nitroglycerin has been researched along with Vascular Diseases in 48 studies
Nitroglycerin: A volatile vasodilator which relieves ANGINA PECTORIS by stimulating GUANYLATE CYCLASE and lowering cytosolic calcium. It is also sometimes used for TOCOLYSIS and explosives.
nitroglycerol : A nitrate ester that is glycerol in which nitro group(s) replace the hydrogen(s) attached to one or more of the hydroxy groups.
nitroglycerin : A nitroglycerol that is glycerol in which the hydrogen atoms of all three hydroxy groups are replaced by nitro groups. It acts as a prodrug, releasing nitric oxide to open blood vessels and so alleviate heart pain.
Vascular Diseases: Pathological processes involving any of the BLOOD VESSELS in the cardiac or peripheral circulation. They include diseases of ARTERIES; VEINS; and rest of the vasculature system in the body.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Transdermal nitroglycerin protects against ischemia-induced microvascular dysfunction and causes marked dilation of the brachial artery %FMD." | 9.34 | Acute application of a transdermal nitroglycerin patch protects against prolonged forearm ischemia-induced microvascular dysfunction. ( Alvares, TS; de Oliveira, GV; Murias, JM; Proctor, DN; Soares, RN, 2020) |
| "The aim of this study was to compare the efficacy of nitroglycerin and diltiazem versus nitroglycerin alone in preventing radial artery spasm (RAS) during transradial coronary procedures." | 9.16 | Nitroglycerin plus diltiazem versus nitroglycerin alone for spasm prophylaxis with transradial approach. ( Dharma, S; Pancholy, S; Patel, T; Radadiya, R; Shah, S; Vyas, C, 2012) |
| "Transdermal nitroglycerin protects against ischemia-induced microvascular dysfunction and causes marked dilation of the brachial artery %FMD." | 5.34 | Acute application of a transdermal nitroglycerin patch protects against prolonged forearm ischemia-induced microvascular dysfunction. ( Alvares, TS; de Oliveira, GV; Murias, JM; Proctor, DN; Soares, RN, 2020) |
| "The spasm was refractory to oral calcium channel blocking agents and direct intraarterial infusion of tolazoline (Priscoline)." | 5.27 | Bilateral upper extremity ischemia after administration of dihydroergotamine-heparin for prophylaxis of deep venous thrombosis. ( Blackshear, WM; Cruse, CW; Schwartz, JA; Seifert, KB; Suslavitch, F, 1988) |
| "The aim of this study was to compare the efficacy of nitroglycerin and diltiazem versus nitroglycerin alone in preventing radial artery spasm (RAS) during transradial coronary procedures." | 5.16 | Nitroglycerin plus diltiazem versus nitroglycerin alone for spasm prophylaxis with transradial approach. ( Dharma, S; Pancholy, S; Patel, T; Radadiya, R; Shah, S; Vyas, C, 2012) |
