metronidazole has been researched along with Colonic Neoplasms in 53 studies
Metronidazole: A nitroimidazole used to treat AMEBIASIS; VAGINITIS; TRICHOMONAS INFECTIONS; GIARDIASIS; ANAEROBIC BACTERIA; and TREPONEMAL INFECTIONS.
metronidazole : A member of the class of imidazoles substituted at C-1, -2 and -5 with 2-hydroxyethyl, nitro and methyl groups respectively. It has activity against anaerobic bacteria and protozoa, and has a radiosensitising effect on hypoxic tumour cells. It may be given by mouth in tablets, or as the benzoate in an oral suspension. The hydrochloride salt can be used in intravenous infusions. Metronidazole is a prodrug and is selective for anaerobic bacteria due to their ability to intracellularly reduce the nitro group of metronidazole to give nitroso-containing intermediates. These can covalently bind to DNA, disrupting its helical structure, inducing DNA strand breaks and inhibiting bacterial nucleic acid synthesis, ultimately resulting in bacterial cell death.
Colonic Neoplasms: Tumors or cancer of the COLON.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Three hundred ten patients with colon cancer randomly were assigned to one of three groups." | 2.79 | Comparison between oral antibiotics and probiotics as bowel preparation for elective colon cancer surgery to prevent infection: prospective randomized trial. ( Kamata, H; Koga, Y; Okada, K; Ozaki, T; Sadahiro, S; Suzuki, T; Tanaka, A, 2014) |
| "In most of the patients studied, ambulatory conservative management was safe and effective in the treatment of uncomplicated acute diverticulitis." | 2.74 | [Safety and efficiency of ambulatory treatment of acute diverticulitis]. ( García Marín, A; Martín Gil, J; Pérez Díaz, MD; Rey Valcárcel, C; Sanz Sánchez, M; Serralta De Colsa, D; Turégano Fuentes, F; Vaquero Rodríguez, A, 2009) |
| "Patients with colorectal cancer treated from May 6, 2004, to April 25, 2005." | 2.73 | Randomized, multicenter trial of antibiotic prophylaxis in elective colorectal surgery: single dose vs 3 doses of a second-generation cephalosporin without metronidazole and oral antibiotics. ( Fujita, S; Ikeda, E; Kondo, K; Moriya, Y; Ohue, M; Saito, N; Takii, Y; Yamada, T, 2007) |
| "The rate of postoperative wound infections was not significantly different in the groups (p = 0,09)." | 2.66 | [Perioperative antibiotic prevention in colon and rectum surgery. A randomized study on the value of single dose prevention]. ( Athanasiadis, S; Hahnel, E; Kuhlgatz, C, 1985) |
| "Ameboma are ulcerative, exophytic, inflammatory masses up to 15 cm in diameter in patients with long standing colonic amoebic infections containing granulation tissue with pseudotumor appearance." | 1.72 | Cecal ameboma and a liver abscess mimicking metastatic colonic cancer. An autochthonous infectious disease in Spain? ( Carbajo, AY; Fernández-Prada, SJ; Fuentes-Valenzuela, E; García-Pajares, F; Martínez Lara, C, 2022) |
