hydrogen carbonate has been researched along with Cholera Infantum in 44 studies
Bicarbonates: Inorganic salts that contain the -HCO3 radical. They are an important factor in determining the pH of the blood and the concentration of bicarbonate ions is regulated by the kidney. Levels in the blood are an index of the alkali reserve or buffering capacity.
hydrogencarbonate : The carbon oxoanion resulting from the removal of a proton from carbonic acid.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Bixalomer (Bix) is an amine-functional polymer, non-calcium-containing phosphate (P) binder, and has been clinically available in Japan recently." | 5.40 | Treatment of hyperphosphatemia with bixalomer in Japanese patients on long-term hemodialysis with gastrointestinal symptoms. ( Ito, K; Kumata, C; Matsuzaka, K; Nakajima, Y; Ogata, H; Shishido, K; Takeshima, A; Wakasa, M, 2014) |
| "Incidences of arrhythmia, muscular cramps and headache were significantly less frequent during HF." | 2.68 | On-line predilution hemofiltration versus ultrapure high-flux hemodialysis: a multicenter prospective study in 23 patients. Sardinian Collaborative Study Group of On-Line Hemofiltration. ( Altieri, P; Asproni, E; Bolasco, F; Bolasco, PG; Bostrom, M; Cabiddu, GF; Cadinu, F; Casu, D; Cossu, M; Ferrara, R; Ganadu, M; Passaghe, M; Pinna, M; Sorba, GB, 1997) |
| "Metabolic alkalosis is defined as a primary increase in plasma bicarbonate concentration." | 2.38 | [Water-electrolyte and acid-base disorders. VII. Metabolic alkalosis]. ( Velásquez-Jones, L, 1990) |
| ", concurrent disease, physical or sociopsychologic stress, dietary and genetic status), the intrinsic pharmacokinetic and physicochemical differences in these drugs account for variations in their rate of absorption or uptake from the circulation into the GI mucosa." | 2.37 | Gastrointestinal damage from nonsteroidal anti-inflammatory drugs. ( Rainsford, KD, 1988) |
| "Chronic gastric ulcer is linked to aspirin intake in patients with rheumatic disease, and epidemiologically in all heavy aspirin users; paradoxically, in only one epidemiologic study was a significant association found between acetaminophen intake and chronic gastric ulcer." | 2.36 | Gastrointestinal effects of antipyretic analgesics. ( Ivey, KJ, 1983) |
| "Bixalomer (Bix) is an amine-functional polymer, non-calcium-containing phosphate (P) binder, and has been clinically available in Japan recently." | 1.40 | Treatment of hyperphosphatemia with bixalomer in Japanese patients on long-term hemodialysis with gastrointestinal symptoms. ( Ito, K; Kumata, C; Matsuzaka, K; Nakajima, Y; Ogata, H; Shishido, K; Takeshima, A; Wakasa, M, 2014) |
| "The rate of metabolic acidosis is highly correlated with the rate of GI syndrome." | 1.36 | Occurrence of metabolic acidosis in pediatric emergency department patients as a data source for disease surveillance systems. ( Capraro, A; Harper, MB; Johnston, P; Kimia, AA, 2010) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 25 (56.82) | 18.7374 |
| 1990's | 5 (11.36) | 18.2507 |
| 2000's | 3 (6.82) | 29.6817 |
| 2010's | 7 (15.91) | 24.3611 |
