guaifenesin has been researched along with Edema in 34 studies
Guaifenesin: An expectorant that also has some muscle relaxing action. It is used in many cough preparations.
Edema: Abnormal fluid accumulation in TISSUES or body cavities. Most cases of edema are present under the SKIN in SUBCUTANEOUS TISSUE.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Previous studies have investigated the short-term effect of capsaicin on edema formation and goblet-cell secretion in the trachea." | 7.72 | Spontaneous remission of edema and regranulation of goblet cells in rat tracheae after capsaicin-induced acute inflammation. ( Guo, JJ; Huang, HT; Wang, DS, 2003) |
| "Pirenzepine has been widely used for the treatment of gastric and duodenal ulcer." | 5.27 | Pirenzepine as anti-inflammatory drug in a model of experimental colitis in rat. ( Bustos-Fernández, L; Celener, D; González, E; Hamamura, S; Kofoed, JA; Ledesma de Paolo, MI; Schiffrin, E, 1987) |
| " subterranea (EEVS) was investigated for its gastroprotective effects on aspirin plus pylorus ligation-induced gastric ulcerated rats using an in vivo assay." | 3.88 | Protective roles of Vigna subterranea (Bambara nut) in rats with aspirin-induced gastric mucosal injury. ( Balogun, ME; Besong, EE; Djobissie, FSA; Mbamalu, OS; Obimma, JN, 2018) |
| "Previous studies have investigated the short-term effect of capsaicin on edema formation and goblet-cell secretion in the trachea." | 3.72 | Spontaneous remission of edema and regranulation of goblet cells in rat tracheae after capsaicin-induced acute inflammation. ( Guo, JJ; Huang, HT; Wang, DS, 2003) |
| "In the present study the antiinflammatory activity of fusidic acid was investigated in a model of formalin-induced edema formation in rats." | 3.71 | The effects of fusidic acid on the inflammatory response in rats. ( Batu, O; Erol, K; Kilic, FS; Usluer, G; Yildirim, E, 2002) |
| "Diarrhea was seen after 16 hr, accompanying severe peritonitis." | 1.29 | Intestinal injuries caused by experimental palytoxicosis in mice. ( Ito, E; Ohkusu, M; Yasumoto, T, 1996) |
| "The tracheo-bronchial mucus viscosity was also significantly reduced (bronchitic animals) as was the fucose and total protein content." | 1.28 | 2-(2,3-Dihydro-5-acetoxy-4,6,7-tribenzofuranyl)acetic acid (IRFI 016): a new antioxidant mucoactive drug. ( Giannetti, P; Paesano, A; Scuri, R, 1990) |
| "Pirenzepine has been widely used for the treatment of gastric and duodenal ulcer." | 1.27 | Pirenzepine as anti-inflammatory drug in a model of experimental colitis in rat. ( Bustos-Fernández, L; Celener, D; González, E; Hamamura, S; Kofoed, JA; Ledesma de Paolo, MI; Schiffrin, E, 1987) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 17 (50.00) | 18.7374 |
| 1990's | 6 (17.65) | 18.2507 |
| 2000's | 4 (11.76) | 29.6817 |
| 2010's | 5 (14.71) | 24.3611 |
| 2020's | 2 (5.88) | 2.80 |
| Authors | Studies |
|---|---|
| Coelho Thomazi, GO | 1 |
| da Costa, A | 1 |
| Rodrigues, JP | 1 |
| Alves, GJ | 1 |
