Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
pargyline | [no description available] | medium | 6 | 0 | aromatic amine | |
trichloroacetaldehyde | [no description available] | medium | 1 | 0 | aldehyde; organochlorine compound | mouse metabolite |
acrolein | [no description available] | medium | 1 | 0 | enal | herbicide; human xenobiotic metabolite; toxin |
n-cyclopropylbenzylamine | [no description available] | medium | 1 | 0 | | |
mercaptoethanol | [no description available] | medium | 1 | 0 | alkanethiol; primary alcohol | geroprotector |
nad | [no description available] | medium | 1 | 0 | organophosphate oxoanion | cofactor; human metabolite; hydrogen acceptor; Saccharomyces cerevisiae metabolite |
proadifen | [no description available] | medium | 3 | 0 | diarylmethane | |
phenobarbital | [no description available] | medium | 2 | 0 | barbiturates | anticonvulsant; drug allergen; excitatory amino acid antagonist; sedative |
acetaldehyde | [no description available] | medium | 1 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
propargyl alcohol | [no description available] | medium | 1 | 0 | propynol; terminal acetylenic compound; volatile organic compound | antifungal agent; Saccharomyces cerevisiae metabolite |
carbon monoxide | [no description available] | medium | 2 | 0 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
cobalt | [no description available] | medium | 1 | 0 | cobalt group element atom; metal allergen | micronutrient |
cobaltous chloride | [no description available] | medium | 1 | 0 | cobalt salt; inorganic chloride | allergen; calcium channel blocker; sensitiser; two-colour indicator |
3,4-dihydroxyphenylacetaldehyde | [no description available] | medium | 1 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
3,4-dihydroxyphenylacetic acid | [no description available] | medium | 1 | 0 | catechols; dihydroxyphenylacetic acid | human metabolite |
alpha-hydroxyglutarate | [no description available] | low | 0 | 0 | 2-hydroxydicarboxylic acid; dicarboxylic fatty acid | metabolite; mouse metabolite |
alpha-ketoadipic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | human urinary metabolite; mouse metabolite |
3-hydroxyanthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; monohydroxybenzoic acid | human metabolite; mouse metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
n-carbamoyl-beta-alanine | [no description available] | low | 0 | 0 | beta-alanine derivative | metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
4-hydroxybenzaldehyde | [no description available] | low | 0 | 0 | hydroxybenzaldehyde | EC 1.14.17.1 (dopamine beta-monooxygenase) inhibitor; mouse metabolite; plant metabolite |
4-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols | fungal metabolite; human metabolite; mouse metabolite; plant metabolite |
isocaproaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde | human metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
ethylene glycol | [no description available] | low | 0 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
adenine | [no description available] | low | 0 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
allantoic acid | [no description available] | low | 0 | 0 | ureas | mouse metabolite; plant metabolite |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
ammonium hydroxide | [no description available] | low | 0 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
anthranilic acid | [no description available] | low | 0 | 0 | aminobenzoic acid | human metabolite; mouse metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
hydrobromic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
1-butanol | [no description available] | low | 0 | 0 | alkyl alcohol; primary alcohol; short-chain primary fatty alcohol | human metabolite; mouse metabolite; protic solvent |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
carnitine | [no description available] | low | 0 | 0 | amino-acid betaine | human metabolite; mouse metabolite |
choline | [no description available] | low | 0 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
hydrochloric acid | [no description available] | low | 0 | 0 | chlorine molecular entity; gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
aminoethylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; primary amino compound; zwitterion | human metabolite; metabolite; mouse metabolite |
1,2-dihydroxy-1,2-dihydronaphthalene | [no description available] | low | 0 | 0 | dihydronaphthalenes; naphthalenediols | bacterial xenobiotic metabolite; mouse metabolite |
4-nitrophenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
trimethylenediamine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | human metabolite; mouse metabolite; reagent |
n(1)-methylnicotinamide | [no description available] | low | 0 | 0 | pyridinium ion | algal metabolite; anti-inflammatory agent; human urinary metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
phosphonoacetaldehyde | [no description available] | low | 0 | 0 | phosphonic acids | mouse metabolite |
gamma-guanidinobutyric acid | [no description available] | low | 0 | 0 | guanidines; monocarboxylic acid; zwitterion | fungal metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
hydrogen selenide | [no description available] | low | 0 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
alpha-keto-delta-guanidinovaleric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
creatine | [no description available] | low | 0 | 0 | glycine derivative; guanidines; zwitterion | geroprotector; human metabolite; mouse metabolite; neuroprotective agent; nutraceutical |
cytosine | [no description available] | low | 0 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
diethyl phosphate | [no description available] | low | 0 | 0 | dialkyl phosphate | human xenobiotic metabolite; mouse metabolite |
o,o-diethyl phosphorothionate | [no description available] | low | 0 | 0 | organic thiophosphate | human xenobiotic metabolite; mouse metabolite |
dihydrolipoamide | [no description available] | low | 0 | 0 | dithiol; monocarboxylic acid amide | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dimethylglycine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-methyl-amino acid; N-methylglycines | Daphnia magna metabolite; human metabolite; mouse metabolite |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
formaldehyde | [no description available] | low | 0 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glycerol | [no description available] | low | 0 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glycocyamine | [no description available] | low | 0 | 0 | guanidinoacetic acids; zwitterion | bacterial metabolite; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
carbonic acid | [no description available] | low | 0 | 0 | carbon oxoacid; chalcocarbonic acid | mouse metabolite |
hydrogen carbonate | [no description available] | low | 0 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
histamine | [no description available] | low | 0 | 0 | aralkylamino compound; imidazoles | human metabolite; mouse metabolite; neurotransmitter |
hydantoin-5-propionic acid | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; monocarboxylic acid | metabolite; mouse metabolite |
hydroquinone | [no description available] | low | 0 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
indole-3-acetaldehyde | [no description available] | low | 0 | 0 | indoleacetaldehyde | bacterial metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
indoleacetic acid | [no description available] | low | 0 | 0 | indole-3-acetic acids; monocarboxylic acid | auxin; human metabolite; mouse metabolite; plant hormone; plant metabolite |
lactaldehyde | [no description available] | low | 0 | 0 | hydroxyaldehyde; propanals | mouse metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyruvaldehyde | [no description available] | low | 0 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
methanol | [no description available] | low | 0 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
melatonin | [no description available] | low | 0 | 0 | acetamides; tryptamines | anticonvulsant; central nervous system depressant; geroprotector; hormone; human metabolite; immunological adjuvant; mouse metabolite; radical scavenger |
n-acetylserotonin | [no description available] | low | 0 | 0 | acetamides; N-acylserotonin; phenols | antioxidant; human metabolite; mouse metabolite; tropomyosin-related kinase B receptor agonist |
