thiorphan has been researched along with Ache in 18 studies
Thiorphan: A potent inhibitor of membrane metalloendopeptidase (ENKEPHALINASE). Thiorphan potentiates morphine-induced ANALGESIA and attenuates naloxone-precipitated withdrawal symptoms.
| Excerpt | Relevance | Reference |
|---|---|---|
| " In rats with hindpaw inflammation, inhibitors of aminopeptidase N (APN; bestatin) or neutral endopeptidase (NEP; thiorphan), and a dual inhibitor, NH(2)-CH-Ph-P(O)(OH)CH(2)-CH-CH(2)Ph(p-Ph)-CONH-CH-CH(3)-COOH (P8B), were applied to injured paws." | 3.78 | Pain inhibition by blocking leukocytic and neuronal opioid peptidases in peripheral inflamed tissue. ( Fournie-Zaluski, MC; Gore, C; Labuz, D; Machelska, H; Roques, BP; Schreiter, A; Stein, C, 2012) |
| "5 mg/kg of GB 52, a highly potent derivative of the enkephalinase inhibitor, thiorphan, were studied on the threshold of both the nociceptive reflex (Tr) and sensation of pain (Tp) as well as on the thresholds of both recruitment of the maximal nociceptive reflex response (Tmr) and tolerable pain (Tip), elicited by electrical stimulation of the sural nerve in normal and relaxed volunteers." | 3.67 | The enkephalinase inhibitor, GB 52, does not affect nociceptive flexion reflexes nor pain sensation in humans. ( Ernst, M; Roby, A; Willer, JC, 1986) |
| "To confirm that endogenous opioid-peptidergic systems and monoaminergic systems participate in the regulation of pain, the effects of a narcotic antagonist naloxone, inhibitors of enkephalin-degrading enzymes and monoaminergic blockers on persistent pain induced by formalin were investigated." | 3.67 | Involvement of medullary opioid-peptidergic and spinal noradrenergic systems in the regulation of formalin-induced persistent pain. ( Kuraishi, Y; Satoh, M; Sugimoto, M; Takagi, H, 1986) |
| "The effect of the inhibition of aminopeptidase and enkephalinase A on the pain threshold of mice and rats was investigated, using bestatin and thiorphan as selective peptidase inhibitors." | 3.66 | Effect of inhibition of neuropeptidases on the pain threshold of mice and rats. ( Carenzi, A; Della Bella, D; Frigeni, V; Reggiani, A, 1983) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 14 (77.78) | 18.7374 |
| 1990's | 2 (11.11) | 18.2507 |
| 2000's | 1 (5.56) | 29.6817 |
| 2010's | 1 (5.56) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Schreiter, A | 1 |
| Gore, C | 1 |
| Labuz, D | 1 |
| Fournie-Zaluski, MC | 4 |
| Roques, BP | 4 |
| Stein, C | 1 |
| Machelska, H | 1 |
| Rougeot, C | 1 |
| Messaoudi, M | 1 |
| Hermitte, V | 1 |
| Rigault, AG | 1 |
| Blisnick, T | 1 |
| Dugave, C | 1 |
| Desor, D | 1 |
| Rougeon, F | 1 |
| Chaillet, P | 1 |
| Coulaud, A | 1 |
| Gacel, G | 1 |
| Costentin, J | 2 |
| Guilbaud, G | 2 |
| Kayser, V | 2 |
| Benoist, JM | 1 |
| Gautron, M | 1 |
| Carenzi, A | 1 |
| Frigeni, V | 1 |
| Reggiani, A | 1 |
| Della Bella, D | 1 |
| Nichols, ML | 1 |
| Bian, D | 1 |
| Ossipov, MH | 1 |
| Malan, TP | 1 |
| Porreca, F | 1 |
| Zhou, Y | 1 |
| Luo, F | 1 |
| Han, J | 1 |
| Yu, Z | 1 |
| Williams, PS | 2 |
| Smith, HJ | 2 |
| Sewell, RD | 2 |
| Patel, A | 1 |
| Gonzalez, JP | 2 |
| Malin, DH | 1 |
| Lake, JR | 1 |
| Hamilton, RF | 1 |
| Skolnick, MH | 1 |
| Michael-Titus, A | 1 |
| Dourmap, N | 1 |
| Caline, H | 1 |
| Schwartz, JC | 1 |
| Villanueva, L | 1 |
| Cadden, S | 1 |
| Chitour, D | 1 |
| Le Bars, D | 2 |
| Willer, JC | 1 |
| Roby, A | 1 |
| Ernst, M | 1 |
| Bourgoin, S | 1 |
| Cesselin, F | 1 |
| Hamon, M | 1 |
| Dickenson, AH | 2 |
| Hill, RG | 1 |
| Hughes, J | 1 |
| Pittaway, KM | 1 |
| Sugimoto, M | 1 |
| Kuraishi, Y | 1 |
| Satoh, M | 1 |
| Takagi, H | 1 |
| Sullivan, AF | 1 |
18 other studies available for thiorphan and Ache
| Article | Year |
|---|---|
Pain inhibition by blocking leukocytic and neuronal opioid peptidases in peripheral inflamed tissue.