| Prezotto Neto, JP | 1 |
| de Oliveira Turíbio, T | 1 |
| Rocha, AM | 1 |
| da Silva Aires, R | 1 |
| Seibert, CS | 2 |
| Spencer, PJ | 1 |
| Galisteo Júnior, AJ | 1 |
| de Andrade Júnior, HF | 1 |
| do Nascimento, N | 1 |
| Oliveira, RG | 1 |
| Damazo, AS | 1 |
| Antonielli, LF | 1 |
| Miyajima, F | 1 |
| Pavan, E | 1 |
| Duckworth, CA | 1 |
| Lima, JCDS | 1 |
| Arunachalam, K | 1 |
| Martins, DTO | 1 |
| Sáenz, A | 1 |
| Ortiz, N | 1 |
| Lomonte, B | 1 |
| Rucavado, A | 1 |
| Díaz, C | 1 |
| Balogun, ME | 1 |
| Besong, EE | 1 |
| Obimma, JN | 1 |
| Mbamalu, OS | 1 |
| Djobissie, FSA | 1 |
| Eller, R | 1 |
| Ginsburg, M | 1 |
| Lurie, D | 1 |
| Heman-Ackah, Y | 1 |
| Lyons, K | 1 |
| Sataloff, R | 1 |
| Hamdan, AL | 1 |
| Sibai, A | 1 |
| Mahfoud, L | 1 |
| Oubari, D | 1 |
| Ashkar, J | 1 |
| Fuleihan, N | 1 |
| Monteiro-dos-Santos, J | 1 |
| Conceição, K | 1 |
| Marques, EE | 1 |
| Silva, PI | 1 |
| Soares, AB | 1 |
| Lima, C | 1 |
| Lopes-Ferreira, M | 1 |
| Postiaux, G | 1 |
| Zwaenepoel, B | 1 |
| Louis, J | 1 |
| Guo, JJ | 1 |
| Wang, DS | 1 |
| Huang, HT | 1 |
| CAPORAL, R | 1 |
| Hogg, JC | 2 |
| Bookman, R | 1 |
| Ito, E | 1 |
| Ohkusu, M | 1 |
| Yasumoto, T | 1 |
| Church, MK | 1 |
| Levi-Schaffer, F | 1 |
| Furuya, S | 1 |
| Naruse, S | 1 |
| Hayakawa, T | 1 |
| Fahy, JV | 1 |
| Corry, DB | 1 |
| Boushey, HA | 1 |
| Kilic, FS | 1 |
| Erol, K | 1 |
| Batu, O | 1 |
| Yildirim, E | 1 |
| Usluer, G | 1 |
| Rainsford, KD | 1 |
| Whitehouse, MW | 1 |
| Tos, M | 1 |
| Mogensen, C | 1 |
| Woodson, BT | 1 |
| Garancis, JC | 1 |
| Toohill, RJ | 1 |
| Piacentini, GL | 1 |
| Kaliner, MA | 1 |
| Scuri, R | 1 |
| Giannetti, P | 1 |
| Paesano, A | 1 |
| Kaliner, M | 2 |
| Bustos-Fernández, L | 1 |
| González, E | 1 |
| Kofoed, JA | 1 |
| Hamamura, S | 1 |
| Schiffrin, E | 1 |
| Celener, D | 1 |
| Ledesma de Paolo, MI | 1 |
| Boquoi, E | 1 |
| Kreuzer, G | 1 |
| Krempien, B | 1 |
| Wanke, M | 1 |
| Ritz, E | 1 |
| Shalygina, NB | 1 |
| Dahlgren, SE | 1 |
| Dalen, H | 1 |
| Dalhamm, T | 1 |
| Waldhalm, DG | 1 |
| Hall, RF | 1 |
| Meinershagen, WA | 1 |
| Card, CS | 1 |
| Frank, FW | 1 |
| Swales, JD | 1 |
| Tange, JD | 1 |
| Evans, DJ | 1 |
| Anderson, AE | 1 |
| Foraker, AG | 1 |
| Willems, G | 1 |
| Gerard, A | 1 |
| Verbeustel, S | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Multicenter Randomized Controlled Trial: Evaluation of the Effects of Respiratory Physiotherapy, Placebo-controlled, in Infants With Moderate Acute Bronchiolitis[NCT03753802] | 168 participants (Anticipated) | Interventional | 2019-12-01 | Recruiting | |||
| Measurement of Pharyngeal Sensitivity With the SENSITEST Device: Validation of the Diagnosis Algorithm for Sleep Disordered Breathing[NCT00885573] | 52 participants (Actual) | Interventional | 2008-12-31 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
7 reviews available for guaifenesin and Edema
| Article | Year |
|---|---|
Chest physical therapy in acute viral bronchiolitis: an updated review.
