hydrogen carbonate has been researched along with Aging in 99 studies
Bicarbonates: Inorganic salts that contain the -HCO3 radical. They are an important factor in determining the pH of the blood and the concentration of bicarbonate ions is regulated by the kidney. Levels in the blood are an index of the alkali reserve or buffering capacity.
hydrogencarbonate : The carbon oxoanion resulting from the removal of a proton from carbonic acid.
Aging: The gradual irreversible changes in structure and function of an organism that occur as a result of the passage of time.
| Excerpt | Relevance | Reference |
|---|---|---|
| "We have identified a novel homozygous nonsense mutation (W516X) in the kidney-type electrogenic sodium bicarbonate cotransporter 1 (NBC1) in a patient with isolated proximal renal tubular acidosis (pRTA)." | 3.77 | Severe metabolic acidosis causes early lethality in NBC1 W516X knock-in mice as a model of human isolated proximal renal tubular acidosis. ( Fujita, T; Horita, S; Lin, SH; Lin, SW; Lo, YF; Seki, G; Tsai, JD; Usui, T; Yamada, H; Yamazaki, O; Yang, SS; Yu, IS, 2011) |
| "Bone resorption is most sensitive to changes in H+ concentration at a pH of about 7." | 2.42 | Regulation of bone cell function by acid-base balance. ( Arnett, T, 2003) |
| "Interestingly respiratory acidosis, caused by an increase in the partial pressure of carbon dioxide induces far less bone dissolution and resorption and the additional hydrogen ions are not buffered by bone." | 2.41 | Acid-base imbalance and the skeleton. ( Bushinsky, DA, 2001) |
| "Proteinuria was obtained from a 24-h urine collection." | 1.40 | In chronic kidney disease, serum α-Klotho is related to serum bicarbonate and proteinuria. ( Cuerq, C; Drai, J; Dubourg, L; Fouque, D; Hadj-Aissa, A; Hage, V; Laville, M; Lemoine, S; Pelletier, S, 2014) |
| "Chronic metabolic acidosis is a process whereby an excess nonvolatile acid load is chronically placed on the body due to excess acid generation or diminished acid removal by normal homeostatic mechanisms." | 1.30 | The clinical spectrum of chronic metabolic acidosis: homeostatic mechanisms produce significant morbidity. ( Alpern, RJ; Sakhaee, K, 1997) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 44 (44.44) | 18.7374 |
| 1990's | 25 (25.25) | 18.2507 |
| 2000's | 18 (18.18) | 29.6817 |
| 2010's | 11 (11.11) | 24.3611 |
| 2020's | 1 (1.01) | 2.80 |
| Authors | Studies |
|---|---|
| Frassetto, LA | 3 |
| Sebastian, A | 6 |
| DuBose, TD | 1 |
| Shea, MK | 1 |
| Dawson-Hughes, B | 1 |
| Ratliff, C | 1 |
| Hartup, BK | 1 |
| Menezes, CJ | 1 |
| Worcester, EM | 1 |
| Coe, FL | 1 |
| Asplin, J | 1 |
| Bergsland, KJ | 1 |
| Ko, B | 1 |
| Hage, V | 1 |
| Pelletier, S | 1 |
| Dubourg, L | 1 |
| Drai, J | 1 |
| Cuerq, C | 1 |
| Lemoine, S | 1 |
| Hadj-Aissa, A | 1 |
| Laville, M | 1 |
| Fouque, D | 1 |
| Tabatabai, LS | 1 |
| Cummings, SR | 1 |
| Tylavsky, FA | 1 |
| Bauer, DC | 1 |
| Cauley, JA | 1 |
| Kritchevsky, SB | 1 |
| Newman, A | 1 |
| Simonsick, EM | 1 |
| Harris, TB | 1 |
| Sellmeyer, DE | 3 |
| Henning, H | 1 |
| Ngo, TT | 1 |
| Waberski, D | 1 |
| Raphael, KL | 1 |
| Murphy, RA | 1 |
| Shlipak, MG | 1 |
| Satterfield, S | 1 |
| Huston, HK | 1 |
| Patel, KV | 1 |
| Newman, AB | 1 |
| Sarnak, MJ | 1 |
| Ix, JH | 1 |
| Fried, LF | 1 |
| Yalçin, S | 1 |
| Cabuk, M | 1 |
| Bruggeman, V | 2 |
| Babacanoglu, E | 1 |
| Buyse, J | 1 |
| Decuypere, E | 2 |
| Siegel, PB | 1 |
| Allen, PJ | 1 |
| Cech, JJ | 1 |
| Kültz, D | 1 |