| 2020's | 4 (9.09) | 2.80 |
| Authors | Studies |
|---|---|
| Durkalec-Michalski, K | 1 |
| Nowaczyk, PM | 1 |
| Kamińska, J | 1 |
| Saunders, B | 1 |
| Łoniewski, I | 1 |
| Czubaszek, D | 1 |
| Steffl, M | 1 |
| Podgórski, T | 1 |
| Gravina, AG | 1 |
| Pellegrino, R | 1 |
| Romeo, M | 1 |
| Ventriglia, L | 1 |
| Scognamiglio, F | 1 |
| Tuccillo, C | 1 |
| Loguercio, C | 1 |
| Federico, A | 1 |
| Marcus, A | 1 |
| Rossi, A | 1 |
| Cornwell, A | 1 |
| Hawkins, SA | 1 |
| Khodiguian, N | 1 |
| Poffé, C | 1 |
| Ramaekers, M | 1 |
| Bogaerts, S | 1 |
| Hespel, P | 1 |
| Urwin, CS | 1 |
| Snow, RJ | 1 |
| Orellana, L | 1 |
| Condo, D | 1 |
| Wadley, GD | 1 |
| Carr, AJ | 1 |
| Ito, K | 1 |
| Takeshima, A | 1 |
| Shishido, K | 1 |
| Wakasa, M | 1 |
| Kumata, C | 1 |
| Matsuzaka, K | 1 |
| Nakajima, Y | 1 |
| Ogata, H | 1 |
| Mennuni, G | 1 |
| Petraccia, L | 2 |
| Fontana, M | 2 |
| Nocchi, S | 2 |
| Stortini, E | 1 |
| Romoli, M | 1 |
| Esposito, E | 1 |
| Priori, F | 1 |
| Grassi, M | 2 |
| Geraci, A | 1 |
| Serio, A | 1 |
| Fraioli, A | 2 |
| Menunni, G | 1 |
| Cameron, SL | 1 |
| McLay-Cooke, RT | 1 |
| Brown, RC | 1 |
| Gray, AR | 1 |
| Fairbairn, KA | 1 |
| Kimia, AA | 1 |
| Johnston, P | 1 |
| Capraro, A | 1 |
| Harper, MB | 1 |
| Palileo, C | 1 |
| Kaunitz, JD | 1 |
| KOBIERSKI, R | 1 |
| MARCHEGIANI, C | 1 |
| PIGNATARO, L | 1 |
| MARS, G | 1 |
| BEULCKE, G | 1 |
| Suñer, M | 1 |
| Guerrero, A | 1 |
| Montes, R | 1 |
| Rivera, M | 1 |
| Ruiz, A | 1 |
| Martínez-García, M | 1 |
| Pérez-Valdivia, MA | 1 |
| Mateos, J | 1 |
| Keller, J | 1 |
| Layer, P | 1 |
| Ivey, KJ | 1 |
| Tweedle, DE | 1 |
| Mogadam, M | 1 |
| Twedt, DC | 1 |
| Grauer, GF | 1 |
| Zucchelli, P | 1 |
| Santoro, A | 1 |
| Spongano, M | 1 |
| Kuno, T | 1 |
| Kikuchi, F | 1 |
| Yanai, M | 1 |
| Nagura, Y | 1 |
| Takahashi, S | 1 |
| Altieri, P | 1 |
| Sorba, GB | 1 |
| Bolasco, PG | 1 |
| Bostrom, M | 1 |
| Asproni, E | 1 |
| Ferrara, R | 1 |
| Bolasco, F | 1 |
| Cossu, M | 1 |
| Cadinu, F | 1 |
| Cabiddu, GF | 1 |
| Casu, D | 1 |
| Ganadu, M | 1 |
| Passaghe, M | 1 |
| Pinna, M | 1 |
| Calatayud, S | 1 |
| Barrachina, D | 1 |
| Esplugues, JV | 1 |
| Kohn, CW | 1 |
| Dreiling, DA | 1 |
| Messer, J | 1 |
| Rolny, P | 1 |
| Jagenburg, R | 1 |
| Malov, IuS | 1 |
| Kulikov, AN | 1 |
| Velásquez-Jones, L | 1 |
| Rainsford, KD | 1 |
| Braun, U | 1 |
| Eicher, R | 1 |
| Bracher, V | 1 |
| Wong, HB | 1 |
| Mohammed, SH | 1 |
| Hendrix, TR | 1 |
| Forwand, SA | 1 |
| Landowne, M | 1 |
| Follansbee, JN | 1 |
| Hansen, JE | 1 |
| Katsikas, JL | 1 |
| Goldsmith, C | 1 |
| Huttman, DH | 1 |
| Capitaine, Y | 1 |
| Cros, RC | 1 |
| Gullo, L | 1 |
| de Barros-Mott, C | 1 |
| Pastor, J | 1 |
| Pauli, AM | 1 |
| Sarles, H | 1 |
| de La Tour, J | 1 |
| Petersen, H | 1 |
| Douillet, M | 1 |
| Beaudoing, A | 1 |
| Bost, M | 1 |
| Salomon, S | 1 |
| Ito, Y | 1 |
| Shibata, H | 1 |
| Kashima, H | 1 |
| Galanda, V | 1 |
| Zawarská, L | 1 |
| Neuwirth, A | 1 |
| Hausmann, W | 1 |
| Tárnoky, AL | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| The Effects of a Novel Bicarbonate Loading Protocol on Elite Running Performance. A Randomized Placebo-controlled Trial[NCT03813329] | Early Phase 1 | 10 participants (Actual) | Interventional | 2004-05-01 | Completed | ||