Topics: Airway Obstruction; Algorithms; Bronchiolitis, Viral; Edema; Humans; Infant; Mucus; Nebulizers and V | 2013 |
The pathology of asthma.
Topics: Asthma; Bronchi; Bronchial Spasm; Edema; Humans; Mucous Membrane; Mucus; Muscle, Smooth | 1984 |
The human mast cell.
Topics: Bronchoconstriction; Cell Communication; Cell Differentiation; Cell Division; Cytokines; Edema; Endo | 1997 |
Airway inflammation and remodeling in asthma.
Topics: Airway Obstruction; Asthma; Basement Membrane; Bronchi; Bronchial Hyperreactivity; Bronchitis; Const | 2000 |
The potential roles of leukotrienes in bronchial asthma.
Topics: Airway Obstruction; Asthma; Edema; Humans; Hypersensitivity, Immediate; Leukotriene Antagonists; Leu | 1991 |
Mechanisms of glucocorticosteroid action in bronchial asthma.
Topics: Adenylyl Cyclases; Arachidonic Acid; Arachidonic Acids; Asthma; Basophils; Bronchial Spasm; Capillar | 1985 |
Mast cell mediators and asthma.
Topics: Animals; Asthma; Autacoids; Bronchial Spasm; Cytoplasmic Granules; Edema; Humans; Immunoglobulin E; | 1987 |
27 other studies available for guaifenesin and Edema
| Article | Year |
|---|---|
Paratrygon aiereba irradiated anti-mucus serum reduce edematogenic activity induced in experimental model.
Topics: Animals; Bites and Stings; Brazil; Edema; Elasmobranchii; Enzyme-Linked Immunosorbent Assay; Fresh W | 2020 |
Dilodendron bipinnatum Radlk. extract alleviates ulcerative colitis induced by TNBS in rats by reducing inflammatory cell infiltration, TNF-α and IL-1β concentrations, IL-17 and COX-2 expressions, supporting mucus production and promotes an antioxidant ef
Topics: Animals; Antioxidants; Brazil; Caco-2 Cells; Cell Survival; Colitis, Ulcerative; Cyclooxygenase 2; D | 2021 |
Comparison of biochemical and cytotoxic activities of extracts obtained from dorsal spines and caudal fin of adult and juvenile non-native Caribbean lionfish (Pterois volitans/miles).
Topics: Age Factors; Animal Fins; Animals; Bone and Bones; Cattle; Cell Line; Cytotoxins; Edema; Fish Venoms | 2017 |
Protective roles of Vigna subterranea (Bambara nut) in rats with aspirin-induced gastric mucosal injury.
Topics: Animals; Anti-Ulcer Agents; Antioxidants; Aspirin; Edema; Gastric Mucosa; Gastrointestinal Agents; G | 2018 |
Flexible laryngoscopy: a comparison of fiber optic and distal chip technologies-part 2: laryngopharyngeal reflux.
Topics: Edema; Erythema; Fiber Optic Technology; Humans; Laryngeal Diseases; Laryngoscopes; Laryngoscopy; Mu | 2009 |
Short term effect of hubble-bubble smoking on voice.
Topics: Adolescent; Adult; Edema; Equipment Design; Erythema; Female; Health Knowledge, Attitudes, Practice; | 2011 |
Studies on pharmacological properties of mucus and sting venom of Potamotrygon cf. henlei.
Topics: Animals; Anti-Infective Agents; Bacteria; Brazil; Edema; Elasmobranchii; Female; Fish Venoms; Fishes | 2011 |
Spontaneous remission of edema and regranulation of goblet cells in rat tracheae after capsaicin-induced acute inflammation.
Topics: Acute Disease; Animals; Capsaicin; Cytoplasmic Granules; Disease Models, Animal; Edema; Goblet Cells | 2003 |
[Value of the treatment of surgical edema by a new diffusion factor: 84-04-C].
Topics: Diffusion; Edema; Mucus | 1960 |
The pathophysiology of asthma.
Topics: Animals; Asthma; Bronchial Spasm; Bronchitis; Edema; Guinea Pigs; Humans; Lung; Mast Cells; Mucous M | 1982 |
Ruminations on an atavism.
