guaifenesin has been researched along with Airway Obstruction in 208 studies
Guaifenesin: An expectorant that also has some muscle relaxing action. It is used in many cough preparations.
Airway Obstruction: Any hindrance to the passage of air into and out of the lungs.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Corticosteroid treatment reduces cough frequency concurrently with reductions in deltaPpl(max) and mucus accumulation in RAO-affected horses." | 2.71 | Coughing, mucus accumulation, airway obstruction, and airway inflammation in control horses and horses affected with recurrent airway obstruction. ( Berney, C; Cornelisse, CJ; deFeijter-Rupp, HL; Derksen, FJ; Eberhart, S; Gerber, VM; Jefcoat, AM; Robinson, NE, 2003) |
| "Although airway obstruction is common in people with motor or neurologic disorders and in those who are chronically debilitated or institutionalized, food and foreign matter are not the only culprits." | 2.45 | Case study: Asphyxia caused by inspissated oral and nasopharyngeal secretions. ( Prahlow, JA; Prahlow, ND; Prahlow, TJ; Rakow, RJ, 2009) |
| "Cough is an important component of airway clearance, particularly in individuals with intrinsic pulmonary disease, weakness of respiratory muscles, or central nervous system disease that impairs breathing." | 2.44 | Mechanical insufflation-exsufflation for airway mucus clearance. ( Homnick, DN, 2007) |
| "Heaves, or recurrent airway obstruction (RAO), is a chronic respiratory disease featuring lower airway inflammation, bronchoconstriction, and mucus accumulation." | 2.42 | Recurrent airway obstruction--heaves. ( Léguillette, R, 2003) |
| "Chronic obstructive pulmonary disease (COPD) is a disease state characterised by airflow obstruction that is not fully reversible and progressive." | 2.42 | [Pathophysiology of chronic obstructive pulmonary disease]. ( Maestrelli, P, 2003) |
| "Also the degree of airway obstruction is related to the physical properties of the sputum." | 2.40 | Lung mucus: a clinician's view. ( Kim, WD, 1997) |
| "Among the 4483 participants with COPD, 4363 were included in the primary analysis (median age, 63 years [IQR, 57-70 years]; 44% were women)." | 1.91 | Airway-Occluding Mucus Plugs and Mortality in Patients With Chronic Obstructive Pulmonary Disease. ( Abozeed, M; Ahmed, AN; Aziz, MU; Cho, M; Diaz, AA; Dolliver, WR; Grumley, S; Han, MK; Jacobs, K; Kim, V; Kligerman, SJ; Make, BJ; Manapragada, PP; Nath, HP; Orejas, JL; San José Estépar, R; Sonavane, S; Terry, NL; Wang, W; Washko, GR; Yen, A; Zahid, M, 2023) |