| " There was no hypotension and other adverse reaction of nitroglycerin in the nitroglycerin group." | 2.78 | Efficacy and safety of nitroglycerin for preventing venous spasm during contrast-guided axillary vein puncture for pacemaker or defibrillator leads implantation. ( Duan, X; Ling, F; Shen, Y; Tong, XS; Xu, HY; Yang, J, 2013) |
| " Glyceryl trinitrate (GTN) that is normally subject to first pass elimination, may exhibit higher bioavailability in these patients." | 1.31 | Noninvasive evaluation of portal-systemic shunting by glyceryl trinitrate. ( Aubrecht, J; Perlík, F; Slanar, O, 2002) |
| " A similar pattern of vascular damage was found in rats treated with a very toxic cyclosporin treatment (50 mg." | 1.29 | Regional differences in vasculotoxic effects of cyclosporin in rats. ( de Ridder, L; Lameire, N; Van de Voorde, J; Verbeke, M, 1995) |
| "The spasm was refractory to oral calcium channel blocking agents and direct intraarterial infusion of tolazoline (Priscoline)." | 1.27 | Bilateral upper extremity ischemia after administration of dihydroergotamine-heparin for prophylaxis of deep venous thrombosis. ( Blackshear, WM; Cruse, CW; Schwartz, JA; Seifert, KB; Suslavitch, F, 1988) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 20 (41.67) | 18.7374 |
| 1990's | 4 (8.33) | 18.2507 |
| 2000's | 13 (27.08) | 29.6817 |
| 2010's | 9 (18.75) | 24.3611 |
| 2020's | 2 (4.17) | 2.80 |
| Authors | Studies |
|---|---|
| Soares, RN | 1 |
| Proctor, DN | 1 |
| de Oliveira, GV | 1 |
| Alvares, TS | 1 |
| Murias, JM | 1 |
| Matsui, S | 1 |
| Kajikawa, M | 1 |
| Maruhashi, T | 1 |
| Iwamoto, Y | 1 |
| Oda, N | 1 |
| Kishimoto, S | 1 |
| Hashimoto, H | 1 |
| Hidaka, T | 1 |
| Kihara, Y | 1 |
| Chayama, K | 1 |
| Hida, E | 1 |
| Goto, C | 1 |
| Aibara, Y | 1 |
| Nakashima, A | 1 |
| Yusoff, FM | 1 |
| Noma, K | 1 |
| Kuwahara, Y | 1 |
| Matsubara, A | 1 |
| Higashi, Y | 1 |
| de Boer, I | 1 |
| Stam, AH | 1 |
| Buntinx, L | 1 |
| Zielman, R | 1 |
| van der Steen, I | 1 |
| van den Maagdenberg, AMJM | 1 |
| de Koning, EJP | 1 |
| Ferrari, MD | 1 |
| de Hoon, JN | 1 |
| Terwindt, GM | 1 |
| Waterbury, TM | 1 |
| Tweet, MS | 1 |
| Hayes, SN | 1 |
| Prasad, A | 1 |
| Lerman, A | 1 |
| Gulati, R | 1 |
| Antignani, PL | 1 |
| Benedetti-Valentini, F | 1 |
| Aluigi, L | 1 |
| Baroncelli, TA | 1 |
| Camporese, G | 1 |
| Failla, G | 1 |
| Martinelli, O | 1 |
| Palasciano, GC | 1 |
| Pulli, R | 1 |
| Rispoli, P | 1 |
| Amato, A | 1 |
| Amitrano, M | 1 |
| Dorigo, W | 1 |
| Gossetti, B | 1 |
| Irace, L | 1 |
| Laurito, A | 1 |
| Magnoni, F | 1 |
| Minucci, S | 1 |
| Pedrini, L | 1 |
| Righi, D | 1 |
| Verlato, F | 1 |
| Heiss, C | 1 |
| Balzer, J | 1 |
| Hauffe, T | 1 |
| Hamada, S | 1 |
| Stegemann, E | 1 |
| Koeppel, T | 1 |
| Merx, MW | 1 |
| Rassaf, T | 1 |
| Kelm, M | 1 |
| Lauer, T | 1 |
| Jablonski, KL | 1 |
| Chonchol, M | 1 |
| Pierce, GL | 1 |
| Walker, AE | 1 |
| Seals, DR | 1 |