naphthalene | [no description available] | low | 0 | 0 | naphthalenes; ortho-fused bicyclic arene | apoptosis inhibitor; carcinogenic agent; environmental contaminant; mouse metabolite; plant metabolite; volatile oil component |
niacinamide | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
niacin | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
hydroxide ion | [no description available] | low | 0 | 0 | oxygen hydride | mouse metabolite |
orotic acid | [no description available] | low | 0 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
4-nitrophenol | [no description available] | low | 0 | 0 | 4-nitrophenols | human xenobiotic metabolite; mouse metabolite |
hexadecanal | [no description available] | low | 0 | 0 | 2,3-saturated fatty aldehyde; long-chain fatty aldehyde | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
parathion | [no description available] | low | 0 | 0 | C-nitro compound; organic thiophosphate; organothiophosphate insecticide | acaricide; agrochemical; avicide; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; mouse metabolite |
phenanthrene | [no description available] | low | 0 | 0 | ortho-fused polycyclic arene; ortho-fused tricyclic hydrocarbon; phenanthrenes | environmental contaminant; mouse metabolite |
phenol | [no description available] | low | 0 | 0 | phenols | antiseptic drug; disinfectant; human xenobiotic metabolite; mouse metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines | allergen; epitope; hapten; human metabolite; mouse metabolite |
phosphorylethanolamine | [no description available] | low | 0 | 0 | phosphoethanolamine; primary amino compound | algal metabolite; human metabolite; mouse metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
propylene glycol | [no description available] | low | 0 | 0 | glycol; propane-1,2-diols | allergen; human xenobiotic metabolite; mouse metabolite; protic solvent |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxal phosphate | [no description available] | low | 0 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
quinolinic acid | [no description available] | low | 0 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
sarcosine | [no description available] | low | 0 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
taurine | [no description available] | low | 0 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
thiamine | [no description available] | low | 0 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thymine | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
tryptamine | [no description available] | low | 0 | 0 | aminoalkylindole; aralkylamino compound; indole alkaloid; tryptamines | human metabolite; mouse metabolite; plant metabolite |
uracil | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
uric acid | [no description available] | low | 0 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
urea | [no description available] | low | 0 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
perillic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid | antineoplastic agent; human metabolite; mouse metabolite |
homovanillic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid | human metabolite; mouse metabolite |
hydroxyindoleacetic acid | [no description available] | low | 0 | 0 | indole-3-acetic acids | drug metabolite; human metabolite; mouse metabolite |
5-methoxytryptamine | [no description available] | low | 0 | 0 | aromatic ether; primary amino compound; tryptamines | 5-hydroxytryptamine 2A receptor agonist; 5-hydroxytryptamine 2B receptor agonist; 5-hydroxytryptamine 2C receptor agonist; antioxidant; cardioprotective agent; human metabolite; mouse metabolite; neuroprotective agent; radiation protective agent; serotonergic agonist |
6-hydroxymelatonin | [no description available] | low | 0 | 0 | acetamides; tryptamines | metabolite; mouse metabolite |
adrenic acid | [no description available] | low | 0 | 0 | docosatetraenoic acid | mouse metabolite |
benzo(a)pyrene | [no description available] | low | 0 | 0 | ortho- and peri-fused polycyclic arene | carcinogenic agent; mouse metabolite |
caffeine | [no description available] | low | 0 | 0 | purine alkaloid; trimethylxanthine | adenosine A2A receptor antagonist; adenosine receptor antagonist; adjuvant; central nervous system stimulant; diuretic; EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor; EC 3.1.4.* (phosphoric diester hydrolase) inhibitor; environmental contaminant; food additive; fungal metabolite; geroprotector; human blood serum metabolite; mouse metabolite; mutagen; plant metabolite; psychotropic drug; ryanodine receptor agonist; xenobiotic |
chloral hydrate | [no description available] | low | 0 | 0 | aldehyde hydrate; ethanediol; organochlorine compound | general anaesthetic; mouse metabolite; sedative; xenobiotic |
2,5-dihydroxybenzoic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; fungal metabolite; human metabolite; MALDI matrix material; mouse metabolite |
tele-methylhistamine | [no description available] | low | 0 | 0 | imidazoles; primary amino compound | human metabolite; mouse metabolite |
quinone | [no description available] | low | 0 | 0 | 1,4-benzoquinones | cofactor; human xenobiotic metabolite; mouse metabolite |
1,7-dimethylxanthine | [no description available] | low | 0 | 0 | dimethylxanthine | central nervous system stimulant; human blood serum metabolite; human xenobiotic metabolite; mouse metabolite |
theobromine | [no description available] | low | 0 | 0 | dimethylxanthine | adenosine receptor antagonist; bronchodilator agent; food component; human blood serum metabolite; mouse metabolite; plant metabolite; vasodilator agent |
tyramine | [no description available] | low | 0 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
corticosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
estriol | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17beta-hydroxy steroid; 3-hydroxy steroid | estrogen; human metabolite; human xenobiotic metabolite; mouse metabolite |
sorbitol | [no description available] | low | 0 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
thymidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
hydroxyproline | [no description available] | low | 0 | 0 | 4-hydroxyproline; L-alpha-amino acid zwitterion | human metabolite; mouse metabolite; plant metabolite |
thyroxine | [no description available] | low | 0 | 0 | 2-halophenol; iodophenol; L-phenylalanine derivative; non-proteinogenic L-alpha-amino acid; thyroxine zwitterion; thyroxine | antithyroid drug; human metabolite; mouse metabolite; thyroid hormone |
aldosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 18-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid hormone; mineralocorticoid; primary alpha-hydroxy ketone; steroid aldehyde | human metabolite; mouse metabolite |
estrone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-hydroxy steroid; phenolic steroid; phenols | antineoplastic agent; bone density conservation agent; estrogen; human metabolite; mouse metabolite |
androsterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid; C19-steroid | androgen; anticonvulsant; human blood serum metabolite; human metabolite; human urinary metabolite; mouse metabolite; pheromone |
etiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3alpha-hydroxy steroid; androstanoid | human metabolite; mouse metabolite |
dehydroepiandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid | androgen; human metabolite; mouse metabolite |
triiodothyronine | [no description available] | low | 0 | 0 | 2-halophenol; amino acid zwitterion; iodophenol; iodothyronine | human metabolite; mouse metabolite; thyroid hormone |
serine | [no description available] | low | 0 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
aspartic acid | [no description available] | low | 0 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
lysine | [no description available] | low | 0 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
sucrose | [no description available] | low | 0 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
uridine monophosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
levodopa | [no description available] | low | 0 | 0 | amino acid zwitterion; dopa; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | allelochemical; antidyskinesia agent; antiparkinson drug; dopaminergic agent; hapten; human metabolite; mouse metabolite; neurotoxin; plant growth retardant; plant metabolite; prodrug |
