid amide; N-acylammonia; pyrazines | antitubercular agent; prodrug |
clofazimine | [no description available] | medium | 5 | 0 | monochlorobenzenes; phenazines | dye; leprostatic drug; non-steroidal anti-inflammatory drug |
isoniazid | [no description available] | medium | 6 | 0 | carbohydrazide | antitubercular agent; drug allergen |
metronidazole | [no description available] | medium | 22 | 0 | C-nitro compound; imidazoles; primary alcohol | antiamoebic agent; antibacterial drug; antimicrobial agent; antiparasitic agent; antitrichomonal drug; environmental contaminant; prodrug; radiosensitizing agent; xenobiotic |
metronidazole | [no description available] | medium | 22 | 4 | C-nitro compound; imidazoles; primary alcohol | antiamoebic agent; antibacterial drug; antimicrobial agent; antiparasitic agent; antitrichomonal drug; environmental contaminant; prodrug; radiosensitizing agent; xenobiotic |
niclosamide | [no description available] | medium | 1 | 0 | benzamides; C-nitro compound; monochlorobenzenes; salicylanilides; secondary carboxamide | anthelminthic drug; anticoronaviral agent; antiparasitic agent; apoptosis inducer; molluscicide; piscicide; STAT3 inhibitor |
ofloxacin | [no description available] | medium | 18 | 0 | 3-oxo monocarboxylic acid; N-arylpiperazine; N-methylpiperazine; organofluorine compound; oxazinoquinoline | |
ofloxacin | [no description available] | medium | 18 | 1 | 3-oxo monocarboxylic acid; N-arylpiperazine; N-methylpiperazine; organofluorine compound; oxazinoquinoline | |
aminosalicylic acid | [no description available] | medium | 3 | 0 | aminobenzoic acid; phenols | antitubercular agent |
cycloserine | [no description available] | medium | 5 | 0 | 4-amino-1,2-oxazolidin-3-one; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic; zwitterion | antiinfective agent; antimetabolite; antitubercular agent; metabolite; NMDA receptor agonist |
ethambutol | [no description available] | medium | 2 | 0 | ethanolamines; ethylenediamine derivative | antitubercular agent; environmental contaminant; xenobiotic |
vancomycin | [no description available] | medium | 104 | 0 | glycopeptide | antibacterial drug; antimicrobial agent; bacterial metabolite |
vancomycin | [no description available] | medium | 104 | 3 | glycopeptide | antibacterial drug; antimicrobial agent; bacterial metabolite |
amikacin | [no description available] | medium | 13 | 0 | alpha-D-glucoside; amino cyclitol glycoside; aminoglycoside; carboxamide | antibacterial drug; antimicrobial agent; nephrotoxin |
clarithromycin | [no description available] | high | 15 | 1 | macrolide antibiotic | antibacterial drug; environmental contaminant; protein synthesis inhibitor; xenobiotic |
clarithromycin | [no description available] | high | 15 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; protein synthesis inhibitor; xenobiotic |
tazobactam | [no description available] | medium | 1 | 0 | penicillanic acids; triazoles | antiinfective agent; antimicrobial agent; EC 3.5.2.6 (beta-lactamase) inhibitor |
moxifloxacin | [no description available] | medium | 8 | 0 | aromatic ether; cyclopropanes; fluoroquinolone antibiotic; pyrrolidinopiperidine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antibacterial drug |
linezolid | [no description available] | high | 37 | 1 | acetamides; morpholines; organofluorine compound; oxazolidinone | antibacterial drug; protein synthesis inhibitor |
linezolid | [no description available] | high | 37 | 0 | acetamides; morpholines; organofluorine compound; oxazolidinone | antibacterial drug; protein synthesis inhibitor |
clindamycin | [no description available] | medium | 53 | 0 | | |
pa 824 | [no description available] | medium | 1 | 0 | | |
lincomycin | [no description available] | medium | 58 | 0 | carbohydrate-containing antibiotic; L-proline derivative; monocarboxylic acid amide; pyrrolidinecarboxamide; S-glycosyl compound | antimicrobial agent; bacterial metabolite |
furazolidone | [no description available] | medium | 2 | 0 | | |
nitrofurantoin | [no description available] | medium | 8 | 0 | imidazolidine-2,4-dione; nitrofuran antibiotic; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic | antibacterial drug; antiinfective agent; hepatotoxic agent |
thioacetazone | [no description available] | medium | 2 | 0 | | |
rifabutin | [no description available] | medium | 4 | 0 | | |
oxacillin | [no description available] | medium | 42 | 0 | penicillin | antibacterial agent; antibacterial drug |
spermidine | [no description available] | medium | 5 | 0 | polyazaalkane; triamine | autophagy inducer; fundamental metabolite; geroprotector |
spermine | [no description available] | medium | 1 | 0 | polyazaalkane; tetramine | antioxidant; fundamental metabolite; immunosuppressive agent |
cephaloridine | [no description available] | medium | 18 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
penicillin g | [no description available] | medium | 36 | 0 | penicillin allergen; penicillin | antibacterial drug; drug allergen; epitope |
cephalothin | [no description available] | medium | 12 | 0 | azabicycloalkene; beta-lactam antibiotic allergen; carboxylic acid; cephalosporin; semisynthetic derivative; thiophenes | antibacterial drug; antimicrobial agent |
cloxacillin | [no description available] | medium | 40 | 0 | penicillin allergen; penicillin; semisynthetic derivative | antibacterial agent; antibacterial drug |
cloxacillin | [no description available] | medium | 40 | 2 | penicillin allergen; penicillin; semisynthetic derivative | antibacterial agent; antibacterial drug |
spectinomycin | [no description available] | medium | 16 | 0 | cyclic acetal; cyclic hemiketal; cyclic ketone; pyranobenzodioxin; secondary alcohol; secondary amino compound | antibacterial drug; antimicrobial agent; bacterial metabolite |
carbenicillin | [no description available] | medium | 7 | 0 | penicillin allergen; penicillin | antibacterial drug |
ticarcillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
piperacillin | [no description available] | medium | 7 | 0 | penicillin allergen; penicillin | antibacterial drug |
cefoperazone | [no description available] | medium | 4 | 0 | cephalosporin | antibacterial drug |
imipenem, anhydrous | [no description available] | medium | 9 | 0 | beta-lactam antibiotic allergen; carbapenems; zwitterion | antibacterial drug |
ceftriaxone | [no description available] | medium | 5 | 0 | 1,2,4-triazines; 1,3-thiazoles; cephalosporin; oxime O-ether | antibacterial drug; drug allergen; EC 3.5.2.6 (beta-lactamase) inhibitor |
ceftazidime | [no description available] | medium | 3 | 0 | cephalosporin; oxime O-ether | antibacterial drug; drug allergen; EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor |
cefotaxime | [no description available] | medium | 7 | 0 | 1,3-thiazoles; cephalosporin; oxime O-ether | antibacterial drug; drug allergen |
azlocillin | [no description available] | medium | 2 | 0 | penicillin allergen; penicillin; semisynthetic derivative | antibacterial drug |
acriflavine chloride | [no description available] | medium | 1 | 0 | organic chloride salt | antibacterial agent; antiseptic drug; carcinogenic agent; histological dye; intercalator |
tobramycin | [no description available] | medium | 15 | 0 | amino cyclitol glycoside | antibacterial agent; antimicrobial agent; toxin |
tobramycin | [no description available] | medium | 15 | 1 | amino cyclitol glycoside | antibacterial agent; antimicrobial agent; toxin |
meropenem | [no description available] | high | 7 | 0 | alpha,beta-unsaturated monocarboxylic acid; carbapenemcarboxylic acid; organic sulfide; pyrrolidinecarboxamide | antibacterial agent; antibacterial drug; drug allergen |
cefoxitin | [no description available] | medium | 7 | 0 | beta-lactam antibiotic allergen; cephalosporin; cephamycin; semisynthetic derivative | antibacterial drug |
hmr 3647 | [no description available] | medium | 5 | 0 | | |
aztreonam | [no description available] | medium | 2 | 0 | beta-lactam antibiotic allergen; monobactam | antibacterial drug; drug allergen; EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor |
gentamicin sulfate | [no description available] | medium | 14 | 0 | | |
tigecycline | [no description available] | medium | 6 | 0 | | |
cefazolin | [no description available] | medium | 5 | 0 | beta-lactam antibiotic allergen; cephalosporin; tetrazoles; thiadiazoles | antibacterial drug |
cefazolin | [no description available] | medium | 5 | 1 | beta-lactam antibiotic allergen; cephalosporin; tetrazoles; thiadiazoles | antibacterial drug |
fosfomycin | [no description available] | medium | 21 | 0 | epoxide; phosphonic acids | antimicrobial agent; EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor |
acridine orange | [no description available] | medium | 1 | 0 | aminoacridines; aromatic amine; tertiary amino compound | fluorochrome; histological dye |
streptogramin b | [no description available] | medium | 1 | 0 | cyclodepsipeptide | antibacterial drug; antimicrobial agent; bacterial metabolite |
carnitine | [no description available] | medium | 2 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
hoe 33342 | [no description available] | medium | 1 | 0 | bibenzimidazole; N-methylpiperazine | fluorochrome |
amantadine | [no description available] | medium | 4 | 0 | adamantanes; primary aliphatic amine | analgesic; antiparkinson drug; antiviral drug; dopaminergic agent; NMDA receptor antagonist; non-narcotic analgesic |
p-aminohippuric acid | [no description available] | medium | 1 | 0 | N-acylglycine | Daphnia magna metabolite |
amiodarone | [no description available] | medium | 4 | 0 | 1-benzofurans; aromatic ketone; organoiodine compound; tertiary amino compound | cardiovascular drug |
amitriptyline | [no description available] | medium | 4 | 0 | carbotricyclic compound; tertiary amine | adrenergic uptake inhibitor; antidepressant; environmental contaminant; tropomyosin-related kinase B receptor agonist; xenobiotic |
astemizole | [no description available] | medium | 2 | 0 | benzimidazoles; piperidines | anti-allergic agent; anticoronaviral agent; H1-receptor antagonist |
benzbromarone | [no description available] | medium | 5 | 0 | 1-benzofurans; aromatic ketone | uricosuric drug |
celecoxib | [no description available] | medium | 3 | 0 | organofluorine compound; pyrazoles; sulfonamide; toluenes | cyclooxygenase 2 inhibitor; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
chloroquine | [no description available] | medium | 7 | 0 | aminoquinoline; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antimalarial; antirheumatic drug; autophagy inhibitor; dermatologic drug |
chlorzoxazone | [no description available] | medium | 3 | 0 | 1,3-benzoxazoles; heteroaryl hydroxy compound; organochlorine compound | muscle relaxant; sedative |
diclofenac | [no description available] | medium | 3 | 0 | amino acid; aromatic amine; dichlorobenzene; monocarboxylic acid; secondary amino compound | antipyretic; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
dipyridamole | [no description available] | medium | 4 | 0 | piperidines; pyrimidopyrimidine; tertiary amino compound; tetrol | adenosine phosphodiesterase inhibitor; EC 3.5.4.4 (adenosine deaminase) inhibitor; platelet aggregation inhibitor; vasodilator agent |
valproic acid | [no description available] | medium | 3 | 0 | branched-chain fatty acid; branched-chain saturated fatty acid | anticonvulsant; antimanic drug; EC 3.5.1.98 (histone deacetylase) inhibitor; GABA agent; neuroprotective agent; psychotropic drug; teratogenic agent |
felodipine | [no description available] | medium | 3 | 0 | dichlorobenzene; dihydropyridine; ethyl ester; methyl ester | anti-arrhythmia drug; antihypertensive agent; calcium channel blocker; vasodilator agent |
fendiline | [no description available] | medium | 1 | 0 | diarylmethane | |
fenofibrate | [no description available] | medium | 5 | 0 | aromatic ether; chlorobenzophenone; isopropyl ester; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
fexofenadine | [no description available] | medium | 1 | 0 | piperidines; tertiary amine | anti-allergic agent; H1-receptor antagonist |
fluorescite | [no description available] | medium | 3 | 0 | benzoic acids; cyclic ketone; hydroxy monocarboxylic acid; organic heterotricyclic compound; phenols; xanthene dye | fluorescent dye; radioopaque medium |
flurbiprofen | [no description available] | medium | 2 | 0 | fluorobiphenyl; monocarboxylic acid | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
flutamide | [no description available] | medium | 5 | 0 | (trifluoromethyl)benzenes; monocarboxylic acid amide | androgen antagonist; antineoplastic agent |
gliclazide | [no description available] | medium | 4 | 0 | N-sulfonylurea | hypoglycemic agent; insulin secretagogue; radical scavenger |
glimepiride | [no description available] | medium | 3 | 0 | sulfonamide | |
glipizide | [no description available] | medium | 3 | 0 | aromatic amide; monocarboxylic acid amide; N-sulfonylurea; pyrazines | EC 2.7.1.33 (pantothenate kinase) inhibitor; hypoglycemic agent; insulin secretagogue |
haloperidol | [no description available] | medium | 5 | 0 | aromatic ketone; hydroxypiperidine; monochlorobenzenes; organofluorine compound; tertiary alcohol | antidyskinesia agent; antiemetic; dopaminergic antagonist; first generation antipsychotic; serotonergic antagonist |
ibuprofen | [no description available] | medium | 5 | 0 | monocarboxylic acid | antipyretic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; drug allergen; environmental contaminant; geroprotector; non-narcotic analgesic; non-steroidal anti-inflammatory drug; radical scavenger; xenobiotic |
isradipine | [no description available] | medium | 3 | 0 | benzoxadiazole; dihydropyridine; isopropyl ester; methyl ester | |
lansoprazole | [no description available] | medium | 5 | 0 | benzimidazoles; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor |
loperamide | [no description available] | medium | 2 | 0 | monocarboxylic acid amide; monochlorobenzenes; piperidines; tertiary alcohol | anticoronaviral agent; antidiarrhoeal drug; mu-opioid receptor agonist |
loratadine | [no description available] | medium | 2 | 0 | benzocycloheptapyridine; ethyl ester; N-acylpiperidine; organochlorine compound; tertiary carboxamide | anti-allergic agent; cholinergic antagonist; geroprotector; H1-receptor antagonist |
maprotiline | [no description available] | medium | 3 | 0 | anthracenes | |
mesalamine | [no description available] | medium | 2 | 0 | amino acid; aromatic amine; monocarboxylic acid; monohydroxybenzoic acid; phenols | non-steroidal anti-inflammatory drug |
mitoxantrone | [no description available] | medium | 3 | 0 | dihydroxyanthraquinone | analgesic; antineoplastic agent |
nevirapine | [no description available] | medium | 4 | 0 | cyclopropanes; dipyridodiazepine | antiviral drug; HIV-1 reverse transcriptase inhibitor |
nicardipine | [no description available] | medium | 4 | 0 | benzenes; C-nitro compound; diester; dihydropyridine; methyl ester; tertiary amino compound | |
nitrendipine | [no description available] | medium | 5 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; ethyl ester; methyl ester | antihypertensive agent; calcium channel blocker; geroprotector; vasodilator agent |
nizatidine | [no description available] | medium | 2 | 0 | 1,3-thiazoles; C-nitro compound; carboxamidine; organic sulfide; tertiary amino compound | anti-ulcer drug; cholinergic drug; H2-receptor antagonist |
omeprazole | [no description available] | medium | 5 | 0 | aromatic ether; benzimidazoles; pyridines; sulfoxide | |
oxazepam | [no description available] | medium | 2 | 0 | 1,4-benzodiazepinone; organochlorine compound | anxiolytic drug; environmental contaminant; xenobiotic |
phenacetin | [no description available] | medium | 4 | 0 | acetamides; aromatic ether | cyclooxygenase 3 inhibitor; non-narcotic analgesic; peripheral nervous system drug |
phenobarbital | [no description available] | medium | 4 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
pramoxine | [no description available] | medium | 1 | 0 | aromatic ether; morpholines | local anaesthetic |
probenecid | [no description available] | medium | 6 | 0 | benzoic acids; sulfonamide | uricosuric drug |
procyclidine | [no description available] | medium | 2 | 0 | pyrrolidines; tertiary alcohol | antidyskinesia agent; antiparkinson drug; muscarinic antagonist |
propafenone | [no description available] | medium | 2 | 0 | aromatic ketone; secondary alcohol; secondary amino compound | anti-arrhythmia drug |
ritanserin | [no description available] | medium | 1 | 0 | organofluorine compound; piperidines; thiazolopyrimidine | antidepressant; antipsychotic agent; anxiolytic drug; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; serotonergic antagonist |
sulfanitran | [no description available] | medium | 2 | 0 | sulfonamide | |
sulfinpyrazone | [no description available] | medium | 3 | 0 | pyrazolidines; sulfoxide | uricosuric drug |
terfenadine | [no description available] | medium | 4 | 0 | diarylmethane | |
thioridazine | [no description available] | medium | 3 | 0 | phenothiazines; piperidines | alpha-adrenergic antagonist; dopaminergic antagonist; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
tinidazole | [no description available] | medium | 2 | 0 | imidazoles | antiamoebic agent; antibacterial drug; antiparasitic agent; antiprotozoal drug |
ultram | [no description available] | medium | 2 | 0 | aromatic ether; tertiary alcohol; tertiary amino compound | |
spironolactone | [no description available] | medium | 2 | 0 | 3-oxo-Delta(4) steroid; oxaspiro compound; steroid lactone; thioester | aldosterone antagonist; antihypertensive agent; diuretic; environmental contaminant; xenobiotic |
prednisone | [no description available] | medium | 3 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | adrenergic agent; anti-inflammatory drug; antineoplastic agent; immunosuppressive agent; prodrug |
vincristine | [no description available] | medium | 2 | 0 | acetate ester; formamides; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; tertiary alcohol; tertiary amino compound; vinca alkaloid | antineoplastic agent; drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
ethinyl estradiol | [no description available] | medium | 3 | 0 | 17-hydroxy steroid; 3-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
colchicine | [no description available] | medium | 5 | 0 | alkaloid; colchicine | anti-inflammatory agent; gout suppressant; mutagen |
sulfobromophthalein sodium | [no description available] | medium | 1 | 0 | organic sodium salt | dye |
rotenone | [no description available] | medium | 2 | 0 | organic heteropentacyclic compound; rotenones | antineoplastic agent; metabolite; mitochondrial NADH:ubiquinone reductase inhibitor; phytogenic insecticide; piscicide; toxin |
phenformin | [no description available] | medium | 4 | 0 | biguanides | antineoplastic agent; geroprotector; hypoglycemic agent |
nandrolone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; anabolic androgenic steroid | human metabolite |
chenodeoxycholic acid | [no description available] | medium | 4 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
medroxyprogesterone | [no description available] | medium | 1 | 0 | 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid; tertiary alpha-hydroxy ketone | contraceptive drug; progestin; synthetic oral contraceptive |
dehydroepiandrosterone sulfate | [no description available] | medium | 1 | 0 | 17-oxo steroid; steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite; mouse metabolite |
vinblastine | [no description available] | medium | 2 | 0 | | |
glycyrrhizic acid | [no description available] | medium | 1 | 0 | enone; glucosiduronic acid; pentacyclic triterpenoid; tricarboxylic acid; triterpenoid saponin | EC 3.4.21.5 (thrombin) inhibitor; plant metabolite |
amiloride | [no description available] | medium | 2 | 0 | aromatic amine; guanidines; organochlorine compound; pyrazines | diuretic; sodium channel blocker |
phenethyl isothiocyanate | [no description available] | medium | 1 | 0 | isothiocyanate | antineoplastic agent; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; metabolite |
floxacillin | [no description available] | medium | 25 | 0 | penicillin allergen; penicillin | antibacterial drug |
floxacillin | [no description available] | medium | 25 | 2 | penicillin allergen; penicillin | antibacterial drug |
ergocristine | [no description available] | medium | 1 | 0 | ergot alkaloid | |
du-21220 | [no description available] | medium | 1 | 0 | benzyl alcohols; polyphenol; secondary alcohol; secondary amino compound | |
diltiazem | [no description available] | medium | 4 | 0 | 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate | antihypertensive agent; calcium channel blocker; vasodilator agent |
1-methyl-4-phenylpyridinium | [no description available] | medium | 1 | 0 | pyridinium ion | apoptosis inducer; herbicide; human xenobiotic metabolite; neurotoxin |
cefadroxil anhydrous | [no description available] | medium | 3 | 0 | cephalosporin | antibacterial drug |
simvastatin | [no description available] | medium | 7 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; statin (semi-synthetic) | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; ferroptosis inducer; geroprotector; prodrug |
pravastatin | [no description available] | medium | 3 | 0 | 3-hydroxy carboxylic acid; carbobicyclic compound; carboxylic ester; hydroxy monocarboxylic acid; secondary alcohol; statin (semi-synthetic) | anticholesteremic drug; environmental contaminant; metabolite; xenobiotic |
atomoxetine | [no description available] | medium | 1 | 0 | aromatic ether; secondary amino compound; toluenes | adrenergic uptake inhibitor; antidepressant; environmental contaminant; xenobiotic |
mifepristone | [no description available] | medium | 3 | 0 | 3-oxo-Delta(4) steroid; acetylenic compound; tertiary amino compound | abortifacient; contraceptive drug; hormone antagonist; synthetic oral contraceptive |
adefovir | [no description available] | medium | 1 | 0 | 6-aminopurines; ether; phosphonic acids | antiviral drug; DNA synthesis inhibitor; drug metabolite; HIV-1 reverse transcriptase inhibitor; nephrotoxic agent |
sparfloxacin | [no description available] | medium | 4 | 0 | fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | |
irinotecan | [no description available] | medium | 2 | 0 | carbamate ester; delta-lactone; N-acylpiperidine; pyranoindolizinoquinoline; ring assembly; tertiary alcohol; tertiary amino compound | antineoplastic agent; apoptosis inducer; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
n-methylnicotinamide | [no description available] | medium | 1 | 0 | pyridinecarboxamide | metabolite |
baicalin | [no description available] | medium | 1 | 0 | dihydroxyflavone; glucosiduronic acid; glycosyloxyflavone; monosaccharide derivative | antiatherosclerotic agent; antibacterial agent; anticoronaviral agent; antineoplastic agent; antioxidant; cardioprotective agent; EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; ferroptosis inhibitor; neuroprotective agent; non-steroidal anti-inflammatory drug; plant metabolite; prodrug |
glutathione disulfide | [no description available] | medium | 2 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
sanguinarine chloride | [no description available] | medium | 1 | 0 | | |
chelerythrine chloride | [no description available] | medium | 1 | 0 | | |
4-nitrophenylglucuronide | [no description available] | medium | 1 | 0 | beta-D-glucosiduronic acid; C-nitro compound | chromogenic compound |
acetaminophen glucuronide | [no description available] | medium | 1 | 0 | beta-D-glucosiduronic acid | drug metabolite |
nicotine | [no description available] | medium | 4 | 0 | 3-(1-methylpyrrolidin-2-yl)pyridine | anxiolytic drug; biomarker; immunomodulator; mitogen; neurotoxin; nicotinic acetylcholine receptor agonist; peripheral nervous system drug; phytogenic insecticide; plant metabolite; psychotropic drug; teratogenic agent; xenobiotic |
lopinavir | [no description available] | medium | 5 | 0 | amphetamines; dicarboxylic acid diamide | anticoronaviral agent; antiviral drug; HIV protease inhibitor |
fluo-3 | [no description available] | medium | 1 | 0 | xanthene dye | fluorochrome |
elacridar | [no description available] | medium | 1 | 0 | | |
imatinib mesylate | [no description available] | medium | 2 | 0 | methanesulfonate salt | anticoronaviral agent; antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
gefitinib | [no description available] | medium | 5 | 0 | aromatic ether; monochlorobenzenes; monofluorobenzenes; morpholines; quinazolines; secondary amino compound; tertiary amino compound | antineoplastic agent; epidermal growth factor receptor antagonist |
5-carboxyfluorescein diacetate | [no description available] | medium | 1 | 0 | | |
disopyramide, (s)-isomer | [no description available] | medium | 1 | 0 | | |
atropine | [no description available] | medium | 5 | 0 | | |
erlotinib | [no description available] | medium | 2 | 0 | aromatic ether; quinazolines; secondary amino compound; terminal acetylenic compound | antineoplastic agent; epidermal growth factor receptor antagonist; protein kinase inhibitor |
noscapine | [no description available] | medium | 2 | 0 | aromatic ether; benzylisoquinoline alkaloid; cyclic acetal; isobenzofuranone; organic heterobicyclic compound; organic heterotricyclic compound; tertiary amino compound | antineoplastic agent; antitussive; apoptosis inducer; plant metabolite |
ritonavir | [no description available] | medium | 5 | 0 | 1,3-thiazoles; carbamate ester; carboxamide; L-valine derivative; ureas | antiviral drug; environmental contaminant; HIV protease inhibitor; xenobiotic |
naringenin | [no description available] | medium | 1 | 0 | (2S)-flavan-4-one; naringenin | expectorant; plant metabolite |
taxifolin | [no description available] | medium | 1 | 0 | taxifolin | metabolite |
taurolithocholic acid | [no description available] | medium | 1 | 0 | bile acid taurine conjugate; monocarboxylic acid amide | human metabolite |
saquinavir | [no description available] | medium | 6 | 0 | L-asparagine derivative; quinolines | antiviral drug; HIV protease inhibitor |
resveratrol | [no description available] | medium | 1 | 0 | resveratrol | antioxidant; phytoalexin; plant metabolite; quorum sensing inhibitor; radical scavenger |
diethylstilbestrol | [no description available] | medium | 2 | 0 | olefinic compound; polyphenol | antifungal agent; antineoplastic agent; autophagy inducer; calcium channel blocker; carcinogenic agent; EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; endocrine disruptor; xenoestrogen |
cefamandole | [no description available] | medium | 3 | 0 | cephalosporin; semisynthetic derivative | antibacterial drug |
chlorprothixene | [no description available] | medium | 2 | 0 | chlorprothixene | |
sulindac | [no description available] | medium | 5 | 0 | monocarboxylic acid; organofluorine compound; sulfoxide | analgesic; antineoplastic agent; antipyretic; apoptosis inducer; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug; tocolytic agent |
digoxin | [no description available] | medium | 2 | 0 | cardenolide glycoside; steroid saponin | anti-arrhythmia drug; cardiotonic drug; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; epitope |
tamoxifen | [no description available] | medium | 4 | 0 | stilbenoid; tertiary amino compound | angiogenesis inhibitor; antineoplastic agent; bone density conservation agent; EC 1.2.3.1 (aldehyde oxidase) inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; estrogen antagonist; estrogen receptor antagonist; estrogen receptor modulator |
estrone sulfate | [no description available] | medium | 2 | 0 | 17-oxo steroid; steroid sulfate | human metabolite; mouse metabolite |
quercetin | [no description available] | medium | 3 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | antibacterial agent; antineoplastic agent; antioxidant; Aurora kinase inhibitor; chelator; EC 1.10.99.2 [ribosyldihydronicotinamide dehydrogenase (quinone)] inhibitor; geroprotector; phytoestrogen; plant metabolite; protein kinase inhibitor; radical scavenger |
biochanin a | [no description available] | medium | 1 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones | antineoplastic agent; EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
apigenin | [no description available] | medium | 2 | 0 | trihydroxyflavone | antineoplastic agent; metabolite |
genistein | [no description available] | medium | 1 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; human urinary metabolite; phytoestrogen; plant metabolite; tyrosine kinase inhibitor |
pulmicort | [no description available] | medium | 3 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic acetal; glucocorticoid; primary alpha-hydroxy ketone | anti-inflammatory drug; bronchodilator agent; drug allergen |
chrysin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; dihydroxyflavone | anti-inflammatory agent; antineoplastic agent; antioxidant; EC 2.7.11.18 (myosin-light-chain kinase) inhibitor; hepatoprotective agent; plant metabolite |
morin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | angiogenesis modulating agent; anti-inflammatory agent; antibacterial agent; antihypertensive agent; antineoplastic agent; antioxidant; EC 5.99.1.2 (DNA topoisomerase) inhibitor; hepatoprotective agent; metabolite; neuroprotective agent |
flupenthixol | [no description available] | medium | 1 | 0 | flupenthixol | dopaminergic antagonist |
l 660,711 | [no description available] | medium | 4 | 0 | quinolines | |
tranilast | [no description available] | medium | 4 | 0 | amidobenzoic acid; cinnamamides; dimethoxybenzene; secondary carboxamide | anti-allergic agent; anti-asthmatic drug; antineoplastic agent; aryl hydrocarbon receptor agonist; calcium channel blocker; hepatoprotective agent; nephroprotective agent |
indocyanine green | [no description available] | medium | 1 | 0 | 1,1-diunsubstituted alkanesulfonate; benzoindole; cyanine dye | |
cyclosporine | [no description available] | medium | 6 | 0 | homodetic cyclic peptide | anti-asthmatic drug; anticoronaviral agent; antifungal agent; antirheumatic drug; carcinogenic agent; dermatologic drug; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; geroprotector; immunosuppressive agent; metabolite |
seglitide | [no description available] | medium | 1 | 0 | | |
dextromethorphan | [no description available] | medium | 2 | 0 | 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene | antitussive; environmental contaminant; neurotoxin; NMDA receptor antagonist; oneirogen; prodrug; xenobiotic |
lisinopril | [no description available] | medium | 3 | 0 | dipeptide | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
indinavir sulfate | [no description available] | medium | 4 | 0 | dicarboxylic acid diamide; N-(2-hydroxyethyl)piperazine; piperazinecarboxamide | HIV protease inhibitor |
sulindac sulfone | [no description available] | medium | 2 | 0 | monocarboxylic acid; organofluorine compound; sulfone | apoptosis inducer; cyclooxygenase 2 inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor |
ko 143 | [no description available] | medium | 2 | 0 | beta-carbolines; tert-butyl ester | |
nystatin a1 | [no description available] | medium | 8 | 0 | nystatins | |
nystatin a1 | [no description available] | medium | 8 | 2 | nystatins | |
