sodium fluoride has been researched along with Disease Exacerbation in 42 studies
| Excerpt | Relevance | Reference |
|---|---|---|
| "18F-Sodium fluoride (18F-NaF) and 18F-fluorodeoxyglucose (18F-FDG) are promising novel biomarkers of disease activity in aortic stenosis." | 9.19 | 18F-sodium fluoride uptake is a marker of active calcification and disease progression in patients with aortic stenosis. ( Boon, NA; Chin, CW; Cowie, WJ; Dweck, MR; Fletcher, A; Jenkins, WS; Malley, TS; Newby, DE; Pessotto, R; Pringle, MA; Richardson, H; Rudd, JH; Tsampasian, V; van Beek, EJ; Vesey, AT; Wallace, WA, 2014) |
| "The present investigation was performed to examine if triclosan and a copolymer, incorporated in a dentifrice and used by periodontitis-susceptible subjects could influence clinical symptoms characteristic of recurrent periodontitis." | 9.08 | The use of a triclosan/copolymer dentifrice may retard the progression of periodontitis. ( Furuichi, Y; Lindhe, J; Ramberg, P; Rosling, B; Volpe, AR; Wannfors, B, 1997) |
| "A significant majority of atherosclerotic plaque ruptures occur in coronary arteries exhibiting none or only modest luminal narrowing on coronary angiography." | 6.49 | Targeted PET/CT imaging of vulnerable atherosclerotic plaques: microcalcification with sodium fluoride and inflammation with fluorodeoxyglucose. ( Chen, W; Dilsizian, V, 2013) |
| "18F-Sodium fluoride (18F-NaF) and 18F-fluorodeoxyglucose (18F-FDG) are promising novel biomarkers of disease activity in aortic stenosis." | 5.19 | 18F-sodium fluoride uptake is a marker of active calcification and disease progression in patients with aortic stenosis. ( Boon, NA; Chin, CW; Cowie, WJ; Dweck, MR; Fletcher, A; Jenkins, WS; Malley, TS; Newby, DE; Pessotto, R; Pringle, MA; Richardson, H; Rudd, JH; Tsampasian, V; van Beek, EJ; Vesey, AT; Wallace, WA, 2014) |
| "The present investigation was performed to examine if triclosan and a copolymer, incorporated in a dentifrice and used by periodontitis-susceptible subjects could influence clinical symptoms characteristic of recurrent periodontitis." | 5.08 | The use of a triclosan/copolymer dentifrice may retard the progression of periodontitis. ( Furuichi, Y; Lindhe, J; Ramberg, P; Rosling, B; Volpe, AR; Wannfors, B, 1997) |
| "18F-sodium fluoride (18F-NaF) has been used to access aortic stenosis in clinical research setting." | 3.96 | Aortic valve microcalcification and cardiovascular risk: an exploratory study using sodium fluoride in high cardiovascular risk patients. ( Abrunhosa, A; Castelo-Branco, M; Chichorro, N; de Lima, JP; Domingues, C; Gonçalves, L; João Ferreira, M; Oliveira-Santos, M; Silva, R, 2020) |
| "The aim of this exploratory double-blinded, randomized, cross-over, in situ study was to compare the effects of various model parameters ('intervention', 'brushing', 'position') on enamel caries lesions in a dose-response model." | 2.80 | The effect of various model parameters on enamel caries lesions in a dose-response model in situ. ( Dörfer, CE; Gninka, B; Heldmann, P; Meyer-Lueckel, H; Paris, S; Wierichs, RJ, 2015) |
| "A significant majority of atherosclerotic plaque ruptures occur in coronary arteries exhibiting none or only modest luminal narrowing on coronary angiography." | 2.49 | Targeted PET/CT imaging of vulnerable atherosclerotic plaques: microcalcification with sodium fluoride and inflammation with fluorodeoxyglucose. ( Chen, W; Dilsizian, V, 2013) |
| " Oral examinations were conducted before radiotherapy, after dosage of 2000 cGy irradiation, immediately after the termination of radiotherapy, and 1 month and 6 months after termination of the radiotherapy." | 1.36 | Progress of oral sequelae during head-neck radiotherapy. ( Deng, J; Gao, XJ; Li, NY; Lu, HJ; Sun, HB, 2010) |
| "Furthermore, progressive severe dental caries can present a dilemma for the clinician in affected individuals, despite intensive preventive and restorative therapy." | 1.31 | Submandibular gland aplasia and progressive dental caries: a case report. ( Fracaro, MS; Hallett, KB; Linnett, VM; Savage, NW, 2002) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 3 (7.14) | 18.2507 |
| 2000's | 8 (19.05) | 29.6817 |
| 2010's | 26 (61.90) | 24.3611 |
| 2020's | 5 (11.90) | 2.80 |
| Authors | Studies |
|---|---|
| Kwiecinski, J | 1 |
| Tzolos, E | 1 |
| Fletcher, AJ | 1 |
| Nash, J | 1 |
| Meah, MN | 1 |
| Cadet, S | 1 |
| Adamson, PD | 1 |
| Grodecki, K | 1 |
| Joshi, N | 1 |
| Williams, MC | 1 |
| van Beek, EJR | 1 |
| Lai, C | 1 |
| Tavares, AAS | 1 |
| MacAskill, MG | 1 |
| Dey, D | 1 |
| Baker, AH | 1 |
| Leipsic, J | 1 |
| Berman, DS | 1 |
| Sellers, SL | 1 |
| Newby, DE | 5 |
| Dweck, MR | 4 |
| Slomka, PJ | 1 |
| Domingues, C | 1 |
| João Ferreira, M | 1 |
| Silva, R | 1 |
| Oliveira-Santos, M | 1 |
| Chichorro, N | 1 |
| de Lima, JP | 1 |
| Gonçalves, L | 1 |
| Castelo-Branco, M | 1 |
| Abrunhosa, A | 1 |
| Nguépy Keubo, FR | 1 |
| Mboua, PC | 1 |
| Djifack Tadongfack, T | 1 |
| Fokouong Tchoffo, E | 1 |
| Tasson Tatang, C | 1 |
| Ide Zeuna, J | 1 |
| Noupoue, EM | 1 |
| Tsoplifack, CB | 1 |
| Folefack, GO | 1 |
| Kettani, M | 1 |
| Bandelier, P | 1 |
| Huo, J | 1 |
| Li, H | 4 |
| Yu, D | 1 |
| Arulsamy, N | 1 |
| AlAbbad, S | 1 |
| Sardot, T | 1 |
| Lekashvili, O | 1 |
| Decato, D | 1 |
| Lelj, F | 1 |
| Alexander Ross, JB | 1 |
| Rosenberg, E | 1 |
| Nazir, H | 1 |
