temefos has been researched along with Onchocerciasis in 18 studies
Temefos: An organothiophosphate insecticide.
temephos : An organic sulfide that is diphenyl sulfide in which the hydrogen at the para position of each of the phenyl groups has been replaced by a (dimethoxyphosphorothioyl)oxy group.
Onchocerciasis: Infection with nematodes of the genus ONCHOCERCA. Characteristics include the presence of firm subcutaneous nodules filled with adult worms, PRURITUS, and ocular lesions.
| Excerpt | Relevance | Reference |
|---|---|---|
| " larvae were killed below a temephos dosing point." | 2.45 | The elimination of the onchocerciasis vector from the island of Bioko as a result of larviciding by the WHO African Programme for Onchocerciasis Control. ( Aké, A; Amazigo, UV; Barro, T; Cheke, RA; Coulibaly, S; Diallo, A; Mas, J; McCall, PJ; Meyer, RR; Noma, M; Post, RJ; Sékétéli, AV; Sima, A; Traoré, S; Wilson, MD; Yaméogo, L; Zouré, H, 2009) |
| "Onchocerciasis is being actively transmitted within the Meme River Basin." | 1.72 | The preparatory phase for ground larviciding implementation for chocerciasis control in the Meme River Basin in South West Cameroon: the COUNTDOWN Consortium alternative strategy implementation trial. ( Abong, RA; Amuam, A; Cho, JF; Ekanya, R; Enyong, P; Esum, ME; Hamill, L; Ndzeshang, BL; Njouendou, AJ; Nkimbeng, DA; Obie, ED; Taylor, MJ; Thorogood, S; Turner, JD; Wanji, S, 2022) |
| "Onchocerciasis is a priority neglected tropical disease targeted for elimination by 2025." | 1.51 | Implementation of test-and-treat with doxycycline and temephos ground larviciding as alternative strategies for accelerating onchocerciasis elimination in an area of loiasis co-endemicity: the COUNTDOWN consortium multi-disciplinary study protocol. ( Abong, RA; Amuam, A; Dean, L; Ekanya, R; Enyong, P; Forrer, A; Fung, EG; Hamill, L; Kah, E; Khan, JAM; Murdoch, ME; Ndongmo, WPC; Ndzeshang, BL; Niessen, L; Nji, TM; Njouendou, AJ; Njoumemi, Z; Nkimbeng, DA; Nnamdi, DB; Obie, ED; Ozano, K; Piotrowski, H; Taylor, MJ; Teghen, S; Theobald, S; Thomson, R; Turner, JD; Wanji, S; Watson, V; Woode, ME, 2019) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 5 (27.78) | 18.7374 |
| 1990's | 2 (11.11) | 18.2507 |
| 2000's | 4 (22.22) | 29.6817 |
| 2010's | 4 (22.22) | 24.3611 |
| 2020's | 3 (16.67) | 2.80 |
| Authors | Studies |
|---|---|
| Ekanya, R | 2 |
| Obie, ED | 2 |
| Hamill, L | 2 |
| Thorogood, S | 1 |
| Abong, RA | 2 |
| Njouendou, AJ | 2 |
| Amuam, A | 2 |
| Ndzeshang, BL | 2 |
| Nkimbeng, DA | 2 |
| Cho, JF | 1 |
| Esum, ME | 1 |
| Enyong, P | 2 |
| Turner, JD | 2 |
| Taylor, MJ | 2 |
| Wanji, S | 2 |
| Atekem, K | 1 |
| Dixon, R | 1 |
| Wilhelm, A | 1 |
| Biholong, B | 1 |
| Oye, J | 1 |
| Djeunga, HN | 1 |
| Nwane, P | 1 |
| Ayisi, F | 1 |
| Boakye, D | 1 |
| Kamgno, J | 1 |
| Schmidt, E | 1 |
| Nditanchou, R | 1 |
| Senyonjo, L | 1 |
| Nji, TM | 1 |
| Dean, L | 1 |
| Ozano, K | 1 |
| Ndongmo, WPC | 1 |
| Fung, EG | 1 |
