hydrogen carbonate has been researched along with Pancreatic Diseases in 105 studies
Bicarbonates: Inorganic salts that contain the -HCO3 radical. They are an important factor in determining the pH of the blood and the concentration of bicarbonate ions is regulated by the kidney. Levels in the blood are an index of the alkali reserve or buffering capacity.
hydrogencarbonate : The carbon oxoanion resulting from the removal of a proton from carbonic acid.
Pancreatic Diseases: Pathological processes of the PANCREAS.
| Excerpt | Relevance | Reference |
|---|---|---|
| "One-hour postprandial responses of plasma concentrations of pancreatic polypeptide, gastrin and motilin were measured in 4 dogs during 31 months of pancreatic atrophy development, produced by obstructing their pancreatic juice flow." | 7.66 | [Similarities and differences in the behavior of pancreatic polypeptide, gastrin, and motilin in dog blood plasma during the development of pancreatic atrophy]. ( Kuznetsov, VL; Trék, NS; Troitskaia, VB, 1980) |
| "One-hour postprandial responses of plasma concentrations of pancreatic polypeptide, gastrin and motilin were measured in 4 dogs during 31 months of pancreatic atrophy development, produced by obstructing their pancreatic juice flow." | 3.66 | [Similarities and differences in the behavior of pancreatic polypeptide, gastrin, and motilin in dog blood plasma during the development of pancreatic atrophy]. ( Kuznetsov, VL; Trék, NS; Troitskaia, VB, 1980) |
| "To evaluate the effect of parenteral and enteral nutrition combined with octreotide on pancreatic exocrine secretion of the patients with pancreatic fistula." | 1.32 | Effect of parenteral and enteral nutrition combined with octreotide on pancreatic exocrine secretion of patients with pancreatic fistula. ( Fan, YB; Qin, HL; Su, ZD; Zou, Y, 2004) |
| "In patients with chronic renal failure even without clinical signs of pancreatic, laboratory findings of exocrine pancreatic abnormalities are reported." | 1.29 | [Exocrine pancreatic function and gastric mucosa and duodenal mucosa in patients with chronic kidney failure]. ( Cecerko, E; Kemona, A; Mazerska, M; Małyszko, J; Raimer, M; Romatowski, J; Sosnowski, S, 1996) |
| "Forty-five patients (17 with pancreatic cancer, 6 pancreatitis, 5 other malignancies, and 17 nonmalignant, nonpancreatic disease found at laparotomy) were studied with a method of duodenal intubation and perfusion with basal saline perfusion alone or with continuous intravenous infusion of secretin or of cholecystokinin-pancreozymin." | 1.26 | The relationships between pancreatic ductal obstruction and pancreatic secretion in man. ( DiMagno, EP; Go, VL; Malagelada, JR, 1979) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 94 (89.52) | 18.7374 |
| 1990's | 3 (2.86) | 18.2507 |
| 2000's | 7 (6.67) | 29.6817 |
| 2010's | 1 (0.95) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Moolsintong, P | 1 |
| Burton, FR | 1 |
| Ishiguro, H | 1 |
| Yamamoto, A | 1 |
| Nakakuki, M | 1 |
| Yi, L | 1 |
| Ishiguro, M | 1 |
| Yamaguchi, M | 1 |
| Kondo, S | 1 |
| Mochimaru, Y | 1 |
| Satoh, H | 1 |
| Moriyama, N | 1 |
| Hara, C | 1 |
| Yamada, H | 1 |
| Horita, S | 1 |
| Kunimi, M | 1 |
| Tsukamoto, K | 1 |
| Iso-O, N | 1 |
| Inatomi, J | 1 |
| Kawakami, H | 1 |
| Kudo, A | 1 |
| Endou, H | 1 |
| Igarashi, T | 1 |
| Goto, A | 1 |
| Fujita, T | 1 |
| Seki, G | 1 |
| Lee, JH | 1 |
| Choi, JH | 1 |
| Namkung, W | 1 |