| A 3-part, Phase 1a/1b, First-in-human, Randomized, Double-blind, Placebo-controlled Study to Evaluate Safety, Tolerability, and Pharmacokinetics of Single and Multiple Ascending Doses of Oral CDX-7108 in Healthy Adult Subjects and to Evaluate Proof-of-con[NCT05082051] | Phase 1 | 54 participants (Actual) | Interventional | 2021-10-11 | Completed | ||
| Treatment of High-altitude Sleep Disturbance: A Double-blind Comparison of Temazepam Versus Acetazolamide.[NCT01519544] | 34 participants (Actual) | Interventional | 2012-03-31 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
10 reviews available for hydrogen carbonate and Cholera Infantum
| Article | Year |
|---|---|
Gastrointestinal defense mechanisms.
Topics: Anti-Inflammatory Agents, Non-Steroidal; Bicarbonates; Gastric Mucosa; Gastrointestinal Diseases; Hu | 2011 |
[Treatment of hyperphosphatemia with sevelamer in patients with chronic renal failure].
Topics: Acid-Base Equilibrium; Adult; Aged; Aged, 80 and over; Bicarbonates; Calcium; Chelating Agents; Drug | 2004 |
Human pancreatic exocrine response to nutrients in health and disease.
Topics: Aging; Bicarbonates; Bile Acids and Salts; Diabetes Mellitus; Diet; Dietary Carbohydrates; Dietary P | 2005 |
Gastrointestinal effects of antipyretic analgesics.
Topics: Acetaminophen; Adenosine Triphosphate; Anti-Inflammatory Agents, Non-Steroidal; Aspirin; Bicarbonate | 1983 |
Nitric oxide: relation to integrity, injury, and healing of the gastric mucosa.
Topics: Animals; Apoptosis; Bicarbonates; Gastric Acid; Gastric Mucosa; Gastrointestinal Diseases; Humans; I | 2001 |
Preparative management of the equine patient with an abdominal crisis.
Topics: Acid-Base Equilibrium; Acid-Base Imbalance; Adrenal Cortex Hormones; Animals; Anti-Bacterial Agents; | 1979 |
The secretin story: a saga in clinical medicine and gastrointestinal physiology.
Topics: Amylases; Animals; Bicarbonates; Cholestasis; Digestive System Physiological Phenomena; Gastrointest | 1978 |
[Water-electrolyte and acid-base disorders. VII. Metabolic alkalosis].
Topics: Alkalosis; Bartter Syndrome; Bicarbonates; Chlorides; Cystic Fibrosis; Diuretics; Gastrointestinal D | 1990 |
Gastrointestinal damage from nonsteroidal anti-inflammatory drugs.
Topics: Animals; Anti-Inflammatory Agents, Non-Steroidal; Bicarbonates; Environment; Free Radicals; Gastric | 1988 |
Disorders of potassium metabolism.
Topics: Acid-Base Equilibrium; Acute Kidney Injury; Bicarbonates; Diet Therapy; Electrocardiography; Gastroi | 1971 |
8 trials available for hydrogen carbonate and Cholera Infantum
| Article | Year |
|---|---|
The interplay between bicarbonate kinetics and gastrointestinal upset on ergogenic potential after sodium bicarbonate intake: a randomized double-blind placebo-controlled trial.
Topics: Athletic Performance; Bicarbonates; Cross-Over Studies; Double-Blind Method; Gastrointestinal Diseas | 2023 |
The effects of a novel bicarbonate loading protocol on serum bicarbonate concentration: a randomized controlled trial.