Topics: Alanine; Amino Acid Sequence; Animals; Antibodies; CD13 Antigens; Dose-Response Relationship, Drug; | 2012 |
Sialorphin, a natural inhibitor of rat membrane-bound neutral endopeptidase that displays analgesic activity.
Topics: Amino Acid Sequence; Analgesics; Animals; Enkephalin, Methionine; Formaldehyde; Glycopeptides; Kidne | 2003 |
Pain control by endogenous enkephalins is mediated by mu opioid receptors.
Topics: Amino Acids, Sulfur; Analgesia; Animals; Enkephalin, Methionine; Enkephalins; Leucine; Male; Mice; P | 1983 |
Depressive effects of morphine and of an enkephalinase inhibitor on responses of ventro-basal thalamic neurones to noxious stimuli.
Topics: Amino Acids, Sulfur; Animals; Morphine; Neprilysin; Neurons; Nociceptors; Pain; Protease Inhibitors; | 1983 |
Effect of inhibition of neuropeptidases on the pain threshold of mice and rats.
Topics: Aminopeptidases; Animals; Endopeptidases; Enkephalin, Leucine; Leucine; Male; Mice; Neprilysin; Pain | 1983 |
The analgesic effects of morphine, but not those of the enkephalinase inhibitor thiorphan, are enhanced in arthritic rats.
Topics: Amino Acids, Sulfur; Analgesia; Animals; Arthritis; Arthritis, Experimental; Male; Morphine; Naloxon | 1983 |
Antiallodynic effects of a CCKB antagonist in rats with nerve ligation injury: role of endogenous enkephalins.
Topics: Animals; Male; Naltrexone; Narcotic Antagonists; Pain; Peripheral Nervous System; Rats; Rats, Spragu | 1996 |
[Enkephelinase inhibitors acetorphan and SCH34826 potentiate the analgesic effect of low frequency electroacupuncture in rats].
Topics: Acupuncture Analgesia; Animals; Dioxolanes; Dipeptides; Electroacupuncture; Female; Male; Neprilysin | 1990 |
Novel inhibitors of enkephalin-degrading enzymes. II: N5'-substituted-4-thioxohydantoic acids as aminopeptidase inhibitors.
Topics: Aminopeptidases; Analgesics; Animals; Glycine; Indicators and Reagents; Leucine; Mice; Naloxone; Nep | 1989 |
Novel inhibitors of enkephalin-degrading enzymes. I: Inhibitors of enkephalinase by penicillins.
Topics: Analgesics; Animals; Brain; Enkephalin, Leucine-2-Alanine; Isoenzymes; Male; Mice; Mice, Inbred Stra | 1989 |
Augmented analgesic effects of enkephalinase inhibitors combined with transcranial electrostimulation.
Topics: Analgesia; Analgesics; Animals; Brain; Cerebral Ventricles; Electric Stimulation; Injections, Intrav | 1989 |
Role of endogenous enkephalins in locomotion and nociception studied with peptidase inhibitors in two inbred strains of mice (C57BL/6J and DBA/2J).
Topics: Analgesics; Animals; Cerebral Ventricles; Enkephalins; Injections, Intraventricular; Leucine; Male; | 1989 |
Failure of ES 52, a highly potent enkephalinase inhibitor, to affect nociceptive transmission by rat dorsal horn convergent neurones.
Topics: Amino Acids, Sulfur; Animals; Enkephalins; Male; Nociceptors; Pain; Rats; Spinal Cord; Synaptic Tran | 1985 |
The enkephalinase inhibitor, GB 52, does not affect nociceptive flexion reflexes nor pain sensation in humans.
Topics: Adult; Amino Acids, Sulfur; Electric Stimulation; Endopeptidases; Enkephalins; Female; Humans; Male; | 1986 |
Increase in met-enkephalin level and antinociceptive effects induced by kelatorphan in the rat spinal cord.
Topics: Analgesics; Animals; Dipeptides; Enkephalin, Methionine; In Vitro Techniques; Leucine; Neurons; Pain | 1986 |
Antinociceptive action of cholecystokinin octapeptide (CCK 8) and related peptides in rats and mice: effects of naloxone and peptidase inhibitors.
Topics: Animals; Captopril; FMRFamide; Gastrins; Leucine; Male; Mice; Naloxone; Neuropeptides; Pain; Proteas | 1987 |
Involvement of medullary opioid-peptidergic and spinal noradrenergic systems in the regulation of formalin-induced persistent pain.
Topics: Animals; Endorphins; Formaldehyde; Injections, Spinal; Leucine; Male; Medulla Oblongata; Naloxone; N | 1986 |
Prevention of degradation of endogenous enkephalins produces inhibition of nociceptive neurones in rat spinal cord.
Topics: Action Potentials; Animals; Dipeptides; Enkephalins; Leucine; Male; Naloxone; Nerve Fibers; Neural I | 1987 |