| Crajoinas, RO | 1 |
| Lessa, LM | 1 |
| Carraro-Lacroix, LR | 1 |
| Davel, AP | 1 |
| Pacheco, BP | 1 |
| Rossoni, LV | 1 |
| Malnic, G | 1 |
| Girardi, AC | 1 |
| Lo, YF | 1 |
| Yang, SS | 1 |
| Seki, G | 1 |
| Yamada, H | 1 |
| Horita, S | 1 |
| Yamazaki, O | 1 |
| Fujita, T | 1 |
| Usui, T | 1 |
| Tsai, JD | 1 |
| Yu, IS | 1 |
| Lin, SW | 1 |
| Lin, SH | 1 |
| Tuo, B | 1 |
| Ju, Z | 1 |
| Riederer, B | 1 |
| Engelhardt, R | 1 |
| Manns, MP | 1 |
| Rudolph, KL | 1 |
| Seidler, U | 1 |
| Wang, J | 1 |
| Zhou, X | 1 |
| Zhao, Y | 1 |
| Tang, H | 1 |
| Hu, Y | 1 |
| CONSTANT, MA | 1 |
| FALCH, J | 1 |
| Arnett, T | 1 |
| Choker, G | 1 |
| Gouyon, JB | 1 |
| Newton, JL | 1 |
| Vetter, AE | 1 |
| O'Grady, SM | 1 |
| Cuende, N | 1 |
| Miranda, B | 1 |
| Cañón, JF | 1 |
| Garrido, G | 1 |
| Matesanz, R | 1 |
| Keller, J | 1 |
| Layer, P | 1 |
| Fiori, M | 1 |
| Radrizzani, M | 1 |
| Díaz-Sylvester, P | 1 |
| Müller, A | 1 |
| Corti, T | 1 |
| Monserrat, A | 1 |
| Amorena, C | 2 |
| Leslie, MA | 1 |
| Coleman, RA | 1 |
| Moehn, S | 1 |
| Ball, RO | 1 |
| Korver, DR | 1 |
| Everaert, N | 1 |
| De Smit, L | 1 |
| Debonne, M | 1 |
| Witters, A | 1 |
| Kamers, B | 1 |
| Ballard, FJ | 1 |
| Hanson, RW | 1 |
| Fabre, J | 1 |
| de Sousa, R | 1 |
| Wiederanders, B | 1 |
| Oelke, B | 1 |
| Schwartz, GJ | 2 |
| Evan, AP | 1 |
| Fleck, C | 1 |
| Bräunlich, H | 1 |
| Tazawa, H | 1 |
| Visschedijk, AH | 1 |
| Wittmann, J | 1 |
| Piiper, J | 1 |
| Gullo, L | 1 |
| Priori, P | 1 |
| Daniele, C | 1 |
| Ventrucci, M | 1 |
| Gasbarrini, G | 1 |
| Labò, G | 1 |
| Burnell, JM | 1 |
| Teubner, EJ | 1 |
| Miller, AG | 1 |
| Massie, HR | 1 |
| Williams, TR | 1 |
| Colacicco, JR | 1 |
| Rürup, B | 1 |
| Schulz, J | 1 |
| Schmidt, UJ | 1 |
| Chow, EI | 1 |
| Chen, D | 1 |
| Hamilton, RM | 1 |
| Cryer, B | 3 |
| Feldman, M | 3 |
| Pridjian, AK | 1 |
| Bove, EL | 1 |
| Bolling, SF | 1 |
| Childs, KF | 1 |
| Brosamer, KM | 1 |
| Lupinetti, FM | 1 |
| Raley-Susman, KM | 1 |
| Sapolsky, RM | 1 |
| Kopito, RR | 1 |
| Bevensee, MO | 1 |
| Cummins, TR | 1 |
| Haddad, GG | 1 |
| Boron, WF | 1 |
| Boyarsky, G | 1 |
| Bosman, GJ | 1 |
| Renkawek, K | 1 |
| Van Workum, FP | 1 |
| Bartholomeus, IG | 1 |
| De Grip, WJ | 1 |
| Morris, RC | 2 |
| Alpern, RJ | 1 |
| Sakhaee, K | 1 |
| Thomas, CE | 1 |
| Mayer, SA | 1 |
| Gungor, Y | 1 |
| Swarup, R | 1 |
| Webster, EA | 1 |
| Chang, I | 1 |
| Brannagan, TH | 1 |
| Fink, ME | 1 |
| Rowland, LP | 1 |
| Backus, KH | 1 |
| Deitmer, JW | 1 |
| Friauf, E | 1 |
| Guslandi, M | 1 |
| Shah, M | 1 |
| Quigley, R | 1 |
| Baum, M | 1 |
| Danetz, JS | 1 |
| Clemo, HF | 1 |
| Davies, RD | 1 |
| Embrey, RP | 1 |
| Damiano, RJ | 1 |
| Baumgarten, CM | 1 |
| Arnal, MA | 1 |
| Mosoni, L | 1 |
| Boirie, Y | 1 |
| Gachon, P | 1 |
| Genest, M | 1 |
| Bayle, G | 1 |
| Grizard, J | 1 |
| Arnal, M | 1 |
| Antoine, JM | 1 |
| Beaufrère, B | 1 |
| Mirand, PP | 1 |
| Jandziszak, K | 1 |
| Suarez, C | 1 |
| Saenger, PH | 1 |
| Brion, LP | 1 |
| Mac Laughlin, M | 1 |
| Damasco, MC | 1 |
| Igarreta, P | 1 |
| Ratel, S | 1 |
| Duche, P | 1 |
| Hennegrave, A | 1 |
| Van Praagh, E | 1 |
| Bedu, M | 1 |
| Frassetto, L | 1 |
| Todd, K | 1 |
| Bushinsky, DA | 1 |
| Stania, H | 1 |
| Kolb, E | 1 |
| Schineff, C | 1 |
| Korkuschko, OW | 1 |
| Tereschtschenko, WP | 1 |
| Blazer-Yost, B | 1 |
| Reynolds, R | 1 |
| Segal, S | 1 |
| Aperia, A | 1 |
| Broberger, O | 1 |
| Herin, P | 1 |
| Thodenius, K | 1 |
| Zetterström, R | 1 |
| Valenkevich, LN | 1 |