| Hanrahan, JW | 1 |
| Chang, J | 1 |
| Song, SY | 1 |
| Park, SW | 1 |
| Kim, DS | 1 |
| Yoon, JH | 1 |
| Suh, Y | 1 |
| Jang, IJ | 1 |
| Nam, JH | 1 |
| Kim, SJ | 1 |
| Cho, MO | 1 |
| Lee, JE | 1 |
| Kim, KH | 1 |
| Lee, MG | 1 |
| BURTON, P | 1 |
| EVANS, DG | 1 |
| HARPER, AA | 1 |
| HOWATH, T | 1 |
| OLEESKY, S | 1 |
| SCOTT, JE | 1 |
| VARLEY, H | 1 |
| Qin, HL | 1 |
| Su, ZD | 1 |
| Zou, Y | 1 |
| Fan, YB | 1 |
| Keller, J | 1 |
| Layer, P | 1 |
| Stevens, T | 1 |
| Conwell, DL | 1 |
| Zuccaro, G | 1 |
| Lewis, SA | 1 |
| Love, TE | 1 |
| Lagerlöf, HO | 1 |
| Schütz, HB | 1 |
| Holmer, S | 1 |
| Wagner, E | 1 |
| Choi, HJ | 1 |
| Goldstein, F | 1 |
| Wirts, CW | 1 |
| Menduke, H | 1 |
| Troitskaia, VB | 3 |
| Kuznetsov, VL | 2 |
| Trék, NS | 2 |
| Lankisch, PG | 2 |
| Gregg, JA | 1 |
| Fox, JN | 1 |
| Mosley, JG | 1 |
| Vogler, GA | 1 |
| Austin, JL | 1 |
| Reber, HA | 2 |
| Lohse, J | 1 |
| Vérnie, HJ | 1 |
| Sarles, H | 3 |
| Lukes, PJ | 1 |
| Rolny, P | 1 |
| Nilson, AE | 1 |
| Gamklou, R | 1 |
| Moore, EW | 1 |
| Verine, HJ | 1 |
| Capitaine, Y | 1 |
| Voirol, M | 1 |
| Lapp, R | 1 |
| Mach, JP | 1 |
| Loizeau, E | 1 |
| Wettstein, M | 1 |
| Häussinger, D | 1 |
| Sosnowski, S | 1 |
| Mazerska, M | 1 |
| Raimer, M | 1 |
| Romatowski, J | 1 |
| Kemona, A | 1 |
| Cecerko, E | 1 |
| Małyszko, J | 1 |
| Cappeliez, O | 1 |
| Delhaye, M | 1 |
| Devière, J | 1 |
| Le Moine, O | 1 |
| Metens, T | 1 |
| Nicaise, N | 1 |
| Cremer, M | 1 |
| Stryuven, J | 1 |
| Matos, C | 1 |
| Arvanitakis, C | 1 |
| Cooke, AR | 1 |
| Dressler, J | 1 |
| Hör, G | 1 |
| Buttermann, G | 1 |
| Pabst, HW | 1 |
| Saunders, JH | 1 |
| Wormsley, KG | 7 |
| Gowenlock, AH | 1 |
| Dreiling, DA | 2 |
| Messer, J | 1 |
| Roberts, C | 1 |
| Ponder, DM | 1 |
| Warey, UA | 1 |
| DiMagno, EP | 2 |
| Malagelada, JR | 2 |
| Go, VL | 2 |
| Funakoshi, A | 1 |
| Tsubota, Y | 1 |
| Wakasugi, H | 1 |
| Ibayashi, H | 1 |
| Takagi, Y | 1 |
| McColl, KE | 1 |
| Brodie, MJ | 1 |
| Whitesmith, R | 1 |
| Gray, KF | 1 |
| Thomson, TJ | 1 |
| Peña Yañez, A | 1 |
| Salmerón Mora, FJ | 1 |
| Mora Lara, J | 1 |
| Aguilar Martínez, JL | 1 |
| Rico Irles, J | 1 |
| Regan, PT | 1 |
| Bourry, J | 1 |
| Cooper, MJ | 1 |
| Moossa, DE | 1 |
| Cockerham, L | 1 |
| Hall, TJ | 1 |
| Levin, B | 1 |
| Moossa, AR | 1 |
| Kaboth, U | 1 |
| Koop, H | 1 |
| Gyr, NE | 1 |
| Lenti, G | 1 |
| Emanuelli, G | 1 |
| Bordalo, O | 2 |
| Noronha, M | 1 |
| Lamy, J | 1 |
| Dreiling, D | 1 |
| Kakizaki, G | 5 |
| Saito, T | 4 |
| Soeno, T | 3 |
| Sasahara, M | 3 |
| Fujiwara, Y | 4 |
| Saito, Y | 1 |
| Noto, N | 3 |
| Tuzhilin, SA | 1 |
| Takebe, T | 1 |
| Koizumi, H | 1 |
| Yamagata, S | 1 |
| Pieroni, PL | 1 |
| Rudick, J | 1 |
| Adler, M | 1 |
| Nacchiero, M | 1 |
| Rybak, BJ | 1 |
| Von Der Lippe, G | 1 |
| Andersen, KJ | 1 |
| Schjönsby, H | 1 |
| Säteri, H | 1 |
| Cotton, PB | 1 |
| Ponder, BA | 1 |
| Beales, JS | 2 |
| Croft, DN | 1 |
| Suda, Y | 1 |
| Shiraso, M | 1 |
| Sato, T | 1 |
| Beck, IT | 1 |
| Scuro, LA | 1 |
| Cavallini, G | 1 |
| Benini, L | 1 |
| Brocco, G | 1 |
| Bovo, P | 1 |
| Riela, A | 1 |
| Togni, M | 1 |
| Cataudella, G | 1 |
| Bassi, C | 1 |
| Pederzoli, P | 1 |
| Dunger, DB | 1 |
| Burns, C | 1 |
| Ghale, GK | 1 |
| Muller, DP | 1 |
| Spitz, L | 1 |
| Grant, DB | 1 |
| Boyd, EJ | 1 |
| Panin, AI | 1 |
| Kaiser, D | 1 |
| Drack, E | 1 |
| Clain, J | 1 |
| Bank, S | 1 |
| Barbezat, GO | 1 |
| Novis, BH | 1 |
| Marks, IN | 1 |
