propentofylline has been researched along with Disease Models, Animal in 24 studies
Disease Models, Animal: Naturally-occurring or experimentally-induced animal diseases with pathological processes analogous to human diseases.
| Excerpt | Relevance | Reference |
|---|---|---|
| " The markedly delayed efficacy of all 3 glial modulatory drugs may prove instructive for interpretation of apparent drug failures after shorter dosing regimens." | 5.40 | Systemic administration of propentofylline, ibudilast, and (+)-naltrexone each reverses mechanical allodynia in a novel rat model of central neuropathic pain. ( Ellis, A; Falci, S; Favret, J; Johnson, KW; Maier, SF; Rice, KC; Watkins, LR; Wieseler, J, 2014) |
| "In the present study, we examined whether activation of p-38alpha MAPK modulates mechanical allodynia and neuronal hyperexcitability, and if propentofylline (PPF, a glial modulator) modulates specifically localized activated p-38alpha MAPK expression in caudal regions remote from a low thoracic hemisection injury in rats." | 3.75 | Activation of p-38alpha MAPK contributes to neuronal hyperexcitability in caudal regions remote from spinal cord injury. ( Gwak, YS; Hulsebosch, CE; Unabia, GC, 2009) |
| "The present study was undertaken to determine whether propentofylline, a glial modulating agent, could both prevent the induction of mechanical allodynia and attenuate existing mechanical allodynia in a rodent L5 spinal nerve transection model of neuropathic pain." | 3.71 | Propentofylline, a glial modulating agent, exhibits antiallodynic properties in a rat model of neuropathic pain. ( DeLeo, JA; Schubert, P; Sweitzer, SM, 2001) |
| "Neuropathic pain is one of the most important types of chronic pain." | 1.51 | The NOD2 signaling in peripheral macrophages contributes to neuropathic pain development. ( Alves-Filho, JC; Cecilio, NT; Cunha, FQ; Cunha, TM; Davoli-Ferreira, M; Ferreira, DW; Fonseca, MM; Guimaraes, RM; Kusuda, R; Lopes, AH; Nachbur, U; Santa-Cecília, FV; Souza, GR; Teixeira, MM; Zamboni, DS, 2019) |
| "We studied sensitivity of mechanical hyperalgesia induced by a single intrathecal (i." | 1.46 | Role of the spinal TrkB-NMDA receptor link in the BDNF-induced long-lasting mechanical hyperalgesia in the rat: A behavioural study. ( Constandil, L; Galleguillos, D; Hernández, A; Marcos, JL; Pelissier, T; Velásquez, L; Villanueva, L, 2017) |
| "Propentofylline (PPF) is a xanthine derivative with pharmacological effects distinct from those of the classical methylxanthines." | 1.40 | Effects of propentofylline on CNS remyelination in the rat brainstem. ( Bondan, EF; Castro Poppe, S; Martha Bernardi, M; Martins, Mde F; Menezes Baliellas, DE; Monteiro Gimenez, CF, 2014) |
| " The markedly delayed efficacy of all 3 glial modulatory drugs may prove instructive for interpretation of apparent drug failures after shorter dosing regimens." | 1.40 | Systemic administration of propentofylline, ibudilast, and (+)-naltrexone each reverses mechanical allodynia in a novel rat model of central neuropathic pain. ( Ellis, A; Falci, S; Favret, J; Johnson, KW; Maier, SF; Rice, KC; Watkins, LR; Wieseler, J, 2014) |