| Tremblay, GC | 1 |
| Jimenez, U | 1 |
| Crandall, DE | 1 |
| Zanconato, S | 1 |
| Cooper, DM | 1 |
| Barstow, TJ | 1 |
| Landaw, E | 1 |
| Redfern, JS | 1 |
| Goldschmiedt, M | 1 |
| Lee, E | 1 |
| Johanson, CE | 2 |
| Parandoosh, Z | 1 |
| Dyas, ML | 1 |
| Ishibashi, T | 1 |
| Matsumoto, S | 1 |
| Harada, H | 1 |
| Ochi, K | 1 |
| Tanaka, J | 1 |
| Seno, T | 1 |
| Oka, H | 1 |
| Miyake, H | 1 |
| Kimura, I | 1 |
| Laugier, R | 1 |
| Bernard, JP | 1 |
| Berthezene, P | 1 |
| Dupuy, P | 1 |
| Luft, FC | 1 |
| Miller, JZ | 1 |
| Grim, CE | 1 |
| Fineberg, NS | 1 |
| Christian, JC | 1 |
| Daugherty, SA | 1 |
| Weinberger, MH | 1 |
| Magovern, JA | 2 |
| Pae, WE | 2 |
| Waldhausen, JA | 2 |
| Murashita, T | 1 |
| Hearse, DJ | 1 |
| Avkiran, M | 1 |
| Miller, TA | 1 |
| Mehrgut, FM | 1 |
| Satlin, LM | 1 |
| Collas, P | 1 |
| Robl, JM | 1 |
| Kim, SW | 1 |
| Parekh, D | 1 |
| Townsend, CM | 2 |
| Thompson, JC | 2 |
| Vellas, B | 1 |
| Balas, D | 1 |
| Moreau, J | 1 |
| Bouisson, M | 1 |
| Senegas-Balas, F | 1 |
| Guidet, M | 1 |
| Ribet, A | 1 |
| Miyasaka, K | 2 |
| Kitani, K | 2 |
| Riedel, BD | 1 |
| Ghishan, FK | 1 |
| Takahashi, S | 1 |
| Kuno, T | 1 |
| Hatano, M | 1 |
| Robert, JJ | 1 |
| Koziet, J | 1 |
| Chauvet, D | 1 |
| Darmaun, D | 1 |
| Desjeux, JF | 1 |
| Young, VR | 1 |
| Allen, J | 1 |
| Withrow, CD | 1 |
| Baker, JE | 1 |
| Boerboom, LE | 1 |
| Olinger, GN | 1 |
| Miller, CA | 1 |
| Wigham, CG | 1 |
| Hodson, SA | 1 |
| Khalil, T | 1 |
| Fujimura, M | 1 |
| Greeley, GH | 1 |
| Patel, MS | 3 |
| Tonkonow, BL | 1 |
| Hollenberg, CH | 1 |
| Vost, A | 1 |
| Wilbur, DO | 1 |
| Jo, JS | 1 |
| Ishihara, N | 1 |
| Kikuchi, G | 1 |
| Siemoneit, KD | 1 |
| Stojiliković, D | 1 |
| Marquardt, B | 1 |
| Strunz, E | 1 |
| Eberlein, HJ | 1 |
| Reinhardt, HW | 1 |
| Sulyok, E | 1 |
| Heim, T | 1 |
| Soltész, G | 1 |
| Jászai, V | 1 |
| Wittman, JS | 1 |
| Bawin, RR | 1 |
| Terestschenko, WP | 1 |
| Sarkisow, KG | 1 |
| Jacobson, BS | 1 |
| Smith, BN | 1 |
| Epstein, S | 1 |
| Laties, GG | 1 |
| McFarlane, H | 1 |
| Akinkugbe, OO | 1 |
| Adejuwon, AC | 1 |
| Oforofuo, IA | 1 |
| Onayemi, OA | 1 |
| Longe, O | 1 |
| Ojo, OA | 1 |
| Reddy, S | 1 |
| Simkiss, K | 1 |
| Adler, S | 1 |
| Lindeman, RD | 1 |
| Yiengst, MJ | 1 |
| Beard, E | 1 |
| Shock, NW | 1 |
| Bartos, V | 1 |
| Groh, J | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Musculoskeletal Benefits of Bicarbonate in Older Adults - A Dose-Finding Trial[NCT01475214] | Phase 2 | 244 participants (Actual) | Interventional | 2012-01-31 | Completed | ||
| A 3-part, Phase 1a/1b, First-in-human, Randomized, Double-blind, Placebo-controlled Study to Evaluate Safety, Tolerability, and Pharmacokinetics of Single and Multiple Ascending Doses of Oral CDX-7108 in Healthy Adult Subjects and to Evaluate Proof-of-con[NCT05082051] | Phase 1 | 54 participants (Actual) | Interventional | 2021-10-11 | Completed | ||
| Paleolithic Diets, Exercise Physiology and Metabolism[NCT00360516] | 10 participants (Actual) | Interventional | 2005-11-30 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
Describe and compare changes in 24-hour urinary nitrogen in the low and high dose and KHCO3 group and in placebo. (NCT01475214)
Timeframe: 84 days
| Intervention | mmol/day (Mean) | |
|---|---|---|
| baseline 24-hr urine nitrogen | change in 24-hr urine nitrogen | |
| Inactive Capsule | 864 | -21.0 |
| Potassium Bicarbonate Higher Dose | 834 | -16.4 |
| Potassium Bicarbonate Low Dose | 769 | -29.4 |