amodiaquine hydrochloride | [no description available] | medium | 2 | 0 | | |
piroxicam | [no description available] | medium | 3 | 0 | benzothiazine; monocarboxylic acid amide; pyridines | analgesic; antirheumatic drug; cyclooxygenase 1 inhibitor; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug |
tipranavir | [no description available] | medium | 1 | 0 | sulfonamide | antiviral drug; HIV protease inhibitor |
valacyclovir | [no description available] | medium | 2 | 0 | L-valyl ester | antiviral drug |
leucovorin | [no description available] | medium | 2 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
polymyxin b nonapeptide | [no description available] | medium | 2 | 0 | | |
zithromax | [no description available] | medium | 8 | 0 | macrolide antibiotic | antibacterial drug; environmental contaminant; xenobiotic |
3-methoxybenzoic acid | [no description available] | medium | 1 | 0 | methoxybenzoic acid | flavouring agent; human urinary metabolite |
4-Methoxybenzamide | [no description available] | medium | 1 | 0 | benzamides | |
3-methoxybenzamide | [no description available] | medium | 1 | 0 | | |
framycetin | [no description available] | high | 51 | 4 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
framycetin | [no description available] | high | 51 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
antibiotic g 418 | [no description available] | medium | 1 | 0 | | |
paromomycin | [no description available] | medium | 7 | 0 | amino cyclitol glycoside; aminoglycoside antibiotic | anthelminthic drug; antibacterial drug; antiparasitic agent; antiprotozoal drug |
telavancin | [no description available] | medium | 1 | 0 | glycopeptide | antibacterial drug; antimicrobial agent |
ly-146032 | [no description available] | medium | 3 | 0 | heterodetic cyclic peptide; lipopeptide antibiotic; lipopeptide; macrocycle; macrolide | antibacterial drug; bacterial metabolite; calcium-dependent antibiotics |
oritavancin | [no description available] | medium | 1 | 0 | disaccharide derivative; glycopeptide; semisynthetic derivative | antibacterial drug; antimicrobial agent |
flufenamic acid | [no description available] | medium | 3 | 0 | aromatic amino acid; organofluorine compound | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
mefenamic acid | [no description available] | medium | 3 | 0 | aminobenzoic acid; secondary amino compound | analgesic; antipyretic; antirheumatic drug; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; environmental contaminant; non-steroidal anti-inflammatory drug; xenobiotic |
mefloquine hydrochloride | [no description available] | medium | 1 | 0 | organofluorine compound; piperidines; quinolines; secondary alcohol | |
propanil | [no description available] | medium | 1 | 0 | anilide; dichlorobenzene | herbicide |
xanthone | [no description available] | medium | 1 | 0 | xanthones | insecticide |
flunixin meglumine | [no description available] | medium | 1 | 0 | organoammonium salt | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
mefloquine | [no description available] | medium | 2 | 0 | [2,8-bis(trifluoromethyl)quinolin-4-yl]-(2-piperidyl)methanol | antimalarial |
diltiazem hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antihypertensive agent; calcium channel blocker; vasodilator agent |
miconazole nitrate | [no description available] | medium | 2 | 0 | | |
diffractaic acid | [no description available] | medium | 1 | 0 | carbonyl compound | |
wr-142,490 | [no description available] | medium | 1 | 0 | [2,8-bis(trifluoromethyl)quinolin-4-yl]-(2-piperidyl)methanol | antimalarial |
tolfenamic acid | [no description available] | medium | 1 | 0 | aminobenzoic acid; organochlorine compound; secondary amino compound | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; EC 2.7.1.33 (pantothenate kinase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
diclofenac sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
harman | [no description available] | medium | 1 | 0 | harmala alkaloid; indole alkaloid fundamental parent; indole alkaloid | anti-HIV agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; plant metabolite |
isotretinoin | [no description available] | medium | 5 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; teratogenic agent |
iclaprim | [no description available] | medium | 1 | 0 | aminopyrimidine; chromenes; cyclopropanes | |
acetic acid | [no description available] | medium | 3 | 0 | monocarboxylic acid | antimicrobial food preservative; Daphnia magna metabolite; food acidity regulator; protic solvent |
acetamide | [no description available] | medium | 1 | 0 | acetamides; carboximidic acid; monocarboxylic acid amide; N-acylammonia | |
adenine | [no description available] | medium | 1 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allantoin | [no description available] | medium | 1 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
quinacrine | [no description available] | medium | 2 | 0 | acridines; aromatic ether; organochlorine compound; tertiary amino compound | antimalarial; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor |
betaine | [no description available] | medium | 2 | 0 | amino-acid betaine; glycine derivative | fundamental metabolite |
citric acid, anhydrous | [no description available] | medium | 1 | 0 | tricarboxylic acid | antimicrobial agent; chelator; food acidity regulator; fundamental metabolite |
aminocaproic acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; epsilon-amino acid; omega-amino fatty acid | antifibrinolytic drug; hematologic agent; metabolite |
creatine | [no description available] | medium | 1 | 0 | glycine derivative; guanidines; zwitterion | geroprotector; human metabolite; mouse metabolite; neuroprotective agent; nutraceutical |
lactic acid | [no description available] | medium | 7 | 0 | 2-hydroxy monocarboxylic acid | algal metabolite; Daphnia magna metabolite |
dimethyl sulfoxide | [no description available] | high | 5 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
formaldehyde | [no description available] | high | 4 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glycine | [no description available] | medium | 6 | 0 | alpha-amino acid; amino acid zwitterion; proteinogenic amino acid; serine family amino acid | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor; fundamental metabolite; hepatoprotective agent; micronutrient; neurotransmitter; NMDA receptor agonist; nutraceutical |
glycerol | [no description available] | medium | 1 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
hydroquinone | [no description available] | medium | 1 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
inositol | [no description available] | medium | 1 | 0 | cyclitol; hexol | |
niacinamide | [no description available] | medium | 1 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
niacin | [no description available] | medium | 2 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
orotic acid | [no description available] | medium | 1 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
phenol | [no description available] | medium | 1 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
phenylacetic acid | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
pyridoxal phosphate | [no description available] | medium | 1 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | medium | 2 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thiamine | [no description available] | medium | 1 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uracil | [no description available] | high | 6 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
urea | [no description available] | high | 5 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
catechin | [no description available] | medium | 1 | 0 | hydroxyflavan | |
menthol | [no description available] | medium | 1 | 0 | p-menthane monoterpenoid; secondary alcohol | volatile oil component |
acetazolamide | [no description available] | medium | 4 | 0 | monocarboxylic acid amide; sulfonamide; thiadiazoles | anticonvulsant; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
acetohexamide | [no description available] | medium | 1 | 0 | acetophenones; N-sulfonylurea | hypoglycemic agent; insulin secretagogue |
acetohydroxamic acid | [no description available] | medium | 1 | 0 | acetohydroxamic acids; carbohydroximic acid | algal metabolite; EC 3.5.1.5 (urease) inhibitor |
albendazole | [no description available] | medium | 2 | 0 | aryl sulfide; benzimidazoles; benzimidazolylcarbamate fungicide; carbamate ester | anthelminthic drug; microtubule-destabilising agent; tubulin modulator |
albuterol | [no description available] | medium | 2 | 0 | phenols; phenylethanolamines; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; environmental contaminant; xenobiotic |
alfuzosin | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; quinazolines; tetrahydrofuranol | alpha-adrenergic antagonist; antihypertensive agent; antineoplastic agent |
ambroxol | [no description available] | medium | 1 | 0 | aromatic amine | |
aminoglutethimide | [no description available] | medium | 2 | 0 | dicarboximide; piperidones; substituted aniline | adrenergic agent; anticonvulsant; antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
pimagedine | [no description available] | medium | 1 | 0 | guanidines; one-carbon compound | EC 1.14.13.39 (nitric oxide synthase) inhibitor; EC 1.4.3.4 (monoamine oxidase) inhibitor |
theophylline | [no description available] | medium | 3 | 0 | dimethylxanthine | adenosine receptor antagonist; anti-asthmatic drug; anti-inflammatory agent; bronchodilator agent; drug metabolite; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; fungal metabolite; human blood serum metabolite; immunomodulator; muscle relaxant; vasodilator agent |
amlodipine | [no description available] | medium | 2 | 0 | dihydropyridine; ethyl ester; methyl ester; monochlorobenzenes; primary amino compound | antihypertensive agent; calcium channel blocker; vasodilator agent |
amobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
amsacrine | [no description available] | medium | 2 | 0 | acridines; aromatic ether; sulfonamide | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
anastrozole | [no description available] | medium | 2 | 0 | nitrile; triazoles | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
anethole trithione | [no description available] | medium | 1 | 0 | methoxybenzenes | |
anthralin | [no description available] | medium | 2 | 0 | anthracenes | antipsoriatic |
azathioprine | [no description available] | medium | 4 | 0 | aryl sulfide; C-nitro compound; imidazoles; thiopurine | antimetabolite; antineoplastic agent; carcinogenic agent; DNA synthesis inhibitor; hepatotoxic agent; immunosuppressive agent; prodrug |
baclofen | [no description available] | medium | 2 | 0 | amino acid zwitterion; gamma-amino acid; monocarboxylic acid; monochlorobenzenes; primary amino compound | central nervous system depressant; GABA agonist; muscle relaxant |
barbital | [no description available] | medium | 1 | 0 | barbiturates | drug allergen |
bendazac | [no description available] | medium | 1 | 0 | indazoles; monocarboxylic acid | non-steroidal anti-inflammatory drug; radical scavenger |
bicalutamide | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; monocarboxylic acid amide; monofluorobenzenes; nitrile; sulfone; tertiary alcohol | |
bay h 4502 | [no description available] | medium | 2 | 0 | biphenyls; imidazoles | |
bisoprolol | [no description available] | medium | 1 | 0 | secondary alcohol; secondary amine | anti-arrhythmia drug; antihypertensive agent; beta-adrenergic antagonist; sympatholytic agent |
bromisovalum | [no description available] | medium | 1 | 0 | N-acylurea; organobromine compound | |
brotizolam | [no description available] | medium | 1 | 0 | organic molecular entity | |
bupivacaine | [no description available] | medium | 1 | 0 | aromatic amide; piperidinecarboxamide; tertiary amino compound | |
buspirone | [no description available] | medium | 2 | 0 | azaspiro compound; N-alkylpiperazine; N-arylpiperazine; organic heteropolycyclic compound; piperidones; pyrimidines | anxiolytic drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; sedative; serotonergic agonist |
busulfan | [no description available] | medium | 3 | 0 | methanesulfonate ester | alkylating agent; antineoplastic agent; carcinogenic agent; insect sterilant; teratogenic agent |
butalbital | [no description available] | medium | 1 | 0 | barbiturates | analgesic; sedative |
candesartan cilexetil | [no description available] | medium | 2 | 0 | biphenyls | |
carisoprodol | [no description available] | medium | 1 | 0 | carbamate ester | muscle relaxant |
carmustine | [no description available] | medium | 3 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
carprofen | [no description available] | medium | 2 | 0 | carbazoles; organochlorine compound | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-steroidal anti-inflammatory drug; photosensitizing agent |
carvedilol | [no description available] | medium | 2 | 0 | carbazoles; secondary alcohol; secondary amino compound | alpha-adrenergic antagonist; antihypertensive agent; beta-adrenergic antagonist; cardiovascular drug; vasodilator agent |
cetirizine | [no description available] | medium | 1 | 0 | ether; monocarboxylic acid; monochlorobenzenes; piperazines | anti-allergic agent; environmental contaminant; H1-receptor antagonist; xenobiotic |
chloral hydrate | [no description available] | medium | 1 | 0 | aldehyde hydrate; ethanediol; organochlorine compound | general anaesthetic; mouse metabolite; sedative; xenobiotic |
chlorambucil | [no description available] | medium | 3 | 0 | aromatic amine; monocarboxylic acid; nitrogen mustard; organochlorine compound; tertiary amino compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
chlordiazepoxide | [no description available] | medium | 3 | 0 | benzodiazepine | |
chlormezanone | [no description available] | medium | 1 | 0 | 1,3-thiazine; lactam; monochlorobenzenes; sulfone | antipsychotic agent; anxiolytic drug; muscle relaxant |
chloroxylenol | [no description available] | medium | 1 | 0 | monochlorobenzenes; phenols | antiseptic drug; disinfectant; molluscicide |
chlorpheniramine | [no description available] | medium | 4 | 0 | monochlorobenzenes; pyridines; tertiary amino compound | anti-allergic agent; antidepressant; antipruritic drug; H1-receptor antagonist; histamine antagonist; serotonin uptake inhibitor |
cinoxacin | [no description available] | medium | 1 | 0 | cinnolines; oxacycle; oxo carboxylic acid | antibacterial drug; antiinfective agent |
ciprofibrate | [no description available] | medium | 4 | 0 | cyclopropanes; monocarboxylic acid; organochlorine compound | antilipemic drug |
cisapride | [no description available] | medium | 1 | 0 | benzamides | |
citalopram | [no description available] | medium | 2 | 0 | 2-benzofurans; cyclic ether; nitrile; organofluorine compound; tertiary amino compound | |
clioquinol | [no description available] | medium | 3 | 0 | monohydroxyquinoline; organochlorine compound; organoiodine compound | antibacterial agent; antifungal agent; antimicrobial agent; antineoplastic agent; antiprotozoal drug; chelator; copper chelator |
clobazam | [no description available] | medium | 2 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; GABA modulator |
clomiphene | [no description available] | medium | 2 | 0 | tertiary amine | estrogen antagonist; estrogen receptor modulator |
clotiazepam | [no description available] | medium | 1 | 0 | organic molecular entity | |
cyclandelate | [no description available] | medium | 1 | 0 | carboxylic ester; secondary alcohol | vasodilator agent |
cyproheptadine | [no description available] | medium | 2 | 0 | piperidines; tertiary amine | anti-allergic agent; antipruritic drug; gastrointestinal drug; H1-receptor antagonist; serotonergic antagonist |
danthron | [no description available] | medium | 1 | 0 | dihydroxyanthraquinone | apoptosis inducer; plant metabolite |
dapsone | [no description available] | medium | 7 | 0 | substituted aniline; sulfone | anti-inflammatory drug; antiinfective agent; antimalarial; leprostatic drug |
deferoxamine | [no description available] | medium | 1 | 0 | acyclic desferrioxamine | bacterial metabolite; ferroptosis inhibitor; iron chelator; siderophore |
amphetamine | [no description available] | medium | 1 | 0 | primary amine | |
eflornithine | [no description available] | medium | 1 | 0 | alpha-amino acid; fluoroamino acid | trypanocidal drug |
diazepam | [no description available] | medium | 4 | 0 | 1,4-benzodiazepinone; organochlorine compound | anticonvulsant; anxiolytic drug; environmental contaminant; sedative; xenobiotic |
diazoxide | [no description available] | medium | 3 | 0 | benzothiadiazine; organochlorine compound; sulfone | antihypertensive agent; beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; diuretic; K-ATP channel agonist; sodium channel blocker; sympathomimetic agent; vasodilator agent |
ddt | [no description available] | medium | 2 | 0 | benzenoid aromatic compound; chlorophenylethane; monochlorobenzenes; organochlorine insecticide | bridged diphenyl acaricide; carcinogenic agent; endocrine disruptor; persistent organic pollutant |
diflunisal | [no description available] | medium | 1 | 0 | monohydroxybenzoic acid; organofluorine compound | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
diphenhydramine | [no description available] | medium | 2 | 0 | ether; tertiary amino compound | anti-allergic agent; antidyskinesia agent; antiemetic; antiparkinson drug; antipruritic drug; antitussive; H1-receptor antagonist; local anaesthetic; muscarinic antagonist; oneirogen; sedative |
disopyramide | [no description available] | medium | 3 | 0 | monocarboxylic acid amide; pyridines; tertiary amino compound | anti-arrhythmia drug |
disulfiram | [no description available] | medium | 2 | 0 | organic disulfide; organosulfur acaricide | angiogenesis inhibitor; antineoplastic agent; apoptosis inducer; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; EC 3.1.1.1 (carboxylesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; ferroptosis inducer; fungicide; NF-kappaB inhibitor |
doxepin | [no description available] | medium | 4 | 0 | dibenzooxepine; tertiary amino compound | antidepressant |
econazole | [no description available] | medium | 2 | 0 | dichlorobenzene; ether; imidazoles; monochlorobenzenes | |
enflurane | [no description available] | medium | 1 | 0 | ether; organochlorine compound; organofluorine compound | anaesthetic |
enoxacin | [no description available] | medium | 2 | 0 | 1,8-naphthyridine derivative; amino acid; fluoroquinolone antibiotic; monocarboxylic acid; N-arylpiperazine; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor |
estazolam | [no description available] | medium | 1 | 0 | triazoles; triazolobenzodiazepine | anticonvulsant; anxiolytic drug; GABA modulator |
ethacrynic acid | [no description available] | medium | 2 | 0 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid | EC 2.5.1.18 (glutathione transferase) inhibitor; ion transport inhibitor; loop diuretic |
ethoxzolamide | [no description available] | medium | 1 | 0 | aromatic ether; benzothiazoles; sulfonamide | antiglaucoma drug; diuretic; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
etodolac | [no description available] | medium | 1 | 0 | monocarboxylic acid; organic heterotricyclic compound | antipyretic; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
brl 42810 | [no description available] | medium | 2 | 0 | 2-aminopurines; acetate ester | antiviral drug; prodrug |
felbamate | [no description available] | medium | 2 | 0 | carbamate ester | anticonvulsant; neuroprotective agent |
fentanyl | [no description available] | medium | 1 | 0 | anilide; monocarboxylic acid amide; piperidines | adjuvant; anaesthesia adjuvant; anaesthetic; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic |
flecainide | [no description available] | medium | 1 | 0 | aromatic ether; monocarboxylic acid amide; organofluorine compound; piperidines | anti-arrhythmia drug |
fluconazole | [no description available] | medium | 3 | 0 | conazole antifungal drug; difluorobenzene; tertiary alcohol; triazole antifungal drug | environmental contaminant; P450 inhibitor; xenobiotic |
flumazenil | [no description available] | medium | 4 | 0 | ethyl ester; imidazobenzodiazepine; organofluorine compound | antidote to benzodiazepine poisoning; GABA antagonist |
flunitrazepam | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; C-nitro compound; monofluorobenzenes | anxiolytic drug; GABAA receptor agonist; sedative |
fluorouracil | [no description available] | medium | 7 | 0 | nucleobase analogue; organofluorine compound | antimetabolite; antineoplastic agent; environmental contaminant; immunosuppressive agent; radiosensitizing agent; xenobiotic |
fluoxetine | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; aromatic ether; secondary amino compound | |
fomepizole | [no description available] | medium | 1 | 0 | pyrazoles | antidote; EC 1.1.1.1 (alcohol dehydrogenase) inhibitor; protective agent |
gemfibrozil | [no description available] | medium | 3 | 0 | aromatic ether | antilipemic drug |
glafenine | [no description available] | medium | 2 | 0 | aminoquinoline; carboxylic ester; glycol; organochlorine compound; secondary amino compound | inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
glutethimide | [no description available] | medium | 1 | 0 | piperidines | |
gossypol | [no description available] | medium | 1 | 0 | | |
guaiazulene | [no description available] | medium | 1 | 0 | sesquiterpene | |
fasudil | [no description available] | medium | 1 | 0 | isoquinolines; N-sulfonyldiazepane | antihypertensive agent; calcium channel blocker; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; geroprotector; neuroprotective agent; nootropic agent; vasodilator agent |
halothane | [no description available] | medium | 1 | 0 | haloalkane; organobromine compound; organochlorine compound; organofluorine compound | inhalation anaesthetic |
hexachlorophene | [no description available] | medium | 2 | 0 | bridged diphenyl fungicide; polyphenol; trichlorobenzene | acaricide; antibacterial agent; antifungal agrochemical; antiseptic drug |
miltefosine | [no description available] | medium | 1 | 0 | phosphocholines; phospholipid | anti-inflammatory agent; anticoronaviral agent; antifungal agent; antineoplastic agent; antiprotozoal drug; apoptosis inducer; immunomodulator; protein kinase inhibitor |
hexestrol | [no description available] | medium | 1 | 0 | stilbenoid | |
hexetidine | [no description available] | medium | 1 | 0 | organic heteromonocyclic compound; organonitrogen heterocyclic compound | |
hexobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
hydralazine | [no description available] | medium | 1 | 0 | azaarene; hydrazines; ortho-fused heteroarene; phthalazines | antihypertensive agent; vasodilator agent |
hydroxyurea | [no description available] | medium | 3 | 0 | one-carbon compound; ureas | antimetabolite; antimitotic; antineoplastic agent; DNA synthesis inhibitor; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; genotoxin; immunomodulator; radical scavenger; teratogenic agent |
hydroxyzine | [no description available] | medium | 1 | 0 | hydroxyether; monochlorobenzenes; N-alkylpiperazine | anticoronaviral agent; antipruritic drug; anxiolytic drug; dermatologic drug; H1-receptor antagonist |
phenelzine | [no description available] | medium | 1 | 0 | primary amine | |
alverine | [no description available] | medium | 1 | 0 | tertiary amine | antispasmodic drug |
idebenone | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; primary alcohol | antioxidant; ferroptosis inhibitor |
ifosfamide | [no description available] | medium | 2 | 0 | ifosfamides | alkylating agent; antineoplastic agent; environmental contaminant; immunosuppressive agent; xenobiotic |
amrinone | [no description available] | medium | 3 | 0 | bipyridines | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor |
indapamide | [no description available] | medium | 3 | 0 | indoles; organochlorine compound; sulfonamide | antihypertensive agent; diuretic |
iohexol | [no description available] | medium | 2 | 0 | benzenedicarboxamide; organoiodine compound | environmental contaminant; radioopaque medium; xenobiotic |
iodipamide | [no description available] | medium | 1 | 0 | benzoic acids; organoiodine compound; secondary carboxamide | radioopaque medium |
iproniazid | [no description available] | medium | 4 | 0 | carbohydrazide; pyridines | |
avapro | [no description available] | medium | 2 | 0 | azaspiro compound; biphenylyltetrazole | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
isoflurane | [no description available] | medium | 1 | 0 | organofluorine compound | inhalation anaesthetic |
2-propanol | [no description available] | medium | 1 | 0 | secondary alcohol; secondary fatty alcohol | protic solvent |
isoproterenol | [no description available] | medium | 2 | 0 | catechols; secondary alcohol; secondary amino compound | beta-adrenergic agonist; bronchodilator agent; cardiotonic drug; sympathomimetic agent |
isoxsuprine | [no description available] | medium | 1 | 0 | alkylbenzene | |
ketamine | [no description available] | medium | 3 | 0 | cyclohexanones; monochlorobenzenes; secondary amino compound | analgesic; environmental contaminant; intravenous anaesthetic; neurotoxin; NMDA receptor antagonist; xenobiotic |
ketanserin | [no description available] | medium | 3 | 0 | aromatic ketone; organofluorine compound; piperidines; quinazolines | alpha-adrenergic antagonist; antihypertensive agent; cardiovascular drug; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; serotonergic antagonist |
khellin | [no description available] | medium | 1 | 0 | furanochromone; organic heterotricyclic compound; oxacycle | anti-asthmatic agent; bronchodilator agent; cardiovascular drug; vasodilator agent |
beta-lapachone | [no description available] | medium | 1 | 0 | benzochromenone; orthoquinones | anti-inflammatory agent; antineoplastic agent; plant metabolite |
leflunomide | [no description available] | medium | 3 | 0 | (trifluoromethyl)benzenes; isoxazoles; monocarboxylic acid amide | antineoplastic agent; antiparasitic agent; EC 1.3.98.1 [dihydroorotate oxidase (fumarate)] inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; hepatotoxic agent; immunosuppressive agent; non-steroidal anti-inflammatory drug; prodrug; pyrimidine synthesis inhibitor; tyrosine kinase inhibitor |
lofepramine | [no description available] | medium | 2 | 0 | aromatic ketone; dibenzoazepine; monochlorobenzenes; tertiary amino compound | antidepressant |
lomustine | [no description available] | medium | 2 | 0 | N-nitrosoureas; organochlorine compound | alkylating agent; antineoplastic agent |
losartan | [no description available] | medium | 2 | 0 | biphenylyltetrazole; imidazoles | angiotensin receptor antagonist; anti-arrhythmia drug; antihypertensive agent; endothelin receptor antagonist |
malathion | [no description available] | medium | 1 | 0 | diester; ethyl ester; organic thiophosphate | |
diisopropyl 1,3-dithiol-2-ylidenemalonate | [no description available] | medium | 1 | 0 | isopropyl ester | |
mazindol | [no description available] | medium | 1 | 0 | organic molecular entity | |
mebendazole | [no description available] | medium | 2 | 0 | aromatic ketone; benzimidazoles; carbamate ester | antinematodal drug; microtubule-destabilising agent; tubulin modulator |
meclizine | [no description available] | medium | 1 | 0 | diarylmethane | |
meclofenoxate | [no description available] | medium | 1 | 0 | monocarboxylic acid | |
vitamin k 3 | [no description available] | medium | 3 | 0 | 1,4-naphthoquinones; vitamin K | angiogenesis inhibitor; antineoplastic agent; EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor; human urinary metabolite; nutraceutical |
meperidine | [no description available] | medium | 1 | 0 | ethyl ester; piperidinecarboxylate ester; tertiary amino compound | antispasmodic drug; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
mephenytoin | [no description available] | medium | 1 | 0 | imidazolidine-2,4-dione | anticonvulsant |
mepivacaine | [no description available] | medium | 1 | 0 | piperidinecarboxamide | drug allergen; local anaesthetic |
meprobamate | [no description available] | medium | 1 | 0 | organic molecular entity | |
metformin | [no description available] | medium | 3 | 0 | guanidines | environmental contaminant; geroprotector; hypoglycemic agent; xenobiotic |
methadone | [no description available] | medium | 3 | 0 | benzenes; diarylmethane; ketone; tertiary amino compound | |
methadone | [no description available] | medium | 3 | 1 | benzenes; diarylmethane; ketone; tertiary amino compound | |
methoxsalen | [no description available] | medium | 1 | 0 | aromatic ether; psoralens | antineoplastic agent; cross-linking reagent; dermatologic drug; photosensitizing agent; plant metabolite |
methoxyflurane | [no description available] | medium | 1 | 0 | ether; organochlorine compound; organofluorine compound | hepatotoxic agent; inhalation anaesthetic; nephrotoxic agent; non-narcotic analgesic |
methyl salicylate | [no description available] | medium | 1 | 0 | benzoate ester; methyl ester; salicylates | flavouring agent; insect attractant; metabolite |
methylphenidate | [no description available] | medium | 1 | 0 | beta-amino acid ester; methyl ester; piperidines | |
methyprylon | [no description available] | medium | 1 | 0 | organic molecular entity | |
metoclopramide | [no description available] | medium | 3 | 0 | benzamides; monochlorobenzenes; substituted aniline; tertiary amino compound | antiemetic; dopaminergic antagonist; environmental contaminant; gastrointestinal drug; xenobiotic |
metyrapone | [no description available] | medium | 2 | 0 | aromatic ketone | antimetabolite; diagnostic agent; EC 1.14.15.4 (steroid 11beta-monooxygenase) inhibitor |
mianserin | [no description available] | medium | 1 | 0 | dibenzoazepine | adrenergic uptake inhibitor; alpha-adrenergic antagonist; antidepressant; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; geroprotector; H1-receptor antagonist; histamine agonist; sedative; serotonergic antagonist |
miconazole | [no description available] | medium | 4 | 0 | dichlorobenzene; ether; imidazoles | |
midazolam | [no description available] | medium | 3 | 0 | imidazobenzodiazepine; monofluorobenzenes; organochlorine compound | anticonvulsant; antineoplastic agent; anxiolytic drug; apoptosis inducer; central nervous system depressant; GABAA receptor agonist; general anaesthetic; muscle relaxant; sedative |
minoxidil | [no description available] | medium | 3 | 0 | dialkylarylamine; tertiary amino compound | |
mirtazapine | [no description available] | medium | 2 | 0 | benzazepine; tetracyclic antidepressant | alpha-adrenergic antagonist; anxiolytic drug; H1-receptor antagonist; histamine antagonist; oneirogen; serotonergic antagonist |
mitotane | [no description available] | medium | 1 | 0 | diarylmethane | |
modafinil | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; sulfoxide | |
moxisylyte | [no description available] | medium | 1 | 0 | monoterpenoid | |