| Muthuswamy, N | 1 |
| Louis, C | 1 |
| Jose, S | 1 |
| Prakash, J | 1 |
| Buan, MEM | 1 |
| Flox, C | 1 |
| Chavan, S | 1 |
| Shi, X | 1 |
| Kauranen, P | 1 |
| Kallio, T | 1 |
| Maia, G | 1 |
| Tammeveski, K | 1 |
| Lymperopoulos, N | 1 |
| Carcadea, E | 1 |
| Veziroglu, E | 1 |
| Iranzo, A | 1 |
| M Kannan, A | 1 |
| Arunamata, A | 1 |
| Tacy, TA | 1 |
| Kache, S | 1 |
| Mainwaring, RD | 1 |
| Ma, M | 1 |
| Maeda, K | 1 |
| Punn, R | 1 |
| Noguchi, S | 1 |
| Hahn, S | 3 |
| Iwasa, Y | 3 |
| Ling, J | 3 |
| Voccio, JP | 2 |
| Kim, Y | 3 |
| Song, J | 3 |
| Bascuñán, J | 2 |
| Chu, Y | 1 |
| Tomita, M | 1 |
| Cazorla, M | 1 |
| Herrera, E | 1 |
| Palomeque, E | 1 |
| Saud, N | 1 |
| Hoplock, LB | 1 |
| Lobchuk, MM | 1 |
| Lemoine, J | 1 |
| Li, X | 10 |
| Henson, MA | 1 |
| Unsihuay, D | 1 |
| Qiu, J | 1 |
| Swaroop, S | 1 |
| Nagornov, KO | 1 |
| Kozhinov, AN | 1 |
| Tsybin, YO | 1 |
| Kuang, S | 1 |
| Laskin, J | 1 |
| Zin, NNINM | 1 |
| Mohamad, MN | 1 |
| Roslan, K | 1 |
| Abdul Wafi, S | 1 |
| Abdul Moin, NI | 1 |
| Alias, A | 1 |
| Zakaria, Y | 1 |
| Abu-Bakar, N | 1 |
| Naveed, A | 1 |
| Jilani, K | 1 |
| Siddique, AB | 1 |
| Akbar, M | 1 |
| Riaz, M | 1 |
| Mushtaq, Z | 1 |
| Sikandar, M | 1 |
| Ilyas, S | 1 |
| Bibi, I | 1 |
| Asghar, A | 1 |
| Rasool, G | 1 |
| Irfan, M | 1 |
| Li, XY | 1 |
| Zhao, S | 1 |
| Fan, XH | 1 |
| Chen, KP | 1 |
| Hua, W | 1 |
| Liu, ZM | 1 |
| Xue, XD | 1 |
| Zhou, B | 1 |
| Zhang, S | 2 |
| Xing, YL | 1 |
| Chen, MA | 1 |
| Sun, Y | 1 |
| Neradilek, MB | 1 |
| Wu, XT | 1 |
| Zhang, D | 2 |
| Huang, W | 1 |
| Cui, Y | 1 |
| Yang, QQ | 1 |
| Li, HW | 1 |
| Zhao, XQ | 1 |
| Hossein Rashidi, B | 1 |
| Tarafdari, A | 1 |
| Ghazimirsaeed, ST | 1 |
| Shahrokh Tehraninezhad, E | 1 |
| Keikha, F | 1 |
| Eslami, B | 1 |
| Ghazimirsaeed, SM | 1 |
| Jafarabadi, M | 1 |
| Silvani, Y | 1 |
| Lovita, AND | 1 |
| Maharani, A | 1 |
| Wiyasa, IWA | 1 |
| Sujuti, H | 1 |
| Ratnawati, R | 1 |
| Raras, TYM | 1 |
| Lemin, AS | 1 |
| Rahman, MM | 1 |
| Pangarah, CA | 1 |
| Kiyu, A | 1 |
| Zeng, C | 2 |
| Du, H | 1 |
| Lin, D | 1 |
| Jalan, D | 1 |
| Rubagumya, F | 1 |
| Hopman, WM | 1 |
| Vanderpuye, V | 1 |
| Lopes, G | 1 |
| Seruga, B | 1 |
| Booth, CM | 1 |
| Berry, S | 1 |
| Hammad, N | 1 |
| Sajo, EA | 1 |
| Okunade, KS | 1 |
| Olorunfemi, G | 1 |
| Rabiu, KA | 1 |
| Anorlu, RI | 1 |
| Xu, C | 2 |
| Xiang, Y | 1 |
| Xu, X | 1 |
| Zhou, L | 2 |
| Dong, X | 1 |
| Tang, S | 1 |
| Gao, XC | 1 |
| Wei, CH | 1 |
| Zhang, RG | 1 |
| Cai, Q | 1 |
| He, Y | 1 |
| Tong, F | 1 |
| Dong, JH | 1 |
| Wu, G | 1 |
| Dong, XR | 1 |
| Tang, X | 1 |
| Tao, F | 1 |
| Xiang, W | 1 |
| Zhao, Y | 2 |
| Jin, L | 1 |
| Tao, H | 1 |
| Lei, Y | 1 |
| Gan, H | 1 |
| Huang, Y | 1 |
| Chen, Y | 3 |
| Chen, L | 3 |
| Shan, A | 1 |
| Zhao, H | 2 |
| Wu, M | 2 |
| Ma, Q | 1 |
| Wang, J | 4 |
| Zhang, E | 1 |
| Zhang, J | 3 |
| Li, Y | 5 |
| Xue, F | 1 |
| Deng, L | 1 |
| Liu, L | 2 |
| Yan, Z | 2 |
| Wang, Y | 2 |
| Meng, J | 1 |
| Chen, G | 3 |
| Anastassiadou, M | 1 |
| Bernasconi, G | 1 |
| Brancato, A | 1 |
| Carrasco Cabrera, L | 1 |
| Greco, L | 1 |
| Jarrah, S | 1 |
| Kazocina, A | 1 |
| Leuschner, R | 1 |
| Magrans, JO | 1 |
| Miron, I | 1 |
| Nave, S | 1 |
| Pedersen, R | 1 |
| Reich, H | 1 |
| Rojas, A | 1 |
| Sacchi, A | 1 |
| Santos, M | 1 |
| Theobald, A | 1 |
| Vagenende, B | 1 |
| Verani, A | 1 |
| Du, L | 1 |
| Liu, X | 1 |
| Ren, Y | 1 |
| Li, J | 7 |
| Li, P | 1 |
| Jiao, Q | 1 |
| Meng, P | 1 |
| Wang, F | 2 |
| Wang, YS | 1 |
| Wang, C | 3 |
| Zhou, X | 2 |
| Wang, W | 1 |
| Wang, S | 2 |
| Hou, J | 1 |
| Zhang, A | 1 |
| Lv, B | 1 |
| Gao, C | 1 |
| Pang, D | 1 |
| Lu, K | 1 |
| Ahmad, NH | 1 |
| Wang, L | 1 |
| Zhu, J | 2 |
| Zhang, L | 2 |
| Zhuang, T | 1 |
| Tu, J | 1 |
| Zhao, Z | 1 |
| Qu, Y | 1 |
| Yao, H | 1 |
| Wang, X | 6 |
| Lee, DF | 1 |
| Shen, J | 3 |
| Wen, L | 1 |
| Huang, G | 2 |
| Xie, X | 1 |
| Zhao, Q | 1 |
| Hu, W | 1 |
| Zhang, Y | 4 |
| Wu, X | 1 |
| Lu, J | 2 |
| Li, M | 1 |
| Li, W | 2 |
| Wu, W | 1 |
| Du, F | 1 |
| Ji, H | 1 |
| Yang, X | 2 |
| Xu, Z | 1 |
| Wan, L | 1 |
| Wen, Q | 1 |
| Cho, CH | 1 |
| Zou, C | 1 |
| Xiao, Z | 1 |
| Liao, J | 1 |
| Su, X | 1 |
| Bi, Z | 1 |
| Su, Q | 1 |
| Huang, H | 1 |
| Wei, Y | 2 |
| Gao, Y | 2 |
| Na, KJ | 1 |
| Choi, H | 1 |
| Oh, HR | 1 |
| Kim, YH | 1 |
| Lee, SB | 1 |
| Jung, YJ | 1 |
| Koh, J | 1 |
| Park, S | 1 |
| Lee, HJ | 1 |
| Jeon, YK | 1 |
| Chung, DH | 1 |
| Paeng, JC | 1 |
| Park, IK | 1 |
| Kang, CH | 1 |
| Cheon, GJ | 1 |
| Kang, KW | 1 |
| Lee, DS | 1 |
| Kim, YT | 1 |
| Pajuelo-Lozano, N | 1 |
| Alcalá, S | 1 |
| Sainz, B | 1 |
| Perona, R | 1 |
| Sanchez-Perez, I | 1 |
| Logotheti, S | 1 |
| Marquardt, S | 1 |
| Gupta, SK | 1 |
| Richter, C | 1 |
| Edelhäuser, BAH | 1 |
| Engelmann, D | 1 |
| Brenmoehl, J | 1 |
| Söhnchen, C | 1 |
| Murr, N | 1 |
| Alpers, M | 1 |
| Singh, KP | 1 |
| Wolkenhauer, O | 1 |
| Heckl, D | 1 |
| Spitschak, A | 1 |
| Pützer, BM | 1 |
| Liao, Y | 1 |
| Cheng, J | 1 |
| Kong, X | 1 |
| Li, S | 1 |
| Zhang, M | 4 |
| Zhang, H | 1 |
| Yang, T | 2 |
| Dong, Y | 1 |
| Xu, Y | 1 |
| Yuan, Z | 1 |
| Cao, J | 1 |
| Zheng, Y | 1 |
| Luo, Z | 1 |
| Mei, Z | 1 |
| Yao, Y | 1 |
| Liu, Z | 2 |
| Liang, C | 1 |
| Yang, H | 1 |
| Song, Y | 1 |
| Yu, K | 1 |
| Zhu, C | 1 |
| Huang, Z | 1 |
| Qian, J | 1 |
| Ge, J | 1 |
| Hu, J | 2 |
| Wang, H | 2 |
| Liu, Y | 4 |
| Mi, Y | 1 |
| Kong, H | 1 |