Describe and compare changes in urinary N-telopeptide (NTX) across the placebo and Potassium Bicarbonate (KHCO3) doses. (NCT01475214)
Timeframe: 84 days
| Intervention | nmol/day (Mean) | |
|---|---|---|
| baseline 24-hr urinary NTX | change in NTX | |
| Inactive Placebo Capsule | 241 | -14 |
| Potassium Bicarbonate Higher Dose | 230 | -43 |
| Potassium Bicarbonate Low Dose | 240 | -53 |
10 reviews available for hydrogen carbonate and Aging
| Article | Year |
|---|---|
How metabolic acidosis and kidney disease may accelerate the aging process.
Topics: Acidosis; Aging; Animals; Bicarbonates; Diet; Fibroblast Growth Factor-23; Humans; Kidney; Kidney Di | 2020 |
Regulation of bone cell function by acid-base balance.
Topics: Acid-Base Equilibrium; Acid-Base Imbalance; Acidosis; Aging; Bicarbonates; Bone and Bones; Bone Reso | 2003 |
Changes in upper gastrointestinal physiology with age.
Topics: Aging; Bicarbonates; Humans; Mucus; Upper Gastrointestinal Tract | 2004 |
Human pancreatic exocrine response to nutrients in health and disease.
Topics: Aging; Bicarbonates; Bile Acids and Salts; Diabetes Mellitus; Diet; Dietary Carbohydrates; Dietary P | 2005 |
[Aminoglycoside nephrotoxicity. II. Transtubular transport and factors modifying aminoglycoside nephrotoxicity].
Topics: Aging; Aminoglycosides; Anti-Bacterial Agents; Bicarbonates; Biological Transport; Dehydration; Dext | 1980 |
Kidney function after unilateral nephrectomy.
Topics: Adaptation, Physiological; Aging; Animals; Bicarbonates; Dogs; Glomerular Filtration Rate; Humans; H | 1984 |
Peptic ulcer disease in the elderly.
Topics: Adult; Aged; Aged, 80 and over; Aging; Anti-Inflammatory Agents, Non-Steroidal; Bicarbonates; Duoden | 1994 |
Diet, evolution and aging--the pathophysiologic effects of the post-agricultural inversion of the potassium-to-sodium and base-to-chloride ratios in the human diet.
Topics: Acid-Base Equilibrium; Acidosis; Aging; Agriculture; Bicarbonates; Biological Evolution; Bone and Bo | 2001 |
Acid-base imbalance and the skeleton.
Topics: Acid-Base Imbalance; Acidosis; Acidosis, Respiratory; Aging; Bicarbonates; Bone and Bones; Bone Remo | 2001 |
[Ammonium chloride and the calcium chloride loading test for the diagnosis of renal tubular acidosis].
Topics: Acidosis, Renal Tubular; Aging; Ammonium Chloride; Bicarbonates; Calcium Chloride; Carbon Dioxide; D | 1985 |
4 trials available for hydrogen carbonate and Aging
| Article | Year |
|---|---|
Association of Urinary Citrate With Acid-Base Status, Bone Resorption, and Calcium Excretion in Older Men and Women.
Topics: Acid-Base Equilibrium; Aged; Aged, 80 and over; Aging; Bicarbonates; Bone Remodeling; Bone Resorptio | 2018 |
Protein turnover modifications induced by the protein feeding pattern still persist after the end of the diets.
Topics: Adaptation, Physiological; Adult; Aged; Aging; Bicarbonates; Blood Glucose; Carbon Isotopes; Deuteri | 2000 |
Acid-base balance during repeated cycling sprints in boys and men.
Topics: Acid-Base Equilibrium; Adult; Aging; Arteries; Bicarbonates; Bicycling; Blood; Carbon Dioxide; Child | 2002 |
Effects of pentazocine upon arterial blood gases. A study in elderly subjects.
Topics: Acid-Base Equilibrium; Aged; Aging; Bicarbonates; Blood Pressure; Body Weight; Carbon Dioxide; Dose- | 1974 |
85 other studies available for hydrogen carbonate and Aging
| Article | Year |
|---|---|
Aging, metabolic acidosis and renal failure: Interactive accelerating processes.
