prednisone has been researched along with Leukemia, Prolymphocytic in 12 studies
Prednisone: A synthetic anti-inflammatory glucocorticoid derived from CORTISONE. It is biologically inert and converted to PREDNISOLONE in the liver.
prednisone : A synthetic glucocorticoid drug that is particularly effective as an immunosuppressant, and affects virtually all of the immune system. Prednisone is a prodrug that is converted by the liver into prednisolone (a beta-hydroxy group instead of the oxo group at position 11), which is the active drug and also a steroid.
Leukemia, Prolymphocytic: A chronic leukemia characterized by a large number of circulating prolymphocytes. It can arise spontaneously or as a consequence of transformation of CHRONIC LYMPHOCYTIC LEUKEMIA.
| Excerpt | Relevance | Reference |
|---|---|---|
| "To describe the results of fludarabine therapy in patients with prolymphocytic leukemia (PLL) and the prolymphocytoid variant of chronic lymphocytic leukemia (CLL-Pro)." | 9.07 | Efficacy of fludarabine, a new adenine nucleoside analogue, in patients with prolymphocytic leukemia and the prolymphocytoid variant of chronic lymphocytic leukemia. ( Beran, M; Childs, C; Huh, Y; Kantarjian, HM; Keating, MJ; Koller, C; O'Brien, S; Schachner, J, 1991) |
| "To describe the results of fludarabine therapy in patients with prolymphocytic leukemia (PLL) and the prolymphocytoid variant of chronic lymphocytic leukemia (CLL-Pro)." | 5.07 | Efficacy of fludarabine, a new adenine nucleoside analogue, in patients with prolymphocytic leukemia and the prolymphocytoid variant of chronic lymphocytic leukemia. ( Beran, M; Childs, C; Huh, Y; Kantarjian, HM; Keating, MJ; Koller, C; O'Brien, S; Schachner, J, 1991) |
| "Although hypercalcemia is more frequently found in T-cell leukaemia associated with human T lymphotropic lymphocyte type I, scattered reports indicate that patients with B-CLL can also be affected with this metabolic disturbance." | 2.39 | B-CLL in PLL transformation associated with hypercalcemia. ( De Oliveira, MS; Esteves, C; Lerner, D, 1994) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 1 (8.33) | 18.7374 |
| 1990's | 8 (66.67) | 18.2507 |
| 2000's | 3 (25.00) | 29.6817 |
| 2010's | 0 (0.00) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Murase, K | 1 |
| Matsunaga, T | 1 |
| Sato, T | 1 |
| Kuribayashi, K | 1 |
| Kogawa, K | 1 |
| Kawano, Y | 1 |
| Okamoto, T | 1 |
| Takayama, T | 1 |
| Watanabe, H | 1 |
| Niitsu, Y | 1 |
| Hirayama, Y | 1 |
| de Lavallade, H | 1 |
| Faucher, C | 1 |
| Fürst, S | 1 |
| El-Cheikh, J | 1 |
| Vey, N | 1 |
| Coso, D | 1 |
| Bouabdallah, R | 1 |
| Stoppa, AM | 1 |
| Gastaut, JA | 1 |
| Blaise, D | 1 |
| Mohty, M | 1 |
| Crisostomo, RH | 1 |
| Fernandez, JA | 1 |
| Caceres, W | 1 |
| Witzig, TE | 1 |
| Weitz, JJ | 1 |
| Lundberg, JH | 1 |
| Tefferi, A | 1 |
| Lerner, D | 1 |
| Esteves, C | 1 |
| De Oliveira, MS | 1 |
| Yuen, BH | 1 |
| Godwin, JE | 1 |
| Jones, R | 1 |
| Pipas, JM | 1 |
| Kritz, AD | 1 |
| Akin, C | 1 |
| Hansen, P | 1 |
| Janckila, A | 1 |
| Sakai, R | 1 |
| Maruta, A | 1 |
| Tomita, N | 1 |
| Taguchi, J | 1 |
| Fujisawa, S | 1 |
| Ogawa, K | 1 |
| Motomura, S | 1 |
| Kodama, F | 1 |
| Mohri, H | 1 |
| Ishigatsubo, Y | 1 |
| Kantarjian, HM | 1 |
| Childs, C | 1 |
| O'Brien, S | 1 |
| Huh, Y | 1 |
| Beran, M | 1 |
| Schachner, J | 1 |
| Koller, C | 1 |
| Keating, MJ | 1 |
| Bisail, M | 1 |
| Cassisa, L | 1 |
| Manca, M | 1 |
| Casula, S | 1 |
| Fele, G | 1 |
| Malavasi, A | 1 |
| De Belilovsky, C | 1 |
| Guillaume, JC | 1 |
| Gilles, E | 1 |
| Bosq, J | 1 |
| Hayat, M | 1 |
| Desvignes, V | 1 |
| Avril, MF | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Treatment of T-Large Granular Lymphocyte (T-LGL) Lymphoproliferative Disorders With Cyclosporine[NCT00001533] | Phase 1 | 25 participants | Interventional | 1996-09-30 | Completed | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
1 review available for prednisone and Leukemia, Prolymphocytic
| Article | Year |
|---|---|
B-CLL in PLL transformation associated with hypercalcemia.