Topics: Bronchial Spasm; Edema; Humans; Hypersensitivity; Mucus; Respiratory Hypersensitivity | 1980 |
Intestinal injuries caused by experimental palytoxicosis in mice.
Topics: Acrylamides; Animals; Cnidarian Venoms; Diarrhea; Edema; Epithelium; Injections, Intraperitoneal; In | 1996 |
Intravenous injection of guanylin induces mucus secretion from goblet cells in rat duodenal crypts.
Topics: Animals; Atropine; Cell Count; Duodenum; Edema; Gastrointestinal Hormones; Hexamethonium; Humans; In | 1998 |
The effects of fusidic acid on the inflammatory response in rats.
Topics: Animals; Blood Cell Count; Edema; Foot; Formaldehyde; Fusidic Acid; Gastric Mucosa; Inflammation; Ma | 2002 |
Gastric mucus effusion elicited by oral copper compounds: potential anti-ulcer activity.
Topics: Administration, Oral; Animals; Aspirin; Copper; Edema; Female; Foot; Gastric Mucosa; Hindlimb; Hydro | 1976 |
Pathogenesis of nasal polyps.
Topics: Adult; Child; Edema; Epithelium; Exocrine Glands; Granulation Tissue; Humans; Mucus; Nasal Mucosa; N | 1977 |
Histopathologic changes in snoring and obstructive sleep apnea syndrome.
Topics: Atrophy; Dilatation, Pathologic; Edema; Exocrine Glands; Fibrosis; Humans; Hypertrophy; Male; Metapl | 1991 |
2-(2,3-Dihydro-5-acetoxy-4,6,7-tribenzofuranyl)acetic acid (IRFI 016): a new antioxidant mucoactive drug.
Topics: Abscess; Animals; Antioxidants; Benzofurans; Bronchi; Carbon Tetrachloride Poisoning; Carrageenan; C | 1990 |
Pirenzepine as anti-inflammatory drug in a model of experimental colitis in rat.
Topics: Acetates; Acetic Acid; Animals; Colitis; Colon; Colonic Diseases; Edema; Male; Mucus; Pirenzepine; R | 1987 |
[Histomorphological investigations of endometrial carcinoma during progestional treatment with chlormadione acetate (author's transl)].
Topics: Adenocarcinoma; Aged; Carcinoma; Carcinoma, Papillary; Cell Transformation, Neoplastic; Chlormadinon | 1973 |
[Histochemical studies of gastric mucosa synthesis of mucous materials in uremia].
Topics: Animals; Edema; Female; Gastric Mucosa; Histocytochemistry; Humans; Male; Mucus; Rats; Uremia | 1973 |
[Functional morphology of the mucous membrane of the small intestine in patients with cholera (according to aspiration biopsy data)].
Topics: Adenosine Triphosphatases; Alkaline Phosphatase; Biopsy, Needle; Capillaries; Carrier State; Cholera | 1974 |
Ultrastructural observations on chemically induced inflammation in guinea pig trachea.
Topics: Aldehydes; Animals; Cilia; Edema; Epithelial Cells; Female; Freeze Drying; Guinea Pigs; Inclusion Bo | 1972 |
Haemophilus somnus infection in the cow as a possible contributing factor to weak calf syndrome: isolation and animal inoculation studies.
Topics: Animals; Animals, Newborn; Arthritis, Infectious; Breeding; Cattle; Cattle Diseases; Edema; Female; | 1974 |
Intestinal ammonia in uraemia: the effect of a urease inhibitor, acetohydroxamic acid.
Topics: Ammonia; Animals; Blood Proteins; Cecum; Colitis; Colon; Edema; Erythrocytes; Hydroxamic Acids; Infl | 1972 |
Bronchorrhea or bronchitis?
Topics: Bronchi; Bronchial Diseases; Bronchitis; Cilia; Diagnosis, Differential; Edema; Epithelium; Exocrine | 1971 |
Histochemical and histo-autoradiographical changes in gastric mucosa of dogs submitted to chronic cortisone administration.
Topics: Animals; Autoradiography; Biopsy; Cortisone; Dogs; Edema; Female; Gastric Mucosa; Glycoproteins; His | 1971 |