| "Propentofylline (PPF) is a synthetic xanthine derivative that inhibits phosphodiesterase and adenosine uptake." | 1.33 | Propentofylline attenuates tau hyperphosphorylation in Alzheimer's Swedish mutant model Tg2576. ( Chauhan, NB; Feinstein, DL; Siegel, GJ, 2005) |
| "Propentofylline has potent stimulatory effects on NGF synthesis/secretion in mouse astrocytes in vitro." | 1.29 | Propentofylline prevents neuronal dysfunction induced by infusion of anti-nerve growth factor antibody into the rat septum. ( Furukawa, S; Hasegawa, T; Nabeshima, T; Nitta, A; Ogihara, Y; Onishi, J, 1996) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 5 (20.83) | 18.2507 |
| 2000's | 4 (16.67) | 29.6817 |
| 2010's | 14 (58.33) | 24.3611 |
| 2020's | 1 (4.17) | 2.80 |
| Authors | Studies |
|---|---|
| Solinski, HJ | 1 |
| Dranchak, P | 1 |
| Oliphant, E | 1 |
| Gu, X | 1 |
| Earnest, TW | 1 |
| Braisted, J | 1 |
| Inglese, J | 1 |
| Hoon, MA | 1 |
| Abrams, RPM | 1 |
| Yasgar, A | 1 |
| Teramoto, T | 1 |
| Lee, MH | 1 |
| Dorjsuren, D | 1 |
| Eastman, RT | 1 |
| Malik, N | 1 |
| Zakharov, AV | 1 |
| Li, W | 1 |
| Bachani, M | 1 |
| Brimacombe, K | 1 |
| Steiner, JP | 1 |
| Hall, MD | 1 |
| Balasubramanian, A | 1 |
| Jadhav, A | 1 |
| Padmanabhan, R | 1 |
| Simeonov, A | 1 |
| Nath, A | 1 |
| Marcos, JL | 1 |
| Galleguillos, D | 1 |
| Pelissier, T | 2 |
| Hernández, A | 2 |
| Velásquez, L | 1 |
| Villanueva, L | 2 |
| Constandil, L | 2 |
| Santa-Cecília, FV | 1 |
| Ferreira, DW | 1 |
| Guimaraes, RM | 1 |
| Cecilio, NT | 1 |
| Fonseca, MM | 1 |
| Lopes, AH | 1 |
| Davoli-Ferreira, M | 1 |
| Kusuda, R | 1 |
| Souza, GR | 1 |
| Nachbur, U | 1 |
| Alves-Filho, JC | 1 |
| Teixeira, MM | 1 |
| Zamboni, DS | 1 |
| Cunha, FQ | 1 |
| Cunha, TM | 1 |
| Wu, F | 1 |
| Miao, X | 1 |
| Chen, J | 1 |
| Liu, Z | 2 |
| Tao, Y | 1 |
| Yu, W | 1 |
| Sun, Y | 1 |
| Bondan, EF | 4 |
| Martins, Mde F | 2 |
| Menezes Baliellas, DE | 1 |
| Monteiro Gimenez, CF | 1 |
| Castro Poppe, S | 1 |
| Martha Bernardi, M | 1 |
| Ellis, A | 1 |
| Wieseler, J | 1 |
| Favret, J | 1 |
| Johnson, KW | 1 |
| Rice, KC | 1 |
| Maier, SF | 1 |
| Falci, S | 1 |
| Watkins, LR | 1 |
| Bernardi, MM | 3 |
| Martins, MF | 2 |
| Dossa, PD | 1 |
| Viebig, LB | 1 |
| Cardoso, CV | 1 |
| Martins, JL | 1 |
| Moraes, MM | 1 |
| Galvão, MC | 1 |
| Cabral, D | 1 |
| Coelho, CP | 1 |
| Queiroz-Hazarbassanov, N | 1 |
| Kirsten, TB | 1 |
| Gwak, YS | 1 |
| Unabia, GC | 1 |
| Hulsebosch, CE | 1 |
| Whitehead, KJ | 1 |
| Smith, CG | 1 |
| Delaney, SA | 1 |
| Curnow, SJ | 1 |
| Salmon, M | 1 |
| Hughes, JP | 1 |
| Chessell, IP | 1 |
| Yao, M | 1 |
| Chang, XY | 1 |
| Chu, YX | 1 |
| Yang, JP | 1 |
| Wang, LN | 1 |
| Cao, HQ | 1 |
| Liu, MJ | 1 |
| Xu, QN | 1 |
| Jacobs, VL | 1 |
| Landry, RP | 1 |
| Liu, Y | 2 |
| Romero-Sandoval, EA | 1 |
| De Leo, JA | 1 |
| Wu, X | 1 |
| Shi, M | 1 |
| Wei, C | 1 |
| Yang, M | 1 |
| Zhang, X | 1 |
| Ren, W | 1 |
| Goich, M | 1 |
| Bourgeais, L | 1 |
| Cazorla, M | 1 |
| Hamon, M | 1 |