| Friĕ, P | 1 |
| Bernstein, L | 1 |
| Herbert, V | 1 |
| Postolov, PM | 1 |
| Fetisov, VA | 1 |
| Raptis, S | 2 |
| Dollinger, H | 1 |
| Rothenbuchner, G | 1 |
| Fussgänger, R | 1 |
| Klör, U | 1 |
| Pfeiffer, EF | 2 |
| Takasaki, T | 1 |
| Kozu, T | 1 |
| Nogami, I | 1 |
| Kadowaki, J | 1 |
| Amaba, T | 1 |
| Oizumi, T | 2 |
| O'Brien, TK | 1 |
| Tijtgat, G | 1 |
| Ensinck, JW | 1 |
| Grivaux, M | 1 |
| Soulié, J | 1 |
| Diallo, A | 1 |
| Renard, C | 1 |
| Chevalley, J | 1 |
| Tiscornia, O | 1 |
| Palasciano, G | 1 |
| Brasca, A | 1 |
| Hage, G | 1 |
| Devaux, MA | 1 |
| Gullo, L | 1 |
| Simon, M | 1 |
| Gosselin, M | 1 |
| Kerbaol, M | 1 |
| Delanoe, G | 1 |
| Trebaul, L | 1 |
| Bourel, M | 1 |
| Nundy, S | 1 |
| Shirley, D | 1 |
| O'Higgins, N | 1 |
| Heaf, R | 1 |
| Pearse, EE | 1 |
| Lavender, JP | 1 |
| Baron, JH | 1 |
| Seiffert, UB | 1 |
| Roth, WD | 1 |
| Tympner, F | 1 |
| Domschke, W | 2 |
| Koch, H | 1 |
| Demling, L | 2 |
| Nozoe, T | 1 |
| Yamazaki, M | 1 |
| Iber, FL | 1 |
| Littman, A | 1 |
| Hanscom, DH | 1 |
| Rick, W | 2 |
| Diwok, K | 1 |
| Jacobs, WH | 1 |
| Chaudhuri, T | 1 |
| Pickering, LI | 1 |
| Thomas, E | 1 |
| Hackett, E | 1 |
| O'Halloran, MW | 1 |
| Hislop, IG | 1 |
| Grant, AK | 1 |
| Filippini, L | 1 |
| Löffler, A | 1 |
| Mott, CB | 1 |
| Neves, DP | 1 |
| Okumura, M | 1 |
| De Brito, T | 1 |
| Bettarello, A | 1 |
| Moeller, DD | 1 |
| Dunn, GD | 1 |
| Klotz, AP | 1 |
| Goebell, H | 1 |
| Ammann, R | 1 |
| Kapp, F | 1 |
| Schmidt, H | 1 |
| Bergner, D | 1 |
| Classen, M | 1 |
| Vagne, M | 2 |
| Descos, L | 2 |
| Trepo, C | 1 |
| Aulagnier, MJ | 1 |
| Desvignes, C | 1 |
| Van der Hoeden, R | 1 |
| Delcourt, A | 1 |
| Algoet, P | 1 |
| Johnson, RB | 1 |
| Sabol, J | 1 |
| McCance, DM | 1 |
| Sode, J | 1 |
| Lukash, WM | 1 |
| Dubarry, JJ | 1 |
| Quinton, A | 1 |
| Tamarelle, C | 1 |
| Leclerc, P | 1 |
| Bancons, J | 1 |
| Hansky, J | 2 |
| Petersen, H | 3 |
| Bartos, V | 1 |
| Melichar, J | 1 |
| Erben, J | 1 |
| Nimmo, J | 1 |
| Finlayson, ND | 1 |
| Smith, AF | 1 |
| Shearman, DJ | 1 |
| Muller, L | 1 |
| Wisniewski, ZS | 1 |
| Rau, RM | 1 |
| Schröder, KE | 1 |
| Hartmann, W | 1 |
| Faulhaber, JD | 1 |
| Clodi, PH | 1 |
| Pascal, JP | 1 |
| Sannou, N | 1 |
| Ribet, A | 1 |
| Hadorn, B | 1 |
| Zoppi, G | 1 |
| Shmerling, DH | 1 |
| Prader, A | 1 |
| McIntyre, I | 1 |
| Anderson, CM | 1 |
| LeBauer, E | 1 |
| Smith, K | 1 |
| Greenberger, NJ | 1 |
| Gülzow, M | 1 |
| Teichmann, W | 1 |
| Arendt, R | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| A 3-part, Phase 1a/1b, First-in-human, Randomized, Double-blind, Placebo-controlled Study to Evaluate Safety, Tolerability, and Pharmacokinetics of Single and Multiple Ascending Doses of Oral CDX-7108 in Healthy Adult Subjects and to Evaluate Proof-of-con[NCT05082051] | Phase 1 | 54 participants (Actual) | Interventional | 2021-10-11 | Completed | ||
| Pancreatic Enzyme Replacement Therapy (PERT) for Treatment of Exocrine Pancreatic Insufficiency in Patients With Unresectable Pancreatic Cancer[NCT02985801] | Phase 1/Phase 2 | 16 participants (Actual) | Interventional | 2016-12-31 | Terminated (stopped due to Study was terminated due to difficulty in recruiting subjects.) | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
14 reviews available for hydrogen carbonate and Pancreatic Diseases
| Article | Year |
|---|---|
Physiology and pathophysiology of bicarbonate secretion by pancreatic duct epithelium.