| Hermann, TS | 1 |
| Dall, CH | 1 |
| Christensen, SB | 1 |
| Goetze, JP | 1 |
| Prescott, E | 1 |
| Gustafsson, F | 1 |
| Dharma, S | 1 |
| Shah, S | 1 |
| Radadiya, R | 1 |
| Vyas, C | 1 |
| Pancholy, S | 1 |
| Patel, T | 1 |
| Asghar, H | 1 |
| Shroff, A | 1 |
| Duan, X | 1 |
| Ling, F | 1 |
| Shen, Y | 1 |
| Yang, J | 1 |
| Xu, HY | 1 |
| Tong, XS | 1 |
| Clemens, RK | 1 |
| Lillis, AP | 1 |
| Alomari, AI | 1 |
| Sorensen, MB | 1 |
| Collins, P | 1 |
| Ong, PJ | 1 |
| Webb, CM | 1 |
| Hayward, CS | 1 |
| Asbury, EA | 1 |
| Gatehouse, PD | 1 |
| Elkington, AG | 1 |
| Yang, GZ | 1 |
| Kubba, A | 1 |
| Pennell, DJ | 1 |
| Slanar, O | 1 |
| Aubrecht, J | 1 |
| Perlík, F | 1 |
| Amar, S | 1 |
| Gokce, N | 1 |
| Morgan, S | 1 |
| Loukideli, M | 1 |
| Van Dyke, TE | 1 |
| Vita, JA | 1 |
| FOLEY, WT | 2 |
| MCDEVITT, E | 1 |
| TULLOCH, JA | 1 |
| TUNIS, M | 1 |
| WRIGHT, IS | 1 |
| HUEBER, EF | 1 |
| THALER, H | 1 |
| WICK, E | 1 |
| DE LA PIERRE, M | 1 |
| BARBERA, G | 1 |
| COSTA, P | 1 |
| KOZAK, P | 1 |
| Vychytil, A | 1 |
| Födinger, M | 1 |
| Pleiner, J | 1 |
| Müllner, M | 1 |
| Konner, P | 1 |
| Skoupy, S | 1 |
| Röhrer, C | 1 |
| Wolzt, M | 1 |
| Sunder-Plassmann, G | 1 |
| Mercanoglu, F | 1 |
| Erdogan, D | 1 |
| Oflaz, H | 1 |
| Kücükkaya, R | 1 |
| Selcukbiricik, F | 1 |
| Gül, A | 1 |
| Inanc, M | 1 |
| Jin, SM | 1 |
| Noh, CI | 1 |
| Bae, EJ | 1 |
| Choi, JY | 1 |
| Yun, YS | 1 |
| Torgrimson, BN | 1 |
| Meendering, JR | 1 |
| Kaplan, PF | 1 |
| Minson, CT | 1 |
| Guthikonda, S | 1 |
| Sinkey, CA | 1 |
| Haynes, WG | 1 |
| Tarhan, IA | 1 |
| Kehlibar, T | 1 |
| Arslan, Y | 1 |
| Yilmaz, M | 1 |
| Dumantepe, M | 1 |
| Berkoz, K | 1 |
| Pancaroglu, C | 1 |
| Ozler, A | 1 |
| Schonberger, RB | 1 |
| Worden, WS | 1 |
| Shahmohammadi, K | 1 |
| Menn, K | 1 |
| Silverman, TJ | 1 |
| Stout, RG | 1 |
| Shelley, KH | 1 |
| Silverman, DG | 1 |
| Dennis, AJ | 1 |
| Hudson, JB | 1 |
| Humphries, AL | 1 |
| Dasgupta, G | 1 |
| Wray, CH | 1 |
| Verbeke, M | 1 |
| Van de Voorde, J | 1 |
| de Ridder, L | 1 |
| Lameire, N | 1 |
| Hutchison, SJ | 1 |
| Glantz, SA | 1 |
| Zhu, BQ | 1 |
| Sun, YP | 1 |
| Chou, TM | 1 |
| Chatterjee, K | 1 |
| Deedwania, PC | 1 |
| Parmley, WW | 1 |
| Sudhir, K | 1 |
| Maiorano, G | 1 |
| Bartolomucci, F | 1 |
| Contursi, V | 1 |
| Minenna, FS | 1 |
| Di Mise, R | 1 |
| Palasciano, A | 1 |
| Allegrini, B | 1 |
| Amoruso, M | 1 |
| Kozàkovà, M | 1 |
| de Divitiis, M | 1 |
| Pilla, C | 1 |
| Kattenhorn, M | 1 |
| Zadinello, M | 1 |
| Donald, A | 1 |
| Leeson, P | 1 |
| Wallace, S | 1 |
| Redington, A | 1 |
| Deanfield, JE | 1 |
| Hollenberg, SM | 1 |
| Klein, LW | 1 |
| Parrillo, JE | 1 |
| Scherer, M | 1 |
| Burns, D | 1 |
| Tamburro, P | 1 |
| Oberoi, M | 1 |
| Johnson, MR | 1 |
| Costanzo, MR | 1 |
| Dobrzhanskaia, AK | 2 |
| Gornik, VM | 1 |
| Kosichkin, MM | 2 |