deet | [no description available] | medium | 1 | 0 | benzamides; monocarboxylic acid amide | environmental contaminant; insect repellent; xenobiotic |
nabumetone | [no description available] | medium | 1 | 0 | methoxynaphthalene; methyl ketone | cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
nefazodone | [no description available] | medium | 4 | 0 | aromatic ether; monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; triazoles | alpha-adrenergic antagonist; analgesic; antidepressant; serotonergic antagonist; serotonin uptake inhibitor |
nialamide | [no description available] | medium | 3 | 0 | organonitrogen compound; organooxygen compound | |
niceritrol | [no description available] | medium | 1 | 0 | organic molecular entity | |
nifedipine | [no description available] | medium | 4 | 0 | C-nitro compound; dihydropyridine; methyl ester | calcium channel blocker; human metabolite; tocolytic agent; vasodilator agent |
niflumic acid | [no description available] | medium | 1 | 0 | aromatic carboxylic acid; pyridines | |
nilutamide | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; imidazolidinone | androgen antagonist; antineoplastic agent |
nimesulide | [no description available] | medium | 2 | 0 | aromatic ether; C-nitro compound; sulfonamide | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
nimodipine | [no description available] | medium | 4 | 0 | 2-methoxyethyl ester; C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; isopropyl ester | antihypertensive agent; calcium channel blocker; cardiovascular drug; vasodilator agent |
nisoldipine | [no description available] | medium | 2 | 0 | C-nitro compound; dicarboxylic acids and O-substituted derivatives; diester; dihydropyridine; methyl ester | |
nitrazepam | [no description available] | medium | 3 | 0 | 1,4-benzodiazepinone; C-nitro compound | anticonvulsant; antispasmodic drug; drug metabolite; GABA modulator; sedative |
nitroglycerin | [no description available] | medium | 1 | 0 | nitroglycerol | explosive; muscle relaxant; nitric oxide donor; prodrug; tocolytic agent; vasodilator agent; xenobiotic |
masoprocol | [no description available] | medium | 1 | 0 | catechols; lignan; tetrol | antioxidant; ferroptosis inhibitor; geroprotector; plant metabolite |
nortriptyline | [no description available] | medium | 3 | 0 | organic tricyclic compound; secondary amine | adrenergic uptake inhibitor; analgesic; antidepressant; antineoplastic agent; apoptosis inducer; drug metabolite |
orphenadrine | [no description available] | medium | 1 | 0 | ether; tertiary amino compound | antidyskinesia agent; antiparkinson drug; H1-receptor antagonist; muscarinic antagonist; muscle relaxant; NMDA receptor antagonist; parasympatholytic |
oxamniquine | [no description available] | medium | 1 | 0 | aromatic primary alcohol; C-nitro compound; quinolines; secondary amino compound | |
oxaprozin | [no description available] | medium | 2 | 0 | 1,3-oxazoles; monocarboxylic acid | analgesic; non-steroidal anti-inflammatory drug |
oxethazaine | [no description available] | medium | 1 | 0 | amino acid amide | |
oxybenzone | [no description available] | medium | 1 | 0 | hydroxybenzophenone; monomethoxybenzene | dermatologic drug; environmental contaminant; protective agent; ultraviolet filter; xenobiotic |
pantoprazole | [no description available] | medium | 2 | 0 | aromatic ether; benzimidazoles; organofluorine compound; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; environmental contaminant; xenobiotic |
pemoline | [no description available] | medium | 2 | 0 | 1,3-oxazoles | central nervous system stimulant |
pentobarbital | [no description available] | medium | 1 | 0 | barbiturates | GABAA receptor agonist |
pentoxifylline | [no description available] | medium | 4 | 0 | oxopurine | |
perazine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-methylpiperazine; phenothiazines | dopaminergic antagonist; phenothiazine antipsychotic drug |
perphenazine | [no description available] | medium | 3 | 0 | N-(2-hydroxyethyl)piperazine; N-alkylpiperazine; organochlorine compound; phenothiazines | antiemetic; dopaminergic antagonist; phenothiazine antipsychotic drug |
phenolphthalein | [no description available] | medium | 1 | 0 | phenols | |
phenoxybenzamine | [no description available] | medium | 1 | 0 | aromatic amine | |
moxonidine | [no description available] | medium | 1 | 0 | organohalogen compound; pyrimidines | |
pinacidil | [no description available] | medium | 2 | 0 | pyridines | |
pipemidic acid | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; N-arylpiperazine; pyridopyrimidine; quinolone antibiotic | antibacterial drug; DNA synthesis inhibitor |
piperazine | [no description available] | medium | 1 | 0 | azacycloalkane; piperazines; saturated organic heteromonocyclic parent | anthelminthic drug |
praziquantel | [no description available] | medium | 3 | 0 | isoquinolines | |
primaquine | [no description available] | medium | 3 | 0 | aminoquinoline; aromatic ether; N-substituted diamine | antimalarial |
primidone | [no description available] | medium | 2 | 0 | pyrimidone | anticonvulsant; environmental contaminant; xenobiotic |
probucol | [no description available] | medium | 1 | 0 | dithioketal; polyphenol | anti-inflammatory drug; anticholesteremic drug; antilipemic drug; antioxidant; cardiovascular drug |
procainamide | [no description available] | medium | 3 | 0 | benzamides | anti-arrhythmia drug; platelet aggregation inhibitor; sodium channel blocker |
procarbazine | [no description available] | medium | 1 | 0 | benzamides; hydrazines | antineoplastic agent |
prochlorperazine | [no description available] | medium | 3 | 0 | N-alkylpiperazine; N-methylpiperazine; organochlorine compound; phenothiazines | alpha-adrenergic antagonist; antiemetic; cholinergic antagonist; dopamine receptor D2 antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; first generation antipsychotic |
promethazine | [no description available] | medium | 3 | 0 | phenothiazines; tertiary amine | anti-allergic agent; anticoronaviral agent; antiemetic; antipruritic drug; H1-receptor antagonist; local anaesthetic; sedative |
propofol | [no description available] | medium | 1 | 0 | phenols | anticonvulsant; antiemetic; intravenous anaesthetic; radical scavenger; sedative |
pyridinolcarbamate | [no description available] | medium | 1 | 0 | pyridines | |
pyrimethamine | [no description available] | medium | 1 | 0 | aminopyrimidine; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
opc 12759 | [no description available] | medium | 1 | 0 | secondary carboxamide | |
riluzole | [no description available] | medium | 2 | 0 | benzothiazoles | |
risperidone | [no description available] | medium | 3 | 0 | 1,2-benzoxazoles; heteroarylpiperidine; organofluorine compound; pyridopyrimidine | alpha-adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; H1-receptor antagonist; psychotropic drug; second generation antipsychotic; serotonergic antagonist |
rofecoxib | [no description available] | medium | 3 | 0 | butenolide; sulfone | analgesic; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
salicylamide | [no description available] | medium | 1 | 0 | phenols; salicylamides | antirheumatic drug; non-narcotic analgesic |
sevoflurane | [no description available] | medium | 1 | 0 | ether; organofluorine compound | central nervous system depressant; inhalation anaesthetic; platelet aggregation inhibitor |
sibutramine | [no description available] | medium | 1 | 0 | organochlorine compound; tertiary amino compound | anti-obesity agent; serotonin uptake inhibitor |
sulfadiazine | [no description available] | medium | 8 | 0 | pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; antiprotozoal drug; coccidiostat; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
sulfadiazine | [no description available] | medium | 8 | 1 | pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; antiprotozoal drug; coccidiostat; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; xenobiotic |
4-phenylbutyric acid, sodium salt | [no description available] | medium | 1 | 0 | organic sodium salt | EC 3.5.1.98 (histone deacetylase) inhibitor; geroprotector; neuroprotective agent; orphan drug; prodrug |
vorinostat | [no description available] | medium | 2 | 0 | dicarboxylic acid diamide; hydroxamic acid | antineoplastic agent; apoptosis inducer; EC 3.5.1.98 (histone deacetylase) inhibitor |
sulfadimethoxine | [no description available] | medium | 2 | 0 | aromatic ether; pyrimidines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; antimicrobial agent; drug allergen; environmental contaminant; xenobiotic |
sulfamerazine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent; drug allergen |
sulfameter | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antiinfective agent; leprostatic drug; renal agent |
sulfamethazine | [no description available] | medium | 2 | 0 | pyrimidines; sulfonamide antibiotic; sulfonamide | antibacterial drug; antiinfective agent; antimicrobial agent; carcinogenic agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; ligand; xenobiotic |
sulfamethizole | [no description available] | medium | 1 | 0 | sulfonamide antibiotic; sulfonamide; thiadiazoles | antiinfective agent; antimicrobial agent; drug allergen; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
sulfamethoxazole | [no description available] | medium | 18 | 0 | isoxazoles; substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; antiinfective agent; antimicrobial agent; drug allergen; EC 1.1.1.153 [sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming)] inhibitor; EC 2.5.1.15 (dihydropteroate synthase) inhibitor; environmental contaminant; epitope; P450 inhibitor; xenobiotic |
sulfanilamide | [no description available] | medium | 1 | 0 | substituted aniline; sulfonamide antibiotic; sulfonamide | antibacterial agent; drug allergen; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
sulfapyridine | [no description available] | medium | 1 | 0 | pyridines; substituted aniline; sulfonamide antibiotic; sulfonamide | antiinfective agent; dermatologic drug; drug allergen; environmental contaminant; xenobiotic |
2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol | [no description available] | medium | 1 | 0 | alkylbenzene | |
sulpiride | [no description available] | medium | 2 | 0 | benzamides; N-alkylpyrrolidine; sulfonamide | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
suprofen | [no description available] | medium | 1 | 0 | aromatic ketone; monocarboxylic acid; thiophenes | antirheumatic drug; drug allergen; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
suramin | [no description available] | medium | 2 | 0 | naphthalenesulfonic acid; phenylureas; secondary carboxamide | angiogenesis inhibitor; antinematodal drug; antineoplastic agent; apoptosis inhibitor; EC 2.7.11.13 (protein kinase C) inhibitor; GABA antagonist; GABA-gated chloride channel antagonist; purinergic receptor P2 antagonist; ryanodine receptor agonist; trypanocidal drug |
gatifloxacin | [no description available] | medium | 5 | 0 | N-arylpiperazine; organofluorine compound; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antiinfective agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
tegafur | [no description available] | medium | 1 | 0 | organohalogen compound; pyrimidines | |
temazepam | [no description available] | medium | 1 | 0 | benzodiazepine | |
temozolomide | [no description available] | medium | 2 | 0 | imidazotetrazine; monocarboxylic acid amide; triazene derivative | alkylating agent; antineoplastic agent; prodrug |
terbutaline | [no description available] | medium | 3 | 0 | phenylethanolamines; resorcinols | anti-asthmatic drug; beta-adrenergic agonist; bronchodilator agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; hypoglycemic agent; sympathomimetic agent; tocolytic agent |
thalidomide | [no description available] | medium | 1 | 0 | phthalimides; piperidones | |
thiabendazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; benzimidazole fungicide; benzimidazoles | antifungal agrochemical; antinematodal drug |
tiaprofenic acid | [no description available] | medium | 1 | 0 | aromatic ketone; monocarboxylic acid; thiophenes | drug allergen; non-steroidal anti-inflammatory drug |
ticlopidine | [no description available] | medium | 2 | 0 | monochlorobenzenes; thienopyridine | anticoagulant; fibrin modulating drug; hematologic agent; P2Y12 receptor antagonist; platelet aggregation inhibitor |
tiopronin | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
tizanidine | [no description available] | medium | 3 | 0 | benzothiadiazole; imidazoles | alpha-adrenergic agonist; muscle relaxant |
tolperisone | [no description available] | medium | 1 | 0 | aromatic ketone | |
tranexamic acid | [no description available] | medium | 1 | 0 | amino acid | |
trazodone | [no description available] | medium | 3 | 0 | monochlorobenzenes; N-alkylpiperazine; N-arylpiperazine; triazolopyridine | adrenergic antagonist; antidepressant; anxiolytic drug; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
triclosan | [no description available] | medium | 1 | 0 | aromatic ether; dichlorobenzene; monochlorobenzenes; phenols | antibacterial agent; antimalarial; drug allergen; EC 1.3.1.9 [enoyl-[acyl-carrier-protein] reductase (NADH)] inhibitor; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; fungicide; persistent organic pollutant; xenobiotic |
trimethadione | [no description available] | medium | 1 | 0 | oxazolidinone | anticonvulsant; geroprotector |
troglitazone | [no description available] | medium | 4 | 0 | chromanes; thiazolidinone | anticoagulant; anticonvulsant; antineoplastic agent; antioxidant; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; hypoglycemic agent; platelet aggregation inhibitor; vasodilator agent |
venlafaxine | [no description available] | medium | 3 | 0 | cyclohexanols; monomethoxybenzene; tertiary alcohol; tertiary amino compound | adrenergic uptake inhibitor; analgesic; antidepressant; dopamine uptake inhibitor; environmental contaminant; serotonin uptake inhibitor; xenobiotic |
vesnarinone | [no description available] | medium | 1 | 0 | organic molecular entity | |
vigabatrin | [no description available] | medium | 2 | 0 | gamma-amino acid | anticonvulsant; EC 2.6.1.19 (4-aminobutyrate--2-oxoglutarate transaminase) inhibitor |
ici 204,219 | [no description available] | medium | 2 | 0 | carbamate ester; indoles; N-sulfonylcarboxamide | anti-asthmatic agent; leukotriene antagonist |
zolpidem | [no description available] | medium | 1 | 0 | imidazopyridine | central nervous system depressant; GABA agonist; sedative |
guanidine hydrochloride | [no description available] | medium | 1 | 0 | one-carbon compound; organic chloride salt | protein denaturant |
hydrocortisone acetate | [no description available] | medium | 2 | 0 | cortisol ester; tertiary alpha-hydroxy ketone | |
cortisone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
mitomycin | [no description available] | medium | 1 | 0 | mitomycin | alkylating agent; antineoplastic agent |
estriol | [no description available] | medium | 1 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
phentolamine | [no description available] | medium | 2 | 0 | imidazoles; phenols; substituted aniline; tertiary amino compound | alpha-adrenergic antagonist; vasodilator agent |
sorbitol | [no description available] | medium | 1 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
floxuridine | [no description available] | medium | 1 | 0 | nucleoside analogue; organofluorine compound; pyrimidine 2'-deoxyribonucleoside | antimetabolite; antineoplastic agent; antiviral drug; radiosensitizing agent |
piperonyl butoxide | [no description available] | medium | 1 | 0 | benzodioxoles | pesticide synergist |
bromouracil | [no description available] | medium | 1 | 0 | nucleobase analogue; pyrimidines | mutagen |
3,3',5-triiodothyroacetic acid | [no description available] | medium | 1 | 0 | | |
histamine dihydrochloride | [no description available] | medium | 1 | 0 | | |
thyroxine | [no description available] | medium | 1 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
dextroamphetamine | [no description available] | medium | 1 | 0 | 1-phenylpropan-2-amine | adrenergic agent; adrenergic uptake inhibitor; dopamine uptake inhibitor; dopaminergic agent; neurotoxin; sympathomimetic agent |
carbachol | [no description available] | medium | 1 | 0 | ammonium salt; carbamate ester | cardiotonic drug; miotic; muscarinic agonist; nicotinic acetylcholine receptor agonist; non-narcotic analgesic |
norethindrone acetate | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; acetate ester; terminal acetylenic compound | progestin; synthetic oral contraceptive |
cyclobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
allobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
penicillamine | [no description available] | medium | 3 | 0 | non-proteinogenic alpha-amino acid; penicillamine | antirheumatic drug; chelator; copper chelator; drug allergen |
trichlorfon | [no description available] | medium | 1 | 0 | organic phosphonate; organochlorine compound; phosphonic ester | agrochemical; anthelminthic drug; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; insecticide |
estrone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-hydroxy steroid; phenolic steroid; phenols | antineoplastic agent; bone density conservation agent; estrogen; human metabolite; mouse metabolite |
oxandrolone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo steroid; anabolic androgenic steroid; oxa-steroid | anabolic agent; androgen |
dehydroepiandrosterone | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
nad | [no description available] | medium | 1 | 0 | NAD | geroprotector |
pilocarpine | [no description available] | medium | 1 | 0 | pilocarpine | antiglaucoma drug |
triiodothyronine | [no description available] | medium | 1 | 0 | 2-halophenol; amino acid zwitterion; iodophenol; iodothyronine | human metabolite; mouse metabolite; thyroid hormone |
glutamine | [no description available] | high | 3 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
cetrimonium bromide | [no description available] | medium | 3 | 0 | organic bromide salt; quaternary ammonium salt | detergent; surfactant |
physostigmine | [no description available] | medium | 2 | 0 | carbamate ester; indole alkaloid | antidote to curare poisoning; EC 3.1.1.8 (cholinesterase) inhibitor; miotic |
sucrose | [no description available] | high | 4 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
testosterone propionate | [no description available] | medium | 1 | 0 | steroid ester | |
apomorphine | [no description available] | medium | 3 | 0 | aporphine alkaloid | alpha-adrenergic drug; antidyskinesia agent; antiparkinson drug; dopamine agonist; emetic; serotonergic drug |
aminopyrine | [no description available] | medium | 1 | 0 | pyrazolone; tertiary amino compound | antipyretic; environmental contaminant; non-narcotic analgesic; non-steroidal anti-inflammatory drug; xenobiotic |
methyltestosterone | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; enone | anabolic agent; androgen; antineoplastic agent |
tetrabenazine | [no description available] | medium | 1 | 0 | benzoquinolizine; cyclic ketone; tertiary amino compound | |
uridine | [no description available] | medium | 4 | 0 | uridines | drug metabolite; fundamental metabolite; human metabolite |
phenylephrine | [no description available] | medium | 1 | 0 | phenols; phenylethanolamines; secondary amino compound | alpha-adrenergic agonist; cardiotonic drug; mydriatic agent; nasal decongestant; protective agent; sympathomimetic agent; vasoconstrictor agent |
levodopa | [no description available] | medium | 2 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
niridazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; C-nitro compound | |
carbaryl | [no description available] | medium | 1 | 0 | carbamate ester; naphthalenes | acaricide; agrochemical; carbamate insecticide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; plant growth retardant |
lactose | [no description available] | medium | 2 | 0 | lactose | |
methionine | [no description available] | medium | 21 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
Mebutamate | [no description available] | medium | 1 | 0 | organic molecular entity | |
norethindrone | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound; tertiary alcohol | progestin; synthetic oral contraceptive |
norethynodrel | [no description available] | medium | 1 | 0 | oxo steroid | |
benziodarone | [no description available] | medium | 1 | 0 | aromatic ketone | |
mannitol | [no description available] | high | 2 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
cytarabine | [no description available] | medium | 2 | 0 | beta-D-arabinoside; monosaccharide derivative; pyrimidine nucleoside | antimetabolite; antineoplastic agent; antiviral agent; immunosuppressive agent |
medroxyprogesterone acetate | [no description available] | medium | 2 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; corticosteroid; steroid ester | adjuvant; androgen; antineoplastic agent; antioxidant; female contraceptive drug; inhibitor; progestin; synthetic oral contraceptive |
mestranol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; aromatic ether; terminal acetylenic compound | prodrug; xenoestrogen |
methaqualone | [no description available] | medium | 1 | 0 | quinazolines | GABA agonist; sedative |
trypan blue | [no description available] | medium | 1 | 0 | | |
cordycepin | [no description available] | medium | 1 | 0 | 3'-deoxyribonucleoside; adenosines | antimetabolite; nucleoside antibiotic |
arginine | [no description available] | high | 3 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
trichloroacetic acid | [no description available] | medium | 2 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
triamcinolone acetonide | [no description available] | medium | 5 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; cyclic ketal; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
allylpropymal | [no description available] | medium | 1 | 0 | barbiturates | |
butobarbital | [no description available] | medium | 1 | 0 | barbiturates | |
trichloroethylene | [no description available] | medium | 1 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
dehydrocholic acid | [no description available] | medium | 2 | 0 | 12-oxo steroid; 3-oxo-5beta-steroid; 7-oxo steroid; oxo-5beta-cholanic acid | gastrointestinal drug |
isosorbide dinitrate | [no description available] | medium | 1 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
synephrine | [no description available] | medium | 1 | 0 | ethanolamines; phenethylamine alkaloid; phenols | alpha-adrenergic agonist; plant metabolite |
benzoyl peroxide | [no description available] | medium | 2 | 0 | carbonyl compound | |
benzoyl peroxide | [no description available] | medium | 2 | 1 | carbonyl compound | |
furan | [no description available] | medium | 1 | 0 | furans; mancude organic heteromonocyclic parent; monocyclic heteroarene | carcinogenic agent; hepatotoxic agent; Maillard reaction product |
ergotamine | [no description available] | medium | 1 | 0 | peptide ergot alkaloid | alpha-adrenergic agonist; mycotoxin; non-narcotic analgesic; oxytocic; serotonergic agonist; vasoconstrictor agent |
neostigmine bromide | [no description available] | medium | 1 | 0 | bromide salt | |
mephobarbital | [no description available] | medium | 1 | 0 | barbiturates | anticonvulsant |
hexachlorobenzene | [no description available] | medium | 1 | 0 | aromatic fungicide; chlorobenzenes | antifungal agrochemical; carcinogenic agent; persistent organic pollutant |
trinitrotoluene | [no description available] | medium | 1 | 0 | trinitrotoluene | explosive |
pyrazolanthrone | [no description available] | medium | 1 | 0 | anthrapyrazole; aromatic ketone; cyclic ketone | antineoplastic agent; c-Jun N-terminal kinase inhibitor; geroprotector |
meglumine | [no description available] | medium | 2 | 0 | hexosamine; secondary amino compound | |
cinchophen | [no description available] | medium | 2 | 0 | quinolines | |
yohimbine | [no description available] | medium | 1 | 0 | methyl 17-hydroxy-20xi-yohimban-16-carboxylate | alpha-adrenergic antagonist; dopamine receptor D2 antagonist; serotonergic antagonist |
mequinol | [no description available] | medium | 1 | 0 | methoxybenzenes; phenols | metabolite |
quinestrol | [no description available] | medium | 1 | 0 | 17-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
dydrogesterone | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid | progestin |
ephedrine | [no description available] | medium | 1 | 0 | phenethylamine alkaloid; phenylethanolamines | bacterial metabolite; environmental contaminant; nasal decongestant; plant metabolite; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
chlormadinone acetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
2,3-dimercaptosuccinic acid | [no description available] | medium | 1 | 0 | | |
evans blue | [no description available] | medium | 1 | 0 | organic sodium salt | fluorochrome; histological dye; sodium channel blocker; teratogenic agent |
testosterone enanthate | [no description available] | medium | 1 | 0 | heptanoate ester; sterol ester | androgen |
aminophylline | [no description available] | medium | 2 | 0 | mixture | bronchodilator agent; cardiotonic drug |
azacitidine | [no description available] | medium | 1 | 0 | N-glycosyl-1,3,5-triazine; nucleoside analogue | antineoplastic agent |
phenyramidol | [no description available] | medium | 1 | 0 | aminopyridine | |
carbutamide | [no description available] | medium | 1 | 0 | benzenes; sulfonamide | |
nandrolone decanoate | [no description available] | medium | 1 | 0 | steroid ester | |
bucladesine | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; butanamides; butyrate ester | agonist; cardiotonic drug; vasodilator agent |
betamethasone | [no description available] | medium | 34 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic agent; anti-inflammatory drug; immunosuppressive agent |
betamethasone | [no description available] | medium | 34 | 9 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-asthmatic agent; anti-inflammatory drug; immunosuppressive agent |
perflubron | [no description available] | medium | 1 | 0 | haloalkane; organobromine compound; perfluorinated compound | blood substitute; radioopaque medium |
cyproterone acetate | [no description available] | medium | 1 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; chlorinated steroid; steroid ester | androgen antagonist; geroprotector; progestin |
dextropropoxyphene | [no description available] | medium | 1 | 0 | 1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propanoate | mu-opioid receptor agonist; opioid analgesic |
glycyrrhetinic acid | [no description available] | medium | 1 | 0 | cyclic terpene ketone; hydroxy monocarboxylic acid; pentacyclic triterpenoid | immunomodulator; plant metabolite |
dihydralazine | [no description available] | medium | 2 | 0 | phthalazines | |
phenylpropanolamine | [no description available] | medium | 1 | 0 | amphetamines; phenethylamine alkaloid | plant metabolite |
dihydroergotamine | [no description available] | medium | 1 | 0 | ergot alkaloid; semisynthetic derivative | dopamine agonist; non-narcotic analgesic; serotonergic agonist; sympatholytic agent; vasoconstrictor agent |
podophyllotoxin | [no description available] | medium | 1 | 0 | furonaphthodioxole; lignan; organic heterotetracyclic compound | antimitotic; antineoplastic agent; keratolytic drug; microtubule-destabilising agent; plant metabolite; tubulin modulator |
hesperidin | [no description available] | medium | 1 | 0 | 3'-hydroxyflavanones; 4'-methoxyflavanones; dihydroxyflavanone; disaccharide derivative; flavanone glycoside; monomethoxyflavanone; rutinoside | mutagen |
chlormethiazole | [no description available] | medium | 1 | 0 | thiazoles | |
methamphetamine | [no description available] | medium | 1 | 0 | amphetamines; secondary amine | central nervous system stimulant; environmental contaminant; neurotoxin; psychotropic drug; xenobiotic |
hematoporphyrin | [no description available] | medium | 1 | 0 | | |
lactulose | [no description available] | medium | 1 | 0 | glycosylfructose | gastrointestinal drug; laxative |
megestrol acetate | [no description available] | medium | 2 | 0 | 20-oxo steroid; 3-oxo-Delta(4) steroid; acetate ester; steroid ester | antineoplastic agent; appetite enhancer; contraceptive drug; progestin; synthetic oral contraceptive |
acetylcysteine | [no description available] | medium | 2 | 0 | acetylcysteine; L-cysteine derivative; N-acetyl-L-amino acid | antidote to paracetamol poisoning; antiinfective agent; antioxidant; antiviral drug; ferroptosis inhibitor; geroprotector; human metabolite; mucolytic; radical scavenger; vulnerary |
erythromycin stearate | [no description available] | medium | 1 | 0 | aminoglycoside | |
estradiol valerate | [no description available] | medium | 1 | 0 | steroid ester | |
d-alpha tocopherol | [no description available] | medium | 1 | 0 | alpha-tocopherol | algal metabolite; antiatherogenic agent; anticoagulant; antioxidant; antiviral agent; EC 2.7.11.13 (protein kinase C) inhibitor; immunomodulator; micronutrient; nutraceutical; plant metabolite |
dronabinol | [no description available] | medium | 1 | 0 | benzochromene; diterpenoid; phytocannabinoid; polyketide | cannabinoid receptor agonist; epitope; hallucinogen; metabolite; non-narcotic analgesic |
pimozide | [no description available] | medium | 2 | 0 | benzimidazoles; heteroarylpiperidine; organofluorine compound | antidyskinesia agent; dopaminergic antagonist; first generation antipsychotic; H1-receptor antagonist; serotonergic antagonist |
sulfadoxine | [no description available] | medium | 1 | 0 | pyrimidines; sulfonamide | antibacterial drug; antimalarial |
acadesine | [no description available] | medium | 1 | 0 | 1-ribosylimidazolecarboxamide; aminoimidazole; nucleoside analogue | antineoplastic agent; platelet aggregation inhibitor |
stavudine | [no description available] | medium | 2 | 0 | dihydrofuran; nucleoside analogue; organic molecular entity | antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
doxifluridine | [no description available] | medium | 1 | 0 | organofluorine compound; pyrimidine 5'-deoxyribonucleoside | antimetabolite; antineoplastic agent; prodrug |
iproclozide | [no description available] | medium | 1 | 0 | aromatic ether | |
cladribine | [no description available] | medium | 2 | 0 | organochlorine compound; purine 2'-deoxyribonucleoside | antineoplastic agent; immunosuppressive agent |
carbenicillin disodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
dehydroemetine | [no description available] | medium | 1 | 0 | aromatic ether; isoquinolines; pyridoisoquinoline | antileishmanial agent; antimalarial; antiprotozoal drug |
benorilate | [no description available] | medium | 1 | 0 | carbonyl compound | |
trimetazidine | [no description available] | medium | 1 | 0 | aromatic amine | |
vidarabine | [no description available] | medium | 1 | 0 | beta-D-arabinoside; purine nucleoside | antineoplastic agent; bacterial metabolite; nucleoside antibiotic |
tiadenol | [no description available] | medium | 1 | 0 | aliphatic sulfide | |