| Nnamdi, DB | 1 |
| Teghen, S | 1 |
| Kah, E | 1 |
| Piotrowski, H | 1 |
| Forrer, A | 1 |
| Khan, JAM | 1 |
| Woode, ME | 1 |
| Niessen, L | 1 |
| Watson, V | 1 |
| Njoumemi, Z | 1 |
| Murdoch, ME | 1 |
| Thomson, R | 1 |
| Theobald, S | 1 |
| Katabarwa, MN | 1 |
| Habomugisha, P | 3 |
| Khainza, A | 1 |
| Oguttu, D | 3 |
| Byamukama, E | 4 |
| Katamanywa, J | 4 |
| Isingooma, T | 1 |
| Bwenume, F | 1 |
| Nahabwe, C | 1 |
| Ngabirano, M | 1 |
| Akampurira, P | 1 |
| Bernard, L | 1 |
| Unnasch, TR | 2 |
| Richards, F | 3 |
| Lakwo, TL | 3 |
| Garms, R | 3 |
| Rubaale, T | 2 |
| Katabarwa, M | 2 |
| Walsh, F | 1 |
| Unnasch, T | 1 |
| Namanya, H | 1 |
| Tukesiga, E | 3 |
| Bamuhiiga, J | 1 |
| Agunyo, S | 1 |
| Lakwo, T | 1 |
| Wamani, J | 1 |
| Tukahebwa, EM | 1 |
| Onapa, AW | 2 |
| Begumisa, S | 1 |
| Ndyomugyenyi, R | 2 |
| Kipp, W | 1 |
| Post, RJ | 2 |
| Amazigo, UV | 2 |
| Traoré, S | 1 |
| Wilson, MD | 1 |
| Sima, A | 1 |
| Barro, T | 2 |
| Diallo, A | 1 |
| Aké, A | 1 |
| Coulibaly, S | 1 |
| Cheke, RA | 1 |
| Meyer, RR | 1 |
| Mas, J | 1 |
| McCall, PJ | 1 |
| Zouré, H | 1 |
| Noma, M | 1 |
| Yaméogo, L | 1 |
| Sékétéli, AV | 1 |
| Infante-Rodríguez, DA | 1 |
| Novelo-Gutiérrez, R | 1 |
| Mercado, G | 1 |
| Williams, T | 1 |
| Twebaze, C | 1 |
| Kalinga, AK | 1 |
| Mweya, CN | 1 |
| Maegga, BT | 1 |
| Le Berre, R | 1 |
| Matsuo, K | 1 |
| Opong-Mensah, K | 1 |
| Ochoa, JO | 1 |
| Castro, JC | 1 |
| Barrios, VM | 1 |
| Juarez, EL | 1 |
| Tada, I | 1 |
| Hougard, JM | 1 |
| Lochouarn, L | 1 |
| Escaffre, H | 1 |
| Le Goff, G | 1 |
| Prud'hom, JM | 1 |
| Quillévéré, D | 1 |
| Baker, RH | 1 |
| Abdelnur, OM | 1 |
| Jamnback, H | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Microfilarial Clearance From the Eye and Ocular Changes Associated With Ivermectin Treatment in Individuals With Onchocerciasis[NCT03517462] | 231 participants (Actual) | Interventional | 2018-08-06 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
3 reviews available for temefos and Onchocerciasis
| Article | Year |
|---|---|
The elimination of the onchocerciasis vector from the island of Bioko as a result of larviciding by the WHO African Programme for Onchocerciasis Control.
Topics: Animals; Disease Vectors; Endemic Diseases; Guinea; Humans; Insecticides; Onchocerciasis; Simuliidae | 2009 |
A review of temephos with particular reference to the West African Onchocerciasis Control Program.
Topics: Africa, Western; Animals; Chemical Phenomena; Chemistry; Humans; Insecticides; Maximum Allowable Con | 1984 |
Recent developments in control of blackflies.
Topics: Animals; Apicomplexa; Carbaryl; Chlorpyrifos; DDT; Diptera; Fenitrothion; Fenthion; Fungi; Humans; I | 1973 |
15 other studies available for temefos and Onchocerciasis
| Article | Year |
|---|---|
The preparatory phase for ground larviciding implementation for chocerciasis control in the Meme River Basin in South West Cameroon: the COUNTDOWN Consortium alternative strategy implementation trial.