| Strozzi, C | 1 |
| Cocco, G | 1 |
| Destro, A | 1 |
| Padovan, G | 1 |
| Abbasciano, V | 1 |
| Tosatti, S | 1 |
| Francis, DR | 1 |
| Hubbard, ER | 1 |
| Johnson, LE | 1 |
| Rehner, M | 1 |
| Schilling, D | 1 |
| Soehendra, N | 1 |
| Werner, B | 1 |
| Harrison, DG | 1 |
| Kurz, MA | 1 |
| Quillen, JE | 1 |
| Sellke, FW | 1 |
| Mügge, A | 1 |
| Becker, GJ | 1 |
| Katzen, BT | 1 |
| Dake, MD | 1 |
| Seifert, KB | 1 |
| Blackshear, WM | 1 |
| Cruse, CW | 1 |
| Schwartz, JA | 1 |
| Suslavitch, F | 1 |
| Weiss, H | 1 |
| Böhme, H | 1 |
| Uemichi, A | 1 |
| Kaneko, Y | 1 |
| Shiraha, Y | 1 |
| Adams Ray, J | 1 |
| Iwata, O | 1 |
| Mori, M | 1 |
| Ui, K | 1 |
| Iriuchijima, J | 1 |
| Bartolo, M | 1 |
| Gambelli, G | 1 |
| Tomei, F | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| "The Virtual Multicenter Spontaneous Coronary Artery Dissection (SCAD) Registry"[NCT01429727] | 2,000 participants (Anticipated) | Observational | 2011-07-31 | Recruiting | |||
| Targeting Inflammation to Treat Cardiovascular Aging in Humans (TIVA Study)[NCT01775865] | Phase 2 | 59 participants (Actual) | Interventional | 2012-09-30 | Completed | ||
| Do Patients Need Pre-Procedural Fasting for Coronary Artery Procedures?[NCT02562638] | 240 participants (Anticipated) | Interventional | 2015-10-31 | Not yet recruiting | |||
| Treatment of Periodontal Disease in Patients With Acute Myocardial Infarction: Randomized Controlled Trial[NCT02543502] | 54 participants (Actual) | Interventional | 2012-08-31 | Completed | |||
| Generation of Marfan Syndrome and Fontan Cardiovascular Models Using Patient-specific Induced Pluripotent Stem Cells[NCT02815072] | 30 participants (Anticipated) | Observational | 2013-10-31 | Recruiting | |||
| Transdermal Application of Acetylcholine and Nitroglycerin Without Iontophoresis.[NCT00259701] | 20 participants | Observational | 2005-06-30 | Completed | |||
| LOVE-COARCT Study: Long-term Outcomes and Vascular Evaluation After Coarctation of the Aorta Treatment[NCT03262753] | 90 participants (Anticipated) | Observational | 2013-06-01 | Recruiting | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
Endothelial function (NCT01775865)
Timeframe: Change from baseline brachial artery FMD at 4 weeks
| Intervention | Percent dilation (Mean) | |
|---|---|---|
| Baseline | 4 Weeks | |
| Placebo | 3.57 | 2.50 |
| Salsalate | 3.49 | 4.60 |
| Young Control Group | 5.88 | NA |
Aortic stiffness (NCT01775865)
Timeframe: Change in CFPWV from baseline at 4 weeks
| Intervention | cm/sec (Mean) | |
|---|---|---|
| Baseline | 4 weeks | |
| Placebo | 785.1 | 740.01 |
| Salsalate | 831.3 | 839.6 |
| Young Control Group | 538.0 | NA |
3 reviews available for nitroglycerin and Vascular Diseases
| Article | Year |
|---|---|
Diagnosis of vascular diseases. Ultrasound investigations--guidelines.