| Chauhan, NB | 1 |
| Siegel, GJ | 1 |
| Feinstein, DL | 1 |
| Garry, EM | 1 |
| Delaney, A | 1 |
| Blackburn-Munro, G | 1 |
| Dickinson, T | 1 |
| Moss, A | 1 |
| Nakalembe, I | 1 |
| Robertson, DC | 1 |
| Rosie, R | 1 |
| Robberecht, P | 1 |
| Mitchell, R | 1 |
| Fleetwood-Walker, SM | 1 |
| Gidday, JM | 1 |
| Fitzgibbons, JC | 1 |
| Shah, AR | 1 |
| Kraujalis, MJ | 1 |
| Park, TS | 1 |
| Nabeshima, T | 2 |
| Nitta, A | 2 |
| Hasegawa, T | 2 |
| Ogihara, Y | 1 |
| Onishi, J | 1 |
| Furukawa, S | 1 |
| McRae, A | 1 |
| Ling, EA | 1 |
| Schubert, P | 2 |
| Rudolphi, K | 1 |
| Sweitzer, SM | 1 |
| DeLeo, JA | 1 |
| Kolvenbach, R | 1 |
| Nemat, AT | 1 |
| Sandmann, W | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| A Phase 2, Multicenter, Randomized, Double-Blind, Placebo-Controlled, Full-Factorial, Parallel-Group Study Evaluating Safety and Efficacy of Naltrexone-Acetaminophen Combination in Acute Migraine Treatment in Adults, With Exploratory Focus on Co-Occurring[NCT05685225] | Phase 2 | 300 participants (Anticipated) | Interventional | 2024-03-01 | Not yet recruiting | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
24 other studies available for propentofylline and Disease Models, Animal
| Article | Year |
|---|---|
Inhibition of natriuretic peptide receptor 1 reduces itch in mice.
Topics: Animals; Behavior, Animal; Cell-Free System; Dermatitis, Contact; Disease Models, Animal; Ganglia, S | 2019 |
Therapeutic candidates for the Zika virus identified by a high-throughput screen for Zika protease inhibitors.
Topics: Animals; Antiviral Agents; Artificial Intelligence; Chlorocebus aethiops; Disease Models, Animal; Dr | 2020 |
Role of the spinal TrkB-NMDA receptor link in the BDNF-induced long-lasting mechanical hyperalgesia in the rat: A behavioural study.
Topics: Animals; Brain-Derived Neurotrophic Factor; Central Nervous System Sensitization; Disease Models, An | 2017 |
The NOD2 signaling in peripheral macrophages contributes to neuropathic pain development.
Topics: Animals; Bone Marrow Transplantation; Carrageenan; Disease Models, Animal; Inflammation; Interleukin | 2019 |
Inhibition of GAP-43 by propentofylline in a rat model of neuropathic pain.
Topics: Animals; Astrocytes; Blotting, Western; Disease Models, Animal; Enzyme-Linked Immunosorbent Assay; F | 2013 |
Effects of propentofylline on CNS remyelination in the rat brainstem.
Topics: Animals; Brain Stem; Demyelinating Diseases; Disease Models, Animal; Humans; Male; Myelin Sheath; Ol | 2014 |
Systemic administration of propentofylline, ibudilast, and (+)-naltrexone each reverses mechanical allodynia in a novel rat model of central neuropathic pain.
Topics: Animals; Disease Models, Animal; Hyperalgesia; Male; Naltrexone; Narcotic Antagonists; Neuralgia; Ne | 2014 |
Propentofylline reverses delayed remyelination in streptozotocin-induced diabetic rats.
Topics: Animals; Astrocytes; Demyelinating Diseases; Diabetes Mellitus, Experimental; Disease Models, Animal | 2015 |
Propentofylline reduces glial scar development following gliotoxic damage in the rat brainstem.
