tranexamic acid has been researched along with Heart Defects, Congenital in 20 studies
Tranexamic Acid: Antifibrinolytic hemostatic used in severe hemorrhage.
Heart Defects, Congenital: Developmental abnormalities involving structures of the heart. These defects are present at birth but may be discovered later in life.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Tranexamic acid has been used both topically and systemically and plays a vital role in pediatric cardiac surgery by reducing blood loss and blood product requirement." | 2.84 | Topical and low-dose intravenous tranexamic acid in cyanotic cardiac surgery. ( Deodhar, S; Gandhi, H; Pandya, H; Patel, H; Patel, J; Prajapati, M, 2017) |
| " There is a reasonable body of literature examining antifibrinolytic therapy in congenital heart surgery, but the large variability in patients studied, procedures, methods, and dosing schemes makes a quantitative analysis of this literature impractical." | 2.44 | Antifibrinolytic therapy in surgery for congenital heart disease. ( Eaton, MP, 2008) |
| "Spinal surgery for scoliosis has been performed in selected patients with single ventricle physiology at a single institution without mortality for 25 years." | 1.62 | Surgical Correction of Scoliosis in Children with Severe Congenital Heart Disease and Palliated Single Ventricle Physiology. ( Cohen, LL; Emans, JB; Hedequist, DJ; Marshall, AC; Przybylski, R, 2021) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 2 (10.00) | 18.2507 |
| 2000's | 7 (35.00) | 29.6817 |
| 2010's | 10 (50.00) | 24.3611 |
| 2020's | 1 (5.00) | 2.80 |
| Authors | Studies |
|---|---|
| Cohen, LL | 1 |
| Przybylski, R | 1 |
| Marshall, AC | 1 |
| Emans, JB | 1 |
| Hedequist, DJ | 1 |
| Junejo, F | 1 |
| Akhtar, MI | 1 |
| Hamid, M | 1 |
| Ahmed, SS | 1 |
| Minai, F | 1 |
| Amanullah, M | 1 |
| Faraoni, D | 2 |
| Rozen, L | 2 |
| Willems, A | 2 |
| Torres, CS | 1 |
| Pereira, LM | 1 |
| Demulder, A | 2 |
| Van der Linden, P | 2 |
| Sanchez Torres, C | 1 |
| Noubouossie, DC | 1 |
| Barglazan, D | 1 |
| Patel, J | 1 |
| Prajapati, M | 1 |
| Patel, H | 1 |
| Gandhi, H | 1 |
| Deodhar, S | 1 |
| Pandya, H | 1 |
| Breuer, T | 1 |
| Martin, K | 3 |
| Wilhelm, M | 1 |
| Wiesner, G | 3 |
| Schreiber, C | 3 |
| Hess, J | 1 |
| Lange, R | 1 |
| Tassani, P | 3 |
| Schindler, E | 1 |
| Photiadis, J | 1 |
| Sinzobahamvya, N | 1 |
| Döres, A | 1 |
| Asfour, B | 1 |
| Hraska, V | 1 |
| Gertler, R | 1 |
| Sterner, A | 1 |
| MacGuill, M | 1 |
| Hörer, J | 1 |
| Vogt, M | 1 |
| Graham, EM | 1 |
| Atz, AM | 1 |
| Gillis, J | 1 |
| Desantis, SM | 1 |
| Haney, AL | 1 |
| Deardorff, RL | 1 |
| Uber, WE | 1 |
| Reeves, ST | 1 |
| McGowan, FX | 1 |
| Bradley, SM | 1 |
| Spinale, FG | 1 |
| Pasquali, SK | 1 |
| Li, JS | 1 |
| He, X | 1 |
| Jacobs, ML | 1 |
| O'Brien, SM | 1 |
| Hall, M | 1 |
| Jaquiss, RD | 1 |
| Welke, KF | 1 |
| Peterson, ED | 1 |
| Shah, SS | 1 |
| Jacobs, JP | 1 |
| Giordano, R | 1 |
| Palma, G | 1 |
| Poli, V | 1 |
| Palumbo, S | 1 |
| Russolillo, V | 1 |
| Cioffi, S | 1 |
| Mucerino, M | 1 |