| Xi, D | 1 |
| Yan, W | 1 |
| Luo, X | 1 |
| Ning, Q | 1 |
| Chang, X | 2 |
| Zhang, T | 2 |
| Wang, Q | 2 |
| Rathore, MG | 1 |
| Reddy, K | 1 |
| Chen, H | 1 |
| Shin, SH | 1 |
| Ma, WY | 1 |
| Bode, AM | 1 |
| Dong, Z | 1 |
| Mu, W | 1 |
| Liu, C | 3 |
| Gao, F | 1 |
| Qi, Y | 1 |
| Lu, H | 1 |
| Zhang, X | 4 |
| Cai, X | 1 |
| Ji, RY | 1 |
| Hou, Y | 3 |
| Tian, J | 2 |
| Shi, Y | 1 |
| Ying, S | 1 |
| Tan, M | 1 |
| Feng, G | 1 |
| Kuang, Y | 1 |
| Chen, D | 1 |
| Wu, D | 3 |
| Zhu, ZQ | 1 |
| Tang, HX | 1 |
| Shi, ZE | 1 |
| Kang, J | 1 |
| Liu, Q | 1 |
| Qi, J | 2 |
| Mu, J | 1 |
| Cong, Z | 1 |
| Chen, S | 2 |
| Fu, D | 1 |
| Li, Z | 2 |
| Celestrin, CP | 1 |
| Rocha, GZ | 1 |
| Stein, AM | 1 |
| Guadagnini, D | 1 |
| Tadelle, RM | 1 |
| Saad, MJA | 1 |
| Oliveira, AG | 1 |
| Bianconi, V | 1 |
| Bronzo, P | 1 |
| Banach, M | 1 |
| Sahebkar, A | 1 |
| Mannarino, MR | 1 |
| Pirro, M | 1 |
| Patsourakos, NG | 1 |
| Kouvari, M | 1 |
| Kotidis, A | 1 |
| Kalantzi, KI | 1 |
| Tsoumani, ME | 1 |
| Anastasiadis, F | 1 |
| Andronikos, P | 1 |
| Aslanidou, T | 1 |
| Efraimidis, P | 1 |
| Georgiopoulos, A | 1 |
| Gerakiou, K | 1 |
| Grigoriadou-Skouta, E | 1 |
| Grigoropoulos, P | 1 |
| Hatzopoulos, D | 1 |
| Kartalis, A | 1 |
| Lyras, A | 1 |
| Markatos, G | 1 |
| Mikrogeorgiou, A | 1 |
| Myroforou, I | 1 |
| Orkopoulos, A | 1 |
| Pavlidis, P | 1 |
| Petras, C | 1 |
| Riga, M | 1 |
| Skouloudi, M | 1 |
| Smyrnioudis, N | 1 |
| Thomaidis, K | 1 |
| Tsikouri, GE | 1 |
| Tsikouris, EI | 1 |
| Zisimos, K | 1 |
| Vavoulis, P | 1 |
| Vitali, MG | 1 |
| Vitsas, G | 1 |
| Vogiatzidis, C | 1 |
| Chantanis, S | 1 |
| Fousas, S | 1 |
| Panagiotakos, DB | 1 |
| Tselepis, AD | 1 |
| Jungen, C | 1 |
| Alken, FA | 1 |
| Eickholt, C | 1 |
| Scherschel, K | 1 |
| Kuklik, P | 1 |
| Klatt, N | 1 |
| Schwarzl, J | 1 |
| Moser, J | 1 |
| Jularic, M | 1 |
| Akbulak, RO | 1 |
| Schaeffer, B | 1 |
| Willems, S | 1 |
| Meyer, C | 1 |
| Nowak, JK | 1 |
| Szczepanik, M | 1 |
| Trypuć, M | 1 |
| Pogorzelski, A | 1 |
| Bobkowski, W | 1 |
| Grytczuk, M | 1 |
| Minarowska, A | 1 |
| Wójciak, R | 1 |
| Walkowiak, J | 1 |
| Lu, Y | 1 |
| Xi, J | 1 |
| Li, C | 1 |
| Chen, W | 3 |
| Hu, X | 1 |
| Zhang, F | 1 |
| Wei, H | 1 |
| Wang, Z | 1 |
| Gurzu, S | 1 |
| Jung, I | 1 |
| Sugimura, H | 2 |
| Stefan-van Staden, RI | 1 |
| Yamada, H | 1 |
| Natsume, H | 1 |
| Iwashita, Y | 1 |
| Szodorai, R | 1 |
| Szederjesi, J | 1 |
| Yari, D | 1 |
| Ehsanbakhsh, Z | 1 |
| Validad, MH | 1 |
| Langroudi, FH | 1 |
| Esfandiari, H | 1 |
| Prager, A | 1 |
| Hassanpour, K | 1 |
| Kurup, SP | 1 |
| Mets-Halgrimson, R | 1 |
| Yoon, H | 1 |
| Zeid, JL | 1 |
| Mets, MB | 1 |
| Rahmani, B | 1 |
| Araujo-Castillo, RV | 1 |
| Culquichicón, C | 1 |
| Solis Condor, R | 1 |
| Efendi, F | 1 |
| Sebayang, SK | 1 |
| Astutik, E | 1 |
| Hadisuyatmana, S | 1 |
| Has, EMM | 1 |
| Kuswanto, H | 1 |
| Foroutan, T | 1 |
| Ahmadi, F | 1 |
| Moayer, F | 1 |
| Khalvati, S | 1 |
| Zhang, Q | 2 |
| Lyu, Y | 1 |
| Huang, J | 1 |
| Yu, N | 1 |
| Wen, Z | 1 |
| Hou, H | 1 |
| Zhao, T | 1 |
| Gupta, A | 1 |
| Khosla, N | 1 |
| Govindasamy, V | 1 |
| Saini, A | 1 |
| Annapurna, K | 1 |
| Dhakate, SR | 1 |
| Akkaya, Ö | 1 |
| Chandgude, AL | 1 |
| Dömling, A | 1 |
| Harnett, J | 1 |
| Oakes, K | 1 |
| Carè, J | 1 |
| Leach, M | 1 |
| Brown, D | 1 |
| Cramer, H | 1 |
| Pinder, TA | 1 |
| Steel, A | 1 |
| Anheyer, D | 1 |
| Cantu, J | 1 |
| Valle, J | 1 |
| Flores, K | 1 |
| Gonzalez, D | 1 |
| Valdes, C | 1 |
| Lopez, J | 1 |
| Padilla, V | 1 |
| Alcoutlabi, M | 1 |
| Parsons, J | 1 |
| Núñez, K | 1 |
| Hamed, M | 1 |
| Fort, D | 1 |
| Bruce, D | 1 |
| Thevenot, P | 1 |
| Cohen, A | 1 |
| Weber, P | 1 |
| Menezes, AMB | 1 |
| Gonçalves, H | 1 |
| Perez-Padilla, R | 1 |
| Jarvis, D | 1 |
| de Oliveira, PD | 1 |
| Wehrmeister, FC | 1 |
| Mir, S | 1 |
| Wong, J | 1 |
| Ryan, CM | 1 |
| Bellingham, G | 1 |
| Singh, M | 2 |
| Waseem, R | 1 |
| Eckert, DJ | 1 |
| Chung, F | 1 |
| Hegde, H | 1 |
| Shimpi, N | 1 |
| Panny, A | 1 |
| Glurich, I | 1 |
| Christie, P | 1 |
| Acharya, A | 1 |
| English, KL | 1 |
| Downs, M | 1 |
| Goetchius, E | 1 |
| Buxton, R | 1 |
| Ryder, JW | 1 |
| Ploutz-Snyder, R | 1 |
| Guilliams, M | 1 |
| Scott, JM | 1 |
| Ploutz-Snyder, LL | 1 |
| Martens, C | 1 |
| Goplen, FK | 1 |
| Aasen, T | 1 |
| Gjestad, R | 1 |
| Nordfalk, KF | 1 |
| Nordahl, SHG | 1 |
| Inoue, T | 1 |
| Soshi, S | 1 |
| Kubota, M | 1 |
| Marumo, K | 1 |
| Mortensen, NP | 1 |
| Caffaro, MM | 1 |
| Patel, PR | 2 |
| Uddin, MJ | 1 |
| Aravamudhan, S | 1 |
| Sumner, SJ | 1 |
| Fennell, TR | 1 |
| Gal, RL | 1 |
| Cohen, NJ | 1 |
| Kruger, D | 1 |
| Beck, RW | 1 |
| Bergenstal, RM | 1 |
| Calhoun, P | 1 |
| Cushman, T | 1 |
| Haban, A | 1 |
| Hood, K | 1 |
| Johnson, ML | 1 |
| McArthur, T | 1 |
| Olson, BA | 1 |
| Weinstock, RS | 1 |
| Oser, SM | 1 |
| Oser, TK | 1 |
| Bugielski, B | 1 |
| Strayer, H | 1 |
| Aleppo, G | 1 |
| Maruyama, H | 1 |
| Hirayama, K | 1 |
| Yamashita, M | 1 |
| Ohgi, K | 1 |
| Tsujimoto, R | 1 |
| Takayasu, M | 1 |
| Shimohata, H | 1 |
| Kobayashi, M | 1 |
| Buscagan, TM | 1 |
| Rees, DC | 1 |
| Jaborek, JR | 1 |
| Zerby, HN | 1 |
| Wick, MP | 1 |
| Fluharty, FL | 1 |
| Moeller, SJ | 1 |
| Razavi, P | 1 |
| Dickler, MN | 1 |
| Shah, PD | 1 |
| Toy, W | 1 |
| Brown, DN | 1 |
| Won, HH | 1 |
| Li, BT | 1 |
| Shen, R | 1 |
| Vasan, N | 1 |
| Modi, S | 1 |
| Jhaveri, K | 1 |
