Substance | Description | Relationhip Strength | Studies | Trials | Classes | Roles |
sodium selenite | [no description available] | medium | 11 | 0 | inorganic sodium salt; selenite salt | nutraceutical |
methanol | [no description available] | medium | 2 | 0 | alkyl alcohol; one-carbon compound; primary alcohol; volatile organic compound | amphiprotic solvent; Escherichia coli metabolite; fuel; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
methaneselenol | [no description available] | medium | 2 | 0 | | |
hydrogen selenide | [no description available] | medium | 1 | 0 | mononuclear parent hydride; selenium hydride | Escherichia coli metabolite; mouse metabolite |
selenomethionine | [no description available] | medium | 3 | 0 | selenoamino acid; selenomethionines | plant metabolite |
selenocyanic acid | [no description available] | medium | 1 | 0 | organic radical | |
selenious acid | [no description available] | medium | 4 | 0 | selenium oxoacid | |
cyanates | [no description available] | medium | 1 | 0 | | |
menatetrenone | [no description available] | medium | 1 | 0 | menaquinone | anti-inflammatory agent; antioxidant; bone density conservation agent; human metabolite; neuroprotective agent |
sphingosine | [no description available] | medium | 1 | 0 | sphing-4-enine | human metabolite; mouse metabolite |
manganese | [no description available] | medium | 1 | 0 | elemental manganese; manganese group element atom | Escherichia coli metabolite; micronutrient |
vitamin k semiquinone radical | [no description available] | medium | 1 | 0 | | |
sphingosine 1-phosphate | [no description available] | medium | 1 | 0 | sphingoid 1-phosphate | mouse metabolite; signalling molecule; sphingosine-1-phosphate receptor agonist; T-cell proliferation inhibitor; vasodilator agent |
cadmium | [no description available] | medium | 1 | 0 | cadmium molecular entity; zinc group element atom | |
menaquinone 6 | [no description available] | medium | 1 | 0 | | |
selenium | [no description available] | medium | 11 | 0 | chalcogen; nonmetal atom | micronutrient |
cystine | [no description available] | medium | 8 | 0 | | |
selenocystine | [no description available] | medium | 7 | 0 | diselenide; selenoamino acid | |
selenocysteine | [no description available] | medium | 2 | 0 | | |
dimethyl mercury | [no description available] | medium | 1 | 0 | methylmercury compound | |
methylselenic acid | [no description available] | medium | 2 | 0 | one-carbon compound; organoselenium compound | antineoplastic agent; EC 3.5.1.98 (histone deacetylase) inhibitor; human xenobiotic metabolite |
s-adenosylmethionine | [no description available] | medium | 1 | 0 | organic cation; sulfonium compound | coenzyme; cofactor; human metabolite; micronutrient; Mycoplasma genitalium metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
cytochrome c-t | [no description available] | medium | 2 | 0 | | |
cysteinylglycine | [no description available] | medium | 1 | 0 | dipeptide zwitterion; dipeptide | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
cystamine | [no description available] | medium | 1 | 0 | organic disulfide; primary amino compound | EC 2.3.2.13 (protein-glutamine gamma-glutamyltransferase) inhibitor |
methionine | [no description available] | medium | 1 | 0 | aspartate family amino acid; L-alpha-amino acid; methionine zwitterion; methionine; proteinogenic amino acid | antidote to paracetamol poisoning; human metabolite; micronutrient; mouse metabolite; nutraceutical |
selenocystamine | [no description available] | medium | 1 | 0 | organoselenium compound | |
dimethylselenide | [no description available] | medium | 1 | 0 | organoselenium compound | bacterial xenobiotic metabolite; plant metabolite |
nadp | [no description available] | medium | 4 | 0 | | |
tert-butylhydroperoxide | [no description available] | medium | 1 | 0 | alkyl hydroperoxide | antibacterial agent; oxidising agent |
15-hydroperoxy-5,8,11,13-eicosatetraenoic acid | [no description available] | medium | 1 | 0 | HPETE | human xenobiotic metabolite |
15-hydroxy-5,8,11,13-eicosatetraenoic acid | [no description available] | medium | 1 | 0 | | |
melphalan | [no description available] | medium | 1 | 0 | L-phenylalanine derivative; nitrogen mustard; non-proteinogenic L-alpha-amino acid; organochlorine compound | alkylating agent; antineoplastic agent; carcinogenic agent; drug allergen; immunosuppressive agent |
cysteine | [no description available] | medium | 2 | 0 | cysteinium | fundamental metabolite |
dithionitrobenzoic acid | [no description available] | medium | 1 | 0 | nitrobenzoic acid; organic disulfide | indicator |
dithiothreitol | [no description available] | medium | 1 | 0 | 1,4-dimercaptobutane-2,3-diol; butanediols; dithiol; glycol; thiol | chelator; human metabolite; reducing agent |
phorbol 12,13-dibutyrate | [no description available] | medium | 1 | 0 | butyrate ester; phorbol ester; tertiary alpha-hydroxy ketone | |
tetradecanoylphorbol acetate | [no description available] | medium | 1 | 0 | acetate ester; diester; phorbol ester; tertiary alpha-hydroxy ketone; tetradecanoate ester | antineoplastic agent; apoptosis inducer; carcinogenic agent; mitogen; plant metabolite; protein kinase C agonist; reactive oxygen species generator |
glutathione disulfide | [no description available] | high | 1 | 0 | glutathione derivative; organic disulfide | Escherichia coli metabolite; mouse metabolite |
1,4-phenylenebis(methylene)selenocyanate | [no description available] | medium | 2 | 0 | | |
calcium sulfate | [no description available] | medium | 1 | 0 | calcium salt; inorganic calcium salt | |
alpha-hydroxyglutarate | [no description available] | low | 0 | 0 | 2-hydroxydicarboxylic acid; dicarboxylic fatty acid | metabolite; mouse metabolite |
alpha-isopropylmalate | [no description available] | low | 0 | 0 | 2-hydroxy carboxylic acid; 3-hydroxy carboxylic acid; dicarboxylic acid | metabolite |
acetoacetic acid | [no description available] | low | 0 | 0 | 3-oxo fatty acid; ketone body | metabolite |
3-hydroxybenzyl alcohol | [no description available] | low | 0 | 0 | hydroxybenzyl alcohol; phenols | metabolite |
n-carbamoyl-beta-alanine | [no description available] | low | 0 | 0 | beta-alanine derivative | metabolite; mouse metabolite |
ethylene glycol | [no description available] | low | 0 | 0 | ethanediol; glycol | metabolite; mouse metabolite; solvent; toxin |
acetoin | [no description available] | low | 0 | 0 | methyl ketone; secondary alpha-hydroxy ketone | metabolite |
ammonium hydroxide | [no description available] | low | 0 | 0 | azane; gas molecular entity; mononuclear parent hydride | EC 3.5.1.4 (amidase) inhibitor; metabolite; mouse metabolite; neurotoxin; NMR chemical shift reference compound; nucleophilic reagent; refrigerant |
benzyl alcohol | [no description available] | low | 0 | 0 | benzyl alcohols | antioxidant; fragrance; metabolite; solvent |
carbon monoxide | [no description available] | low | 0 | 0 | carbon oxide; gas molecular entity; one-carbon compound | biomarker; EC 1.9.3.1 (cytochrome c oxidase) inhibitor; human metabolite; ligand; metabolite; mitochondrial respiratory-chain inhibitor; mouse metabolite; neurotoxin; neurotransmitter; P450 inhibitor; probe; signalling molecule; vasodilator agent |
formic acid | [no description available] | low | 0 | 0 | monocarboxylic acid | antibacterial agent; astringent; metabolite; protic solvent; solvent |
4-hydroxymandelic acid | [no description available] | low | 0 | 0 | 2-hydroxy carboxylic acid; phenols | metabolite |
aminoethylphosphonic acid | [no description available] | low | 0 | 0 | phosphonic acids; primary amino compound; zwitterion | human metabolite; metabolite; mouse metabolite |
hydrogen sulfide | [no description available] | low | 0 | 0 | gas molecular entity; hydracid; mononuclear parent hydride; sulfur hydride | Escherichia coli metabolite; genotoxin; metabolite; signalling molecule; toxin; vasodilator agent |
4-aminophenol | [no description available] | low | 0 | 0 | aminophenol | allergen; metabolite |
n(1)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; metabolite |
aminocaproic acid | [no description available] | low | 0 | 0 | amino acid zwitterion; epsilon-amino acid; omega-amino fatty acid | antifibrinolytic drug; hematologic agent; metabolite |
dihydrouracil | [no description available] | low | 0 | 0 | pyrimidone | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
dihydroxyacetone | [no description available] | low | 0 | 0 | ketotriose; primary alpha-hydroxy ketone | antifungal agent; Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
dimethylamine | [no description available] | low | 0 | 0 | methylamines; secondary aliphatic amine | metabolite |
glycolic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; primary alcohol | keratolytic drug; metabolite |
hydantoin-5-propionic acid | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; monocarboxylic acid | metabolite; mouse metabolite |
niacinamide | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinecarboxamide; vitamin B3 | anti-inflammatory agent; antioxidant; cofactor; EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; Escherichia coli metabolite; geroprotector; human urinary metabolite; metabolite; mouse metabolite; neuroprotective agent; Saccharomyces cerevisiae metabolite; Sir2 inhibitor |
niacin | [no description available] | low | 0 | 0 | pyridine alkaloid; pyridinemonocarboxylic acid; vitamin B3 | antidote; antilipemic drug; EC 3.5.1.19 (nicotinamidase) inhibitor; Escherichia coli metabolite; human urinary metabolite; metabolite; mouse metabolite; plant metabolite; vasodilator agent |
orotic acid | [no description available] | low | 0 | 0 | pyrimidinemonocarboxylic acid | Escherichia coli metabolite; metabolite; mouse metabolite |
oxaloacetic acid | [no description available] | low | 0 | 0 | C4-dicarboxylic acid; oxo dicarboxylic acid | geroprotector; metabolite |
porphobilinogen | [no description available] | low | 0 | 0 | aralkylamino compound; dicarboxylic acid; pyrroles | Escherichia coli metabolite; metabolite; mouse metabolite |
1-propanol | [no description available] | low | 0 | 0 | propan-1-ols; short-chain primary fatty alcohol | metabolite; protic solvent |
trimethyloxamine | [no description available] | low | 0 | 0 | tertiary amine oxide | Escherichia coli metabolite; metabolite; osmolyte |
6-hydroxymelatonin | [no description available] | low | 0 | 0 | acetamides; tryptamines | metabolite; mouse metabolite |
n-acetylphenylalanine | [no description available] | low | 0 | 0 | N-acetyl-amino acid; phenylalanine derivative | antidepressant; metabolite |
n-acetyltryptophan | [no description available] | low | 0 | 0 | N-acetyl-amino acid; tryptophan derivative | metabolite |
arecoline | [no description available] | low | 0 | 0 | enoate ester; methyl ester; pyridine alkaloid; tetrahydropyridine | metabolite; muscarinic agonist |
aristolochic acid i | [no description available] | low | 0 | 0 | aristolochic acids; aromatic ether; C-nitro compound; cyclic acetal; monocarboxylic acid; organic heterotetracyclic compound | carcinogenic agent; metabolite; mutagen; nephrotoxin; toxin |
berberine | [no description available] | low | 0 | 0 | alkaloid antibiotic; berberine alkaloid; botanical anti-fungal agent; organic heteropentacyclic compound | antilipemic drug; antineoplastic agent; antioxidant; EC 1.1.1.141 [15-hydroxyprostaglandin dehydrogenase (NAD(+))] inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.13.11.52 (indoleamine 2,3-dioxygenase) inhibitor; EC 1.21.3.3 (reticuline oxidase) inhibitor; EC 2.1.1.116 [3'-hydroxy-N-methyl-(S)-coclaurine 4'-O-methyltransferase] inhibitor; EC 2.1.1.122 [(S)-tetrahydroprotoberberine N-methyltransferase] inhibitor; EC 2.7.11.10 (IkappaB kinase) inhibitor; EC 3.1.1.4 (phospholipase A2) inhibitor; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.1.1.8 (cholinesterase) inhibitor; EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor; EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor; EC 3.4.21.26 (prolyl oligopeptidase) inhibitor; geroprotector; hypoglycemic agent; metabolite; potassium channel blocker |
dibutyl phthalate | [no description available] | low | 0 | 0 | diester; phthalate ester | EC 3.2.1.20 (alpha-glucosidase) inhibitor; environmental contaminant; metabolite; plasticiser; teratogenic agent |
hydroxymethyltolbutamide | [no description available] | low | 0 | 0 | benzyl alcohols; sulfonamide; ureas | metabolite |
methyl salicylate | [no description available] | low | 0 | 0 | benzoate ester; methyl ester; salicylates | flavouring agent; insect attractant; metabolite |
myristicin | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
phenmetrazine | [no description available] | low | 0 | 0 | morpholines | metabolite; sympathomimetic agent |
phenylbutazone | [no description available] | low | 0 | 0 | pyrazolidines | antirheumatic drug; EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; peripheral nervous system drug |
safrole | [no description available] | low | 0 | 0 | benzodioxoles | flavouring agent; insecticide; metabolite; plant metabolite |
2,2'-thiodiethanol | [no description available] | low | 0 | 0 | aliphatic sulfide; diol | antineoplastic agent; antioxidant; metabolite; solvent |
sorbitol | [no description available] | low | 0 | 0 | glucitol | cathartic; Escherichia coli metabolite; food humectant; human metabolite; laxative; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite; sweetening agent |
alloxan | [no description available] | low | 0 | 0 | pyrimidone | hyperglycemic agent; metabolite |
thymidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
glutamine | [no description available] | low | 0 | 0 | amino acid zwitterion; glutamine family amino acid; glutamine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
allyl isothiocyanate | [no description available] | low | 0 | 0 | alkenyl isothiocyanate; isothiocyanate | antimicrobial agent; antineoplastic agent; apoptosis inducer; lachrymator; metabolite |
n-methyltryptamine | [no description available] | low | 0 | 0 | tryptamine alkaloid; tryptamines | metabolite |
4-deoxypyridoxine | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine | metabolite |
cycloserine | [no description available] | low | 0 | 0 | 4-amino-1,2-oxazolidin-3-one; organonitrogen heterocyclic antibiotic; organooxygen heterocyclic antibiotic; zwitterion | antiinfective agent; antimetabolite; antitubercular agent; metabolite; NMDA receptor agonist |
17-alpha-hydroxyprogesterone | [no description available] | low | 0 | 0 | 17alpha-hydroxy-C21-steroid; 17alpha-hydroxy steroid; tertiary alpha-hydroxy ketone | human metabolite; metabolite; mouse metabolite; progestin |
mannitol | [no description available] | low | 0 | 0 | mannitol | allergen; antiglaucoma drug; compatible osmolytes; Escherichia coli metabolite; food anticaking agent; food bulking agent; food humectant; food stabiliser; food thickening agent; hapten; metabolite; osmotic diuretic; sweetening agent |
phenacyl bromide | [no description available] | low | 0 | 0 | acetophenones; alpha-bromoketone | metabolite |
trichloroacetic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; organochlorine compound | carcinogenic agent; metabolite; mouse metabolite |
acrylic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid | metabolite |
n-methylacetamide | [no description available] | low | 0 | 0 | acetamides; monocarboxylic acid amide | metabolite |
bis(4-hydroxyphenyl)sulfone | [no description available] | low | 0 | 0 | bisphenol; sulfone | endocrine disruptor; metabolite |
rotenone | [no description available] | low | 0 | 0 | organic heteropentacyclic compound; rotenones | antineoplastic agent; metabolite; mitochondrial NADH:ubiquinone reductase inhibitor; phytogenic insecticide; piscicide; toxin |
7-amino-4-hydroxy-2-naphthalenesulfonic acid | [no description available] | low | 0 | 0 | aminonaphthalenesulfonic acid; naphthols | metabolite |
methyl benzoate | [no description available] | low | 0 | 0 | benzoate ester; methyl ester | insect attractant; metabolite |
2-dichlorobenzene | [no description available] | low | 0 | 0 | dichlorobenzene | hepatotoxic agent; metabolite |
2,4-diaminotoluene | [no description available] | low | 0 | 0 | aminotoluene | metabolite |
4-butyrolactone | [no description available] | low | 0 | 0 | butan-4-olide | metabolite; neurotoxin |
sulfosalicylic acid | [no description available] | low | 0 | 0 | arenesulfonic acid; benzoic acids; phenols | metabolite |
ethyl lactate | [no description available] | low | 0 | 0 | ethyl ester; lactate ester; secondary alcohol | metabolite |
furaldehyde | [no description available] | low | 0 | 0 | aldehyde; furans | Maillard reaction product; metabolite |
thiophene-2-carboxaldehyde | [no description available] | low | 0 | 0 | aldehyde; thiophenes | metabolite |
alpha-resorcylic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid; resorcinols | metabolite |
methylenebis(chloroaniline) | [no description available] | low | 0 | 0 | chloroaniline | metabolite |
2-phenylethyl acetate | [no description available] | low | 0 | 0 | acetate ester | metabolite; Saccharomyces cerevisiae metabolite |
dibenzyl ether | [no description available] | low | 0 | 0 | benzyl ether | metabolite |
ethyl propionate | [no description available] | low | 0 | 0 | propanoate ester | metabolite |
citronellal | [no description available] | low | 0 | 0 | aldehyde; monoterpenoid | antifungal agent; metabolite |
ethyl oenanthate | [no description available] | low | 0 | 0 | fatty acid ethyl ester | metabolite |
ethyl caprylate | [no description available] | low | 0 | 0 | fatty acid ethyl ester; octanoate ester | metabolite |
ethyl laurate | [no description available] | low | 0 | 0 | fatty acid ethyl ester | metabolite |
acetic anhydride | [no description available] | low | 0 | 0 | acyclic carboxylic anhydride | metabolite; reagent |
ethyl isovalerate | [no description available] | low | 0 | 0 | fatty acid ethyl ester; olefinic compound | metabolite |
n-butyl n-butyrate | [no description available] | low | 0 | 0 | butyrate ester | metabolite |
ethyl decanoate | [no description available] | low | 0 | 0 | decanoate ester; fatty acid ethyl ester | metabolite |
methyl octanoate | [no description available] | low | 0 | 0 | fatty acid methyl ester; octanoate ester | metabolite |
2-octanone | [no description available] | low | 0 | 0 | methyl ketone | metabolite |
hexylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | metabolite |
lauric acid methyl ester | [no description available] | low | 0 | 0 | dodecanoate ester; fatty acid methyl ester | metabolite |
octylamine | [no description available] | low | 0 | 0 | primary aliphatic amine | metabolite |
n-decyl alcohol | [no description available] | low | 0 | 0 | decanol; primary alcohol | metabolite; pheromone; protic solvent |
methyl palmitate | [no description available] | low | 0 | 0 | fatty acid methyl ester | metabolite |
maltol | [no description available] | low | 0 | 0 | 4-pyranones | metabolite |
chloranil | [no description available] | low | 0 | 0 | 1,4-benzoquinones; organochlorine compound | EC 2.7.1.33 (pantothenate kinase) inhibitor; metabolite |
dibenzoylmethane | [no description available] | low | 0 | 0 | aromatic ketone; beta-diketone | antimutagen; antineoplastic agent; metabolite |
methyl anthranilate | [no description available] | low | 0 | 0 | benzoate ester | flavouring agent; metabolite |
benzyl acetate | [no description available] | low | 0 | 0 | acetate ester; benzyl ester | metabolite |
ethyl acetate | [no description available] | low | 0 | 0 | acetate ester; ethyl ester; volatile organic compound | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor; metabolite; polar aprotic solvent; Saccharomyces cerevisiae metabolite |
dibenzyl disulfide | [no description available] | low | 0 | 0 | organic aromatic compound; organic disulfide | metabolite |
mequinol | [no description available] | low | 0 | 0 | methoxybenzenes; phenols | metabolite |
gamma-resorcylic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid | metabolite |
kynuramine | [no description available] | low | 0 | 0 | kynurenamines; primary amino compound | metabolite |
5-methylpyrazole-3-carboxylic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; pyrazoles | metabolite |
4-trifluoromethylaniline | [no description available] | low | 0 | 0 | (trifluoromethyl)benzenes; substituted aniline | metabolite |
methylguanidine | [no description available] | low | 0 | 0 | guanidines | EC 1.14.13.39 (nitric oxide synthase) inhibitor; metabolite; uremic toxin |
liriodenine | [no description available] | low | 0 | 0 | alkaloid antibiotic; cyclic ketone; organic heteropentacyclic compound; oxacycle; oxoaporphine alkaloid | antifungal agent; antimicrobial agent; antineoplastic agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
plumbagin | [no description available] | low | 0 | 0 | hydroxy-1,4-naphthoquinone; phenols | anticoagulant; antineoplastic agent; immunological adjuvant; metabolite |
imperatorin | [no description available] | low | 0 | 0 | psoralens | EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite |
osthol | [no description available] | low | 0 | 0 | botanical anti-fungal agent; coumarins | metabolite |
Dillapiole | [no description available] | low | 0 | 0 | benzodioxoles | metabolite |
coumaran | [no description available] | low | 0 | 0 | 1-benzofurans | metabolite |
1,3-propanediol | [no description available] | low | 0 | 0 | propane-1,3-diols | metabolite; protic solvent |
tridecanedioic acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid | metabolite |
physcione | [no description available] | low | 0 | 0 | dihydroxyanthraquinone | anti-inflammatory agent; antibacterial agent; antifungal agent; antineoplastic agent; apoptosis inducer; hepatoprotective agent; metabolite |
apiole | [no description available] | low | 0 | 0 | benzodioxoles | metabolite |
flavone | [no description available] | low | 0 | 0 | flavones | metabolite; nematicide |
cetyl palmitate | [no description available] | low | 0 | 0 | hexadecanoate ester | metabolite |
n-amyl butyrate | [no description available] | low | 0 | 0 | butyrate ester | metabolite |
3-aminobutyric acid | [no description available] | low | 0 | 0 | amino acid zwitterion; beta-amino acid; monocarboxylic acid | metabolite |
methyl lactate | [no description available] | low | 0 | 0 | lactate ester; methyl ester | metabolite |
paeonol | [no description available] | low | 0 | 0 | methoxybenzenes; phenols | metabolite |
2,2-dimethylbutyric acid | [no description available] | low | 0 | 0 | dimethylbutyric acid | metabolite |