Topics: Animals; Brachyura; Cameroon; Ivermectin; Larva; Onchocerciasis; Rivers; Simuliidae; Temefos | 2022 |
Evaluating the impact of alternative intervention strategies in accelerating onchocerciasis elimination in an area of persistent transmission in the West Region of Cameroon.
Topics: Animals; Cameroon; Doxycycline; Humans; Ivermectin; Microfilariae; Onchocerciasis; Temefos | 2022 |
Implementation of test-and-treat with doxycycline and temephos ground larviciding as alternative strategies for accelerating onchocerciasis elimination in an area of loiasis co-endemicity: the COUNTDOWN consortium multi-disciplinary study protocol.
Topics: Animals; Anthelmintics; Cameroon; Disease Eradication; Doxycycline; Feasibility Studies; Health Plan | 2019 |
Elimination of
Topics: Animals; Antiparasitic Agents; Brachyura; Disease Eradication; Humans; Ivermectin; Onchocerciasis; S | 2020 |
The disappearance of onchocerciasis from the Itwara focus, western Uganda after elimination of the vector Simulium neavei and 19 years of annual ivermectin treatments.
Topics: Animals; Anthelmintics; Antibodies, Helminth; Child; Child, Preschool; Disease Eradication; Disease | 2013 |
Interruption of the transmission of Onchocerca volvulus in the Kashoya-Kitomi focus, western Uganda by long-term ivermectin treatment and elimination of the vector Simulium neavei by larviciding.
Topics: Animals; Antiparasitic Agents; Child; Humans; Insect Control; Insect Vectors; Insecticides; Ivermect | 2017 |
The elimination of the vector Simulium neavei from the Itwara onchocerciasis focus in Uganda by ground larviciding.
Topics: Animals; Female; Humans; Insect Control; Insecticides; Onchocerca volvulus; Onchocerciasis; Simuliid | 2009 |
Spinosad toxicity to Simulium spp. larvae and associated aquatic biota in a coffee-growing region of Veracruz State, Mexico.
Topics: Animals; Drug Combinations; Female; Insect Control; Insect Vectors; Insecta; Larva; Lethal Dose 50; | 2011 |
Transmission of Onchocerca volvulus and prospects for the elimination of its vector, the blackfly Simulium neavei in the Mpamba-Nkusi focus in Western Uganda.
Topics: Animals; Antiparasitic Agents; Brachyura; Ecosystem; Feeding Behavior; Female; Insect Bites and Stin | 2006 |
Susceptibility of Simulium damnosum complex larvae to temephos in the Tukuyu onchocerciasis focus, southwest Tanzania.
Topics: Animals; Insect Control; Insect Vectors; Insecticide Resistance; Insecticides; Larva; Lethal Dose 50 | 2007 |
[The fight against Simulium vectors of onchocercosis in Africa].
Topics: Africa; Diptera; Humans; Insect Vectors; Onchocerciasis; Temefos | 1981 |
Use of temephos larvicide in solid form for the control of onchocerciasis in Guatemala.
Topics: Animals; Guatemala; Humans; Insecticides; Onchocerciasis; Simuliidae; Temefos | 1984 |
Successful control of onchocerciasis vectors in San Vicente Pacaya, Guatemala, 1984-1989.
Topics: Animals; Child; Guatemala; Humans; Incidence; Insect Control; Insect Vectors; Insecticides; Onchocer | 1997 |
[Campaign against the vectors of onchocerciasis in the surroundings of a refugee camp located in a savanna zone of Cameroon].
Topics: Animals; Cameroon; Chad; Humans; Insect Control; Onchocerciasis; Seasons; Simuliidae; Temefos | 1990 |
Localized onchocerciasis vector control in the Bahr el Ghazal Region of South-Western Sudan. II. Control.
Topics: Animals; Fresh Water; Humans; Insect Bites and Stings; Insect Control; Insect Vectors; Insecticides; | 1986 |