cysteamine | [no description available] | low | 0 | 0 | amine; thiol | geroprotector; human metabolite; mouse metabolite; radiation protective agent |
leucine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
androstenedione | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-oxo-Delta(4) steroid; androstanoid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
cytidine monophosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
uridine triphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
methionine | [no description available] | low | 0 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
phenylalanine | [no description available] | low | 0 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
desoxycorticosterone | [no description available] | low | 0 | 0 | 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; mineralocorticoid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
cytidine | [no description available] | low | 0 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cytidine triphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
1-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
2-naphthaldehyde | [no description available] | low | 0 | 0 | naphthaldehyde | mouse metabolite |
17-alpha-hydroxyprogesterone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
ornithine | [no description available] | low | 0 | 0 | non-proteinogenic L-alpha-amino acid; ornithine | algal metabolite; hepatoprotective agent; mouse metabolite |
asparagine | [no description available] | low | 0 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
histidine | [no description available] | low | 0 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
valine | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
threonine | [no description available] | low | 0 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
tryptophan | [no description available] | low | 0 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
isoleucine | [no description available] | low | 0 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
arginine | [no description available] | low | 0 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
methylamine | [no description available] | low | 0 | 0 | methylamines; one-carbon compound; primary aliphatic amine | mouse metabolite |
ethylene oxide | [no description available] | low | 0 | 0 | gas molecular entity; oxacycle; saturated organic heteromonocyclic parent | allergen; mouse metabolite; mutagen |
vinylidene chloride | [no description available] | low | 0 | 0 | chloroethenes | carcinogenic agent; mouse metabolite; mutagen |
trichloroacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
gibberellic acid | [no description available] | low | 0 | 0 | C19-gibberellin; gibberellin monocarboxylic acid; lactone; organic heteropentacyclic compound | mouse metabolite; plant metabolite |
trichloroethylene | [no description available] | low | 0 | 0 | chloroethenes | inhalation anaesthetic; mouse metabolite |
pyridoxic acid | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | human urinary metabolite; mouse metabolite |
1-nitronaphthalene | [no description available] | low | 0 | 0 | mononitronaphthalene | environmental contaminant; mouse metabolite |
beta-glucono-1,5-lactone | [no description available] | low | 0 | 0 | aldono-1,5-lactone; gluconolactone | animal metabolite; mouse metabolite |
2-naphthoic acid | [no description available] | low | 0 | 0 | naphthoic acid | mouse metabolite; xenobiotic metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
methylphenyl carbinol | [no description available] | low | 0 | 0 | aromatic alcohol | mouse metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4-hydroxyacetophenone | [no description available] | low | 0 | 0 | monohydroxyacetophenone | fungal metabolite; mouse metabolite; plant metabolite |
styrene | [no description available] | low | 0 | 0 | styrenes; vinylarene; volatile organic compound | mouse metabolite; mutagen; plant metabolite |
2-phenylacetamide | [no description available] | low | 0 | 0 | monocarboxylic acid amide | mouse metabolite |
4-bromophenol | [no description available] | low | 0 | 0 | bromophenol | human urinary metabolite; human xenobiotic metabolite; marine metabolite; mouse metabolite; persistent organic pollutant; rat metabolite |
ethylene dibromide | [no description available] | low | 0 | 0 | bromoalkane; bromohydrocarbon | algal metabolite; carcinogenic agent; fumigant; marine metabolite; mouse metabolite; mutagen |
bromobenzene | [no description available] | low | 0 | 0 | bromoarene; bromobenzenes; volatile organic compound | hepatotoxic agent; mouse metabolite; non-polar solvent |
2-heptanone | [no description available] | low | 0 | 0 | dialkyl ketone; methyl ketone | mouse metabolite; pheromone |
2,2,2-trichloroethanol | [no description available] | low | 0 | 0 | chloroethanol | mouse metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-naphthol | [no description available] | low | 0 | 0 | naphthol | antinematodal drug; genotoxin; human urinary metabolite; human xenobiotic metabolite; mouse metabolite; radical scavenger |
pregnenolone | [no description available] | low | 0 | 0 | 20-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; C21-steroid | human metabolite; mouse metabolite |
20-alpha-dihydroprogesterone | [no description available] | low | 0 | 0 | 20-hydroxypregn-4-en-3-one | human metabolite; mouse metabolite |
D-proline | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; proline | mouse metabolite |
diiodotyrosine | [no description available] | low | 0 | 0 | diiodotyrosine; L-tyrosine derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite |
paraoxon | [no description available] | low | 0 | 0 | aryl dialkyl phosphate; organophosphate insecticide | EC 3.1.1.7 (acetylcholinesterase) inhibitor; mouse metabolite |
aminoimidazole carboxamide | [no description available] | low | 0 | 0 | aminoimidazole; monocarboxylic acid amide | mouse metabolite |
methyl-4-tyramine | [no description available] | low | 0 | 0 | tyramines | mouse metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
lithocholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; monohydroxy-5beta-cholanic acid | geroprotector; human metabolite; mouse metabolite |
chenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
fructose-1,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 1,6-bisphosphate | mouse metabolite |
androstenediol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid | androgen; human metabolite; mouse metabolite; radiation protective agent |
dihydrotestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 17beta-hydroxyandrostan-3-one; 3-oxo-5alpha-steroid | androgen; Daphnia magna metabolite; human metabolite; mouse metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
hydroxyhydroquinone | [no description available] | low | 0 | 0 | benzenetriol | mouse metabolite |
18-hydroxycorticosterone | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 18-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo steroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
1,2-dihydroxynaphthalene | [no description available] | low | 0 | 0 | naphthalenediol | mouse metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
2-hydroxyphenylacetic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; phenols | human metabolite; mouse metabolite |
dehydroepiandrosterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | EC 2.7.1.33 (pantothenate kinase) inhibitor; human metabolite; mouse metabolite |
phenylphosphate | [no description available] | low | 0 | 0 | aryl phosphate | mouse metabolite |
n-cyclohexylformamide | [no description available] | low | 0 | 0 | alicyclic compound; formamides | mouse metabolite |
deoxycytidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cytidine diphosphate choline | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphocholines | human metabolite; mouse metabolite; neuroprotective agent; psychotropic drug; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
dihydroferulic acid | [no description available] | low | 0 | 0 | guaiacols; monocarboxylic acid; phenylpropanoid | antioxidant; human xenobiotic metabolite; mouse metabolite; plant metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
perillaldehyde | [no description available] | low | 0 | 0 | aldehyde; olefinic compound | human metabolite; mouse metabolite; volatile oil component |
fucose | [no description available] | low | 0 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate galactose | [no description available] | low | 0 | 0 | UDP-D-galactose | mouse metabolite |