2-chloroacrylic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; chlorocarboxylic acid | metabolite |
galactitol | [no description available] | low | 0 | 0 | hexitol | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite |
1-methyluracil | [no description available] | low | 0 | 0 | nucleobase analogue; pyrimidone | metabolite |
2-pyrrolidone | [no description available] | low | 0 | 0 | pyrrolidin-2-ones | metabolite; polar solvent |
n-ethylacetamide | [no description available] | low | 0 | 0 | acetamides | metabolite |
6-methyluracil | [no description available] | low | 0 | 0 | pyrimidone | metabolite |
3-methylglutaric acid | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid | metabolite |
amyl acetate | [no description available] | low | 0 | 0 | acetate ester | metabolite |
dibenzothiophene 5-oxide | [no description available] | low | 0 | 0 | dibenzothiophenes | metabolite |
2-acetamidoethanethiol | [no description available] | low | 0 | 0 | acetamides | metabolite |
2-hydroxyquinoxaline | [no description available] | low | 0 | 0 | hydroxyquinoxaline | metabolite |
3,4-dihydroxyacetophenone | [no description available] | low | 0 | 0 | acetophenones; catechols; dihydroxyacetophenone | metabolite |
methyl hippurate | [no description available] | low | 0 | 0 | glycine derivative; methyl ester | metabolite |
isobarbaloin | [no description available] | low | 0 | 0 | anthracenes; C-glycosyl compound; cyclic ketone; phenols | laxative; metabolite |
vincamine | [no description available] | low | 0 | 0 | alkaloid ester; hemiaminal; methyl ester; organic heteropentacyclic compound; vinca alkaloid | antihypertensive agent; metabolite; vasodilator agent |
methyl tert-butyl ether | [no description available] | low | 0 | 0 | ether | fuel additive; metabolite; non-polar solvent |
4-octylphenol | [no description available] | low | 0 | 0 | phenols | metabolite; surfactant; xenoestrogen |
dronabinol | [no description available] | low | 0 | 0 | benzochromene; diterpenoid; phytocannabinoid; polyketide | cannabinoid receptor agonist; epitope; hallucinogen; metabolite; non-narcotic analgesic |
phenethyl isothiocyanate | [no description available] | low | 0 | 0 | isothiocyanate | antineoplastic agent; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; metabolite |
2-methoxy-1,4-naphthoquinone | [no description available] | low | 0 | 0 | 1,4-naphthoquinones; enol ether | antimicrobial agent; metabolite; plant metabolite |
aviprin | [no description available] | low | 0 | 0 | furanocoumarin | metabolite |
hydroxyphenytoin | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; phenols | metabolite |
squaric acid | [no description available] | low | 0 | 0 | alicyclic ketone; carbon oxoacid | metabolite |
methyl methanethiosulfonate | [no description available] | low | 0 | 0 | sulfonic acid derivative; thiosulfonate ester | metabolite |
arabinofuranosyluracil | [no description available] | low | 0 | 0 | N-glycosyl compound | metabolite |
6-aminonicotinic acid | [no description available] | low | 0 | 0 | aminonicotinic acid; aminopyridine; aromatic amine | metabolite |
mannose | [no description available] | low | 0 | 0 | D-aldohexose; D-mannose; mannopyranose | metabolite |
2,3-hexanedione | [no description available] | low | 0 | 0 | alpha-diketone | metabolite |
tabersonine | [no description available] | low | 0 | 0 | alkaloid ester; methyl ester; monoterpenoid indole alkaloid; organic heteropentacyclic compound | antineoplastic agent; metabolite |
3,3-dimethylglutarate | [no description available] | low | 0 | 0 | alpha,omega-dicarboxylic acid | metabolite |
raspberry ketone | [no description available] | low | 0 | 0 | methyl ketone; phenols | androgen antagonist; cosmetic; flavouring agent; fragrance; hepatoprotective agent; metabolite |
laurolitsine | [no description available] | low | 0 | 0 | aporphine alkaloid; aromatic ether; phenols | HIV-1 integrase inhibitor; metabolite |
helenalin | [no description available] | low | 0 | 0 | cyclic ketone; gamma-lactone; organic heterotricyclic compound; secondary alcohol; sesquiterpene lactone | anti-inflammatory agent; antineoplastic agent; metabolite; plant metabolite |
diethyl malate | [no description available] | low | 0 | 0 | malate ester | metabolite |
carbendazim | [no description available] | low | 0 | 0 | benzimidazole fungicide; benzimidazoles; benzimidazolylcarbamate fungicide; carbamate ester | antifungal agrochemical; antinematodal drug; metabolite; microtubule-destabilising agent |
glucoheptonate | [no description available] | low | 0 | 0 | carbohydrate acid; monocarboxylic acid | metabolite |
deslanoside | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 14beta-hydroxy steroid; cardenolide glycoside; tetrasaccharide derivative | anti-arrhythmia drug; cardiotonic drug; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; metabolite |
streptozocin | [no description available] | low | 0 | 0 | N-acylglucosamine; N-nitrosoureas | antimicrobial agent; antineoplastic agent; DNA synthesis inhibitor; metabolite |
pedalitin | [no description available] | low | 0 | 0 | monomethoxyflavone; tetrahydroxyflavone | EC 1.17.3.2 (xanthine oxidase) inhibitor; metabolite |
ethyl nonanoate | [no description available] | low | 0 | 0 | fatty acid ethyl ester | metabolite |
ethyl hexanoate | [no description available] | low | 0 | 0 | fatty acid ethyl ester; hexanoate ester | metabolite |
butyl acetate | [no description available] | low | 0 | 0 | acetate ester | metabolite |
1,4-dioxane | [no description available] | low | 0 | 0 | dioxane; volatile organic compound | carcinogenic agent; metabolite; NMR chemical shift reference compound; non-polar solvent |
isoamyl acetate | [no description available] | low | 0 | 0 | acetate ester | metabolite; Saccharomyces cerevisiae metabolite |
ribostamycin | [no description available] | low | 0 | 0 | amino cyclitol glycoside; aminoglycoside antibiotic | antibacterial drug; antimicrobial agent; metabolite |
tramadol | [no description available] | low | 0 | 0 | 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol | adrenergic uptake inhibitor; antitussive; capsaicin receptor antagonist; delta-opioid receptor agonist; kappa-opioid receptor agonist; metabolite; mu-opioid receptor agonist; muscarinic antagonist; nicotinic antagonist; NMDA receptor antagonist; opioid analgesic; serotonergic antagonist; serotonin uptake inhibitor |
6-pentylpyrone | [no description available] | low | 0 | 0 | 2-pyranones | metabolite |
paclitaxel | [no description available] | low | 0 | 0 | taxane diterpenoid; tetracyclic diterpenoid | antineoplastic agent; human metabolite; metabolite; microtubule-stabilising agent |
4-methylhistamine | [no description available] | low | 0 | 0 | aralkylamino compound; imidazoles | histamine agonist; metabolite |
perfosfamide | [no description available] | low | 0 | 0 | nitrogen mustard; organochlorine compound; peroxol; phosphorodiamide | alkylating agent; antineoplastic agent; drug allergen; immunosuppressive agent; metabolite |
castanospermine | [no description available] | low | 0 | 0 | indolizidine alkaloid | anti-HIV-1 agent; anti-inflammatory agent; EC 3.2.1.* (glycosidase) inhibitor; metabolite |
pravastatin | [no description available] | low | 0 | 0 | 3-hydroxy carboxylic acid; carbobicyclic compound; carboxylic ester; hydroxy monocarboxylic acid; secondary alcohol; statin (semi-synthetic) | anticholesteremic drug; environmental contaminant; metabolite; xenobiotic |
3-methyl-2-butenal | [no description available] | low | 0 | 0 | enal | metabolite |
ethyl 3-hydroxybutyrate | [no description available] | low | 0 | 0 | fatty acid ethyl ester | metabolite |
4,5-dimethyl-3-hydroxy-2(5h)-furanone | [no description available] | low | 0 | 0 | butenolide | metabolite |
n-methylnicotinamide | [no description available] | low | 0 | 0 | pyridinecarboxamide | metabolite |
3-aminoisobutyric acid | [no description available] | low | 0 | 0 | amino acid zwitterion; beta-amino acid | metabolite |
platanic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; methyl ketone; pentacyclic triterpenoid | anti-HIV agent; metabolite |
2'-deoxyuridylic acid | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
gallocatechol | [no description available] | low | 0 | 0 | gallocatechin | antioxidant; metabolite; radical scavenger |
1-methylinosine | [no description available] | low | 0 | 0 | inosines | metabolite |
dihydrobetulinic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-HIV agent; antileishmanial agent; EC 5.99.1.2 (DNA topoisomerase) inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; metabolite |
bergenin | [no description available] | low | 0 | 0 | trihydroxybenzoic acid | metabolite |
2-methoxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 3-hydroxy steroid | angiogenesis modulating agent; antimitotic; antineoplastic agent; human metabolite; metabolite; mouse metabolite |
3'-cmp | [no description available] | low | 0 | 0 | cytidine 3'-phosphate; pyrimidine ribonucleoside 3'-monophosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
xanthoxyletin | [no description available] | low | 0 | 0 | coumarins | metabolite |
pinocembrin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; dihydroxyflavanone | antineoplastic agent; antioxidant; metabolite; neuroprotective agent; vasodilator agent |
orsellinic acid | [no description available] | low | 0 | 0 | dihydroxybenzoic acid; resorcinols | fungal metabolite; marine metabolite; metabolite |
isoimperatorin | [no description available] | low | 0 | 0 | psoralens | EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite |
rotenolone | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
seselin | [no description available] | low | 0 | 0 | coumarins | metabolite |
perillene | [no description available] | low | 0 | 0 | furans; monoterpenoid | fragrance; metabolite; semiochemical |
glycine methyl ester | [no description available] | low | 0 | 0 | glycinyl ester | metabolite |
hexadecanamide | [no description available] | low | 0 | 0 | primary fatty amide | metabolite |
benzocyclobutene | [no description available] | low | 0 | 0 | carbobicyclic compound | metabolite |
9-methyladenine | [no description available] | low | 0 | 0 | methyladenine | metabolite |
n'-methyl-2-pyridone-5-carboxamide | [no description available] | low | 0 | 0 | methylpyridines; pyridinecarboxamide; pyridone | metabolite; mouse metabolite |
1,3-dimethyluracil | [no description available] | low | 0 | 0 | pyrimidone | metabolite |
3-methoxysalicylic acid | [no description available] | low | 0 | 0 | methoxysalicylic acid | metabolite |
1,3-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | metabolite |
leucyltyrosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
3-methylxanthine | [no description available] | low | 0 | 0 | 3-methylxanthine | metabolite |
leucyl-glycyl-glycine | [no description available] | low | 0 | 0 | tripeptide | metabolite |
acetylleucine | [no description available] | low | 0 | 0 | L-leucine derivative; N-acetyl-L-amino acid | metabolite |
n-benzoylalanine, (dl-ala)-isomer | [no description available] | low | 0 | 0 | alanine derivative; N-acyl-amino acid | metabolite |
dipropylacetamide | [no description available] | low | 0 | 0 | fatty amide | geroprotector; metabolite; teratogenic agent |
masoprocol | [no description available] | low | 0 | 0 | nordihydroguaiaretic acid | antineoplastic agent; hypoglycemic agent; lipoxygenase inhibitor; metabolite |
7-methyladenine | [no description available] | low | 0 | 0 | methyladenine | metabolite |
acetylisoniazid | [no description available] | low | 0 | 0 | carbohydrazide | metabolite |
illimaquinone | [no description available] | low | 0 | 0 | monohydroxy-1,4-benzoquinones; prenylquinone | metabolite |
coptisine | [no description available] | low | 0 | 0 | alkaloid | metabolite |
betulin | [no description available] | low | 0 | 0 | diol; pentacyclic triterpenoid | analgesic; anti-inflammatory agent; antineoplastic agent; antiviral agent; metabolite |
narciclasine | [no description available] | low | 0 | 0 | phenanthridines | metabolite |
lividomycin | [no description available] | low | 0 | 0 | lividomycins | metabolite |
dmp 323 | [no description available] | low | 0 | 0 | diazepanone; ureas | anti-HIV agent; metabolite |
eupolauridine | [no description available] | low | 0 | 0 | naphthyridine derivative | metabolite |
zaluzanin C | [no description available] | low | 0 | 0 | gamma-lactone; guaiane sesquiterpenoid; organic heterotricyclic compound; secondary alcohol; sesquiterpene lactone | EC 1.14.13.39 (nitric oxide synthase) inhibitor; metabolite |
2-aminonicotinic acid | [no description available] | low | 0 | 0 | aminonicotinic acid; aminopyridine | metabolite |
(-)-catechin | [no description available] | low | 0 | 0 | catechin | metabolite |
dehydrocostus lactone | [no description available] | low | 0 | 0 | gamma-lactone; guaiane sesquiterpenoid; organic heterotricyclic compound; sesquiterpene lactone | antimycobacterial drug; antineoplastic agent; apoptosis inducer; cyclooxygenase 2 inhibitor; metabolite; trypanocidal drug |
Tormentic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
pinobanksin | [no description available] | low | 0 | 0 | secondary alpha-hydroxy ketone; trihydroxyflavanone | antimutagen; antioxidant; metabolite |
sigmoidin a | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; tetrahydroxyflavanone | anti-inflammatory agent; anti-obesity agent; antibacterial agent; metabolite; radical scavenger |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-monophosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; metabolite; mouse metabolite |
monotropein | [no description available] | low | 0 | 0 | beta-D-glucoside; cyclopentapyran; iridoid monoterpenoid; monocarboxylic acid; monosaccharide derivative | anti-inflammatory agent; metabolite |
glycyl-histidyl-lysine | [no description available] | low | 0 | 0 | tripeptide | chelator; hepatoprotective agent; metabolite; vulnerary |
homoeriodictyol | [no description available] | low | 0 | 0 | 3'-methoxyflavanones; 4'-hydroxyflavanones; monomethoxyflavanone; trihydroxyflavanone | flavouring agent; metabolite |
arjunolic acid | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; pentacyclic triterpenoid | antibacterial agent; antifungal agent; antioxidant; metabolite |
oxazolidin-2-one | [no description available] | low | 0 | 0 | carbamate ester; oxazolidinone | metabolite |
monoethyl phthalate | [no description available] | low | 0 | 0 | ethyl ester; phthalic acid monoester | metabolite |
methylimidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | GABA agonist; metabolite |
2-(2-aminoethyl)pyridine | [no description available] | low | 0 | 0 | aminoalkylpyridine; primary amine | histamine agonist; metabolite |
xanthurenic acid 8-methyl ether | [no description available] | low | 0 | 0 | aromatic ether; monohydroxyquinoline; quinolinemonocarboxylic acid | carcinogenic agent; metabolite; mouse metabolite |
methyl orsellinate | [no description available] | low | 0 | 0 | hydroxybenzoic acid | metabolite |
2,2-di(4-methacryloxyphenyl)propane | [no description available] | low | 0 | 0 | bisphenol; enoate ester | metabolite |
sofosbuvir | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic carboxylic acid; nucleobase analogue; pyrimidone | metabolite |
3-methyluracil | [no description available] | low | 0 | 0 | nucleobase analogue; pyrimidone | metabolite |
1-methylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; methylcytosine; pyrimidone | metabolite |
leucyl-alanine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
leucyl-leucyl-leucine | [no description available] | low | 0 | 0 | tripeptide | metabolite |
3,4-dihydroxyphenylethanol | [no description available] | low | 0 | 0 | catechols; primary alcohol | antineoplastic agent; antioxidant; metabolite |
3,7-dimethyluric acid | [no description available] | low | 0 | 0 | oxopurine | metabolite; mouse metabolite |
alanylproline | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
d-biotin-d-sulfoxide | [no description available] | low | 0 | 0 | biotins; sulfoxide | metabolite |
biotin sulfone | [no description available] | low | 0 | 0 | biotins; sulfone | metabolite |
asperuloside | [no description available] | low | 0 | 0 | acetate ester; beta-D-glucoside; gamma-lactone; iridoid monoterpenoid; monosaccharide derivative | metabolite |
primin | [no description available] | low | 0 | 0 | 1,4-benzoquinones | allergen; antifeedant; antimicrobial agent; hapten; metabolite |
2-(hydroxymethyl)anthraquinone | [no description available] | low | 0 | 0 | anthraquinone | metabolite |
tyrosylleucine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
o-methylserine | [no description available] | low | 0 | 0 | L-serine derivative; non-proteinogenic L-alpha-amino acid | metabolite |
cinchonine | [no description available] | low | 0 | 0 | (8xi)-cinchonan-9-ol; cinchona alkaloid | metabolite |
aucubin | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
catalpol | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
3,4-dihydroxyphenylglycol | [no description available] | low | 0 | 0 | catechols; tetrol | metabolite; mouse metabolite |
2-methylhistamine | [no description available] | low | 0 | 0 | aralkylamino compound; imidazoles | histamine agonist; metabolite |
2-methylhippuric acid | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
taraxerol | [no description available] | low | 0 | 0 | pentacyclic triterpenoid; secondary alcohol | metabolite |
alpha-peltatin | [no description available] | low | 0 | 0 | furonaphthodioxole; gamma-lactone; lignan; organic heterotetracyclic compound; phenols | antineoplastic agent; metabolite |
3-acetyllupeol | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
lupenone | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
glycyltryptophan | [no description available] | low | 0 | 0 | dipeptide | metabolite |
monocerin | [no description available] | low | 0 | 0 | hydroxybenzoic acid | metabolite |
propionyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
alpha-hydroxyisocaproic acid | [no description available] | low | 0 | 0 | 2-hydroxy fatty acid; branched-chain fatty acid | metabolite |
totarol | [no description available] | low | 0 | 0 | diterpenoid | metabolite |
taraxerone | [no description available] | low | 0 | 0 | scalarane sesterterpenoid | metabolite |
prunin protein, prunus | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; flavanone 7-O-beta-D-glucoside; monosaccharide derivative | antibacterial agent; antilipemic drug; hypoglycemic agent; metabolite |
uvaol | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
glycyltyrosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
glycylleucine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
alanyltyrosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
glycyl-l-phenylalanine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | human metabolite; metabolite |
digoxigenin-mono(digitoxoside) | [no description available] | low | 0 | 0 | cardenolide glycoside; digitoxoside; monosaccharide derivative; steroid saponin | metabolite |
thiazolidine-4-carboxylic acid, (r)-isomer | [no description available] | low | 0 | 0 | thiazolidinemonocarboxylic acid; thioproline | geroprotector; metabolite |
5,6-dihydrothymine | [no description available] | low | 0 | 0 | pyrimidone | human metabolite; metabolite; mouse metabolite |
dehydroabietic acid | [no description available] | low | 0 | 0 | abietane diterpenoid; carbotricyclic compound; monocarboxylic acid | allergen; metabolite |
palmitone | [no description available] | low | 0 | 0 | dialkyl ketone | anticonvulsant; metabolite |
1-methylthymine | [no description available] | low | 0 | 0 | methylthymine | metabolite |
imidazoleacetic acid | [no description available] | low | 0 | 0 | imidazoles; monocarboxylic acid | metabolite; mouse metabolite |
1-methylguanosine | [no description available] | low | 0 | 0 | methylguanosine | metabolite |
alanylphenylalanine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
murrayanine | [no description available] | low | 0 | 0 | carbazoles | metabolite |
girinimbine | [no description available] | low | 0 | 0 | carbazoles | metabolite |
tryptophylglycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
canthin-6-one | [no description available] | low | 0 | 0 | enone; indole alkaloid; organic heterotetracyclic compound | antimycobacterial drug; metabolite |
glycylaspartic acid | [no description available] | low | 0 | 0 | dipeptide | metabolite |
4-methylhippuric acid | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
delta(9)-tetrahydrocannabinolic acid | [no description available] | low | 0 | 0 | benzochromene; diterpenoid; hydroxy monocarboxylic acid; phytocannabinoid; polyketide | anti-inflammatory agent; biomarker; metabolite; neuroprotective agent |
3-methylhippuric acid | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
n-glycylglutamic acid | [no description available] | low | 0 | 0 | dipeptide | metabolite |
n-caproylglycine | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
diosgenin | [no description available] | low | 0 | 0 | 3beta-sterol; hexacyclic triterpenoid; sapogenin; spiroketal | antineoplastic agent; antiviral agent; apoptosis inducer; metabolite |
s-2-aminoethyl cysteine | [no description available] | low | 0 | 0 | L-cysteine thioether; non-proteinogenic L-alpha-amino acid | EC 5.4.3.2 (lysine 2,3-aminomutase) inhibitor; metabolite; protein synthesis inhibitor |
4-hydroxycyclophosphamide | [no description available] | low | 0 | 0 | nitrogen mustard; organochlorine compound; phosphorodiamide | alkylating agent; metabolite |
alpha-glutamyltryptophan | [no description available] | low | 0 | 0 | dipeptide | angiogenesis modulating agent; antineoplastic agent; immunomodulator; metabolite |
malabaricone c | [no description available] | low | 0 | 0 | butanone | metabolite |
loliolide | [no description available] | low | 0 | 0 | benzofurans | metabolite |
tuberostemonine | [no description available] | low | 0 | 0 | alkaloid | metabolite |
pyrrole-3-carboxylic acid | [no description available] | low | 0 | 0 | pyrrolecarboxylic acid | metabolite; Penicillium metabolite |
histidylglycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
histidinoalanine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
cinchonidine | [no description available] | low | 0 | 0 | (8xi)-cinchonan-9-ol; cinchona alkaloid | metabolite |
quillaic acid | [no description available] | low | 0 | 0 | aldehyde; hydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-inflammatory agent; metabolite |
p-methoxy-n-methylphenethylamine | [no description available] | low | 0 | 0 | aromatic ether; secondary amino compound | metabolite |