Topics: Ankle Brachial Index; Blood Circulation; Blood Flow Velocity; Blood Gas Monitoring, Transcutaneous; | 2012 |
Normal and pathophysiologic considerations of endothelial regulation of vascular tone and their relevance to nitrate therapy.
Topics: Animals; Endothelium, Vascular; Muscle Tonus; Muscle, Smooth, Vascular; Nitric Oxide; Nitroglycerin; | 1992 |
Noncoronary angioplasty.
Topics: Angioplasty, Balloon; Aspirin; Constriction, Pathologic; Heparin; Humans; Nifedipine; Nitroglycerin; | 1989 |
14 trials available for nitroglycerin and Vascular Diseases
| Article | Year |
|---|---|
Acute application of a transdermal nitroglycerin patch protects against prolonged forearm ischemia-induced microvascular dysfunction.
Topics: Adult; Forearm; Humans; Ischemia; Male; Microcirculation; Nitroglycerin; Transdermal Patch; Vascular | 2020 |
Endothelial dysfunction, abnormal vascular structure and lower urinary tract symptoms in men and women.
Topics: Adult; Aged; Aged, 80 and over; Blood Flow Velocity; Cross-Sectional Studies; Endothelium, Vascular; | 2018 |
Effect of high intensity exercise on peak oxygen uptake and endothelial function in long-term heart transplant recipients.
Topics: Biomarkers; Blood Pressure; Endothelium, Vascular; Exercise Therapy; Female; Graft Rejection; Heart | 2011 |
Nitroglycerin plus diltiazem versus nitroglycerin alone for spasm prophylaxis with transradial approach.
Topics: Aged; Angioplasty, Balloon, Coronary; Blood Pressure; Cardiovascular Diseases; Diltiazem; Drug Thera | 2012 |
Efficacy and safety of nitroglycerin for preventing venous spasm during contrast-guided axillary vein puncture for pacemaker or defibrillator leads implantation.
Topics: Administration, Intravenous; Aged; Aged, 80 and over; Axillary Vein; Catheterization, Peripheral; Ch | 2013 |
Long-term use of contraceptive depot medroxyprogesterone acetate in young women impairs arterial endothelial function assessed by cardiovascular magnetic resonance.
Topics: Adult; Amenorrhea; Brachial Artery; Delayed-Action Preparations; Endothelium, Vascular; Estradiol; F | 2002 |
Acute effect of amino acid peritoneal dialysis solution on vascular function.
Topics: Adult; Amino Acids; Blood Flow Velocity; Blood Pressure; Cross-Over Studies; Endothelium, Vascular; | 2003 |
Impaired brachial endothelial function in patients with primary anti-phospholipid syndrome.
Topics: Adult; Antiphospholipid Syndrome; Arteriosclerosis; Brachial Artery; Cross-Sectional Studies; Endoth | 2004 |
Endothelial function across an oral contraceptive cycle in women using levonorgestrel and ethinyl estradiol.
Topics: Adult; Blood Pressure; Brachial Artery; Contraceptives, Oral, Combined; Drug Administration Schedule | 2007 |
What is the most appropriate methodology for detection of conduit artery endothelial dysfunction?
Topics: Administration, Oral; Adolescent; Adult; Aged; Aged, 80 and over; Allopurinol; Brachial Artery; Cros | 2007 |
Effects of normothermic organ bath and verapamil-nitroglycerin solution alone or in combination on the blood flow of radial artery.
Topics: Adult; Aged; Body Temperature; Drug Combinations; Female; Humans; Hypothermia, Induced; Male; Middle | 2007 |
Topical non-iontophoretic application of acetylcholine and nitroglycerin via a translucent patch: a new means for assessing microvascular reactivity.