Topics: Animals; Bicarbonates; Biological Transport, Active; Cystic Fibrosis; Cystic Fibrosis Transmembrane | 2012 |
Human pancreatic exocrine response to nutrients in health and disease.
Topics: Aging; Bicarbonates; Bile Acids and Salts; Diabetes Mellitus; Diet; Dietary Carbohydrates; Dietary P | 2005 |
Tubeless pancreatic function tests.
Topics: 4-Aminobenzoic Acid; Amylases; Bicarbonates; Chymotrypsin; Feces; Fluoresceins; Humans; Isoamylase; | 1981 |
Diagnostic tests of exocrine pancreatic function and disease.
Topics: 4-Aminobenzoic Acid; Amino Acids, Essential; Bicarbonates; Body Fluids; Cholecystokinin; Chymotrypsi | 1978 |
Pancreatic extracts in the treatment of pancreatic exocrine insufficiency.
Topics: Amylases; Antacids; Bicarbonates; Bile Acids and Salts; Calcium; Celiac Disease; Digestion; Duodenum | 1975 |
Tests of exocrine pancreatic function.
Topics: Amylases; Bicarbonates; Biliary Tract Diseases; Carbohydrate Metabolism; Child; Cholecystokinin; Chy | 1977 |
The pancreas: pancreatic exocrine physiology.
Topics: Animals; Bicarbonates; Chemoreceptor Cells; Cholecystokinin; Digestion; Food; Gastrins; Humans; Inte | 1977 |
The secretin story: a saga in clinical medicine and gastrointestinal physiology.
Topics: Amylases; Animals; Bicarbonates; Cholestasis; Digestive System Physiological Phenomena; Gastrointest | 1978 |
Tests of exocrine pancreatic function.
Topics: Adolescent; Adult; Aminobenzoates; Amylases; Animals; Bicarbonates; Catalase; Cholecystokinin; Chymo | 1975 |
Laboratory tests in the diagnosis of the chronic pancreatic diseases. Part 1. Secretagogues used in tests of pancreatic secretion.
Topics: Bicarbonates; Humans; Hydrolases; Pancreas; Pancreatic Diseases; Peptides | 1987 |
The role of pancreatic exocrine secretions in the absorption of vitamin B 12 and iron.
Topics: Animals; Bicarbonates; Binding Sites; Cations, Divalent; Dogs; Drug Synergism; Humans; Hydrogen-Ion | 1973 |
[The effect of vagotomy on the structure and function of the pancreas (review of the literature)].
Topics: Animals; Bicarbonates; Cholecystokinin; Dogs; Glucose; Humans; Insulin; Insulin Secretion; Islets of | 1972 |
Current concepts: pancreatic extracts.
Topics: Adolescent; Adult; Animals; Bicarbonates; Cattle; Celiac Disease; Child; Cystic Fibrosis; Dietary Fa | 1969 |
[Gastrointestinal hormones and their clinical significance].
Topics: Acetamides; Acetylcholine; Amino Acids; Animals; Antibodies; Bicarbonates; Chemistry Techniques, Ana | 1970 |
1 trial available for hydrogen carbonate and Pancreatic Diseases
| Article | Year |
|---|---|
Cimetidine as an adjunct to oral enzymes in the treatment of malabsorption due to pancreatic insufficiency.
Topics: Bicarbonates; Cimetidine; Drug Therapy, Combination; Guanidines; Humans; Malabsorption Syndromes; Pa | 1978 |
90 other studies available for hydrogen carbonate and Pancreatic Diseases
| Article | Year |
|---|---|
Pancreatic function testing is best determined by the extended endoscopic collection technique.
Topics: Abdominal Pain; Adolescent; Adult; Aged; Aged, 80 and over; Bicarbonates; Diagnostic Errors; Duodeno | 2008 |
Localization of Na+-HCO-3 cotransporter (NBC-1) variants in rat and human pancreas.
Topics: Animals; Bicarbonates; Blotting, Western; Cell Membrane; Cells, Cultured; Epithelial Cells; Humans; | 2003 |
A haplotype-based molecular analysis of CFTR mutations associated with respiratory and pancreatic diseases.
Topics: Alleles; Animals; Bicarbonates; Bronchiectasis; Case-Control Studies; Chloride Channels; Chlorides; | 2003 |
A test of pancreatic function in man based on the analysis of duodenal contents after administration of secretin and pancreozymin.
Topics: Amylases; Bicarbonates; Biological Assay; Cholecystokinin; Gastrointestinal Hormones; Humans; Lipase | 1960 |
Effect of parenteral and enteral nutrition combined with octreotide on pancreatic exocrine secretion of patients with pancreatic fistula.