| "Colitis is a frequently occurred side effect of immune checkpoint inhibitors (ICIs), which are increasingly used in cancer treatment, whereas antibiotics are widely used to treat colitis, their effectiveness in ICI-associated colitis remains controversial." | 1.72 | Sex-Biased Immune Responses to Antibiotics during Anti-PD-L1 Treatment in Mice with Colon Cancer. ( Ai, C; Jiang, G; Jing, N; Liu, Z; Wang, L; Zhuang, H, 2022) |
| "The most frequent cause of pseudomembranous colitis is Clostridium difficile (C." | 1.39 | Atypical presentation of pseudomembranous colitis localized in adenomatous polyps. ( Alvarez-Lobos, M; Barra-Carrasco, J; Guzmán, AM; Hernández-Rocha, C; Lezcano, G; Paredes-Sabja, D; Zoroquiaín, P, 2013) |
| "An increased incidence of colonic cancer is associated with chronic inflammatory bowel disease." | 1.28 | The effect of therapeutic drugs used in inflammatory bowel disease on the incidence and growth of colonic cancer in the dimethylhydrazine rat model. ( Crouch, R; Davis, AE; Patterson, F, 1992) |
| " While the in vitro studies failed to reveal any synergism between 5-FU and MND, pharmacokinetic evaluation revealed that 5-FU clearance was significantly reduced (26." | 1.27 | 5-Fluorouracil-metronidazole combination therapy in metastatic colorectal cancer. Clinical, pharmacokinetic and in vitro cytotoxicity studies. ( Ayoub, J; Bardakji, Z; Besner, JG; Jolivet, J; Langelier, Y, 1986) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 32 (60.38) | 18.7374 |
| 1990's | 6 (11.32) | 18.2507 |
| 2000's | 6 (11.32) | 29.6817 |
| 2010's | 7 (13.21) | 24.3611 |
| 2020's | 2 (3.77) | 2.80 |
| Authors | Studies |
|---|---|
| Fuentes-Valenzuela, E | 1 |
| Carbajo, AY | 1 |
| Fernández-Prada, SJ | 1 |
| Martínez Lara, C | 1 |
| García-Pajares, F | 1 |
| Jing, N | 1 |
| Wang, L | 1 |
| Zhuang, H | 1 |
| Ai, C | 1 |
| Jiang, G | 1 |
| Liu, Z | 1 |
| Vo, E | 1 |
| Massarweh, NN | 1 |
| Chai, CY | 1 |
| Tran Cao, HS | 1 |
| Zamani, N | 1 |
| Abraham, S | 1 |
| Adigun, K | 1 |
| Awad, SS | 1 |
| Martín Rizo, L | 1 |
| Malpartida Flores, M | 1 |
| Fernández Lisón, LC | 1 |
| Sadahiro, S | 1 |
| Suzuki, T | 1 |
| Tanaka, A | 1 |
| Okada, K | 1 |
| Kamata, H | 1 |
| Ozaki, T | 1 |
| Koga, Y | 1 |
| Ozdemir, S | 1 |
| Gulpinar, K | 1 |
| Ozis, SE | 1 |
| Sahli, Z | 1 |
| Kesikli, SA | 1 |
| Korkmaz, A | 1 |
| Gecim, IE | 1 |
| Martín Gil, J | 1 |
| Serralta De Colsa, D | 1 |
| García Marín, A | 1 |
| Vaquero Rodríguez, A | 1 |
| Rey Valcárcel, C | 1 |
| Pérez Díaz, MD | 1 |
| Sanz Sánchez, M | 1 |
| Turégano Fuentes, F | 1 |
| Takashima, M | 1 |
| Kakimoto, T | 1 |
| Saito, H | 1 |
| Misaki, S | 1 |
| Onishi, Y | 1 |
| Kasugai, T | 1 |
| Akuta, K | 1 |
| Kasahara, H | 1 |
| Yamamoto, K | 1 |
| Doi, Y | 1 |
| Ujiie, H | 1 |
| Sugahara, H | 1 |
| Hoshida, Y | 1 |
| Sakoda, H | 1 |
| Sadowska, A | 1 |
| Kędra, B | 1 |
| Cepowicz, D | 1 |
| Rodziewicz, L | 1 |
| Fiedorowicz, A | 1 |
| Prokopiuk, S | 1 |
| Miltyk, W | 1 |
| Car, H | 1 |
| Hernández-Rocha, C | 1 |