Topics: Acidosis; Adolescent; Adult; Aged; Aged, 80 and over; Aging; Animals; Bicarbonates; Cohort Studies; | 2019 |
Serum Biochemical Analytes and Trace Elements in Juvenile Whooping Cranes (
Topics: Acid-Base Equilibrium; Aging; Alkaline Phosphatase; Animals; Animals, Wild; Aspartate Aminotransfera | 2019 |
Mechanisms for falling urine pH with age in stone formers.
Topics: Adult; Aging; Ammonia; Anions; Bicarbonates; Body Mass Index; Female; Gastrointestinal Tract; Glomer | 2019 |
In chronic kidney disease, serum α-Klotho is related to serum bicarbonate and proteinuria.
Topics: Adult; Aging; Bicarbonates; Biomarkers; C-Reactive Protein; Creatinine; Cross-Sectional Studies; Fem | 2014 |
Arterialized venous bicarbonate is associated with lower bone mineral density and an increased rate of bone loss in older men and women.
Topics: Aged; Aging; Bicarbonates; Blood Gas Analysis; Body Composition; Bone Density; Bone Resorption; Coho | 2015 |
Centrifugation stress reduces the responsiveness of spermatozoa to a capacitation stimulus in in vitro-aged semen.
Topics: Acrosome; Aging; Animals; Bicarbonates; Calcium; Centrifugation, Density Gradient; Cryopreservation; | 2015 |
Bicarbonate Concentration, Acid-Base Status, and Mortality in the Health, Aging, and Body Composition Study.
Topics: Acid-Base Equilibrium; Acidosis; Age Factors; Aged; Aging; Alkalosis; Bicarbonates; Biomarkers; Blac | 2016 |
Acclimation to heat during incubation: 3. Body weight, cloacal temperatures, and blood acid-base balance in broilers exposed to daily high temperatures.
Topics: Acclimatization; Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Blood Gas Analysis; Body Tempe | 2008 |
Mechanisms of seawater acclimation in a primitive, anadromous fish, the green sturgeon.
Topics: Acclimatization; Aging; Analysis of Variance; Animals; Bicarbonates; Body Weight; Calcium; Californi | 2009 |
Posttranslational mechanisms associated with reduced NHE3 activity in adult vs. young prehypertensive SHR.
Topics: Absorption; Aging; Animals; Bicarbonates; Blood Pressure; Dipeptidyl Peptidase 4; Disease Models, An | 2010 |
Severe metabolic acidosis causes early lethality in NBC1 W516X knock-in mice as a model of human isolated proximal renal tubular acidosis.
Topics: Acidosis; Acidosis, Renal Tubular; Age Factors; Aging; Analysis of Variance; Anemia; Animals; Aquapo | 2011 |
Telomere shortening is associated with reduced duodenal HCOFormula secretory but normal gastric acid secretory capacity in aging mice.
Topics: Aging; Animals; Bicarbonates; Duodenum; Gastric Acid; Intestinal Mucosa; Mice; Mice, Inbred C57BL; M | 2012 |
Myocardial protection of immature rabbits: polarizing versus depolarizing.
Topics: Aging; Animals; Bicarbonates; Body Water; Calcium Chloride; Cardiotonic Agents; Coronary Circulation | 2003 |
PHOSPHATE AND PROTEIN CONCENTRATIONS OF INTRAOCULAR FLUIDS. I. EFFECT OF CARBONIC ANHYDRASE INHIBITION IN YOUNG AND OLD RABBITS.
Topics: Aging; Animals; Aqueous Humor; Ascorbic Acid; Bicarbonates; Blood Chemical Analysis; Carbonic Anhydr | 1963 |
Diagnosis of acute renal failure in very preterm infants.
Topics: Acute Kidney Injury; Aging; Bicarbonates; Creatinine; Diuresis; Gestational Age; Glomerular Filtrati | 2004 |
Sodium and anion transport across the avian uterine (shell gland) epithelium.
Topics: Aging; Animals; Anions; Bicarbonates; Chickens; Chloride Channels; Chlorides; Cyclic AMP; Egg Shell; | 2005 |
Donor characteristics associated with liver graft survival.
Topics: Acidosis; Adolescent; Adult; Aged; Aging; Bicarbonates; Female; Graft Survival; Humans; Hypertension | 2005 |
Relative contribution of V-H+ATPase and NA+/H+ exchanger to bicarbonate reabsorption in proximal convoluted tubules of old rats.
Topics: Aging; Amiloride; Animals; Bicarbonates; Blotting, Western; Hydrogen-Ion Concentration; Kidney Tubul | 2006 |
Relationship between bicarbonate retention and bone characteristics in broiler chickens.
Topics: Aging; Amino Acids; Animal Nutritional Physiological Phenomena; Animals; Bicarbonates; Body Weight; | 2006 |
Changes in acid-base balance and related physiological responses as a result of external hypercapnia during the second half of incubation in the chicken embryo.
Topics: Acid-Base Equilibrium; Acidosis; Aging; Alkalosis; Animals; Bicarbonates; Carbon Dioxide; Chick Embr | 2008 |
Phosphoenolpyruvate carboxykinase and pyruvate carboxylase in developing rat liver.