Topics: Adult; Aged; Amylases; Bicarbonates; Chlorides; Combined Modality Therapy; Enteral Nutrition; Female | 2004 |
The efficiency of endoscopic pancreatic function testing is optimized using duodenal aspirates at 30 and 45 minutes after intravenous secretin.
Topics: Abdominal Pain; Adolescent; Adult; Aged; Aged, 80 and over; Bicarbonates; Cross-Sectional Studies; D | 2007 |
A secretin test with high doses of secretin and correction for incomplete recovery of duodenal juice.
Topics: Adult; Aged; Amylases; Bicarbonates; Body Fluids; Clinical Enzyme Tests; Duodenum; Female; Gastric J | 1967 |
[Pancreas secretion following stomach resection of type B II].
Topics: Amylases; Bicarbonates; Carboxypeptidases; Chymotrypsin; Gastrectomy; Humans; Lipase; Pancreas; Panc | 1967 |
Normal duodenal trypsin values in response to secretin-pancreozymin stimulation with preliminary data in patients with pancreatic disease.
Topics: Adult; Aged; Amylases; Bicarbonates; Cholecystokinin; Duodenum; Female; Humans; Lipase; Male; Middle | 1967 |
[Similarities and differences in the behavior of pancreatic polypeptide, gastrin, and motilin in dog blood plasma during the development of pancreatic atrophy].
Topics: Amylases; Animals; Atrophy; Bicarbonates; Dogs; Gastrins; Gastrointestinal Hormones; Motilin; Pancre | 1980 |
The intraductal secretin test: an adjunct to ERCP.
Topics: Bicarbonates; Cholangiopancreatography, Endoscopic Retrograde; Cholecystokinin; Diagnosis, Different | 1982 |
Pancreatic function in domestic cats with pancreatic fluke infection.
Topics: Animals; Bicarbonates; Cat Diseases; Cats; Pancreas; Pancreatic Diseases; Pancreatic Juice; Trematod | 1981 |
Studies on pancreatic stones. I. In vitro dissolution.
Topics: Albumins; Bicarbonates; Calculi; Citrates; Humans; In Vitro Techniques; Pancreatic Diseases; Sodium | 1981 |
Hypotonic duodenography and secretin-CCK test in the diagnosis of pancreatic disease.
Topics: Adult; Aged; Bicarbonates; Cholecystokinin; Duodenum; Female; Humans; Male; Middle Aged; Pancreatic | 1981 |
Pancreatic calcification: formation constants of CaHCO3+ and CaC03(0) complexes determined with Ca2+ electrode.
Topics: Bicarbonates; Calcinosis; Calcium; Calcium Carbonate; Chemical Phenomena; Chemistry; Dialysis; Elect | 1981 |
[Opposite variations of carcinoembryogenic antigen and bicarbonates in human duodenal contents (author's transl)].
Topics: Bicarbonates; Carcinoembryonic Antigen; Duodenum; Humans; Intestinal Secretions; Pancreatic Diseases | 1980 |
Secretin-induced plasma bicarbonate decrease as a simple indicator of exocrine pancreatic function.
Topics: Acid-Base Equilibrium; Amylases; Bicarbonates; Ceruletide; Chymotrypsin; Female; Humans; Kinetics; L | 1996 |
[Exocrine pancreatic function and gastric mucosa and duodenal mucosa in patients with chronic kidney failure].
Topics: Adult; Amylases; Bicarbonates; Duodenitis; Female; Gastric Acid; Gastric Mucosa; Gastritis; Humans; | 1996 |
Chronic pancreatitis: evaluation of pancreatic exocrine function with MR pancreatography after secretin stimulation.
Topics: Adolescent; Adult; Aged; Analysis of Variance; Bicarbonates; Child; Chronic Disease; Duodenum; Femal | 2000 |
[Diagnosis of pancreatic function by the selenomethionine--75Se test].
Topics: Amylases; Bicarbonates; Blood; Cholecystokinin; Diagnostic Errors; Duodenum; Humans; Hydrogen-Ion Co | 1975 |
Effects of partial duct obstruction on pancreatic function in cats.
Topics: Animals; Bicarbonates; Cats; Pancreas; Pancreatic Diseases; Pancreatic Ducts; Proteins | 1978 |
The relationships between pancreatic ductal obstruction and pancreatic secretion in man.
Topics: Adult; Bicarbonates; Humans; Lipase; Pancreas; Pancreatic Diseases; Pancreatic Ducts; Pancreatic Neo | 1979 |
Clinical studies on human pancreatic deoxyribonuclease I.
Topics: Amylases; Bicarbonates; Chronic Disease; Deoxyribonucleases; Duodenum; Humans; Pancreas; Pancreatic | 1979 |
[Pancreatic atrophy: its effect on the plasma concentration of pancreatic polpeptide, gastrin and motilin in dogs].
Topics: Amylases; Animals; Atrophy; Bicarbonates; Dogs; Fasting; Gastrins; Gastrointestinal Hormones; Motili | 1979 |
Parotid salivary gland function in patients with exocrine pancreatic insufficiency.