| Mannacio, VA | 1 |
| Vosa, C | 1 |
| Vacharaksa, K | 1 |
| Prakanrattana, U | 1 |
| Suksompong, S | 1 |
| Chumpathong, S | 1 |
| Chauhan, S | 2 |
| Das, SN | 1 |
| Bisoi, A | 2 |
| Kale, S | 2 |
| Kiran, U | 2 |
| Kumar, N | 1 |
| Mittal, D | 1 |
| Venugopal, P | 1 |
| Varela Crespo, CA | 1 |
| Sanabria Carretero, P | 1 |
| Palomero Rodríguez, MA | 1 |
| Tormo las de Heras, C | 1 |
| Rodríguez Pérez, E | 1 |
| Goldman Tarlousky, L | 1 |
| Eaton, MP | 1 |
| Reid, RW | 1 |
| Zimmerman, AA | 1 |
| Laussen, PC | 1 |
| Mayer, JE | 1 |
| Gorlin, JB | 1 |
| Burrows, FA | 1 |
| Williams, GD | 1 |
| Ramamoorthy, C | 1 |
| Levin, E | 1 |
| Wu, J | 1 |
| Devine, DV | 1 |
| Alexander, J | 1 |
| Reichart, C | 1 |
| Sett, S | 1 |
| Seear, M | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Tranexamic Acid to Reduce Blood Loss in Hemorrhagic Caesarean Delivery: a Multicenter Randomized Double Blind Placebo Controlled Therapeutic and Pharmaco-biological Dose Ranging Study (TRACES) for Its Optimal Benefit/Risk[NCT02797119] | Phase 4 | 225 participants (Actual) | Interventional | 2016-03-15 | Terminated (stopped due to Study will be stopped due to the impossibility of reaching the objective of inclusions within a reasonable time frame and taking into account the recommendations of the international WOMAN study) | ||
| Determination of the Minimal Concentration of Antifibrinolytics Required to Inhibit t-PA-activated Fibrinolysis Using an in Vitro Experimental Model of Fibrinolysis.[NCT02352675] | 40 participants (Actual) | Observational | 2015-04-30 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
1 review available for tranexamic acid and Heart Defects, Congenital
| Article | Year |
|---|---|
Antifibrinolytic therapy in surgery for congenital heart disease.
Topics: Antifibrinolytic Agents; Aprotinin; Child; Heart Defects, Congenital; Humans; Infant, Newborn; Place | 2008 |
9 trials available for tranexamic acid and Heart Defects, Congenital
| Article | Year |
|---|---|
Comparison between Intravenous Boluses versus Infusion of Tranexamic Acid (TXA) to Reduce Bleeding in Paediatric Cyanotic Congenital Heart Disease (CHD) Surgeries.
Topics: Administration, Intravenous; Adolescent; Adult; Antifibrinolytic Agents; Blood Loss, Surgical; Cardi | 2018 |
Topical and low-dose intravenous tranexamic acid in cyanotic cardiac surgery.
Topics: Administration, Intravenous; Administration, Topical; Adolescent; Antifibrinolytic Agents; Blood Coa | 2017 |
The blood sparing effect and the safety of aprotinin compared to tranexamic acid in paediatric cardiac surgery.
Topics: Antifibrinolytic Agents; Aprotinin; Blood Component Transfusion; Blood Loss, Surgical; Drug Administ | 2009 |
Tranexamic acid as a means of reducing the need for blood and blood component therapy in children undergoing open heart surgery for congenital cyanotic heart disease.
Topics: Antifibrinolytic Agents; Blood Loss, Surgical; Blood Transfusion; Cardiopulmonary Bypass; Child; Chi | 2002 |
Comparison of epsilon aminocaproic acid and tranexamic acid in pediatric cardiac surgery.