zalcitabine | [no description available] | medium | 4 | 0 | pyrimidine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; HIV-1 reverse transcriptase inhibitor |
stanozolol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; anabolic androgenic steroid; organic heteropentacyclic compound; tertiary alcohol | anabolic agent; androgen |
clodronic acid | [no description available] | medium | 1 | 0 | 1,1-bis(phosphonic acid); one-carbon compound; organochlorine compound | antineoplastic agent; bone density conservation agent |
xipamide | [no description available] | medium | 1 | 0 | benzamides | |
selegiline | [no description available] | medium | 1 | 0 | selegiline; terminal acetylenic compound | geroprotector |
levamisole | [no description available] | medium | 1 | 0 | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | antinematodal drug; antirheumatic drug; EC 3.1.3.1 (alkaline phosphatase) inhibitor; immunological adjuvant; immunomodulator |
thiamphenicol | [no description available] | medium | 2 | 0 | monocarboxylic acid amide; sulfone | antimicrobial agent; immunosuppressive agent |
pizotyline | [no description available] | medium | 1 | 0 | benzocycloheptathiophene | histamine antagonist; muscarinic antagonist; serotonergic antagonist |
isosorbide-5-mononitrate | [no description available] | medium | 1 | 0 | glucitol derivative; nitrate ester | nitric oxide donor; vasodilator agent |
danazol | [no description available] | medium | 2 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | anti-estrogen; estrogen antagonist; geroprotector |
daunorubicin | [no description available] | medium | 2 | 0 | aminoglycoside antibiotic; anthracycline; p-quinones; tetracenequinones | antineoplastic agent; bacterial metabolite |
carbimazole | [no description available] | medium | 1 | 0 | 1,3-dihydroimidazole-2-thiones; carbamate ester | antithyroid drug; prodrug |
bromocriptine | [no description available] | medium | 1 | 0 | indole alkaloid | antidyskinesia agent; antiparkinson drug; dopamine agonist; hormone antagonist |
triamcinolone | [no description available] | medium | 4 | 0 | 11beta-hydroxy steroid; 16alpha-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; fluorinated steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | anti-allergic agent; anti-inflammatory drug |
oxyphenisatin | [no description available] | medium | 1 | 0 | indoles | |
tetrachloroethylene | [no description available] | medium | 1 | 0 | chlorocarbon; chloroethenes | nephrotoxic agent |
ursodeoxycholic acid | [no description available] | medium | 1 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
butachlor | [no description available] | medium | 1 | 0 | aromatic amide; organochlorine compound; tertiary carboxamide | environmental contaminant; herbicide; xenobiotic |
rose bengal b disodium salt | [no description available] | medium | 1 | 0 | | |
glutamic acid | [no description available] | medium | 1 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
nicergoline | [no description available] | medium | 1 | 0 | organic heterotetracyclic compound; organonitrogen heterocyclic compound | |
oxcarbazepine | [no description available] | medium | 2 | 0 | cyclic ketone; dibenzoazepine | anticonvulsant; drug allergen |
amineptin | [no description available] | medium | 1 | 0 | amino acid; carbocyclic fatty acid; carbotricyclic compound; secondary amino compound | antidepressant; dopamine uptake inhibitor |
pirprofen | [no description available] | medium | 1 | 0 | pyrroline | |
paclitaxel | [no description available] | medium | 5 | 0 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
dobutamine | [no description available] | medium | 1 | 0 | catecholamine; secondary amine | beta-adrenergic agonist; cardiotonic drug; sympathomimetic agent |
ribavirin | [no description available] | medium | 2 | 0 | 1-ribosyltriazole; aromatic amide; monocarboxylic acid amide; primary carboxamide | anticoronaviral agent; antiinfective agent; antimetabolite; antiviral agent; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
ticrynafen | [no description available] | medium | 1 | 0 | aromatic ether; aromatic ketone; dichlorobenzene; monocarboxylic acid; thiophenes | antihypertensive agent; hepatotoxic agent; loop diuretic |
methyldopa | [no description available] | medium | 2 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | alpha-adrenergic agonist; antihypertensive agent; hapten; peripheral nervous system drug; sympatholytic agent |
bezafibrate | [no description available] | medium | 2 | 0 | aromatic ether; monocarboxylic acid amide; monocarboxylic acid; monochlorobenzenes | antilipemic drug; environmental contaminant; geroprotector; xenobiotic |
benoxaprofen | [no description available] | medium | 2 | 0 | 1,3-benzoxazoles; monocarboxylic acid; monochlorobenzenes | antipsoriatic; antipyretic; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; hepatotoxic agent; nephrotoxin; non-narcotic analgesic; non-steroidal anti-inflammatory drug; protein kinase C agonist |
permethrin | [no description available] | medium | 3 | 0 | cyclopropanecarboxylate ester; cyclopropanes | agrochemical; ectoparasiticide; pyrethroid ester acaricide; pyrethroid ester insecticide; scabicide |
permethrin | [no description available] | medium | 3 | 1 | cyclopropanecarboxylate ester; cyclopropanes | agrochemical; ectoparasiticide; pyrethroid ester acaricide; pyrethroid ester insecticide; scabicide |
pirfenidone | [no description available] | medium | 1 | 0 | pyridone | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
desogestrel | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | contraceptive drug; progestin; synthetic oral contraceptive |
muzolimine | [no description available] | medium | 1 | 0 | dichlorobenzene | |
epirubicin | [no description available] | medium | 1 | 0 | aminoglycoside; anthracycline antibiotic; anthracycline; deoxy hexoside; monosaccharide derivative; p-quinones; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | antimicrobial agent; antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
desflurane | [no description available] | medium | 1 | 0 | organofluorine compound | inhalation anaesthetic |
paroxetine | [no description available] | medium | 1 | 0 | aromatic ether; benzodioxoles; organofluorine compound; piperidines | antidepressant; anxiolytic drug; hepatotoxic agent; P450 inhibitor; serotonin uptake inhibitor |
foscarnet sodium | [no description available] | medium | 2 | 0 | one-carbon compound; organic sodium salt | antiviral drug |
moxalactam | [no description available] | medium | 1 | 0 | cephalosporin; oxacephem | antibacterial drug |
nicorandil | [no description available] | medium | 2 | 0 | nitrate ester; pyridinecarboxamide | potassium channel opener; vasodilator agent |
encainide | [no description available] | medium | 1 | 0 | benzamides; piperidines | anti-arrhythmia drug; sodium channel blocker |
cefaclor anhydrous | [no description available] | medium | 3 | 0 | cephalosporin | antibacterial drug; drug allergen |
miglustat | [no description available] | medium | 1 | 0 | piperidines; tertiary amino compound | anti-HIV agent; EC 2.4.1.80 (ceramide glucosyltransferase) inhibitor |
cefotetan | [no description available] | medium | 3 | 0 | | |
lovastatin | [no description available] | medium | 3 | 0 | delta-lactone; fatty acid ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | anticholesteremic drug; antineoplastic agent; Aspergillus metabolite; prodrug |
enoximone | [no description available] | medium | 2 | 0 | aromatic ketone | |
piritrexim | [no description available] | medium | 1 | 0 | | |
atomoxetine hydrochloride | [no description available] | medium | 2 | 0 | hydrochloride | adrenergic uptake inhibitor; antidepressant |
quinapril | [no description available] | medium | 2 | 0 | dicarboxylic acid monoester; ethyl ester; isoquinolines; tertiary carboxamide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
gepirone | [no description available] | medium | 1 | 0 | N-arylpiperazine | |
zileuton | [no description available] | medium | 3 | 0 | 1-benzothiophenes; ureas | anti-asthmatic drug; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; ferroptosis inhibitor; leukotriene antagonist; non-steroidal anti-inflammatory drug |
clopidogrel | [no description available] | medium | 1 | 0 | methyl ester; monochlorobenzenes; thienopyridine | anticoagulant; P2Y12 receptor antagonist; platelet aggregation inhibitor |
cidofovir anhydrous | [no description available] | medium | 2 | 0 | phosphonic acids; pyrimidone | anti-HIV agent; antineoplastic agent; antiviral drug; photosensitizing agent |
bromfenac | [no description available] | medium | 2 | 0 | aromatic amino acid; benzophenones; organobromine compound; substituted aniline | non-narcotic analgesic; non-steroidal anti-inflammatory drug |
atorvastatin | [no description available] | medium | 7 | 0 | aromatic amide; dihydroxy monocarboxylic acid; monofluorobenzenes; pyrroles; statin (synthetic) | environmental contaminant; xenobiotic |
lamivudine | [no description available] | medium | 2 | 0 | monothioacetal; nucleoside analogue; oxacycle; primary alcohol | allergen; anti-HBV agent; antiviral drug; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor; HIV-1 reverse transcriptase inhibitor; prodrug |
duloxetine | [no description available] | medium | 1 | 0 | duloxetine | |
valsartan | [no description available] | medium | 2 | 0 | biphenylyltetrazole; monocarboxylic acid amide; monocarboxylic acid | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
adefovir dipivoxil | [no description available] | medium | 2 | 0 | 6-aminopurines; carbonate ester; ether; organic phosphonate | antiviral drug; DNA synthesis inhibitor; HIV-1 reverse transcriptase inhibitor; nephrotoxic agent; prodrug |
capecitabine | [no description available] | medium | 1 | 0 | carbamate ester; cytidines; organofluorine compound | antimetabolite; antineoplastic agent; prodrug |
adenosine | [no description available] | medium | 2 | 0 | adenosines; purines D-ribonucleoside | analgesic; anti-arrhythmia drug; fundamental metabolite; human metabolite; vasodilator agent |
halofuginone | [no description available] | medium | 1 | 0 | quinazolines | |
ortho-cept | [no description available] | medium | 1 | 0 | | |
cefprozil | [no description available] | medium | 1 | 0 | cephalosporin; semisynthetic derivative | antibacterial drug |
4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol | [no description available] | medium | 1 | 0 | stilbenoid | |
efavirenz | [no description available] | medium | 3 | 0 | acetylenic compound; benzoxazine; cyclopropanes; organochlorine compound; organofluorine compound | antiviral drug; HIV-1 reverse transcriptase inhibitor |
nelfinavir | [no description available] | medium | 4 | 0 | aryl sulfide; benzamides; organic heterobicyclic compound; phenols; secondary alcohol; tertiary amino compound | antineoplastic agent; HIV protease inhibitor |
doxapram hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | central nervous system stimulant |
1,5-anhydroglucitol | [no description available] | medium | 1 | 0 | anhydro sugar | human metabolite |
betulinic acid | [no description available] | medium | 3 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-HIV agent; anti-inflammatory agent; antimalarial; antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; plant metabolite |
amprenavir | [no description available] | medium | 4 | 0 | carbamate ester; sulfonamide; tetrahydrofuryl ester | antiviral drug; HIV protease inhibitor |
bendamustine | [no description available] | medium | 1 | 0 | benzimidazoles | |
erdosteine | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
mizolastine | [no description available] | medium | 1 | 0 | benzimidazoles | |
intoplicine | [no description available] | medium | 1 | 0 | pyridoindole | |
telmisartan | [no description available] | medium | 4 | 0 | benzimidazoles; biphenyls; carboxybiphenyl | angiotensin receptor antagonist; antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; environmental contaminant; xenobiotic |
dexfenfluramine | [no description available] | medium | 1 | 0 | fenfluramine | appetite depressant; serotonergic agonist; serotonin uptake inhibitor |
2-methoxyestradiol | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
medetomidine | [no description available] | medium | 1 | 0 | imidazoles | |
sertraline | [no description available] | medium | 1 | 0 | dichlorobenzene; secondary amino compound; tetralins | antidepressant; serotonin uptake inhibitor |
picosulfate sodium | [no description available] | medium | 1 | 0 | aryl sulfate; pyridines | |
dienogest | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; aliphatic nitrile; steroid hormone | progesterone receptor agonist; progestin; synthetic oral contraceptive |
morphazinamide | [no description available] | medium | 1 | 0 | morpholines; pyrazines; secondary carboxamide | |
dexrazoxane | [no description available] | medium | 1 | 0 | razoxane | antineoplastic agent; cardiovascular drug; chelator; immunosuppressive agent |
voriconazole | [no description available] | medium | 2 | 0 | conazole antifungal drug; difluorobenzene; pyrimidines; tertiary alcohol; triazole antifungal drug | P450 inhibitor |
cyclobutyrol | [no description available] | medium | 1 | 0 | hydroxy monocarboxylic acid | bile therapy drug |
terlipressin | [no description available] | medium | 1 | 0 | polypeptide | |
isoflavone | [no description available] | medium | 1 | 0 | isoflavones | |
clevudine | [no description available] | medium | 1 | 0 | | |
tetrandrine | [no description available] | medium | 1 | 0 | bisbenzylisoquinoline alkaloid; isoquinolines | |
rosiglitazone | [no description available] | medium | 4 | 0 | aminopyridine; thiazolidinediones | EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; insulin-sensitizing drug |
sr141716 | [no description available] | medium | 2 | 0 | amidopiperidine; carbohydrazide; dichlorobenzene; monochlorobenzenes; pyrazoles | anti-obesity agent; appetite depressant; CB1 receptor antagonist |
bosentan anhydrous | [no description available] | medium | 4 | 0 | primary alcohol; pyrimidines; sulfonamide | antihypertensive agent; endothelin receptor antagonist |
selenomethionine | [no description available] | medium | 1 | 0 | amino acid zwitterion; selenomethionine | plant metabolite |
perindopril | [no description available] | medium | 1 | 0 | alpha-amino acid ester; dicarboxylic acid monoester; ethyl ester; organic heterobicyclic compound | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
fingolimod | [no description available] | medium | 1 | 0 | aminodiol; primary amino compound | antineoplastic agent; CB1 receptor antagonist; immunosuppressive agent; prodrug; sphingosine-1-phosphate receptor agonist |
ecteinascidin 743 | [no description available] | medium | 1 | 0 | acetate ester; azaspiro compound; bridged compound; hemiaminal; isoquinoline alkaloid; lactone; organic heteropolycyclic compound; organic sulfide; oxaspiro compound; polyphenol; tertiary amino compound | alkylating agent; angiogenesis modulating agent; anti-inflammatory agent; antineoplastic agent; marine metabolite |
nitisinone | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; C-nitro compound; cyclohexanones; mesotrione | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor |
marimastat | [no description available] | medium | 1 | 0 | hydroxamic acid; secondary carboxamide | antineoplastic agent; matrix metalloproteinase inhibitor |
clofarabine | [no description available] | medium | 2 | 0 | adenosines; organofluorine compound | antimetabolite; antineoplastic agent |
mitiglinide | [no description available] | medium | 1 | 0 | benzenes; monocarboxylic acid | |
n(6)-(3-iodobenzyl)-5'-n-methylcarboxamidoadenosine | [no description available] | medium | 1 | 0 | adenosines; monocarboxylic acid amide; organoiodine compound | adenosine A3 receptor agonist |
antiprimod | [no description available] | medium | 1 | 0 | | |
sulbactam | [no description available] | medium | 6 | 0 | penicillanic acids | |
olmesartan medoxomil | [no description available] | medium | 2 | 0 | biphenyls | |
ilomastat | [no description available] | medium | 1 | 0 | hydroxamic acid; L-tryptophan derivative; N-acyl-amino acid | anti-inflammatory agent; antibacterial agent; antineoplastic agent; EC 3.4.24.24 (gelatinase A) inhibitor; neuroprotective agent |
docetaxel | [no description available] | medium | 1 | 0 | hydrate; secondary alpha-hydroxy ketone | antineoplastic agent |
atazanavir | [no description available] | medium | 2 | 0 | carbohydrazide | antiviral drug; HIV protease inhibitor |
ezetimibe | [no description available] | medium | 2 | 0 | azetidines; beta-lactam; organofluorine compound | anticholesteremic drug; antilipemic drug; antimetabolite |
cariporide | [no description available] | medium | 1 | 0 | | |
tezosentan | [no description available] | medium | 1 | 0 | | |
jtt 501 | [no description available] | medium | 1 | 0 | | |
cyc 202 | [no description available] | medium | 1 | 0 | 2,6-diaminopurines | antiviral drug; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
avasimibe | [no description available] | medium | 1 | 0 | monoterpenoid | |
biotin | [no description available] | medium | 1 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
troleandomycin | [no description available] | medium | 1 | 0 | acetate ester; epoxide; macrolide antibiotic; monosaccharide derivative; polyketide; semisynthetic derivative | EC 1.14.13.97 (taurochenodeoxycholate 6alpha-hydroxylase) inhibitor; xenobiotic |
deferasirox | [no description available] | medium | 2 | 0 | benzoic acids; monocarboxylic acid; phenols; triazoles | iron chelator |
tbc-11251 | [no description available] | medium | 2 | 0 | benzodioxoles | |
sitosterol, (3beta)-isomer | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C29-steroid; phytosterols; stigmastane sterol | anticholesteremic drug; antioxidant; mouse metabolite; plant metabolite; sterol methyltransferase inhibitor |
benzarone | [no description available] | medium | 1 | 0 | 1-benzofurans | |
estramustine | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; carbamate ester; organochlorine compound | alkylating agent; antineoplastic agent; radiation protective agent |
homoharringtonine | [no description available] | medium | 1 | 0 | alkaloid ester; enol ether; organic heteropentacyclic compound; tertiary alcohol | anticoronaviral agent; antineoplastic agent; apoptosis inducer; protein synthesis inhibitor |
o-(chloroacetylcarbamoyl)fumagillol | [no description available] | medium | 1 | 0 | carbamate ester; organochlorine compound; semisynthetic derivative; sesquiterpenoid; spiro-epoxide | angiogenesis inhibitor; antineoplastic agent; EC 1.5.1.3 (dihydrofolate reductase) inhibitor; methionine aminopeptidase 2 inhibitor; retinoic acid receptor alpha antagonist |
bortezomib | [no description available] | medium | 2 | 0 | amino acid amide; L-phenylalanine derivative; pyrazines | antineoplastic agent; antiprotozoal drug; protease inhibitor; proteasome inhibitor |
nexavar | [no description available] | medium | 1 | 0 | organosulfonate salt | |
glucosamine | [no description available] | medium | 1 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
griseofulvin | [no description available] | medium | 2 | 0 | 1-benzofurans; antibiotic antifungal drug; benzofuran antifungal drug; organochlorine compound; oxaspiro compound | antibacterial agent; Penicillium metabolite |
netilmicin | [no description available] | medium | 3 | 0 | | |
trimethaphan camsylate | [no description available] | medium | 1 | 0 | | |
erythromycin estolate | [no description available] | medium | 3 | 0 | aminoglycoside sulfate salt; erythromycin derivative | enzyme inhibitor |
cyclopamine | [no description available] | medium | 1 | 0 | piperidines | glioma-associated oncogene inhibitor |
devazepide | [no description available] | medium | 1 | 0 | 1,4-benzodiazepinone; indolecarboxamide | antineoplastic agent; apoptosis inducer; cholecystokinin antagonist; gastrointestinal drug |
tolterodine | [no description available] | medium | 1 | 0 | tertiary amine | antispasmodic drug; muscarinic antagonist; muscle relaxant |
doxorubicin hydrochloride | [no description available] | medium | 1 | 0 | anthracycline | |
erythromycin ethylsuccinate | [no description available] | medium | 2 | 0 | cyclic ketone; erythromycin derivative; ethyl ester; succinate ester | |
ao 128 | [no description available] | medium | 2 | 0 | organic molecular entity | |
acarbose | [no description available] | medium | 1 | 0 | amino cyclitol; glycoside | |
tretinoin | [no description available] | medium | 4 | 0 | retinoic acid; vitamin A | anti-inflammatory agent; antineoplastic agent; antioxidant; AP-1 antagonist; human metabolite; keratolytic drug; retinoic acid receptor agonist; retinoid X receptor agonist; signalling molecule |
retinol | [no description available] | medium | 3 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
alpha-D-fructofuranose 1,6-bisphosphate | [no description available] | medium | 1 | 0 | D-fructofuranose 1,6-bisphosphate | |
docosahexaenoate | [no description available] | medium | 1 | 0 | docosahexaenoic acid; omega-3 fatty acid | algal metabolite; antineoplastic agent; Daphnia tenebrosa metabolite; human metabolite; mouse metabolite; nutraceutical |
oleic acid | [no description available] | high | 2 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
tacrolimus | [no description available] | medium | 9 | 0 | macrolide lactam | bacterial metabolite; immunosuppressive agent |
tacrolimus | [no description available] | medium | 9 | 1 | macrolide lactam | bacterial metabolite; immunosuppressive agent |
cerivastatin | [no description available] | medium | 1 | 0 | dihydroxy monocarboxylic acid; pyridines; statin (synthetic) | |
rosuvastatin | [no description available] | medium | 1 | 0 | dihydroxy monocarboxylic acid; monofluorobenzenes; pyrimidines; statin (synthetic); sulfonamide | anti-inflammatory agent; antilipemic drug; cardioprotective agent; CETP inhibitor; environmental contaminant; xenobiotic |
cocaine | [no description available] | medium | 1 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
eicosapentaenoic acid | [no description available] | medium | 1 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
mycophenolic acid | [no description available] | medium | 1 | 0 | 2-benzofurans; gamma-lactone; monocarboxylic acid; phenols | anticoronaviral agent; antimicrobial agent; antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; environmental contaminant; immunosuppressive agent; mycotoxin; Penicillium metabolite; xenobiotic |
drf 2725 | [no description available] | medium | 1 | 0 | | |
alitretinoin | [no description available] | medium | 1 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; metabolite; retinoid X receptor agonist |
decitabine | [no description available] | medium | 2 | 0 | 2'-deoxyribonucleoside | |
teniposide | [no description available] | medium | 2 | 0 | aromatic ether; beta-D-glucoside; cyclic acetal; furonaphthodioxole; gamma-lactone; monosaccharide derivative; phenols; thiophenes | antineoplastic agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor |
dactinomycin | [no description available] | medium | 8 | 0 | actinomycin | mutagen |
tiazofurin | [no description available] | medium | 1 | 0 | 1,3-thiazoles; C-glycosyl compound; monocarboxylic acid amide | antineoplastic agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; prodrug |
melphalan | [no description available] | medium | 2 | 0 | L-phenylalanine derivative; nitrogen mustard; non-proteinogenic L-alpha-amino acid; organochlorine compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
tenofovir | [no description available] | medium | 1 | 0 | nucleoside analogue; phosphonic acids | antiviral drug; drug metabolite; HIV-1 reverse transcriptase inhibitor |
rubitecan | [no description available] | medium | 2 | 0 | C-nitro compound; delta-lactone; pyranoindolizinoquinoline; semisynthetic derivative; tertiary alcohol | antineoplastic agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; prodrug |
micafungin | [no description available] | medium | 2 | 0 | antibiotic antifungal drug; echinocandin | antiinfective agent |
riboflavin | [no description available] | medium | 1 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
sodium bicarbonate | [no description available] | medium | 1 | 0 | one-carbon compound; organic sodium salt | antacid; food anticaking agent |
sodium acetate, anhydrous | [no description available] | medium | 1 | 0 | organic sodium salt | NMR chemical shift reference compound |
sodium benzoate | [no description available] | medium | 1 | 0 | organic sodium salt | algal metabolite; antimicrobial food preservative; drug allergen; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; human xenobiotic metabolite; plant metabolite |
dipyrone | [no description available] | medium | 1 | 0 | organic sodium salt | anti-inflammatory agent; antipyretic; antirheumatic drug; cyclooxygenase 3 inhibitor; non-narcotic analgesic; peripheral nervous system drug; prodrug |
ditiocarb sodium | [no description available] | medium | 1 | 0 | organic molecular entity | |
carbenoxolone | [no description available] | medium | 1 | 0 | | |
discodermolide | [no description available] | medium | 1 | 0 | diterpenoid | |
cannabidiol | [no description available] | medium | 1 | 0 | olefinic compound; phytocannabinoid; resorcinols | antimicrobial agent; plant metabolite |
prothionamide | [no description available] | medium | 1 | 0 | pyridines | |
etomidate | [no description available] | medium | 1 | 0 | ethyl ester; imidazoles | intravenous anaesthetic; sedative |
mercaptopurine | [no description available] | medium | 2 | 0 | aryl thiol; purines; thiocarbonyl compound | anticoronaviral agent; antimetabolite; antineoplastic agent |
methimazole | [no description available] | medium | 3 | 0 | 1,3-dihydroimidazole-2-thiones | antithyroid drug |
capsaicin | [no description available] | medium | 1 | 0 | capsaicinoid | non-narcotic analgesic; TRPV1 agonist; voltage-gated sodium channel blocker |
thioguanine anhydrous | [no description available] | medium | 1 | 0 | 2-aminopurines | anticoronaviral agent; antimetabolite; antineoplastic agent |
tacrine hydrochloride | [no description available] | medium | 1 | 0 | | |
sodium propionate | [no description available] | medium | 1 | 0 | organic sodium salt | antifungal drug; food preservative |
streptozocin | [no description available] | medium | 1 | 0 | | |
ethionamide | [no description available] | medium | 1 | 0 | pyridines; thiocarboxamide | antilipemic drug; antitubercular agent; fatty acid synthesis inhibitor; leprostatic drug; prodrug |
toremifene | [no description available] | medium | 1 | 0 | aromatic ether; organochlorine compound; tertiary amine | antineoplastic agent; bone density conservation agent; estrogen antagonist; estrogen receptor modulator |
telaprevir | [no description available] | medium | 1 | 0 | cyclopentapyrrole; cyclopropanes; oligopeptide; pyrazines | antiviral drug; hepatitis C protease inhibitor; peptidomimetic |
droloxifene | [no description available] | medium | 1 | 0 | stilbenoid | |
or 1259 | [no description available] | medium | 1 | 0 | hydrazone; nitrile; pyridazinone | anti-arrhythmia drug; cardiotonic drug; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; vasodilator agent |
gestodene | [no description available] | medium | 2 | 0 | steroid | estrogen |
orlistat | [no description available] | medium | 2 | 0 | beta-lactone; carboxylic ester; formamides; L-leucine derivative | anti-obesity agent; bacterial metabolite; EC 2.3.1.85 (fatty acid synthase) inhibitor; EC 3.1.1.3 (triacylglycerol lipase) inhibitor |
idoxifene | [no description available] | medium | 1 | 0 | stilbenoid | |
zd 6474 | [no description available] | medium | 2 | 0 | aromatic ether; organobromine compound; organofluorine compound; piperidines; quinazolines; secondary amine | antineoplastic agent; tyrosine kinase inhibitor |
silybin | [no description available] | medium | 1 | 0 | | |
chloramine-t | [no description available] | medium | 1 | 0 | organic sodium salt | allergen; antifouling biocide; disinfectant |
flosequinan | [no description available] | medium | 1 | 0 | quinolines | |
tolcapone | [no description available] | medium | 4 | 0 | 2-nitrophenols; benzophenones; catechols | antiparkinson drug; EC 2.1.1.6 (catechol O-methyltransferase) inhibitor |
dinoprostone | [no description available] | medium | 1 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
dinoprost | [no description available] | medium | 1 | 0 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
calcitriol | [no description available] | medium | 2 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
beta carotene | [no description available] | medium | 1 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
alprostadil | [no description available] | medium | 2 | 0 | prostaglandins E | anticoagulant; human metabolite; platelet aggregation inhibitor; vasodilator agent |
cholecalciferol | [no description available] | medium | 1 | 0 | D3 vitamins; hydroxy seco-steroid; seco-cholestane; secondary alcohol; steroid hormone | geroprotector; human metabolite |
amphotericin b | [no description available] | medium | 8 | 0 | antibiotic antifungal drug; macrolide antibiotic; polyene antibiotic | antiamoebic agent; antiprotozoal drug; bacterial metabolite |
clavulanic acid | [no description available] | medium | 6 | 0 | oxapenam | antibacterial drug; anxiolytic drug; bacterial metabolite; EC 3.5.2.6 (beta-lactamase) inhibitor |
oxymetholone | [no description available] | medium | 2 | 0 | | |
montelukast | [no description available] | medium | 1 | 0 | aliphatic sulfide; monocarboxylic acid; quinolines | anti-arrhythmia drug; anti-asthmatic drug; leukotriene antagonist |
mycophenolate mofetil | [no description available] | medium | 2 | 0 | carboxylic ester; ether; gamma-lactone; phenols; tertiary amino compound | anticoronaviral agent; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; immunosuppressive agent; prodrug |
entacapone | [no description available] | medium | 2 | 0 | 2-nitrophenols; catechols; monocarboxylic acid amide; nitrile | antidyskinesia agent; antiparkinson drug; central nervous system drug; EC 2.1.1.6 (catechol O-methyltransferase) inhibitor |
astaxanthine | [no description available] | medium | 1 | 0 | carotenol; carotenone | animal metabolite; anticoagulant; antioxidant; food colouring; plant metabolite |
diosmin | [no description available] | medium | 1 | 0 | dihydroxyflavanone; disaccharide derivative; glycosyloxyflavone; monomethoxyflavone; rutinoside | anti-inflammatory agent; antioxidant |
cynarine | [no description available] | medium | 1 | 0 | alkyl caffeate ester; quinic acid | plant metabolite |
sdz psc 833 | [no description available] | medium | 1 | 0 | homodetic cyclic peptide | |
coenzyme q10 | [no description available] | medium | 1 | 0 | ubiquinones | antioxidant; ferroptosis inhibitor; human metabolite |
etretinate | [no description available] | medium | 2 | 0 | enoate ester; ethyl ester; retinoid | keratolytic drug |
misoprostol | [no description available] | medium | 1 | 0 | | |
ozagrel | [no description available] | medium | 1 | 0 | cinnamic acids | |
pitavastatin | [no description available] | medium | 1 | 0 | cyclopropanes; dihydroxy monocarboxylic acid; monofluorobenzenes; quinolines; statin (synthetic) | antioxidant |