Topics: Adult; Athletes; Bicarbonates; Female; Gastrointestinal Diseases; Hematocrit; Humans; Hydrogen-Ion C | 2019 |
Bicarbonate Unlocks the Ergogenic Action of Ketone Monoester Intake in Endurance Exercise.
Topics: Appetite; Bicarbonates; Blood Gas Analysis; Blood Glucose; Cross-Over Studies; Dietary Supplements; | 2021 |
Does varying the ingestion period of sodium citrate influence blood alkalosis and gastrointestinal symptoms?
Topics: Adult; Alkalosis; Bicarbonates; Exercise; Female; Gastrointestinal Diseases; Humans; Male; Sodium Ci | 2021 |
Increased blood pH but not performance with sodium bicarbonate supplementation in elite rugby union players.
Topics: Acid-Base Equilibrium; Athletic Performance; Bicarbonates; Cross-Over Studies; Dietary Supplements; | 2010 |
Clinical advantages of acetate-free biofiltration.
Topics: Acetates; Acidosis; Adult; beta 2-Microglobulin; Bicarbonates; Blood Urea Nitrogen; Cardiovascular D | 1994 |
On-line predilution hemofiltration versus ultrapure high-flux hemodialysis: a multicenter prospective study in 23 patients. Sardinian Collaborative Study Group of On-Line Hemofiltration.
Topics: Aged; Arrhythmias, Cardiac; beta 2-Microglobulin; Bicarbonates; Body Weight; Electrolytes; Fatigue; | 1997 |
Effect of acetazolamide on acute mountain sickness.
Topics: Acetazolamide; Acute Disease; Adult; Alkalosis; Altitude; Bicarbonates; Blood; Blood Pressure; Carbo | 1968 |
26 other studies available for hydrogen carbonate and Cholera Infantum
| Article | Year |
|---|---|
The use of bicarbonate-sulphate-calcium-magnesium and sodium-low drinkable water improves functional gastrointestinal symptoms in patients with non-alcoholic fatty liver disease: A prospective study.
Topics: Bicarbonates; Calcium; Drinking Water; Gastrointestinal Diseases; Humans; Magnesium; Non-alcoholic F | 2023 |
Treatment of hyperphosphatemia with bixalomer in Japanese patients on long-term hemodialysis with gastrointestinal symptoms.
Topics: Abdominal Pain; Bicarbonates; Calcium; Chelating Agents; Cohort Studies; Constipation; Female; Follo | 2014 |
The therapeutic activity of sulphate-bicarbonate-calcium-magnesiac mineral water in the functional disorders of the biliary tract.
Topics: Adult; Bicarbonates; Biliary Tract; Biliary Tract Diseases; Calcium Sulfate; Female; Gastrointestina | 2014 |
Sulphate-bicarbonate mineral waters in the treatment of biliary and digestive tract diseases.
Topics: Balneology; Bicarbonates; Biliary Tract Diseases; Dyspepsia; Female; Gastrointestinal Diseases; Huma | 2010 |
Occurrence of metabolic acidosis in pediatric emergency department patients as a data source for disease surveillance systems.
Topics: Acidosis; Bicarbonates; Biomarkers; Boston; Child; Child, Preschool; Cohort Studies; Emergency Servi | 2010 |
[Experience in the treatment of gastrointestinal diseases with roter tablets].
Topics: Antacids; Bicarbonates; Bismuth; Gastritis; Gastrointestinal Diseases; Humans; Nitrates; Peptic Ulce | 1958 |
[CHANGES IN THE SERUM GLYCOPROTEIN PATTERN IN PATIENTS WITH HEPATOBILIARY DISEASES AFTER ADMINISTRATION OF BICARBONATED-ALKALINE EARTH MINERAL WATER (SANGEMINI WATER)].
Topics: Bicarbonates; Biliary Tract; Disease; Earth, Planet; Gastrointestinal Diseases; Humans; Liver Diseas | 1963 |
[BEHAVIOR OF GASTRIC ACIDITY IN STOMACH DISEASE PATIENTS OVER 70 YEARS OF AGE SUBJECTED TO HYDROPINOTHERAPY WITH CALCIUM-SULPHATE-BICARBONATE WATER].