| Caravella, BA | 1 |
| Patil, S | 1 |
| Selenica, P | 1 |
| Zamora, S | 1 |
| Cowan, AM | 1 |
| Comen, E | 1 |
| Singh, A | 2 |
| Covey, A | 1 |
| Berger, MF | 1 |
| Hudis, CA | 1 |
| Norton, L | 1 |
| Nagy, RJ | 1 |
| Odegaard, JI | 1 |
| Lanman, RB | 1 |
| Solit, DB | 1 |
| Robson, ME | 1 |
| Lacouture, ME | 1 |
| Brogi, E | 1 |
| Reis-Filho, JS | 1 |
| Moynahan, ME | 1 |
| Scaltriti, M | 1 |
| Chandarlapaty, S | 1 |
| Papouskova, K | 1 |
| Moravcova, M | 1 |
| Masrati, G | 1 |
| Ben-Tal, N | 1 |
| Sychrova, H | 1 |
| Zimmermannova, O | 1 |
| Fang, J | 1 |
| Fan, Y | 1 |
| Luo, T | 2 |
| Su, H | 1 |
| Tsetseris, L | 1 |
| Anthopoulos, TD | 1 |
| Liu, SF | 1 |
| Zhao, K | 1 |
| Sacan, O | 1 |
| Turkyilmaz, IB | 1 |
| Bayrak, BB | 1 |
| Mutlu, O | 1 |
| Akev, N | 1 |
| Yanardag, R | 1 |
| Gruber, S | 1 |
| Kamnoedboon, P | 1 |
| Özcan, M | 1 |
| Srinivasan, M | 1 |
| Jo, YH | 1 |
| Oh, HK | 1 |
| Jeong, SY | 1 |
| Lee, BG | 1 |
| Zheng, J | 1 |
| Guan, H | 1 |
| Li, D | 2 |
| Tan, H | 1 |
| Maji, TK | 1 |
| J R, A | 1 |
| Mukherjee, S | 1 |
| Alexander, R | 1 |
| Mondal, A | 1 |
| Das, S | 1 |
| Sharma, RK | 1 |
| Chakraborty, NK | 1 |
| Dasgupta, K | 1 |
| Sharma, AMR | 1 |
| Hawaldar, R | 1 |
| Pandey, M | 1 |
| Naik, A | 1 |
| Majumdar, K | 1 |
| Pal, SK | 1 |
| Adarsh, KV | 1 |
| Ray, SK | 1 |
| Karmakar, D | 1 |
| Ma, Y | 2 |
| Gao, W | 1 |
| Ma, S | 1 |
| Lin, W | 1 |
| Zhou, T | 1 |
| Wu, T | 1 |
| Wu, Q | 1 |
| Ye, C | 1 |
| He, X | 1 |
| Jiang, F | 1 |
| Yuan, D | 1 |
| Chen, Q | 1 |
| Hong, M | 1 |
| Chen, K | 1 |
| Hussain, M | 1 |
| Razi, SS | 1 |
| Yildiz, EA | 1 |
| Zhao, J | 1 |
| Yaglioglu, HG | 1 |
| Donato, MD | 1 |
| Jiang, J | 1 |
| Jamil, MI | 1 |
| Zhan, X | 1 |
| Chen, F | 1 |
| Cheng, D | 1 |
| Wu, CT | 1 |
| Utsunomiya, T | 1 |
| Ichii, T | 1 |
| Fujinami, S | 1 |
| Nakajima, K | 1 |
| Sanchez, DM | 1 |
| Raucci, U | 1 |
| Ferreras, KN | 1 |
| Martínez, TJ | 1 |
| Mordi, NA | 1 |
| Mordi, IR | 1 |
| Singh, JS | 1 |
| McCrimmon, RJ | 1 |
| Struthers, AD | 1 |
| Lang, CC | 1 |
| Wang, XW | 1 |
| Yuan, LJ | 1 |
| Yang, Y | 1 |
| Chen, WF | 1 |
| Luo, R | 1 |
| Yang, K | 1 |
| Amarasiri, SS | 1 |
| Attanayake, AP | 1 |
| Arawwawala, LDAM | 1 |
| Jayatilaka, KAPW | 1 |
| Mudduwa, LKB | 1 |
| Ogunsuyi, O | 2 |
| Akanni, O | 1 |
| Alabi, O | 1 |
| Alimba, C | 1 |
| Adaramoye, O | 1 |
| Cambier, S | 1 |
| Eswara, S | 1 |
| Gutleb, AC | 1 |
| Bakare, A | 1 |
| Gu, Z | 1 |
| Cong, J | 1 |
| Pellegrini, M | 1 |
| Palmieri, S | 1 |
| Ricci, A | 1 |
| Serio, A | 1 |
| Paparella, A | 1 |
| Lo Sterzo, C | 1 |
| Jadeja, SD | 1 |
| Vaishnav, J | 1 |
| Mansuri, MS | 1 |
| Shah, C | 1 |
| Mayatra, JM | 1 |
| Shah, A | 1 |
| Begum, R | 1 |
| Song, H | 2 |
| Lian, Y | 1 |
| Wan, T | 1 |
| Schultz-Lebahn, A | 1 |
| Skipper, MT | 1 |
| Hvas, AM | 1 |
| Larsen, OH | 1 |
| Hijazi, Z | 1 |
| Granger, CB | 1 |
| Hohnloser, SH | 1 |
| Westerbergh, J | 1 |
| Lindbäck, J | 1 |
| Alexander, JH | 1 |
| Keltai, M | 1 |
| Parkhomenko, A | 1 |
| López-Sendón, JL | 1 |
| Lopes, RD | 1 |
| Siegbahn, A | 1 |
| Wallentin, L | 1 |
| El-Tarabany, MS | 1 |
| Saleh, AA | 1 |
| El-Araby, IE | 1 |
| El-Magd, MA | 1 |
| van Ginkel, MPH | 1 |
| Schijven, MP | 1 |
| van Grevenstein, WMU | 1 |
| Schreuder, HWR | 1 |
| Pereira, EDM | 1 |
| da Silva, J | 1 |
| Carvalho, PDS | 1 |
| Grivicich, I | 1 |
| Picada, JN | 1 |
| Salgado Júnior, IB | 1 |
| Vasques, GJ | 1 |
| Pereira, MADS | 1 |
| Reginatto, FH | 1 |
| Ferraz, ABF | 1 |
| Vasilenko, EA | 1 |
| Gorshkova, EN | 1 |
| Astrakhantseva, IV | 1 |
| Drutskaya, MS | 1 |
| Tillib, SV | 1 |
| Nedospasov, SA | 1 |
| Mokhonov, VV | 1 |
| Nam, YW | 1 |
| Cui, M | 1 |
| Orfali, R | 1 |
| Viegas, A | 1 |
| Nguyen, M | 1 |
| Mohammed, EHM | 1 |
| Zoghebi, KA | 1 |
| Rahighi, S | 1 |
| Parang, K | 1 |
| Patterson, KC | 1 |
| Kahanovitch, U | 1 |
| Gonçalves, CM | 1 |
| Hablitz, JJ | 1 |
| Staruschenko, A | 1 |
| Mulkey, DK | 1 |
| Olsen, ML | 1 |
| Gu, L | 1 |
| Cao, X | 1 |
| Mukhtar, A | 1 |
| Wu, K | 1 |
| Zhang, YY | 1 |
| Zhu, Y | 1 |
| Lu, DZ | 1 |
| Dong, W | 1 |
| Bi, WJ | 1 |
| Feng, XJ | 1 |
| Wen, LM | 1 |
| Sun, H | 1 |
| Qi, MC | 1 |
| Chang, CC | 1 |
| Dinh, TK | 1 |
| Lee, YA | 1 |
| Wang, FN | 1 |
| Sung, YC | 1 |
| Yu, PL | 1 |
| Chiu, SC | 1 |
| Shih, YC | 1 |
| Wu, CY | 1 |
| Huang, YD | 1 |
| Lu, TT | 1 |
| Wan, D | 1 |
| Sakizadeh, J | 1 |
| Cline, JP | 1 |
| Snyder, MA | 1 |
| Kiely, CJ | 1 |
| McIntosh, S | 1 |
| Jiang, X | 1 |
| Cao, JW | 1 |
| Zhao, CK | 1 |
| Yang, R | 1 |
| Zhang, QY | 1 |
| Chen, KJ | 2 |
| Liu, H | 1 |
| He, Z | 1 |
| Chen, B | 1 |
| Wu, J | 1 |
| Du, X | 1 |
| Moore, J | 1 |
| Blank, BR | 1 |
| Eksterowicz, J | 1 |
| Sutimantanapi, D | 1 |
| Yuen, N | 1 |
| Metzger, T | 1 |
| Chan, B | 1 |
| Huang, T | 1 |
| Chen, X | 1 |
| Duong, F | 1 |
| Kong, W | 1 |
| Chang, JH | 1 |
| Sun, J | 2 |
| Zavorotinskaya, T | 1 |
| Ye, Q | 1 |
| Junttila, MR | 1 |
| Ndubaku, C | 1 |
| Friedman, LS | 1 |
| Fantin, VR | 1 |
| Sun, D | 1 |
| Fei, P | 1 |
| Xie, Q | 2 |
| Jiang, Y | 1 |
| Feng, H | 1 |
| Chang, Y | 1 |
| Kang, H | 1 |
| Xing, M | 1 |
| Chen, J | 1 |
| Shao, Z | 1 |
| Yuan, C | 1 |
| Wu, Y | 1 |
| Allan, R | 1 |
| Canham, K | 1 |
| Wallace, R | 1 |
| Singh, D | 1 |
| Ward, J | 1 |
| Cooper, A | 1 |
| Newcomb, C | 1 |
| Nammour, S | 1 |
| El Mobadder, M | 1 |
| Maalouf, E | 1 |
| Namour, M | 1 |
| Namour, A | 1 |
| Rey, G | 1 |