Topics: Bicarbonates; Chronic Disease; Humans; Pancreatic Diseases; Pancreatic Function Tests; Pancreatic Ju | 1979 |
[Test of secretin-pancreozymin in healthy nonalcohol-consumer patients].
Topics: Adult; Aged; Bicarbonates; Cholecystokinin; Duodenum; Female; Humans; Male; Middle Aged; Pancreas; P | 1977 |
Secretory pattern and pathological study of the pancreas of steroid-treated rats.
Topics: Animals; Bicarbonates; Male; Oleic Acids; Pancreas; Pancreatic Diseases; Pancreatic Juice; Prednisol | 1978 |
Tests of pancreatic secretion.
Topics: Amino Acids; Bicarbonates; Clinical Enzyme Tests; Diagnosis, Differential; Humans; Methods; Pancreas | 1978 |
The place of duodenal drainage studies in the diagnosis of pancreatic disease.
Topics: Bicarbonates; Carcinoembryonic Antigen; Cholelithiasis; Chronic Disease; Drainage; Duodenum; Humans; | 1978 |
[Involvement of the exocrine pancreas in Wilson's disease? (author's transl)].
Topics: Adolescent; Adult; Amylases; Bicarbonates; Child; Cholecystokinin; Female; Hepatolenticular Degenera | 1978 |
[Clinical Significance of Different Tests for the Diagnosis of Chronic Diseases of the Pancreas].
Topics: Acute Disease; Amylases; Bicarbonates; Cholecystokinin; Chronic Disease; Humans; Isoamylase; Monoacy | 1976 |
[Standard and Augmented Secretin Tests in Chronic Pancreatitis].
Topics: Alcoholism; Bicarbonates; Chronic Disease; Dose-Response Relationship, Drug; Ethanol; Humans; Intest | 1976 |
Parotid saliva tests in patients with pancreatic diseases before and after surgery.
Topics: Adenocarcinoma; Adult; Amylases; Bicarbonates; Bile Duct Neoplasms; Calculi; Child, Preschool; Duode | 1977 |
A new pattern of pancreatic secretion (PBS) observed in pancreatic edema.
Topics: Amylases; Animals; Bicarbonates; Diuretics; Dogs; Edema; Epinephrine; Humans; Hydrochloric Acid; Pan | 1977 |
A new diagnostic test for pancreatic disorders by examination of parotid saliva.
Topics: Amylases; Bicarbonates; Cholecystokinin; Clinical Enzyme Tests; Humans; Methods; Pancreatic Diseases | 1976 |
Continuous secretin infusion with pancreozymin pretreatment as a pancreatic function test.
Topics: Amylases; Bicarbonates; Cholecystokinin; Female; Humans; Male; Methods; Pancreas; Pancreatic Disease | 1976 |
Effect of irradiation on the canine exocrine pancreas.
Topics: Animals; Bicarbonates; Cholecystokinin; Disease Models, Animal; Dogs; Female; Male; Pancreas; Pancre | 1976 |
Intestinal absorption of vitamin B12 in patients with chronic pancreatic insufficiency and the effect of human duodenal juice on the intestinal uptake of vitamin B12.
Topics: Adolescent; Adult; Aged; Animals; Bicarbonates; Chronic Disease; Duodenum; Female; Guinea Pigs; Hot | 1976 |
Investigations on the exocrine pancreatic function in dogs suffering from chronic exocrine pancreatic insufficiency.
Topics: Alanine Transaminase; Amylases; Animals; Atrophy; Bicarbonates; Blood Glucose; Cholecystokinin; Chro | 1975 |
Proceedings: Pancreatic diagnosis: Comparison of endoscopic pancreatography (ERCP), isotope scanning, and secretin tests in 62 patients.
Topics: Bicarbonates; Endoscopy; Humans; Pancreas; Pancreatic Diseases; Radiography; Radionuclide Imaging; S | 1975 |
Exocrine pancreatic function after upper abdominal surgery.
Topics: Adult; Amylases; Bicarbonates; Biliary Tract Diseases; Cholecystokinin; Duodenum; Female; Gastrectom | 1975 |
Diagnosis of chronic pancreatic disease.
Topics: Amylases; Bicarbonates; Biological Transport; Chronic Disease; Dietary Carbohydrates; Dietary Fats; | 1976 |
Pancreatic calcifications in patients with chronic pancreatitis. A sign of long-lasting or severe disease?
Topics: Adolescent; Adult; Aged; Bicarbonates; Calcinosis; Chronic Disease; Female; Humans; Lipase; Male; Mi | 1990 |
Pancreatic exocrine and endocrine function after subtotal pancreatectomy for nesidioblastosis.
Topics: Amylases; Bicarbonates; Blood Glucose; C-Peptide; Child, Preschool; Humans; Infant; Insulin; Islets | 1988 |
[Nature of correlations among biochemical ingredients of pancreatic juice during digestion in the dog].
Topics: alpha-Amylases; Animals; Atrophy; Bicarbonates; Diet; Digestion; Dogs; Meat; Pancreatic Diseases; Pa | 1985 |
Diminished excretion of bicarbonate from the single sweat gland of patients with cystic fibrosis of the pancreas.