1-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
hydroiodic acid | [no description available] | low | 0 | 0 | gas molecular entity; hydrogen halide; mononuclear parent hydride | mouse metabolite |
iron | [no description available] | low | 0 | 0 | divalent metal cation; iron cation; monoatomic dication | cofactor; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
trichloroepoxyethane | [no description available] | low | 0 | 0 | epoxide | mouse metabolite |
ursodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid; C24-steroid; dihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
glutamic acid | [no description available] | low | 0 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
acetylgalactosamine | [no description available] | low | 0 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cyromazine | [no description available] | low | 0 | 0 | triamino-1,3,5-triazine | mouse metabolite; triazine insecticide |
glucose, (beta-d)-isomer | [no description available] | low | 0 | 0 | D-glucopyranose | epitope; mouse metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
n-acetylaspartic acid | [no description available] | low | 0 | 0 | N-acetyl-L-amino acid; N-acyl-L-aspartic acid | antioxidant; human metabolite; mouse metabolite; nutraceutical; rat metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
homocitrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; L-lysine derivative; non-proteinogenic L-alpha-amino acid; ureas | human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
aica ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
obtusifoliol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol | mouse metabolite; plant metabolite |
glutathione disulfide | [no description available] | low | 0 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
lathosterol | [no description available] | low | 0 | 0 | 3beta-sterol; C27-steroid; cholestanoid; Delta(7)-sterol | human metabolite; mouse metabolite |
2-methoxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
cystine | [no description available] | low | 0 | 0 | cystine zwitterion; cystine; L-cysteine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetylglycine | [no description available] | low | 0 | 0 | monocarboxylic acid amide; monocarboxylic acid; N-acylglycine | human metabolite; mouse metabolite |
hordenine | [no description available] | low | 0 | 0 | phenethylamine alkaloid | human metabolite; mouse metabolite |
7-methylxanthine | [no description available] | low | 0 | 0 | oxopurine; purine alkaloid | human xenobiotic metabolite; mouse metabolite; plant metabolite |
glutaurine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide; L-glutamine derivative; sulfonic acid | anticonvulsant; anxiolytic drug; hormone; human metabolite; mammalian metabolite; mouse metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
n'-methyl-2-pyridone-5-carboxamide | [no description available] | low | 0 | 0 | methylpyridines; pyridinecarboxamide; pyridone | metabolite; mouse metabolite |
1-methyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
cyclopropylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | mouse metabolite |
5-hydroxymethylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol; nucleobase analogue; pyrimidone | human metabolite; mouse metabolite |
2,5-dihydroxybenzaldehyde | [no description available] | low | 0 | 0 | dihydroxybenzaldehyde | human metabolite; mouse metabolite; Penicillium metabolite |
6-hydroxynicotinic acid | [no description available] | low | 0 | 0 | monohydroxypyridine | Arabidopsis thaliana metabolite; human urinary metabolite; mouse metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
2-naphthalenemethanol | [no description available] | low | 0 | 0 | naphthylmethanol | mouse metabolite; xenobiotic metabolite |
hydroxyindoleacetaldehyde | [no description available] | low | 0 | 0 | hydroxyindoles; indoleacetaldehyde | human metabolite; mouse metabolite |
xanthurenic acid 8-methyl ether | [no description available] | low | 0 | 0 | aromatic ether; monohydroxyquinoline; quinolinemonocarboxylic acid | carcinogenic agent; metabolite; mouse metabolite |
glucose | [no description available] | low | 0 | 0 | D-glucopyranose | mouse metabolite |
1,3,7-trimethylurate | [no description available] | low | 0 | 0 | oxopurine | human blood serum metabolite; human urinary metabolite; human xenobiotic metabolite; mouse metabolite |
1-methylxanthine | [no description available] | low | 0 | 0 | 1-methylxanthine | mouse metabolite |
3,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | metabolite; mouse metabolite |
biocytin | [no description available] | low | 0 | 0 | azabicycloalkane; L-alpha-amino acid zwitterion; L-lysine derivative; monocarboxylic acid amide; non-proteinogenic L-alpha-amino acid; thiabicycloalkane; ureas | mouse metabolite |
d-aspartic acid | [no description available] | low | 0 | 0 | aspartic acid; D-alpha-amino acid | mouse metabolite |
3,4-dihydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; catechols | antioxidant; drug metabolite; human metabolite; mouse metabolite |
coenzyme a | [no description available] | low | 0 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
17-alpha-hydroxypregnenolone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; hydroxypregnenolone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
mephentermine | [no description available] | low | 0 | 0 | 2-aminooctadecane-1,3-diol | EC 2.7.11.13 (protein kinase C) inhibitor; human metabolite; mouse metabolite |
3,4-dihydroxyphenylglycol | [no description available] | low | 0 | 0 | catechols; tetrol | metabolite; mouse metabolite |
homocysteine | [no description available] | low | 0 | 0 | amino acid zwitterion; homocysteine; serine family amino acid | fundamental metabolite; mouse metabolite |
1,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | human xenobiotic metabolite; mouse metabolite |
24-methylenecholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol | mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
2,8-dihydroxyadenine | [no description available] | low | 0 | 0 | 6-aminopurines; diol; heteroaryl hydroxy compound; oxopurine | human urinary metabolite; mammalian metabolite; mouse metabolite; nephrotoxic agent |
5beta-pregnane-3,20-dione | [no description available] | low | 0 | 0 | 20-oxo steroid; 3-oxo-5beta-steroid; C21-steroid | human metabolite; mouse metabolite |
zymosterol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
21-deoxycortisol | [no description available] | low | 0 | 0 | 11beta-hydroxy steroid; 17alpha-hydroxy-C21-steroid; deoxycortisol; tertiary alpha-hydroxy ketone | human blood serum metabolite; mouse metabolite |
5,6-dihydrothymine | [no description available] | low | 0 | 0 | pyrimidone | human metabolite; metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
imidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | metabolite; mouse metabolite |
1-hydroxyphenanthrene | [no description available] | low | 0 | 0 | phenanthrol | mouse metabolite |
2,5-dihydroxypyridine | [no description available] | low | 0 | 0 | dihydroxypyridine | mouse metabolite |
cerium | [no description available] | low | 0 | 0 | cholesteryl ester | mouse metabolite |
zymostenol | [no description available] | low | 0 | 0 | 3beta-sterol; cholestanoid | human metabolite; mouse metabolite |
16-hydroxydehydroepiandrosterone | [no description available] | low | 0 | 0 | 16alpha-hydroxy steroid; 17-oxo steroid; 3beta-hydroxy-Delta(5)-steroid; androstanoid; secondary alpha-hydroxy ketone | human metabolite; mouse metabolite |
6,6-dimethyl-2-methylenebicyclo(3.1.1)heptan-3-ol | [no description available] | low | 0 | 0 | carbobicyclic compound; pinane monoterpenoid; secondary alcohol | GABA modulator; mouse metabolite; plant metabolite; volatile oil component |
hydrogen sulfite | [no description available] | low | 0 | 0 | sulfur oxoanion | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ecgonine methyl ester | [no description available] | low | 0 | 0 | methyl ester; tertiary amino compound; tropane alkaloid | analgesic; central nervous system depressant; metabolite; mouse metabolite; opioid analgesic; peripheral nervous system drug |
2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | [no description available] | low | 0 | 0 | hydroxylamine; imidazopyridine | carcinogenic agent; genotoxin; human xenobiotic metabolite; mouse metabolite; mutagen; neurotoxin; rat metabolite |