| Barra-Carrasco, J | 1 |
| Guzmán, AM | 1 |
| Paredes-Sabja, D | 1 |
| Lezcano, G | 1 |
| Zoroquiaín, P | 1 |
| Alvarez-Lobos, M | 1 |
| Manninen, I | 1 |
| Kamar, M | 1 |
| Raziel, A | 1 |
| Susmallian, S | 1 |
| Kyzer, S | 1 |
| Charuzi, I | 1 |
| Hopf, G | 1 |
| Boecker, R | 1 |
| Benz, K | 1 |
| Stuetz, G | 1 |
| Ng, DC | 1 |
| Kwok, SY | 1 |
| Cheng, Y | 1 |
| Chung, CC | 1 |
| Li, MK | 1 |
| Fujita, S | 1 |
| Saito, N | 1 |
| Yamada, T | 1 |
| Takii, Y | 1 |
| Kondo, K | 1 |
| Ohue, M | 1 |
| Ikeda, E | 1 |
| Moriya, Y | 1 |
| Kraft-Kinz, J | 2 |
| Kronberger, L | 2 |
| Sloan, DA | 1 |
| Fleiszer, DM | 2 |
| Richards, GK | 2 |
| Murray, D | 1 |
| Brown, RA | 2 |
| Graber, H | 1 |
| Csiba, A | 1 |
| Csikós, F | 1 |
| Deutsch, T | 1 |
| Baradnay, G | 1 |
| Nagy, A | 1 |
| Rainey, JB | 3 |
| Maeda, M | 2 |
| Williams, C | 1 |
| Williamson, RC | 2 |
| A-Kareem, AM | 1 |
| Senterman, MK | 1 |
| Aeberhard, P | 1 |
| Flückiger, M | 1 |
| Berger, J | 1 |
| Novak, A | 1 |
| Laitinen, S | 1 |
| Huttunen, R | 1 |
| Ståhlberg, M | 1 |
| Mokka, R | 1 |
| Kairaluoma, M | 1 |
| Larmi, TK | 1 |
| Fingerhut, A | 1 |
| Hay, JM | 1 |
| Raderer, M | 1 |
| Pfeffel, F | 1 |
| Pohl, G | 1 |
| Mannhalter, C | 1 |
| Valencak, J | 1 |
| Chott, A | 1 |
| Goldring, J | 1 |
| McNaught, W | 1 |
| Scott, A | 1 |
| Gillespie, G | 1 |
| Feathers, RS | 1 |
| Sagor, GR | 1 |
| Lewis, AA | 1 |
| Amirak, ID | 1 |
| Noone, P | 1 |
| Keighley, MR | 1 |
| Arabi, Y | 1 |
| Alexander-Williams, J | 1 |
| Youngs, D | 1 |
| Burdon, DW | 1 |
| Frytak, S | 1 |
| Moertel, CG | 1 |
| Childs, DS | 1 |
| Schutt, AJ | 1 |
| Albers, JW | 1 |
| Kelly, JP | 1 |
| Hannam, TW | 1 |
| Giles, GR | 1 |
| Windle, R | 1 |
| Macpherson, S | 1 |
| Bell, PR | 1 |
| Yamada, M | 1 |
| Ohkusa, T | 1 |
| Okayasu, I | 1 |
| Davis, AE | 1 |
| Patterson, F | 1 |
| Crouch, R | 1 |
| Cai, CJ | 1 |
| Lonardo, A | 1 |
| Grisendi, A | 1 |
| Pulvirenti, M | 1 |
| Della Casa, G | 1 |
| Melini, L | 1 |
| Di Gregorio, C | 1 |
| Nasi, G | 1 |
| Sarti, M | 1 |
| Tamborrino, E | 1 |
| Lonardo, F | 1 |
| Wolfsen, HC | 1 |
| Brubacher, LL | 1 |
| Ng, CS | 1 |
| Kayne, AL | 1 |
| Kozarek, RA | 1 |
| Kling, PA | 1 |
| Dahlgren, S | 1 |
| Bittner, R | 1 |
| Butters, M | 1 |
| Rampf, W | 1 |
| Kapfer, X | 1 |
| Kingston, RD | 1 |
| Duthie, J | 1 |
| Lau, WY | 1 |
| Chu, KW | 1 |
| Poon, GP | 1 |
| Ho, KK | 1 |
| Mendel, V | 1 |
| Jung, D | 1 |
| Heymann, H | 1 |
| Fujimoto, M | 1 |
| Sakai, K | 1 |
| Ueda, T | 1 |
| Bardakji, Z | 1 |
| Jolivet, J | 1 |
| Langelier, Y | 1 |
| Besner, JG | 1 |
| Ayoub, J | 1 |
| Eckert, P | 1 |
| Brom, A | 1 |
| Schneider, G | 1 |
| Athanasiadis, S | 1 |
| Kuhlgatz, C | 1 |
| Hahnel, E | 1 |
| Entner, M | 1 |
| Heimberger, H | 1 |
| Hildebrandt, J | 1 |
| Diettrich, H | 1 |
| Roland, M | 1 |
| Bergan, T | 1 |
| Bjerkeset, T | 1 |
| Erichsen, H | 1 |
| Hoel, R | 1 |
| Johansen, S | 1 |
| Liavåg, I | 1 |
| Reinertsen, S | 1 |
| Rosseland, A | 1 |
| Teigan, T | 1 |
| Pittman, FE | 1 |