ecgonine methyl ester | [no description available] | low | 0 | 0 | methyl ester; tertiary amino compound; tropane alkaloid | analgesic; central nervous system depressant; metabolite; mouse metabolite; opioid analgesic; peripheral nervous system drug |
n-acetylcytidine | [no description available] | low | 0 | 0 | acetamides; cytidines; secondary carboxamide | metabolite |
4-hydroxydebrisoquin | [no description available] | low | 0 | 0 | carboxamidine; isoquinolines; secondary alcohol | metabolite |
hypotaurine | [no description available] | low | 0 | 0 | aminosulfinic acid; zwitterion | human metabolite; metabolite; mouse metabolite |
hc toxin | [no description available] | low | 0 | 0 | homodetic cyclic peptide; tetrapeptide | antineoplastic agent; EC 3.5.1.98 (histone deacetylase) inhibitor; metabolite; phytotoxin |
epicatechin gallate | [no description available] | low | 0 | 0 | catechin; gallate ester; polyphenol | EC 3.2.1.1 (alpha-amylase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
versiconal hemiacetal acetate | [no description available] | low | 0 | 0 | acetate ester; anthrafuran; lactol; palmitoyl amino acid; polyphenol | metabolite |
coprine | [no description available] | low | 0 | 0 | cyclopropanes; dicarboxylic acid monoamide; L-glutamine derivative; non-proteinogenic L-alpha-amino acid | EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; metabolite; mycotoxin |
aristolochic acid ii | [no description available] | low | 0 | 0 | aristolochic acids; aromatic ether; C-nitro compound; cyclic acetal; monocarboxylic acid; organic heterotetracyclic compound | carcinogenic agent; metabolite; mutagen; nephrotoxin; toxin |
exp3174 | [no description available] | low | 0 | 0 | biphenylyltetrazole; imidazoles; organochlorine compound | metabolite |
ribonolactone | [no description available] | low | 0 | 0 | butan-4-olide; ribonolactone | metabolite |
sulfamethoxazole hydroxylamine | [no description available] | low | 0 | 0 | isoxazoles; sulfonamide | allergen; metabolite |
androsterone glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; steroid glucosiduronic acid | human metabolite; metabolite; mouse metabolite |
tephrosin | [no description available] | low | 0 | 0 | aromatic ether; cyclic ketone; organic heteropentacyclic compound; rotenones | antineoplastic agent; metabolite; pesticide |
sapintoxin d | [no description available] | low | 0 | 0 | phorbol ester; tertiary alpha-hydroxy ketone | fluorescent probe; metabolite |
amarogentin | [no description available] | low | 0 | 0 | monosaccharide derivative; secoiridoid glycoside | EC 5.99.1.2 (DNA topoisomerase) inhibitor; metabolite |
taraxasterol | [no description available] | low | 0 | 0 | pentacyclic triterpenoid; secondary alcohol | anti-inflammatory agent; metabolite |
asiatic acid | [no description available] | low | 0 | 0 | monocarboxylic acid; pentacyclic triterpenoid; triol | angiogenesis modulating agent; metabolite |
flavoglaucin | [no description available] | low | 0 | 0 | hydroquinones | metabolite |
1-(6-hydroxy-2-isopropenyl-1-benzofuran-5-yl)-1-ethanone | [no description available] | low | 0 | 0 | benzofurans | metabolite |
dioscin | [no description available] | low | 0 | 0 | hexacyclic triterpenoid; spiroketal; spirostanyl glycoside; trisaccharide derivative | anti-inflammatory agent; antifungal agent; antineoplastic agent; antiviral agent; apoptosis inducer; EC 1.14.18.1 (tyrosinase) inhibitor; hepatoprotective agent; metabolite |
maculosin | [no description available] | low | 0 | 0 | dipeptide; homodetic cyclic peptide; phenols; pyrrolopyrazine | metabolite |
n(4)-methylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; methylcytosine; pyrimidone | metabolite |
n-acetylputrescine | [no description available] | low | 0 | 0 | N-monoacetylalkane-alpha,omega-diamine; N-substituted putrescine | metabolite; mouse metabolite |
4'-demethylpodophyllotoxin | [no description available] | low | 0 | 0 | furonaphthodioxole; organic heterotetracyclic compound; phenols | metabolite |
lysicamine | [no description available] | low | 0 | 0 | alkaloid antibiotic; oxoaporphine alkaloid | metabolite |
celastrol | [no description available] | low | 0 | 0 | monocarboxylic acid; pentacyclic triterpenoid | anti-inflammatory drug; antineoplastic agent; antioxidant; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Hsp90 inhibitor; metabolite |
procyanidin b2 | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavan; polyphenol; proanthocyanidin | antioxidant; metabolite |
aromadedrin | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; dihydroflavonols; secondary alpha-hydroxy ketone; tetrahydroxyflavanone | metabolite |
3-methylthymine | [no description available] | low | 0 | 0 | methylthymine; pyrimidone | metabolite |
tyrosyl-glycyl-glycine | [no description available] | low | 0 | 0 | tripeptide zwitterion; tripeptide | metabolite |
cyclic adp-ribose | [no description available] | low | 0 | 0 | cyclic purine nucleotide; nucleotide-sugar | metabolite; ryanodine receptor agonist |
glycylglutamine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite; protective agent |
alanylglutamine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
naadp | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | calcium channel agonist; metabolite; signalling molecule |
procyanidin b5 | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavan; polyphenol; proanthocyanidin | metabolite |
proanthocyanidin a2 | [no description available] | low | 0 | 0 | hydroxyflavan; proanthocyanidin | angiogenesis modulating agent; anti-HIV agent; antioxidant; metabolite |
dihydrosanguinarine | [no description available] | low | 0 | 0 | benzophenanthridine alkaloid | antifungal agent; metabolite |
tetrahydrocurcumin | [no description available] | low | 0 | 0 | beta-diketone; diarylheptanoid; polyphenol | metabolite |
eriodictyol 7-glucuronide | [no description available] | low | 0 | 0 | 3'-hydroxyflavonoid; beta-D-glucosiduronic acid | EC 1.1.1.21 (aldehyde reductase) inhibitor; metabolite |
beta-lipotropin, gln(9)- | [no description available] | low | 0 | 0 | catechols; crown compound; macrocyclic lactone | bacterial metabolite; metabolite |
4-nitrososulfamethoxazole | [no description available] | low | 0 | 0 | isoxazoles; nitroso compound; sulfonamide | allergen; metabolite |
protosappanin a | [no description available] | low | 0 | 0 | catechols | metabolite |
3,3'-neotrehalosadiamine | [no description available] | low | 0 | 0 | amino disaccharide; glycosyl glycoside derivative | antimicrobial agent; metabolite |
salvinorin a | [no description available] | low | 0 | 0 | organic heterotricyclic compound; organooxygen compound | metabolite; oneirogen |
cyanidin | [no description available] | low | 0 | 0 | 5-hydroxyanthocyanidin | antioxidant; metabolite; neuroprotective agent |
yakuchinone-a | [no description available] | low | 0 | 0 | ketone; monomethoxybenzene; phenols | antineoplastic agent; cyclooxygenase 1 inhibitor; cyclooxygenase 2 inhibitor; EC 1.14.13.39 (nitric oxide synthase) inhibitor; metabolite |
marsupsin | [no description available] | low | 0 | 0 | 1-benzofurans; aromatic ether; polyphenol | antilipemic drug; hypoglycemic agent; metabolite |
6,6'-bieckol | [no description available] | low | 0 | 0 | aromatic ether; oxacycle; phlorotannin | anti-HIV-1 agent; metabolite; radical scavenger |
3-methylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; methylcytosine; pyrimidone | metabolite |
eckol | [no description available] | low | 0 | 0 | phlorotannin | antioxidant; metabolite |
procyanidin b3 | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavan; polyphenol; proanthocyanidin | anti-inflammatory agent; antioxidant; EC 2.3.1.48 (histone acetyltransferase) inhibitor; metabolite |
aclacinomycin | [no description available] | low | 0 | 0 | aminoglycoside; anthracycline; deoxy hexoside; methyl ester; monosaccharide derivative; phenols; polyketide; tertiary alcohol; tetracenequinones; zwitterion | antimicrobial agent; antineoplastic agent; metabolite |
phenylalanylarginine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
prolylarginine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
5-methoxytryptophan | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-tryptophan derivative | metabolite |
phenylalanylglutamate | [no description available] | low | 0 | 0 | dipeptide | metabolite |
aspartylglycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
aspartylglutamate | [no description available] | low | 0 | 0 | dipeptide | metabolite |
5-hydroxypipecolic acid | [no description available] | low | 0 | 0 | piperidinemonocarboxylic acid | metabolite |
prolyl-tyrosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
histidylproline | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
phenylalanyl-glycyl-glycine | [no description available] | low | 0 | 0 | tripeptide | metabolite |
leucylarginine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
pendolmycin | [no description available] | low | 0 | 0 | indoles | metabolite |
atractylenolide iii | [no description available] | low | 0 | 0 | naphthofuran | metabolite |
malvidin | [no description available] | low | 0 | 0 | 5-hydroxyanthocyanidin | biological pigment; metabolite |
5-hydroxytryptoline | [no description available] | low | 0 | 0 | beta-carbolines | metabolite |
perlolyrine | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
endocrocin | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols; trihydroxyanthraquinone | metabolite |
sulochrin | [no description available] | low | 0 | 0 | benzophenones; carboxylic ester; phenols | metabolite |
i-677 | [no description available] | low | 0 | 0 | L-serine derivative; non-proteinogenic L-alpha-amino acid | antimetabolite; antimicrobial agent; antineoplastic agent; metabolite |
isohomovanillic acid | [no description available] | low | 0 | 0 | aromatic ether; phenols; phenylacetic acids | metabolite |
4-amino-2-methoxypyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic ether; methylcytosine | metabolite |
asimilobine | [no description available] | low | 0 | 0 | aporphine alkaloid | metabolite |
aristolochic acid D | [no description available] | low | 0 | 0 | aristolochic acids; aromatic ether; C-nitro compound; cyclic acetal; monocarboxylic acid; organic heterotetracyclic compound | carcinogenic agent; metabolite; nephrotoxin; toxin |
leukodopachrome | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; indoles | metabolite |
ampelopsin | [no description available] | low | 0 | 0 | dihydromyricetin; secondary alpha-hydroxy ketone | antineoplastic agent; antioxidant; metabolite |
pinusolide | [no description available] | low | 0 | 0 | diterpene lactone | metabolite |
2,4,5-trihydroxypentanoic acid gamma-lactone | [no description available] | low | 0 | 0 | ribonolactone | metabolite |
hydroxysitosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 7alpha-hydroxy steroid | metabolite; plant metabolite |
jolkinolide a | [no description available] | low | 0 | 0 | diterpene lactone | metabolite |
jolkinolide b | [no description available] | low | 0 | 0 | diterpene lactone | metabolite |
1-o-hexadecyl-2-lyso-glycero-3-phosphorylcholine | [no description available] | low | 0 | 0 | 1-alkyl-sn-glycero-3-phosphocholine; lysophosphatidylcholine O-16:0 | metabolite |
isovitexin | [no description available] | low | 0 | 0 | C-glycosyl compound; trihydroxyflavone | EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
dopamine quinone | [no description available] | low | 0 | 0 | 1,2-benzoquinones; primary amino compound | metabolite |
platycodin d | [no description available] | low | 0 | 0 | triterpenoid saponin | metabolite |
frenolicin b | [no description available] | low | 0 | 0 | benzoisochromanequinone; p-quinones | metabolite |
4-oxopentanal | [no description available] | low | 0 | 0 | ketoaldehyde | metabolite |
my 12-62c | [no description available] | low | 0 | 0 | monohydroxyquinoline; quinolone | antibacterial agent; iron chelator; metabolite; signalling molecule |
3,4-dihydroxyphenylpyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid | metabolite |
proximadiol | [no description available] | low | 0 | 0 | eudesmane sesquiterpenoid | metabolite |
aristolochic acid c | [no description available] | low | 0 | 0 | aristolochic acids; aromatic ether; C-nitro compound; cyclic acetal; monocarboxylic acid; organic heterotetracyclic compound | carcinogenic agent; metabolite; mutagen; nephrotoxin; toxin |
phenylacetyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite; metabolite; mouse metabolite |
taxusin | [no description available] | low | 0 | 0 | acetate ester; carbotricyclic compound; taxane diterpenoid | metabolite |
confertin | [no description available] | low | 0 | 0 | cyclic ketone; gamma-lactone; organic heterotricyclic compound; pseudoguaianolide | anti-inflammatory agent; metabolite; plant metabolite |
beta-methylcrotonylglycine | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
tracheloside | [no description available] | low | 0 | 0 | glycoside; lignan | metabolite |
maytenonic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
procyanidin C1 | [no description available] | low | 0 | 0 | hydroxyflavan; polyphenol; proanthocyanidin | anti-inflammatory agent; antioxidant; EC 1.17.3.2 (xanthine oxidase) inhibitor; EC 3.2.1.20 (alpha-glucosidase) inhibitor; lipoxygenase inhibitor; metabolite |
3-methyleneindolenine | [no description available] | low | 0 | 0 | indoles | metabolite |
isopulegol | [no description available] | low | 0 | 0 | p-menthane monoterpenoid | metabolite |
kadsurin | [no description available] | low | 0 | 0 | tannin | metabolite |
lysylproline | [no description available] | low | 0 | 0 | dipeptide | metabolite |
5-o-methylembelin | [no description available] | low | 0 | 0 | enol ether; monohydroxy-1,4-benzoquinones | antileishmanial agent; antineoplastic agent; hepatitis C protease inhibitor; metabolite |
dihydrodaidzein | [no description available] | low | 0 | 0 | hydroxyisoflavanone | metabolite |
4'-o-methylepigallocatechin | [no description available] | low | 0 | 0 | catechin | metabolite |
corynoline | [no description available] | low | 0 | 0 | benzophenanthridine alkaloid; cyclic acetal; isoquinolines; organic heterohexacyclic compound; secondary alcohol | antineoplastic agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; hepatoprotective agent; metabolite |
limonin | [no description available] | low | 0 | 0 | epoxide; furans; hexacyclic triterpenoid; lactone; limonoid; organic heterohexacyclic compound | inhibitor; metabolite; volatile oil component |
dichamanetin | [no description available] | low | 0 | 0 | diarylheptanoid | metabolite |
brevianamide f | [no description available] | low | 0 | 0 | dipeptide; indoles; pyrrolopyrazine | metabolite |
ergolide | [no description available] | low | 0 | 0 | acetate ester; cyclic ketone; gamma-lactone; organic heterotricyclic compound; sesquiterpene lactone | anti-inflammatory agent; antineoplastic agent; metabolite; NF-kappaB inhibitor; plant metabolite |
4-sulfocatechol | [no description available] | low | 0 | 0 | dihydroxybenzenesulfonic acid | metabolite |
histidylleucine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
7-methoxyheptaphylline | [no description available] | low | 0 | 0 | carbazoles | metabolite |
phenylalanylserine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
phellamurin | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; beta-D-glucoside; dihydroflavonols; flavanone glycoside; monosaccharide derivative; trihydroxyflavanone | metabolite |
prolylglutamic acid | [no description available] | low | 0 | 0 | dipeptide | metabolite |
nantenine | [no description available] | low | 0 | 0 | oxoaporphine alkaloid | metabolite |
hydrastine | [no description available] | low | 0 | 0 | isoquinolines | metabolite |
butyrylcarnitine | [no description available] | low | 0 | 0 | O-butanoylcarnitine; saturated fatty acyl-L-carnitine | metabolite |
2-hydroxyestradiol | [no description available] | low | 0 | 0 | 17beta-hydroxy steroid; 2-hydroxy steroid | carcinogenic agent; human metabolite; metabolite; mouse metabolite; prodrug |
aromaticin | [no description available] | low | 0 | 0 | cyclic ketone; gamma-lactone; organic heterotricyclic compound; sesquiterpene lactone | anti-inflammatory agent; metabolite; plant metabolite |
acivicin | [no description available] | low | 0 | 0 | isoxazoles; non-proteinogenic L-alpha-amino acid; organochlorine compound | antileishmanial agent; antimetabolite; antimicrobial agent; antineoplastic agent; EC 2.3.2.2 (gamma-glutamyltransferase) inhibitor; glutamine antagonist; metabolite |
n-methylcorydaldine | [no description available] | low | 0 | 0 | quinolone | metabolite |
2-amino-3,3-dimethylbutanoic acid | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid | metabolite |
pentabromopseudilin | [no description available] | low | 0 | 0 | pyrroles | metabolite |
rocaglamide | [no description available] | low | 0 | 0 | monocarboxylic acid amide; monomethoxybenzene; organic heterotricyclic compound | antileishmanial agent; antineoplastic agent; metabolite |
dentatin | [no description available] | low | 0 | 0 | coumarins | metabolite |
acronine | [no description available] | low | 0 | 0 | acridone derivatives; alkaloid | antineoplastic agent; metabolite |
enmein | [no description available] | low | 0 | 0 | delta-lactone | metabolite |
5-aminonicotinic acid | [no description available] | low | 0 | 0 | aminonicotinic acid; aminopyridine; aromatic amine | metabolite |
pomolic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
aglafoline | [no description available] | low | 0 | 0 | methyl ester; organic heterotricyclic compound | metabolite; platelet aggregation inhibitor |
isomaltose | [no description available] | low | 0 | 0 | glycosylglucose | human metabolite; metabolite; mouse metabolite |
deoxyglucose | [no description available] | low | 0 | 0 | 2-deoxy-D-glucose | metabolite |
vestitone | [no description available] | low | 0 | 0 | (3R)-2'-hydroxyisoflavanones; hydroxyisoflavanone; methoxyisoflavanone | antibacterial agent; metabolite |
pantetheine | [no description available] | low | 0 | 0 | pantetheines; thiol | human metabolite; metabolite; mouse metabolite |
salicin | [no description available] | low | 0 | 0 | aromatic primary alcohol; aryl beta-D-glucoside; benzyl alcohols | antipyretic; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; metabolite; non-narcotic analgesic; non-steroidal anti-inflammatory drug; prodrug |
taxifolin | [no description available] | low | 0 | 0 | taxifolin | metabolite |
n-formylmethionine | [no description available] | low | 0 | 0 | L-methionine derivative; N-formyl amino acid; proteinogenic amino acid | metabolite |
fucose | [no description available] | low | 0 | 0 | deoxygalactose | metabolite |
saponarin | [no description available] | low | 0 | 0 | C-glycosyl compound; dihydroxyflavone; glycosyloxyflavone; monosaccharide derivative | metabolite |
hippeastrine | [no description available] | low | 0 | 0 | delta-lactone; indole alkaloid; organic heteropentacyclic compound; secondary alcohol | antineoplastic agent; metabolite |
cyanidin 3-o-beta-d-glucopyranoside | [no description available] | low | 0 | 0 | anthocyanin cation; beta-D-glucoside; monosaccharide derivative | metabolite |
silychristin | [no description available] | low | 0 | 0 | 1-benzofurans; aromatic ether; flavonolignan; polyphenol; secondary alpha-hydroxy ketone | lipoxygenase inhibitor; metabolite; prostaglandin antagonist; radical scavenger |
peonidin | [no description available] | low | 0 | 0 | 5-hydroxyanthocyanidin | antineoplastic agent; antioxidant; apoptosis inducer; metabolite |
convallatoxin | [no description available] | low | 0 | 0 | 14beta-hydroxy steroid; 19-oxo steroid; 5beta-hydroxy steroid; alpha-L-rhamnoside; steroid aldehyde; steroid lactone | metabolite; vasodilator agent |
furostanol i | [no description available] | low | 0 | 0 | beta-D-glucoside; cyclic hemiketal; pentacyclic triterpenoid; steroid saponin; trisaccharide derivative | metabolite |
decursinol | [no description available] | low | 0 | 0 | cyclic ether; delta-lactone; organic heterotricyclic compound; secondary alcohol | analgesic; antineoplastic agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite |
abyssinone v | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; phenols; trihydroxyflavanone | metabolite |
davidigenin | [no description available] | low | 0 | 0 | dihydrochalcones; polyphenol | anti-allergic agent; anti-asthmatic agent; antioxidant; metabolite |
farrerol | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
naringin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; disaccharide derivative; neohesperidoside | anti-inflammatory agent; antineoplastic agent; metabolite |
isonaringin | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; dihydroxyflavanone; disaccharide derivative; rutinoside | anti-inflammatory agent; antioxidant; metabolite |
cleomiscosin a | [no description available] | low | 0 | 0 | aromatic ether; delta-lactone; organic heterotricyclic compound; phenols; primary alcohol | anti-inflammatory agent; metabolite |
vicenin ii | [no description available] | low | 0 | 0 | C-glycosyl compound; trihydroxyflavone | metabolite |
eugeniin | [no description available] | low | 0 | 0 | beta-D-glucoside; ellagitannin; gallate ester; lactone | anti-HSV-1 agent; antifungal agent; antineoplastic agent; EC 3.2.1.20 (alpha-glucosidase) inhibitor; metabolite |
knipholone | [no description available] | low | 0 | 0 | aromatic ketone; dihydroxyanthraquinone; methoxybenzenes; methyl ketone; polyphenol; resorcinols | antineoplastic agent; antioxidant; antiplasmodial drug; leukotriene antagonist; metabolite |
alpha bitter acid | [no description available] | low | 0 | 0 | aromatic ketone; cyclic ketone; diketone; tertiary alpha-hydroxy ketone; triol | antibacterial drug; antioxidant; cyclooxygenase 2 inhibitor; metabolite |
acanthoside b | [no description available] | low | 0 | 0 | beta-D-glucoside | metabolite |
chlorpromazine n-oxide | [no description available] | low | 0 | 0 | organochlorine compound; phenothiazines; tertiary amine oxide | metabolite |
3-hydroxyaspartic acid, (threo-l)-isomer | [no description available] | low | 0 | 0 | 3-hydroxy-L-aspartic acid | metabolite |
cyclo(l-phe-l-pro) | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
pyochelin | [no description available] | low | 0 | 0 | monocarboxylic acid; phenols; thiazolidines | metabolite; siderophore |
surfactin c | [no description available] | low | 0 | 0 | cyclodepsipeptide; lipopeptide antibiotic; macrocyclic lactone | antibacterial agent; antifungal agent; antineoplastic agent; antiviral agent; metabolite; platelet aggregation inhibitor; surfactant |