| Matamba, P | 1 |
| Matys, J | 1 |
| Zeinoun, T | 1 |
| Grzech-Leśniak, K | 1 |
| Segabinazi Peserico, C | 1 |
| Garozi, L | 1 |
| Zagatto, AM | 1 |
| Machado, FA | 1 |
| Hirth, JM | 1 |
| Dinehart, EE | 1 |
| Lin, YL | 1 |
| Kuo, YF | 1 |
| Nouri, SS | 1 |
| Ritchie, C | 1 |
| Volow, A | 1 |
| Li, B | 2 |
| McSpadden, S | 1 |
| Dearman, K | 1 |
| Kotwal, A | 1 |
| Sudore, RL | 1 |
| Ward, L | 1 |
| Thakur, A | 1 |
| Kondadasula, SV | 1 |
| Ji, K | 1 |
| Schalk, DL | 1 |
| Bliemeister, E | 1 |
| Ung, J | 1 |
| Aboukameel, A | 1 |
| Casarez, E | 1 |
| Sloane, BF | 1 |
| Lum, LG | 1 |
| Xiao, M | 1 |
| Feng, X | 1 |
| Gao, R | 1 |
| Du, B | 1 |
| Brooks, T | 1 |
| Zwirner, J | 1 |
| Hammer, N | 1 |
| Ondruschka, B | 1 |
| Jermy, M | 1 |
| Luengo, A | 1 |
| Marzo, I | 1 |
| Reback, M | 1 |
| Daubit, IM | 1 |
| Fernández-Moreira, V | 1 |
| Metzler-Nolte, N | 1 |
| Gimeno, MC | 1 |
| Tonchev, I | 1 |
| Heberman, D | 1 |
| Peretz, A | 1 |
| Medvedovsky, AT | 1 |
| Gotsman, I | 1 |
| Rashi, Y | 1 |
| Poles, L | 1 |
| Goland, S | 1 |
| Perlman, GY | 1 |
| Danenberg, HD | 1 |
| Beeri, R | 1 |
| Shuvy, M | 1 |
| Fu, Q | 1 |
| Yang, D | 1 |
| Sarapulova, A | 1 |
| Pang, Q | 1 |
| Meng, Y | 1 |
| Wei, L | 1 |
| Ehrenberg, H | 1 |
| Kim, CC | 1 |
| Jeong, SH | 1 |
| Oh, KH | 1 |
| Nam, KT | 1 |
| Sun, JY | 1 |
| Ning, J | 1 |
| Duan, Z | 1 |
| Kershaw, SV | 1 |
| Rogach, AL | 1 |
| Gao, Z | 1 |
| Wang, T | 1 |
| Li, Q | 1 |
| Cao, T | 1 |
| Guo, L | 1 |
| Fu, Y | 1 |
| Seeger, ZL | 1 |
| Izgorodina, EI | 1 |
| Hue, S | 1 |
| Beldi-Ferchiou, A | 1 |
| Bendib, I | 1 |
| Surenaud, M | 1 |
| Fourati, S | 1 |
| Frapard, T | 1 |
| Rivoal, S | 1 |
| Razazi, K | 1 |
| Carteaux, G | 1 |
| Delfau-Larue, MH | 1 |
| Mekontso-Dessap, A | 1 |
| Audureau, E | 1 |
| de Prost, N | 1 |
| Gao, SS | 1 |
| Duangthip, D | 1 |
| Lo, ECM | 1 |
| Chu, CH | 1 |
| Roberts, W | 1 |
| Rosenheck, RA | 1 |
| Miyake, T | 1 |
| Kimoto, E | 1 |
| Luo, L | 1 |
| Mathialagan, S | 1 |
| Horlbogen, LM | 1 |
| Ramanathan, R | 1 |
| Wood, LS | 1 |
| Johnson, JG | 1 |
| Le, VH | 1 |
| Vourvahis, M | 1 |
| Rodrigues, AD | 1 |
| Muto, C | 1 |
| Furihata, K | 1 |
| Sugiyama, Y | 1 |
| Kusuhara, H | 1 |
| Gong, Q | 1 |
| Song, W | 1 |
| Sun, B | 1 |
| Cao, P | 1 |
| Gu, S | 1 |
| Sun, X | 1 |
| Zhou, G | 1 |
| Toma, C | 1 |
| Khandhar, S | 1 |
| Zalewski, AM | 1 |
| D'Auria, SJ | 1 |
| Tu, TM | 1 |
| Jaber, WA | 1 |
| Cho, J | 2 |
| Suwandaratne, NS | 1 |
| Razek, S | 1 |
| Choi, YH | 1 |
| Piper, LFJ | 1 |
| Watson, DF | 1 |
| Banerjee, S | 1 |
| Xie, S | 1 |
| Lindsay, AP | 1 |
| Bates, FS | 1 |
| Lodge, TP | 1 |
| Hao, Y | 1 |
| Chapovetsky, A | 1 |
| Liu, JJ | 1 |
| Welborn, M | 1 |
| Luna, JM | 1 |
| Do, T | 1 |
| Haiges, R | 1 |
| Miller Iii, TF | 1 |
| Marinescu, SC | 1 |
| Lopez, SA | 1 |
| Compter, I | 1 |
| Eekers, DBP | 1 |
| Hoeben, A | 1 |
| Rouschop, KMA | 1 |
| Reymen, B | 1 |
| Ackermans, L | 1 |
| Beckervordersantforth, J | 1 |
| Bauer, NJC | 1 |
| Anten, MM | 1 |
| Wesseling, P | 1 |
| Postma, AA | 1 |
| De Ruysscher, D | 1 |
| Lambin, P | 1 |
| Qiang, L | 1 |
| Yang, S | 1 |
| Cui, YH | 1 |
| He, YY | 1 |
| Kumar, SK | 1 |
| Jacobus, SJ | 1 |
| Cohen, AD | 1 |
| Weiss, M | 1 |
| Callander, N | 1 |
| Singh, AK | 1 |
| Parker, TL | 1 |
| Menter, A | 1 |
| Parsons, B | 1 |
| Kumar, P | 1 |
| Kapoor, P | 1 |
| Rosenberg, A | 1 |
| Zonder, JA | 1 |
| Faber, E | 1 |
| Lonial, S | 1 |
| Anderson, KC | 1 |
| Richardson, PG | 1 |
| Orlowski, RZ | 1 |
| Wagner, LI | 1 |
| Rajkumar, SV | 1 |
| Li, G | 1 |
| Hou, G | 1 |
| Cui, J | 1 |
| Xie, H | 1 |
| Sun, Z | 1 |
| Fang, Z | 1 |
| Dunstand-Guzmán, E | 1 |
| Hallal-Calleros, C | 1 |
| Hernández-Velázquez, VM | 1 |
| Canales-Vargas, EJ | 1 |
| Domínguez-Roldan, R | 1 |
| Pedernera, M | 1 |
| Peña-Chora, G | 1 |
| Flores-Pérez, I | 1 |
| Kim, MJ | 1 |
| Han, C | 1 |
| White, K | 1 |
| Park, HJ | 1 |
| Ding, D | 1 |
| Boyd, K | 1 |
| Rothenberger, C | 1 |
| Bose, U | 1 |
| Carmichael, P | 1 |
| Linser, PJ | 1 |
| Tanokura, M | 1 |
| Salvi, R | 1 |
| Someya, S | 1 |
| Samuni, A | 1 |
| Goldstein, S | 1 |
| Divya, KP | 1 |
| Dharuman, V | 1 |
| Feng, J | 2 |
| Qian, Y | 1 |
| Cheng, Q | 1 |
| Ma, H | 1 |
| Ren, X | 1 |
| Wei, Q | 1 |
| Pan, W | 1 |
| Guo, J | 1 |
| Situ, B | 1 |
| An, T | 1 |
| Zheng, L | 1 |
| Augusto, S | 1 |
| Ratola, N | 1 |
| Tarín-Carrasco, P | 1 |
| Jiménez-Guerrero, P | 1 |
| Turco, M | 1 |
| Schuhmacher, M | 1 |
| Costa, S | 1 |
| Teixeira, JP | 1 |
| Costa, C | 1 |
| Syed, A | 1 |
| Marraiki, N | 1 |
| Al-Rashed, S | 1 |
| Elgorban, AM | 1 |
| Yassin, MT | 1 |
| Chankhanittha, T | 1 |
| Nanan, S | 1 |
| Sorokina, KN | 1 |
| Samoylova, YV | 1 |
| Gromov, NV | 1 |
| Ogorodnikova, OL | 1 |
| Parmon, VN | 1 |
| Ye, J | 1 |
| Liao, W | 1 |
| Zhang, P | 1 |
| Nabi, M | 1 |
| Cai, Y | 1 |
| Li, F | 1 |
| Alsbou, EM | 1 |
| Omari, KW | 1 |
| Adeosun, WA | 1 |
| Asiri, AM | 1 |
| Marwani, HM | 1 |
| Barral, M | 1 |
| Jemal-Turki, A | 1 |
| Beuvon, F | 1 |
| Soyer, P | 1 |
| Camparo, P | 1 |
| Cornud, F | 1 |
| Atwater, BD | 1 |
| Jones, WS | 1 |
| Loring, Z | 1 |
| Friedman, DJ | 1 |
| Namburath, M | 1 |
| Papirio, S | 1 |
| Moscariello, C | 1 |
| Di Costanzo, N | 1 |
| Pirozzi, F | 1 |
| Alappat, BJ | 1 |
| Sreekrishnan, TR | 1 |
| Volpin, F | 1 |
| Woo, YC | 1 |
| Kim, H | 1 |
| Freguia, S | 1 |
| Jeong, N | 1 |
| Choi, JS | 1 |
| Phuntsho, S | 1 |
| Shon, HK | 1 |