| "The percentages of airway obstruction due to mucus plugs were notably higher in the fourth- and fifth-generation bronchi (17." | 1.56 | Changes in airway diameter and mucus plugs in patients with asthma exacerbation. ( Kurashima, K; Nakamoto, Y; Takaku, Y; Takayanagi, N; Takizawa, H; Yanagisawa, T; Yoshida, Y, 2020) |
| "Pretreatment with diminazene aceturate, a small molecule with ability to inhibit acid detection through blockade of the acid-sensing ion channel (ASIC) at the doses provided, did not prevent acid-induced pathologic mucus or transport defects but did mitigate airway obstruction." | 1.56 | Acid exposure disrupts mucus secretion and impairs mucociliary transport in neonatal piglet airways. ( Atanasova, KR; Bravo, L; Collins, EN; Dadural, JS; Eken, E; Guevara, MV; Kuan, SP; Liao, YSJ; Reznikov, LR; Schurmann, V; Sponchiado, M; Vogt, K, 2020) |
| "Central airway obstruction (CAO) is defined as obstruction of the airway lumen in the trachea or mainstem bronchi, most commonly due to primary or metastatic malignancy; and is classified as extraluminal, endoluminal, or mixed." | 1.51 | A Single Center Experience of Feasibility of a Novel Self-Expanding Metallic Airway Stent (Bonastent): A Case Series. ( Chawla, M; Lee, R; Makkar, P; Revelo, A, 2019) |
| "As recurrent airway obstruction (RAO) is progressive and as medical history is frequently unknown by owners, it's important to suggest a score model to characterize RAO stages for a more accurate diagnosis and treatment." | 1.38 | Correlation and discriminant analysis between clinical, endoscopic, thoracic X-ray and bronchoalveolar lavage fluid cytology scores, for staging horses with recurrent airway obstruction (RAO). ( Branco Ferreira, M; Sales Luis, JP; Tilley, P, 2012) |
| "Lower respiratory tract infections were associated with decreased survival (HR = 1." | 1.38 | Respiratory infections increase the risk of granulation tissue formation following airway stenting in patients with malignant airway obstruction. ( Eapen, GA; Godoy, MCB; Jani, P; Jimenez, CA; Larson, AJ; Lei, X; Morice, RC; Ost, DE; Sarkiss, MG; Shah, AM, 2012) |
| "It may be performed to relieve upper airway obstruction from congenital stenoses or from acquired conditions such as foreign body impaction, swelling from neck trauma or anaphylaxis, benign or malignant tumors, and infection." | 1.37 | Potentially lethal complications of tracheostomy: autopsy considerations. ( Byard, RW; Gilbert, JD, 2011) |
| "Cast bronchitis is a rare but potentially fatal condition caused by the accumulation of mucus in the bronchial tree usually secondary to infection, inflammation, or vascular stasis." | 1.35 | Thoracic air leakage in the presentation of cast bronchitis. ( Kerem, E; Kruger, J; Picard, E; Shpringer, C, 2009) |