| Pittman, JC | 1 |
| el-Hashimi, WK | 1 |
| Balikian, JP | 1 |
| Uthman, SM | 1 |
| Khouri, NF | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Randomized Multicentric Controlled Clinical Trial of Parallel Groups to Evaluate the Non-therapeutic Inferiority of a Free Diet With a Progressive Diet, in the Treatment of Non-complicated Acute Diverticulitis[NCT03496090] | 134 participants (Actual) | Interventional | 2018-04-16 | Completed | |||
| Randomized Multicenter Trial of Antibiotic Prophylaxis in Elective Colorectal Surgery: Single-Dose Vs. Three Doses of Second-Generation Cephalosporin[NCT00292708] | Phase 3 | 500 participants | Interventional | 2004-05-31 | Completed | ||
| ERAS Lazio Network Clinical Registry[NCT03353311] | 1,000 participants (Actual) | Observational [Patient Registry] | 2014-09-01 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
19 trials available for metronidazole and Colonic Neoplasms
| Article | Year |
|---|---|
Comparison between oral antibiotics and probiotics as bowel preparation for elective colon cancer surgery to prevent infection: prospective randomized trial.
Topics: Administration, Oral; Adult; Aged; Aged, 80 and over; Anastomotic Leak; Anti-Bacterial Agents; Catha | 2014 |
[Safety and efficiency of ambulatory treatment of acute diverticulitis].
Topics: Abdominal Pain; Abscess; Acute Disease; Adenocarcinoma; Adult; Aged; Aged, 80 and over; Ambulatory C | 2009 |
Randomized, multicenter trial of antibiotic prophylaxis in elective colorectal surgery: single dose vs 3 doses of a second-generation cephalosporin without metronidazole and oral antibiotics.
Topics: Administration, Oral; Anti-Infective Agents; Antibiotic Prophylaxis; Cefmetazole; Colectomy; Colonic | 2007 |
Randomized, multicenter trial of antibiotic prophylaxis in elective colorectal surgery: single dose vs 3 doses of a second-generation cephalosporin without metronidazole and oral antibiotics.
Topics: Administration, Oral; Anti-Infective Agents; Antibiotic Prophylaxis; Cefmetazole; Colectomy; Colonic | 2007 |
Randomized, multicenter trial of antibiotic prophylaxis in elective colorectal surgery: single dose vs 3 doses of a second-generation cephalosporin without metronidazole and oral antibiotics.
Topics: Administration, Oral; Anti-Infective Agents; Antibiotic Prophylaxis; Cefmetazole; Colectomy; Colonic | 2007 |
Randomized, multicenter trial of antibiotic prophylaxis in elective colorectal surgery: single dose vs 3 doses of a second-generation cephalosporin without metronidazole and oral antibiotics.
Topics: Administration, Oral; Anti-Infective Agents; Antibiotic Prophylaxis; Cefmetazole; Colectomy; Colonic | 2007 |
[Parenteral antibiotic prophylaxis or oral antimicrobial bowel preparation for colorectal surgery (author's transl)].
Topics: Administration, Oral; Adult; Aged; Anti-Bacterial Agents; Bacterial Infections; Colonic Neoplasms; D | 1981 |
[Prevention of septic complications in colorectal surgery (author's transl)].
