meperidine has been researched along with Sensitivity and Specificity in 24 studies
Meperidine: A narcotic analgesic that can be used for the relief of most types of moderate to severe pain, including postoperative pain and the pain of labor. Prolonged use may lead to dependence of the morphine type; withdrawal symptoms appear more rapidly than with morphine and are of shorter duration.
pethidine : A piperidinecarboxylate ester that is piperidine which is substituted by a methyl group at position 1 and by phenyl and ethoxycarbonyl groups at position 4. It is an analgesic which is used for the treatment of moderate to severe pain, including postoperative pain and labour pain.
Sensitivity and Specificity: Binary classification measures to assess test results. Sensitivity or recall rate is the proportion of true positives. Specificity is the probability of correctly determining the absence of a condition. (From Last, Dictionary of Epidemiology, 2d ed)
| Excerpt | Relevance | Reference |
|---|---|---|
| "To determine the effectiveness and side effects of intravenous meperidine in labour pain relief." | 9.10 | Effectiveness of intravenous meperidine for pain relief in the first stage of labour. ( Komwilaisak, R; Somboonporn, W; Sookpanya, S; Soontrapa, S, 2002) |
| "Thirty patients presenting to the emergency department with abdominal pain were randomized to receive placebo or meperidine for the first two doses of medication." | 5.14 | The impact of analgesia on the diagnostic accuracy of the sonographic Murphy's sign. ( Liteplo, AS; Nelson, BP; Noble, VE; Thomas, SH, 2010) |
| "To determine the effectiveness and side effects of intravenous meperidine in labour pain relief." | 5.10 | Effectiveness of intravenous meperidine for pain relief in the first stage of labour. ( Komwilaisak, R; Somboonporn, W; Sookpanya, S; Soontrapa, S, 2002) |
| " Further studies should address the optimization of dosing and lock out setting." | 2.74 | Remifentanil vs. meperidine for patient-controlled analgesia during colonoscopy: a randomized double-blind trial. ( Agostoni, M; Alberto, TP; Antonio, F; Facciorusso, A; Fanti, L; Gambino, G; Gemma, M; Giorgio, T; Giulia, G; Guslandi, M; Marco, G; Mario, G; Massimo, A; Testoni, PA; Torri, G, 2009) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 1 (4.17) | 18.7374 |
| 1990's | 2 (8.33) | 18.2507 |
| 2000's | 18 (75.00) | 29.6817 |
| 2010's | 3 (12.50) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Dewitt, J | 1 |
| McGreevy, K | 1 |
| Sherman, S | 1 |
| Imperiale, TF | 1 |
| NARODICK, BG | 1 |
| STEELE, JD | 1 |
| Fanti, L | 1 |
| Agostoni, M | 1 |
| Massimo, A | 1 |
| Gemma, M | 1 |
| Marco, G | 1 |
| Gambino, G | 1 |
| Giulia, G | 1 |
| Facciorusso, A | 1 |
| Antonio, F | 1 |
| Guslandi, M | 1 |
| Mario, G | 1 |
| Torri, G | 1 |
| Giorgio, T | 1 |
| Testoni, PA | 1 |
| Alberto, TP | 1 |
| Noble, VE | 1 |
| Liteplo, AS | 1 |
| Nelson, BP | 1 |
| Thomas, SH | 1 |
| Wang, X | 2 |
| Xiang, Z | 1 |
| Cai, X | 1 |
| Wu, H | 1 |
| Li, J | 1 |
| Zhang, M | 1 |
| Abu-Shawish, HM | 1 |
| Dalou, AA | 1 |
| Ghalwa, NA | 1 |
| Khraish, GI | 1 |
| Hammad, J | 1 |
| Basheer, AH | 1 |
| Kolatat, T | 1 |
| Jarungphan, S | 1 |
| Charastong, C | 1 |
| Jundeewong, Y | 1 |
| Soontrapa, S | 1 |
| Somboonporn, W | 1 |
| Komwilaisak, R | 1 |
| Sookpanya, S | 1 |
| Lampinen, M | 1 |
| Bondesson, U | 1 |
| Fredriksson, E | 1 |