Topics: Aging; Animals; Animals, Newborn; Bicarbonates; Carbon Isotopes; Carboxy-Lyases; Cell Nucleus; Centr | 1967 |
The turnover of liver cytosol proteins in very old rats.
Topics: Aging; Animals; Bicarbonates; Cathepsin D; Cathepsins; Cytosol; Female; Half-Life; Liver; Proteins; | 1981 |
Development of solute transport in rabbit proximal tubule. III. Na-K-ATPase activity.
Topics: Aging; Animals; Bicarbonates; Kidney Medulla; Kidney Tubules, Proximal; Microscopy, Electron; Ouabai | 1984 |
Gas exchange, blood gases and acid-base status in the chick before, during and after hatching.
Topics: Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Carbon Dioxide; Chick Embryo; Chickens; Extraem | 1983 |
Exocrine pancreatic function in the elderly.
Topics: Adult; Aged; Aging; Bicarbonates; Chymotrypsin; Female; Humans; Lipase; Male; Middle Aged; Pancreas; | 1983 |
Normal maturational changes in bone matrix, mineral, and crystal size in the rat.
Topics: Aging; Animals; Bicarbonates; Bone Matrix; Calcium; Carbonates; Crystallography; Hydroxyproline; Mag | 1980 |
Changes in pH with age in Drosophila and the influence of buffers on longevity.
Topics: Aging; Animals; Bicarbonates; Buffers; Carbonic Anhydrases; Drosophila melanogaster; HEPES; Hydrogen | 1981 |
[Acute disorders of the acid-base balance in the aged].
Topics: Acid-Base Imbalance; Acidosis, Respiratory; Aged; Aging; Bicarbonates; Carbonic Acid; Diabetes Melli | 1981 |
Kinetic characteristics of bicarbonate-chloride exchange across the neonatal human red cell membrane.
Topics: Adult; Aging; Bicarbonates; Biological Transport, Active; Chlorides; Erythrocyte Membrane; Erythrocy | 1982 |
The effects of strain, age, time after oviposition, and egg specific gravity on acid-base balance in White Leghorn hens.
Topics: Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Calcium; Chickens; Female; Oviposition; Species | 1981 |
Developmental differences in myocardial protection in response to 5'-nucleotidase inhibition.
Topics: 5'-Nucleotidase; Aging; Animals; Animals, Newborn; Bicarbonates; Calcium Chloride; Cardiac Output; C | 1994 |
Cl-/HCO3- exchange function differs in adult and fetal rat hippocampal neurons.
Topics: Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Chlorides; Female; Fluorescent Dyes; Hippocampu | 1993 |
pH regulation in single CA1 neurons acutely isolated from the hippocampi of immature and mature rats.
Topics: Aging; Animals; Bicarbonates; Carbon Dioxide; Fluoresceins; Fluorescent Dyes; Hippocampus; Hydrogen- | 1996 |
Involvement of neuronal anion exchange proteins in cell death in Alzheimer's disease.
Topics: Aging; Alzheimer Disease; Ankyrins; Antibody Specificity; Antiporters; Astrocytes; Bicarbonates; Cel | 1997 |
Effect of age on blood acid-base composition in adult humans: role of age-related renal functional decline.
Topics: Acid-Base Equilibrium; Adolescent; Adult; Aged; Aging; Bicarbonates; Carbon Dioxide; Chlorides; Fema | 1996 |
The clinical spectrum of chronic metabolic acidosis: homeostatic mechanisms produce significant morbidity.
Topics: Acid-Base Equilibrium; Acidosis; Aging; Bicarbonates; Bone and Bones; Chronic Disease; Homeostasis; | 1997 |
Myasthenic crisis: clinical features, mortality, complications, and risk factors for prolonged intubation.
Topics: Adult; Aged; Aged, 80 and over; Aging; Bicarbonates; Female; Humans; Infections; Lung; Male; Middle | 1997 |
Glycine-activated currents are changed by coincident membrane depolarization in developing rat auditory brainstem neurones.
Topics: Aging; Animals; Animals, Newborn; Auditory Pathways; Bicarbonates; Calcium; Chlorides; Evoked Potent | 1998 |
Effects of age on gastric alkaline and nonparietal fluid secretion in humans.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Aging; Alkalies; Bicarbonates; Body Fluids; Electrolytes | 1998 |
The aging stomach.
Topics: Aged; Aging; Bicarbonates; Gastric Mucosa; Humans; Mucoproteins | 1998 |
Neonatal rabbit proximal tubule basolateral membrane Na+/H+ antiporter and Cl-/base exchange.
Topics: 4,4'-Diisothiocyanostilbene-2,2'-Disulfonic Acid; Acetazolamide; Aging; Amiloride; Animals; Animals, | 1999 |
Age-related effects of St Thomas' Hospital cardioplegic solution on isolated cardiomyocyte cell volume.
Topics: Aging; Animals; Bicarbonates; Calcium Chloride; Cardiomyopathies; Cardioplegic Solutions; Cell Size; | 1999 |
Time course of the response to recombinant growth hormone in acidotic mice.