petunidin-3-glucoside | [no description available] | low | 0 | 0 | anthocyanin cation; aromatic ether; beta-D-glucoside | antioxidant; metabolite |
malvidin-3-glucoside | [no description available] | low | 0 | 0 | anthocyanin cation; aromatic ether; beta-D-glucoside | metabolite |
dioncophylline a | [no description available] | low | 0 | 0 | biaryl; isoquinoline alkaloid; isoquinolines; methoxynaphthalene; methylnaphthalenes; naphthalenes | antifungal agent; antimalarial; metabolite; molluscicide |
dioncophylline c | [no description available] | low | 0 | 0 | aromatic ether; biaryl; isoquinoline alkaloid; isoquinolines; methoxynaphthalene; methylnaphthalenes; naphthols | antimalarial; antiplasmodial drug; metabolite |
latrunculin a | [no description available] | low | 0 | 0 | cyclic hemiketal; macrolide; oxabicycloalkane; thiazolidinone | actin polymerisation inhibitor; metabolite; toxin |
aglucovancomycin b | [no description available] | low | 0 | 0 | cyclic ether; heterodetic cyclic peptide; peptide antibiotic; peptide zwitterion; polyphenol | metabolite |
(S)-ATPA | [no description available] | low | 0 | 0 | isoxazoles; non-proteinogenic L-alpha-amino acid | metabolite |
epothilone a | [no description available] | low | 0 | 0 | epothilone; epoxide | antineoplastic agent; metabolite; microtubule-stabilising agent; tubulin modulator |
alitretinoin | [no description available] | low | 0 | 0 | retinoic acid | antineoplastic agent; keratolytic drug; metabolite; retinoid X receptor agonist |
isoleucylvaline | [no description available] | low | 0 | 0 | dipeptide | metabolite |
afimoxifene | [no description available] | low | 0 | 0 | phenols; tertiary amino compound | antineoplastic agent; estrogen receptor antagonist; metabolite |
3-hydroxyhippuric acid | [no description available] | low | 0 | 0 | N-acylglycine; phenols | metabolite |
12-deoxyphorbol 13-acetate | [no description available] | low | 0 | 0 | phorbol ester | metabolite |
conidendrin | [no description available] | low | 0 | 0 | lignan | metabolite |
bevirimat | [no description available] | low | 0 | 0 | dicarboxylic acid monoester; monocarboxylic acid; pentacyclic triterpenoid | HIV-1 maturation inhibitor; metabolite |
azaserine | [no description available] | low | 0 | 0 | carboxylic ester; diazo compound; L-serine derivative; non-proteinogenic L-alpha-amino acid | antifungal agent; antimetabolite; antimicrobial agent; antineoplastic agent; glutamine antagonist; immunosuppressive agent; metabolite |
16beta,17-dihydroxy-ent-kaurane-19-oic acid | [no description available] | low | 0 | 0 | bridged compound; diol; ent-kaurane diterpenoid; hydroxy monocarboxylic acid; primary alcohol; tertiary alcohol | anti-HIV agent; metabolite |
glycyrin | [no description available] | low | 0 | 0 | aromatic ether; coumarins; hydroxyisoflavans | antibacterial agent; metabolite; plant metabolite |
reynosin | [no description available] | low | 0 | 0 | organic heterotricyclic compound; sesquiterpene lactone | metabolite |
moronic acid | [no description available] | low | 0 | 0 | pentacyclic triterpenoid | anti-HIV agent; anti-HSV-1 agent; metabolite |
maltitol | [no description available] | low | 0 | 0 | alpha-D-glucoside; glycosyl alditol | laxative; metabolite; sweetening agent |
Phe-Tyr | [no description available] | low | 0 | 0 | dipeptide | metabolite |
2-acetyl-1-pyrroline | [no description available] | low | 0 | 0 | acylimine; methyl ketone; pyrroline | flavouring agent; Maillard reaction product; metabolite |
methyl indole-3-carboxylate | [no description available] | low | 0 | 0 | indoles; methyl ester | metabolite |
camalexin | [no description available] | low | 0 | 0 | 1,3-thiazoles; indole phytoalexin | metabolite |
komaroviquinone | [no description available] | low | 0 | 0 | bridged compound; lactol; p-quinones; tetracyclic diterpenoid | metabolite; trypanocidal drug |
2-hydroxycinnamic acid | [no description available] | low | 0 | 0 | 2-coumaric acid; phenols | antioxidant; metabolite |
16-epivincamine | [no description available] | low | 0 | 0 | alkaloid | metabolite |
diethyl fumarate | [no description available] | low | 0 | 0 | diester | metabolite |
isoliquiritigenin | [no description available] | low | 0 | 0 | chalcones | antineoplastic agent; biological pigment; EC 1.14.18.1 (tyrosinase) inhibitor; GABA modulator; geroprotector; metabolite; NMDA receptor antagonist |
1-acetyl-beta-carboline | [no description available] | low | 0 | 0 | harmala alkaloid | metabolite |
propolin c | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; tetrahydroxyflavanone | metabolite; radical scavenger |
xanthohumol | [no description available] | low | 0 | 0 | aromatic ether; chalcones; polyphenol | anti-HIV-1 agent; antineoplastic agent; antiviral agent; apoptosis inducer; EC 2.3.1.20 (diacylglycerol O-acyltransferase) inhibitor; metabolite |
butylidenephthalide | [no description available] | low | 0 | 0 | 2-benzofurans; gamma-lactone | EC 3.2.1.20 (alpha-glucosidase) inhibitor; hypoglycemic agent; metabolite |
malonyl coenzyme a | [no description available] | low | 0 | 0 | malonyl-CoAs | EC 2.3.1.21 (carnitine O-palmitoyltransferase) inhibitor; Escherichia coli metabolite; metabolite; mouse metabolite |
imidazol-1-ylacetic acid | [no description available] | low | 0 | 0 | imidazolyl carboxylic acid | metabolite |
captax | [no description available] | low | 0 | 0 | aryl thiol; benzothiazoles | carcinogenic agent; metabolite |
n-acetyltryptophan | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-acetyl-L-amino acid | metabolite |
cinnamoylglycine | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
n-benzoylalanine | [no description available] | low | 0 | 0 | N-acyl-L-alanine; N-benzoylalanine | metabolite |
isoferulic acid | [no description available] | low | 0 | 0 | ferulic acids | antioxidant; biomarker; metabolite |
oxypeucadanin, (r)-(+)-isomer | [no description available] | low | 0 | 0 | furanocoumarin | metabolite |
curcumin | [no description available] | low | 0 | 0 | aromatic ether; beta-diketone; diarylheptanoid; enone; polyphenol | anti-inflammatory agent; antifungal agent; antineoplastic agent; biological pigment; contraceptive drug; dye; EC 1.1.1.205 (IMP dehydrogenase) inhibitor; EC 1.1.1.21 (aldehyde reductase) inhibitor; EC 1.1.1.25 (shikimate dehydrogenase) inhibitor; EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor; EC 1.8.1.9 (thioredoxin reductase) inhibitor; EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor; EC 3.5.1.98 (histone deacetylase) inhibitor; flavouring agent; food colouring; geroprotector; hepatoprotective agent; immunomodulator; iron chelator; ligand; lipoxygenase inhibitor; metabolite; neuroprotective agent; nutraceutical; radical scavenger |
thiouracil | [no description available] | low | 0 | 0 | nucleobase analogue; thiocarbonyl compound | antithyroid drug; metabolite |
allylthiourea | [no description available] | low | 0 | 0 | thioureas | metabolite |
n-glycylalanine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
caryophyllene oxide | [no description available] | low | 0 | 0 | epoxide | metabolite |
fumonisin b1 | [no description available] | low | 0 | 0 | diester; fumonisin; primary amino compound; triol | carcinogenic agent; metabolite |
olivetolic acid | [no description available] | low | 0 | 0 | benzoic acids; monocarboxylic acid; polyketide; resorcinols | metabolite |
hirsutine, (16e,20beta)-isomer | [no description available] | low | 0 | 0 | alkaloid | metabolite |
Ganodermanontriol | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
dieckol | [no description available] | low | 0 | 0 | aromatic ether; oxacycle; phlorotannin | anticoagulant; EC 3.2.1.20 (alpha-glucosidase) inhibitor; hepatoprotective agent; metabolite; radical scavenger |
glycylproline | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
tamoxifen n-oxide | [no description available] | low | 0 | 0 | aromatic ether; tertiary amine oxide | anti-estrogen; metabolite |
7-deacetylgedunin | [no description available] | low | 0 | 0 | cyclic terpene ketone; delta-lactone; enone; epoxide; furans; limonoid; pentacyclic triterpenoid | anti-inflammatory agent; antimalarial; metabolite; plant metabolite |
galactose-6-phosphate | [no description available] | low | 0 | 0 | D-galactose 6-phosphate | metabolite |
nicotine n-glucuronide | [no description available] | low | 0 | 0 | iminium betaine; N-glycosylpyridine | metabolite |
isorhyncophylline | [no description available] | low | 0 | 0 | indolizines | metabolite |
cysteinylproline | [no description available] | low | 0 | 0 | dipeptide | metabolite |
glycyllysine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
methionyltryptophan | [no description available] | low | 0 | 0 | dipeptide | metabolite |
ascorbigen | [no description available] | low | 0 | 0 | indolyl carbohydrate | metabolite |
pimeloyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | metabolite |
1-salicylate glucuronide | [no description available] | low | 0 | 0 | benzoic acids; beta-D-glucosiduronic acid | metabolite |
isoschaftoside | [no description available] | low | 0 | 0 | C-glycosyl compound; trihydroxyflavone | metabolite |
croomine | [no description available] | low | 0 | 0 | alkaloid | metabolite |
3-hydroxyflavanone | [no description available] | low | 0 | 0 | 3'-hydroxyflavanones; monohydroxyflavanone | metabolite |
ungeremine | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
seryl-proline | [no description available] | low | 0 | 0 | dipeptide | metabolite |
4-hydroxy-5-methyl-3(2h)-furanone | [no description available] | low | 0 | 0 | cyclic ketone; enol; furans | metabolite |
annomontine | [no description available] | low | 0 | 0 | alkaloid; aminopyrimidine; beta-carbolines | antiparasitic agent; metabolite |
8-hydroxymanzamine a | [no description available] | low | 0 | 0 | alkaloid; beta-carbolines; isoquinolines | anti-HSV-2 agent; EC 2.7.11.26 (tau-protein kinase) inhibitor; metabolite |
ginkgetin | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavone; methoxyflavone; ring assembly | anti-HSV-1 agent; antineoplastic agent; cyclooxygenase 2 inhibitor; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; metabolite |
calceolarioside b | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
eupatilin | [no description available] | low | 0 | 0 | dihydroxyflavone; trimethoxyflavone | anti-inflammatory agent; anti-ulcer drug; antineoplastic agent; EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor; metabolite |
quercetin 3-o-glucuronide | [no description available] | low | 0 | 0 | beta-D-glucosiduronic acid; quercetin O-glycoside | antidepressant; antioxidant; metabolite |
australifungin | [no description available] | low | 0 | 0 | carbobicyclic compound; enol; enone; secondary alcohol | antifungal agent; EC 2.3.1.24 (sphingosine N-acyltransferase) inhibitor; HIV-1 integrase inhibitor; metabolite |
catechin gallate | [no description available] | low | 0 | 0 | flavans; gallate ester; polyphenol | metabolite |
sterigmatocystin | [no description available] | low | 0 | 0 | sterigmatocystins | metabolite |
3,7-dimethoxy-5,3',4'-trihydroxyflavone | [no description available] | low | 0 | 0 | dimethoxyflavone; trihydroxyflavone | EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor; metabolite |
apigenin | [no description available] | low | 0 | 0 | trihydroxyflavone | antineoplastic agent; metabolite |
7,3'-dihydroxy-4'-methoxyisoflavone | [no description available] | low | 0 | 0 | 4'-methoxyisoflavones; 7-hydroxyisoflavones | antioxidant; metabolite |
calcitriol | [no description available] | low | 0 | 0 | D3 vitamins; hydroxycalciol; triol | antineoplastic agent; antipsoriatic; bone density conservation agent; calcium channel agonist; calcium channel modulator; hormone; human metabolite; immunomodulator; metabolite; mouse metabolite; nutraceutical |
vomifoliol | [no description available] | low | 0 | 0 | (6S)-vomifoliol | metabolite; phytotoxin |
feruloyltyramine | [no description available] | low | 0 | 0 | tyramines | metabolite |
luteolin-7-glucuronide | [no description available] | low | 0 | 0 | glycosyloxyflavone; luteolin O-glucuronoside; monosaccharide derivative; trihydroxyflavone | metabolite |
chrysoeriol | [no description available] | low | 0 | 0 | monomethoxyflavone; trihydroxyflavone | antineoplastic agent; antioxidant; metabolite |
quercetin 3-o-methyl ether | [no description available] | low | 0 | 0 | monomethoxyflavone; tetrahydroxyflavone | antimicrobial agent; metabolite |
dexmedetomidine | [no description available] | low | 0 | 0 | trihydroxyflavone; trimethoxyflavone | antineoplastic agent; metabolite |
apigetrin | [no description available] | low | 0 | 0 | beta-D-glucoside; dihydroxyflavone; glycosyloxyflavone; monosaccharide derivative | antibacterial agent; metabolite; non-steroidal anti-inflammatory drug |
rutin | [no description available] | low | 0 | 0 | disaccharide derivative; quercetin O-glucoside; rutinoside; tetrahydroxyflavone | antioxidant; metabolite |
6-ketoprostaglandin e1 | [no description available] | low | 0 | 0 | prostaglandins E | metabolite; platelet aggregation inhibitor |
lipoxin a4 | [no description available] | low | 0 | 0 | hydroxy polyunsaturated fatty acid; lipoxin; long-chain fatty acid | human metabolite; metabolite |
harmine | [no description available] | low | 0 | 0 | harmala alkaloid | anti-HIV agent; EC 1.4.3.4 (monoamine oxidase) inhibitor; metabolite |
naringenin chalcone | [no description available] | low | 0 | 0 | chalcones; polyphenol | anti-allergic agent; anti-inflammatory agent; metabolite |
cornexistin | [no description available] | low | 0 | 0 | cyclic dicarboxylic anhydride; organic heterobicyclic compound; secondary alpha-hydroxy ketone | herbicide; metabolite |
isobavachalcone | [no description available] | low | 0 | 0 | chalcones; polyphenol | antibacterial agent; metabolite; platelet aggregation inhibitor |
daphnoretin | [no description available] | low | 0 | 0 | aromatic ether; hydroxycoumarin | antineoplastic agent; antiviral agent; metabolite |
Rhynchophylline | [no description available] | low | 0 | 0 | indolizines | metabolite |
esculin | [no description available] | low | 0 | 0 | beta-D-glucoside; hydroxycoumarin | antioxidant; metabolite |
mammeisin | [no description available] | low | 0 | 0 | neoflavonoid | metabolite |
ostruthin | [no description available] | low | 0 | 0 | terpene lactone | metabolite |
costunolide | [no description available] | low | 0 | 0 | germacranolide; heterobicyclic compound | anthelminthic drug; antiinfective agent; antineoplastic agent; antiparasitic agent; antiviral drug; metabolite |
caryophyllene | [no description available] | low | 0 | 0 | beta-caryophyllene | fragrance; insect attractant; metabolite; non-steroidal anti-inflammatory drug |
phaseic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; apo carotenoid sesquiterpenoid | metabolite |
agathisflavone | [no description available] | low | 0 | 0 | biaryl; biflavonoid; hydroxyflavone | antineoplastic agent; antiviral agent; hepatoprotective agent; metabolite |
cupressuflavone | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavone; ring assembly | EC 3.4.21.37 (leukocyte elastase) inhibitor; metabolite; radical scavenger |
fisetin | [no description available] | low | 0 | 0 | 3'-hydroxyflavonoid; 7-hydroxyflavonol; tetrahydroxyflavone | anti-inflammatory agent; antioxidant; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; geroprotector; metabolite; plant metabolite |
genkwanin | [no description available] | low | 0 | 0 | dihydroxyflavone; monomethoxyflavone | metabolite |
bellidifolin | [no description available] | low | 0 | 0 | polyphenol; xanthones | EC 3.1.1.7 (acetylcholinesterase) inhibitor; hypoglycemic agent; metabolite |
demethylbellidifolin | [no description available] | low | 0 | 0 | tetrol; xanthones | antioxidant; EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite; mutagen; radical scavenger |
hinokiflavone | [no description available] | low | 0 | 0 | aromatic ether; biflavonoid; hydroxyflavone | antineoplastic agent; metabolite; neuroprotective agent |
euxanthone | [no description available] | low | 0 | 0 | phenols; xanthones | metabolite; plant metabolite |
3-methylquercetin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | anticoagulant; EC 1.14.18.1 (tyrosinase) inhibitor; metabolite |
norswertianolin | [no description available] | low | 0 | 0 | beta-D-glucoside; xanthones | EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite |
swerchirin | [no description available] | low | 0 | 0 | aromatic ether; phenols; xanthones | hypoglycemic agent; metabolite |
isoscutellarein | [no description available] | low | 0 | 0 | tetrahydroxyflavone | metabolite |
kaempferide | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; monomethoxyflavone; trihydroxyflavone | antihypertensive agent; metabolite |
morin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; pentahydroxyflavone | angiogenesis modulating agent; anti-inflammatory agent; antibacterial agent; antihypertensive agent; antineoplastic agent; antioxidant; EC 5.99.1.2 (DNA topoisomerase) inhibitor; hepatoprotective agent; metabolite; neuroprotective agent |
norwogonin | [no description available] | low | 0 | 0 | trihydroxyflavone | antioxidant; metabolite |
orientin | [no description available] | low | 0 | 0 | 3'-hydroxyflavonoid; C-glycosyl compound; tetrahydroxyflavone | antioxidant; metabolite |
patuletin | [no description available] | low | 0 | 0 | flavonols; monomethoxyflavone; pentahydroxyflavone | analgesic; antioxidant; EC 1.1.1.21 (aldehyde reductase) inhibitor; lipoxygenase inhibitor; metabolite |
rhamnetin | [no description available] | low | 0 | 0 | monomethoxyflavone; tetrahydroxyflavone | anti-inflammatory agent; antioxidant; metabolite |
robustaflavone | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavone; ring assembly | anti-HBV agent; antineoplastic agent; antioxidant; metabolite |
scutellarein | [no description available] | low | 0 | 0 | tetrahydroxyflavone | metabolite |
tamarixetin | [no description available] | low | 0 | 0 | 7-hydroxyflavonol; monomethoxyflavone; tetrahydroxyflavone | antioxidant; metabolite |
tricetin | [no description available] | low | 0 | 0 | pentahydroxyflavone | antineoplastic agent; metabolite |
tricin | [no description available] | low | 0 | 0 | 3'-methoxyflavones; dimethoxyflavone; trihydroxyflavone | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; metabolite |
astringin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative; polyphenol; stilbenoid | antineoplastic agent; antioxidant; metabolite |
polydatin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative; polyphenol; stilbenoid | anti-arrhythmia drug; antioxidant; geroprotector; hepatoprotective agent; metabolite; nephroprotective agent; potassium channel modulator |
epsilon-viniferin | [no description available] | low | 0 | 0 | 1-benzofurans; polyphenol; stilbenoid | metabolite |
irilone | [no description available] | low | 0 | 0 | hydroxyisoflavone; organic heterotricyclic compound; oxacycle | antineoplastic agent; immunomodulator; metabolite |
caffeic acid phenethyl ester | [no description available] | low | 0 | 0 | alkyl caffeate ester | anti-inflammatory agent; antibacterial agent; antineoplastic agent; antioxidant; antiviral agent; immunomodulator; metabolite; neuroprotective agent |
licoisoflavone a | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | metabolite |
prunetin | [no description available] | low | 0 | 0 | 7-methoxyisoflavones; hydroxyisoflavone | anti-inflammatory agent; EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor; EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor; metabolite |
wedelolactone | [no description available] | low | 0 | 0 | aromatic ether; coumestans; delta-lactone; polyphenol | antineoplastic agent; apoptosis inducer; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; hepatoprotective agent; metabolite |
rottlerin | [no description available] | low | 0 | 0 | aromatic ketone; benzenetriol; chromenol; enone; methyl ketone | anti-allergic agent; antihypertensive agent; antineoplastic agent; apoptosis inducer; K-ATP channel agonist; metabolite |
syringetin | [no description available] | low | 0 | 0 | 3',5'-dimethoxyflavone; 3'-methoxyflavones; 7-hydroxyflavonol; dimethoxyflavone; tetrahydroxyflavone | metabolite; platelet aggregation inhibitor |
10-deoxymethynolide | [no description available] | low | 0 | 0 | macrolide | metabolite |
4',7-dihydroxyflavone | [no description available] | low | 0 | 0 | dihydroxyflavone | metabolite |
rhoifolin | [no description available] | low | 0 | 0 | dihydroxyflavone; glycosyloxyflavone; neohesperidoside | metabolite |
veronicastroside | [no description available] | low | 0 | 0 | disaccharide derivative; glycosyloxyflavone; neohesperidoside; trihydroxyflavone | antibacterial agent; metabolite |
quercimeritrin | [no description available] | low | 0 | 0 | beta-D-glucoside; flavonols; monosaccharide derivative; quercetin O-glucoside; tetrahydroxyflavone | antioxidant; metabolite |
josamycin | [no description available] | low | 0 | 0 | acetate ester; aldehyde; disaccharide derivative; glycoside; macrolide antibiotic; tertiary alcohol; tertiary amino compound | antibacterial drug; metabolite |
n,n-dimethylsphingenine | [no description available] | low | 0 | 0 | aminodiol; sphingoid; tertiary amino compound | EC 2.7.1.91 (sphingosine kinase) inhibitor; metabolite |
4-hydroxyestradiol | [no description available] | low | 0 | 0 | 4-hydroxy steroid | metabolite |
9-hydroxy-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | HODE; octadecadienoic acid | human metabolite; metabolite; mouse metabolite; plant metabolite |
9-oxo-10,12-octadecadienoic acid | [no description available] | low | 0 | 0 | enone; oxooctadecadienoic acid | metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid; oxo fatty acid | metabolite |
13,14-dihydro-15-ketoprostaglandin d2 | [no description available] | low | 0 | 0 | prostaglandins D | metabolite |
15-keto-13,14-dihydroprostaglandin f2alpha | [no description available] | low | 0 | 0 | ketone; prostaglandins Falpha | metabolite |
2,3-dinor-6-ketoprostaglandin f1alpha | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; prostanoid; secondary alcohol | metabolite |
ergosta-7,22-dien-3-ol, (3beta,5alpha,6alpha,22e)-isomer | [no description available] | low | 0 | 0 | 3beta-sterol | anti-HSV-1 agent; antifungal agent; EC 3.2.1.18 (exo-alpha-sialidase) inhibitor; metabolite |