alatrofloxacin mesylate | [no description available] | medium | 1 | 0 | | |
codeine | [no description available] | medium | 1 | 0 | morphinane alkaloid; organic heteropentacyclic compound | antitussive; drug allergen; environmental contaminant; opioid analgesic; opioid receptor agonist; prodrug; xenobiotic |
natamycin | [no description available] | medium | 2 | 0 | antibiotic antifungal drug; dicarboxylic acid monoester; epoxide; macrolide antibiotic; monosaccharide derivative; polyene antibiotic | antifungal agrochemical; antimicrobial food preservative; apoptosis inducer; bacterial metabolite; ophthalmology drug |
acitretin | [no description available] | medium | 3 | 0 | acitretin; alpha,beta-unsaturated monocarboxylic acid; retinoid | keratolytic drug |
dothiepin | [no description available] | medium | 1 | 0 | dothiepin | |
levetiracetam | [no description available] | medium | 2 | 0 | pyrrolidin-2-ones | anticonvulsant; environmental contaminant; xenobiotic |
nalorphine | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
naloxone | [no description available] | medium | 3 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary alcohol | antidote to opioid poisoning; central nervous system depressant; mu-opioid receptor antagonist |
oxymorphone | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
sirolimus | [no description available] | medium | 2 | 0 | antibiotic antifungal drug; cyclic acetal; cyclic ketone; ether; macrolide lactam; organic heterotricyclic compound; secondary alcohol | antibacterial drug; anticoronaviral agent; antineoplastic agent; bacterial metabolite; geroprotector; immunosuppressive agent; mTOR inhibitor |
topiramate | [no description available] | medium | 2 | 0 | cyclic ketal; ketohexose derivative; sulfamate ester | anticonvulsant; sodium channel blocker |
alvocidib | [no description available] | medium | 1 | 0 | dihydroxyflavone; hydroxypiperidine; monochlorobenzenes; tertiary amino compound | antineoplastic agent; antirheumatic drug; apoptosis inducer; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor |
seocalcitol | [no description available] | medium | 1 | 0 | | |
fenretinide | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; retinoid | antineoplastic agent; antioxidant |
geldanamycin | [no description available] | medium | 1 | 0 | 1,4-benzoquinones; ansamycin; carbamate ester; organic heterobicyclic compound | antimicrobial agent; antineoplastic agent; antiviral agent; cysteine protease inhibitor; Hsp90 inhibitor |
morphine | [no description available] | medium | 3 | 0 | morphinane alkaloid; organic heteropentacyclic compound; tertiary amino compound | anaesthetic; drug allergen; environmental contaminant; geroprotector; mu-opioid receptor agonist; opioid analgesic; plant metabolite; vasodilator agent; xenobiotic |
demycarosylturimycin h | [no description available] | medium | 2 | 0 | | |
iloprost | [no description available] | medium | 1 | 0 | carbobicyclic compound; monocarboxylic acid; secondary alcohol | platelet aggregation inhibitor; vasodilator agent |
vinorelbine | [no description available] | medium | 1 | 0 | acetate ester; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; ring assembly; vinca alkaloid | antineoplastic agent; photosensitizing agent |
fluvoxamine | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; 5-methoxyvalerophenone O-(2-aminoethyl)oxime | antidepressant; anxiolytic drug; serotonin uptake inhibitor |
semaxinib | [no description available] | medium | 1 | 0 | olefinic compound; oxindoles; pyrroles | angiogenesis modulating agent; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; vascular endothelial growth factor receptor antagonist |
orantinib | [no description available] | medium | 1 | 0 | | |
(6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | [no description available] | medium | 3 | 0 | dihydroxy monocarboxylic acid; indoles; organofluorine compound | |
molsidomine | [no description available] | medium | 2 | 0 | ethyl ester; morpholines; oxadiazole; zwitterion | antioxidant; apoptosis inhibitor; cardioprotective agent; nitric oxide donor; vasodilator agent |
naltrexone | [no description available] | medium | 1 | 0 | cyclopropanes; morphinane-like compound; organic heteropentacyclic compound | antidote to opioid poisoning; central nervous system depressant; environmental contaminant; mu-opioid receptor antagonist; xenobiotic |
cefixime | [no description available] | medium | 3 | 0 | cephalosporin | antibacterial drug; drug allergen |
ramipril | [no description available] | medium | 2 | 0 | azabicycloalkane; cyclopentapyrrole; dicarboxylic acid monoester; dipeptide; ethyl ester | bradykinin receptor B2 agonist; cardioprotective agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; matrix metalloproteinase inhibitor; prodrug |
enalapril | [no description available] | medium | 1 | 0 | dicarboxylic acid monoester; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; geroprotector; prodrug |
nitrofurazone | [no description available] | medium | 3 | 0 | | |
bleomycin | [no description available] | medium | 1 | 0 | bleomycin | antineoplastic agent; metabolite |
enalaprilat anhydrous | [no description available] | medium | 2 | 0 | dicarboxylic acid; dipeptide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
imidapril | [no description available] | medium | 1 | 0 | dicarboxylic acid monoester; dipeptide; ethyl ester; imidazolidines; N-acylurea; secondary amino compound | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
ximelagatran | [no description available] | medium | 1 | 0 | amidoxime; azetidines; carboxamide; ethyl ester; hydroxylamines; secondary amino compound; secondary carboxamide; tertiary carboxamide | anticoagulant; EC 3.4.21.5 (thrombin) inhibitor; prodrug; serine protease inhibitor |
trandolapril | [no description available] | medium | 2 | 0 | dicarboxylic acid monoester; dipeptide; ethyl ester; organic heterobicyclic compound; secondary amino compound; tertiary carboxamide | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
guanabenz acetate | [no description available] | medium | 1 | 0 | dichlorobenzene | geroprotector |
famotidine | [no description available] | medium | 4 | 0 | 1,3-thiazoles; guanidines; sulfonamide | anti-ulcer drug; H2-receptor antagonist; P450 inhibitor |
proguanil | [no description available] | medium | 2 | 0 | biguanides; monochlorobenzenes | antimalarial; antiprotozoal drug; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
rifamycin sv | [no description available] | medium | 5 | 0 | acetate ester; cyclic ketal; lactam; macrocycle; organic heterotetracyclic compound; polyphenol; rifamycins | antimicrobial agent; antitubercular agent; bacterial metabolite |
epoprostenol sodium | [no description available] | medium | 1 | 0 | prostanoid | |
ixabepilone | [no description available] | medium | 1 | 0 | 1,3-thiazoles; beta-hydroxy ketone; epoxide; lactam; macrocycle | antineoplastic agent; microtubule-destabilising agent |
dantrolene sodium | [no description available] | medium | 1 | 0 | | |
nifurtimox | [no description available] | medium | 1 | 0 | nitrofuran antibiotic | |
beraprost | [no description available] | medium | 1 | 0 | enyne; monocarboxylic acid; organic heterotricyclic compound; secondary alcohol; secondary allylic alcohol | anti-inflammatory agent; antihypertensive agent; platelet aggregation inhibitor; prostaglandin receptor agonist; vasodilator agent |
lanreotide | [no description available] | medium | 1 | 0 | | |
lu 208075 | [no description available] | medium | 1 | 0 | diarylmethane | |
acetylcarnitine | [no description available] | medium | 1 | 0 | O-acetylcarnitine; saturated fatty acyl-L-carnitine | human metabolite; Saccharomyces cerevisiae metabolite |
nifurtoinol | [no description available] | medium | 1 | 0 | hydrazone; imidazolidine-2,4-dione; nitrofuran antibiotic; organonitrogen heterocyclic antibiotic | antibacterial drug; antiinfective agent; hepatotoxic agent |
fosinopril | [no description available] | medium | 1 | 0 | | |
eflucimibe | [no description available] | medium | 1 | 0 | | |
etomoxir | [no description available] | medium | 1 | 0 | aromatic ether | |
pentagastrin | [no description available] | medium | 1 | 0 | organic molecular entity | |
azd 6244 | [no description available] | medium | 1 | 0 | benzimidazoles; bromobenzenes; hydroxamic acid ester; monochlorobenzenes; organofluorine compound; secondary amino compound | anticoronaviral agent; antineoplastic agent; EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor |
vinflunine | [no description available] | medium | 1 | 0 | acetate ester; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; semisynthetic derivative; vinca alkaloid | antineoplastic agent |
baci-im | [no description available] | medium | 2 | 0 | homodetic cyclic peptide; polypeptide; zwitterion | antibacterial agent; antimicrobial agent |
pf 03491390 | [no description available] | medium | 1 | 0 | | |
tannins | [no description available] | medium | 1 | 0 | tannin | |
mesna | [no description available] | medium | 2 | 0 | organosulfonic acid | |
cerivastatin sodium | [no description available] | medium | 1 | 0 | organic sodium salt; statin (synthetic) | |
monensin | [no description available] | medium | 1 | 0 | | |
oxacillin sodium | [no description available] | medium | 2 | 0 | organic sodium salt | |
sodium diatrizoate | [no description available] | medium | 1 | 0 | organic sodium salt; organoiodine compound | radioopaque medium |
ascorbic acid | [no description available] | medium | 5 | 0 | ascorbic acid; vitamin C | coenzyme; cofactor; flour treatment agent; food antioxidant; food colour retention agent; geroprotector; plant metabolite; skin lightening agent |
chlortetracycline | [no description available] | medium | 13 | 0 | | |
chlortetracycline | [no description available] | medium | 13 | 1 | | |
oxytetracycline, anhydrous | [no description available] | medium | 9 | 0 | | |
oxytetracycline, anhydrous | [no description available] | medium | 9 | 1 | | |
dicumarol | [no description available] | medium | 1 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; Hsp90 inhibitor; vitamin K antagonist |
acenocoumarol | [no description available] | medium | 1 | 0 | C-nitro compound; hydroxycoumarin; methyl ketone | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
mobic | [no description available] | medium | 2 | 0 | 1,3-thiazoles; benzothiazine; monocarboxylic acid amide | analgesic; antirheumatic drug; cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
mobiflex | [no description available] | medium | 3 | 0 | heteroaryl hydroxy compound; monocarboxylic acid amide; pyridines; thienothiazine | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
phenprocoumon | [no description available] | medium | 1 | 0 | hydroxycoumarin | anticoagulant; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor |
rolitetracycline | [no description available] | medium | 2 | 0 | | |
lornoxicam | [no description available] | medium | 2 | 0 | heteroaryl hydroxy compound; monocarboxylic acid amide; organochlorine compound; pyridines; thienothiazine | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
ajmaline | [no description available] | medium | 1 | 0 | | |
entecavir | [no description available] | medium | 2 | 0 | 2-aminopurines; oxopurine; primary alcohol; secondary alcohol | antiviral drug; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
acyclovir | [no description available] | medium | 8 | 0 | 2-aminopurines; oxopurine | antimetabolite; antiviral drug |
inosine | [no description available] | medium | 1 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
folic acid | [no description available] | medium | 2 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
clozapine | [no description available] | medium | 4 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine; organochlorine compound | adrenergic antagonist; dopaminergic antagonist; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; environmental contaminant; GABA antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; xenobiotic |
dacarbazine | [no description available] | medium | 2 | 0 | dacarbazine | |
didanosine | [no description available] | medium | 3 | 0 | purine 2',3'-dideoxyribonucleoside | antimetabolite; antiviral drug; EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor; geroprotector; HIV-1 reverse transcriptase inhibitor |
ganciclovir | [no description available] | medium | 3 | 0 | 2-aminopurines; oxopurine | antiinfective agent; antiviral drug |
sildenafil | [no description available] | medium | 1 | 0 | piperazines; pyrazolopyrimidine; sulfonamide | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
olanzapine | [no description available] | medium | 2 | 0 | benzodiazepine; N-arylpiperazine; N-methylpiperazine | antiemetic; dopaminergic antagonist; histamine antagonist; muscarinic antagonist; second generation antipsychotic; serotonergic antagonist; serotonin uptake inhibitor |
penciclovir | [no description available] | medium | 1 | 0 | 2-aminopurines; propane-1,3-diols | antiviral drug |
oxypurinol | [no description available] | medium | 1 | 0 | pyrazolopyrimidine | drug metabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor |
raltitrexed | [no description available] | medium | 2 | 0 | N-acyl-amino acid | |
allopurinol | [no description available] | medium | 2 | 0 | nucleobase analogue; organic heterobicyclic compound | antimetabolite; EC 1.17.3.2 (xanthine oxidase) inhibitor; gout suppressant; radical scavenger |
alanosine | [no description available] | medium | 1 | 0 | | |
tirapazamine | [no description available] | medium | 1 | 0 | aromatic amine; benzotriazines; N-oxide | antibacterial agent; antineoplastic agent; apoptosis inducer |
dapi | [no description available] | medium | 1 | 0 | indoles | fluorochrome |
stallimycin | [no description available] | medium | 1 | 0 | | |
enrofloxacin | [no description available] | medium | 1 | 0 | cyclopropanes; N-alkylpiperazine; N-arylpiperazine; organofluorine compound; quinolinemonocarboxylic acid; quinolone | antibacterial agent; antimicrobial agent; antineoplastic agent |
mbx 1066 | [no description available] | medium | 1 | 0 | | |
mbx 1090 | [no description available] | medium | 1 | 0 | | |
nab741 | [no description available] | medium | 1 | 0 | | |
1,10-phenanthroline | [no description available] | medium | 1 | 0 | phenanthroline | EC 2.7.1.1 (hexokinase) inhibitor; EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor |
nafcillin | [no description available] | medium | 4 | 0 | penicillin allergen; penicillin | antibacterial drug |
tetraphenylphosphonium chloride | [no description available] | medium | 2 | 0 | | |
deoxycholic acid | [no description available] | medium | 9 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human blood serum metabolite |
phenylalanine arginine beta-naphthylamide | [no description available] | medium | 1 | 0 | peptide | |
1-(1-naphthylmethyl)piperazine | [no description available] | medium | 1 | 0 | | |
tacrine | [no description available] | medium | 3 | 0 | acridines; aromatic amine | EC 3.1.1.7 (acetylcholinesterase) inhibitor |
ciglitazone | [no description available] | medium | 2 | 0 | aromatic ether; thiazolidinone | antineoplastic agent; insulin-sensitizing drug |
clomipramine | [no description available] | medium | 2 | 0 | dibenzoazepine | anticoronaviral agent; antidepressant; EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor; serotonergic antagonist; serotonergic drug; serotonin uptake inhibitor |
4-chloro-N-(2,6-dimethyl-1-piperidinyl)-3-sulfamoylbenzamide | [no description available] | medium | 2 | 0 | sulfonamide | |
guanfacine | [no description available] | medium | 2 | 0 | acetamides | |
moclobemide | [no description available] | medium | 2 | 0 | benzamides; monochlorobenzenes; morpholines | antidepressant; environmental contaminant; xenobiotic |
acecainide | [no description available] | medium | 2 | 0 | acetamides; benzamides | anti-arrhythmia drug |
nadolol | [no description available] | medium | 2 | 0 | tetralins | |
nefopam | [no description available] | medium | 2 | 0 | benzoxazocine; tertiary amino compound | |
neostigmine | [no description available] | medium | 2 | 0 | quaternary ammonium ion | antidote to curare poisoning; EC 3.1.1.7 (acetylcholinesterase) inhibitor |
oxybutynin | [no description available] | medium | 2 | 0 | acetylenic compound; carboxylic ester; racemate; tertiary alcohol; tertiary amino compound | antispasmodic drug; calcium channel blocker; local anaesthetic; muscarinic antagonist; muscle relaxant; parasympatholytic |
papaverine | [no description available] | medium | 3 | 0 | benzylisoquinoline alkaloid; dimethoxybenzene; isoquinolines | antispasmodic drug; vasodilator agent |
pentamidine | [no description available] | medium | 4 | 0 | aromatic ether; carboxamidine; diether | anti-inflammatory agent; antifungal agent; calmodulin antagonist; chemokine receptor 5 antagonist; EC 2.3.1.48 (histone acetyltransferase) inhibitor; NMDA receptor antagonist; S100 calcium-binding protein B inhibitor; trypanocidal drug; xenobiotic |
pioglitazone | [no description available] | medium | 3 | 0 | aromatic ether; pyridines; thiazolidinediones | antidepressant; cardioprotective agent; EC 2.7.1.33 (pantothenate kinase) inhibitor; EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor; ferroptosis inhibitor; geroprotector; hypoglycemic agent; insulin-sensitizing drug; PPARgamma agonist; xenobiotic |
imatinib | [no description available] | medium | 3 | 0 | aromatic amine; benzamides; N-methylpiperazine; pyridines; pyrimidines | antineoplastic agent; apoptosis inducer; tyrosine kinase inhibitor |
sulfisoxazole | [no description available] | medium | 2 | 0 | isoxazoles; sulfonamide antibiotic; sulfonamide | antibacterial drug; drug allergen |
thiotepa | [no description available] | medium | 2 | 0 | aziridines | |
tilorone | [no description available] | medium | 2 | 0 | aromatic ether; diether; fluoren-9-ones; tertiary amino compound | anti-inflammatory agent; antineoplastic agent; antiviral agent; interferon inducer; nicotinic acetylcholine receptor agonist |
triamterene | [no description available] | medium | 2 | 0 | pteridines | diuretic; sodium channel blocker |
urapidil | [no description available] | medium | 2 | 0 | piperazines | |
pirinixic acid | [no description available] | medium | 2 | 0 | aryl sulfide; organochlorine compound; pyrimidines | |
zonisamide | [no description available] | medium | 2 | 0 | 1,2-benzoxazoles; sulfonamide | anticonvulsant; antioxidant; central nervous system drug; protective agent; T-type calcium channel blocker |
carbon tetrachloride | [no description available] | medium | 2 | 0 | chlorocarbon; chloromethanes | hepatotoxic agent; refrigerant |
tubocurarine | [no description available] | medium | 2 | 0 | bisbenzylisoquinoline alkaloid | drug allergen; muscle relaxant; nicotinic antagonist |
galantamine | [no description available] | medium | 2 | 0 | benzazepine alkaloid fundamental parent; benzazepine alkaloid; organic heterotetracyclic compound; tertiary amino compound | antidote to curare poisoning; cholinergic drug; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; plant metabolite |
emetine | [no description available] | high | 10 | 0 | isoquinoline alkaloid; pyridoisoquinoline | antiamoebic agent; anticoronaviral agent; antiinfective agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; expectorant; plant metabolite; protein synthesis inhibitor |
1-naphthylisothiocyanate | [no description available] | medium | 2 | 0 | isothiocyanate | insecticide |
antimycin a | [no description available] | medium | 2 | 0 | benzamides; formamides; macrodiolide; phenols | antifungal agent; mitochondrial respiratory-chain inhibitor; piscicide |
dicloxacillin | [no description available] | medium | 12 | 0 | dichlorobenzene; penicillin | antibacterial drug |
dicloxacillin | [no description available] | medium | 12 | 1 | dichlorobenzene; penicillin | antibacterial drug |
metocurine | [no description available] | medium | 2 | 0 | isoquinolines | |
selegiline hydrochloride, (r)-isomer | [no description available] | medium | 2 | 0 | hydrochloride; terminal acetylenic compound | antiparkinson drug; dopaminergic agent; EC 1.4.3.4 (monoamine oxidase) inhibitor |
indoramin | [no description available] | medium | 2 | 0 | tryptamines | |
lorcainide | [no description available] | medium | 2 | 0 | acetamides | |
staurosporine | [no description available] | medium | 2 | 0 | indolocarbazole alkaloid; organic heterooctacyclic compound | apoptosis inducer; bacterial metabolite; EC 2.7.11.13 (protein kinase C) inhibitor; geroprotector |
pefloxacin | [no description available] | medium | 4 | 0 | fluoroquinolone antibiotic; monocarboxylic acid; N-alkylpiperazine; N-arylpiperazine; quinolone antibiotic; quinolone | antibacterial drug; antiinfective agent; DNA synthesis inhibitor |
alfentanil | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; piperidines | central nervous system depressant; intravenous anaesthetic; mu-opioid receptor agonist; opioid analgesic; peripheral nervous system drug |
flupirtine | [no description available] | medium | 2 | 0 | aminopyridine | |
idazoxan | [no description available] | medium | 2 | 0 | benzodioxine; imidazolines | alpha-adrenergic antagonist |
remoxipride | [no description available] | medium | 2 | 0 | dimethoxybenzene | |
finasteride | [no description available] | medium | 2 | 0 | 3-oxo steroid; aza-steroid; delta-lactam | androgen antagonist; antihyperplasia drug; EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor |
mibefradil | [no description available] | medium | 1 | 0 | tetralins | T-type calcium channel blocker |
zoledronic acid | [no description available] | medium | 2 | 0 | 1,1-bis(phosphonic acid); imidazoles | bone density conservation agent |
betamipron | [no description available] | medium | 2 | 0 | organonitrogen compound; organooxygen compound | |
mk 0663 | [no description available] | medium | 2 | 0 | bipyridines; organochlorine compound; sulfone | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
lapatinib | [no description available] | medium | 2 | 0 | furans; organochlorine compound; organofluorine compound; quinazolines | antineoplastic agent; tyrosine kinase inhibitor |
bms204352 | [no description available] | medium | 2 | 0 | | |
sorafenib | [no description available] | medium | 2 | 0 | (trifluoromethyl)benzenes; aromatic ether; monochlorobenzenes; phenylureas; pyridinecarboxamide | angiogenesis inhibitor; anticoronaviral agent; antineoplastic agent; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; ferroptosis inducer; tyrosine kinase inhibitor |
vincaleukoblastine | [no description available] | medium | 2 | 0 | acetate ester; indole alkaloid fundamental parent; methyl ester; organic heteropentacyclic compound; organic heterotetracyclic compound; tertiary alcohol; tertiary amino compound; vinca alkaloid | antineoplastic agent; immunosuppressive agent; microtubule-destabilising agent; plant metabolite |
wortmannin | [no description available] | medium | 2 | 0 | acetate ester; cyclic ketone; delta-lactone; organic heteropentacyclic compound | anticoronaviral agent; antineoplastic agent; autophagy inhibitor; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; geroprotector; Penicillium metabolite; radiosensitizing agent |
cinnarizine | [no description available] | medium | 2 | 0 | diarylmethane; N-alkylpiperazine; olefinic compound | anti-allergic agent; antiemetic; calcium channel blocker; geroprotector; H1-receptor antagonist; histamine antagonist; muscarinic antagonist |
drotaverin | [no description available] | medium | 2 | 0 | isoquinolines | |
valinomycin | [no description available] | medium | 2 | 0 | cyclodepsipeptide; macrocycle | antimicrobial agent; antiviral agent; bacterial metabolite; potassium ionophore |
ranitidine | [no description available] | medium | 2 | 0 | C-nitro compound; furans; organic sulfide; tertiary amino compound | anti-ulcer drug; drug allergen; environmental contaminant; H2-receptor antagonist; xenobiotic |
sitagliptin | [no description available] | medium | 2 | 0 | triazolopyrazine; trifluorobenzene | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor; environmental contaminant; hypoglycemic agent; serine proteinase inhibitor; xenobiotic |
eprosartan | [no description available] | medium | 2 | 0 | dicarboxylic acid; imidazoles; thiophenes | angiotensin receptor antagonist; antihypertensive agent; environmental contaminant; xenobiotic |
butorphanol | [no description available] | medium | 2 | 0 | morphinane alkaloid | antitussive; kappa-opioid receptor agonist; mu-opioid receptor agonist; opioid analgesic |
florfenicol | [no description available] | medium | 1 | 0 | organochlorine compound; organofluorine compound; secondary alcohol; secondary carboxamide; sulfone | antimicrobial agent |
donepezil | [no description available] | medium | 2 | 0 | aromatic ether; indanones; piperidines; racemate | EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; nootropic agent |
ketotifen | [no description available] | medium | 2 | 0 | cyclic ketone; olefinic compound; organic heterotricyclic compound; organosulfur heterocyclic compound; piperidines; tertiary amino compound | anti-asthmatic drug; H1-receptor antagonist |
methapyrilene | [no description available] | medium | 1 | 0 | ethylenediamine derivative | anti-allergic agent; carcinogenic agent; H1-receptor antagonist; sedative |
nomifensine | [no description available] | medium | 1 | 0 | isoquinolines | dopamine uptake inhibitor |
pargyline | [no description available] | medium | 1 | 0 | aromatic amine | |
picotamide | [no description available] | medium | 1 | 0 | benzamides | |
practolol | [no description available] | medium | 1 | 0 | acetamides; ethanolamines; propanolamine; secondary alcohol; secondary amino compound | anti-arrhythmia drug; beta-adrenergic antagonist |
fenclozic acid | [no description available] | medium | 1 | 0 | | |
clobetasol propionate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; fluorinated steroid; glucocorticoid | anti-inflammatory drug |
fialuridine | [no description available] | medium | 1 | 0 | | |
alpidem | [no description available] | medium | 1 | 0 | imidazoles | |
melatonin | [no description available] | medium | 1 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
1-(3-chlorophenyl)piperazine | [no description available] | medium | 1 | 0 | monochlorobenzenes; N-arylpiperazine | drug metabolite; environmental contaminant; serotonergic agonist; xenobiotic |
diatrizoic acid | [no description available] | medium | 1 | 0 | acetamides; benzoic acids; organoiodine compound | environmental contaminant; radioopaque medium; xenobiotic |
dan 2163 | [no description available] | medium | 1 | 0 | aromatic amide; aromatic amine; benzamides; pyrrolidines; sulfone | environmental contaminant; second generation antipsychotic; xenobiotic |
amlexanox | [no description available] | medium | 1 | 0 | monocarboxylic acid; pyridochromene | anti-allergic agent; anti-ulcer drug; non-steroidal anti-inflammatory drug |
amoxapine | [no description available] | medium | 1 | 0 | dibenzooxazepine | adrenergic uptake inhibitor; antidepressant; dopaminergic antagonist; geroprotector; serotonin uptake inhibitor |
benzocaine | [no description available] | medium | 1 | 0 | benzoate ester; substituted aniline | allergen; antipruritic drug; sensitiser; topical anaesthetic |
bisacodyl | [no description available] | medium | 1 | 0 | diarylmethane | |
bromopride | [no description available] | medium | 1 | 0 | benzamides | |
bronopol | [no description available] | medium | 1 | 0 | nitro compound | |
chlorthalidone | [no description available] | medium | 1 | 0 | isoindoles; monochlorobenzenes; sulfonamide | |
cifenline | [no description available] | medium | 1 | 0 | diarylmethane | |
ciclopirox | [no description available] | medium | 1 | 0 | cyclic hydroxamic acid; hydroxypyridone antifungal drug; pyridone | antibacterial agent; antiseborrheic |
cilostazol | [no description available] | medium | 1 | 0 | lactam; tetrazoles | anticoagulant; bronchodilator agent; EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor; fibrin modulating drug; neuroprotective agent; platelet aggregation inhibitor; vasodilator agent |
domperidone | [no description available] | medium | 1 | 0 | benzimidazoles; heteroarylpiperidine | antiemetic; dopaminergic antagonist |
ebastine | [no description available] | medium | 1 | 0 | organic molecular entity | |
ethosuximide | [no description available] | medium | 1 | 0 | dicarboximide; pyrrolidinone | anticonvulsant; geroprotector; T-type calcium channel blocker |
4-biphenylylacetic acid | [no description available] | medium | 1 | 0 | biphenyls; monocarboxylic acid | non-steroidal anti-inflammatory drug |
fleroxacin | [no description available] | medium | 2 | 0 | difluorobenzene; fluoroquinolone antibiotic; monocarboxylic acid; N-alkylpiperazine; quinolines | antibacterial drug; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; topoisomerase IV inhibitor |
hydroflumethiazide | [no description available] | medium | 1 | 0 | benzothiadiazine; thiazide | antihypertensive agent; diuretic |
letrozole | [no description available] | medium | 1 | 0 | nitrile; triazoles | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor |
mexiletine | [no description available] | medium | 1 | 0 | aromatic ether; primary amino compound | anti-arrhythmia drug |
piracetam | [no description available] | medium | 1 | 0 | organonitrogen compound; organooxygen compound | |
piribedil | [no description available] | medium | 1 | 0 | N-arylpiperazine | |
ono 1078 | [no description available] | medium | 1 | 0 | chromones | |
pyranoprofen | [no description available] | medium | 1 | 0 | pyridochromene | |
tazarotene | [no description available] | medium | 1 | 0 | acetylenic compound; ethyl ester; pyridines; retinoid; thiochromane | keratolytic drug; prodrug; teratogenic agent |
tiapride | [no description available] | medium | 1 | 0 | benzamides | |
nikethamide | [no description available] | medium | 1 | 0 | pyridinecarboxamide | |
tolnaftate | [no description available] | medium | 1 | 0 | monothiocarbamic ester | antifungal drug |
thenoyltrifluoroacetone | [no description available] | medium | 1 | 0 | | |
undecylenic acid | [no description available] | medium | 1 | 0 | undecenoic acid | antifungal drug; plant metabolite |
zaleplon | [no description available] | medium | 1 | 0 | nitrile; pyrazolopyrimidine | anticonvulsant; anxiolytic drug; central nervous system depressant; sedative |
zopiclone | [no description available] | medium | 1 | 0 | monochloropyridine; pyrrolopyrazine | central nervous system depressant; sedative |
triamcinolone diacetate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
procarbazine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antineoplastic agent |
dimenhydrinate | [no description available] | medium | 1 | 0 | diarylmethane | |
hydroxychloroquine sulfate | [no description available] | medium | 1 | 0 | | |
levonorgestrel | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound | contraceptive drug; female contraceptive drug; progestin; synthetic oral contraceptive |
ethambutol hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antitubercular agent |
pregnenolone carbonitrile | [no description available] | medium | 1 | 0 | aliphatic nitrile | |