| Domínguez-Zambrano, E | 1 |
| Pedraza-Chaverri, J | 1 |
| López-Santos, AL | 1 |
| Medina-Campos, ON | 1 |
| Cruz-Rivera, C | 1 |
| Bueno-Hernández, F | 1 |
| Espinosa-Cuevas, A | 1 |
| Bulavaitė, A | 1 |
| Dalgediene, I | 1 |
| Michailoviene, V | 1 |
| Pleckaityte, M | 1 |
| Sauerbier, P | 1 |
| Köhler, R | 1 |
| Renner, G | 1 |
| Militz, H | 1 |
| Kyriakopoulos, CE | 1 |
| Heath, EI | 1 |
| Ferrari, A | 1 |
| Sperger, JM | 1 |
| Perlman, SB | 1 |
| Roth, AR | 1 |
| Perk, TG | 1 |
| Modelska, K | 1 |
| Porcari, A | 1 |
| Duggan, W | 1 |
| Lang, JM | 1 |
| Jeraj, R | 1 |
| Liu, G | 1 |
| Gil, M | 1 |
| Khorashadi, S | 1 |
| Lee, C | 1 |
| Ishida, Y | 1 |
| Nagai, M | 1 |
| Wada, S | 1 |
| Ishikawa-Nagai, S | 1 |
| Da Silva, JD | 1 |
| Martines de Souza, B | 1 |
| Vertuan, M | 1 |
| Buzalaf, MAR | 1 |
| Magalhães, AC | 2 |
| Høilund-Carlsen, PF | 2 |
| Moghbel, MC | 1 |
| Gerke, O | 1 |
| Alavi, A | 3 |
| Raggi, P | 1 |
| Prandini, N | 1 |
| Ligabue, G | 1 |
| Braglia, G | 1 |
| Esposito, F | 1 |
| Milic, J | 1 |
| Malagoli, A | 1 |
| Scaglioni, R | 1 |
| Besutti, G | 1 |
| Beghetto, B | 1 |
| Nardini, G | 1 |
| Roncaglia, E | 1 |
| Mussini, C | 1 |
| Guaraldi, G | 1 |
| Dilsizian, V | 1 |
| Luo, Q | 1 |
| Leng, H | 1 |
| Zhou, Y | 1 |
| Rong, Q | 1 |
| Borges, AB | 2 |
| Scaramucci, T | 2 |
| Lippert, F | 1 |
| Zero, DT | 1 |
| Hara, AT | 1 |
| Jenkins, WS | 2 |
| Vesey, AT | 2 |
| Pringle, MA | 2 |
| Chin, CW | 2 |
| Malley, TS | 1 |
| Cowie, WJ | 1 |
| Tsampasian, V | 1 |
| Richardson, H | 1 |
| Fletcher, A | 2 |
| Wallace, WA | 1 |
| Pessotto, R | 2 |
| van Beek, EJ | 2 |
| Boon, NA | 2 |
| Rudd, JH | 3 |
| Zhao, W | 1 |
| Bedran-Russo, AK | 1 |
| Pan, S | 1 |
| Wu, CD | 1 |
| Charone, S | 1 |
| Cardoso, Cde A | 1 |
| Kato, MT | 2 |
| Ducati, P | 1 |
| Fukushima, R | 1 |
| Gennaro, G | 1 |
| Buzalaf, MA | 2 |
| Zarella, BL | 1 |
| Cardoso, CA | 1 |
| Pelá, VT | 1 |
| Tjäderhane, L | 1 |
| McKenney-Drake, ML | 1 |
| Territo, PR | 1 |
| Salavati, A | 1 |
| Houshmand, S | 2 |
| Persohn, S | 1 |
| Liang, Y | 1 |
| Alloosh, M | 1 |
| Moe, SM | 1 |
| Weaver, CM | 1 |
| Sturek, M | 1 |
| João-Souza, SH | 1 |
| Bezerra, SJ | 1 |
| Aranha, AC | 1 |
| Meyer-Lueckel, H | 1 |
| Wierichs, RJ | 1 |
| Gninka, B | 1 |
| Heldmann, P | 1 |
| Dörfer, CE | 1 |
| Paris, S | 1 |
| Shah, AS | 1 |
| Pawade, TA | 1 |
| White, AC | 1 |
| Cartlidge, TR | 1 |
| Mitchell, AJ | 1 |
| Brown, OS | 1 |
| McKillop, G | 1 |
| Eversole, SL | 2 |
| Saunders-Burkhardt, K | 1 |
| Faller, RV | 2 |
| Doris, MK | 1 |
| Jedeon, K | 1 |
| Houari, S | 1 |
| Loiodice, S | 1 |
| Thuy, TT | 1 |
| Le Normand, M | 1 |
| Berdal, A | 1 |
| Babajko, S | 1 |
| Raynor, W | 1 |
| Gholami, S | 1 |
| Emamzadehfard, S | 1 |
| Rajapakse, CS | 1 |
| Blomberg, BA | 1 |
| Werner, TJ | 1 |
| Baker, JF | 1 |
| da Silva, CV | 1 |
| Ramos-Oliveira, TM | 1 |
| Mantilla, TF | 1 |
| de Freitas, PM | 1 |
| Schlueter, N | 2 |
| Klimek, J | 2 |
| Ganss, C | 2 |
| Bailey, DL | 1 |
| Adams, GG | 1 |
| Tsao, CE | 1 |
| Hyslop, A | 1 |
| Escobar, K | 1 |
| Manton, DJ | 1 |
| Reynolds, EC | 1 |
| Morgan, MV | 1 |
| Salvi, GE | 1 |
| Della Chiesa, A | 1 |
| Kianpur, P | 1 |
| Attström, R | 1 |
| Schmidlin, K | 1 |
| Zwahlen, M | 1 |
| Lang, NP | 1 |
| Weinstein, P | 1 |
| Spiekerman, C | 1 |
| Milgrom, P | 1 |
| Ekstrand, KR | 1 |
| Bakhshandeh, A | 1 |
| Martignon, S | 1 |
| Nordström, A | 1 |
| Birkhed, D | 1 |
| Sun, HB | 1 |
| Gao, XJ | 1 |
| Deng, J | 1 |
| Li, NY | 1 |
| Lu, HJ | 1 |
| Ekambaram, M | 1 |
| Itthagarun, A | 1 |
| King, NM | 1 |
| Tzeghai, GE | 1 |
| Messias, DC | 1 |
| Maeda, FA | 1 |
| Turssi, CP | 1 |
| Serra, MC | 1 |
| Joshi, FR | 1 |
| Fracaro, MS | 1 |
| Linnett, VM | 1 |
| Hallett, KB | 1 |
| Savage, NW | 1 |
| Lima, TJ | 1 |
| Ribeiro, CC | 1 |
| Tenuta, LM | 1 |
| Cury, JA | 1 |
| Ogaard, B | 1 |
| Duschner, H | 1 |
| Ruben, J | 1 |
| Arends, J | 1 |
| Rosling, B | 1 |
| Wannfors, B | 1 |
| Volpe, AR | 1 |
| Furuichi, Y | 1 |
| Ramberg, P | 1 |
| Lindhe, J | 1 |
| Pfarrer, AM | 1 |
| White, DJ | 1 |
| Featherstone, JD | 1 |
| Reznik, DA | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| A PHASE 2, OPEN-LABEL, SINGLE-ARM STUDY OF 18F-SODIUM FLUORIDE PET/CT BONE IMAGING IN ENZALUTAMIDE-TREATED CHEMOTHERAPY-NAÏVE PATIENTS WITH BONE-METASTATIC CASTRATION-RESISTANT PROSTATE CANCER[NCT02384382] | Phase 2 | 23 participants (Actual) | Interventional | 2015-11-30 | Completed | ||
| SALTIRE II: Bisphosphonates and RANKL Inhibition in Aortic Stenosis[NCT02132026] | Phase 2 | 152 participants (Actual) | Interventional | 2014-11-12 | Completed | ||
| An Observational PET/CT Study Examining the Role of Active Valvular Calcification and Inflammation in Patients With Aortic Stenosis[NCT01358513] | 121 participants (Actual) | Observational | 2010-07-31 | Completed | |||
| Comparison of MI Paste Plus and Resin Infiltration in Improvement of White Spot Lesions Following Fixed Orthodontic Treatment: A Randomized Controlled Trial[NCT05733676] | 62 participants (Anticipated) | Interventional | 2023-05-30 | Recruiting | |||
| Fluoride Varnish Trial in High Caries Preschoolers[NCT00067353] | Phase 3 | 500 participants | Interventional | 2003-11-30 | Completed | ||
| Radiographic Progression of Sealed and Infiltrated Caries Lesions in Vivo[NCT01417832] | Phase 2/Phase 3 | 37 participants (Actual) | Interventional | 2008-01-31 | Completed | ||