Topics: Bicarbonates; Calcium; Calcium Sulfate; Calcium, Dietary; Gastric Acidity Determination; Gastrointes | 1964 |
Electrolyte disorders in the surgical patient.
Topics: Bicarbonates; Body Water; Calcium; Chlorides; Endocrine System Diseases; Fluid Therapy; Gastrointest | 1984 |
The GI drug column. The ACG committee on FDA related matters.
Topics: Alginates; Aluminum Hydroxide; Antacids; Bicarbonates; Chemical and Drug Induced Liver Injury; Cheno | 1983 |
Fluid therapy for gastrointestinal, pancreatic, and hepatic disorders.
Topics: Animals; Bicarbonates; Dog Diseases; Dogs; Fluid Therapy; Gastrointestinal Diseases; Glucose; Liver | 1982 |
Acetate-free biofiltration: acidosis correction and cardiovascular stability.
Topics: Acetates; Acidosis; Bicarbonates; Cardiovascular Diseases; Evaluation Studies as Topic; Gastrointest | 1994 |
The secretin-CCK test and a modified Lundh test. A comparative study.
Topics: Adult; Aged; Bicarbonates; Cholecystokinin; Duodenum; Food; Gastrointestinal Diseases; Humans; Intub | 1978 |
[Status of the bicarbonate-mucous barrier in patients with gastroduodenal pathology].
Topics: Adolescent; Adult; Bicarbonates; Chronic Disease; Gastric Acid; Gastric Mucosa; Gastritis; Gastroint | 1991 |
[Internal reflux in cattle--studies of the abomasal reflux syndrome in various diseases of the digestive system].
Topics: Abomasum; Animals; Bicarbonates; Cattle; Cattle Diseases; Chlorides; Female; Gastrointestinal Diseas | 1988 |
Gastrointestinal infection.
Topics: Acid-Base Equilibrium; Animals; Anti-Bacterial Agents; Antiprotozoal Agents; Bicarbonates; Cattle; C | 1985 |
Andrew's liver salt as an effervescent in upper gastrointestinal radiography.
Topics: Barium Sulfate; Bicarbonates; Citrates; Contrast Media; Drug Combinations; Gastrointestinal Diseases | 1985 |
Antacids.
Topics: Aluminum Hydroxide; Antacids; Bicarbonates; Calcium Carbonate; Duodenal Ulcer; Gastroesophageal Refl | 1974 |
[Aspirin in the treatment of myocardial infarct].
Topics: Aspirin; Bicarbonates; Blood Coagulation; Blood Sedimentation; Gastrointestinal Diseases; Hematuria; | 1971 |
[Multivariate study of data from pancreatic investigations with intubation].
Topics: Acute Disease; Bicarbonates; Calcium; Cholecystokinin; Chronic Disease; Duodenum; Enzymes; Factor An | 1971 |
[Digestive spasmophilia and the sodium bicarbonate cure].
Topics: Adolescent; Adult; Bicarbonates; Calcium; Female; Gastrointestinal Diseases; Humans; Magnesium; Male | 1971 |
The relationship between the gastric and pancreatic secretion in man.
Topics: Adolescent; Adult; Aged; Bicarbonates; Chronic Disease; Duodenal Ulcer; Female; Gastric Acidity Dete | 1969 |
[Cystinuria-lysinuria. 12 cases].
Topics: Adolescent; Adult; Aged; Bicarbonates; Chelating Agents; Child; Child, Preschool; Cystinuria; Cystit | 1970 |
[Significance of pancreatic function test in the diagnosis of digestive function. 1. Significance of LAP and zinc in pancreozymin secretion test].
Topics: Amylases; Bicarbonates; Cholecystokinin; Chronic Disease; Duodenum; Gallbladder Diseases; Gastrointe | 1970 |
[Utilization of observation of acid-base metabolism in the treatment of infantile toxic conditions].
Topics: Acid-Base Equilibrium; Acidosis; Acidosis, Respiratory; Bicarbonates; Coma; Communicable Diseases; D | 1969 |
Biochemical effects of short-term treatment with carbenoxolone disodium.
Topics: Adolescent; Adult; Aged; Bicarbonates; Digestive System; Female; Gastric Mucosa; Gastrointestinal Di | 1966 |