calcifediol | [no description available] | low | 0 | 0 | D3 vitamins; diol; hydroxycalciol | bone density conservation agent; human metabolite; metabolite; mouse metabolite; nutraceutical |
cyclosporine | [no description available] | low | 0 | 0 | homodetic cyclic peptide | anti-asthmatic drug; anticoronaviral agent; antifungal agent; antirheumatic drug; carcinogenic agent; dermatologic drug; EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor; geroprotector; immunosuppressive agent; metabolite |
oleyl alcohol | [no description available] | low | 0 | 0 | fatty alcohol 18:1; long-chain primary fatty alcohol | metabolite; nonionic surfactant |
fortimicin a | [no description available] | low | 0 | 0 | amino cyclitol glycoside; aminoglycoside antibiotic; diol; monocarboxylic acid amide; primary amino compound | antibacterial agent; metabolite |
3',4',7-trihydroxyisoflavone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | antineoplastic agent; EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor; metabolite |
6,7,4'-trihydroxyisoflavone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | anti-inflammatory agent; antimutagen; EC 1.14.18.1 (tyrosinase) inhibitor; metabolite; PPARalpha agonist; PPARgamma agonist |
15-deoxy-delta(12,14)-prostaglandin j2 | [no description available] | low | 0 | 0 | prostaglandins J | electrophilic reagent; insulin-sensitizing drug; metabolite |
cytochalasin b | [no description available] | low | 0 | 0 | cytochalasin; lactam; lactone; organic heterotricyclic compound | actin polymerisation inhibitor; metabolite; mycotoxin; platelet aggregation inhibitor |
ciguatoxins | [no description available] | low | 0 | 0 | ciguatoxin | metabolite |
12-hydroxy-5,8,10-heptadecatrienoic acid | [no description available] | low | 0 | 0 | hydroxy polyunsaturated fatty acid; long-chain fatty acid; trienoic fatty acid | metabolite |
bisdemethoxycurcumin | [no description available] | low | 0 | 0 | beta-diketone; diarylheptanoid; enone; polyphenol | EC 3.2.1.1 (alpha-amylase) inhibitor; metabolite |
clausine e | [no description available] | low | 0 | 0 | carbazoles | metabolite |
ethyl caffeate | [no description available] | low | 0 | 0 | alkyl caffeate ester; ethyl ester; hydroxycinnamic acid | anti-inflammatory agent; antineoplastic agent; metabolite |
heptaphylline | [no description available] | low | 0 | 0 | carbazoles | metabolite |
pellitorine | [no description available] | low | 0 | 0 | fatty amide | metabolite |
andrographolide | [no description available] | low | 0 | 0 | carbobicyclic compound; gamma-lactone; labdane diterpenoid; primary alcohol; secondary alcohol | anti-HIV agent; anti-inflammatory drug; antineoplastic agent; metabolite |
isorhamnetin-3-o-galactoside | [no description available] | low | 0 | 0 | beta-D-galactoside; glycosyloxyflavone; monomethoxyflavone; monosaccharide derivative; trihydroxyflavone | metabolite |
isorhamnetin 3-o-glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside; glycosyloxyflavone; monomethoxyflavone; monosaccharide derivative; trihydroxyflavone | metabolite |
kaempferol-3-o-rutinoside | [no description available] | low | 0 | 0 | disaccharide derivative; kaempferol O-glucoside; rutinoside; trihydroxyflavone | metabolite; plant metabolite; radical scavenger |
ligustilide | [no description available] | low | 0 | 0 | butenolide | metabolite |
7,4'-dihydroxy-3'-methoxyisoflavone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones; methoxyisoflavone | antiplasmodial drug; metabolite |
sappanchalcone | [no description available] | low | 0 | 0 | catechols; chalcones; monomethoxybenzene | anti-allergic agent; anti-inflammatory agent; antioxidant; metabolite |
methyl brevifolincarboxylate | [no description available] | low | 0 | 0 | cyclic ketone; delta-lactone; organic heterotricyclic compound; phenols | EC 5.99.1.2 (DNA topoisomerase) inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; metabolite; platelet aggregation inhibitor; radical scavenger; vasodilator agent |
3-deoxysappanchalcone | [no description available] | low | 0 | 0 | chalcones; monomethoxybenzene; phenols | metabolite |
nostocarboline | [no description available] | low | 0 | 0 | alkaloid; beta-carbolines; organic cation; organochlorine compound | antimalarial; EC 3.1.1.8 (cholinesterase) inhibitor; metabolite |
ergosterol-5,8-peroxide | [no description available] | low | 0 | 0 | 3beta-sterol; ergostanoid; organic peroxide; phytosterols | antimycobacterial drug; antineoplastic agent; metabolite; trypanocidal drug |
3-(4-hydroxy-3-methoxyphenyl)-n-(2-(4-hydroxy-3-methoxyphenyl)ethyl)-2-propenamide | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
macluraxanthone b | [no description available] | low | 0 | 0 | phenols; xanthones | anti-HIV agent; antineoplastic agent; metabolite |
flavokawain b | [no description available] | low | 0 | 0 | chalcones; dimethoxybenzene; phenols | anti-inflammatory agent; antileishmanial agent; antineoplastic agent; apoptosis inducer; metabolite |
alternariol | [no description available] | low | 0 | 0 | benzochromenone; phenols | EC 3.1.1.8 (cholinesterase) inhibitor; metabolite; mycotoxin |
cis-3-hexenyl acetate | [no description available] | low | 0 | 0 | acetate ester; olefinic compound | metabolite |
pipercallosidine | [no description available] | low | 0 | 0 | alkaloid; benzodioxoles; enamide; secondary carboxamide | apoptosis inducer; metabolite; plant metabolite |
n-(4-hydroxy-beta-phenethyl)-4-hydroxycinnamide | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
7-hydroxyisoflavone | [no description available] | low | 0 | 0 | 7-hydroxyisoflavones | EC 1.14.14.14 (aromatase) inhibitor; metabolite |
flazin | [no description available] | low | 0 | 0 | harmala alkaloid | metabolite |
11-hydroxynoracronycine | [no description available] | low | 0 | 0 | acridines | metabolite |
jaceosidin | [no description available] | low | 0 | 0 | dimethoxyflavone; trihydroxyflavone | anti-allergic agent; anti-inflammatory agent; antineoplastic agent; apoptosis inducer; metabolite |
5,7,3'-trihydroxy-3,4'-dimethoxyflavone | [no description available] | low | 0 | 0 | dimethoxyflavone; trihydroxyflavone | antineoplastic agent; metabolite |
salutaridine | [no description available] | low | 0 | 0 | morphinane alkaloid | anti-HBV agent; metabolite |
cytochalasin e | [no description available] | low | 0 | 0 | cytochalasan alkaloid | metabolite |
artocarpin lectin | [no description available] | low | 0 | 0 | monomethoxyflavone; trihydroxyflavone | antineoplastic agent; metabolite |
fumarates | [no description available] | low | 0 | 0 | butenedioate; C4-dicarboxylate | human metabolite; metabolite; Saccharomyces cerevisiae metabolite |
bleomycin | [no description available] | low | 0 | 0 | bleomycin | antineoplastic agent; metabolite |
1,7-dihydroxy-4-methoxyxanthone | [no description available] | low | 0 | 0 | aromatic ether; phenols; xanthones | metabolite; plant metabolite |
demethoxycurcumin | [no description available] | low | 0 | 0 | beta-diketone; diarylheptanoid; enone; polyphenol | anti-inflammatory agent; antineoplastic agent; metabolite |
bergamottin | [no description available] | low | 0 | 0 | furanocoumarin | metabolite |
alanyl-alanyl-alanine | [no description available] | low | 0 | 0 | tripeptide | metabolite |
24-ethyl-4-cholesten-3-one | [no description available] | low | 0 | 0 | C29-steroid; steroid | metabolite |
myricetin 3-o-glucuronide | [no description available] | low | 0 | 0 | monosaccharide derivative; myricetin O-glucuronide; pentahydroxyflavone | metabolite |
phenylalanylalanine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
alpinumisoflavone | [no description available] | low | 0 | 0 | isoflavanones | metabolite |
alpha-aspartylalanine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
arglabin | [no description available] | low | 0 | 0 | epoxide; gamma-lactone; organic heterotetracyclic compound; sesquiterpene lactone | antineoplastic agent; metabolite |
ap 10 | [no description available] | low | 0 | 0 | diterpene lactone | metabolite |
quercetin 7-rhamnoside | [no description available] | low | 0 | 0 | alpha-L-rhamnoside; flavonols; monosaccharide derivative; quercetin O-glycoside; tetrahydroxyflavone | metabolite |
albonoursin | [no description available] | low | 0 | 0 | 2,5-diketopiperazines | metabolite |
oroidin | [no description available] | low | 0 | 0 | pyrroles; secondary carboxamide | metabolite |
monorden | [no description available] | low | 0 | 0 | cyclic ketone; enone; epoxide; macrolide antibiotic; monochlorobenzenes; phenols | antifungal agent; metabolite; tyrosine kinase inhibitor |
apratoxin a | [no description available] | low | 0 | 0 | 1,3-thiazoles; apratoxin | antineoplastic agent; metabolite |
(-)-catechin-3-O-gallate | [no description available] | low | 0 | 0 | flavans; gallate ester; polyphenol | metabolite |
aspartyllysine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
arginyllysine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
hygromycin a | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
latrunculin b | [no description available] | low | 0 | 0 | cyclic hemiketal; macrolide; oxabicycloalkane; thiazolidinone | actin polymerisation inhibitor; metabolite; toxin |
falcarindiol | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
dehydroergosterol | [no description available] | low | 0 | 0 | 3beta-hydroxy-Delta(5)-steroid; 3beta-sterol; ergostanoid; phytosterols | biomarker; metabolite |
n-oleoylglycine | [no description available] | low | 0 | 0 | fatty amide; N-acylglycine 18:1 | metabolite |
rhizoxin | [no description available] | low | 0 | 0 | 1,3-oxazoles; epoxide; macrolide antibiotic | antimitotic; antineoplastic agent; metabolite |
manoalide | [no description available] | low | 0 | 0 | butenolide; lactol; sesterterpenoid | EC 3.1.1.4 (phospholipase A2) inhibitor; EC 5.99.1.2 (DNA topoisomerase) inhibitor; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; metabolite |
concanamycin a | [no description available] | low | 0 | 0 | carbamate ester; concanamycin | antifungal agent; EC 3.6.3.14 (H(+)-transporting two-sector ATPase) inhibitor; metabolite |
n(3)-(4-methoxyfumaroyl)-2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | enoate ester; methyl ester; monocarboxylic acid amide | metabolite |
thunberginol f | [no description available] | low | 0 | 0 | catechols; gamma-lactone; isobenzofuranone | metabolite; plant metabolite |
pyracrenic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
eicosa-11,14-dienoic acid, (z,z)-isomer | [no description available] | low | 0 | 0 | icosadienoic acid | metabolite |
yuanhuadine | [no description available] | low | 0 | 0 | diterpenoid | metabolite |
tiglylglycine | [no description available] | low | 0 | 0 | N-acylglycine | metabolite |
rhodiocyanoside a | [no description available] | low | 0 | 0 | aliphatic nitrile; beta-D-glucoside; cyanogenic glycoside; monosaccharide derivative | anti-allergic agent; metabolite |
(2E,4E)-N-isobutyl-2,4-dodecadienamide | [no description available] | low | 0 | 0 | fatty amide | metabolite |
mycothiazole | [no description available] | low | 0 | 0 | thiazoles | metabolite |
13-oxo-9,11-octadecadienoic acid | [no description available] | low | 0 | 0 | 13-oxo-9,11-octadecadienoic acid | metabolite; mouse metabolite |
linderalactone | [no description available] | low | 0 | 0 | butenolide | metabolite |
pros-methylimidazoleacetic acid | [no description available] | low | 0 | 0 | imidazolyl carboxylic acid | metabolite |
cellobionic acid | [no description available] | low | 0 | 0 | carbohydrate acid; disaccharide | metabolite |
pseudopteroxazole | [no description available] | low | 0 | 0 | tetralins | metabolite |
sophoraflavanone a | [no description available] | low | 0 | 0 | (2S)-flavan-4-one; 4'-hydroxyflavanones; trihydroxyflavanone | antibacterial agent; antineoplastic agent; metabolite |
panduratin a | [no description available] | low | 0 | 0 | diarylheptanoid | metabolite |
stigmasterol 3-o-beta-d-glucopyranoside | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative; phytosterols; steroid saponin | metabolite |
17-hydroxyjolkinolide b | [no description available] | low | 0 | 0 | diterpene lactone | metabolite |
sq-23377 | [no description available] | low | 0 | 0 | cyclic ether; enol; polyunsaturated fatty acid; very long-chain fatty acid | calcium ionophore; metabolite |
corosolic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
cyclo(prolyl-valyl) | [no description available] | low | 0 | 0 | piperazinone | metabolite |
phenylalanylglycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
leucyl-phenylalanine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
glutamylalanine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
glutaminyl-glycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
methionylglycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
valylleucine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
phenylalanyl-valine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
cyclo(glycyltryptophyl) | [no description available] | low | 0 | 0 | indoles | metabolite |
alanylglycine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
valyltyrosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
alpha-glutamyltryptophan | [no description available] | low | 0 | 0 | dipeptide | metabolite |
lysylglutamic acid | [no description available] | low | 0 | 0 | dipeptide | metabolite |
methionylglutamic acid | [no description available] | low | 0 | 0 | dipeptide | metabolite |
seryl-histidine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
arginyl-glutamine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
phenylalanylproline | [no description available] | low | 0 | 0 | dipeptide | metabolite |
lysylglycine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
glycylhistidine | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
kopsinine | [no description available] | low | 0 | 0 | indole alkaloid | metabolite |
cyclo(leucyl-phenylalanyl) | [no description available] | low | 0 | 0 | 2,5-diketopiperazines | metabolite |
prolylisoleucine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
isoleucyl-tyrosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
prolyl-serine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
grayanotoxin i | [no description available] | low | 0 | 0 | acetate ester; pentol; secondary alcohol; tertiary alcohol; tetracyclic diterpenoid | antihypertensive agent; metabolite; neuromuscular agent; phytotoxin |
19-norandrosterone | [no description available] | low | 0 | 0 | 17-oxo steroid | metabolite |
s-allylcysteine | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; S-hydrocarbyl-L-cysteine | antineoplastic agent; metabolite |
oleandrigenin | [no description available] | low | 0 | 0 | 14beta-hydroxy steroid; 3beta-hydroxy steroid; steroid ester | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; metabolite |
valyl-prolyl-proline | [no description available] | low | 0 | 0 | tripeptide | metabolite |
prolylvaline | [no description available] | low | 0 | 0 | dipeptide | metabolite |
palbinone | [no description available] | low | 0 | 0 | 16-oxo steroid | metabolite |
pseurotin | [no description available] | low | 0 | 0 | azaspiro compound; lactam; oxaspiro compound | metabolite |
gambogic acid | [no description available] | low | 0 | 0 | pyranoxanthones | metabolite |
xenovulene a | [no description available] | low | 0 | 0 | cyclic ether; enone; organic heterotetracyclic compound; sesquiterpenoid | GABA antagonist; metabolite |
fr 148083 | [no description available] | low | 0 | 0 | aromatic ether; macrolide; phenols; secondary alcohol; secondary alpha-hydroxy ketone | antibacterial agent; antineoplastic agent; metabolite; NF-kappaB inhibitor |
LL-Z1640-1 | [no description available] | low | 0 | 0 | macrolide; resorcinols | metabolite |
9-methoxycanthin-6-one | [no description available] | low | 0 | 0 | aromatic ether; indole alkaloid; organic heterotetracyclic compound | antineoplastic agent; antiplasmodial drug; metabolite |
n-acetylcarnosine | [no description available] | low | 0 | 0 | dipeptide | metabolite |
cholest-5-en-3-one | [no description available] | low | 0 | 0 | 3-oxo-Delta(5)-steroid; cholestanoid | metabolite |
kaempferol 3-O-beta-L-glucopyranoside | [no description available] | low | 0 | 0 | beta-L-glucoside; flavonols; kaempferol O-glucoside; monosaccharide derivative; trihydroxyflavone | metabolite |
rubraxanthone | [no description available] | low | 0 | 0 | aromatic ether; polyphenol; xanthones | antibacterial agent; antineoplastic agent; metabolite |
ubiquinol | [no description available] | low | 0 | 0 | polyprenylhydroquinone; ubiquinol | biomarker; metabolite |
landomycin a | [no description available] | low | 0 | 0 | oligosaccharide | metabolite |
ancistroealaine a | [no description available] | low | 0 | 0 | aromatic ether; biaryl; isoquinoline alkaloid; isoquinolines; methoxynaphthalene; methylnaphthalenes | antileishmanial agent; antiplasmodial drug; metabolite; trypanocidal drug |
cerberin | [no description available] | low | 0 | 0 | acetate ester; cardenolide glycoside; monosaccharide derivative | antineoplastic agent; metabolite |
actein | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
araloside a | [no description available] | low | 0 | 0 | triterpenoid saponin | metabolite |
ageladine a | [no description available] | low | 0 | 0 | alkaloid; aromatic amine; imidazopyridine; organobromine compound; pyrroles | angiogenesis inhibitor; antineoplastic agent; matrix metalloproteinase inhibitor; metabolite |
corynoxine b | [no description available] | low | 0 | 0 | indolizines | metabolite |
kaempferol 7-o-glucoside | [no description available] | low | 0 | 0 | beta-D-glucoside; flavonols; kaempferol O-glucoside; monosaccharide derivative; trihydroxyflavone | metabolite; plant metabolite; radical scavenger |
delphinidin 3-sambubioside | [no description available] | low | 0 | 0 | anthocyanidin 3-O-beta-D-sambubioside | apoptosis inducer; metabolite |
nodosin | [no description available] | low | 0 | 0 | delta-lactone | metabolite |
protylonolide | [no description available] | low | 0 | 0 | diol; enone; macrolide | metabolite |
arisugacin | [no description available] | low | 0 | 0 | aromatic ether; delta-lactone; enone; organic heterotetracyclic compound; tertiary alcohol | antimicrobial agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite; Penicillium metabolite |
nymphaeol c | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; tetrahydroxyflavanone | metabolite; radical scavenger |
thonningianin a | [no description available] | low | 0 | 0 | tannin | metabolite |
cephalostatin i | [no description available] | low | 0 | 0 | oxo steroid | metabolite |
papyriflavonol a | [no description available] | low | 0 | 0 | 3'-hydroxyflavonoid; flavonols; pentahydroxyflavone | EC 1.14.18.1 (tyrosinase) inhibitor; EC 3.1.1.4 (phospholipase A2) inhibitor; metabolite |
lactonamycin | [no description available] | low | 0 | 0 | gamma-lactone; organic heterohexacyclic compound; phenols; trideoxyhexose derivative | antibacterial agent; antimicrobial agent; metabolite |
myrsinoic acid b | [no description available] | low | 0 | 0 | 1-benzofurans; monocarboxylic acid | anti-inflammatory agent; EC 4.4.1.11 (methionine gamma-lyase) inhibitor; metabolite |
betulone | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
eckstolonol | [no description available] | low | 0 | 0 | organic heteropentacyclic compound; oxacycle; phlorotannin | metabolite; radical scavenger |
manassantin b | [no description available] | low | 0 | 0 | benzodioxoles; dimethoxybenzene; lignan; oxolanes; secondary alcohol | antineoplastic agent; metabolite |
gitaloxin | [no description available] | low | 0 | 0 | cardenolide glycoside | metabolite |
paeonilide | [no description available] | low | 0 | 0 | benzoate ester | metabolite |
dihydroxanthohumol | [no description available] | low | 0 | 0 | aromatic ether; dihydrochalcones; polyphenol | EC 1.14.13.39 (nitric oxide synthase) inhibitor; metabolite |
corynoxine | [no description available] | low | 0 | 0 | indolizines | metabolite |
7-phloroeckol | [no description available] | low | 0 | 0 | aromatic ether; phlorotannin | antioxidant; EC 3.1.1.3 (triacylglycerol lipase) inhibitor; metabolite |
(+)-lyoniresinol-3-alpha-O-beta-D-glucopyranoside | [no description available] | low | 0 | 0 | beta-D-glucoside; dimethoxybenzene; lignan; monosaccharide derivative; polyphenol; primary alcohol; tetralins | antibacterial agent; antifungal agent; metabolite |
Sphaeropsidin C | [no description available] | low | 0 | 0 | tricyclic diterpenoid | metabolite |
kelampayoside a | [no description available] | low | 0 | 0 | glycoside | metabolite |
3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-beta-D-glucopyranoside | [no description available] | low | 0 | 0 | aromatic ether; benzyl alcohols; beta-D-glucoside; monosaccharide derivative; primary alcohol | antineoplastic agent; metabolite |
2,3-dihydro-3beta-methoxy withaferin A | [no description available] | low | 0 | 0 | 27-hydroxy steroid; 4-hydroxy steroid; delta-lactone; epoxy steroid; ergostanoid; primary alcohol; secondary alcohol; withanolide | metabolite; plant metabolite |
nigranoic acid | [no description available] | low | 0 | 0 | dicarboxylic acid; tetracyclic triterpenoid | antineoplastic agent; HIV-1 reverse transcriptase inhibitor; metabolite |
esculeoside a | [no description available] | low | 0 | 0 | azaspiro compound; oxaspiro compound; saponin; steroid alkaloid; steroid saponin | antineoplastic agent; metabolite |
aerothionin | [no description available] | low | 0 | 0 | isoxazoles | metabolite |
artemisic acid | [no description available] | low | 0 | 0 | carbobicyclic compound; monocarboxylic acid; octahydronaphthalenes; sesquiterpenoid | metabolite |
26-deoxyactein | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
5-formylcytosine | [no description available] | low | 0 | 0 | aminopyrimidine; heteroarenecarbaldehyde; nucleobase analogue; pyrimidone | metabolite |
migrastatin | [no description available] | low | 0 | 0 | ether; macrolide antibiotic; piperidones; secondary alcohol | antineoplastic agent; metabolite |
Lyngbic acid | [no description available] | low | 0 | 0 | long-chain fatty acid | metabolite |
2,3,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)-5-(2-methylbut-3-en-2-yl)-9h-xanthen-9-one | [no description available] | low | 0 | 0 | polyphenol; xanthones | anti-inflammatory agent; antineoplastic agent; EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor; metabolite |
bielschowskysin | [no description available] | low | 0 | 0 | acetate ester; cyclic acetal; diterpenoid; gamma-lactone; organic heterohexacyclic compound | antimalarial; antineoplastic agent; metabolite |