Topics: Adolescent; Aminocaproic Acid; Antifibrinolytic Agents; Blood Coagulation Tests; Blood Transfusion; | 2004 |
Dose comparison of tranexamic acid in pediatric cardiac surgery.
Topics: Adolescent; Antifibrinolytic Agents; Biomarkers; Blood Coagulation; Cardiac Surgical Procedures; Car | 2004 |
[Effect of tranexamic acid on postoperative bleeding in pediatric heart surgery].
Topics: Antifibrinolytic Agents; Biomarkers; Blood Loss, Surgical; Blood Proteins; Cardiac Surgical Procedur | 2007 |
The efficacy of tranexamic acid versus placebo in decreasing blood loss in pediatric patients undergoing repeat cardiac surgery.
Topics: Antifibrinolytic Agents; Blood Coagulation; Blood Loss, Surgical; Blood Transfusion; Cardiac Surgica | 1997 |
Hemostatic parameters and platelet activation marker expression in cyanotic and acyanotic pediatric patients undergoing cardiac surgery in the presence of tranexamic acid.
Topics: Antifibrinolytic Agents; Child; Child, Preschool; Coronary Artery Bypass; Cyanosis; Female; Heart De | 2000 |
10 other studies available for tranexamic acid and Heart Defects, Congenital
| Article | Year |
|---|---|
Surgical Correction of Scoliosis in Children with Severe Congenital Heart Disease and Palliated Single Ventricle Physiology.
Topics: Adolescent; Adult; Child; Cohort Studies; Female; Heart Defects, Congenital; Heart Ventricles; Human | 2021 |
Experimental model of hyperfibrinolysis designed for rotational thromboelastometry in children with congenital heart disease.
Topics: Antifibrinolytic Agents; Child; Child, Preschool; Fibrinolysis; Heart Defects, Congenital; Hemorrhag | 2015 |
Effective tranexamic acid concentration for 95% inhibition of tissue-type plasminogen activator induced hyperfibrinolysis in children with congenital heart disease: A prospective, controlled, in-vitro study.
Topics: Adult; Antifibrinolytic Agents; Child; Child, Preschool; Female; Fibrinolysis; Heart Defects, Congen | 2015 |
Tranexamic acid: an alternative to aprotinin as antifibrinolytic therapy in pediatric congenital heart surgery.
Topics: Antifibrinolytic Agents; Aprotinin; Blood Loss, Surgical; Blood Transfusion; Cardiac Surgical Proced | 2011 |
Comparison of blood-sparing efficacy of ε-aminocaproic acid and tranexamic acid in newborns undergoing cardiac surgery.
Topics: Aminocaproic Acid; Antifibrinolytic Agents; Blood Loss, Surgical; Blood Transfusion; Cardiac Surgica | 2011 |
Is tranexamic acid really an alternative to aprotinin?
Topics: Antifibrinolytic Agents; Aprotinin; Blood Loss, Surgical; Cardiac Surgical Procedures; Female; Heart | 2012 |
Differential effects of aprotinin and tranexamic acid on outcomes and cytokine profiles in neonates undergoing cardiac surgery.
Topics: Age Factors; Analysis of Variance; Antifibrinolytic Agents; Aprotinin; Blood Loss, Surgical; Cardiac | 2012 |
Comparative analysis of antifibrinolytic medications in pediatric heart surgery.
Topics: Aminocaproates; Antifibrinolytic Agents; Aprotinin; Cardiac Surgical Procedures; Chi-Square Distribu | 2012 |
Tranexamic acid therapy in pediatric cardiac surgery: a single-center study.
Topics: Antifibrinolytic Agents; Cardiac Surgical Procedures; Cardiopulmonary Bypass; Child, Preschool; Dose | 2012 |
Con: the routine use of aprotinin during pediatric cardiac surgery is not a benefit.
Topics: Adult; Anti-Inflammatory Agents; Aprotinin; Blood Transfusion; Cardiac Surgical Procedures; Child; C | 1999 |