Topics: Adult; Bicarbonates; Biological Transport; Body Water; Cell Membrane Permeability; Child; Child, Pre | 1974 |
A comparison between secretin alone and sequential and simultaneous secretin and cholecystokinin administration in the assessment of pancreatic function.
Topics: Bicarbonates; Cholecystokinin; Humans; Pancreas; Pancreatic Diseases; Secretin | 1974 |
[Experiences in the biochemical diagnosis of the pancreatic diseases].
Topics: Amylases; Bicarbonates; Bile Pigments; Blood Glucose; Blood Protein Electrophoresis; Chymotrypsin; D | 1974 |
Effect of acetazolamide on the insulin response to intravenous administration of secretin.
Topics: Acetazolamide; Antigens; Bicarbonates; Blood Glucose; Chronic Disease; Drug Synergism; Duodenum; Fat | 1974 |
[Criteria of pancreozymin-secretin test].
Topics: Amylases; Bicarbonates; Cholecystokinin; Humans; Pancreatic Diseases; Pancreatic Juice; Pancreatitis | 1972 |
[Examination of the parotid saliva for the diagnosis of pancreatic diseases].
Topics: Adult; Amylases; Bicarbonates; Female; Humans; Male; Methods; Middle Aged; Pancreatic Diseases; Paro | 1972 |
Alimentary hypoglycemia associated with the Zollinger-Ellison syndrome.
Topics: Adult; Bicarbonates; Biopsy; Blood Glucose; Duodenum; Female; Humans; Hyperparathyroidism; Hypoglyce | 1973 |
[Therapeutic hyperosmolarity].
Topics: Adult; Bicarbonates; Blood Transfusion; Brain Diseases; Chemical and Drug Induced Liver Injury; Diaz | 1973 |
Laboratory diagnostic test for pancreatic disorders by examination of parotid saliva.
Topics: Adult; Amylases; Bicarbonates; Female; Humans; Male; Middle Aged; Pancreatic Diseases; Parotid Gland | 1973 |
Effects of chronic intragastric ethanol administration on canine exocrine pancreatic secretion.
Topics: Alcoholism; Animals; Bicarbonates; Calculi; Cholecystokinin; Depression, Chemical; Dogs; Drug Synerg | 1973 |
Functional study of exocrine pancreas in idiopathic hemochromatosis, untreated and treated by venesections.
Topics: Adult; Aged; Bicarbonates; Bloodletting; Cholecystokinin; Duodenum; Female; Hemochromatosis; Humans; | 1973 |
Simultaneous combined pancreatic test.
Topics: Acute Disease; Bicarbonates; Chronic Disease; Diagnosis, Differential; Drainage; Duodenum; Humans; I | 1974 |
[Pancreas function test in combined continuous stimulation using secretin and pancreozymin].
Topics: Amylases; Bicarbonates; Cholecystokinin; Humans; Lipase; Pancreas; Pancreatic Diseases; Pancreatic J | 1974 |
[Secretin-pancreozymin test (author's transl)].
Topics: Adolescent; Adult; Amylases; Bicarbonates; Cholecystokinin; Chronic Disease; Chymotrypsin; Clinical | 1974 |
[Studies of parotid saliva test as a diagnostic means for pancreatic disorders].
Topics: Adult; Aged; Amylases; Bicarbonates; Female; Humans; Male; Middle Aged; Pancreatic Diseases; Parotid | 1974 |
Topics in clinical medicine: treatment of pancreatic insufficiency.
Topics: Anti-Bacterial Agents; Bicarbonates; Body Weight; Diabetes Complications; Diet Therapy; Dietary Fats | 1968 |
[The secretin-pancreozymin test in the diagnosis of pancreatic insufficiency].
Topics: Adult; Bicarbonates; Cholecystokinin; Endopeptidases; Female; Humans; Lipase; Male; Middle Aged; Pan | 1970 |
Present status of the secretin test.
Topics: Bicarbonates; Humans; Methods; Pancreas; Pancreatic Diseases; Secretin | 1972 |
An evaluation of the secretin test in chronic pancreatic disease.
Topics: Bicarbonates; Chronic Disease; Cytodiagnosis; Duodenum; Evaluation Studies as Topic; Humans; Hydroge | 1972 |
[Exocrine pancreatic function in chronic alcoholism].
Topics: Adult; Aged; Alcoholism; Amylases; Bicarbonates; Cholecystokinin; Duodenum; Female; Humans; Intestin | 1972 |
Histologic and functional alterations of human exocrine pancreas in Manson's schistosomiasis.
Topics: Adolescent; Adult; Amylases; Bicarbonates; Female; Humans; Hypertension, Portal; Male; Middle Aged; | 1972 |
Comparison of the pancreozymin-secretin test and the Lundh test meal.
Topics: Acute Disease; Adult; Aged; Bicarbonates; Cholecystokinin; Chronic Disease; Chymotrypsin; Female; Fo | 1972 |
[Functional diagnostics of the exocrine pancreas].
Topics: Amylases; Bicarbonates; Chymotrypsin; Humans; Lipase; Pancreatic Diseases; Pancreatic Juice; Secreti | 1972 |
[Hydrobicarbonated pancreatic secretion after secretin administration by rapid injection and continuous perfusion in man].