fructose 2,6-diphosphate | [no description available] | low | 0 | 0 | D-fructofuranose 2,6-bisphosphate | human metabolite; mouse metabolite |
cholest-5-en-3 beta,7 alpha-diol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid; oxysterol | mouse metabolite |
hypotaurine | [no description available] | low | 0 | 0 | aminosulfinic acid; zwitterion | human metabolite; metabolite; mouse metabolite |
s-chloromethylglutathione | [no description available] | low | 0 | 0 | organochlorine compound; S-substituted glutathione | alkylating agent; bacterial xenobiotic metabolite; mouse metabolite |
5-acetylamino-6-formylamino-3-methyluracil | [no description available] | low | 0 | 0 | formamidopyrimidine | mouse metabolite |
anserine | [no description available] | low | 0 | 0 | beta-alanine derivative; dipeptide; zwitterion | animal metabolite; mouse metabolite |
5,6-dihydroxyindole | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
androsterone glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; metabolite; mouse metabolite |
estrone-3-glucuronide | [no description available] | low | 0 | 0 | 17-oxo steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
5,6-dihydroxy-2-indolylcarboxylic acid | [no description available] | low | 0 | 0 | dihydroxyindole | mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
inositol-3,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
(20s)-20-hydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; oxysterol | human metabolite; mouse metabolite |
24-hydroxycholesterol | [no description available] | low | 0 | 0 | 24-hydroxycholesterol | biomarker; human blood serum metabolite; mouse metabolite |
phytosphingosine | [no description available] | low | 0 | 0 | amino alcohol; sphingoid; triol | mouse metabolite; Saccharomyces cerevisiae metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
n-acetylputrescine | [no description available] | low | 0 | 0 | N-monoacetylalkane-alpha,omega-diamine; N-substituted putrescine | metabolite; mouse metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cdp ethanolamine | [no description available] | low | 0 | 0 | nucleotide-(amino alcohol)s; phosphoethanolamine | mouse metabolite |
7 alpha-hydroxy-4-cholesten-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; 7alpha-hydroxy steroid; cholestanoid | human metabolite; mouse metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
27-hydroxycholesterol | [no description available] | low | 0 | 0 | 26-hydroxycholesterol | apoptosis inducer; human metabolite; mouse metabolite; neuroprotective agent |
dehydroalanine | [no description available] | low | 0 | 0 | 2,3-dehydroamino acid; alpha,beta-unsaturated monocarboxylic acid; amino acid zwitterion; enamine; non-proteinogenic alpha-amino acid | alkylating agent; human metabolite; mouse metabolite |
1-myristoyl-2-palmitoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 30:0; tetradecanoate ester | mouse metabolite |
proline | [no description available] | low | 0 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
d-glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; D-alpha-amino acid; glutamine | mouse metabolite |
diquafosol | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-tetraphosphate; uridine 5'-phosphate | mouse metabolite; P2Y2 receptor agonist |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
19-hydroxytestosterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 19-hydroxy steroid; 3-oxo-Delta(4) steroid | mouse metabolite |
2-hydroxy-1,4-benzoquinone | [no description available] | low | 0 | 0 | monohydroxy-1,4-benzoquinones | mouse metabolite |
3,4-dihydroxyphenylglycolaldehyde | [no description available] | low | 0 | 0 | catechols; hydroxyaldehyde | human metabolite; mouse metabolite; neurotoxin |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
androsterone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; androstanoid; steroid sulfate | human metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
3,7,12-trihydroxycoprostane | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
saccharopine | [no description available] | low | 0 | 0 | amino acid opine; L-lysine derivative | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
allysine | [no description available] | low | 0 | 0 | allysine; amino acid zwitterion; aminoadipate semialdehyde; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
beta-ureidoisobutyric acid | [no description available] | low | 0 | 0 | ureidocarboxylic acid | human metabolite; mouse metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
kynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; kynurenine; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
hydromethylthionine | [no description available] | low | 0 | 0 | aromatic amine; phenothiazines; tertiary amino compound | bacterial xenobiotic metabolite; fluorochrome; mouse metabolite; rat metabolite |
5-hydroxykynuramine | [no description available] | low | 0 | 0 | hydroxykynurenamine; primary amino compound | mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
thiocysteine | [no description available] | low | 0 | 0 | amino acid zwitterion; S-substituted L-cysteine | human metabolite; mouse metabolite |
diadenosine triphosphate | [no description available] | low | 0 | 0 | diadenosyl triphosphate | mouse metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
isovaleryl-coenzyme a | [no description available] | low | 0 | 0 | methylbutanoyl-CoA; short-chain fatty acyl-CoA | mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4,4-dimethyl-5-alpha-cholesta-(8,24)-dien-3-beta-ol | [no description available] | low | 0 | 0 | 3beta-sterol | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
biotin | [no description available] | low | 0 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
campesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C28-steroid; phytosterols | mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cholestane-3,7,12,26-tetrol | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 26-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cholic acid | [no description available] | low | 0 | 0 | 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7alpha-hydroxy steroid; bile acid; C24-steroid; trihydroxy-5beta-cholanic acid | human metabolite; mouse metabolite |
sitosterol, (3beta)-isomer | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C29-steroid; phytosterols; stigmastane sterol | anticholesteremic drug; antioxidant; mouse metabolite; plant metabolite; sterol methyltransferase inhibitor |
cortisone | [no description available] | low | 0 | 0 | 11-oxo steroid; 17alpha-hydroxy steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; C21-steroid; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
androstane-3,17-dione, (5alpha)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5alpha-steroid; androstane-3,17-dione | mouse metabolite |
cholesteryl palmitate | [no description available] | low | 0 | 0 | cholesteryl ester | human metabolite; mouse metabolite |
lanosterol | [no description available] | low | 0 | 0 | 14alpha-methyl steroid; 3beta-sterol; tetracyclic triterpenoid | bacterial metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
21-hydroxypregnenolone | [no description available] | low | 0 | 0 | 21-hydroxy steroid; hydroxypregnenolone; primary alpha-hydroxy ketone | mouse metabolite |
2-hydroxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 2-hydroxy steroid | carcinogenic agent; human metabolite; metabolite; mouse metabolite; prodrug |
epietiocholanolone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3beta-hydroxy steroid; androstanoid | androgen; animal metabolite; human blood serum metabolite; mouse metabolite; rat metabolite |
5-hydroxyisourate | [no description available] | low | 0 | 0 | oxopurine | human metabolite; mouse metabolite |
19-hydroxy-4-androstene-3,17-dione | [no description available] | low | 0 | 0 | 17-oxo steroid; 19-hydroxy steroid; 3-oxo steroid; androstanoid | mouse metabolite |
taurochenodeoxycholic acid | [no description available] | low | 0 | 0 | bile acid taurine conjugate | human metabolite; mouse metabolite |
glyceraldehyde 3-phosphate | [no description available] | low | 0 | 0 | glyceraldehyde 3-phosphate | mouse metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose 5-phosphate | [no description available] | low | 0 | 0 | ribulose 5-phosphate | mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