| "The etiology of the acutely developed atelectasis was unclear." | 1.34 | Pulmonary atelectasis manifested after induction of anesthesia: a contribution of sinobronchial syndrome? ( Amagasa, S; Igarashi, A; Oda, S; Yokoo, N, 2007) |
| "Airway eosinophilia was observed during both responses." | 1.33 | Effect of disodium cromoglycate on airway mucus secretion during antigen-induced late asthmatic responses in a murine model of asthma. ( Arakawa, H; Koyama, H; Mayuzumi, H; Mizuno, T; Mochizuki, H; Morikawa, A; Nishimura, H; Ohki, Y; Tokuyama, K, 2005) |
| "RAO-affected horses had more airway obstruction and luminal mucus than control horses under both management systems." | 1.33 | Persistent mucus accumulation: a consequence of delayed bronchial mucous cell apoptosis in RAO-affected horses? ( Bartner, LR; Kiupel, M; Robinson, NE; Tesfaigzi, Y, 2006) |
| "Plastic bronchitis is an infrequent cause of acute life-threatening respiratory failure that can mimic foreign body aspiration or status asthmaticus." | 1.32 | Plastic bronchitis mimicking foreign body aspiration that needs a specific diagnostic procedure. ( Brichet, A; Cremer, R; Dorkenoo, A; Fourier, C; Leclerc, F; Leteurtre, S; Noizet, O; Pouessel, G, 2003) |
| "These findings suggest that bronchial asthma with mucoid impactions is among several pathogeneses that cause increased levels of CEA in serum and BALF." | 1.32 | [Concentrations of carcinoembryonic antigen in serum and bronchoalveolar lavage fluid of asthmatic patients with mucoid impaction]. ( Fukui, Y; Harada, T; Hizawa, N; Kikuchi, E; Maeda, Y; Nagai, K; Nishimura, M; Suko, N; Takahashi, D, 2004) |
| "Plastic bronchitis was observed in 44 years old man, who expectorated white, branching, bronchial casts for three months." | 1.31 | [Plastic bronchitis and mucoid impaction--uncommon disease syndromes with expectoration mucus plugs]. ( Bestry, I; Pirozynski, M; Płodziszewska, M; Rowińska-Zakrzewska, E; Sledziewska, J; Wiatr, E; Załeska, J; Załeska, M, 2001) |
| "Despite the severe degree of atelectasis, he exhibited only mild respiratory distress." | 1.31 | Atelectasis and mucus plugging in spinal cord injury: case report and therapeutic approaches. ( Aguilera, EJ; Slonimski, M, 2001) |
| "Although rare, major lung collapse secondary to mucous plugging should be considered in the differential diagnosis of intraoperative hypoxaemia, particularly following major trauma." | 1.28 | Profound intraoperative atelectasis. ( Brodsky, JB; Samuels, SI, 1989) |
| "In the case reported here, airway obstruction by a large mucous-like plug apparently developed in the context of severe oligohydramnios and fetal distress." | 1.27 | Tracheal plugs in oligohydramnios. ( Ewy, GI; Kuruvilla, AC, 1988) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 74 (35.58) | 18.7374 |