Topics: Antigens, CD; Antineoplastic Combined Chemotherapy Protocols; Bone Marrow; Chlorambucil; Cyclophosph | 1994 |
1 trial available for prednisone and Leukemia, Prolymphocytic
| Article | Year |
|---|---|
Efficacy of fludarabine, a new adenine nucleoside analogue, in patients with prolymphocytic leukemia and the prolymphocytoid variant of chronic lymphocytic leukemia.
Topics: Aged; Aged, 80 and over; Agranulocytosis; Antineoplastic Agents; Chromosome Aberrations; Chromosome | 1991 |
10 other studies available for prednisone and Leukemia, Prolymphocytic
| Article | Year |
|---|---|
Allogeneic bone marrow transplantation in a patient with T-prolymphocytic leukemia with small-intestinal involvement.
Topics: Adult; Antineoplastic Combined Chemotherapy Protocols; Bone Marrow Transplantation; Cyclophosphamide | 2003 |
Allogeneic stem cell transplantation after reduced-intensity conditioning in a patient with T-cell prolymphocytic leukemia: graft-versus-tumor effect and long-term remission.
Topics: Adult; Antineoplastic Combined Chemotherapy Protocols; Cyclophosphamide; Doxorubicin; Follow-Up Stud | 2006 |
Complex karyotype including chromosomal translocation (8;14) (q24;q32) in one case with B-cell prolymphocytic leukemia.
Topics: Antineoplastic Combined Chemotherapy Protocols; Chromosome Aberrations; Chromosomes, Human, Pair 14; | 2007 |
Treatment of refractory T-cell chronic lymphocytic leukemia with purine nucleoside analogues.
Topics: 2-Chloroadenosine; Anemia; Antineoplastic Combined Chemotherapy Protocols; CD3 Complex; CD4-Positive | 1994 |
ProMACE day 1/MOPP day 8 chemotherapy for prolymphocytic leukemia: a case report of prolonged survival.
Topics: Aged; Antineoplastic Combined Chemotherapy Protocols; Cyclophosphamide; Doxorubicin; Drug Administra | 1994 |
Tumor lysis syndrome provides evidence for dose-intense response for corticosteroids in prolymphocytic leukemia.
Topics: Aged; Aged, 80 and over; Humans; Leukemia, Prolymphocytic; Male; Prednisone; Tumor Lysis Syndrome | 1993 |
Prolymphocytic leukemia: diagnosis and treatment. A case report.
Topics: Antineoplastic Combined Chemotherapy Protocols; B-Lymphocytes; Biopsy, Needle; Bone Marrow; Combined | 1997 |
Improvement of quality of life after splenectomy in an HTLV-I carrier with T-cell prolymphocytic leukemia.
Topics: Adult; Antineoplastic Combined Chemotherapy Protocols; Carrier State; Combined Modality Therapy; Cyc | 1999 |
[Discordance between clinical and immunological aspects in a case of chronic B-type lymphoproliferative syndrome].
Topics: Aged; Antineoplastic Combined Chemotherapy Protocols; B-Lymphocytes; Chronic Disease; Cyclophosphami | 1991 |
[Cutaneous manifestations of T-cell prolymphocytic leukemia].
Topics: Antineoplastic Combined Chemotherapy Protocols; Back; Cyclophosphamide; Doxorubicin; Follow-Up Studi | 1989 |