| Anticaries Potential and Fluorosis Risk From Different Fluoride Toothpastes[NCT01589991] | Phase 1 | 24 participants (Actual) | Interventional | 2011-01-31 | Completed | ||
| Effects of a Toothpaste Containing 0.3% Triclosan in the Maintenance Phase of Peri-implantitis Treatment.[NCT03191721] | Phase 3 | 102 participants (Actual) | Interventional | 2010-06-30 | Completed | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
Global SUVhetero score:Sum of(SUVmean of each lesion minus global SUVmean of all lesion)^2/number of lesions,measure of heterogeneity of tumor activity across all bone lesions.SUVmean(mean NaF uptake)indicated average activity of each lesions.Real limits for SUVhetero score ranged:0(minimum) to infinite(maximum).Higher global SUVhetero score:more heterogeneity in bone lesion activity.NaF-3 performed on any of these 1)PSA progression(increase of>=25% and absolute increase of>=2.0ng/mL above nadir);2)bone PD(appearance of>=2 new lesions after screening assessed by 99mTc-MDP bone scintigraphy);3)soft tissue PD(RECIST1.1);4)clinically relevant progression by investigator;5)at 2years without progression after treatment initiation.PD perRECIST1.1:>=20%increase in sum of diameters of target lesions,(reference smallest sum on study,this included baseline sum if that is smallest on study),relative increase of20%,sum of diameters indicated absolute increase of>=5mm,appearance of>=1 new lesions. (NCT02384382)
Timeframe: At NaF-3 schedule: at time of PSA, or radiographic(bone or soft tissue), or clinically relevant progression, or at 2years without progression after treatment initiation, whichever occurred first(From first dose of study drug up to maximum of 34.1 months)
| Intervention | unit on SUVhetero score (Mean) |
|---|---|
| Enzalutamide 160 mg (18F-NaF PET/CT) | 3.9 |
Bone lesion responded: if its change from baseline in SUVtotal is below limit of agreement (LOA, no specific value, based upon test/retest analysis using software). SUVtotal: total NaF uptake,indicated tumor burden across all bone lesions/in individual lesions reflecting bone-metastatic prostate cancer.NaF-3 performed on any of these: 1) prostate-specific antigen (PSA) progression(increase of >=25% and absolute increase of >=2.0 ng/mL above nadir); 2) bone progressive disease(PD)(appearance of >=2 new lesions after screening assessed by technetium Tc 99m medronate [99mTc-MDP] bone scintigraphy); 3) soft tissue PD; 4) clinically relevant progression by investigator; 5) at 2 years without progression after treatment initiation. PD, RECIST1.1:>=20% increase in sum of diameters of target lesions,(reference smallest sum on study, included baseline sum if that is smallest on study),relative increase of 20%,sum of diameters indicated absolute increase of >=5mm, appearance of >=1 new lesions. (NCT02384382)
Timeframe: At NaF-3 schedule: at time of PSA, or radiographic(bone or soft tissue), or clinically relevant progression, or at 2years without progression after treatment initiation, whichever occurred first(From first dose of study drug up to maximum of 34.1 months)
| Intervention | percentage of participants (Number) |
|---|---|
| Enzalutamide 160 mg (18F-NaF PET/CT) | 100.0 |
5 reviews available for sodium fluoride and Disease Exacerbation
| Article | Year |
|---|---|
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Evolving Role of PET in Detecting and Characterizing Atherosclerosis.
Topics: Adult; Aged; Aged, 80 and over; Animals; Contrast Media; Coronary Artery Disease; Disease Models, An | 2019 |
Targeted PET/CT imaging of vulnerable atherosclerotic plaques: microcalcification with sodium fluoride and inflammation with fluorodeoxyglucose.
Topics: Calcinosis; Coronary Angiography; Coronary Artery Disease; Disease Progression; Early Diagnosis; Fem | 2013 |
Identification of early vascular calcification with (18)F-sodium fluoride: potential clinical application.
Topics: Disease Progression; Early Diagnosis; Humans; Plaque, Atherosclerotic; Positron Emission Tomography | 2016 |
Evolving Role of Molecular Imaging with (18)F-Sodium Fluoride PET as a Biomarker for Calcium Metabolism.
Topics: Arthritis, Rheumatoid; Back Pain; Bisphosphonate-Associated Osteonecrosis of the Jaw; Bone and Bones | 2016 |
14 trials available for sodium fluoride and Disease Exacerbation
| Article | Year |
|---|---|
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Exploring Spatial-Temporal Changes in
Topics: Aged; Aged, 80 and over; Antineoplastic Agents; Benzamides; Bone Neoplasms; Disease Progression; Flu | 2020 |
18F-sodium fluoride uptake is a marker of active calcification and disease progression in patients with aortic stenosis.
Topics: Aged; Aged, 80 and over; Aortic Valve Stenosis; Biomarkers; Calcinosis; Disease Progression; Female; | 2014 |
18F-sodium fluoride uptake is a marker of active calcification and disease progression in patients with aortic stenosis.
Topics: Aged; Aged, 80 and over; Aortic Valve Stenosis; Biomarkers; Calcinosis; Disease Progression; Female; | 2014 |
18F-sodium fluoride uptake is a marker of active calcification and disease progression in patients with aortic stenosis.
Topics: Aged; Aged, 80 and over; Aortic Valve Stenosis; Biomarkers; Calcinosis; Disease Progression; Female; | 2014 |
18F-sodium fluoride uptake is a marker of active calcification and disease progression in patients with aortic stenosis.