Topics: Acidosis; Aging; Animal Nutritional Physiological Phenomena; Animals; Bicarbonates; Body Height; Bod | 2000 |
In vitro and in vivo evaluation of proximal tubular acidification in aging rats.
Topics: Acids; Aging; Animals; Bicarbonates; Blotting, Western; Hydrogen-Ion Concentration; In Vitro Techniq | 2001 |
[Studies of the presence of enzymes in various tissues of swine. 5. Studies of the activity and properties of adenosine triphosphatases in the pancreas].
Topics: Adenosine Triphosphatases; Aging; Animals; Bicarbonates; Calcium; Calcium-Transporting ATPases; Hydr | 1979 |
[The secretory function of the pancreas and the ageing progress (author's transl)].
Topics: Adult; Aged; Aging; Amylases; Bicarbonates; Blood Glucose; Cholecystokinin; Female; Humans; Hydrochl | 1976 |
Amino acid content of rat renal cortex and the response to in vitro incubation.
Topics: Aging; Amino Acids; Animals; Animals, Newborn; Bicarbonates; Culture Media; Cycloheximide; Female; I | 1979 |
A comparative study of the response to an oral NaCl and NaHCO3 load in newborn preterm and full term infants.
Topics: Aging; Bicarbonates; Body Water; Humans; Infant, Newborn; Infant, Premature; Kidney Tubules, Distal; | 1977 |
[Functional condition of the pancreas in aging].
Topics: Adolescent; Adult; Age Factors; Aged; Aging; Amylases; Bicarbonates; Chlorides; Humans; Lipase; Midd | 1976 |
Pyrimidine biosynthesis and its regulation in the developing rat brain.
Topics: Aging; Animals; Animals, Newborn; Aspartic Acid; Azauridine; Bicarbonates; Brain; Female; Fetus; Mal | 1976 |
13CO2 washout dynamics during intermittent exercise in children and adults.
Topics: Adult; Aging; Anaerobic Threshold; Arm; Bicarbonates; Carbon Dioxide; Carbon Isotopes; Child; Exerci | 1992 |
Effect of aging on gastric and duodenal mucosal prostaglandin concentrations in humans.
Topics: Adult; Aged; Aged, 80 and over; Aging; Bicarbonates; Duodenum; Gastric Acid; Gastric Mucosa; Gastrit | 1992 |
Maturational differences in acetazolamide-altered pH and HCO3 of choroid plexus, cerebrospinal fluid, and brain.
Topics: Acetazolamide; Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Blood; Brain; Choroid Plexus; Di | 1992 |
[Aging and exocrine pancreatic function evaluated by the recently standardized secretin test].
Topics: Adult; Aged; Aging; Amylases; Bicarbonates; Female; Humans; Lipase; Male; Middle Aged; Pancreas; Pan | 1991 |
Changes in pancreatic exocrine secretion with age: pancreatic exocrine secretion does decrease in the elderly.
Topics: Adult; Aged; Aged, 80 and over; Aging; Bicarbonates; Chymotrypsin; Female; Humans; Lipase; Male; Mid | 1991 |
Salt sensitivity and resistance of blood pressure. Age and race as factors in physiological responses.
Topics: Aging; Bicarbonates; Black People; Blood Pressure; Diet; Diet, Sodium-Restricted; Drug Resistance; F | 1991 |
Age-related changes in the efficacy of crystalloid cardioplegia.
Topics: Aging; Animals; Aorta; Bicarbonates; Calcium Chloride; Coronary Disease; Heart Arrest, Induced; Hemo | 1991 |
Effects of diltiazem as an additive to St Thomas's Hospital cardioplegic solution in isolated neonatal and adult rabbit hearts.
Topics: Aging; Animals; Bicarbonates; Calcium Chloride; Coronary Disease; Diltiazem; Dose-Response Relations | 1991 |
Bicarbonate secretory breakdown: explanation for increased incidence of duodenal ulcer with age?
Topics: Adult; Aged; Aging; Animals; Bicarbonates; Dinoprostone; Duodenal Ulcer; Duodenum; Female; Humans; H | 1991 |
Maturation of HCO3- transport in rabbit collecting duct.
Topics: Absorption; Aging; Animals; Animals, Newborn; Bicarbonates; Biological Transport; Chlorides; In Vitr | 1990 |
Factors affecting the efficiency of nuclear transplantation in the rabbit embryo.
Topics: Aging; Animals; Bicarbonates; Cell Nucleus; Cytochalasin B; Electric Stimulation; Embryo Transfer; E | 1990 |
Effects of aging on duodenal bicarbonate secretion.
Topics: Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Dinoprostone; Duodenum; Intestinal Mucosa; Male | 1990 |
Exocrine pancreatic secretion in the elderly.
Topics: Adult; Aged; Aging; Amylases; Bicarbonates; Chymotrypsin; Female; Humans; Lipase; Male; Pancreatic J | 1988 |
Aging and pancreatic exocrine function. Studies in female conscious rats.
Topics: Aging; Animals; Bicarbonates; Female; Pancreas; Pancreatic Juice; Proteins; Rats; Rats, Inbred F344; | 1989 |
Maturation of chloride-bicarbonate exchange in rat ileal brush border membrane vesicles.