Topics: Acetylcholine; Administration, Topical; Adult; Bandages; Blood Flow Velocity; Drug Delivery Systems; | 2006 |
Vascular dysfunction after repair of coarctation of the aorta: impact of early surgery.
Topics: Adult; Age Factors; Aortic Coarctation; Blood Flow Velocity; Brachial Artery; Cardiovascular Surgica | 2001 |
Coronary endothelial dysfunction after heart transplantation predicts allograft vasculopathy and cardiac death.
Topics: Acetylcholine; Adenosine; Adolescent; Adult; Child; Coronary Angiography; Coronary Circulation; Coro | 2001 |
31 other studies available for nitroglycerin and Vascular Diseases
| Article | Year |
|---|---|
RVCL-S and CADASIL display distinct impaired vascular function.
Topics: Adult; Blood Flow Velocity; CADASIL; Capsaicin; Exodeoxyribonucleases; Female; Humans; Leukoencephal | 2018 |
Coronary endothelial function and spontaneous coronary artery dissection.
Topics: Acetylcholine; Adenosine; Adult; Aged; Blood Flow Velocity; Case-Control Studies; Chest Pain; Corona | 2020 |
Vascular dysfunction of brachial artery after transradial access for coronary catheterization: impact of smoking and catheter changes.
Topics: Aged; Brachial Artery; Cardiac Catheterization; Coronary Angiography; Equipment Design; Female; Huma | 2009 |
25-Hydroxyvitamin D deficiency is associated with inflammation-linked vascular endothelial dysfunction in middle-aged and older adults.
Topics: 25-Hydroxyvitamin D3 1-alpha-Hydroxylase; Aged; Brachial Artery; Endothelium, Vascular; Female; Huma | 2011 |
Preventing spasm during transradial angiography: sometimes less is more.
Topics: Angioplasty, Balloon, Coronary; Diltiazem; Female; Humans; Male; Nitroglycerin; Radial Artery; Spasm | 2012 |
Catheter-induced venous spasm.
Topics: Adolescent; Catheterization; Catheters; Humans; Male; Muscle, Smooth, Vascular; Nitroglycerin; Phleb | 2012 |
Noninvasive evaluation of portal-systemic shunting by glyceryl trinitrate.
Topics: Administration, Oral; Administration, Sublingual; Adult; Diagnosis, Computer-Assisted; Female; Human | 2002 |
Periodontal disease is associated with brachial artery endothelial dysfunction and systemic inflammation.
Topics: Adult; Analysis of Variance; Biomarkers; Brachial Artery; C-Reactive Protein; Case-Control Studies; | 2003 |
Studies of vasospasm. I. The use of glyceryl trinitrate as a diagnostic test of peripheral pulses.
Topics: Cardiovascular Physiological Phenomena; Diagnostic Tests, Routine; Heart Rate; Humans; Nitrites; Nit | 1953 |
[Peripheral arterial circulatory disorders and therapy. I. Rheoangiographic registration of the effect of nitroglycerin preparations in healthy subjects].
Topics: Healthy Volunteers; Nitrites; Nitroglycerin; Peripheral Arterial Disease; Peripheral Vascular Diseas | 1956 |
[Variations of oscillometric indices of the extremities induced by nitroglycerin in healthy subjects and in arteriopathic patients].
Topics: Extremities; Healthy Volunteers; Humans; Nitrites; Nitroglycerin; Peripheral Vascular Diseases; Vasc | 1959 |
[EFFECT OF NITROGLYCERIN ON PERIPHERAL CIRCULATION].
Topics: Arteriosclerosis Obliterans; Blood Circulation; Humans; Nitroglycerin; Oscillometry; Plethysmography | 1964 |
Impaired vascular function in patients with Fontan circulation.
Topics: Administration, Sublingual; Adolescent; Blood Flow Velocity; Brachial Artery; Carotid Artery, Common | 2007 |
Nitroglycerin as a remedy for peripheral vascular insufficiency associated with oxalosis.
Topics: Adult; Female; Humans; Nitroglycerin; Oxalates; Vascular Diseases | 1980 |
Regional differences in vasculotoxic effects of cyclosporin in rats.