procyanidin b1 | [no description available] | low | 0 | 0 | biflavonoid; hydroxyflavan; polyphenol; proanthocyanidin | anti-inflammatory agent; EC 3.4.21.5 (thrombin) inhibitor; metabolite |
cyclo(tyrosyl-tyrosyl) | [no description available] | low | 0 | 0 | cyclo(tyrosyl-tyrosyl) | metabolite |
spiculoic acid a | [no description available] | low | 0 | 0 | carbobicyclic compound; cyclic ketone; oxo monocarboxylic acid; styrenes | antineoplastic agent; metabolite |
myrocin a | [no description available] | low | 0 | 0 | tertiary alcohol | metabolite |
3'-o-methylepicatechin | [no description available] | low | 0 | 0 | catechin | metabolite |
episilvestrol | [no description available] | low | 0 | 0 | dioxanes; ether; methyl ester; organic heterotricyclic compound | antineoplastic agent; metabolite |
protopanaxatriol | [no description available] | low | 0 | 0 | 12beta-hydroxy steroid; 3beta-hydroxy-4,4-dimethylsteroid; 3beta-hydroxy steroid; 6alpha-hydroxy steroid; sapogenin; tetracyclic triterpenoid | metabolite |
laurinterol | [no description available] | low | 0 | 0 | organobromine compound; phenols; sesquiterpenoid | antibacterial agent; apoptosis inducer; EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor; metabolite |
Pseudopterosin G-J aglycone | [no description available] | low | 0 | 0 | diterpenoid | metabolite |
ceratamine a | [no description available] | low | 0 | 0 | alkaloid; aromatic ether; cyclic ketone; organic heterobicyclic compound; organobromine compound; secondary amino compound; tertiary amine | antimitotic; metabolite |
liphagal | [no description available] | low | 0 | 0 | aldehyde; cyclic ether; meroterpenoid; organic heterotetracyclic compound; polyphenol | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor; metabolite |
pulsatilla saponin d | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
diversonol | [no description available] | low | 0 | 0 | phenols; tertiary alcohol | antibacterial agent; metabolite |
neotuberostemonine | [no description available] | low | 0 | 0 | alkaloid | metabolite |
drymaritin | [no description available] | low | 0 | 0 | enol ether; enone; indole alkaloid; organic heterotetracyclic compound | anti-HIV agent; metabolite |
lyoniresinol | [no description available] | low | 0 | 0 | dimethoxybenzene; lignan; polyphenol; primary alcohol; tetralins | antineoplastic agent; metabolite |
silvestrol | [no description available] | low | 0 | 0 | dioxanes; ether; methyl ester; organic heterotricyclic compound | antineoplastic agent; metabolite |
ginsenoside ro | [no description available] | low | 0 | 0 | triterpenoid saponin | metabolite |
diosgenin glucoside | [no description available] | low | 0 | 0 | hexacyclic triterpenoid; monosaccharide derivative; spiroketal; sterol 3-beta-D-glucoside | metabolite |
pyripyropene a | [no description available] | low | 0 | 0 | organic heterotetracyclic compound; sesquiterpenoid | acyl-CoA:cholesterol acyltransferase 2 inhibitor; metabolite |
3-epioleanolic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
leucylproline | [no description available] | low | 0 | 0 | dipeptide zwitterion; dipeptide | metabolite |
R-(-)-actinodaphnine | [no description available] | low | 0 | 0 | aporphine alkaloid | metabolite |
cytotrienin a | [no description available] | low | 0 | 0 | cyclopropanecarboxylate ester; ether; hydroquinones; lactam; macrocycle; secondary alcohol | antibacterial agent; antimicrobial agent; antineoplastic agent; apoptosis inducer; metabolite |
methylamphotericin b | [no description available] | low | 0 | 0 | macrolide; methyl ester; monosaccharide derivative | antifungal agent; antiinfective agent; metabolite |
2'-methoxykurarinone | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; dihydroxyflavanone; dimethoxyflavanone | antineoplastic agent; metabolite |
verproside | [no description available] | low | 0 | 0 | glycoside | metabolite |
verminoside | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
minecoside | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
(R)-(+)-6',7'-dihydroxybergamottin | [no description available] | low | 0 | 0 | furanocoumarin | metabolite |
lapidilectine b | [no description available] | low | 0 | 0 | indolyl carboxylic acid | metabolite |
batzelladine a | [no description available] | low | 0 | 0 | alkaloid; carboxylic ester; guanidines; organic heterotricyclic compound; pyrrolopyrimidine; triazaacenaphthylene | anti-HIV-1 agent; metabolite |
alloin | [no description available] | low | 0 | 0 | anthracenes; C-glycosyl compound; cyclic ketone; phenols | laxative; metabolite |
longipinene | [no description available] | low | 0 | 0 | alpha-longipinene | metabolite |
parkeol | [no description available] | low | 0 | 0 | 3beta-hydroxy-4,4-dimethylsteroid; 3beta-sterol; tetracyclic triterpenoid | metabolite |
rutundic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
a-factor (streptomyces) | [no description available] | low | 0 | 0 | butan-4-olide; primary alcohol | metabolite |
taraxasteryl acetate | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
chikusetsu saponin iva | [no description available] | low | 0 | 0 | triterpenoid saponin | metabolite |
xestoaminol c | [no description available] | low | 0 | 0 | amino alcohol; sphingoid | metabolite |
malyngamide A | [no description available] | low | 0 | 0 | dicarboximide | metabolite |
simalikalactone D | [no description available] | low | 0 | 0 | cyclic ether; delta-lactone; enone; organic heteropentacyclic compound; quassinoid; secondary alcohol; secondary alpha-hydroxy ketone; triol | antimalarial; antineoplastic agent; antiviral agent; metabolite |
friedelane | [no description available] | low | 0 | 0 | triterpene | metabolite |
shamixanthone | [no description available] | low | 0 | 0 | cyclic ketone; phenols; pyranoxanthene | metabolite |
17,18-epoxy-5,8,11,14-eicosatetraenoic acid | [no description available] | low | 0 | 0 | EpETE | metabolite |
chaetominine | [no description available] | low | 0 | 0 | indole alkaloid; lactam; organic heterotetracyclic compound; quinazolines | metabolite |
schweinfurthin g | [no description available] | low | 0 | 0 | cyclic ether; organic heterotricyclic compound; resorcinols; stilbenoid | antineoplastic agent; metabolite |
salmon calcitonin | [no description available] | low | 0 | 0 | heterodetic cyclic peptide; peptide hormone; polypeptide | bone density conservation agent; metabolite |
complestatin | [no description available] | low | 0 | 0 | cyclic ether; heterodetic cyclic peptide; indoles; organic heterobicyclic compound; organochlorine compound; peptide antibiotic; polyphenol | anti-HIV-1 agent; antimicrobial agent; HIV-1 integrase inhibitor; metabolite |
neuroprotectin a | [no description available] | low | 0 | 0 | cyclic ether; heterodetic cyclic peptide; indoles; organochlorine compound; polyphenol | HIV-1 integrase inhibitor; metabolite |
alx-0600 | [no description available] | low | 0 | 0 | polypeptide | antioxidant; glucagon-like peptide-2 receptor agonist; metabolite; protective agent |
schweinfurthin f | [no description available] | low | 0 | 0 | cyclic ether; organic heterotricyclic compound; resorcinols; stilbenoid | metabolite |
antrocamphin a | [no description available] | low | 0 | 0 | methoxybenzenes | anti-inflammatory agent; metabolite |
respirantin | [no description available] | low | 0 | 0 | benzamides; cyclodepsipeptide; formamides; phenols | antimicrobial agent; antineoplastic agent; metabolite |
streptobiosamine | [no description available] | low | 0 | 0 | amino disaccharide | metabolite |
interiotherin b | [no description available] | low | 0 | 0 | aromatic ether; fatty acid ester; lignan; organic heteropentacyclic compound; oxacycle | anti-HIV agent; metabolite |
succinyladenosine | [no description available] | low | 0 | 0 | adenosines; amino dicarboxylic acid; L-aspartic acid derivative | metabolite |
6-tuliposide a | [no description available] | low | 0 | 0 | 6-O-acyl-D-glucose; homoallylic alcohol | allergen; metabolite |
glycochenodeoxycholate-3-sulfate | [no description available] | low | 0 | 0 | 7alpha-hydroxy steroid; bile acid glycine conjugate; steroid sulfate | metabolite |
wewakazole | [no description available] | low | 0 | 0 | cyclic peptide | metabolite |
spongia-13(16),14-dien-19-oic acid | [no description available] | low | 0 | 0 | cyclic ether; monocarboxylic acid; tetracyclic diterpenoid | androgen antagonist; metabolite |
Icariside E4 | [no description available] | low | 0 | 0 | benzofurans | metabolite |
lucidenic acid n | [no description available] | low | 0 | 0 | cyclic terpene ketone; dioxo monocarboxylic acid; secondary alcohol; tetracyclic triterpenoid | antineoplastic agent; EC 3.1.1.8 (cholinesterase) inhibitor; metabolite |
dihydroagarofuran | [no description available] | low | 0 | 0 | bridged compound; cyclic ether; eudesmane sesquiterpenoid; organic heterotricyclic compound | metabolite |
23-epi-26-deoxyactein | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
23-hydroxybetulinic acid | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
(1S,3aR,4S,6S,6aS,9aS,9bS)-9a-isocyano-6-(2-isocyano-2-methylpropyl)-1,4-dimethyl-7-methylidene-2,3,3a,4,5,6,6a,8,9,9b-decahydro-1H-phenalene | [no description available] | low | 0 | 0 | diterpenoid | metabolite |
bromophycolide a | [no description available] | low | 0 | 0 | diterpenoid; macrolide; organobromine compound; phenols; tertiary alcohol | anti-HIV agent; antibacterial agent; antifungal agent; antimalarial; antineoplastic agent; metabolite |
2-acetamidoglucal | [no description available] | low | 0 | 0 | acetamides; glycal derivative | metabolite |
diorcinol | [no description available] | low | 0 | 0 | aromatic ether; phenols | fungal metabolite; marine metabolite; metabolite |
caribenol a | [no description available] | low | 0 | 0 | organic heterotetracyclic compound; terpene lactone; tertiary alcohol | antimalarial; antitubercular agent; metabolite |
halisulfate 1 | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
6-O-feruloylcatalpol | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
grassypeptolide | [no description available] | low | 0 | 0 | cyclodepsipeptide; macrocycle | antineoplastic agent; metabolite |
essramycin | [no description available] | low | 0 | 0 | triazolopyrimidines | metabolite |
ainsliadimer a | [no description available] | low | 0 | 0 | sesquiterpene lactone; spiro compound | EC 1.14.13.39 (nitric oxide synthase) inhibitor; metabolite |
salvileucalin b | [no description available] | low | 0 | 0 | bridged compound; diterpenoid; furans; gamma-lactone | antineoplastic agent; metabolite |
ciliatamide a | [no description available] | low | 0 | 0 | caprolactams; lipopeptide | antileishmanial agent; metabolite |
etnangien | [no description available] | low | 0 | 0 | hydroxy monocarboxylic acid; macrolide antibiotic | antibacterial agent; metabolite |
latrunculol a | [no description available] | low | 0 | 0 | macrolide | metabolite |
N-trans-sinapoyltyramine | [no description available] | low | 0 | 0 | hydroxycinnamic acid | metabolite |
lycojapodine a | [no description available] | low | 0 | 0 | alkaloid; bridged compound; cyclic ketone; lactone; organic heterotetracyclic compound | anti-HIV-1 agent; EC 3.1.1.7 (acetylcholinesterase) inhibitor; metabolite |
epi-maslinic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; pentacyclic triterpenoid | anti-inflammatory agent; metabolite |
eoxin c4 | [no description available] | low | 0 | 0 | eoxin; leukotriene | metabolite |
brartemicin | [no description available] | low | 0 | 0 | benzoate ester; glycosyl glycoside derivative; resorcinols | antimicrobial agent; metabolite |
Majusculamide AB | [no description available] | low | 0 | 0 | amino acid amide | metabolite |
7,8-dihydroxyflavanone | [no description available] | low | 0 | 0 | dihydroxyflavanone | antineoplastic agent; metabolite |
antcin a | [no description available] | low | 0 | 0 | ergostanoid | metabolite |
integric acid | [no description available] | low | 0 | 0 | carboxylic ester; cyclic ketone; dioxo monocarboxylic acid; enal; enone; eremophilane sesquiterpenoid | HIV-1 integrase inhibitor; metabolite |
vanilloloside | [no description available] | low | 0 | 0 | glycoside | metabolite |
2,3-dihydro-3beta-O-sulfate withaferin A | [no description available] | low | 0 | 0 | 27-hydroxy steroid; 4-hydroxy steroid; delta-lactone; epoxy steroid; ergostanoid; primary alcohol; steroid sulfate; withanolide | antineoplastic agent; metabolite; plant metabolite |
dicranin | [no description available] | low | 0 | 0 | acetylenic fatty acid; long-chain fatty acid; straight-chain fatty acid; trienoic fatty acid | antibacterial agent; EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor; metabolite |
leachianone a | [no description available] | low | 0 | 0 | 4'-hydroxyflavanones; monomethoxyflavanone; trihydroxyflavanone | antimalarial; antineoplastic agent; metabolite |
hordatine a | [no description available] | low | 0 | 0 | aromatic ether; benzofurans; dicarboxylic acid diamide; guanidines; phenols | adrenergic antagonist; metabolite |
englerin a | [no description available] | low | 0 | 0 | cinnamate ester; glycolate ester; guaiane sesquiterpenoid | antineoplastic agent; metabolite |
monanchocidin | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
eurycomanone | [no description available] | low | 0 | 0 | cyclic ether; delta-lactone; enone; organic heteropentacyclic compound; pentol; quassinoid; secondary alcohol; secondary alpha-hydroxy ketone; tertiary alcohol | antimalarial; antineoplastic agent; metabolite |
sphaeropsidin a | [no description available] | low | 0 | 0 | gamma-lactone | metabolite |
gardenoside | [no description available] | low | 0 | 0 | beta-D-glucoside; cyclopentapyran; enoate ester; methyl ester; monosaccharide derivative; tertiary alcohol | metabolite |
landomycin d | [no description available] | low | 0 | 0 | anthraquinone | metabolite |
3alpha,12alpha-dihydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 12alpha-hydroxy steroid; 3alpha-hydroxy steroid; 7-oxo steroid; monocarboxylic acid; secondary alpha-hydroxy ketone; steroid acid | antineoplastic agent; metabolite |
antcin k | [no description available] | low | 0 | 0 | bile acid | metabolite |
3alpha-hydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | [no description available] | low | 0 | 0 | 11-oxo steroid; 3alpha-hydroxy steroid; 7-oxo steroid; monocarboxylic acid; steroid acid | antineoplastic agent; cholinergic antagonist; metabolite; serotonergic antagonist |
shizukaol B | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
shizukaol f | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
calicheamicin gamma(1)i | [no description available] | low | 0 | 0 | calicheamicin; enediyne antibiotic; organoiodine compound | antineoplastic agent; metabolite |
staphyloxanthin | [no description available] | low | 0 | 0 | apo carotenoid triterpenoid; D-aldohexose derivative; fatty acid ester; triol; xanthophyll | antioxidant; biological pigment; metabolite; virulence factor |
sm 1 peptide | [no description available] | low | 0 | 0 | acetate ester; ergot alkaloid | metabolite |
mycocyclosin | [no description available] | low | 0 | 0 | 2,5-diketopiperazines; organic heterotetracyclic compound; polyphenol | metabolite |
callipeltin a | [no description available] | low | 0 | 0 | cyclodepsipeptide; guanidines; lactone; oligopeptide; phenols | anti-HIV-1 agent; antifungal agent; metabolite |
vinylamycin | [no description available] | low | 0 | 0 | cyclodepsipeptide; macrocycle; primary alcohol | antibacterial agent; antimicrobial agent; metabolite |
promegestone | [no description available] | low | 0 | 0 | terpene lactone | metabolite |
lancifodilactone g | [no description available] | low | 0 | 0 | cyclic ether; diol; enol; gamma-lactone; oxaspiro compound; triterpenoid | anti-HIV agent; metabolite |
rediocide a | [no description available] | low | 0 | 0 | diterpenoid; epoxide; ortho ester; terpene lactone | insecticide; metabolite |
lasiokaurin | [no description available] | low | 0 | 0 | kaurane diterpenoid | metabolite |
longikaurin a | [no description available] | low | 0 | 0 | kaurane diterpenoid | metabolite |
ponicidin | [no description available] | low | 0 | 0 | dioxanes | metabolite |
(Z)-6,6',7,3'a-Diligustilide | [no description available] | low | 0 | 0 | butenolide | metabolite |
suvanine | [no description available] | low | 0 | 0 | organic molecular entity | metabolite |
shizukaol d | [no description available] | low | 0 | 0 | triterpenoid | metabolite |
thailandepsin a | [no description available] | low | 0 | 0 | cyclodepsipeptide | metabolite |
nordidemnin b | [no description available] | low | 0 | 0 | didemnin | metabolite |
4-formylaminooxyvinylglycine | [no description available] | low | 0 | 0 | non-proteinogenic alpha-amino acid | metabolite |
platycoside e | [no description available] | low | 0 | 0 | triterpenoid saponin | metabolite |
leuconoxine | [no description available] | low | 0 | 0 | alkaloid | metabolite |
epidermin | [no description available] | low | 0 | 0 | macrocycle; type A lantibiotic | antibacterial agent; metabolite |
surfactin A | [no description available] | low | 0 | 0 | cyclodepsipeptide; lipopeptide antibiotic; macrocyclic lactone | antibacterial agent; antifungal agent; antineoplastic agent; antiviral agent; metabolite; surfactant |
myriaporone 3 | [no description available] | low | 0 | 0 | beta-hydroxy ketone; epoxide; lactol; oxanes; primary alcohol; secondary alcohol | antineoplastic agent; metabolite |
avenacoside b | [no description available] | low | 0 | 0 | beta-D-glucoside; hexacyclic triterpenoid; spiroketal; steroid saponin; tetrasaccharide derivative | metabolite |
3-methylglutarylcarnitine | [no description available] | low | 0 | 0 | O-methylglutarylcarnitine | metabolite |
pivaloylcarnitine | [no description available] | low | 0 | 0 | C5-acylcarnitine | metabolite |
levoleucovorin | [no description available] | low | 0 | 0 | 5-formyltetrahydrofolic acid | antineoplastic agent; metabolite |
7,8-dihydroneopterin | [no description available] | low | 0 | 0 | dihydropterin; neopterins | Escherichia coli metabolite; human metabolite; metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
guanosine monophosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-monophosphate | biomarker; Escherichia coli metabolite; metabolite; mouse metabolite |
2-amino-4-oxo-6-acetyl-7,8-dihydro-3h,9h-pyrimidodiazepine | [no description available] | low | 0 | 0 | methyl ketone; pyrimidodiazepine | metabolite |
dyspropterin | [no description available] | low | 0 | 0 | biopterins; tetrahydropterin | human metabolite; metabolite; mouse metabolite |
2'-o-methylguanosine | [no description available] | low | 0 | 0 | methylguanosine | metabolite |
allopurinol riboside | [no description available] | low | 0 | 0 | nucleoside analogue | metabolite |
norclozapine | [no description available] | low | 0 | 0 | dibenzodiazepine; organochlorine compound; piperazines | delta-opioid receptor agonist; metabolite; serotonergic antagonist |
7-methylguanosine | [no description available] | low | 0 | 0 | methylguanosine; organic cation | metabolite |
3'-o-methylguanosine | [no description available] | low | 0 | 0 | methylguanosine | metabolite |
primapterin | [no description available] | low | 0 | 0 | biopterins | metabolite |
7-methylinosine | [no description available] | low | 0 | 0 | inosines; organic cation | metabolite |
marineosin a | [no description available] | low | 0 | 0 | azaspiro compound; ether; macrocycle; oxaspiro compound; pyrroles | antineoplastic agent; metabolite |
marineosin b | [no description available] | low | 0 | 0 | azaspiro compound; ether; macrocycle; oxaspiro compound; pyrroles | antineoplastic agent; metabolite |
monoisopropanolamine | [no description available] | low | 0 | 0 | amino alcohol; secondary alcohol | Escherichia coli metabolite |
dihydro-3-coumaric acid | [no description available] | low | 0 | 0 | monocarboxylic acid | Escherichia coli metabolite; human xenobiotic metabolite |
3-mercaptopyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; thiol | antidote to cyanide poisoning; Escherichia coli metabolite; human metabolite; mouse metabolite |
4-aminobutyraldehyde | [no description available] | low | 0 | 0 | aminobutanal; omega-aminoaldehyde | Escherichia coli metabolite; mouse metabolite |
aminolevulinic acid | [no description available] | low | 0 | 0 | 4-oxo monocarboxylic acid; amino acid zwitterion; delta-amino acid | antineoplastic agent; dermatologic drug; Escherichia coli metabolite; human metabolite; mouse metabolite; photosensitizing agent; plant metabolite; prodrug; Saccharomyces cerevisiae metabolite |
5,6,7,8-tetrahydropteridine | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
acetaldehyde | [no description available] | low | 0 | 0 | aldehyde | carcinogenic agent; EC 3.5.1.4 (amidase) inhibitor; electron acceptor; Escherichia coli metabolite; human metabolite; mouse metabolite; mutagen; oxidising agent; Saccharomyces cerevisiae metabolite; teratogenic agent |
acetyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
adenine | [no description available] | low | 0 | 0 | 6-aminopurines; purine nucleobase | Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
agmatine | [no description available] | low | 0 | 0 | guanidines; primary amino compound | Escherichia coli metabolite; mouse metabolite |
allantoin | [no description available] | low | 0 | 0 | imidazolidine-2,4-dione; ureas | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite; vulnerary |
aminoacetone | [no description available] | low | 0 | 0 | methyl ketone; propanones | Escherichia coli metabolite; mouse metabolite |
arsenic acid | [no description available] | low | 0 | 0 | arsenic oxoacid | Escherichia coli metabolite |
betaine aldehyde | [no description available] | low | 0 | 0 | quaternary ammonium ion | Aspergillus metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
butyraldehyde | [no description available] | low | 0 | 0 | butanals | biomarker; Escherichia coli metabolite; mouse metabolite |
cadaverine | [no description available] | low | 0 | 0 | alkane-alpha,omega-diamine | Daphnia magna metabolite; Escherichia coli metabolite; mouse metabolite; plant metabolite |
carbamic acid | [no description available] | low | 0 | 0 | carbon oxoacid; one-carbon compound; organonitrogen compound | Escherichia coli metabolite |
carbamyl phosphate | [no description available] | low | 0 | 0 | acyl monophosphate; one-carbon compound | Escherichia coli metabolite; mouse metabolite |
ureidosuccinic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; N-carbamoyl-amino acid | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