isomaltose | [no description available] | low | 0 | 0 | glycosylglucose | human metabolite; metabolite; mouse metabolite |
arabinose | [no description available] | low | 0 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
n-acetylneuraminic acid | [no description available] | low | 0 | 0 | N-acetylneuraminic acids | antioxidant; bacterial metabolite; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; human metabolite; mouse metabolite |
glucosamine | [no description available] | low | 0 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
carnosine | [no description available] | low | 0 | 0 | amino acid zwitterion; dipeptide | anticonvulsant; antineoplastic agent; antioxidant; Daphnia magna metabolite; geroprotector; human metabolite; mouse metabolite; neuroprotective agent |
raffinose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; trisaccharide | mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
5-hydroxytryptophan | [no description available] | low | 0 | 0 | 5-hydroxytryptophan; amino acid zwitterion; hydroxy-L-tryptophan; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; plant metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
dopaquinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; amino acid zwitterion; L-phenylalanine derivative | human metabolite; mouse metabolite |
pantetheine | [no description available] | low | 0 | 0 | pantetheines; thiol | human metabolite; metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | epitope; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactopyranose | mouse metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
5-diphosphomevalonic acid | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | human metabolite; mouse metabolite |
7-dehydrocholesterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; Delta(5),Delta(7)-sterol | human metabolite; mouse metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
inositol 1,4,5-trisphosphate | [no description available] | low | 0 | 0 | myo-inositol trisphosphate | mouse metabolite |
stachyose | [no description available] | low | 0 | 0 | raffinose family oligosaccharide; tetrasaccharide | mouse metabolite; plant metabolite |
desmosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; C27-steroid; cholestanoid | human metabolite; mouse metabolite |
monoiodotyrosine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-tyrosine derivative; monoiodotyrosine; non-proteinogenic L-alpha-amino acid | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor; human metabolite; mouse metabolite |
n'-formylkynurenine | [no description available] | low | 0 | 0 | amino acid zwitterion; N-formylkynurenine; non-proteinogenic amino acid derivative; non-proteinogenic L-alpha-amino acid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
ketodihydrosphingosine | [no description available] | low | 0 | 0 | 2-amino-1-hydroxyoctadecan-3-one | mouse metabolite |
nicotinamide-beta-riboside | [no description available] | low | 0 | 0 | N-glycosylnicotinamide; pyridine nucleoside | geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
androstane-3,17-dione, (5beta)-isomer | [no description available] | low | 0 | 0 | 3-oxo-5beta-steroid; androstane-3,17-dione | mouse metabolite |
trimethyllysine | [no description available] | low | 0 | 0 | alpha-amino-acid cation | human metabolite; mouse metabolite |
inositol 3,4-bisphosphate | [no description available] | low | 0 | 0 | myo-inositol bisphosphate | human metabolite; mouse metabolite |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
24,25-dihydrolanosterol | [no description available] | low | 0 | 0 | 3beta-sterol; tetracyclic triterpenoid | human metabolite; mouse metabolite |
2-methoxyestrone | [no description available] | low | 0 | 0 | 17-oxo steroid; 3-hydroxy steroid; alicyclic ketone; aromatic ether; phenolic steroid; phenols | human metabolite; mouse metabolite |
dehydroascorbic acid | [no description available] | low | 0 | 0 | dehydroascorbic acid; vitamin C | coenzyme; mouse metabolite |
cortodoxone | [no description available] | low | 0 | 0 | deoxycortisol; glucocorticoid; primary alpha-hydroxy ketone; tertiary alpha-hydroxy ketone | human metabolite; mouse metabolite |
estradiol-3-glucuronide | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; mouse metabolite |
beta-sulfopyruvic acid | [no description available] | low | 0 | 0 | carboxyalkanesulfonic acid | mouse metabolite |
acetyl adenylate | [no description available] | low | 0 | 0 | 5'-acylphosphoadenosin | human metabolite; mouse metabolite |
2-hydroxypropylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; secondary alcohol | mouse metabolite |
4,4-dimethylcholesta-8,14,24-trienol | [no description available] | low | 0 | 0 | 3beta-sterol; Delta(14) steroid | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inositol-1,4,5,6-tetrakisphosphate | [no description available] | low | 0 | 0 | myo-inositol tetrakisphosphate | mouse metabolite |
maleic acid | [no description available] | low | 0 | 0 | butenedioic acid | algal metabolite; mouse metabolite; plant metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
arachidonic acid | [no description available] | low | 0 | 0 | icosa-5,8,11,14-tetraenoic acid; long-chain fatty acid; omega-6 fatty acid | Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
prostaglandin h2 | [no description available] | low | 0 | 0 | olefinic compound; oxylipin; prostaglandins H; secondary alcohol | mouse metabolite |
3-hydroxy-3-methylglutaryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxy-3-methylglutaryl-CoA; 3-hydroxy fatty acyl-CoA | human metabolite; mouse metabolite |
retinol | [no description available] | low | 0 | 0 | retinol; vitamin A | human metabolite; mouse metabolite; plant metabolite |
docosahexaenoate | [no description available] | low | 0 | 0 | docosahexaenoic acid; omega-3 fatty acid | algal metabolite; antineoplastic agent; Daphnia tenebrosa metabolite; human metabolite; mouse metabolite; nutraceutical |
oleic acid | [no description available] | low | 0 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
cocaine | [no description available] | low | 0 | 0 | benzoate ester; methyl ester; tertiary amino compound; tropane alkaloid | adrenergic uptake inhibitor; central nervous system stimulant; dopamine uptake inhibitor; environmental contaminant; local anaesthetic; mouse metabolite; plant metabolite; serotonin uptake inhibitor; sodium channel blocker; sympathomimetic agent; vasoconstrictor agent; xenobiotic |
eicosapentaenoic acid | [no description available] | low | 0 | 0 | icosapentaenoic acid; omega-3 fatty acid | anticholesteremic drug; antidepressant; antineoplastic agent; Daphnia galeata metabolite; fungal metabolite; micronutrient; mouse metabolite; nutraceutical |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
geranylgeranyl pyrophosphate | [no description available] | low | 0 | 0 | geranylgeranyl diphosphate | mouse metabolite |
cytidine monophosphate n-acetylneuraminic acid | [no description available] | low | 0 | 0 | CMP-N-acyl-beta-neuraminic acid | mouse metabolite |
prostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins D | human metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
colfosceril palmitate | [no description available] | low | 0 | 0 | 1-acyl-2-hexadecanoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:0 | mouse metabolite; surfactant |
lyso-pc | [no description available] | low | 0 | 0 | 1-O-acyl-sn-glycero-3-phosphocholine; lysophosphatidylcholine 16:0 | mouse metabolite |
riboflavin | [no description available] | low | 0 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
trans-4-coumaric acid | [no description available] | low | 0 | 0 | 4-coumaric acid | food component; mouse metabolite; plant metabolite |
retinaldehyde | [no description available] | low | 0 | 0 | retinal; vitamin A | gap junctional intercellular communication inhibitor; human metabolite; mouse metabolite |
squalene | [no description available] | low | 0 | 0 | triterpene | human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
flavin mononucleotide | [no description available] | low | 0 | 0 | flavin mononucleotide; vitamin B2 | bacterial metabolite; coenzyme; cofactor; human metabolite; mouse metabolite |
3-hydroxybutyryl-coenzyme a | [no description available] | low | 0 | 0 | 3-hydroxyacyl-CoA; hydroxybutanoyl-CoA | mouse metabolite |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
dihydrosphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