| 1990's | 25 (12.02) | 18.2507 |
| 2000's | 55 (26.44) | 29.6817 |
| 2010's | 42 (20.19) | 24.3611 |
| 2020's | 12 (5.77) | 2.80 |
| Authors | Studies |
|---|---|
| Sorenson, HM | 1 |
| McIntosh, MJ | 2 |
| Kooner, HK | 2 |
| Eddy, RL | 3 |
| Jeimy, S | 1 |
| Licskai, C | 2 |
| Mackenzie, CA | 2 |
| Svenningsen, S | 2 |
| Nair, P | 2 |
| Yamashita, C | 2 |
| Parraga, G | 3 |
| Cedano, J | 1 |
| Choi, J | 1 |
| Castro, M | 1 |
| Wilson, A | 1 |
| Serajeddini, H | 1 |
| Bhalla, A | 1 |
| Bessonov, N | 1 |
| Volpert, V | 1 |
| Diaz, AA | 1 |
| Orejas, JL | 1 |
| Grumley, S | 1 |
| Nath, HP | 1 |
| Wang, W | 1 |
| Dolliver, WR | 1 |
| Yen, A | 1 |
| Kligerman, SJ | 1 |
| Jacobs, K | 1 |
| Manapragada, PP | 1 |
| Abozeed, M | 1 |
| Aziz, MU | 1 |
| Zahid, M | 1 |
| Ahmed, AN | 1 |
| Terry, NL | 1 |
| San José Estépar, R | 2 |
| Kim, V | 1 |
| Make, BJ | 1 |
| Han, MK | 1 |
| Sonavane, S | 1 |
| Washko, GR | 1 |
| Cho, M | 1 |
| Fiorelli, A | 1 |
| Natale, G | 1 |
| Freda, C | 1 |
| Cascone, R | 1 |
| Carlucci, A | 2 |
| Costanzo, S | 1 |
| Ferrara, V | 1 |
| Santini, M | 1 |
| Balázs, A | 1 |
| Mall, MA | 6 |
| Yoshida, Y | 1 |
| Takaku, Y | 1 |
| Nakamoto, Y | 1 |
| Takayanagi, N | 1 |
| Yanagisawa, T | 1 |
| Takizawa, H | 1 |
| Kurashima, K | 1 |
| Liao, YSJ | 1 |
| Kuan, SP | 1 |
| Guevara, MV | 1 |
| Collins, EN | 1 |
| Atanasova, KR | 1 |
| Dadural, JS | 1 |
| Vogt, K | 1 |
| Schurmann, V | 1 |
| Bravo, L | 1 |
| Eken, E | 1 |
| Sponchiado, M | 1 |
| Reznikov, LR | 1 |
| Linssen, RS | 1 |
| Chai, G | 1 |
| Ma, J | 1 |
| Kummarapurugu, AB | 1 |
| van Woensel, JBM | 1 |
| Bem, RA | 1 |
| Kaler, L | 1 |
| Duncan, GA | 1 |
| Zhou, L | 1 |
| Rubin, BK | 4 |
| Xu, Q | 1 |
| Comegna, M | 1 |
| Conte, G | 1 |
| Falanga, AP | 1 |
| Marzano, M | 1 |
| Cernera, G | 1 |
| Di Lullo, AM | 1 |
| Amato, F | 1 |
| Borbone, N | 1 |
| D'Errico, S | 1 |
| Ungaro, F | 1 |
| d'Angelo, I | 1 |
| Oliviero, G | 1 |
| Castaldo, G | 1 |
| Yoshida, M | 1 |
| Miyahara, Y | 1 |
| Orimo, K | 1 |
| Kono, N | 1 |
| Narita, M | 1 |
| Ohya, Y | 1 |
| Matsumoto, K | 1 |
| Nakagawa, S | 1 |
| Ueki, S | 1 |
| Morita, H | 1 |
| Miyairi, I | 1 |
| Jiang, M | 1 |
| Fang, Y | 1 |
| Li, Y | 1 |
| Huang, H | 1 |
| Wei, Z | 1 |
| Gao, X | 1 |
| Sung, HK | 1 |
| Hu, J | 1 |
| Qiang, L | 1 |
| Ruan, J | 1 |
| Chen, Q | 1 |
| Jiang, D | 1 |
| Whitsett, JA | 1 |
| Ai, X | 1 |
| Que, J | 1 |
| Cao, LJ | 1 |
| Liu, JH | 2 |
| Shuai, JF | 1 |
| Niu, B | 1 |
| Lu, SK | 1 |
| Huang, KL | 1 |
| Masood, MM | 1 |
| Farquhar, DR | 1 |