choline | [no description available] | low | 0 | 0 | cholines | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter; nutrient; plant metabolite; Saccharomyces cerevisiae metabolite |
chlorine | [no description available] | low | 0 | 0 | halide anion; monoatomic chlorine | cofactor; Escherichia coli metabolite; human metabolite |
coproporphyrinogen iii | [no description available] | low | 0 | 0 | coproporphyrinogen | Escherichia coli metabolite; mouse metabolite |
2-aminoacetaldehyde | [no description available] | low | 0 | 0 | amino aldehyde; omega-aminoaldehyde | Escherichia coli metabolite |
2,3-diaminopropionic acid | [no description available] | low | 0 | 0 | alanine derivative; amino acid zwitterion; beta-amino acid; diamino acid; non-proteinogenic alpha-amino acid | Escherichia coli metabolite |
octanoic acid | [no description available] | low | 0 | 0 | medium-chain fatty acid; straight-chain saturated fatty acid | antibacterial agent; Escherichia coli metabolite; human metabolite |
oxaluric acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; ureas | Escherichia coli metabolite |
propionaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; propanals | Escherichia coli metabolite |
phosphoglycolate | [no description available] | low | 0 | 0 | carboxyalkyl phosphate | Escherichia coli metabolite; mouse metabolite |
cytosine | [no description available] | low | 0 | 0 | aminopyrimidine; pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
3,3-dimethylallyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
diacetyl | [no description available] | low | 0 | 0 | alpha-diketone | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
dihydroxyacetone phosphate | [no description available] | low | 0 | 0 | glycerone phosphates; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
1,4-dihydroxy-2-naphthoic acid | [no description available] | low | 0 | 0 | dihydroxy monocarboxylic acid; naphthalenediols; naphthohydroquinone; naphthoic acid | Escherichia coli metabolite |
5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | dimethylbenzimidazole | Escherichia coli metabolite; human metabolite |
dimethyl sulfoxide | [no description available] | low | 0 | 0 | sulfoxide; volatile organic compound | alkylating agent; antidote; Escherichia coli metabolite; geroprotector; MRI contrast agent; non-narcotic analgesic; polar aprotic solvent; radical scavenger |
ethanolamine | [no description available] | low | 0 | 0 | ethanolamines; primary alcohol; primary amine | Escherichia coli metabolite; human metabolite; mouse metabolite |
formaldehyde | [no description available] | low | 0 | 0 | aldehyde; one-carbon compound | allergen; carcinogenic agent; disinfectant; EC 3.5.1.4 (amidase) inhibitor; environmental contaminant; Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
gamma-butyrobetaine | [no description available] | low | 0 | 0 | amino-acid betaine | Escherichia coli metabolite; human metabolite |
glycerol | [no description available] | low | 0 | 0 | alditol; triol | algal metabolite; detergent; Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; solvent |
glyoxylic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; aldehydic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydrogen cyanide | [no description available] | low | 0 | 0 | hydracid; one-carbon compound | Escherichia coli metabolite; human metabolite; poison |
hydrogen carbonate | [no description available] | low | 0 | 0 | carbon oxoanion | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
toxopyrimidine | [no description available] | low | 0 | 0 | aminopyrimidine; aromatic primary alcohol | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
thiocyanic acid | [no description available] | low | 0 | 0 | hydracid; one-carbon compound; organosulfur compound | Escherichia coli metabolite |
hydroquinone | [no description available] | low | 0 | 0 | benzenediol; hydroquinones | antioxidant; carcinogenic agent; cofactor; Escherichia coli metabolite; human xenobiotic metabolite; mouse metabolite; skin lightening agent |
hydroxymethylbilane | [no description available] | low | 0 | 0 | bilanes | Escherichia coli metabolite; mouse metabolite |
iminoaspartic acid | [no description available] | low | 0 | 0 | aspartic acid derivative; C4-dicarboxylic acid; ketimine | Escherichia coli metabolite |
indole | [no description available] | low | 0 | 0 | indole; polycyclic heteroarene | Escherichia coli metabolite |
lipoamide | [no description available] | low | 0 | 0 | dithiolanes; monocarboxylic acid amide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
racemethionine | [no description available] | low | 0 | 0 | alpha-amino acid; amino acid zwitterion; sulfur-containing amino acid | algal metabolite; Daphnia magna metabolite; Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
pyruvaldehyde | [no description available] | low | 0 | 0 | 2-oxo aldehyde; propanals | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxypyruvic acid | [no description available] | low | 0 | 0 | 2-oxo monocarboxylic acid; 3-hydroxy monocarboxylic acid; primary alpha-hydroxy ketone | Escherichia coli metabolite; human metabolite |
oxamic acid | [no description available] | low | 0 | 0 | dicarboxylic acid monoamide | Escherichia coli metabolite |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoic acid; aromatic amino-acid zwitterion | allergen; Escherichia coli metabolite; plant metabolite |
phenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
phenylacetic acid | [no description available] | low | 0 | 0 | benzenes; monocarboxylic acid; phenylacetic acids | allergen; Aspergillus metabolite; auxin; EC 6.4.1.1 (pyruvate carboxylase) inhibitor; Escherichia coli metabolite; human metabolite; plant growth retardant; plant metabolite; Saccharomyces cerevisiae metabolite; toxin |
phenethylamine | [no description available] | low | 0 | 0 | alkaloid; aralkylamine; phenylethylamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
diphosphoric acid | [no description available] | low | 0 | 0 | acyclic phosphorus acid anhydride; phosphorus oxoacid | Escherichia coli metabolite |
prephenic acid | [no description available] | low | 0 | 0 | oxo dicarboxylic acid | Escherichia coli metabolite; plant metabolite |
pyridoxal | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxal phosphate | [no description available] | low | 0 | 0 | methylpyridines; monohydroxypyridine; pyridinecarbaldehyde; vitamin B6 phosphate | coenzyme; cofactor; EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine | [no description available] | low | 0 | 0 | aminoalkylpyridine; hydroxymethylpyridine; monohydroxypyridine; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
pyridoxamine phosphate | [no description available] | low | 0 | 0 | aminoalkylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine | [no description available] | low | 0 | 0 | hydroxymethylpyridine; methylpyridines; monohydroxypyridine; vitamin B6 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
pyridoxine 5-phosphate | [no description available] | low | 0 | 0 | vitamin B6 phosphate | Escherichia coli metabolite; mouse metabolite |
quinolinic acid | [no description available] | low | 0 | 0 | pyridinedicarboxylic acid | Escherichia coli metabolite; human metabolite; mouse metabolite; NMDA receptor agonist |
dimethyl sulfide | [no description available] | low | 0 | 0 | aliphatic sulfide | algal metabolite; bacterial xenobiotic metabolite; EC 3.5.1.4 (amidase) inhibitor; Escherichia coli metabolite; marine metabolite |
sarcosine | [no description available] | low | 0 | 0 | N-alkylglycine zwitterion; N-alkylglycine; N-methyl-amino acid; N-methylglycines | Escherichia coli metabolite; glycine receptor agonist; glycine transporter 1 inhibitor; human metabolite; mouse metabolite |
succinic semialdehyde | [no description available] | low | 0 | 0 | aldehydic acid | Escherichia coli metabolite; mouse metabolite |
sulfur dioxide | [no description available] | low | 0 | 0 | sulfur oxide | Escherichia coli metabolite; food bleaching agent; refrigerant |
tartronate semialdehyde | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 3-oxo monocarboxylic acid; aldehyde | Escherichia coli metabolite; mouse metabolite |
taurine | [no description available] | low | 0 | 0 | amino sulfonic acid; zwitterion | antioxidant; Escherichia coli metabolite; glycine receptor agonist; human metabolite; mouse metabolite; nutrient; radical scavenger; Saccharomyces cerevisiae metabolite |
thiamine | [no description available] | low | 0 | 0 | primary alcohol; vitamin B1 | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
thymine | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | Escherichia coli metabolite; human metabolite; mouse metabolite |
2-(4-methyl-1,3-thiazol-5-yl)ethanol | [no description available] | low | 0 | 0 | 1,3-thiazoles; primary alcohol | Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
trimethylamine | [no description available] | low | 0 | 0 | methylamines; tertiary amine | Escherichia coli metabolite; human xenobiotic metabolite |
uracil | [no description available] | low | 0 | 0 | pyrimidine nucleobase; pyrimidone | allergen; Daphnia magna metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; prodrug; Saccharomyces cerevisiae metabolite |
uric acid | [no description available] | low | 0 | 0 | uric acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
urea | [no description available] | low | 0 | 0 | isourea; monocarboxylic acid amide; one-carbon compound | Daphnia magna metabolite; Escherichia coli metabolite; fertilizer; flour treatment agent; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
uroporphyrinogen iii | [no description available] | low | 0 | 0 | uroporphyrinogen | Escherichia coli metabolite; mouse metabolite |
isopentenyl pyrophosphate | [no description available] | low | 0 | 0 | prenol phosphate | antigen; antioxidant; epitope; Escherichia coli metabolite; mouse metabolite; phosphoantigen |
beta-glycerophosphoric acid | [no description available] | low | 0 | 0 | glycerol monophosphate | Escherichia coli metabolite; plant metabolite |
4-cresol | [no description available] | low | 0 | 0 | cresol | Escherichia coli metabolite; human metabolite; uremic toxin |
4-aminobenzoic acid | [no description available] | low | 0 | 0 | aminobenzoate; aromatic amino-acid anion | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
tyramine | [no description available] | low | 0 | 0 | monoamine molecular messenger; primary amino compound; tyramines | EC 3.1.1.8 (cholinesterase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; neurotransmitter |
serine | [no description available] | low | 0 | 0 | L-alpha-amino acid; proteinogenic amino acid; serine family amino acid; serine zwitterion; serine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
chloramphenicol | [no description available] | low | 0 | 0 | C-nitro compound; carboxamide; diol; organochlorine compound | antibacterial drug; antimicrobial agent; Escherichia coli metabolite; geroprotector; Mycoplasma genitalium metabolite; protein synthesis inhibitor |
aspartic acid | [no description available] | low | 0 | 0 | aspartate family amino acid; aspartic acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; mouse metabolite; neurotransmitter |
lysine | [no description available] | low | 0 | 0 | aspartate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; lysine; organic molecular entity; proteinogenic amino acid | algal metabolite; anticonvulsant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
sucrose | [no description available] | low | 0 | 0 | glycosyl glycoside | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; osmolyte; Saccharomyces cerevisiae metabolite; sweetening agent |
uridine monophosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate; uridine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
uridine diphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-diphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
galactose | [no description available] | low | 0 | 0 | D-galactose; galactopyranose | Escherichia coli metabolite; mouse metabolite |
leucine | [no description available] | low | 0 | 0 | amino acid zwitterion; L-alpha-amino acid; leucine; proteinogenic amino acid; pyruvate family amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
cytidine monophosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
cytidine diphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite |
uridine triphosphate | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-triphosphate; uridine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
phenylalanine | [no description available] | low | 0 | 0 | amino acid zwitterion; erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid; phenylalanine; proteinogenic amino acid | algal metabolite; EC 3.1.3.1 (alkaline phosphatase) inhibitor; Escherichia coli metabolite; human xenobiotic metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
cytidine | [no description available] | low | 0 | 0 | cytidines | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cytidine triphosphate | [no description available] | low | 0 | 0 | cytidine 5'-phosphate; pyrimidine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
asparagine | [no description available] | low | 0 | 0 | amino acid zwitterion; asparagine; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
histidine | [no description available] | low | 0 | 0 | amino acid zwitterion; histidine; L-alpha-amino acid; polar amino acid zwitterion; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
valine | [no description available] | low | 0 | 0 | L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; pyruvate family amino acid; valine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
threonine | [no description available] | low | 0 | 0 | amino acid zwitterion; aspartate family amino acid; L-alpha-amino acid; proteinogenic amino acid; threonine | algal metabolite; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
tryptophan | [no description available] | low | 0 | 0 | erythrose 4-phosphate/phosphoenolpyruvate family amino acid; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid; tryptophan zwitterion; tryptophan | antidepressant; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; Saccharomyces cerevisiae metabolite |
isoleucine | [no description available] | low | 0 | 0 | aspartate family amino acid; isoleucine; L-alpha-amino acid zwitterion; L-alpha-amino acid; proteinogenic amino acid | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
arginine | [no description available] | low | 0 | 0 | arginine; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | biomarker; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical |
methanesulfonic acid | [no description available] | low | 0 | 0 | alkanesulfonic acid; one-carbon compound | Escherichia coli metabolite |
phosphoribosyl pyrophosphate | [no description available] | low | 0 | 0 | 5-O-phosphono-D-ribofuranosyl diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
trehalose | [no description available] | low | 0 | 0 | trehalose | Escherichia coli metabolite; geroprotector; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
acetol | [no description available] | low | 0 | 0 | methyl ketone; primary alcohol; primary alpha-hydroxy ketone; propanones | Escherichia coli metabolite; human metabolite; mouse metabolite |
framycetin | [no description available] | low | 0 | 0 | aminoglycoside | allergen; antibacterial drug; Escherichia coli metabolite |
shikimic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; cyclohexenecarboxylic acid; hydroxy monocarboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
citrulline | [no description available] | low | 0 | 0 | amino acid zwitterion; citrulline | Daphnia magna metabolite; EC 1.14.13.39 (nitric oxide synthase) inhibitor; Escherichia coli metabolite; human metabolite; micronutrient; mouse metabolite; nutraceutical; plant metabolite; protective agent; Saccharomyces cerevisiae metabolite |
phosphoadenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl sulfate; adenosine bisphosphate; purine ribonucleoside bisphosphate | Escherichia coli metabolite; mouse metabolite |
adenosine phosphosulfate | [no description available] | low | 0 | 0 | acyl monophosphate; acyl sulfate; adenosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
pyridoxamine dihydrochloride | [no description available] | low | 0 | 0 | hydrochloride; vitamin B6 | Escherichia coli metabolite; human metabolite; iron chelator; mouse metabolite; nephroprotective agent; plant metabolite; Saccharomyces cerevisiae metabolite |
chorismic acid | [no description available] | low | 0 | 0 | 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid | Escherichia coli metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
homoserine | [no description available] | low | 0 | 0 | amino acid zwitterion; homoserine | algal metabolite; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyuridine | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyadenosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxycytidine monophosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
nicotinamide mononucleotide | [no description available] | low | 0 | 0 | nicotinamide mononucleotide | Escherichia coli metabolite; mouse metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
fucose | [no description available] | low | 0 | 0 | fucopyranose; L-fucose | Escherichia coli metabolite; mouse metabolite |
uridine diphosphate glucuronic acid | [no description available] | low | 0 | 0 | UDP-D-glucuronic acid | Escherichia coli metabolite; human metabolite; mouse metabolite |
1,3,4-butanetriol | [no description available] | low | 0 | 0 | triol | bacterial xenobiotic metabolite; Escherichia coli metabolite |
diadenosine tetraphosphate | [no description available] | low | 0 | 0 | diadenosyl tetraphosphate | Escherichia coli metabolite; mouse metabolite |
d-glutamate | [no description available] | low | 0 | 0 | D-alpha-amino acid; glutamic acid | Escherichia coli metabolite; mouse metabolite |
silver | [no description available] | low | 0 | 0 | copper group element atom; elemental silver | Escherichia coli metabolite |
molybdate ion | [no description available] | low | 0 | 0 | divalent inorganic anion; molybdenum oxoanion | Escherichia coli metabolite |
myrmicacin | [no description available] | low | 0 | 0 | 3-hydroxy fatty acid; medium-chain fatty acid | antimitotic; Escherichia coli metabolite |
phosphotyrosine | [no description available] | low | 0 | 0 | L-tyrosine derivative; non-proteinogenic L-alpha-amino acid; O(4)-phosphotyrosine | Escherichia coli metabolite; immunogen |
glutamic acid | [no description available] | low | 0 | 0 | glutamic acid; glutamine family amino acid; L-alpha-amino acid; proteinogenic amino acid | Escherichia coli metabolite; ferroptosis inducer; micronutrient; mouse metabolite; neurotransmitter; nutraceutical |
adenosine diphosphate ribose | [no description available] | low | 0 | 0 | ADP-sugar | Escherichia coli metabolite; mouse metabolite |
acetylgalactosamine | [no description available] | low | 0 | 0 | N-acetyl-D-hexosamine; N-acetylgalactosamine | Escherichia coli metabolite; human metabolite; mouse metabolite |
phosphopantothenic acid | [no description available] | low | 0 | 0 | amidoalkyl phosphate | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
d-lactic acid | [no description available] | low | 0 | 0 | 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
xanthosine | [no description available] | low | 0 | 0 | purines D-ribonucleoside; xanthosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
thymidine 5'-triphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-triphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyuridine triphosphate | [no description available] | low | 0 | 0 | deoxyuridine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite |
2'-deoxycytidine 5'-triphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
aica ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide; aminoimidazole | cardiovascular drug; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
n-(3-aminopropyl)cadaverine | [no description available] | low | 0 | 0 | polyazaalkane; triamine | Escherichia coli metabolite |
hydracrylic acid | [no description available] | low | 0 | 0 | 3-hydroxy monocarboxylic acid; omega-hydroxy-short-chain fatty acid | Escherichia coli metabolite; human metabolite |
plasmenylserine | [no description available] | low | 0 | 0 | O-phosphoserine | EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor; EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor; EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
cifostodine | [no description available] | low | 0 | 0 | 2',3'-cyclic pyrimidine nucleotide | Escherichia coli metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
ubiquinone-o | [no description available] | low | 0 | 0 | ubiquinones | Escherichia coli metabolite; human metabolite |
D-serine | [no description available] | low | 0 | 0 | D-alpha-amino acid; serine zwitterion; serine | Escherichia coli metabolite; human metabolite; NMDA receptor agonist |
D-alanine | [no description available] | low | 0 | 0 | alanine zwitterion; alanine; D-alpha-amino acid | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor; Escherichia coli metabolite; human metabolite |
D-tyrosine | [no description available] | low | 0 | 0 | D-alpha-amino acid zwitterion; D-alpha-amino acid; tyrosine | Escherichia coli metabolite |
glucose-1,6-bisphosphate | [no description available] | low | 0 | 0 | D-glucose 1,6-bisphosphate | Escherichia coli metabolite; human metabolite |
coenzyme a | [no description available] | low | 0 | 0 | adenosine 3',5'-bisphosphate | coenzyme; Escherichia coli metabolite; mouse metabolite |
succinyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite; inhibitor; mouse metabolite |
L-2-aminoadipic acid | [no description available] | low | 0 | 0 | 2-aminoadipic acid | Escherichia coli metabolite; human metabolite |
acetoacetyl coa | [no description available] | low | 0 | 0 | 3-oxo-fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
stearoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
3'-uridylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 3'-monophosphate; uridine phosphate | Escherichia coli metabolite |
2',3'-cyclic amp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
2,5-diketogluconic acid | [no description available] | low | 0 | 0 | diketoaldonic acid | Escherichia coli metabolite |
l-lactic acid | [no description available] | low | 0 | 0 | (2S)-2-hydroxy monocarboxylic acid; 2-hydroxypropanoic acid | Escherichia coli metabolite; human metabolite |