Topics: Anti-Bacterial Agents; Colonic Neoplasms; Drug Therapy, Combination; Humans; Metronidazole; Preopera | 1981 |
Single-dose ceftriaxone, ornidazole, and povidone-iodine enema in elective left colectomy. A randomized multicenter controlled trial. The French Association for Surgical Research.
Topics: Adult; Aged; Aged, 80 and over; Anastomosis, Surgical; Cefotaxime; Ceftriaxone; Colectomy; Colonic N | 1993 |
Prophylactic oral antimicrobial agents in elective colonic surgery. A controlled trial.
Topics: Administration, Oral; Adult; Aged; Bacteroides; Clinical Trials as Topic; Colon; Colonic Diseases; C | 1975 |
Prophylactic systemic antibiotics in colorectal surgery.
Topics: Abscess; Adult; Aged; Bacteroides fragilis; Clinical Trials as Topic; Colitis; Colon; Colonic Neopla | 1977 |
Comparison between systemic and oral antimicrobial prophylaxis in colorectal surgery.
Topics: Administration, Oral; Adult; Aged; Clinical Trials as Topic; Colon; Colonic Neoplasms; Drug Evaluati | 1979 |
Phase II study of metronidazole therapy for advanced colorectal carcinoma.
Topics: Adult; Aged; Clinical Trials as Topic; Colonic Neoplasms; Drug Evaluation; Female; Humans; Male; Met | 1978 |
[Clinical study of prophylactic use of gentamicin and metronidazole in the surgery of colorectal carcinoma].
Topics: Colonic Neoplasms; Female; Gentamicins; Humans; Male; Metronidazole; Middle Aged; Premedication; Pro | 1992 |
Oral prophylaxis with neomycin and erythromycin in colorectal surgery. More proof for efficacy than failure.
Topics: Administration, Oral; Adult; Aged; Aged, 80 and over; Ceftriaxone; Clinical Trials as Topic; Colonic | 1989 |
[Duration of the preventive use of antibiotics in colorectal surgery--single administration versus short-term prevention].
Topics: Aged; Colonic Neoplasms; Drug Administration Schedule; Drug Therapy, Combination; Female; Humans; Ma | 1989 |
Serious postoperative bleeding associated with a single intravenous dose of cefuroxime and metronidazole.
Topics: Aged; Cefuroxime; Cephalosporins; Colonic Neoplasms; Drug Combinations; Female; Gastrointestinal Hem | 1986 |
Prophylactic antibiotics in elective colorectal surgery.
Topics: Administration, Oral; Anti-Bacterial Agents; Colon; Colonic Neoplasms; Erythromycin; Female; Gentami | 1988 |
Single-shot antibiotic prophylaxis in colon surgery.
Topics: Bacteria; Ceftizoxime; Clinical Trials as Topic; Colonic Neoplasms; Diverticulitis; Humans; Metronid | 1987 |
[Significance of amikacin administered orally prior to operation for prevention of postoperative infections in colonic cancer surgery].
Topics: Administration, Oral; Aged; Aged, 80 and over; Amikacin; Clinical Trials as Topic; Colonic Neoplasms | 1986 |
[Perioperative antibiotic prevention in colon and rectum surgery. A randomized study on the value of single dose prevention].
Topics: Adult; Aged; Clinical Trials as Topic; Colonic Diseases; Colonic Neoplasms; Dose-Response Relationsh | 1985 |
Prophylactic regimens in colorectal surgery: comparisons between metronidazole used alone or with ampicillin for one or three days.
Topics: Adult; Aged; Ampicillin; Colonic Neoplasms; Drug Therapy, Combination; Female; Humans; Male; Metroni | 1985 |
34 other studies available for metronidazole and Colonic Neoplasms
| Article | Year |
|---|---|
Cecal ameboma and a liver abscess mimicking metastatic colonic cancer. An autochthonous infectious disease in Spain?
Topics: Amebiasis; Cecum; Colonic Neoplasms; Communicable Diseases; Entamoeba histolytica; Humans; Liver Abs | 2022 |
Sex-Biased Immune Responses to Antibiotics during Anti-PD-L1 Treatment in Mice with Colon Cancer.