caffeic acid | [no description available] | low | 0 | 0 | caffeic acid | geroprotector; mouse metabolite |
coniferyl alcohol | [no description available] | low | 0 | 0 | guaiacols; phenylpropanoid | animal metabolite; monolignol; mouse metabolite; pheromone; plant metabolite; volatile oil component |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
estrone sulfate | [no description available] | low | 0 | 0 | 17-oxo steroid; steroid sulfate | human metabolite; mouse metabolite |
raphanusamic acid | [no description available] | low | 0 | 0 | thiazolidinemonocarboxylic acid | Arabidopsis thaliana metabolite; mouse metabolite; xenobiotic metabolite |
isobutyryl-coenzyme a | [no description available] | low | 0 | 0 | methyl-branched fatty acyl-CoA; short-chain fatty acyl-CoA | human metabolite; mouse metabolite |
dihydroxycoprostane | [no description available] | low | 0 | 0 | 3alpha-hydroxy steroid; 7alpha-hydroxy steroid | human metabolite; mouse metabolite |
glutaryl-coenzyme a | [no description available] | low | 0 | 0 | glutaryl-CoAs | mouse metabolite |
sphingosine | [no description available] | low | 0 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
bilirubin | [no description available] | low | 0 | 0 | biladienes; dicarboxylic acid | antioxidant; human metabolite; mouse metabolite |
dinoprostone | [no description available] | low | 0 | 0 | prostaglandins E | human metabolite; mouse metabolite; oxytocic |
dinoprost | [no description available] | low | 0 | 0 | monocarboxylic acid; prostaglandins Falpha | human metabolite; mouse metabolite |
leukotriene a4 | [no description available] | low | 0 | 0 | epoxy fatty acid; leukotriene; long-chain fatty acid; oxylipin; polyunsaturated fatty acid | human metabolite; mouse metabolite; plant metabolite |
calcitriol | [no description available] | low | 0 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
beta carotene | [no description available] | low | 0 | 0 | carotenoid beta-end derivative; cyclic carotene | antioxidant; biological pigment; cofactor; ferroptosis inhibitor; human metabolite; mouse metabolite; plant metabolite; provitamin A |
11-cis-retinal | [no description available] | low | 0 | 0 | retinal | chromophore; human metabolite; mouse metabolite |
leukotriene b4 | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; hydroxy polyunsaturated fatty acid; leukotriene; long-chain fatty acid | human metabolite; mouse metabolite; plant metabolite; vasoconstrictor agent |
leukotriene c4 | [no description available] | low | 0 | 0 | leukotriene | bronchoconstrictor agent; human metabolite; mouse metabolite |
thromboxane a2 | [no description available] | low | 0 | 0 | epoxy monocarboxylic acid; thromboxanes A | mouse metabolite |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | low | 0 | 0 | (5Z,8Z,11Z,13E)-15-HETE | human metabolite; mouse metabolite |
5-hydroxy-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE | human metabolite; mouse metabolite |
arachidonic acid 5-hydroperoxide | [no description available] | low | 0 | 0 | 5-HPETE | mouse metabolite |
leukotriene d4 | [no description available] | low | 0 | 0 | dipeptide; leukotriene; organic sulfide | bronchoconstrictor agent; human metabolite; mouse metabolite |
prostaglandin g2 | [no description available] | low | 0 | 0 | prostaglandins G | human metabolite; mouse metabolite |
6-ketoprostaglandin f1 alpha | [no description available] | low | 0 | 0 | prostaglandins Falpha | human metabolite; mouse metabolite |
arachidonic acid omega-9 hydroperoxide | [no description available] | low | 0 | 0 | HPETE | mouse metabolite |
15-hydroperoxy-5,8,11,13-eicosatetraenoic acid, (s)-(e,z,z,z)-isomer | [no description available] | low | 0 | 0 | 15-HPETE | mouse metabolite |
gamma-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-6 fatty acid | human metabolite; mouse metabolite; plant metabolite |
alpha-linolenic acid | [no description available] | low | 0 | 0 | linolenic acid; omega-3 fatty acid | micronutrient; mouse metabolite; nutraceutical |
1-palmitoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-palmitoyl-2-oleoylglycerol | mouse metabolite |
epoprostenol | [no description available] | low | 0 | 0 | prostaglandins I | mouse metabolite |
9-hydroxy-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | HODE; octadecadienoic acid | human metabolite; metabolite; mouse metabolite; plant metabolite |
thromboxane b2 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
thromboxane b3 | [no description available] | low | 0 | 0 | thromboxanes B | human metabolite; mouse metabolite |
11,12-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET | mouse metabolite |
14,15-dihydroxyeicosatrienoic acid | [no description available] | low | 0 | 0 | DHET; diol; secondary allylic alcohol | mouse metabolite |
20-hydroxy-5,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | HETE; hydroxy monocarboxylic acid | human metabolite; mouse metabolite |
5-oxo-6,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | oxoicosatetraenoic acid | human metabolite; immunomodulator; mouse metabolite |
5,6-epoxy-8,11,14-eicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
8,9-epoxyeicosatrienoic acid | [no description available] | low | 0 | 0 | EET | mouse metabolite |
1-palmitoyl-2-oleoylphosphatidylethanolamine, (z & r)-isomer | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphoethanolamine; phosphatidylethanolamine 34:1 zwitterion; phosphatidylethanolamine | mouse metabolite |
sphingosine 1-phosphate | [no description available] | low | 0 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
cholesteryl oleate | [no description available] | low | 0 | 0 | CE(18:1); cholesteryl octadec-9-enoate | mouse metabolite |
calcifediol | [no description available] | low | 0 | 0 | D3 vitamins; diol; hydroxycalciol | bone density conservation agent; human metabolite; metabolite; mouse metabolite; nutraceutical |
hyodeoxycholic acid | [no description available] | low | 0 | 0 | 5beta-cholanic acids; 6alpha,20xi-murideoxycholic acid; bile acid; C24-steroid | human metabolite; mouse metabolite |
cerium | [no description available] | low | 0 | 0 | CE(18:2); cholesteryl octadeca-9,12-dienoate | human metabolite; mouse metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
11-dehydrocorticosterone | [no description available] | low | 0 | 0 | 11-oxo steroid; 20-oxo steroid; 21-hydroxy steroid; 3-oxo-Delta(4) steroid; corticosteroid; primary alpha-hydroxy ketone | human metabolite; mouse metabolite |
stearidonic acid | [no description available] | low | 0 | 0 | long-chain fatty acid; octadecatetraenoic acid; omega-3 fatty acid | Daphnia galeata metabolite; mouse metabolite; plant metabolite |
trilinolein | [no description available] | low | 0 | 0 | 1,2-diacyl-3-linoleoylglycerol; 1,3-diacyl-2-linoleoylglycerol; linoleoyl containing 1,2,3-triacyl-sn-glycerol; TG(18:2/18:2/18:2); triglyceride | mouse metabolite |
dimyristoylphosphatidylcholine | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycero-3-phosphocholine; phosphatidylcholine 28:0; tetradecanoate ester | antigen; mouse metabolite |
2,3-oxidosqualene | [no description available] | low | 0 | 0 | 2,3-epoxysqualene | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyribose | [no description available] | low | 0 | 0 | deoxypentose | human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
monodehydroascorbate | [no description available] | low | 0 | 0 | organic radical | mouse metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
vitamin a2 | [no description available] | low | 0 | 0 | retinoid; vitamin A | human xenobiotic metabolite; marine xenobiotic metabolite; mouse metabolite |
1,2-dioleoylphosphatidylserine | [no description available] | low | 0 | 0 | phosphatidylserine(18:1/18:1) | mouse metabolite |
5-hydroxy-6,8,11,14,17-eicosapentaenoic acid | [no description available] | low | 0 | 0 | HEPE | mouse metabolite |
1-stearoyl-2-linoleoylphosphatidylcholine | [no description available] | low | 0 | 0 | phosphatidylcholine 36:2 | mouse metabolite |
1-stearoyl-2-linoleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; diacylglycerol 36:2 | mouse metabolite |
1-palmitoyl-2-docosahexaenoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | phosphatidylcholine 38:6 | mouse metabolite |
13(S)-HODE | [no description available] | low | 0 | 0 | HODE | antineoplastic agent; human xenobiotic metabolite; mouse metabolite |
1-stearoyl-2-oleoyl-sn-glycerol | [no description available] | low | 0 | 0 | 1,2-diacyl-sn-glycerol; 1-stearoyl-2-oleoylglycerol; diacylglycerol 36:1 | mouse metabolite |