2-deoxyglucose-6-phosphate | [no description available] | low | 0 | 0 | deoxyaldohexose phosphate | Escherichia coli metabolite; Mycoplasma genitalium metabolite |
3,4-dihydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; catechols; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
protoporphyrinogen | [no description available] | low | 0 | 0 | porphyrinogens | Escherichia coli metabolite; mouse metabolite |
thymidine diphosphate-l-rhamnose | [no description available] | low | 0 | 0 | dTDP-L-rhamnose | Escherichia coli metabolite |
butyryl-coenzyme a | [no description available] | low | 0 | 0 | butanoyl-CoAs | Escherichia coli metabolite; mouse metabolite |
trehalose-6-phosphate | [no description available] | low | 0 | 0 | trehalose phosphate | Escherichia coli metabolite |
erythrose 4-phosphate | [no description available] | low | 0 | 0 | erythrose phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
ribulose-1,5 diphosphate | [no description available] | low | 0 | 0 | ribulose phosphate | Escherichia coli metabolite; plant metabolite |
n(8)-acetylspermidine | [no description available] | low | 0 | 0 | acetylspermidine | Escherichia coli metabolite; human metabolite |
aerobactin | [no description available] | low | 0 | 0 | L-lysine derivative | Escherichia coli metabolite; siderophore; virulence factor |
lipid x | [no description available] | low | 0 | 0 | N-acyl-D-glucosamine 1-phosphate | Escherichia coli metabolite |
galactose-1-phosphate | [no description available] | low | 0 | 0 | alpha-D-hexose 1-phosphate; D-galactopyranose 1-phosphate | Escherichia coli metabolite; mouse metabolite |
gamma-glutamylcysteine | [no description available] | low | 0 | 0 | gamma-glutamylcysteine | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
glutamate-1-semialdehyde | [no description available] | low | 0 | 0 | 5-oxo monocarboxylic acid; amino acid zwitterion; gamma-amino acid; glutamic semialdehyde | Escherichia coli metabolite |
mannitol-1-phosphate | [no description available] | low | 0 | 0 | alditol 1-phosphate; hexitol phosphate | Escherichia coli metabolite; human metabolite |
proline | [no description available] | low | 0 | 0 | amino acid zwitterion; glutamine family amino acid; L-alpha-amino acid; proline; proteinogenic amino acid | algal metabolite; compatible osmolytes; Escherichia coli metabolite; micronutrient; mouse metabolite; nutraceutical; Saccharomyces cerevisiae metabolite |
2'-deoxycytidine diphosphate | [no description available] | low | 0 | 0 | 2'-deoxycytidine phosphate; pyrimidine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
o-phosphohomoserine | [no description available] | low | 0 | 0 | O-phosphorylhomoserine | Escherichia coli metabolite |
ribulose | [no description available] | low | 0 | 0 | ribulose | Escherichia coli metabolite; human metabolite |
2,3-dihydroxybenzoylserine | [no description available] | low | 0 | 0 | L-serine derivative | Escherichia coli metabolite |
sorbitol 6-phosphate | [no description available] | low | 0 | 0 | alditol 6-phosphate; glucitol phosphate | Escherichia coli metabolite; mouse metabolite |
beta-aspartyl phosphate | [no description available] | low | 0 | 0 | aminoacyl phosphate; L-aspartic acid derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
adenosine 3'-phosphate-5'-phosphate | [no description available] | low | 0 | 0 | adenosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
alpha-ribazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole | Escherichia coli metabolite; mouse metabolite |
abrine | [no description available] | low | 0 | 0 | L-tryptophan derivative; N-methyl-L-alpha-amino acid zwitterion; N-methyl-L-alpha-amino acid | Escherichia coli metabolite |
orotidylic acid | [no description available] | low | 0 | 0 | pyrimidine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
3-deoxy-d-arabino-heptulosonate-7-phosphate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
saicar | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
n(6)-(n-threonylcarbonyl)adenosine | [no description available] | low | 0 | 0 | L-threonine derivative; N-(adenosin-N(6)-ylcarbonyl)threonine | Escherichia coli metabolite; human metabolite |
thymidine 5'-diphosphate | [no description available] | low | 0 | 0 | pyrimidine 2'-deoxyribonucleoside 5'-diphosphate; thymidine phosphate | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 1,7-bisphosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; mouse metabolite |
sedoheptulose 7-phosphate | [no description available] | low | 0 | 0 | ketoheptose phosphate; sedoheptulose derivative | Escherichia coli metabolite; human metabolite; mouse metabolite |
histidinol | [no description available] | low | 0 | 0 | amino alcohol; imidazoles | EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor; Escherichia coli metabolite; human metabolite; Saccharomyces cerevisiae metabolite |
carboxyaminoimidazole ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazole; aminoimidazole; imidazole-4-carboxylic acid | Escherichia coli metabolite; mouse metabolite |
lauroyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
nicotinic acid adenine dinucleotide | [no description available] | low | 0 | 0 | nicotinic acid dinucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5-formamidoimidazole-4-carboxamide ribotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite; mouse metabolite |
6,7-dimethyl-8-ribityllumazine, (d)-isomer | [no description available] | low | 0 | 0 | pteridines | cofactor; Escherichia coli metabolite |
biotin | [no description available] | low | 0 | 0 | biotins; vitamin B7 | coenzyme; cofactor; Escherichia coli metabolite; fundamental metabolite; human metabolite; mouse metabolite; nutraceutical; prosthetic group; Saccharomyces cerevisiae metabolite |
glucosamine 1-phosphate | [no description available] | low | 0 | 0 | glucosamine phosphate | Escherichia coli metabolite |
2'-deoxyadenosine triphosphate | [no description available] | low | 0 | 0 | 2'-deoxyadenosine 5'-phosphate; purine 2'-deoxyribonucleoside 5'-diphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
9-mercaptodethiobiotin | [no description available] | low | 0 | 0 | imidazolidinone; monocarboxylic acid; thiol; ureas | Escherichia coli metabolite |
idonic acid | [no description available] | low | 0 | 0 | idonic acid | Escherichia coli metabolite |
gamma-glutamyl phosphate | [no description available] | low | 0 | 0 | gamma-glutamyl phosphate | Escherichia coli metabolite; mouse metabolite |
5-amino-6-ribitylamino-2,4-(1h,3h)pyrimidinedione | [no description available] | low | 0 | 0 | aminouracil; hydroxypyrimidine | Escherichia coli metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
hydroxythreonine | [no description available] | low | 0 | 0 | amino acid zwitterion; hydroxy-amino acid; L-threonine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
n(1)-((5'-phosphoribulosyl)formimino)-5-aminoimidazo-4-carboxamide ribonucleotide | [no description available] | low | 0 | 0 | 1-(phosphoribosyl)imidazolecarboxamide | Escherichia coli metabolite |
2-oxo-3-deoxygalactonic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
5'-methylthioadenosine | [no description available] | low | 0 | 0 | thioadenosine | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
5'-deoxyadenosine | [no description available] | low | 0 | 0 | 5'-deoxyribonucleoside; adenosines | Escherichia coli metabolite; human metabolite; mouse metabolite |
xylulose-5-phosphate, (d)-isomer | [no description available] | low | 0 | 0 | xylulose 5-phosphate | Escherichia coli metabolite; mouse metabolite |
glycerate 1,3-biphosphate | [no description available] | low | 0 | 0 | 2,3-bisphosphoglyceric acid; acyl monophosphate | Escherichia coli metabolite; mouse metabolite |
arabinose | [no description available] | low | 0 | 0 | L-arabinose | Escherichia coli metabolite; mouse metabolite |
glucosamine | [no description available] | low | 0 | 0 | D-glucosamine | Escherichia coli metabolite; geroprotector; mouse metabolite |
ribose 1-phosphate | [no description available] | low | 0 | 0 | D-ribose 1-phosphate | Escherichia coli metabolite |
diaminopimelic acid | [no description available] | low | 0 | 0 | 2,6-diaminopimelic acid; amino acid zwitterion | Escherichia coli metabolite |
xanthosine 5'-triphosphate | [no description available] | low | 0 | 0 | purine ribonucleoside 5'-triphosphate; xanthosine 5'-phosphate | Escherichia coli metabolite; mouse metabolite |
3-dehydroquinic acid | [no description available] | low | 0 | 0 | 2-hydroxy monocarboxylic acid; 4-hydroxy monocarboxylic acid; 4-oxo monocarboxylic acid; 5-hydroxy monocarboxylic acid; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
o-succinylhomoserine | [no description available] | low | 0 | 0 | hemisuccinate; o-succinylhomoserine | Escherichia coli metabolite; Saccharomyces cerevisiae metabolite |
s-adenosyl-3-methylthiopropylamine | [no description available] | low | 0 | 0 | adenosines; sulfonium compound | Escherichia coli metabolite; human urinary metabolite; mouse metabolite; rat metabolite |
6-phosphonoglucono-delta-lactone | [no description available] | low | 0 | 0 | aldonolactone phosphate | Escherichia coli metabolite; mouse metabolite |
tartaric acid | [no description available] | low | 0 | 0 | tartaric acid | Escherichia coli metabolite |
s-ribosyl-l-homocysteine | [no description available] | low | 0 | 0 | S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | Escherichia coli metabolite |
4-hydroxyphenylacetaldehyde | [no description available] | low | 0 | 0 | alpha-CH2-containing aldehyde; phenylacetaldehydes | Escherichia coli metabolite; human metabolite; mouse metabolite |
nitro-bis(2,4-pentanedionato)(pyridine)cobalt(iii) | [no description available] | low | 0 | 0 | diadenosyl pentaphosphate | Escherichia coli metabolite; vasoconstrictor agent |
n-acetylglucosamine-1-phosphate | [no description available] | low | 0 | 0 | N-acetyl-D-glucosamine 1-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
pantothenylcysteine 4'-phosphate | [no description available] | low | 0 | 0 | L-cysteine derivative | Escherichia coli metabolite; mouse metabolite |
glutathionylspermidine | [no description available] | medium | 0 | 0 | glutathione derivative | Escherichia coli metabolite |
arbutin | [no description available] | low | 0 | 0 | beta-D-glucoside; monosaccharide derivative | Escherichia coli metabolite; plant metabolite |
2-c-methylerythritol 4-phosphate | [no description available] | low | 0 | 0 | tetritol phosphate | Escherichia coli metabolite |
1-deoxy-d-xylulose 5-phosphate | [no description available] | low | 0 | 0 | xylulose phosphate | Escherichia coli metabolite |
c(alpha)-formylglycine | [no description available] | low | 0 | 0 | 3-oxoalanine; amino acid zwitterion; L-alanine derivative; non-proteinogenic L-alpha-amino acid | Escherichia coli metabolite |
dephosphocoenzyme a | [no description available] | low | 0 | 0 | adenosine 5'-phosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | [no description available] | low | 0 | 0 | 1-ribosylbenzimidazole; dimethylbenzimidazole; ribose monophosphate | Escherichia coli metabolite; mouse metabolite |
ribothymidine | [no description available] | low | 0 | 0 | methyluridine | antigen; Escherichia coli metabolite; human metabolite |
palmitoleic acid | [no description available] | low | 0 | 0 | hexadec-9-enoic acid | algal metabolite; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; human blood serum metabolite |
oleic acid | [no description available] | low | 0 | 0 | octadec-9-enoic acid | antioxidant; Daphnia galeata metabolite; EC 3.1.1.1 (carboxylesterase) inhibitor; Escherichia coli metabolite; mouse metabolite; plant metabolite; solvent |
farnesyl pyrophosphate | [no description available] | low | 0 | 0 | farnesyl diphosphate | Escherichia coli metabolite; mouse metabolite |
geranyl pyrophosphate | [no description available] | low | 0 | 0 | polyprenyl diphosphate | Escherichia coli metabolite; mouse metabolite |
1,5-dihydro-fad | [no description available] | low | 0 | 0 | flavin adenine dinucleotide | Escherichia coli metabolite; mouse metabolite |
s-hydroxymethylglutathione | [no description available] | low | 0 | 0 | S-substituted glutathione | Escherichia coli metabolite; mouse metabolite |
hexanoyl-coenzyme a | [no description available] | low | 0 | 0 | medium-chain fatty acyl-CoA | Escherichia coli metabolite; human metabolite; mouse metabolite |
4-phosphoerythronate | [no description available] | low | 0 | 0 | 4-phosphoerythronic acid | Escherichia coli metabolite; mouse metabolite |
riboflavin | [no description available] | low | 0 | 0 | flavin; vitamin B2 | anti-inflammatory agent; antioxidant; cofactor; Escherichia coli metabolite; food colouring; fundamental metabolite; human urinary metabolite; mouse metabolite; photosensitizing agent; plant metabolite |
flavin-adenine dinucleotide | [no description available] | low | 0 | 0 | flavin adenine dinucleotide; vitamin B2 | cofactor; Escherichia coli metabolite; human metabolite; mouse metabolite; prosthetic group |
sucrose-6-phosphate | [no description available] | low | 0 | 0 | disaccharide phosphate | Escherichia coli metabolite |
palmitoyl coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; 3-substituted propionyl-CoA; long-chain fatty acyl-CoA; palmitoyl bioconjugate | Escherichia coli metabolite; mouse metabolite |
glycerylphosphorylcholine | [no description available] | low | 0 | 0 | phosphocholines; sn-glycerol 3-phosphates | Escherichia coli metabolite; human metabolite; mouse metabolite; neuroprotective agent; parasympatholytic; Saccharomyces cerevisiae metabolite |
cysteine sulfinic acid | [no description available] | low | 0 | 0 | organosulfinic acid; S-substituted L-cysteine | Escherichia coli metabolite; human metabolite; metabotropic glutamate receptor agonist; mouse metabolite |
fusidic acid | [no description available] | low | 0 | 0 | 11alpha-hydroxy steroid; 3alpha-hydroxy steroid; alpha,beta-unsaturated monocarboxylic acid; steroid acid; steroid antibiotic; sterol ester | EC 2.7.1.33 (pantothenate kinase) inhibitor; Escherichia coli metabolite; protein synthesis inhibitor |
iminoglycine | [no description available] | low | 0 | 0 | dehydroamino acid; imine; zwitterion | Escherichia coli metabolite |
2-keto-3-deoxy-6-phosphogluconate | [no description available] | low | 0 | 0 | ketoaldonic acid phosphate | Escherichia coli metabolite |
formyl-coenzyme a | [no description available] | low | 0 | 0 | acyl-CoA | Escherichia coli metabolite |
3-deoxy-2-octulosonic acid(2)-lipid iv(a) | [no description available] | low | 0 | 0 | lipid As | Escherichia coli metabolite |
phosphothreonine | [no description available] | low | 0 | 0 | L-threonine derivative; non-proteinogenic L-alpha-amino acid; O-phosphoamino acid | Escherichia coli metabolite |
maleamic acid | [no description available] | low | 0 | 0 | alpha,beta-unsaturated monocarboxylic acid; dicarboxylic acid monoamide | bacterial xenobiotic metabolite; Escherichia coli metabolite |
retinol palmitate | [no description available] | low | 0 | 0 | all-trans-retinyl ester; retinyl palmitate | antioxidant; Escherichia coli metabolite; human xenobiotic metabolite |
canthaxanthin | [no description available] | low | 0 | 0 | carotenone | biological pigment; Escherichia coli metabolite; food colouring; fungal metabolite |
(e)-4-hydroxy-3-methylbut-2-enyl diphosphate | [no description available] | low | 0 | 0 | prenol phosphate | epitope; Escherichia coli metabolite; phosphoantigen |
menaquinone 7 | [no description available] | low | 0 | 0 | menaquinone | bone density conservation agent; cofactor; Escherichia coli metabolite; human blood serum metabolite; Mycoplasma genitalium metabolite |
xylulose | [no description available] | low | 0 | 0 | xylulose | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
vitamin mk 8 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite; human metabolite |
5-ketogluconic acid | [no description available] | low | 0 | 0 | hexonic acid; ketoaldonic acid | Escherichia coli metabolite |
oleoyl-coenzyme a | [no description available] | low | 0 | 0 | octadecenoyl-CoA | Escherichia coli metabolite; mouse metabolite |
menaquinone 9 | [no description available] | low | 0 | 0 | menaquinone | Escherichia coli metabolite |
allolactose | [no description available] | low | 0 | 0 | glycosylglucose | Escherichia coli metabolite |
fuculose | [no description available] | low | 0 | 0 | deoxyketohexose | Escherichia coli metabolite; human metabolite |
1-deoxy-2-pentulose | [no description available] | low | 0 | 0 | deoxypentose | Escherichia coli metabolite |
fructosyl-lysine | [no description available] | low | 0 | 0 | fructosamine; glyco-amino acid | Escherichia coli metabolite |
lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid A; tetradecanoate ester | Escherichia coli metabolite |
methionine sulfoxide | [no description available] | low | 0 | 0 | amino acid zwitterion; L-methionine S-oxide | Escherichia coli metabolite |
(S)-4,5-dihydroxypentane-2,3-dione | [no description available] | low | 0 | 0 | alpha-diketone; secondary alpha-hydroxy ketone | Escherichia coli metabolite |
kdo2-lipid a | [no description available] | low | 0 | 0 | dodecanoate ester; lipid As; tetradecanoate ester | Escherichia coli metabolite |
oxalyl-coenzyme a | [no description available] | low | 0 | 0 | omega-carboxyacyl-CoA | Escherichia coli metabolite |
s-tetradecanoyl-coenzyme a | [no description available] | low | 0 | 0 | 11,12-saturated fatty acyl-CoA; long-chain fatty acyl-CoA | Escherichia coli metabolite; mouse metabolite |
novobiocin | [no description available] | low | 0 | 0 | carbamate ester; ether; hexoside; hydroxycoumarin; monocarboxylic acid amide; monosaccharide derivative; phenols | antibacterial agent; antimicrobial agent; EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor; Escherichia coli metabolite; hepatoprotective agent |
cyclic gmp | [no description available] | low | 0 | 0 | 3',5'-cyclic purine nucleotide; guanyl ribonucleotide | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
diguanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-tetraphosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
deoxyinosine | [no description available] | low | 0 | 0 | purine 2'-deoxyribonucleoside; purines 2'-deoxy-D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
2'-deoxyguanosine 5'-phosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; mouse metabolite |
deoxyguanosine triphosphate | [no description available] | low | 0 | 0 | deoxyguanosine phosphate; guanyl deoxyribonucleotide; purine 2'-deoxyribonucleoside 5'-triphosphate | Arabidopsis thaliana metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite; Saccharomyces cerevisiae metabolite |
dihydrofolate | [no description available] | low | 0 | 0 | dihydrofolic acids | Escherichia coli metabolite; mouse metabolite |
dihydroneopterin triphosphate | [no description available] | low | 0 | 0 | dihydropterin; neopterins; pterin phosphate | Escherichia coli metabolite; mouse metabolite |
deoxyinosine monophosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite; Mycoplasma genitalium metabolite |
2'-deoxyinosine triphosphate | [no description available] | low | 0 | 0 | deoxyinosine phosphate; purine 2'-deoxyribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-diphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
gdp-4-keto-6-deoxymannose | [no description available] | low | 0 | 0 | GDP-sugar | Escherichia coli metabolite; mouse metabolite |
guanosine diphosphate mannose | [no description available] | low | 0 | 0 | GDP-D-mannose | Escherichia coli metabolite; human metabolite; mouse metabolite; plant metabolite |
guanosine pentaphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
guanosine triphosphate | [no description available] | low | 0 | 0 | guanosine 5'-phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; mouse metabolite; uncoupling protein inhibitor |
guanine | [no description available] | low | 0 | 0 | 2-aminopurines; oxopurine; purine nucleobase | algal metabolite; Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
guanosine tetraphosphate | [no description available] | low | 0 | 0 | guanosine bisphosphate | Escherichia coli metabolite; mouse metabolite |
inosinic acid | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-monophosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
inosine | [no description available] | low | 0 | 0 | inosines; purines D-ribonucleoside | Escherichia coli metabolite; human metabolite; mouse metabolite; Saccharomyces cerevisiae metabolite |
inosine triphosphate | [no description available] | low | 0 | 0 | inosine phosphate; purine ribonucleoside 5'-triphosphate | Escherichia coli metabolite; human metabolite; mouse metabolite |
queuine | [no description available] | low | 0 | 0 | pyrrolopyrimidine | Escherichia coli metabolite |
3'-guanylic acid | [no description available] | low | 0 | 0 | guanosine 3'-phosphate; purine ribonucleoside 3'-monophosphate | Escherichia coli metabolite |
2',3'-cyclic gmp | [no description available] | low | 0 | 0 | 2',3'-cyclic purine nucleotide | Escherichia coli metabolite |
rifampin | [no description available] | low | 0 | 0 | cyclic ketal; hydrazone; N-iminopiperazine; N-methylpiperazine; rifamycins; semisynthetic derivative; zwitterion | angiogenesis inhibitor; antiamoebic agent; antineoplastic agent; antitubercular agent; DNA synthesis inhibitor; EC 2.7.7.6 (RNA polymerase) inhibitor; Escherichia coli metabolite; geroprotector; leprostatic drug; neuroprotective agent; pregnane X receptor agonist; protein synthesis inhibitor |
leucovorin | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
5,10-methenyltetrahydrofolate | [no description available] | low | 0 | 0 | methylenetetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
10-formyltetrahydrofolate | [no description available] | low | 0 | 0 | formyltetrahydrofolic acid | Escherichia coli metabolite; mouse metabolite |
colibactin | [no description available] | low | 0 | 0 | 1,3-thiazoles; azaspiro compound; polyketide; pyrroline; secondary carboxamide | alkylating agent; carcinogenic agent; Escherichia coli metabolite; genotoxin |
3-(glutathion-s-yl)acetaminophen | [no description available] | low | 0 | 0 | glutathione derivative | |
s-nitrosoglutathione | [no description available] | low | 0 | 0 | glutathione derivative; nitrosothio compound | bronchodilator agent; nitric oxide donor; platelet aggregation inhibitor; signalling molecule |
4-(n-(s-glutathionylacetyl)amino)phenylarsenoxide | [no description available] | low | 0 | 0 | glutathione derivative | |