| Hedeland, M | 1 |
| Ishii, A | 3 |
| Tanaka, M | 1 |
| Kurihara, R | 2 |
| Watanabe-Suzuki, K | 2 |
| Kumazawa, T | 3 |
| Seno, H | 3 |
| Suzuki, O | 3 |
| Katsumata, Y | 2 |
| Lázaro, C | 1 |
| Caseras, X | 1 |
| Torrubia, R | 1 |
| Baños, JE | 1 |
| Kelm-Kahl, I | 1 |
| Stark, E | 1 |
| Steffens, J | 1 |
| Gourlay, GK | 1 |
| Yardeni, IZ | 1 |
| Melzer, E | 1 |
| Smolyarenko, V | 1 |
| Zeidel, A | 1 |
| Chervinsky, A | 1 |
| Binder, Y | 1 |
| Beilin, B | 1 |
| Moore, C | 1 |
| Rana, S | 1 |
| Coulter, C | 1 |
| Qadeer, MA | 1 |
| Vargo, JJ | 1 |
| Patel, S | 1 |
| Dumot, JA | 1 |
| Lopez, AR | 1 |
| Trolli, PA | 1 |
| Conwell, DL | 1 |
| Stevens, T | 1 |
| Zuccaro, G | 1 |
| Shalaby, A | 1 |
| El-Tohamy, M | 1 |
| El-Maamly, M | 1 |
| Aboul-Enein, HY | 1 |
| Nishikawa, M | 1 |
| Watanabe, K | 1 |
| Breindahl, T | 1 |
| Andreasen, K | 1 |
| Bower, AL | 1 |
| Ripepi, A | 1 |
| Dilger, J | 1 |
| Boparai, N | 1 |
| Brody, FJ | 1 |
| Ponsky, JL | 1 |
| Liu, ZH | 1 |
| Wen, ML | 1 |
| Yao, Y | 1 |
| Xiong, J | 1 |
| Svensson, JO | 1 |
| Säwe, J | 1 |
| AL-Shurbaji, A | 1 |
| Matsushima, H | 1 |
| Szkutnik, D | 1 |
| Dyderski, S | 1 |
| Majcher, K | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Safety and Efficacy Evaluation of Remimazolam for Endoscopic Ultrasound-guided Fine Needle Aspiration/Biopsy[NCT05437497] | 264 participants (Anticipated) | Interventional | 2021-08-01 | Recruiting | |||
| The Comparison of Two Different Techniques of Remifentanil Consumption During Implantable Vascular Access Device Procedures[NCT04749069] | 107 participants (Actual) | Interventional | 2012-08-01 | Completed | |||
| Bispectral Index Monitoring for Sedation in Elective Colonoscopies of Adult Patients: a Randomized Controlled Trial[NCT03453359] | 180 participants (Actual) | Interventional | 2018-01-28 | Completed | |||
| Bispectral Index Monitoring During Anesthesiologist - Directed Sedation in Scheduled Colonoscopies[NCT03461029] | 196 participants (Actual) | Observational [Patient Registry] | 2016-01-30 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
1 review available for meperidine and Sensitivity and Specificity
| Article | Year |
|---|---|
Advances in opioid pharmacology.
Topics: Analgesics, Opioid; Animals; Codeine; Dose-Response Relationship, Drug; Drug Administration Routes; | 2005 |
6 trials available for meperidine and Sensitivity and Specificity
| Article | Year |
|---|---|
Nurse-administered propofol sedation compared with midazolam and meperidine for EUS: a prospective, randomized trial.
Topics: Adult; Aged; Aged, 80 and over; Ambulatory Care; Anesthesia Recovery Period; Anesthetics, Intravenou | 2008 |
Remifentanil vs. meperidine for patient-controlled analgesia during colonoscopy: a randomized double-blind trial.
Topics: Adult; Aged; Analgesia, Patient-Controlled; Analysis of Variance; Anesthesia Recovery Period; Colono | 2009 |
The impact of analgesia on the diagnostic accuracy of the sonographic Murphy's sign.
Topics: Abdominal Pain; Analgesia; Cholecystitis; Confidence Intervals; Diagnosis, Differential; Diagnostic | 2010 |
Effectiveness of intravenous meperidine for pain relief in the first stage of labour.
Topics: Adult; Analgesia, Obstetrical; Analgesics, Opioid; Chi-Square Distribution; Double-Blind Method; Fem | 2002 |
Combining physostigmine with meperidine for sedation and analgesia during colonoscopy.