metylperon | [no description available] | medium | 1 | 0 | aromatic ketone | |
etidronate disodium | [no description available] | medium | 1 | 0 | organic sodium salt | antineoplastic agent; bone density conservation agent; chelator |
mafenide acetate | [no description available] | medium | 1 | 0 | carboxylic acid | |
diacerein | [no description available] | medium | 1 | 0 | anthraquinone | |
pancuronium bromide | [no description available] | medium | 1 | 0 | bromide salt | cholinergic antagonist; muscle relaxant; nicotinic antagonist |
ornidazole | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles; organochlorine compound; secondary alcohol | antiamoebic agent; antibacterial drug; antiinfective agent; antiprotozoal drug; antitrichomonal drug; epitope |
fludarabine phosphate | [no description available] | medium | 1 | 0 | nucleoside analogue; organofluorine compound; purine arabinonucleoside monophosphate | antimetabolite; antineoplastic agent; antiviral agent; DNA synthesis inhibitor; immunosuppressive agent; prodrug |
benzonidazole | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles; monocarboxylic acid amide | antiprotozoal drug |
carbidopa | [no description available] | medium | 1 | 0 | catechols; hydrazines; monocarboxylic acid | antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
feprazone | [no description available] | medium | 1 | 0 | organic molecular entity | |
vecuronium bromide | [no description available] | medium | 1 | 0 | organic bromide salt; quaternary ammonium salt | muscle relaxant; neuromuscular agent; nicotinic antagonist |
nitazoxanide | [no description available] | medium | 2 | 0 | benzamides; carboxylic ester | |
acarbose | [no description available] | medium | 1 | 0 | tetrasaccharide derivative | EC 3.2.1.1 (alpha-amylase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; geroprotector; hypoglycemic agent |
atracurium besylate | [no description available] | medium | 1 | 0 | organosulfonate salt; quaternary ammonium salt | muscle relaxant; nicotinic antagonist |
pergolide mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | antiparkinson drug; dopamine agonist; geroprotector |
talniflumate | [no description available] | medium | 1 | 0 | benzofurans | |
fenoldopam mesylate | [no description available] | medium | 1 | 0 | benzazepine | |
stepronin | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
cabergoline | [no description available] | medium | 1 | 0 | N-acylurea | antineoplastic agent; antiparkinson drug; dopamine agonist |
salmeterol xinafoate | [no description available] | medium | 1 | 0 | naphthoic acid | |
imiquimod | [no description available] | medium | 1 | 0 | imidazoquinoline | antineoplastic agent; interferon inducer |
sertindole | [no description available] | medium | 1 | 0 | heteroarylpiperidine; imidazolidinone; organochlorine compound; organofluorine compound; phenylindole | alpha-adrenergic antagonist; H1-receptor antagonist; second generation antipsychotic; serotonergic antagonist |
adapalene | [no description available] | medium | 1 | 0 | adamantanes; monocarboxylic acid; naphthoic acid | dermatologic drug; EC 2.7.11.22 (cyclin-dependent kinase) inhibitor; non-steroidal anti-inflammatory drug |
aromasil | [no description available] | medium | 1 | 0 | 17-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid | antineoplastic agent; EC 1.14.14.14 (aromatase) inhibitor; environmental contaminant; xenobiotic |
gemcitabine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride; organofluorine compound | anticoronaviral agent; antimetabolite; antineoplastic agent; antiviral drug; EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor; immunosuppressive agent; radiosensitizing agent |
aripiprazole | [no description available] | medium | 1 | 0 | aromatic ether; delta-lactam; dichlorobenzene; N-alkylpiperazine; N-arylpiperazine; quinolone | drug metabolite; H1-receptor antagonist; second generation antipsychotic; serotonergic agonist |
atorvastatin calcium anhydrous | [no description available] | medium | 1 | 0 | organic calcium salt | |
duloxetine hydrochloride | [no description available] | medium | 1 | 0 | duloxetine hydrochloride | antidepressant |
zolmitriptan | [no description available] | medium | 1 | 0 | oxazolidinone; tryptamines | anti-inflammatory drug; serotonergic agonist; vasoconstrictor agent |
emtricitabine | [no description available] | medium | 1 | 0 | monothioacetal; nucleoside analogue; organofluorine compound; pyrimidone | antiviral drug; HIV-1 reverse transcriptase inhibitor |
paroxetine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antidepressant; anxiolytic drug; hepatotoxic agent; P450 inhibitor; serotonin uptake inhibitor |
bupropion hydrochloride | [no description available] | medium | 1 | 0 | aromatic ketone | |
trazodone hydrochloride | [no description available] | medium | 6 | 0 | hydrochloride | adrenergic antagonist; antidepressant; H1-receptor antagonist; sedative; serotonin uptake inhibitor |
doxazosin mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | geroprotector |
mevastatin | [no description available] | medium | 1 | 0 | 2-pyranones; carboxylic ester; hexahydronaphthalenes; polyketide; statin (naturally occurring) | antifungal agent; apoptosis inducer; EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor; fungal metabolite; Penicillium metabolite |
bupivacaine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride; racemate | adrenergic antagonist; amphiphile; EC 3.1.1.8 (cholinesterase) inhibitor; EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor; local anaesthetic |
plerixafor | [no description available] | medium | 1 | 0 | azacycloalkane; azamacrocycle; benzenes; crown amine; secondary amino compound; tertiary amino compound | anti-HIV agent; antineoplastic agent; C-X-C chemokine receptor type 4 antagonist; immunological adjuvant |
ticlopidine hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | |
epirubicin hydrochloride | [no description available] | medium | 1 | 0 | | |
pazufloxacin | [no description available] | medium | 1 | 0 | quinolines | |
repaglinide | [no description available] | medium | 1 | 0 | piperidines | |
artemisinin | [no description available] | medium | 1 | 0 | organic peroxide; sesquiterpene lactone | antimalarial; plant metabolite |
brinzolamide | [no description available] | medium | 1 | 0 | sulfonamide; thienothiazine | antiglaucoma drug; EC 4.2.1.1 (carbonic anhydrase) inhibitor |
drospirenone | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; steroid lactone | aldosterone antagonist; contraceptive drug; progestin |
artemether | [no description available] | medium | 1 | 0 | artemisinin derivative; cyclic acetal; organic peroxide; semisynthetic derivative; sesquiterpenoid | antimalarial |
uk 68798 | [no description available] | medium | 1 | 0 | aromatic ether; sulfonamide; tertiary amino compound | anti-arrhythmia drug; potassium channel blocker |
hp 873 | [no description available] | medium | 1 | 0 | 1,2-benzoxazoles; aromatic ether; aromatic ketone; methyl ketone; monoamine; organofluorine compound; piperidines; tertiary amino compound | dopaminergic antagonist; second generation antipsychotic; serotonergic antagonist |
loxapine succinate | [no description available] | medium | 1 | 0 | succinate salt | geroprotector |
uroxatral | [no description available] | medium | 1 | 0 | hydrochloride | |
aceclofenac | [no description available] | medium | 1 | 0 | amino acid; carboxylic ester; dichlorobenzene; monocarboxylic acid; secondary amino compound | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
thiocolchicoside | [no description available] | medium | 1 | 0 | glycoside | |
doripenem | [no description available] | medium | 1 | 0 | carbapenems | |
tamiflu | [no description available] | medium | 1 | 0 | phosphate salt | |
bexarotene | [no description available] | medium | 1 | 0 | benzoic acids; naphthalenes; retinoid | antineoplastic agent |
s20098 | [no description available] | medium | 1 | 0 | acetamides | |
flunisolide | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic ketal; fluorinated steroid; primary alpha-hydroxy ketone | anti-asthmatic drug; anti-inflammatory drug; immunosuppressive agent |
ketorolac tromethamine | [no description available] | medium | 1 | 0 | organoammonium salt | analgesic; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor |
gliquidone | [no description available] | medium | 1 | 0 | isoquinolines | |
moxifloxacin hydrochloride | [no description available] | medium | 1 | 0 | hydrochloride | antibacterial drug |
fulvestrant | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid; organofluorine compound; sulfoxide | antineoplastic agent; estrogen antagonist; estrogen receptor antagonist |
mizoribine | [no description available] | medium | 1 | 0 | imidazoles | anticoronaviral agent |
racecadotril | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
tadalafil | [no description available] | medium | 1 | 0 | benzodioxoles; pyrazinopyridoindole | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
plavix | [no description available] | medium | 1 | 0 | azaheterocycle sulfate salt; organoammonium sulfate salt | anticoagulant; P2Y12 receptor antagonist; platelet aggregation inhibitor |
pramipexole | [no description available] | medium | 1 | 0 | benzothiazoles; diamine | antidyskinesia agent; antiparkinson drug; dopamine agonist; radical scavenger |
valdecoxib | [no description available] | medium | 1 | 0 | isoxazoles; sulfonamide | antipyretic; antirheumatic drug; cyclooxygenase 2 inhibitor; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
desloratadine | [no description available] | medium | 1 | 0 | benzocycloheptapyridine | anti-allergic agent; cholinergic antagonist; drug metabolite; H1-receptor antagonist |
abiraterone | [no description available] | medium | 1 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; pyridines | antineoplastic agent; EC 1.14.99.9 (steroid 17alpha-monooxygenase) inhibitor |
febuxostat | [no description available] | medium | 2 | 0 | 1,3-thiazolemonocarboxylic acid; aromatic ether; nitrile | EC 1.17.3.2 (xanthine oxidase) inhibitor |
lexapro | [no description available] | medium | 1 | 0 | | |
docetaxel anhydrous | [no description available] | medium | 1 | 0 | secondary alpha-hydroxy ketone; tetracyclic diterpenoid | antimalarial; antineoplastic agent; photosensitizing agent |
cox 189 | [no description available] | medium | 1 | 0 | amino acid; monocarboxylic acid; organochlorine compound; organofluorine compound; secondary amino compound | cyclooxygenase 2 inhibitor; non-steroidal anti-inflammatory drug |
xamoterol | [no description available] | medium | 1 | 0 | morpholines | |
telbivudine | [no description available] | medium | 1 | 0 | pyrimidine 2'-deoxyribonucleoside | antiviral drug; EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor |
ramelteon | [no description available] | medium | 1 | 0 | indanes | |
tolvaptan | [no description available] | medium | 1 | 0 | benzazepine; benzenedicarboxamide | aquaretic; vasopressin receptor antagonist |
lenalidomide | [no description available] | medium | 1 | 0 | aromatic amine; dicarboximide; isoindoles; piperidones | angiogenesis inhibitor; antineoplastic agent; immunomodulator |
lacosamide | [no description available] | medium | 1 | 0 | N-acyl-amino acid | |
vincristine sulfate | [no description available] | medium | 1 | 0 | organic sulfate salt | antineoplastic agent; geroprotector |
pentostatin | [no description available] | medium | 1 | 0 | coformycins | antimetabolite; antineoplastic agent; Aspergillus metabolite; bacterial metabolite; EC 3.5.4.4 (adenosine deaminase) inhibitor |
perindopril erbumine | [no description available] | medium | 1 | 0 | addition compound | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor |
miglitol | [no description available] | medium | 1 | 0 | piperidines | |
rocuronium bromide | [no description available] | medium | 1 | 0 | organic bromide salt; quaternary ammonium salt | muscle relaxant; neuromuscular agent |
pemirolast potassium salt | [no description available] | medium | 1 | 0 | | |
eplerenone | [no description available] | medium | 1 | 0 | 3-oxo-Delta(4) steroid; epoxy steroid; gamma-lactone; methyl ester; organic heteropentacyclic compound; oxaspiro compound; steroid acid ester | aldosterone antagonist; antihypertensive agent |
loteprednol etabonate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; etabonate ester; organochlorine compound; steroid acid ester; steroid ester | anti-inflammatory drug |
fluticasone propionate | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; corticosteroid; fluorinated steroid; propanoate ester; steroid ester; thioester | adrenergic agent; anti-allergic agent; anti-asthmatic drug; anti-inflammatory drug; bronchodilator agent; dermatologic drug |
valrubicin | [no description available] | medium | 1 | 0 | anthracycline; trifluoroacetamide | |
posaconazole | [no description available] | medium | 2 | 0 | aromatic ether; conazole antifungal drug; N-arylpiperazine; organofluorine compound; oxolanes; triazole antifungal drug; triazoles | trypanocidal drug |
arginine vasopressin | [no description available] | medium | 2 | 0 | vasopressin | cardiovascular drug; hematologic agent; mitogen |
trilostane | [no description available] | medium | 1 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid; androstanoid; epoxy steroid; nitrile | abortifacient; antineoplastic agent; EC 1.1.1.210 [3beta(or 20alpha)-hydroxysteroid dehydrogenase] inhibitor |
leuprolide acetate | [no description available] | medium | 1 | 0 | acetate salt | antineoplastic agent; gonadotropin releasing hormone agonist |
levosulpiride | [no description available] | medium | 1 | 0 | sulpiride | antidepressant; antiemetic; antipsychotic agent; dopaminergic antagonist |
eszopiclone | [no description available] | medium | 1 | 0 | zopiclone | central nervous system depressant; sedative |
epalrestat | [no description available] | medium | 1 | 0 | monocarboxylic acid; thiazolidines | EC 1.1.1.21 (aldehyde reductase) inhibitor |
latoconazole | [no description available] | medium | 1 | 0 | conazole antifungal drug; imidazole antifungal drug | |
maraviroc | [no description available] | medium | 1 | 0 | tropane alkaloid | |
toremifene citrate | [no description available] | medium | 1 | 0 | stilbenoid | anticoronaviral agent |
nelarabine | [no description available] | medium | 1 | 0 | beta-D-arabinoside; monosaccharide derivative; purine nucleoside | antineoplastic agent; DNA synthesis inhibitor; prodrug |
azilect | [no description available] | medium | 1 | 0 | | |
dasatinib | [no description available] | medium | 2 | 0 | 1,3-thiazoles; aminopyrimidine; monocarboxylic acid amide; N-(2-hydroxyethyl)piperazine; N-arylpiperazine; organochlorine compound; secondary amino compound; tertiary amino compound | anticoronaviral agent; antineoplastic agent; tyrosine kinase inhibitor |
vitamin d 2 | [no description available] | medium | 1 | 0 | hydroxy seco-steroid; seco-ergostane; vitamin D | bone density conservation agent; nutraceutical; plant metabolite; rodenticide |
brompheniramine maleate | [no description available] | medium | 1 | 0 | maleate salt | anti-allergic agent |
dexchlorpheniramine maleate | [no description available] | medium | 1 | 0 | organic molecular entity | |
travoprost | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; isopropyl ester; prostaglandins Falpha | antiglaucoma drug; antihypertensive agent; ophthalmology drug; prodrug; prostaglandin receptor agonist |
imipenem | [no description available] | medium | 1 | 0 | carbapenems | |
ketotifen fumarate | [no description available] | medium | 1 | 0 | organoammonium salt | anti-asthmatic drug; H1-receptor antagonist |
dinoprost tromethamine | [no description available] | medium | 1 | 0 | organic molecular entity | |
rosuvastatin calcium | [no description available] | medium | 1 | 0 | N-acyl-15-methylhexadecasphinganine-1-phosphoethanolamine; organic calcium salt | anti-inflammatory agent; cardioprotective agent; CETP inhibitor |
terbinafine hydrochloride | [no description available] | medium | 1 | 0 | allylamine antifungal drug; hydrochloride | EC 1.14.13.132 (squalene monooxygenase) inhibitor; P450 inhibitor |
nalmefene | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
acipimox | [no description available] | medium | 1 | 0 | pyrazinecarboxylic acid | |
atosiban | [no description available] | medium | 1 | 0 | oligopeptide | |
bimatoprost | [no description available] | medium | 1 | 0 | monocarboxylic acid amide | antiglaucoma drug; antihypertensive agent |
latanoprost | [no description available] | medium | 1 | 0 | isopropyl ester; prostaglandins Falpha; triol | antiglaucoma drug; antihypertensive agent; EC 4.2.1.1 (carbonic anhydrase) inhibitor; prodrug |
nateglinide | [no description available] | medium | 1 | 0 | phenylalanine derivative | |
enalapril maleate | [no description available] | medium | 1 | 0 | maleate salt | antihypertensive agent; EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor; prodrug |
pregabalin | [no description available] | medium | 2 | 0 | gamma-amino acid | anticonvulsant; calcium channel blocker |
alvimopan anhydrous | [no description available] | medium | 1 | 0 | peptide | |
tenofovir disoproxil fumarate | [no description available] | medium | 1 | 0 | fumarate salt | antiviral drug; HIV-1 reverse transcriptase inhibitor; prodrug |
dexbrompheniramine maleate | [no description available] | medium | 1 | 0 | brompheniramine maleate | anti-allergic agent; H1-receptor antagonist |
rifaximin | [no description available] | medium | 1 | 0 | acetate ester; cyclic ketal; lactam; macrocycle; organic heterohexacyclic compound; rifamycins; semisynthetic derivative | antimicrobial agent; gastrointestinal drug; orphan drug |
everolimus | [no description available] | medium | 1 | 0 | cyclic acetal; cyclic ketone; ether; macrolide lactam; primary alcohol; secondary alcohol | anticoronaviral agent; antineoplastic agent; geroprotector; immunosuppressive agent; mTOR inhibitor |
cefpodoxime proxetil | [no description available] | medium | 1 | 0 | carboxylic acid; carboxylic ester; cephalosporin | antibacterial drug; prodrug |
fluphenazine | [no description available] | medium | 1 | 0 | | |
cefdinir | [no description available] | medium | 1 | 0 | cephalosporin; ketoxime | antibacterial drug |
bisoprolol, fumarate (1:1) salt | [no description available] | medium | 1 | 0 | | |
artesunate | [no description available] | medium | 3 | 0 | artemisinin derivative; cyclic acetal; dicarboxylic acid monoester; hemisuccinate; semisynthetic derivative; sesquiterpenoid | antimalarial; antineoplastic agent; ferroptosis inducer |
etoposide phosphate | [no description available] | medium | 1 | 0 | furonaphthodioxole | |
ciclesonide | [no description available] | medium | 1 | 0 | organic molecular entity | |
temsirolimus | [no description available] | medium | 1 | 0 | macrolide lactam | |
dutasteride | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; aza-steroid; delta-lactam | antihyperplasia drug; EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor |
tekturna | [no description available] | medium | 1 | 0 | fumarate salt | antihypertensive agent |
vildagliptin | [no description available] | medium | 1 | 0 | amino acid amide | |
sgd 301-76 | [no description available] | medium | 1 | 0 | conazole antifungal drug; imidazole antifungal drug; organic nitrate salt | antiinfective agent |
fluvoxamine maleate | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes | |
dexlansoprazole | [no description available] | medium | 1 | 0 | benzimidazoles; sulfoxide | |
gemifloxacin mesylate | [no description available] | medium | 1 | 0 | methanesulfonate salt | antimicrobial agent; topoisomerase IV inhibitor |
rivaroxaban | [no description available] | medium | 1 | 0 | aromatic amide; lactam; monocarboxylic acid amide; morpholines; organochlorine compound; oxazolidinone; thiophenes | anticoagulant; EC 3.4.21.6 (coagulation factor Xa) inhibitor |
hki 272 | [no description available] | medium | 1 | 0 | nitrile; quinolines | antineoplastic agent; tyrosine kinase inhibitor |
tofacitinib | [no description available] | medium | 1 | 0 | N-acylpiperidine; nitrile; pyrrolopyrimidine; tertiary amino compound | antirheumatic drug; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor |
pazopanib | [no description available] | medium | 1 | 0 | aminopyrimidine; indazoles; sulfonamide | angiogenesis modulating agent; antineoplastic agent; tyrosine kinase inhibitor; vascular endothelial growth factor receptor antagonist |
amg 009 | [no description available] | medium | 1 | 0 | | |
cefotaxime sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
losartan potassium | [no description available] | medium | 1 | 0 | | |
dactolisib | [no description available] | medium | 1 | 0 | imidazoquinoline; nitrile; quinolines; ring assembly; ureas | antineoplastic agent; EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; mTOR inhibitor |
rabeprazole sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
bivalirudin | [no description available] | medium | 1 | 0 | polypeptide | anticoagulant; EC 3.4.21.5 (thrombin) inhibitor |
somatostatin | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide; peptide hormone | |
warfarin sodium | [no description available] | medium | 1 | 0 | | |
pravastatin sodium | [no description available] | medium | 1 | 0 | organic sodium salt; statin (semi-synthetic) | anticholesteremic drug |
alendronate sodium | [no description available] | medium | 1 | 0 | | |
sl 80.0750 | [no description available] | medium | 1 | 0 | | |
clavulanate potassium | [no description available] | medium | 1 | 0 | potassium salt | antibacterial drug; antimicrobial agent; EC 3.5.2.6 (beta-lactamase) inhibitor |
piperacillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
cefazolin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
azlocillin sodium | [no description available] | medium | 1 | 0 | organic sodium salt | |
roquinimex | [no description available] | medium | 1 | 0 | aromatic amide | |
isoxicam | [no description available] | medium | 1 | 0 | benzothiazine; isoxazoles; monocarboxylic acid amide | antirheumatic drug; non-steroidal anti-inflammatory drug |
minocycline hydrochloride | [no description available] | medium | 1 | 0 | | |
valtrex | [no description available] | medium | 1 | 0 | organic molecular entity | |
citrovorum factor | [no description available] | medium | 1 | 0 | tetrahydrofolic acid | |
rifapentine | [no description available] | medium | 1 | 0 | N-alkylpiperazine; N-iminopiperazine; rifamycins | antitubercular agent; leprostatic drug |
sildenafil citrate | [no description available] | medium | 1 | 0 | citrate salt | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor; vasodilator agent |
aprepitant | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; cyclic acetal; morpholines; triazoles | antidepressant; antiemetic; neurokinin-1 receptor antagonist; peripheral nervous system drug; substance P receptor antagonist |
tegaserod maleate | [no description available] | medium | 1 | 0 | maleate salt | serotonergic agonist |
methicillin | [no description available] | medium | 74 | 0 | penicillin allergen; penicillin | antibacterial drug |
methicillin | [no description available] | medium | 74 | 3 | penicillin allergen; penicillin | antibacterial drug |
imidazole | [no description available] | medium | 1 | 0 | imidazole | |
cytidine triphosphate | [no description available] | medium | 1 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
cylindrocyclophane a | [no description available] | medium | 1 | 0 | | |
zephiramine | [no description available] | medium | 1 | 0 | | |
dodecyltrimethylammonium bromide | [no description available] | medium | 1 | 0 | bromide salt; quaternary ammonium salt | surfactant |
didecyldimethylammonium chloride | [no description available] | medium | 1 | 0 | organic molecular entity | |
gentamicin c1a | [no description available] | medium | 2 | 0 | gentamycin C | |
diosgenin | [no description available] | medium | 1 | 0 | 3beta-sterol; hexacyclic triterpenoid; sapogenin; spiroketal | antineoplastic agent; antiviral agent; apoptosis inducer; metabolite |
cucurbitacin b | [no description available] | medium | 1 | 0 | cucurbitacin; secondary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
b 844-39 | [no description available] | medium | 1 | 0 | diarylmethane | |
rabeprazole | [no description available] | medium | 1 | 0 | benzimidazoles; pyridines; sulfoxide | anti-ulcer drug; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor |
delavirdine | [no description available] | medium | 1 | 0 | aminopyridine; indolecarboxamide; N-acylpiperazine; sulfonamide | antiviral drug; HIV-1 reverse transcriptase inhibitor |
1,3-benzodioxole | [no description available] | medium | 1 | 0 | benzodioxole | |
atovaquone | [no description available] | medium | 1 | 0 | hydroxy-1,2-naphthoquinone | |
tryptoquivaline | [no description available] | medium | 1 | 0 | aromatic ether; indole alkaloid; organic heteropentacyclic compound | breast cancer resistance protein inhibitor; mycotoxin |
abacavir | [no description available] | medium | 1 | 0 | 2,6-diaminopurines | antiviral drug; drug allergen; HIV-1 reverse transcriptase inhibitor |
6-prenylchrysin | [no description available] | medium | 1 | 0 | 7-hydroxyflavonol; dihydroxyflavone | |
ketoconazole | [no description available] | medium | 1 | 0 | cis-1-acetyl-4-(4-{[2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazine | |
s 1033 | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; imidazoles; pyridines; pyrimidines; secondary amino compound; secondary carboxamide | anticoronaviral agent; antineoplastic agent; tyrosine kinase inhibitor |
curcumin | [no description available] | medium | 2 | 0 | aromatic ether; beta-diketone; diarylheptanoid; enone; polyphenol | anti-inflammatory agent; antifungal agent; antineoplastic agent; biological pigment; contraceptive drug; dye; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; EC 1.8.1.9 (thioredoxin reductase) inhibitor; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; flavouring agent; food colouring; geroprotector; hepatoprotective agent; immunomodulator; iron chelator; ligand; lipoxygenase inhibitor; metabolite; neuroprotective agent; nutraceutical; radical scavenger |
cancidas | [no description available] | medium | 1 | 0 | | |
sq 109 | [no description available] | medium | 1 | 0 | | |
tectochrysin | [no description available] | medium | 1 | 0 | monohydroxyflavone; monomethoxyflavone | antidiarrhoeal drug; antineoplastic agent; plant metabolite |
topiroxostat | [no description available] | medium | 1 | 0 | | |
bosutinib | [no description available] | medium | 1 | 0 | aminoquinoline; aromatic ether; dichlorobenzene; N-methylpiperazine; nitrile; tertiary amino compound | antineoplastic agent; tyrosine kinase inhibitor |
su 11248 | [no description available] | medium | 1 | 0 | monocarboxylic acid amide; pyrroles | angiogenesis inhibitor; antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor; immunomodulator; neuroprotective agent; vascular endothelial growth factor receptor antagonist |
3,3',4,5'-tetramethoxy-trans-stilbene | [no description available] | medium | 1 | 0 | | |
rilpivirine | [no description available] | medium | 1 | 0 | aminopyrimidine; nitrile | EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor; HIV-1 reverse transcriptase inhibitor |
isavuconazole | [no description available] | medium | 1 | 0 | 1,3-thiazoles; conazole antifungal drug; difluorobenzene; nitrile; tertiary alcohol; triazole antifungal drug | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor; ergosterol biosynthesis inhibitor; orphan drug |
timcodar | [no description available] | medium | 1 | 0 | | |
tivozanib | [no description available] | medium | 1 | 0 | aromatic ether | |
regorafenib | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; aromatic ether; monochlorobenzenes; monofluorobenzenes; phenylureas; pyridinecarboxamide | antineoplastic agent; hepatotoxic agent; tyrosine kinase inhibitor |
fostamatinib | [no description available] | medium | 1 | 0 | | |
gdc 0449 | [no description available] | medium | 1 | 0 | benzamides; monochlorobenzenes; pyridines; sulfone | antineoplastic agent; Hedgehog signaling pathway inhibitor; SMO receptor antagonist; teratogenic agent |
ponatinib | [no description available] | medium | 1 | 0 | (trifluoromethyl)benzenes; acetylenic compound; benzamides; imidazopyridazine; N-methylpiperazine | antineoplastic agent; tyrosine kinase inhibitor |
cobicistat | [no description available] | medium | 1 | 0 | 1,3-thiazoles; carbamate ester; monocarboxylic acid amide; morpholines; ureas | P450 inhibitor |
alectinib | [no description available] | medium | 1 | 0 | aromatic ketone; morpholines; nitrile; organic heterotetracyclic compound; piperidines | antineoplastic agent; EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor |
chir 258 | [no description available] | medium | 1 | 0 | | |
amg531 | [no description available] | medium | 1 | 0 | | |
gentamicin c1 | [no description available] | medium | 1 | 0 | | |
artocarpin lectin | [no description available] | medium | 1 | 0 | monomethoxyflavone; trihydroxyflavone | antineoplastic agent; metabolite |
polymyxin b(1) | [no description available] | medium | 1 | 0 | | |
forapin | [no description available] | medium | 1 | 0 | peptidyl amide; polypeptide | animal metabolite; antineoplastic agent; apoptosis inducer; EC 2.7.11.13 (protein kinase C) inhibitor; hepatoprotective agent; neuroprotective agent; venom |
trimethoprim, sulfamethoxazole drug combination | [no description available] | medium | 13 | 1 | | |
gentamicin | [no description available] | medium | 81 | 4 | | |
octenidine | [no description available] | medium | 1 | 0 | dihydropyridine | |
niraparib | [no description available] | medium | 1 | 0 | 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide | antineoplastic agent; apoptosis inducer; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; radiosensitizing agent |
indazoles | [no description available] | medium | 1 | 0 | indazole | |
betamethasone-17,21-dipropionate | [no description available] | medium | 1 | 0 | | |
epidermal growth factor | [no description available] | medium | 1 | 0 | | |
aflatoxin b1 | [no description available] | medium | 1 | 0 | aflatoxin; aromatic ether; aromatic ketone | carcinogenic agent; human metabolite |
chitosan | [no description available] | medium | 3 | 0 | | |
colistin | [no description available] | medium | 14 | 0 | | |
cephalosporin c | [no description available] | medium | 44 | 2 | cephalosporin | fungal metabolite |
transforming growth factor beta | [no description available] | medium | 1 | 0 | | |
mannich bases | [no description available] | medium | 1 | 0 | | |
endolysin | [no description available] | medium | 1 | 0 | alpha-amino acid; diamino acid; polar amino acid | Daphnia magna metabolite |
guanosine tetraphosphate | [no description available] | medium | 6 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
helvolic acid | [no description available] | medium | 42 | 0 | 3-oxo-Delta(1) steroid; acetate ester; monocarboxylic acid; steroid acid | antibacterial agent; fungal metabolite; mycotoxin |
cerulenin | [no description available] | medium | 5 | 0 | epoxide; monocarboxylic acid amide | antifungal agent; antiinfective agent; antilipemic drug; antimetabolite; antimicrobial agent; fatty acid synthesis inhibitor |