1-palmitoyl-2-palmitoleoyl-sn-glycero-3-phosphocholine | [no description available] | low | 0 | 0 | 1-acyl-2-palmitoleoyl-sn-glycero-3-phosphocholine; phosphatidylcholine 32:1 | mouse metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid | metabolite; mouse metabolite |
n-stearoylsphingomyelin | [no description available] | low | 0 | 0 | sphingomyelin 36:1; sphingomyelin d18:1 | mouse metabolite |
20,22-dihydroxycholesterol | [no description available] | low | 0 | 0 | 20-hydroxy steroid; 22-hydroxy steroid; 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; cholestanoid; oxysterol | human metabolite; mouse metabolite |
cholesteryl arachidonate | [no description available] | low | 0 | 0 | cholesteryl icosatetraenoate | antibacterial agent; mouse metabolite |
acryloyl-coenzyme a | [no description available] | low | 0 | 0 | 2-enoyl-CoA; monounsaturated fatty acyl-CoA | mouse metabolite |
phosphocreatine | [no description available] | low | 0 | 0 | phosphagen; phosphoamino acid | human metabolite; mouse metabolite |
samarium | [no description available] | low | 0 | 0 | sphingomyelin d18:1/16:0 | mouse metabolite |
n-palmitoylgalactosylsphingosine | [no description available] | low | 0 | 0 | HexCer(d18:1/16:0); N-acyl-beta-D-galactosylsphingosine | mouse metabolite |
palmitoylcarnitine | [no description available] | low | 0 | 0 | O-palmitoylcarnitine; saturated fatty acyl-L-carnitine | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; human metabolite; mouse metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
prosomatostatin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone | fungal metabolite; mouse metabolite; rat metabolite |
phosphatidylcholines | [no description available] | low | 0 | 0 | phosphatidylcholine 40:6 | mouse metabolite |
2-ketoarginine | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; zwitterion | human metabolite; mouse metabolite |
cyclosporine | [no description available] | low | 0 | 0 | keto-disaccharide | mouse metabolite |
g(m3) ganglioside | [no description available] | low | 0 | 0 | alpha-N-acetylneuraminyl-(2->3)-beta-D-galactosyl-(1->4)-beta-D-glucosyl-(1<->1')-ceramide; sialodiosylceramide; sialotriaosylceramide | mouse metabolite |
cyclic gmp | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine monophosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
guanosine triphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
guanine | [no description available] | low | 0 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
guanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
inosine | [no description available] | low | 0 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inosine triphosphate | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
folic acid | [no description available] | low | 0 | 0 | folic acids; N-acyl-amino acid | human metabolite; mouse metabolite; nutrient |
dyspropterin | [no description available] | low | 0 | 0 | biopterins; tetrahydropterin | human metabolite; metabolite; mouse metabolite |
leucovorin | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
17-octadecynoic acid | [no description available] | low | 0 | 0 | acetylenic fatty acid; long-chain fatty acid; monounsaturated fatty acid; terminal acetylenic compound | EC 1.14.14.94 (leukotriene-B4 20-monooxygenase) inhibitor; EC 1.14.15.3 (alkane 1-monooxygenase) inhibitor; P450 inhibitor |
ethinamate | [no description available] | low | 0 | 0 | carbamate ester; terminal acetylenic compound | sedative |
clorgyline | [no description available] | low | 0 | 0 | aromatic ether; dichlorobenzene; terminal acetylenic compound; tertiary amino compound | antidepressant; EC 1.4.3.4 (monoamine oxidase) inhibitor |
propargite | [no description available] | low | 0 | 0 | sulfite ester; terminal acetylenic compound | sulfite ester acaricide |
norethindrone acetate | [no description available] | low | 0 | 0 | 3-oxo-Delta(4) steroid; acetate ester; terminal acetylenic compound | progestin; synthetic oral contraceptive |
ethinyl estradiol | [no description available] | low | 0 | 0 | 17-hydroxy steroid; 3-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
norethindrone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound; tertiary alcohol | progestin; synthetic oral contraceptive |
mestranol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; aromatic ether; terminal acetylenic compound | prodrug; xenoestrogen |
acetylene | [no description available] | low | 0 | 0 | alkyne; gas molecular entity; terminal acetylenic compound | |
methylacetylene | [no description available] | low | 0 | 0 | alkyne; gas molecular entity; terminal acetylenic compound | |
quinestrol | [no description available] | low | 0 | 0 | 17-hydroxy steroid; terminal acetylenic compound | xenoestrogen |
ethynodiol diacetate | [no description available] | low | 0 | 0 | steroid ester; terminal acetylenic compound | contraceptive drug; estrogen receptor modulator; synthetic oral contraceptive |
propiolic acid | [no description available] | low | 0 | 0 | acetylenic fatty acid; alpha,beta-unsaturated monocarboxylic acid; monounsaturated fatty acid; short-chain fatty acid; terminal acetylenic compound | xenobiotic metabolite |
ethyl propiolate | [no description available] | low | 0 | 0 | ethyl ester; terminal acetylenic compound; ynoate ester | |
levonorgestrel | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound | contraceptive drug; female contraceptive drug; progestin; synthetic oral contraceptive |
ethynodiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3beta-hydroxy steroid; terminal acetylenic compound | progestin |
selegiline | [no description available] | low | 0 | 0 | selegiline; terminal acetylenic compound | geroprotector |
selegiline hydrochloride, (r)-isomer | [no description available] | low | 0 | 0 | hydrochloride; terminal acetylenic compound | antiparkinson drug; dopaminergic agent; EC 1.4.3.4 (monoamine oxidase) inhibitor |
danazol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | anti-estrogen; estrogen antagonist; geroprotector |
pronamide | [no description available] | low | 0 | 0 | benzamides; dichlorobenzene; terminal acetylenic compound | agrochemical; herbicide |
desogestrel | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | contraceptive drug; progestin; synthetic oral contraceptive |
s 53482 | [no description available] | low | 0 | 0 | benzoxazine; dicarboximide; organofluorine compound; terminal acetylenic compound | agrochemical; EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor; herbicide; teratogenic agent |
10-propargyl-10-deazaaminopterin | [no description available] | low | 0 | 0 | N-acyl-L-glutamic acid; pteridines; terminal acetylenic compound | antimetabolite; antineoplastic agent; EC 1.5.1.3 (dihydrofolate reductase) inhibitor |
s 23121 | [no description available] | low | 0 | 0 | aromatic ether; dicarboximide; monochlorobenzenes; monofluorobenzenes; pyrroline; terminal acetylenic compound | |
erlotinib | [no description available] | low | 0 | 0 | aromatic ether; quinazolines; secondary amino compound; terminal acetylenic compound | antineoplastic agent; epidermal growth factor receptor antagonist; protein kinase inhibitor |
erlotinib hydrochloride | [no description available] | low | 0 | 0 | hydrochloride; terminal acetylenic compound | antineoplastic agent; protein kinase inhibitor |
tibolone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; terminal acetylenic compound | bone density conservation agent; hormone agonist |
rasagiline | [no description available] | low | 0 | 0 | indanes; secondary amine; terminal acetylenic compound | EC 1.4.3.4 (monoamine oxidase) inhibitor; neuroprotective agent |
ethisterone | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound; tertiary alcohol | drug metabolite; progestin |
zr 777 | [no description available] | low | 0 | 0 | farnesane sesquiterpenoid; terminal acetylenic compound | juvenile hormone mimic |
norgestimate | [no description available] | low | 0 | 0 | ketoxime; steroid ester; terminal acetylenic compound | contraceptive drug; progestin; synthetic oral contraceptive |
etonogestrel | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-oxo-Delta(4) steroid; terminal acetylenic compound | contraceptive drug; female contraceptive drug; progestin |
mandipropamid | [no description available] | low | 0 | 0 | aromatic ether; monocarboxylic acid amide; monochlorobenzenes; terminal acetylenic compound | |