Topics: Aged; Aged, 80 and over; Aortic Valve Stenosis; Biomarkers; Calcinosis; Disease Progression; Female; | 2014 |
The effect of various model parameters on enamel caries lesions in a dose-response model in situ.
Topics: Adult; Animals; Cariostatic Agents; Cattle; Chlorhexidine; Cross-Over Studies; Dental Caries; Dental | 2015 |
Frequency of Application of AmF/NaF/SnCl2 Solution and Its Potential in Controlling Human Enamel Erosion Progression: An in situ Study.
Topics: Adult; Cross-Over Studies; Disease Progression; Double-Blind Method; Fluorides, Topical; Humans; Mou | 2017 |
In vitro efficacy of experimental tin- and fluoride-containing mouth rinses as anti-erosive agents in enamel.
Topics: Amines; Citric Acid; Dental Enamel; Diamines; Disease Progression; Drug Combinations; Fluorides; Hum | 2009 |
Regression of post-orthodontic lesions by a remineralizing cream.
Topics: Adolescent; Cariostatic Agents; Caseins; Child; Dental Caries; Disease Progression; Double-Blind Met | 2009 |
Clinical effects of interdental cleansing on supragingival biofilm formation and development of experimental gingivitis.
Topics: Adult; Biofilms; Cariostatic Agents; Case-Control Studies; Dental Devices, Home Care; Dental Plaque; | 2009 |
Randomized equivalence trial of intensive and semiannual applications of fluoride varnish in the primary dentition.
Topics: Cariostatic Agents; Child, Preschool; Cohort Studies; Dental Caries; Dental Caries Susceptibility; D | 2009 |
Treatment of proximal superficial caries lesions on primary molar teeth with resin infiltration and fluoride varnish versus fluoride varnish only: efficacy after 1 year.
Topics: Acid Etching, Dental; Cariostatic Agents; Child; Child, Preschool; Cohort Studies; Composite Resins; | 2010 |
Preventive effect of high-fluoride dentifrice (5,000 ppm) in caries-active adolescents: a 2-year clinical trial.
Topics: Adolescent; Age Factors; Dental Caries; Dentifrices; Disease Progression; DMF Index; Dose-Response R | 2010 |
Comparison of the remineralizing potential of child formula dentifrices.
Topics: Cariostatic Agents; Chemistry, Pharmaceutical; Child; Dentifrices; Diamines; Disease Progression; Fl | 2011 |
Low-fluoride dentifrice and caries lesion control in children with different caries experience: a randomized clinical trial.
Topics: Cariostatic Agents; Child, Preschool; Dental Caries; Dentifrices; Disease Progression; DMF Index; Do | 2008 |
The use of a triclosan/copolymer dentifrice may retard the progression of periodontitis.
Topics: Adult; Alveolar Bone Loss; Anti-Infective Agents, Local; Cariostatic Agents; Dental Plaque; Dentifri | 1997 |
24 other studies available for sodium fluoride and Disease Exacerbation
| Article | Year |
|---|---|
Bypass Grafting and Native Coronary Artery Disease Activity.
Topics: Aged; Calcinosis; Calcium; Coronary Angiography; Coronary Artery Disease; Disease Progression; Femal | 2022 |
Aortic valve microcalcification and cardiovascular risk: an exploratory study using sodium fluoride in high cardiovascular risk patients.
Topics: Aged; Aortic Valve; Aortic Valve Stenosis; Asymptomatic Diseases; Calcinosis; Disease Progression; F | 2020 |
Efficacy of bisphosphonates in detection of early enamel caries using NIR fluorescence imaging and inhibition of caries progression.
Topics: Bone Density Conservation Agents; Contrast Media; Dental Caries; Dental Enamel; Diphosphonates; Dise | 2021 |
The Impact of the Demineralized Organic Matrix on the Effect of TiF4 Varnish on the Progression of Dentin Erosive Loss.
Topics: Animals; Cariostatic Agents; Cattle; Citric Acid; Dentin; Disease Progression; Fluorides; Hydrogen-I | 2017 |
Molecular Imaging of Vascular Calcification with
Topics: Aged; Coronary Artery Disease; Disease Progression; Female; Fluorine Radioisotopes; HIV; HIV Infecti | 2019 |
The role of water and mineral-collagen interfacial bonding on microdamage progression in bone.
Topics: Animals; Bone and Bones; Collagen; Compressive Strength; Disease Progression; Femur; Fluorocarbons; | 2014 |
Erosion protection by calcium lactate/sodium fluoride rinses under different salivary flows in vitro.
Topics: Animals; Calcium Compounds; Cattle; Citric Acid; Dental Enamel; Dentin; Diffusion Chambers, Culture; | 2014 |
The preventive effect of grape seed extract on artificial enamel caries progression in a microbial biofilm-induced caries model.
Topics: Animals; Anti-Bacterial Agents; Biofilms; Cariostatic Agents; Cattle; Dental Caries; Dental Enamel; | 2014 |
The effect of mouthwashes containing biguanides on the progression of erosion in dentin.
Topics: Animals; Anti-Infective Agents, Local; Biguanides; Cattle; Chlorhexidine; Citric Acid; Dentin; Disea | 2014 |
The role of matrix metalloproteinases and cysteine-cathepsins on the progression of dentine erosion.
Topics: Cathepsins; Chlorhexidine; Cysteine; Dentin; Dipeptides; Disease Progression; Humans; In Vitro Techn | 2015 |
(18)F-NaF PET Imaging of Early Coronary Artery Calcification.
Topics: Animals; Coronary Artery Disease; Coronary Vessels; Diet, Atherogenic; Disease Models, Animal; Disea | 2016 |
Effect of sodium fluoride and stannous chloride associated with Nd:YAG laser irradiation on the progression of enamel erosion.
Topics: Animals; Cattle; Citric Acid; Dental Enamel; Disease Progression; Lasers, Solid-State; Sodium Fluori | 2015 |
Valvular (18)F-Fluoride and (18)F-Fluorodeoxyglucose Uptake Predict Disease Progression and Clinical Outcome in Patients With Aortic Stenosis.
Topics: Aged; Aged, 80 and over; Aortic Valve; Aortic Valve Stenosis; Case-Control Studies; Disease Progress | 2015 |
Erosion Prevention Potential of an Over-the-Counter Stabilized SnF2 Dentifrice Compared to 5000 ppm F Prescription-Strength Products.
Topics: Acidulated Phosphate Fluoride; Calcium Phosphates; Cariostatic Agents; Citric Acid; Dental Enamel; D | 2015 |
Chronic Exposure to Bisphenol A Exacerbates Dental Fluorosis in Growing Rats.
Topics: Animals; Benzhydryl Compounds; Child; Dental Enamel; Disease Progression; Epithelium; Female; Fluoro | 2016 |
Effect of stannous and fluoride concentration in a mouth rinse on erosive tissue loss in enamel in vitro.
Topics: Cariostatic Agents; Citric Acid; Dental Enamel; Diamines; Disease Progression; Fluorides; Humans; Hy | 2009 |
Progress of oral sequelae during head-neck radiotherapy.
Topics: Aged; Analysis of Variance; Cariostatic Agents; Cranial Irradiation; Dental Caries; Disease Progress | 2010 |
Enamel protection: a comparison of marketed dentifrice performance against dental erosion.
Topics: Citric Acid; Dental Enamel; Dental Pellicle; Dentifrices; Disease Progression; Drug Combinations; Fl | 2011 |
Effect of dentifrices against hydrochloric acid-induced erosion.
Topics: Animals; Cariostatic Agents; Cattle; Coloring Agents; Copper Sulfate; Dental Enamel; Dental Enamel P | 2011 |
Noninvasive imaging in cardiovascular therapy: the promise of coronary arterial ¹⁸F-sodium fluoride uptake as a marker of plaque biology.
Topics: Atherosclerosis; Biological Transport; Biomarkers; Coronary Artery Disease; Coronary Vessels; Diseas | 2012 |
Submandibular gland aplasia and progressive dental caries: a case report.
Topics: Adolescent; Cariostatic Agents; Dental Caries; Dental Enamel; Dental Restoration, Permanent; Disease | 2002 |
Microradiography and confocal laser scanning microscopy applied to enamel lesions formed in vivo with and without fluoride varnish treatment.
Topics: Adolescent; Bicuspid; Chemical Precipitation; Child; Dental Caries; Dental Enamel; Disease Progressi | 1996 |
Anticaries profile qualification of an improved whitening dentifrice.
Topics: Analysis of Variance; Cariostatic Agents; Dental Calculus; Dental Caries; Dental Enamel; Dentifrices | 2001 |
Case reports. 1. Xerostomia.
Topics: Cariostatic Agents; Dentifrices; Disease Progression; Fluorides, Topical; Follow-Up Studies; Humans; | 1997 |