Topics: Animals; Anti-Bacterial Agents; Colitis; Colon; Colonic Neoplasms; Cytokines; Disease Models, Animal | 2022 |
Association of the Addition of Oral Antibiotics to Mechanical Bowel Preparation for Left Colon and Rectal Cancer Resections With Reduction of Surgical Site Infections.
Topics: Administration, Oral; Aged; Anastomotic Leak; Anti-Bacterial Agents; Antibiotic Prophylaxis; Cathart | 2018 |
Fidaxomicin in the treatment of Clostridium difficile infection in oncohematology patients.
Topics: Anti-Bacterial Agents; Clostridioides difficile; Clostridium Infections; Colonic Neoplasms; Diarrhea | 2019 |
The effects of preoperative oral antibiotic use on the development of surgical site infection after elective colorectal resections: A retrospective cohort analysis in consecutively operated 90 patients.
Topics: Administration, Oral; Adult; Aged; Aged, 80 and over; Anastomotic Leak; Anti-Bacterial Agents; Antib | 2016 |
Synchronous tumor with diffuse large B-cell lymphoma and ameboma.
Topics: Abdominal Pain; Aged; Amebicides; Antibodies, Monoclonal, Murine-Derived; Antigens, Protozoan; Antin | 2011 |
Increased concentration of metronidazole and its hydroxy metabolite in colon cancer in women.
Topics: Aged; Aged, 80 and over; Anti-Infective Agents; Colon; Colonic Neoplasms; Female; Humans; Hydroxylat | 2012 |
Atypical presentation of pseudomembranous colitis localized in adenomatous polyps.
Topics: Adenomatous Polyps; Aged, 80 and over; Anti-Infective Agents; Clostridioides difficile; Colonic Neop | 2013 |
[The mystery of missing flatulence].
Topics: Abdominal Pain; Adenomatous Polyposis Coli; Adult; Anti-Infective Agents; Colon; Colonic Neoplasms; | 2001 |
D-lactic acidosis in a patient after subtotal colectomy.
Topics: Acidosis, Lactic; Adenocarcinoma; Aged; Aged, 80 and over; Anti-Bacterial Agents; Colectomy; Colonic | 2003 |
Concentration of ciprofloxacin and metronidazole in human tissues during abdominal surgery.
Topics: Anti-Infective Agents; Ciprofloxacin; Colonic Neoplasms; Humans; Infusions, Intravenous; Kinetics; M | 1989 |
Colonic amoebic abscess mimicking carcinoma of the colon.
Topics: Animals; Antibodies, Protozoan; Antiprotozoal Agents; Colonic Neoplasms; Diagnosis, Differential; Dy | 2006 |
[Diagnosis and therapy of cancer of the large intestine (author's transl)].
Topics: Aged; Colonic Neoplasms; Colostomy; Female; Humans; Intestinal Obstruction; Male; Metronidazole; Mid | 1982 |
Increased incidence of experimental colon cancer associated with long-term metronidazole therapy.
Topics: 1,2-Dimethylhydrazine; Animals; Cocarcinogenesis; Colon; Colonic Neoplasms; Dietary Fiber; Dimethylh | 1983 |
Pharmacokinetic examinations with metronidazole in healthy volunteers and colectomized patients.
Topics: Adult; Bacterial Infections; Colectomy; Colonic Neoplasms; Humans; Kinetics; Metronidazole; Premedic | 1983 |
Modern trends in colorectal surgery.
Topics: Anti-Bacterial Agents; Colectomy; Colonic Neoplasms; Enterobacteriaceae Infections; Female; Humans; | 1983 |
The cocarcinogenic effect of intrarectal deoxycholate in rats is reduced by oral metronidazole.
Topics: Animals; Azoxymethane; Cocarcinogenesis; Colonic Neoplasms; Deoxycholic Acid; Intestines; Male; Metr | 1984 |
Effect of long-term metronidazole (MTZ) therapy on experimental colon cancer in rats.
Topics: 1,2-Dimethylhydrazine; Animals; Carcinogens; Cocarcinogenesis; Colon; Colonic Neoplasms; Dimethylhyd | 1984 |
Experiences with the EEA stapling instrument for colorectal anastomosis.