Topics: Adult; Aged; Ambulatory Care; Analgesia; Analysis of Variance; Colonoscopy; Colorectal Neoplasms; Co | 2005 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
17 other studies available for meperidine and Sensitivity and Specificity
| Article | Year |
|---|---|
The use of demerol in patients sensitive to morphine.
Topics: Humans; Meperidine; Morphine; Morphine Derivatives; Sensitivity and Specificity | 1948 |
Determination of pethidine in human plasma by LC-MS/MS.
Topics: Adult; Chemical Fractionation; Chromatography, Liquid; Drug Stability; Female; Humans; Infant; Linea | 2011 |
Determination of pethidine hydrochloride using potentiometric coated graphite and carbon paste electrodes.
Topics: Analgesics, Opioid; Animals; Carbon; Cattle; Electrodes; Graphite; Humans; Hydrogen-Ion Concentratio | 2013 |
Pulmonary function in infants exposed to pethidine.
Topics: Analgesics, Opioid; Apgar Score; Birth Weight; Case-Control Studies; Female; Gestational Age; Humans | 2002 |
Validation of a method for quantification of ketobemidone in human plasma with liquid chromatography-tandem mass spectrometry.
Topics: Analgesics, Opioid; Chromatography, High Pressure Liquid; Humans; Mass Spectrometry; Meperidine; Sen | 2003 |
Sensitive determination of pethidine in body fluids by gas chromatography-tandem mass spectrometry.
Topics: Analgesics, Opioid; Gas Chromatography-Mass Spectrometry; Humans; Meperidine; Reference Standards; R | 2003 |
[Measurement of postoperative pain: analysis of the sensitivity of various self-evaluation instruments].
Topics: Adult; Aged; Analgesics, Opioid; Anti-Inflammatory Agents, Non-Steroidal; Diclofenac; Female; Humans | 2003 |
[Guidelines of U.S. specialty societies on kidney stones: ureteroscopy and ESWL recommended as equivalent].
Topics: Algorithms; Analgesics, Opioid; Anti-Inflammatory Agents, Non-Steroidal; Colic; Cyclooxygenase Inhib | 2004 |
Determination of meperidine, tramadol and oxycodone in human oral fluid using solid phase extraction and gas chromatography-mass spectrometry.
Topics: Analgesics; Gas Chromatography-Mass Spectrometry; Humans; Meperidine; Oxycodone; Reproducibility of | 2007 |
Bispectral index monitoring of conscious sedation with the combination of meperidine and midazolam during endoscopy.
Topics: Adjuvants, Anesthesia; Aged; Ambulatory Care; Conscious Sedation; Deep Sedation; Drug Therapy, Combi | 2008 |
Potentiometric membrane sensor for the selective determination of pethidine in pharmaceutical preparations and biological fluids.
Topics: Electrodes; Equipment Design; Humans; Hydrogen-Ion Concentration; Meperidine; Pharmaceutical Prepara | 2007 |
Simple and sensitive detection of phencyclidine in body fluids by gas chromatography with surface ionization detection.
Topics: Body Fluids; Chromatography, Gas; Humans; Meperidine; Phencyclidine; Sensitivity and Specificity | 1996 |
Validation of urine drug-of-abuse testing methods for ketobemidone using thin-layer chromatography and liquid chromatography-electrospray mass spectrometry.
Topics: Analgesics, Opioid; Chromatography, Liquid; Chromatography, Thin Layer; Gas Chromatography-Mass Spec | 1999 |
Plastic membrane electrode for the potentiometric determination of pethidine hydrochloride in pharmaceutical preparations.
Topics: Calibration; Electrochemistry; Electrodes; Hydrogen-Ion Concentration; Injections; Ions; Membranes, | 2000 |
Determination of ketobemidone and its metabolites in plasma and urine using solid-phase extraction and liquid chromatography-mass spectrometry.
Topics: Analgesics, Opioid; Chromatography, Liquid; Humans; Meperidine; Quality Control; Sensitivity and Spe | 2001 |
Sensitive determination of pethidine in body fluids by surface ionization organic mass spectrometry.
Topics: Analgesics, Opioid; Body Fluids; Humans; Male; Mass Spectrometry; Meperidine; Reproducibility of Res | 2001 |
Determination of pethidine in rabbit plasma by capillary gas chromatography.
Topics: Analgesics, Opioid; Animals; Biological Availability; Calibration; Chromatography, Gas; Injections, | 2001 |