| Biancaniello, C | 1 |
| Hackman, TG | 1 |
| Delgado Pecellín, I | 1 |
| Moreno Ortega, M | 1 |
| Carrasco Hernández, L | 1 |
| Marín Barrera, L | 1 |
| Muñoz Zara, P | 1 |
| Moreno Valera, MJ | 1 |
| Quintana Gallego, ME | 1 |
| Han, J | 1 |
| Xiang, H | 1 |
| Ridley, WE | 1 |
| Ridley, LJ | 1 |
| Worren, MK | 1 |
| Storesund, AK | 1 |
| Sharma, R | 1 |
| Vintermyr, OK | 1 |
| Gjerde, S | 1 |
| Flaatten, HK | 1 |
| Dunican, EM | 1 |
| Watchorn, DC | 1 |
| Fahy, JV | 4 |
| Small, DM | 1 |
| Brown, RR | 1 |
| Doherty, DF | 1 |
| Abladey, A | 1 |
| Zhou-Suckow, Z | 2 |
| Delaney, RJ | 1 |
| Kerrigan, L | 1 |
| Dougan, CM | 1 |
| Borensztajn, KS | 1 |
| Holsinger, L | 1 |
| Booth, R | 1 |
| Scott, CJ | 1 |
| López-Campos, G | 1 |
| Elborn, JS | 1 |
| Weldon, S | 1 |
| Taggart, CC | 1 |
| Haider, E | 1 |
| Boylan, C | 1 |
| Mukherjee, M | 1 |
| Capaldi, DPI | 1 |
| Makkar, P | 1 |
| Revelo, A | 1 |
| Lee, R | 1 |
| Chawla, M | 1 |
| Crespo-Lessmann, A | 1 |
| Torrego-Fernández, A | 1 |
| Shah, RJ | 1 |
| Kotloff, RM | 1 |
| Volsko, TA | 1 |
| Mietto, C | 1 |
| Foley, K | 1 |
| Salerno, L | 1 |
| Oleksak, J | 1 |
| Pinciroli, R | 1 |
| Goverman, J | 1 |
| Berra, L | 1 |
| Gehrig, S | 1 |
| Duerr, J | 3 |
| Weitnauer, M | 1 |
| Wagner, CJ | 2 |
| Graeber, SY | 1 |
| Schatterny, J | 3 |
| Hirtz, S | 3 |
| Belaaouaj, A | 1 |
| Dalpke, AH | 1 |
| Schultz, C | 2 |
| Trojanek, JB | 1 |
| Cobos-Correa, A | 1 |
| Diemer, S | 1 |
| Kormann, M | 1 |
| Schubert, SC | 1 |
| Agrawal, R | 2 |
| Sommerburg, O | 1 |
| Hartl, D | 1 |
| Currie, LL | 1 |
| Medford, AR | 1 |
| Patel, A | 1 |
| Theokli, C | 1 |
| Woittiez, KJ | 1 |
| Woittiez, AJ | 1 |
| da Cunha, AA | 1 |
| Nuñez, NK | 1 |
| de Souza, RG | 1 |
| Moraes Vargas, MH | 1 |
| Silveira, JS | 1 |
| Antunes, GL | 1 |
| Durante, Lda S | 1 |
| Porto, BN | 1 |
| Marczak, ES | 1 |
| Jones, MH | 1 |
| Pitrez, PM | 1 |
| Bonser, LR | 1 |
| Zlock, L | 1 |
| Finkbeiner, W | 1 |
| Erle, DJ | 1 |
| Capasso, R | 1 |
| Carbone, M | 1 |
| Rossi, E | 1 |
| Mamone, R | 1 |
| Zeccolini, R | 1 |
| Reginelli, A | 1 |
| Zeccolini, M | 1 |
| Brunese, L | 1 |
| Rotondo, A | 1 |
| Panchabhai, TS | 1 |
| Mukhopadhyay, S | 1 |
| Sehgal, S | 1 |
| Bandyopadhyay, D | 1 |
| Erzurum, SC | 1 |
| Mehta, AC | 1 |
| Soler, X | 1 |
| Mahmoud, M | 1 |
| Smith, G | 1 |
| Subramanyam, R | 1 |
| Ryhner, T | 1 |
| Müller, N | 1 |
| Balmer, V | 1 |
| Gerber, V | 4 |
| Avena, Kde M | 1 |
| Duarte, AC | 1 |
| Cravo, SL | 1 |
| Sologuren, MJ | 1 |
| Gastaldi, AC | 1 |
| Volpe, MS | 1 |
| Adams, AB | 1 |
| Amato, MB | 1 |
| Marini, JJ | 3 |
| Agrawal, A | 1 |
| Mabalirajan, U | 1 |
| Ram, A | 1 |
| Ghosh, B | 1 |
| Evans, CM | 1 |