Topics: Adult; Aged; Clindamycin; Colectomy; Colon; Colonic Neoplasms; Disposable Equipment; Female; Gentami | 1980 |
Regression of colonic low grade B cell lymphoma of the mucosa associated lymphoid tissue type after eradication of Helicobacter pylori.
Topics: Aged; Anti-Bacterial Agents; Anti-Ulcer Agents; Clarithromycin; Colonic Neoplasms; Drug Therapy, Com | 2000 |
The cytocidal action of metronidazole in combination with other antineoplastic agents.
Topics: Adenocarcinoma; Animals; Antineoplastic Agents; Cell Survival; Cells, Cultured; Colonic Neoplasms; D | 1979 |
Neutropenia associated with metronidazole.
Topics: Agranulocytosis; Colonic Neoplasms; Drug Therapy, Combination; Fluorouracil; Humans; Metronidazole; | 1979 |
Occurrence of dysplasia and adenocarcinoma after experimental chronic ulcerative colitis in hamsters induced by dextran sulphate sodium.
Topics: Adenocarcinoma; Adenocarcinoma, Mucinous; Animals; Bacteria; Colitis, Ulcerative; Colon; Colonic Neo | 1992 |
The effect of therapeutic drugs used in inflammatory bowel disease on the incidence and growth of colonic cancer in the dimethylhydrazine rat model.
Topics: Adenocarcinoma; Aminosalicylic Acids; Animals; Cocarcinogenesis; Colonic Neoplasms; Dimethylhydrazin | 1992 |
Right colon adenocarcinoma presenting as Bacteroides fragilis liver abscesses.
Topics: Adenocarcinoma; Bacteroides fragilis; Bacteroides Infections; Colonic Neoplasms; Diagnostic Imaging; | 1992 |
Refractory parastomal ulcers: a multidisciplinary approach.
Topics: Chronic Disease; Colonic Neoplasms; Enterostomy; Female; Humans; Inflammatory Bowel Diseases; Male; | 1990 |
Bile acids in experimental colorectal cancer.
Topics: Animals; Colonic Neoplasms; Deoxycholic Acid; Feces; Male; Metronidazole; Rats; Rats, Inbred Strains | 1986 |
The tropic effect of intrarectal deoxycholate on rat colorectum is unaffected by oral metronidazole.
Topics: Administration, Rectal; Animals; Cell Division; Colonic Neoplasms; Deoxycholic Acid; Male; Metronida | 1986 |
5-Fluorouracil-metronidazole combination therapy in metastatic colorectal cancer. Clinical, pharmacokinetic and in vitro cytotoxicity studies.
Topics: Adult; Aged; Antineoplastic Combined Chemotherapy Protocols; Cell Survival; Colonic Neoplasms; Femal | 1986 |
[Perioperative antibiotic prophylaxis. A comparative study of 244 patients with colonic diseases].
Topics: Anti-Bacterial Agents; Cefotaxime; Ceftriaxone; Colonic Diseases; Colonic Neoplasms; Female; Humans; | 1985 |
One row anastomosis in colonic operations with antibiotic prophylaxis.
Topics: Adolescent; Adult; Aged; Colon; Colonic Neoplasms; Diverticulitis, Colonic; Humans; Metronidazole; M | 1985 |
[Modern mechanical antibiotic preparation in colorectal operations. Results of a prospective study].
Topics: Anti-Bacterial Agents; Chloramphenicol; Colonic Neoplasms; Drug Administration Schedule; Drug Therap | 1985 |
Studies of human amebiasis. 3. Ameboma: a radiologic manifestation of amebic colitis.
Topics: Adolescent; Adult; Barium Sulfate; Biopsy; Cecal Diseases; Cecum; Colitis; Colon; Colonic Neoplasms; | 1973 |
Intestinal amebiasis. A roentgen analysis of 19 cases including 2 case reports.
Topics: Abscess; Aged; Cecal Diseases; Colitis, Ulcerative; Colonic Diseases; Colonic Neoplasms; Diagnosis, | 1974 |