retapamulin | [no description available] | medium | 9 | 1 | carbotricyclic compound; carboxylic ester; cyclic ketone | |
carbostyril | [no description available] | medium | 7 | 1 | monohydroxyquinoline; quinolone | bacterial xenobiotic metabolite |
betadex | [no description available] | medium | 4 | 0 | cyclodextrin | |
chlorhexidine | [no description available] | medium | 7 | 0 | biguanides; monochlorobenzenes | antibacterial agent; antiinfective agent |
betamethasone valerate | [no description available] | medium | 10 | 2 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; primary alpha-hydroxy ketone; steroid ester | anti-inflammatory drug |
choline | [no description available] | medium | 1 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
2-bromo-5-(2-bromo-2-nitrovinyl)furan | [no description available] | medium | 1 | 0 | | |
ozenoxacin | [no description available] | medium | 2 | 0 | quinolines | |
alpha-aminopyridine | [no description available] | medium | 2 | 0 | | |
bufexamac | [no description available] | medium | 1 | 0 | aromatic ether; hydroxamic acid | antipyretic; non-narcotic analgesic; non-steroidal anti-inflammatory drug |
azelastine | [no description available] | medium | 1 | 0 | monochlorobenzenes; phthalazines; tertiary amino compound | anti-allergic agent; anti-asthmatic drug; bronchodilator agent; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; H1-receptor antagonist; platelet aggregation inhibitor |
tempo | [no description available] | medium | 1 | 0 | aminoxyls; piperidines | catalyst; ferroptosis inhibitor; radical scavenger |
daptomycin | [no description available] | medium | 5 | 0 | | |
clobetasol | [no description available] | medium | 6 | 1 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; chlorinated steroid; fluorinated steroid; glucocorticoid; tertiary alpha-hydroxy ketone | anti-inflammatory drug; SMO receptor agonist |
guanosine triphosphate | [no description available] | medium | 87 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
viomycin | [no description available] | medium | 5 | 0 | heterodetic cyclic peptide; peptide antibiotic | antitubercular agent |
thiostrepton | [no description available] | medium | 10 | 0 | | |
nadp | [no description available] | medium | 3 | 0 | | |
beta-lactams | [no description available] | medium | 5 | 0 | beta-lactam antibiotic allergen; beta-lactam | |
aminolevulinic acid | [no description available] | medium | 1 | 1 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
rifamycins | [no description available] | medium | 10 | 1 | | |
triazoles | [no description available] | medium | 1 | 0 | 1,2,3-triazole | |
lymecycline | [no description available] | medium | 1 | 0 | | |
silver | [no description available] | medium | 1 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
pseurotin | [no description available] | medium | 1 | 0 | azaspiro compound; lactam; oxaspiro compound | metabolite |
fumagillin | [no description available] | medium | 2 | 0 | antibiotic antifungal drug; carboxylic ester; dicarboxylic acid monoester; meroterpenoid; organooxygen heterocyclic antibiotic; spiro-epoxide | angiogenesis inhibitor; antibacterial drug; antimicrobial agent; antiprotozoal drug; fungal metabolite; methionine aminopeptidase 2 inhibitor |
sesquiterpenes | [no description available] | medium | 4 | 0 | | |
fluorobenzenes | [no description available] | medium | 1 | 0 | monofluorobenzenes | NMR chemical shift reference compound |
oxazolidin-2-one | [no description available] | medium | 14 | 1 | carbamate ester; oxazolidinone | metabolite |
methylparaben | [no description available] | medium | 1 | 0 | paraben | antifungal agent; antimicrobial food preservative; neuroprotective agent; plant metabolite |
propylparaben | [no description available] | medium | 1 | 0 | benzoate ester; paraben; phenols | antifungal agent; antimicrobial agent |
sorbic acid | [no description available] | medium | 2 | 0 | alpha,beta-unsaturated monocarboxylic acid; sorbic acid | |
methylprednisolone aceponate | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
nintedanib | [no description available] | medium | 1 | 0 | | |
amoxicillin-potassium clavulanate combination | [no description available] | medium | 5 | 0 | | |
berberine | [no description available] | medium | 1 | 0 | alkaloid antibiotic; berberine alkaloid; botanical anti-fungal agent; organic heteropentacyclic compound | antilipemic drug; antineoplastic agent; antioxidant; EC 1.1.1.141 [15-hydroxyprostaglandin dehydrogenase (NAD(+))] inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.13.11.52 (indoleamine 2,3-dioxygenase) inhibitor; EC 1.21.3.3 (reticuline oxidase) inhibitor; EC 2.1.1.116 [3'-hydroxy-N-methyl-(S)-coclaurine 4'-O-methyltransferase] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.11.10 (IkappaB kinase) inhibitor; EC 3.1.1.4 (phospholipase A2) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor; EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; geroprotector; hypoglycemic agent; metabolite; potassium channel blocker |
gliotoxin | [no description available] | medium | 4 | 0 | dipeptide; organic disulfide; organic heterotetracyclic compound; pyrazinoindole | antifungal agent; EC 2.5.1.58 (protein farnesyltransferase) inhibitor; immunosuppressive agent; mycotoxin; proteasome inhibitor |
sodium hypochlorite | [no description available] | medium | 1 | 0 | inorganic sodium salt | bleaching agent; disinfectant |
meglumine antimoniate | [no description available] | medium | 1 | 0 | | |
ergosterol | [no description available] | medium | 5 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | fungal metabolite; Saccharomyces cerevisiae metabolite |
n-vinyl-2-pyrrolidinone | [no description available] | medium | 1 | 0 | pyrrolidin-2-ones | |
propylene glycol | [no description available] | medium | 1 | 0 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
virginiamycin | [no description available] | medium | 10 | 1 | | |
arbekacin | [no description available] | medium | 1 | 0 | aminoglycoside; kanamycins | antibacterial agent; antibacterial drug; antimicrobial agent; protein synthesis inhibitor |
ru 66647 | [no description available] | medium | 1 | 0 | | |
quinupristin-dalfopristin | [no description available] | medium | 2 | 0 | organic molecular entity | |
dibekacin | [no description available] | medium | 1 | 0 | kanamycins | antibacterial agent; protein synthesis inhibitor |
carbapenems | [no description available] | medium | 2 | 0 | | |
aszonalenin | [no description available] | medium | 1 | 0 | benzodiazepine; zwitterion | |
2-nitrophenylgalactoside | [no description available] | medium | 1 | 0 | | |
nitrophenylgalactosides | [no description available] | medium | 1 | 0 | beta-D-galactoside; C-nitro compound | chromogenic compound |
cyclin d1 | [no description available] | medium | 1 | 0 | | |
rupatadine | [no description available] | medium | 1 | 0 | benzocycloheptapyridine | |
4-(carboethoxyphenyl)retinamide | [no description available] | medium | 1 | 0 | | |
phosphonoacetic acid | [no description available] | medium | 1 | 0 | monocarboxylic acid; phosphonic acids | antiviral agent; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor |
pyrroles | [no description available] | medium | 6 | 0 | pyrrole; secondary amine | |
cefepime | [no description available] | medium | 3 | 1 | cephalosporin; oxime O-ether | antibacterial drug |
hepes | [no description available] | medium | 1 | 0 | HEPES; organosulfonic acid | |
calcium sulfate | [no description available] | medium | 5 | 0 | calcium salt; inorganic calcium salt | |
thymidine | [no description available] | medium | 5 | 1 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
chlorocresol | [no description available] | medium | 1 | 0 | hydroxytoluene; monochlorobenzenes | antimicrobial agent; disinfectant; ryanodine receptor agonist |
mometasone furoate | [no description available] | medium | 2 | 0 | 11beta-hydroxy steroid; 2-furoate ester; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; organochlorine compound; steroid ester | anti-allergic agent; anti-inflammatory drug |
squalene | [no description available] | medium | 8 | 0 | triterpene | human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2,3-oxidosqualene | [no description available] | medium | 1 | 0 | 2,3-epoxysqualene | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
catechin | [no description available] | medium | 1 | 0 | catechin | antioxidant; plant metabolite |
ethyl gallate | [no description available] | medium | 1 | 0 | gallate ester | plant metabolite |
gallic acid | [no description available] | medium | 1 | 0 | trihydroxybenzoic acid | antineoplastic agent; antioxidant; apoptosis inducer; astringent; cyclooxygenase 2 inhibitor; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; geroprotector; human xenobiotic metabolite; plant metabolite |
epicatechin gallate | [no description available] | medium | 1 | 0 | catechin; gallate ester; polyphenol | EC 3.2.1.1 (alpha-amylase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
methylcellulose | [no description available] | medium | 1 | 0 | | |
cefuroxime | [no description available] | medium | 4 | 1 | carbamate ester; cephalosporin | |
leucine | [no description available] | medium | 24 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
orabase | [no description available] | medium | 2 | 0 | | |
phenanthrenes | [no description available] | medium | 1 | 0 | | |
4-phenylenediamine | [no description available] | medium | 1 | 0 | phenylenediamine | allergen; dye; hapten; reagent |
potassium permanganate | [no description available] | medium | 2 | 0 | | |
aluminum chloride | [no description available] | medium | 2 | 0 | aluminium coordination entity | Lewis acid |
chlorine | [no description available] | medium | 5 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
fluorescein | [no description available] | medium | 3 | 0 | 2-benzofurans; gamma-lactone; organic heteropentacyclic compound; oxaspiro compound; polyphenol; xanthene dye | fluorescent dye; radioopaque medium |
propoxycaine | [no description available] | medium | 1 | 0 | benzoate ester | |
proxymetacaine | [no description available] | medium | 1 | 0 | benzoate ester | |
acetonitrile | [no description available] | medium | 1 | 0 | aliphatic nitrile; volatile organic compound | EC 3.5.1.4 (amidase) inhibitor; NMR chemical shift reference compound; polar aprotic solvent |
methanol | [no description available] | medium | 4 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
methylene chloride | [no description available] | medium | 1 | 0 | chloromethanes; volatile organic compound | carcinogenic agent; polar aprotic solvent; refrigerant |
guanosine diphosphate | [no description available] | medium | 18 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
sm 1 peptide | [no description available] | medium | 2 | 0 | acetate ester; ergot alkaloid | metabolite |
valine | [no description available] | medium | 10 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
taurine | [no description available] | medium | 3 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
nvc-422 | [no description available] | medium | 1 | 0 | | |
amicoumacin a | [no description available] | medium | 1 | 0 | organic molecular entity | |
thiazoles | [no description available] | medium | 1 | 0 | 1,3-thiazoles; mancude organic heteromonocyclic parent; monocyclic heteroarene | |
diminazene aceturate | [no description available] | medium | 1 | 0 | N-acetylglycinate salt | antiparasitic agent; trypanocidal drug |
diminazene | [no description available] | medium | 1 | 0 | carboxamidine; triazene derivative | antiparasitic agent; trypanocidal drug |
dextrothyroxine | [no description available] | medium | 1 | 0 | | |
moxidectin | [no description available] | medium | 1 | 0 | | |
sordarin | [no description available] | medium | 3 | 0 | | |
lactimidomycin | [no description available] | medium | 1 | 0 | macrolide | |
2-piperidone | [no description available] | medium | 1 | 0 | delta-lactam; piperidones | EC 1.2.1.88 (L-glutamate gamma-semialdehyde dehydrogenase) inhibitor |
cadmium | [no description available] | medium | 5 | 0 | cadmium molecular entity; zinc group element atom | |
ethidium | [no description available] | medium | 2 | 0 | phenanthridines | fluorochrome; intercalator |
sodium salicylate | [no description available] | medium | 3 | 0 | organic molecular entity | |
lithium chloride | [no description available] | medium | 1 | 0 | inorganic chloride; lithium salt | antimanic drug; geroprotector |
povidone-iodine | [no description available] | medium | 2 | 1 | | |
peptide elongation factor 2 | [no description available] | medium | 9 | 0 | | |
gamma-cyclodextrin | [no description available] | medium | 2 | 0 | cyclodextrin | |
cytellin | [no description available] | medium | 1 | 0 | | |
fibrin | [no description available] | medium | 2 | 0 | peptide | |
hydrochloric acid | [no description available] | medium | 1 | 0 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
sultamicillin | [no description available] | medium | 1 | 0 | penicillanic acid ester | |
interleukin-8 | [no description available] | medium | 2 | 0 | | |
1,2-dicapryl-sn-3-glycerophosphocholine | [no description available] | medium | 1 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine; decanoate ester | |
lysophosphatidylcholines | [no description available] | medium | 2 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine | |
phosphatidylcholines | [no description available] | medium | 8 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
ristocetin | [no description available] | medium | 4 | 0 | glycopeptide; heterodetic cyclic peptide; macrocycle; tetrasaccharide derivative | antibacterial drug; antimicrobial agent; bacterial metabolite; platelet-activating factor receptor agonist |
hydroxyl radical | [no description available] | medium | 1 | 0 | oxygen hydride; oxygen radical; reactive oxygen species | |
aminopenicillanic acid | [no description available] | medium | 1 | 0 | amino acid zwitterion; penicillanic acids | allergen |
penicillanic acid | [no description available] | medium | 1 | 0 | penicillanic acids | |
7-aminocephalosporanic acid | [no description available] | medium | 1 | 0 | alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion | |
cefaloram | [no description available] | medium | 1 | 0 | cephalosporin | antibacterial drug |
agar | [no description available] | medium | 5 | 0 | | |
cysteine | [no description available] | medium | 1 | 0 | cysteinium | fundamental metabolite |
2,4-dinitrobenzenesulfonic acid | [no description available] | medium | 1 | 0 | arenesulfonic acid; C-nitro compound | |
tetradecanoylphorbol acetate | [no description available] | medium | 2 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
indolmycin | [no description available] | medium | 1 | 0 | 1,3-oxazoles; indoles; secondary amino compound | antibacterial agent; antimicrobial agent; bacterial metabolite; EC 6.1.1.2 (tryptophan--tRNA ligase) inhibitor |
potassium chloride | [no description available] | medium | 3 | 0 | inorganic chloride; inorganic potassium salt; potassium salt | fertilizer |
nickel | [no description available] | medium | 2 | 0 | metal allergen; nickel group element atom | epitope; micronutrient |
heme | [no description available] | medium | 1 | 0 | | |
physcione | [no description available] | medium | 1 | 0 | dihydroxyanthraquinone | anti-inflammatory agent; antibacterial agent; antifungal agent; antineoplastic agent; apoptosis inducer; hepatoprotective agent; metabolite |
tryptoquivaline | [no description available] | medium | 1 | 0 | | |
emodin | [no description available] | medium | 1 | 0 | trihydroxyanthraquinone | antineoplastic agent; laxative; plant metabolite; tyrosine kinase inhibitor |
sulochrin | [no description available] | medium | 1 | 0 | benzophenones; carboxylic ester; phenols | metabolite |
ergosta-7,22-dien-3-ol | [no description available] | medium | 1 | 0 | | |
lysine | [no description available] | medium | 7 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
c-peptide | [no description available] | medium | 1 | 1 | | |
glycocholic acid | [no description available] | medium | 2 | 0 | bile acid glycine conjugate | human metabolite |
azobis(isobutyronitrile) | [no description available] | medium | 1 | 0 | | |
diazomethane | [no description available] | medium | 1 | 0 | diazo compound | alkylating agent; antineoplastic agent; carcinogenic agent; poison |
azides | [no description available] | medium | 3 | 0 | pseudohalide anion | mitochondrial respiratory-chain inhibitor |
dalfopristin | [no description available] | medium | 1 | 0 | | |
quinupristin | [no description available] | medium | 1 | 0 | cyclodepsipeptide | |
fluorometholone | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(1),Delta(4)-steroid; fluorinated steroid; glucocorticoid; tertiary alpha-hydroxy ketone | anti-inflammatory drug |
adenosine diphosphate | [no description available] | medium | 5 | 0 | adenosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | fundamental metabolite; human metabolite |
phenyl acetate | [no description available] | medium | 11 | 0 | benzenes; phenyl acetates | |
propamidine isethionate | [no description available] | medium | 1 | 0 | guanidinium salt; organosulfonate salt | antimicrobial agent; antiseptic drug |
cadmium acetate | [no description available] | medium | 1 | 0 | | |
fluticasone | [no description available] | medium | 1 | 1 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; fluorinated steroid; thioester | anti-allergic agent; anti-asthmatic drug |
isepamicin | [no description available] | medium | 1 | 0 | | |
1-palmitoyl-2-oleoylphosphatidylcholine | [no description available] | medium | 1 | 0 | | |
cyclosporine | [no description available] | medium | 1 | 0 | | |
ribosomal protein l7-l12 | [no description available] | medium | 1 | 0 | | |
guanosine monophosphate | [no description available] | medium | 1 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
5'-guanylylmethylenebisphosphonate | [no description available] | medium | 2 | 0 | nucleoside triphosphate analogue | |
puromycin | [no description available] | medium | 65 | 0 | puromycins | antiinfective agent; antimicrobial agent; antineoplastic agent; EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor; EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor; nucleoside antibiotic; protein synthesis inhibitor |
levallorphan | [no description available] | medium | 1 | 0 | morphinane alkaloid | |
filipin | [no description available] | medium | 1 | 0 | | |
mocimycin | [no description available] | medium | 3 | 0 | C-glycosyl compound | |
guanylyl imidodiphosphate | [no description available] | medium | 3 | 0 | nucleoside triphosphate analogue | |
cefotiam | [no description available] | medium | 1 | 0 | beta-lactam antibiotic allergen; cephalosporin; semisynthetic derivative | antibacterial drug |
sulfobromophthalein | [no description available] | medium | 2 | 0 | 2-benzofurans; organobromine compound; organosulfonic acid; phenols | dye |
hydrocortisone-17-butyrate | [no description available] | medium | 1 | 0 | butyrate ester; cortisol ester; primary alpha-hydroxy ketone | dermatologic drug; drug allergen |
cephradine | [no description available] | medium | 1 | 0 | beta-lactam antibiotic allergen; cephalosporin | antibacterial drug |
methylmethacrylate | [no description available] | medium | 2 | 0 | enoate ester; methyl ester | allergen; polymerisation monomer |
sparsomycin | [no description available] | medium | 6 | 0 | | |
diacetyl | [no description available] | medium | 1 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
bilirubin | [no description available] | medium | 4 | 0 | biladienes; dicarboxylic acid | antioxidant; human metabolite; mouse metabolite |
phosphorus | [no description available] | medium | 1 | 0 | monoatomic phosphorus; nonmetal atom; pnictogen | macronutrient |
arsenic | [no description available] | medium | 2 | 0 | metalloid atom; pnictogen | micronutrient |
fluorescein-5-isothiocyanate | [no description available] | medium | 4 | 0 | fluorescein isothiocyanate | |
(hexadecanoyl)aminofluorescein | [no description available] | medium | 1 | 0 | | |
erythrosine | [no description available] | medium | 1 | 0 | | |
tauro-24,25-dihydrofusidate | [no description available] | medium | 22 | 1 | | |
polidocanol | [no description available] | medium | 1 | 0 | hydroxypolyether | hepatotoxic agent; nonionic surfactant; sclerotherapy agent |
foscarnet | [no description available] | medium | 1 | 0 | carboxylic acid; one-carbon compound; phosphonic acids | antiviral drug; geroprotector; HIV-1 reverse transcriptase inhibitor; sodium-dependent Pi-transporter inhibitor |
trovafloxacin | [no description available] | medium | 1 | 0 | | |
glycolipids | [no description available] | medium | 2 | 1 | | |
sulfacetamide | [no description available] | medium | 3 | 0 | N-sulfonylcarboxamide; substituted aniline | antibacterial drug; antiinfective agent; antimicrobial agent; EC 2.5.1.15 (dihydropteroate synthase) inhibitor |
calcitonin | [no description available] | medium | 1 | 0 | | |
concanavalin a | [no description available] | medium | 2 | 0 | | |
fluocinonide | [no description available] | medium | 1 | 0 | organic molecular entity | |
duramycin | [no description available] | medium | 1 | 0 | heterodetic cyclic peptide; macrocycle | antimicrobial agent; apoptosis inducer; bacterial metabolite |
ro13-9904 | [no description available] | medium | 1 | 0 | | |
cromolyn sodium | [no description available] | medium | 2 | 0 | organic sodium salt | anti-asthmatic drug; drug allergen |
tixocortol pivalate | [no description available] | medium | 1 | 0 | corticosteroid; pivalate ester; tertiary alpha-hydroxy ketone; thioester | allergen; anti-allergic agent; glucocorticoid receptor agonist |
lhrh, ala(6)- | [no description available] | medium | 1 | 0 | | |
edetic acid | [no description available] | medium | 5 | 0 | ethylenediamine derivative; polyamino carboxylic acid; tetracarboxylic acid | anticoagulant; antidote; chelator; copper chelator; geroprotector |
prednisolone acetate | [no description available] | medium | 2 | 0 | corticosteroid hormone | |
lomefloxacin | [no description available] | medium | 1 | 1 | fluoroquinolone antibiotic; N-arylpiperazine; quinolinemonocarboxylic acid; quinolone antibiotic; quinolone | antimicrobial agent; antitubercular agent; photosensitizing agent |
hexamidine | [no description available] | medium | 1 | 0 | aromatic ether; guanidines; polyether | antimicrobial agent; antiseptic drug |
alpha-sarcin | [no description available] | medium | 1 | 0 | | |
1,2-didecanoylphosphatidylcholine | [no description available] | medium | 1 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine | |
nadifloxacin | [no description available] | medium | 1 | 0 | heteroarylpiperidine; hydroxypiperidine; pyridoquinoline; quinolone antibiotic | antibacterial drug |
tosufloxacin | [no description available] | medium | 2 | 0 | 1,8-naphthyridine derivative; amino acid; aminopyrrolidine; monocarboxylic acid; organofluorine compound; primary amino compound; quinolone antibiotic; tertiary amino compound | |
vanadates | [no description available] | medium | 2 | 0 | trivalent inorganic anion; vanadium oxoanion | EC 3.1.3.1 (alkaline phosphatase) inhibitor; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor |
sulfadiazine, trimethoprim drug combination | [no description available] | medium | 1 | 0 | | |
1-anilino-8-naphthalenesulfonate | [no description available] | medium | 3 | 0 | aminonaphthalene; naphthalenesulfonic acid | fluorescent probe |
cefditoren | [no description available] | medium | 1 | 0 | carboxylic acid; cephalosporin | antibacterial drug |
salicylates | [no description available] | medium | 5 | 0 | monohydroxybenzoate | plant metabolite |
bucladesine | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide | |
adenylyl imidodiphosphate | [no description available] | medium | 1 | 0 | adenosine 5'-phosphate | |
nitrites | [no description available] | medium | 1 | 0 | monovalent inorganic anion; nitrogen oxoanion; reactive nitrogen species | human metabolite |
histidine | [no description available] | medium | 1 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
ribostamycin | [no description available] | medium | 1 | 0 | amino cyclitol glycoside; aminoglycoside antibiotic | antibacterial drug; antimicrobial agent; metabolite |
aztreonam | [no description available] | medium | 1 | 0 | | |
mezlocillin | [no description available] | medium | 1 | 0 | penicillin allergen; penicillin | antibacterial drug |
aspartic acid | [no description available] | medium | 1 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
alanine | [no description available] | medium | 3 | 0 | alanine zwitterion; alanine; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; fundamental metabolite |
threonine | [no description available] | medium | 2 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
nad | [no description available] | medium | 4 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
phenylalanine | [no description available] | medium | 75 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
egtazic acid | [no description available] | medium | 1 | 0 | diether; tertiary amino compound; tetracarboxylic acid | chelator |
1,7-phenanthroline | [no description available] | medium | 1 | 0 | phenanthroline | |
mercury | [no description available] | medium | 5 | 0 | elemental mercury; zinc group element atom | neurotoxin |
proline | [no description available] | medium | 1 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
anisomycin | [no description available] | medium | 2 | 0 | monohydroxypyrrolidine; organonitrogen heterocyclic antibiotic | anticoronaviral agent; antimicrobial agent; antineoplastic agent; antiparasitic agent; bacterial metabolite; DNA synthesis inhibitor; protein synthesis inhibitor |
azomycin | [no description available] | medium | 1 | 0 | C-nitro compound; imidazoles | antitubercular agent |
cyclic gmp | [no description available] | medium | 1 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
tromethamine | [no description available] | medium | 1 | 0 | primary amino compound; triol | buffer |
ethylmaleimide | [no description available] | medium | 4 | 0 | maleimides | anticoronaviral agent; EC 1.3.1.8 [acyl-CoA dehydrogenase (NADP(+))] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.1.1 (hexokinase) inhibitor |
ammonium hydroxide | [no description available] | medium | 1 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
retinaldehyde | [no description available] | medium | 1 | 0 | retinal; vitamin A | gap junctional intercellular communication inhibitor; human metabolite; mouse metabolite |
cyanides | [no description available] | medium | 1 | 0 | pseudohalide anion | EC 1.9.3.1 (cytochrome c oxidase) inhibitor |
phosphorus radioisotopes | [no description available] | medium | 10 | 0 | | |
blasticidin s | [no description available] | medium | 1 | 0 | | |
n-formylmethionine | [no description available] | medium | 1 | 0 | L-methionine derivative; N-formyl amino acid; proteinogenic amino acid | metabolite |
fluorides | [no description available] | medium | 5 | 0 | halide anion; monoatomic fluorine | |
pivampicillin | [no description available] | medium | 1 | 0 | penicillanic acid ester; pivaloyloxymethyl ester | prodrug |
lithium | [no description available] | medium | 1 | 0 | alkali metal atom | |
phthalocyanine | [no description available] | medium | 1 | 0 | phthalocyanines; tetrapyrrole fundamental parent | |
zinc sulfate | [no description available] | medium | 1 | 0 | metal sulfate; zinc molecular entity | fertilizer |
linoleic acid | [no description available] | medium | 1 | 0 | octadecadienoic acid; omega-6 fatty acid | algal metabolite; Daphnia galeata metabolite; plant metabolite |
lysophosphatidylglycerol | [no description available] | medium | 1 | 0 | a 3-acyl-sn-glycero-1-phospho-(1'-sn-glycerol)(1-) | |
argipressin, des-glynh2(9)- | [no description available] | medium | 1 | 0 | | |
dideoxyadenosine | [no description available] | medium | 1 | 0 | adenosines; purine 2',3'-dideoxyribonucleoside | EC 3.5.4.4 (adenosine deaminase) inhibitor; EC 4.6.1.1 (adenylate cyclase) inhibitor |
n-formylmethionine leucyl-phenylalanine | [no description available] | medium | 1 | 0 | tripeptide | |
carbonyl cyanide p-trifluoromethoxyphenylhydrazone | [no description available] | medium | 1 | 0 | aromatic ether; hydrazone; nitrile; organofluorine compound | ATP synthase inhibitor; geroprotector; ionophore |
coumermycin | [no description available] | medium | 3 | 0 | aromatic amide; coumarins; glycoside; heteroarenecarboxylate ester; pyrroles | antimicrobial agent; antineoplastic agent; bacterial metabolite; DNA synthesis inhibitor; Hsp90 inhibitor; topoisomerase IV inhibitor |
pulvomycin | [no description available] | medium | 1 | 0 | | |
glycosides | [no description available] | medium | 3 | 0 | | |
methionine sulfoximine | [no description available] | medium | 1 | 0 | methionine derivative; non-proteinogenic alpha-amino acid; sulfoximide | |
c.i. 42510 | [no description available] | medium | 1 | 0 | | |
buserelin | [no description available] | medium | 1 | 0 | oligopeptide | |
sulfan blue | [no description available] | medium | 1 | 0 | organic molecular entity | |
(9R)-9-chloro-11,17-dihydroxy-17-(2-hydroxy-1-oxoethyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | [no description available] | medium | 5 | 0 | 21-hydroxy steroid | |
neotetrazolium | [no description available] | medium | 1 | 0 | | |
monensin | [no description available] | medium | 1 | 0 | cyclic hemiketal; monocarboxylic acid; polyether antibiotic; spiroketal | antifungal agent; coccidiostat; ionophore |
clobetasone butyrate | [no description available] | medium | 4 | 1 | organic molecular entity | |
monoacetyldapsone | [no description available] | medium | 1 | 0 | acetamides; anilide; secondary carboxamide; sulfone | |
nitrous acid | [no description available] | medium | 1 | 0 | nitrogen oxoacid | |
pentylenetetrazole | [no description available] | medium | 1 | 0 | organic heterobicyclic compound; organonitrogen heterocyclic compound | |
strychnine | [no description available] | medium | 1 | 0 | monoterpenoid indole alkaloid; organic heteroheptacyclic compound | avicide; cholinergic antagonist; glycine receptor antagonist; neurotransmitter agent; rodenticide |
dihydrostreptomycin sulfate | [no description available] | medium | 2 | 0 | | |
oligonucleotides | [no description available] | medium | 1 | 0 | | |
ouabain | [no description available] | medium | 1 | 0 | 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; cardenolide glycoside; steroid hormone | anti-arrhythmia drug; cardiotonic drug; EC 2.3.3.1 [citrate (Si)-synthase] inhibitor; EC 3.1.3.41 (4-nitrophenylphosphatase) inhibitor; EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; ion transport inhibitor; plant metabolite |
ammonium chloride | [no description available] | medium | 6 | 0 | ammonium salt; inorganic chloride | ferroptosis inhibitor |
fluocinolone acetonide | [no description available] | medium | 1 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(1),Delta(4)-steroid; cyclic ketal; fluorinated steroid; glucocorticoid; organic heteropentacyclic compound; primary alpha-hydroxy ketone | anti-inflammatory drug; antipruritic drug |