Topics: Animals; Astrocytes; Brain Stem; Demyelinating Diseases; Disease Models, Animal; Ethidium; Glial Fib | 2016 |
Propentofylline Prevents Sickness Behavior and Depressive-Like Behavior Induced by Lipopolysaccharide in Rats via Neuroinflammatory Pathway.
Topics: Animals; Antidepressive Agents; Anxiety; Behavior, Animal; Body Weight; Brain-Derived Neurotrophic F | 2017 |
Activation of p-38alpha MAPK contributes to neuronal hyperexcitability in caudal regions remote from spinal cord injury.
Topics: Animals; Astrocytes; Disease Models, Animal; Enzyme Activation; Gliosis; Hyperalgesia; Male; Microgl | 2009 |
Dynamic regulation of spinal pro-inflammatory cytokine release in the rat in vivo following peripheral nerve injury.
Topics: Afferent Pathways; Animals; Cytokines; Disease Models, Animal; Electric Stimulation; Interleukin-1be | 2010 |
Antiallodynic effects of propentofylline Elicited by interrupting spinal glial function in a rat model of bone cancer pain.
Topics: Animals; Bone Neoplasms; Cytokines; Disease Models, Animal; Female; Neuroglia; Pain; Rats; Rats, Spr | 2011 |
Propentofylline decreases tumor growth in a rodent model of glioblastoma multiforme by a direct mechanism on microglia.
Topics: Animals; Antineoplastic Agents; Brain Neoplasms; Central Nervous System; Disease Models, Animal; Gli | 2012 |
Potentiation of synaptic strength and intrinsic excitability in the nucleus accumbens after 10 days of morphine withdrawal.
Topics: 2-Amino-5-phosphonovalerate; 6-Cyano-7-nitroquinoxaline-2,3-dione; Amino Acids; Analysis of Variance | 2012 |
Cyclotraxin-B, a new TrkB antagonist, and glial blockade by propentofylline, equally prevent and reverse cold allodynia induced by BDNF or partial infraorbital nerve constriction in mice.
Topics: Analgesics; Animals; Brain-Derived Neurotrophic Factor; Central Nervous System Sensitization; Cold T | 2012 |
Propentofylline attenuates tau hyperphosphorylation in Alzheimer's Swedish mutant model Tg2576.
Topics: Alzheimer Disease; Amyloid; Amyloid beta-Protein Precursor; Analysis of Variance; Animals; Blotting, | 2005 |
Activation of p38 and p42/44 MAP kinase in neuropathic pain: involvement of VPAC2 and NK2 receptors and mediation by spinal glia.
Topics: Animals; Disease Models, Animal; Enzyme Activation; Enzyme Inhibitors; Inflammation Mediators; Male; | 2005 |
Reduction in cerebral ischemic injury in the newborn rat by potentiation of endogenous adenosine.
Topics: Adenosine; Animals; Animals, Newborn; Body Temperature; Brain; Brain Ischemia; Disease Models, Anima | 1995 |
Impairment of learning and memory and the accessory symptom in aged rat as senile dementia model (3): Oral administration of propentofylline produces recovery of reduced NGF content in the brain of aged rats.
Topics: Administration, Oral; Aging; Alzheimer Disease; Animals; Brain; Choline O-Acetyltransferase; Disease | 1993 |
Propentofylline prevents neuronal dysfunction induced by infusion of anti-nerve growth factor antibody into the rat septum.
Topics: Administration, Intranasal; Animals; Anti-Ulcer Agents; Antibodies, Monoclonal; Choline O-Acetyltran | 1996 |
Properties of activated microglia and pharmacologic interference by propentofylline.
Topics: Adult; Alzheimer Disease; Amyloid beta-Protein Precursor; Animals; Animals, Newborn; Brain Ischemia; | 1998 |
Propentofylline, a glial modulating agent, exhibits antiallodynic properties in a rat model of neuropathic pain.
Topics: Animals; Disease Models, Animal; Dose-Response Relationship, Drug; Hyperalgesia; Immunohistochemistr | 2001 |
Disturbance of cerebral autoregulation after global ischemia and the stabilizing role of adenosine.
Topics: Animals; Brain Ischemia; Cerebrovascular Circulation; Disease Models, Animal; Homeostasis; Rats; Xan | 1992 |