| Kim, K | 1 |
| Tuvim, MJ | 1 |
| Dickey, BF | 1 |
| Tumes, DJ | 1 |
| Connolly, A | 1 |
| Dent, LA | 1 |
| Kravitz, RM | 1 |
| Prahlow, JA | 1 |
| Prahlow, TJ | 1 |
| Rakow, RJ | 1 |
| Prahlow, ND | 1 |
| Xue, FS | 1 |
| Luo, MP | 1 |
| Liao, X | 1 |
| Zhang, YM | 1 |
| Kruger, J | 1 |
| Shpringer, C | 1 |
| Picard, E | 1 |
| Kerem, E | 1 |
| Tiddens, HA | 1 |
| Donaldson, SH | 1 |
| Rosenfeld, M | 1 |
| Paré, PD | 2 |
| Hasegawa, M | 1 |
| Inamo, Y | 1 |
| Fuchigami, T | 1 |
| Hashimoto, K | 1 |
| Morozumi, M | 1 |
| Ubukata, K | 1 |
| Watanabe, H | 1 |
| Takahashi, T | 1 |
| Burgel, PR | 1 |
| Martin, C | 1 |
| Stone, RH | 1 |
| Bricknell, SS | 1 |
| Wielpütz, MO | 1 |
| Eichinger, M | 1 |
| Zhou, Z | 1 |
| Leotta, K | 1 |
| Bartling, SH | 1 |
| Semmler, W | 1 |
| Kauczor, HU | 1 |
| Puderbach, M | 1 |
| Rousseau, K | 1 |
| Cardwell, JM | 1 |
| Humphrey, E | 1 |
| Newton, R | 1 |
| Knight, D | 1 |
| Clegg, P | 1 |
| Thornton, DJ | 1 |
| Ntoumenopoulos, G | 1 |
| Shannon, H | 1 |
| Main, E | 1 |
| Byard, RW | 1 |
| Gilbert, JD | 1 |
| Knox, T | 1 |
| Tilley, P | 1 |
| Sales Luis, JP | 1 |
| Branco Ferreira, M | 1 |
| Ost, DE | 1 |
| Shah, AM | 1 |
| Lei, X | 1 |
| Godoy, MCB | 1 |
| Jimenez, CA | 1 |
| Eapen, GA | 1 |
| Jani, P | 1 |
| Larson, AJ | 1 |
| Sarkiss, MG | 1 |
| Morice, RC | 1 |
| Livraghi-Butrico, A | 1 |
| Grubb, BR | 1 |
| Kelly, EJ | 1 |
| Wilkinson, KJ | 1 |
| Yang, H | 1 |
| Geiser, M | 1 |
| Randell, SH | 1 |
| Boucher, RC | 1 |
| O'Neal, WK | 1 |
| Schreiber, A | 1 |
| Nava, S | 1 |
| Ceriana, P | 1 |
| Law, JA | 1 |
| Mariotti, C | 1 |
| Mullen, T | 1 |
| Anagnostopoulou, P | 1 |
| Riederer, B | 1 |
| Michel, S | 1 |
| Binia, A | 1 |
| Liu, X | 1 |
| Kalitzki, K | 1 |
| Xiao, F | 1 |
| Chen, M | 1 |
| Hartmann, D | 1 |
| Thum, T | 1 |
| Kabesch, M | 1 |
| Soleimani, M | 1 |
| Seidler, U | 1 |
| Kreda, SM | 1 |
| Davis, CW | 1 |
| Rose, MC | 2 |
| Hong, WS | 1 |
| Im, SA | 1 |
| Kim, HL | 1 |
| Yoon, JS | 1 |
| Postiaux, G | 1 |
| Zwaenepoel, B | 1 |
| Louis, J | 1 |
| Nair, SR | 1 |
| Pearson, SB | 1 |
| Noizet, O | 1 |
| Leclerc, F | 1 |
| Leteurtre, S | 1 |
| Brichet, A | 1 |
| Pouessel, G | 1 |
| Dorkenoo, A | 1 |
| Fourier, C | 1 |
| Cremer, R | 1 |
| Léguillette, R | 1 |
| Robinson, NE | 5 |
| Berney, C | 1 |
| Eberhart, S | 1 |
| deFeijter-Rupp, HL | 1 |
| Jefcoat, AM | 3 |
| Cornelisse, CJ | 1 |
| Gerber, VM | 1 |
| Derksen, FJ | 1 |
| Venta, RJ | 1 |
| Rawson, J | 1 |
| Hotchkiss, JA | 2 |
| Swischuk, LE | 1 |
| Hashimoto, Y | 1 |
| Murata, A | 1 |
| Mikami, M | 1 |
| Nakamura, S | 1 |
| Yamanaka, E | 1 |
| Kudoh, S | 1 |
| Kuyper, LM | 1 |
| Hogg, JC | 2 |
| Lambert, RK | 1 |