metaperiodate | [no description available] | medium | 1 | 0 | iodine oxoacid | |
mevalonic acid | [no description available] | medium | 5 | 0 | 3,5-dihydroxy-3-methylpentanoic acid | |
muramidase | [no description available] | medium | 1 | 0 | | |
s-adenosylmethionine | [no description available] | medium | 1 | 0 | organic cation; sulfonium compound | coenzyme; cofactor; human metabolite; micronutrient; Mycoplasma genitalium metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
ammonium sulfate | [no description available] | medium | 2 | 0 | ammonium salt; inorganic sulfate salt | fertilizer |
mercaptoethanol | [no description available] | medium | 1 | 0 | alkanethiol; primary alcohol | geroprotector |
lanosterol | [no description available] | medium | 3 | 0 | 14alpha-methyl steroid; 3beta-sterol; tetracyclic triterpenoid | bacterial metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
hydrazine | [no description available] | medium | 2 | 0 | azane; hydrazines | EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor |
dihydroxyphenylalanine | [no description available] | medium | 2 | 0 | hydroxyphenylalanine; non-proteinogenic alpha-amino acid; tyrosine derivative | human metabolite |
benserazide | [no description available] | medium | 1 | 0 | carbohydrazide; catechols; primary alcohol; primary amino compound | antiparkinson drug; dopaminergic agent; EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor |
thiourea | [no description available] | medium | 1 | 0 | one-carbon compound; thioureas; ureas | antioxidant; chromophore |
pyrogallol | [no description available] | medium | 1 | 0 | benzenetriol; phenolic donor | plant metabolite |
carbamates | [no description available] | medium | 2 | 0 | amino-acid anion | |
norethandrolone | [no description available] | medium | 1 | 0 | corticosteroid hormone | |
pancuronium | [no description available] | medium | 1 | 0 | acetate ester; steroid ester | cholinergic antagonist; muscle relaxant; nicotinic antagonist |
hydrogen | [no description available] | medium | 2 | 0 | elemental hydrogen; elemental molecule; gas molecular entity | antioxidant; electron donor; food packaging gas; fuel; human metabolite |
beta-escin | [no description available] | medium | 1 | 0 | | |
hydrogen carbonate | [no description available] | medium | 1 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
nitrosoguanidines | [no description available] | medium | 1 | 0 | | |
isoleucine | [no description available] | medium | 1 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
organophosphonates | [no description available] | medium | 2 | 0 | divalent inorganic anion; phosphite ion | |
xylose | [no description available] | medium | 1 | 0 | D-xylose | |
galactose | [no description available] | medium | 1 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
ribose | [no description available] | medium | 2 | 0 | D-ribose; ribopyranose | |
demeclocycline | [no description available] | medium | 1 | 0 | | |
cholestyramine resin | [no description available] | medium | 2 | 0 | | |
arabinose | [no description available] | medium | 1 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
octadecyl palmitate | [no description available] | medium | 1 | 0 | hexadecanoate ester; wax ester | coral metabolite; cosmetic |
tyrosine | [no description available] | medium | 1 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; proteinogenic amino acid; tyrosine | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor; fundamental metabolite; micronutrient; nutraceutical |
histamine | [no description available] | medium | 1 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
biguanides | [no description available] | medium | 1 | 0 | guanidines | |
isomethyleugenol | [no description available] | medium | 1 | 0 | isomethyleugenol | |
exudates | [no description available] | medium | 4 | 0 | | |
phenylephrine hydrochloride | [no description available] | medium | 12 | 3 | hydrochloride | |
fusarium | [no description available] | medium | 2 | 0 | | |
inositol 3-phosphate | [no description available] | medium | 1 | 0 | | |
trolamine salicylate | [no description available] | medium | 1 | 0 | | |
eye | [no description available] | medium | 2 | 0 | | |
guaifenesin | [no description available] | medium | 1 | 0 | methoxybenzenes | |
zinc oxide | [no description available] | medium | 1 | 0 | | |
acetopyrrothine | [no description available] | low | 0 | 0 | acetamides; dithiolopyrrolone antibiotic | angiogenesis inhibitor; antibacterial agent; antifungal agent; antineoplastic agent; bacterial metabolite; chelator; EC 2.7.7.6 (RNA polymerase) inhibitor; marine metabolite; protein synthesis inhibitor; toxin |
nucleocidin | [no description available] | low | 0 | 0 | 6-aminopurines; adenosines; diol; organofluorine compound; sulfamate ester | antibacterial agent; bacterial metabolite; nucleoside antibiotic; protein synthesis inhibitor; trypanocidal drug |
lycorine | [no description available] | low | 0 | 0 | indolizidine alkaloid | anticoronaviral agent; antimalarial; plant metabolite; protein synthesis inhibitor |
cryptopleurine | [no description available] | low | 0 | 0 | alkaloid antibiotic; alkaloid; aromatic ether; organic heteropentacyclic compound | antineoplastic agent; antiviral agent; protein synthesis inhibitor |
s-2-aminoethyl cysteine | [no description available] | low | 0 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid | EC 5.4.3.2 (lysine 2,3-aminomutase) inhibitor; metabolite; protein synthesis inhibitor |
a 195773 | [no description available] | low | 0 | 0 | macrolide antibiotic; monosaccharide derivative; quinolines | antibacterial drug; protein synthesis inhibitor |
emetine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride | anticoronaviral agent; antimalarial; antineoplastic agent; antiprotozoal drug; antiviral agent; autophagy inhibitor; emetic; protein synthesis inhibitor |
tedizolid | [no description available] | low | 0 | 0 | carbamate ester; organofluorine compound; oxazolidinone; primary alcohol; pyridines; tetrazoles | antimicrobial agent; drug metabolite; protein synthesis inhibitor |
tedizolid phosphate | [no description available] | low | 0 | 0 | carbamate ester; organofluorine compound; oxazolidinone; phosphate monoester; pyridines; tetrazoles | antimicrobial agent; prodrug; protein synthesis inhibitor |
tavaborole | [no description available] | low | 0 | 0 | benzoxaborole; organofluorine compound | antifungal agent; EC 6.1.1.4 (leucine--tRNA ligase) inhibitor; protein synthesis inhibitor |
gamithromycin | [no description available] | low | 0 | 0 | macrolide antibiotic; monosaccharide derivative | antibacterial drug; protein synthesis inhibitor |
althiomycin | [no description available] | low | 0 | 0 | 1,3-thiazoles; aldoxime; ether; gamma-lactam; pentapeptide; peptide antibiotic; primary alcohol; pyrroline; secondary carboxamide; tertiary carboxamide | antibacterial agent; bacterial metabolite; protein synthesis inhibitor |
chloranil | [no description available] | low | 0 | 0 | 1,4-benzoquinones; organochlorine compound | EC 2.7.1.33 (pantothenate kinase) inhibitor; metabolite |
pregnenolone sulfate | [no description available] | low | 0 | 0 | steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite |
monoisopropanolamine | [no description available] | low | 0 | 0 | amino alcohol; secondary alcohol | Escherichia coli metabolite |
dihydro-3-coumaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid | Escherichia coli metabolite; human xenobiotic metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
5,6,7,8-tetrahydropteridine | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
acetaldehyde | [no description available] | low | 0 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
arsenic acid | [no description available] | low | 0 | 0 | arsenic oxoacid | Escherichia coli metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
carbamic acid | [no description available] | low | 0 | 0 | carbon oxoacid; one-carbon compound; organonitrogen compound | Escherichia coli metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
2-aminoacetaldehyde | [no description available] | low | 0 | 0 | amino aldehyde; omega-aminoaldehyde | Escherichia coli metabolite |
2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; amino acid zwitterion; beta-amino acid; diamino acid; non-proteinogenic alpha-amino acid | Escherichia coli metabolite |
octanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
hydrogen sulfide | [no description available] | low | 0 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
oxaluric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; ureas | Escherichia coli metabolite |
n(1)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; metabolite |
propionaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; propanals | Escherichia coli metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
cytosine | [no description available] | low | 0 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1,4-dihydroxy-2-naphthoic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; naphthalenediols; naphthohydroquinone; naphthoic acid | Escherichia coli metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydrogen cyanide | [no description available] | low | 0 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
toxopyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
thiocyanic acid | [no description available] | low | 0 | 0 | hydracid; one-carbon compound; organosulfur compound | Escherichia coli metabolite |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
iminoaspartic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; ketimine | Escherichia coli metabolite |
indole | [no description available] | low | 0 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
pyruvaldehyde | [no description available] | low | 0 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxypyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
oxamic acid | [no description available] | low | 0 | 0 | dicarboxylic acid monoamide | Escherichia coli metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
diphosphoric acid | [no description available] | low | 0 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | Escherichia coli metabolite |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
quinolinic acid | [no description available] | low | 0 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
dimethyl sulfide | [no description available] | low | 0 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
sarcosine | [no description available] | low | 0 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
sulfur dioxide | [no description available] | low | 0 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
thymine | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
trimethyloxamine | [no description available] | low | 0 | 0 | tertiary amine oxide | Escherichia coli metabolite; metabolite; osmolyte |
trimethylamine | [no description available] | low | 0 | 0 | methylamines; tertiary amine | Escherichia coli metabolite; human xenobiotic metabolite |
uric acid | [no description available] | low | 0 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
beta-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
4-cresol | [no description available] | low | 0 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
tyramine | [no description available] | low | 0 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
serine | [no description available] | low | 0 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uridine monophosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine monophosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
uridine triphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
cytidine | [no description available] | low | 0 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
asparagine | [no description available] | low | 0 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
methanesulfonic acid | [no description available] | low | 0 | 0 | alkanesulfonic acid; one-carbon compound | Escherichia coli metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
shikimic acid | [no description available] | medium | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
homoserine | [no description available] | low | 0 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
fucose | [no description available] | low | 0 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
1,3,4-butanetriol | [no description available] | low | 0 | 0 | triol | bacterial xenobiotic metabolite; Escherichia coli metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
manganese | [no description available] | low | 0 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
molybdate ion | [no description available] | low | 0 | 0 | divalent inorganic anion; molybdenum oxoanion | Escherichia coli metabolite |
myrmicacin | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; medium-chain fatty acid | antimitotic; Escherichia coli metabolite |
phosphotyrosine | [no description available] | low | 0 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid; O(4)-phosphotyrosine | Escherichia coli metabolite; immunogen |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
acetylgalactosamine | [no description available] | low | 0 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
aica ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
n-(3-aminopropyl)cadaverine | [no description available] | low | 0 | 0 | polyazaalkane; triamine | Escherichia coli metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
hydracrylic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
D-serine | [no description available] | low | 0 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
D-tyrosine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; tyrosine | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
coenzyme a | [no description available] | low | 0 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
L-2-aminoadipic acid | [no description available] | low | 0 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
3'-uridylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 3'-monophosphate; uridine phosphate | Escherichia coli metabolite |
2',3'-cyclic amp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
2,5-diketogluconic acid | [no description available] | low | 0 | 0 | diketoaldonic acid | Escherichia coli metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
selenodiglutathione | [no description available] | low | 0 | 0 | glutathione derivative; thioselenide | Escherichia coli metabolite; metabolite |
2-deoxyglucose-6-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | Escherichia coli metabolite; Mycoplasma genitalium metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
thymidine diphosphate-l-rhamnose | [no description available] | low | 0 | 0 | dTDP-L-rhamnose | Escherichia coli metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
trehalose-6-phosphate | [no description available] | low | 0 | 0 | trehalose phosphate | Escherichia coli metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
aerobactin | [no description available] | low | 0 | 0 | L-lysine derivative | Escherichia coli metabolite; siderophore; virulence factor |
lipid x | [no description available] | low | 0 | 0 | N-acyl-D-glucosamine 1-phosphate | Escherichia coli metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glutamate-1-semialdehyde | [no description available] | low | 0 | 0 | 5-oxo monocarboxylic acid; amino acid zwitterion; gamma-amino acid; glutamic semialdehyde | Escherichia coli metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
o-phosphohomoserine | [no description available] | low | 0 | 0 | O-phosphorylhomoserine | Escherichia coli metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
2,3-dihydroxybenzoylserine | [no description available] | low | 0 | 0 | L-serine derivative | Escherichia coli metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
beta-aspartyl phosphate | [no description available] | low | 0 | 0 | aminoacyl phosphate; L-aspartic acid derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
abrine | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-methyl-L-alpha-amino acid zwitterion; N-methyl-L-alpha-amino acid | Escherichia coli metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-deoxy-d-arabino-heptulosonate-7-phosphate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
glucosamine 1-phosphate | [no description available] | low | 0 | 0 | glucosamine phosphate | Escherichia coli metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
9-mercaptodethiobiotin | [no description available] | low | 0 | 0 | imidazolidinone; monocarboxylic acid; thiol; ureas | Escherichia coli metabolite |
idonic acid | [no description available] | low | 0 | 0 | idonic acid | Escherichia coli metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxythreonine | [no description available] | low | 0 | 0 | amino acid zwitterion; hydroxy-amino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite |
2-oxo-3-deoxygalactonic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
ribose 1-phosphate | [no description available] | low | 0 | 0 | D-ribose 1-phosphate | Escherichia coli metabolite |
diaminopimelic acid | [no description available] | low | 0 | 0 | 2,6-diaminopimelic acid; amino acid zwitterion | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
3-dehydroquinic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 4-hydroxy monocarboxylic acid; 4-oxo monocarboxylic acid; 5-hydroxy monocarboxylic acid; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
o-succinylhomoserine | [no description available] | low | 0 | 0 | hemisuccinate; o-succinylhomoserine | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
cysteinylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
tartaric acid | [no description available] | low | 0 | 0 | tartaric acid | Escherichia coli metabolite |
s-ribosyl-l-homocysteine | [no description available] | low | 0 | 0 | S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | Escherichia coli metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | [no description available] | low | 0 | 0 | diadenosyl pentaphosphate | Escherichia coli metabolite; vasoconstrictor agent |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
glutathionylspermidine | [no description available] | low | 0 | 0 | glutathione derivative | Escherichia coli metabolite |
arbutin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
2-c-methylerythritol 4-phosphate | [no description available] | low | 0 | 0 | tetritol phosphate | Escherichia coli metabolite |
1-deoxy-d-xylulose 5-phosphate | [no description available] | low | 0 | 0 | xylulose phosphate | Escherichia coli metabolite |
c(alpha)-formylglycine | [no description available] | low | 0 | 0 | 3-oxoalanine; amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
palmitoleic acid | [no description available] | low | 0 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
sucrose-6-phosphate | [no description available] | low | 0 | 0 | disaccharide phosphate | Escherichia coli metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
iminoglycine | [no description available] | low | 0 | 0 | dehydroamino acid; imine; zwitterion | Escherichia coli metabolite |
2-keto-3-deoxy-6-phosphogluconate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
formyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | [no description available] | low | 0 | 0 | lipid As | Escherichia coli metabolite |
phosphothreonine | [no description available] | low | 0 | 0 | L-threonine derivative; non-proteinogenic L-alpha-amino acid; O-phosphoamino acid | Escherichia coli metabolite |
maleamic acid | [no description available] | medium | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dicarboxylic acid monoamide | bacterial xenobiotic metabolite; Escherichia coli metabolite |
retinol palmitate | [no description available] | low | 0 | 0 | all-trans-retinyl ester; retinyl palmitate | antioxidant; Escherichia coli metabolite; human xenobiotic metabolite |
canthaxanthin | [no description available] | low | 0 | 0 | carotenone | biological pigment; Escherichia coli metabolite; food colouring; fungal metabolite |
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; phosphoantigen |
menaquinone 7 | [no description available] | low | 0 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
5-ketogluconic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
menaquinone 9 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite |
allolactose | [no description available] | low | 0 | 0 | glycosylglucose | Escherichia coli metabolite |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
1-deoxy-2-pentulose | [no description available] | low | 0 | 0 | deoxypentose | Escherichia coli metabolite |
fructosyl-lysine | [no description available] | low | 0 | 0 | fructosamine; glyco-amino acid | Escherichia coli metabolite |
lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid A; tetradecanoate ester | Escherichia coli metabolite |
methionine sulfoxide | [no description available] | low | 0 | 0 | amino acid zwitterion; L-methionine S-oxide | Escherichia coli metabolite |
(S)-4,5-dihydroxypentane-2,3-dione | [no description available] | low | 0 | 0 | alpha-diketone; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
kdo2-lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid As; tetradecanoate ester | Escherichia coli metabolite |
oxalyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanine | [no description available] | low | 0 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
inosine triphosphate | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
queuine | [no description available] | low | 0 | 0 | pyrrolopyrimidine | Escherichia coli metabolite |
3'-guanylic acid | [no description available] | low | 0 | 0 | guanosine 3'-phosphate; purine ribonucleoside 3'-monophosphate | Escherichia coli metabolite |
2',3'-cyclic gmp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
colibactin | [no description available] | low | 0 | 0 | 1,3-thiazoles; azaspiro compound; polyketide; pyrroline; secondary carboxamide | alkylating agent; carcinogenic agent; Escherichia coli metabolite; genotoxin |
tetrahydrocortisol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3alpha-hydroxy steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | |
androsterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid; C19-steroid | androgen; anticonvulsant; human blood serum metabolite; human metabolite; human urinary metabolite; mouse metabolite; pheromone |
etiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid | human metabolite; mouse metabolite |
pregnanolone | [no description available] | low | 0 | 0 | 3-hydroxy-5beta-pregnan-20-one; 3alpha-hydroxy steroid | human metabolite; intravenous anaesthetic; sedative |
3 alpha,17 alpha-dihydroxy-5 beta-pregnan-20-one | [no description available] | low | 0 | 0 | 17alpha-hydroxy steroid; 20-oxo steroid; 3alpha-hydroxy steroid; C21-steroid; corticosteroid hormone | human urinary metabolite |
brassinolide | [no description available] | low | 0 | 0 | 22-hydroxy steroid; 23-hydroxy steroid; 2alpha-hydroxy steroid; 3alpha-hydroxy steroid; brassinosteroid | plant growth stimulator; plant hormone |
muricholic acid | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 6-hydroxy steroid; 7-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | |
3,7,12-trihydroxycoprostanic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; cholestanoic acid; hydroxy monocarboxylic acid | human metabolite |
3,7,12-trihydroxycholestan-26-oic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; hydroxy monocarboxylic acid; steroid acid | human metabolite |
ursocholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7beta-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | EC 1.1.1.159 (7alpha-hydroxysteroid dehydrogenase) inhibitor; human urinary metabolite |
castasterone | [no description available] | low | 0 | 0 | 22-hydroxy steroid; 23-hydroxy steroid; 2alpha-hydroxy steroid; 3alpha-hydroxy steroid; 6-oxo steroid; brassinosteroid | plant growth stimulator |
3,7,12-trihydroxycoprostane | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
allocholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; allo-bile acid; C24-steroid | human metabolite; marine metabolite; rat metabolite |
scymnol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 24-hydroxy steroid; 26-hydroxy steroid; 27-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | |
cholestane-3,7,12,26-tetrol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 26-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
rocuronium | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; acetate ester; androstane; morpholines; quaternary ammonium ion; tertiary amino compound | drug allergen; muscle relaxant; neuromuscular agent |
7-ketolithocholic acid | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; bile acid; monohydroxy-5beta-cholanic acid; oxo-5beta-cholanic acid | human metabolite |
obeticholic acid | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; dihydroxy-5beta-cholanic acid | farnesoid X receptor agonist; hepatoprotective agent |
3,7,12,24-tetrahydroxycholestanoic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 24-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; hydroxy monocarboxylic acid | bile acid metabolite |
dihydroxycoprostane | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
3alpha,12alpha-dihydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7-oxo steroid; monocarboxylic acid; secondary alpha-hydroxy ketone; steroid acid | antineoplastic agent; metabolite |
3alpha-hydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 3alpha-hydroxy steroid; 7-oxo steroid; monocarboxylic acid; steroid acid | antineoplastic agent; cholinergic antagonist; metabolite; serotonergic antagonist |
11-hydroxyprogesterone, (11alpha)-isomer | [no description available] | low | 0 | 0 | 11alpha-hydroxy steroid; 20-oxo steroid; 3-oxo-Delta(4) steroid | |
ouabagenin | [no description available] | low | 0 | 0 | 1-hydroxy steroid; 11alpha-hydroxy steroid; 14beta-hydroxy steroid; 19-hydroxy steroid; 3beta-hydroxy steroid; 5beta-hydroxy steroid | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor |
testosterone acetate | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; androstanoid; sterol ester | human metabolite |
abiraterone acetate | [no description available] | low | 0 | 0 | pyridines; sterol ester | antineoplastic agent; EC 1.14.99.9 (steroid 17alpha-monooxygenase) inhibitor; prodrug |
epristeride | [no description available] | low | 0 | 0 | steroid acid | |
3-hydroxy-5-cholestenoic acid | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; monocarboxylic acid; steroid acid | bacterial metabolite |
canrenoic acid | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; monocarboxylic acid; steroid acid | |
4alpha-methylergosta-8,24(28)-dien-3,7,11-trione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 3-oxo steroid; 7-oxo steroid; ergostanoid; monocarboxylic acid; steroid acid | anti-inflammatory agent; antineoplastic agent; plant metabolite |
koetjapic acid | [no description available] | low | 0 | 0 | steroid acid | |
perillic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | antineoplastic agent; human metabolite; mouse metabolite |
gabaculine | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; gamma-amino acid | |
guvacine | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; beta-amino acid; pyridine alkaloid; secondary amino compound; tetrahydropyridine | GABA reuptake inhibitor; plant metabolite |
methacrylic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid | |
retinoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; retinoid | human metabolite |
acrylic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid | metabolite |
propiolic acid | [no description available] | low | 0 | 0 | acetylenic fatty acid; alpha,beta-unsaturated monocarboxylic acid; monounsaturated fatty acid; short-chain fatty acid; terminal acetylenic compound | xenobiotic metabolite |
senecioic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; methyl-branched fatty acid; monounsaturated fatty acid; short-chain fatty acid | plant metabolite |
2-chloroacrylic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; chlorocarboxylic acid | metabolite |
enbucrilate | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; nitrile | |
phenylpropiolic acid | [no description available] | low | 0 | 0 | acetylenic compound; alpha,beta-unsaturated monocarboxylic acid; benzenes | |
loganic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclopentapyran; glucoside | plant metabolite |
dehydroalanine | [no description available] | low | 0 | 0 | 2,3-dehydroamino acid; alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion; enamine; non-proteinogenic alpha-amino acid | alkylating agent; human metabolite; mouse metabolite |
sq 27860 | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; carbapenemcarboxylic acid | |
7-deoxyloganic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; beta-D-glucoside; cyclopentapyran; iridoid monoterpenoid; monosaccharide derivative; monoterpene glycoside | plant metabolite |
geranylgeranic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; diterpenoid; methyl-branched fatty acid; trienoic fatty acid | |
4-coumaroylshikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | |
phaseic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; apo carotenoid sesquiterpenoid | metabolite |
5-o-caffeoylshikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; carboxylic ester; catechols; cyclohexenecarboxylic acid | plant metabolite |
10-hydroxy-2-decenoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; hydroxy monounsaturated fatty acid; omega-hydroxy-medium-chain fatty acid; straight-chain fatty acid | animal metabolite; geroprotector |
piperic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; benzodioxoles | plant metabolite |
trans-3-methyl-2-hexenoic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; monounsaturated fatty acid; short-chain fatty acid | |
kalimantacin a | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; carbamate ester; fatty acid derivative; secondary carboxamide | antibacterial agent; antimicrobial agent; bacterial metabolite |
sr 11302 | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; retinoid; toluenes | antineoplastic agent; AP-1 antagonist |
pentalenolactone f | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; organic heterotricyclic compound; sesquiterpene lactone; spiro-epoxide | bacterial metabolite |
gamendazole | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dichlorobenzene; indazoles; olefinic compound; organofluorine compound | antispermatogenic agent; eukaryotic translation elongation factor 1alpha 1 inhibitor; Hsp90 inhibitor; synthetic oral contraceptive |
ascr#3 | [no description available] | low | 0 | 0 | (omega-1)-hydroxy fatty acid ascaroside; alpha,beta-unsaturated monocarboxylic acid | Caenorhabditis elegans metabolite; pheromone |
arenaemycin e | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; organic heterotricyclic compound; sesquiterpene lactone; spiro-epoxide | antimicrobial agent; bacterial metabolite; EC 1.2.1.12 [glyceraldehyde-3-phosphate dehydrogenase (phosphorylating)] inhibitor |