Topics: Aging; Animals; Animals, Suckling; Bicarbonates; Chlorides; Ileum; In Vitro Techniques; Microvilli; | 1989 |
Use of 13C-labeled glucose for estimating glucose oxidation: some design considerations.
Topics: Adult; Aged; Aging; Bicarbonates; Blood Glucose; Carbon Dioxide; Carbon Isotopes; Humans; Kinetics; | 1987 |
Regulation of pH and HCO3 in brain and CSF of the developing mammalian central nervous system.
Topics: Acidosis; Aging; Alkalosis; Animals; Bicarbonates; Brain; Carbon Dioxide; Dimethadione; Hydrogen-Ion | 1988 |
Age-related changes in the ability of hypothermia and cardioplegia to protect ischemic rabbit myocardium.
Topics: Aging; Animals; Bicarbonates; Calcium Chloride; Cardioplegic Solutions; Coronary Circulation; Heart; | 1988 |
The immature and the mature myocardium. Responses to multidose crystalloid cardioplegia.
Topics: Adenosine Triphosphate; Aging; Animals; Bicarbonates; Calcium Chloride; Cardioplegic Solutions; Glyc | 1988 |
Physiological changes in the cornea of the ageing eye.
Topics: Aged; Aged, 80 and over; Aging; Bicarbonates; Biological Transport, Active; Cell Membrane Permeabili | 1987 |
Aging and pancreatic exocrine function: studies in conscious male rats.
Topics: Aging; Animals; Bicarbonates; Bile; Dose-Response Relationship, Drug; Female; Male; Pancreas; Pancre | 1987 |
Effect of aging on pancreatic secretion in rats.
Topics: Aging; Animals; Bicarbonates; Dose-Response Relationship, Drug; Male; Pancreas; Pancreatic Juice; Pr | 1985 |
Development of lipogenesis in rat brain cortex: the differential incorporation of glucose and acetate into brain lipids in vitro.
Topics: Acetates; Acetyl-CoA Carboxylase; Aging; Animals; Animals, Newborn; ATP Citrate (pro-S)-Lyase; Bicar | 1974 |
Regulation of DNA synthesis in fat cells and stromal elements from rat adipose tissue.
Topics: Acetone; Adipose Tissue; Aging; Animals; Bicarbonates; Centrifugation; Chromatography; DNA; Epididym | 1969 |
Development of mitochondrial pyruvate metabolism in rat brain.
Topics: Aconitate Hydratase; Aging; Alanine Transaminase; Animals; Animals, Newborn; Antigen-Antibody Reacti | 1974 |
Change of the relative proportion of various forms of phosphoenolpyruvate carboxykinase in chicken liver possibly associated with enhanced gluconeogenesis.
Topics: Aging; Animals; Bicarbonates; Carbon Radioisotopes; Chickens; Chromatography, Ion Exchange; Cold Tem | 1974 |
The influence of maturity on renal control of acidosis in newborn infants.
Topics: Acid-Base Equilibrium; Acidosis; Aging; Ammonia; Ammonium Chloride; Bicarbonates; Birth Weight; Bloo | 1972 |
Body weight and the distribution of newly synthesized glucose in the fasted rat.
Topics: Aging; Animals; Bicarbonates; Blood Glucose; Body Weight; Carbon Isotopes; Fasting; Female; Glucose; | 1972 |
[Age-induced peculiarities of pancreatic excretion].
Topics: Adult; Age Factors; Aged; Aging; Amylases; Bicarbonates; Duodenum; Female; Humans; Intestinal Secret | 1972 |
The prevalence of carbon-13 in respiratory carbon dioxide as an indicator of the types of endogenous substrate. The change from lipid to carbohydrate during the respiratory rise in potato slices.
Topics: Aging; Bicarbonates; Carbon; Carbon Dioxide; Carbon Isotopes; Hydrogen-Ion Concentration; Lipid Meta | 1970 |
Carboxylation of pyruvate by human adipose tissue mitochondria.
Topics: Abdomen; Adipose Tissue; Adult; Aging; Animals; Bicarbonates; Carbon Isotopes; Citrates; Coenzyme A; | 1970 |
Biochemical normals in Nigerians with particular reference to electrolytes and urea.
Topics: Adolescent; Adult; Aging; Bicarbonates; Calcium; Child; Child, Preschool; Electrolytes; Female; Huma | 1970 |
Sex differences in the acid-base balance of adult and immature fowl.
Topics: Acid-Base Equilibrium; Aging; Animals; Bicarbonates; Calcification, Physiologic; Calcium; Chickens; | 1970 |
Effect of acute acid loading on urinary acid excretion by the aging human kidney.
Topics: Acid-Base Equilibrium; Adolescent; Adult; Aged; Aging; Amino Acids; Ammonia; Ammonium Chloride; Bica | 1968 |
The effect of repeated stimulation of the pancreas on the pancreatic secretion in young and aged men.
Topics: Adolescent; Adult; Aged; Aging; Amylases; Bicarbonates; Cholecystokinin; Humans; Male; Middle Aged; | 1969 |