Topics: Bicarbonates; Duodenum; Female; Humans; Intestinal Secretions; Male; Pancreas; Pancreatic Diseases; | 1971 |
[The secretin-pancreozymin test: search for a significant parameter].
Topics: Adult; Aged; Bicarbonates; Biliary Tract Diseases; Cholecystokinin; Female; Humans; Male; Methods; M | 1971 |
Effect of exogenous secretin on serum insulin levels in patients with pancreatic disease.
Topics: Bicarbonates; Blood Glucose; Diabetes Mellitus; Diagnosis, Differential; Humans; Insulin; Insulin Se | 1971 |
[Pancreatic intubation under secretin and pancreozymin. Apropos of 56 cases].
Topics: Bicarbonates; Cholecystokinin; Diagnosis, Differential; Humans; Hydrogen-Ion Concentration; Intubati | 1971 |
Pancreatic function tests: comparison of standard and augmented secretin.
Topics: Bicarbonates; Chronic Disease; Diagnostic Errors; Humans; Methods; Pancreatic Diseases; Secretin | 1971 |
The duodenal aspirate following secretin stimulation. A variance study in man.
Topics: Adolescent; Adult; Aged; Analysis of Variance; Bicarbonates; Duodenum; Female; Humans; Injections, I | 1969 |
The response to infusion of a combination of secretin and pancreozymin in health and disease.
Topics: Adult; Bicarbonates; Bile Pigments; Chlorides; Cholecystokinin; Duodenal Ulcer; Humans; Male; Middle | 1969 |
The function of the exocrine pancreas in chronic renal disease.
Topics: Amylases; Bicarbonates; Cholecystokinin; Chronic Disease; Humans; Injections, Intravenous; Kidney Di | 1970 |
Pancreatic extracts.
Topics: Adult; Aged; Bicarbonates; Bile Acids and Salts; Cystic Fibrosis; Humans; Infant; Lipase; Malabsorpt | 1970 |
The production of calcium and magnesium during pancreatic function tests in health and disease.
Topics: Bicarbonates; Calcinosis; Calcium; Duodenum; Humans; Magnesium; Pancreatic Diseases; Pancreatic Juic | 1970 |
[Value of secretin test in the diagnosis of pancreatic diseases].
Topics: Adolescent; Adult; Aged; Bicarbonates; Humans; Middle Aged; Pancreatic Diseases; Pancreatic Neoplasm | 1970 |
Tests of pancreatic function.
Topics: Bicarbonates; Cholecystokinin; Duodenum; Humans; Pancreas; Pancreatic Diseases; Pancreatic Neoplasms | 1970 |
Bicarbonate and acid secretion in the diagnosis of pancreatic disease.
Topics: Adolescent; Adult; Aged; Bicarbonates; Duodenum; Female; Gastric Acidity Determination; Gastric Juic | 1970 |
[Some aspects of exocrine pancreas secretion. Experiences with the "augmented secretin test"].
Topics: Adult; Aged; Bicarbonates; Chronic Disease; Female; Humans; Male; Microscopy, Electron; Middle Aged; | 1970 |
Tests of pancreatic function.
Topics: Bicarbonates; Humans; Methods; Pancreas; Pancreatic Diseases; Pancreatic Neoplasms; Pancreatitis; Tr | 1970 |
The measurement of faecal chymotrypsin: a screening test for pancreatic exocrine insufficiency.
Topics: Bicarbonates; Chymotrypsin; Feces; Humans; Mathematics; Pancreatic Diseases; Secretin; Temperature; | 1970 |
The role of the exocrine pancreas in the stimulation of insulin secretion by intestinal hormones. 3. Insulin responses to secretin and pancreozymin, and to oral and intravenous glucose, in patients suffering from chronic insufficiency of the exocrine panc
Topics: Administration, Oral; Bicarbonates; Blood Glucose; Cholecystokinin; Fatty Acids, Nonesterified; Gluc | 1971 |
[Intestinal pressure recording and methods for studying intestinal secretion].
Topics: Bicarbonates; Digestive System Physiological Phenomena; Humans; Intestinal Absorption; Intestinal Se | 1967 |
Exploration of pancreatic exocrine function by continuous infusion of secretin.
Topics: Adult; Bicarbonates; Cholecystokinin; Humans; Infusions, Parenteral; Injections, Intravenous; Lipase | 1968 |
Quantitative assessment of exocrine pancreatic function in infants and children.
Topics: Adolescent; Age Factors; Amylases; Bicarbonates; Body Weight; Child; Child, Preschool; Cholecystokin | 1968 |
Pancreatic insufficiency and vitamin B 12 malabsorption.
Topics: Adult; Bicarbonates; Binding Sites; Celiac Disease; Humans; Intestinal Absorption; Intrinsic Factor; | 1968 |
[On the reproducibility of the secretin test in healthy persons].
Topics: Amylases; Bicarbonates; Body Weight; Humans; Pancreatic Diseases; Pancreatic Juice; Secretin | 1965 |