Topics: Acetylcholine; Animals; Aorta; Carotid Arteries; Cyclosporine; Endothelium, Vascular; Immunosuppress | 1995 |
In-utero and neonatal exposure to secondhand smoke causes vascular dysfunction in newborn rats.
Topics: Acetylcholine; Animals; Animals, Newborn; Aorta, Thoracic; Calcimycin; Cotinine; Disease Models, Ani | 1998 |
Noninvasive detection of vascular dysfunction in alcoholic patients.
Topics: Administration, Sublingual; Adult; Alcoholism; Blood Flow Velocity; Blood Pressure; Blood Pressure M | 1999 |
[State of peripheral circulation in the late stages of vibration disease].
Topics: Adult; Blood Circulation; Disability Evaluation; Humans; Middle Aged; Nitroglycerin; Plethysmography | 1978 |
Studies of vasospasm. II. The use of nitroglycerin cigarettes.
Topics: Humans; Male; Middle Aged; Nitroglycerin; Smoking; Vascular Diseases | 1979 |
Disorders in peripheral arterial system in asymptomatic elderly: plethysmographic semiology at rest, during postural, effort and pharmacological tests.
Topics: Aged; Arm; Female; Humans; Male; Metaproterenol; Middle Aged; Nitroglycerin; Physical Exertion; Plet | 1979 |
Nitroglycerin ointment as a vasodilator in the lower extremities.
Topics: Foot; Foot Diseases; Humans; Nitroglycerin; Ointments; Pulse; Vascular Diseases | 1977 |
[Pancreatic pain: a clinical-experimental study].
Topics: Endoscopy; Humans; Nitroglycerin; Pain; Pancreatic Diseases; Vascular Diseases | 1976 |
[Features of peripheral circulatory disorders in patients with progressive muscular dystrophies].
Topics: Adolescent; Adult; Blood Circulation; Disability Evaluation; Extremities; Humans; Middle Aged; Muscu | 1987 |
Bilateral upper extremity ischemia after administration of dihydroergotamine-heparin for prophylaxis of deep venous thrombosis.
Topics: Arm; Brachial Artery; Dihydroergotamine; Drug Combinations; Female; Heparin; Heparin, Low-Molecular- | 1988 |
[Studies on the determination and evaluation of metamorphopsias. V. Further tests for the evaluation of metamorphopsias and their components].
Topics: Adolescent; Adult; Aged; Electroretinography; Female; Glucose; Humans; Ischemia; Light; Macula Lutea | 1972 |
[Effect of nitroglycerin on the phonoangiogram in organic vascular diseases].
Topics: Blood Circulation; Collateral Circulation; Extremities; Humans; Male; Middle Aged; Nitroglycerin; Ph | 1967 |
[Experiences in the use of anginine for chronic occlusive disease of the lower extremity artery, with special reference to the evaluation of its effects through angiography].
Topics: Adult; Aged; Angiography; Arteries; Chronic Disease; Female; Humans; Leg; Male; Middle Aged; Nitrogl | 1968 |
[1st degree frostbite with remaining vasoconstriction symptoms].
Topics: Aged; Fingers; Frostbite; Humans; Hypesthesia; Male; Nitroglycerin; Stellate Ganglion; Tolazoline; V | 1970 |
[A fluorescence angiographic study of retinal vein obstruction].
Topics: Adolescent; Adult; Aged; Female; Fluoresceins; Fundus Oculi; Humans; Male; Middle Aged; Nitroglyceri | 1971 |
Effects of nitrites on arterial collateral vessels of dogs.
Topics: Animals; Arteries; Blood Pressure; Carotid Arteries; Collateral Circulation; Dogs; Female; Femoral A | 1971 |
[Significance and value of the nitrite test in angiology].
Topics: Arteriosclerosis; Diabetic Angiopathies; Humans; Methods; Nitrites; Nitroglycerin; Plethysmography, | 1971 |