| Ionescu, D | 1 |
| Woods, R | 1 |
| Bai, TR | 1 |
| Hays, SR | 1 |
| MANNES, P | 1 |
| SEVERIN, A | 1 |
| DUPREZ, A | 1 |
| Aizawa, H | 1 |
| Groneberg, DA | 1 |
| Wagner, U | 1 |
| Chung, KF | 1 |
| Maestrelli, P | 1 |
| Deaton, CM | 1 |
| Marlin, DJ | 1 |
| Smith, NC | 1 |
| Smith, KC | 1 |
| Newton, RJ | 1 |
| Gower, SM | 1 |
| Cade, SM | 1 |
| Roberts, CA | 1 |
| Harris, PA | 1 |
| Schroter, RC | 1 |
| Kelly, FJ | 1 |
| Rogers, DF | 1 |
| Shoun, P | 1 |
| Steelman, R | 1 |
| Barber, B | 1 |
| Olson, M | 1 |
| Pate, MF | 1 |
| Zimmerman, AT | 1 |
| Nagata, K | 1 |
| Iwasaki, Y | 1 |
| Yamada, T | 1 |
| Yuba, T | 1 |
| Kohno, K | 1 |
| Hosogi, S | 1 |
| Ohsugi, S | 1 |
| Kuwahara, H | 1 |
| Yokomura, I | 1 |
| Maeda, Y | 1 |
| Hizawa, N | 1 |
| Fukui, Y | 1 |
| Nagai, K | 1 |
| Kikuchi, E | 1 |
| Takahashi, D | 1 |
| Harada, T | 1 |
| Suko, N | 1 |
| Nishimura, M | 1 |
| Koyama, H | 1 |
| Tokuyama, K | 1 |
| Nishimura, H | 1 |
| Mizuno, T | 1 |
| Mayuzumi, H | 1 |
| Ohki, Y | 1 |
| Arakawa, H | 1 |
| Mochizuki, H | 1 |
| Morikawa, A | 1 |
| Ferreres-Franco, J | 1 |
| Blanquer-Olivas, J | 1 |
| Pastor-Esplá, E | 1 |
| Borrás-Pallé, S | 1 |
| Galán-Gil, G | 1 |
| Jordá-Miñana, A | 1 |
| Zamanian, M | 1 |
| Bartner, LR | 1 |
| Kiupel, M | 1 |
| Tesfaigzi, Y | 1 |
| Muz, MH | 1 |
| Deveci, F | 1 |
| Bulut, Y | 1 |
| Ilhan, N | 1 |
| Yekeler, H | 1 |
| Turgut, T | 1 |
| Panitch, HB | 1 |
| Igarashi, A | 1 |
| Amagasa, S | 1 |
| Oda, S | 1 |
| Yokoo, N | 1 |
| Fink, JB | 1 |
| Corry, DB | 2 |
| Kheradmand, F | 1 |
| Hashida, F | 1 |
| Komori, M | 1 |
| Nishiyama, K | 1 |
| Taniguchi, Y | 1 |
| Kondo, I | 1 |
| Kawamata, M | 1 |
| Ozaki, M | 1 |
| Homnick, DN | 1 |
| Haas, CF | 1 |
| Loik, PS | 1 |
| Gay, SE | 1 |
| Schechter, MS | 1 |
| Hess, DR | 1 |
| Therien, AG | 1 |
| Bernier, V | 1 |
| Weicker, S | 1 |
| Tawa, P | 1 |
| Falgueyret, JP | 1 |
| Mathieu, MC | 1 |
| Honsberger, J | 1 |
| Pomerleau, V | 1 |
| Robichaud, A | 1 |
| Stocco, R | 1 |
| Dufresne, L | 1 |
| Houshyar, H | 1 |
| Lafleur, J | 1 |
| Ramachandran, C | 1 |
| O'Neill, GP | 1 |
| Slipetz, D | 1 |
| Tan, CM | 1 |
| Todisco, T | 1 |
| Dottorini, M | 1 |
| Nowak, RM | 1 |
| Casale, TB | 1 |
| Marom, Z | 2 |
| Bray, ST | 2 |
| Johnstone, WH | 1 |
| Dee, PM | 2 |
| Pope, TL | 1 |
| Teates, CD | 1 |
| Tegtmeyer, CJ | 1 |
| Pokora, T | 1 |
| Bing, D | 1 |
| Mammel, M | 1 |
| Boros, S | 1 |
| Weiss, T | 1 |
| Dorow, P | 1 |
| Felix, R | 1 |
| Suratt, PM | 1 |
| Rose, CE | 1 |
| Chodosh, S | 1 |
| Zanjanian, MH | 1 |
| Middleton, E | 1 |
| Atkins, FM | 1 |
| Fanning, M | 1 |
| Georgitis, JW | 1 |
| Denneny, JC | 1 |
| Handler, SD | 1 |
| Wanner, A | 2 |
| Hudgel, DW | 1 |
