| Protein | Synonyms | Taxonomy |
|---|
| Corrinoid adenosyltransferase | EC 2.5.1.17; Cob(II)alamin adenosyltransferase; Cob(II)yrinic acid a,c-diamide adenosyltransferase; Cobinamide/cobalamin adenosyltransferase | Escherichia coli K-12 |
| Adenosylcobinamide-GDP ribazoletransferase | EC 2.7.8.26; Cobalamin synthase; Cobalamin-5'-phosphate synthase | Escherichia coli K-12 |
| Protein TonB | | Escherichia coli K-12 |
| Vitamin B12 import ATP-binding protein BtuD | EC 7.6.2.8; Vitamin B12-transporting ATPase | Escherichia coli K-12 |
| Biopolymer transport protein ExbB | | Escherichia coli K-12 |
| Biopolymer transport protein ExbD | | Escherichia coli K-12 |
| Bifunctional adenosylcobalamin biosynthesis protein CobU | Adenosylcobinamide kinase; 2.7.1.156; Adenosylcobinamide-phosphate guanylyltransferase; 2.7.7.62 | Escherichia coli K-12 |
| Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | NN:DBI PRT; EC 2.4.2.21; N(1)-alpha-phosphoribosyltransferase | Escherichia coli K-12 |
| Vitamin B12-binding protein | | Escherichia coli K-12 |
| Adenosylcobalamin/alpha-ribazole phosphatase | EC 3.1.3.73; Adenosylcobalamin phosphatase; Alpha-ribazole-5'-phosphate phosphatase | Escherichia coli K-12 |
| Vitamin B12 import system permease protein BtuC | | Escherichia coli str. K-12 substr. DH10B |
| Vitamin B12 transporter BtuB | Cobalamin receptor; Outer membrane cobalamin translocator | Escherichia coli O157:H7 |
| Compound | Description |
|---|
| hydronium ion | |
| Orthophosphate | |
| Adenosine Triphosphate | An adenine nucleotide containing three phosphate groups esterified to the sugar moiety. In addition to its crucial roles in metabolism adenosine triphosphate is a neurotransmitter. |
| adenosine diphosphate | Adenosine 5'-(trihydrogen diphosphate). An adenine nucleotide containing two phosphate groups esterified to the sugar moiety at the 5'-position. |
| niacin | A water-soluble vitamin of the B complex occurring in various animal and plant tissues. It is required by the body for the formation of coenzymes NAD and NADP. It has PELLAGRA-curative, vasodilating, and antilipemic properties. |
| Water | A clear, odorless, tasteless liquid that is essential for most animal and plant life and is an excellent solvent for many substances. The chemical formula is hydrogen oxide (H2O). (McGraw-Hill Dictionary of Scientific and Technical Terms, 4th ed) |
| triphosphoric acid | used as water softener, peptizing agent, emulsifier & dispersing agent; ingredient of cleansers; meat preservative; RN given refers to parent cpd; structure |
| adensoylcobinamide | structure in first source |
| cobamamide 5'-phosphate | |
| triphosphate | |
| n(1)-(5-phosphoribosyl)-5,6-dimethylbenzimidazole | structure given in first source |
| 5,6-dimethylbenzimidazole | RN given refers to parent cpd |
| pyrophosphate | |
| cobinamide | |