| Shucard, DW | 1 |
| Ketha, S | 1 |
| Diaz, C | 1 |
| Farrow, J | 1 |
| Mehta, J | 1 |
| Ulstad, DR | 1 |
| Koppin, J | 1 |
| Van Surell, C | 1 |
| Louis, B | 1 |
| Lofaso, F | 1 |
| Beydon, L | 1 |
| Brochard, L | 1 |
| Harf, A | 1 |
| Fredberg, J | 1 |
| Isabey, D | 1 |
| de Groot, RE | 1 |
| Dik, H | 1 |
| de Groot, HG | 1 |
| Bakker, W | 1 |
| Duncan, W | 1 |
| Tyrrell, M | 1 |
| Bharadwaj, B | 1 |
| George, D | 1 |
| Rothe, TB | 1 |
| Frey, JG | 1 |
| Ciobanu, TD | 1 |
| Karrer, W | 1 |
| Hansell, DM | 1 |
| Rubens, MB | 1 |
| Padley, SP | 1 |
| Wells, AU | 1 |
| Kim, WD | 1 |
| Cohen, SP | 1 |
| Anderson, PL | 1 |
| Denehy, L | 1 |
| Boushey, HA | 2 |
| Hill, NS | 1 |
| Wood, KE | 1 |
| Flaten, AL | 1 |
| Backes, WJ | 1 |
| Blackburn, MR | 1 |
| Volmer, JB | 1 |
| Thrasher, JL | 1 |
| Zhong, H | 1 |
| Crosby, JR | 1 |
| Lee, JJ | 1 |
| Kellems, RE | 1 |
| King, M | 2 |
| Schneider, DA | 1 |
| Bitsori, M | 1 |
| Galanakis, E | 1 |
| Paraskakis, E | 1 |
| Papadakis, CE | 1 |
| Kokori, H | 1 |
| Sbyrakis, S | 1 |
| Sledziewska, J | 1 |
| Załeska, J | 1 |
| Wiatr, E | 1 |
| Płodziszewska, M | 1 |
| Załeska, M | 1 |
| Pirozynski, M | 1 |
| Bestry, I | 1 |
| Rowińska-Zakrzewska, E | 1 |
| El Hassan, NO | 1 |
| Chess, PR | 1 |
| Huysman, MW | 1 |
| Merkus, PJ | 1 |
| de Jongste, JC | 1 |
| Harkema, JR | 1 |
| Basbaum, CB | 1 |
| Nickola, TJ | 1 |
| Voynow, JA | 1 |
| Tomkiewicz, R | 1 |
| Green, FH | 1 |
| Slonimski, M | 1 |
| Aguilera, EJ | 1 |
| Proctor, DF | 1 |
| Adams, GK | 1 |
| Pavia, D | 1 |
| Bateman, JR | 1 |
| Sheahan, NF | 1 |
| Clarke, SW | 1 |
| Helders, PJ | 1 |
| Rasche, B | 1 |
| Hochstrasser, K | 1 |
| Ulmer, WT | 1 |
| Aurnhammer, W | 1 |
| Konietzko, N | 1 |
| Matthys, H | 1 |
| Speizer, FE | 1 |
| Tager, IB | 1 |
| Fairshter, RD | 1 |
| Riley, CA | 1 |
| Hewlett, RI | 1 |
| Felson, B | 1 |
| Minette, A | 1 |
| Donaldson, JC | 1 |
| Stoop, DR | 1 |
| Raymond, LW | 1 |
| Royall, JD | 1 |
| Hippensteel, KE | 1 |
| Cobb, OM | 1 |
| Hong, ND | 1 |
| Newhouse, M | 1 |
| Sanchis, J | 1 |
| Bienenstock, J | 1 |
| Fletcher, C | 1 |
| Peto, R | 1 |
| Reid, L | 1 |
| Wick, MM | 1 |
| Ingram, RH | 1 |
| Katzenstein, AL | 1 |
| Liebow, AA | 1 |
| Friedman, PJ | 1 |
| Hewlett, AM | 1 |
| Branthwaite, MA | 1 |
| Wood, RE | 1 |
| Hirsch, J | 1 |
| Farrell, PM | 1 |
| Fortin, D | 1 |
| Davidson, KC | 1 |
| Perlman, M | 1 |
| Williams, J | 1 |
| Hirsch, M | 1 |
| Bar-Ziv, J | 1 |
| Elmes, PC | 1 |
| Bignon, J | 1 |
| Depierre, A | 1 |
| André-Bougaran, J | 1 |
| Hem, B | 1 |
| Cairns-Bazarian, AM | 1 |
| Conway, EE | 1 |
| Yankelowitz, S | 1 |
| Lundgren, JD | 2 |
| Charlton, GA | 1 |
| Torlot, KJ | 1 |
| Hacking, CN | 1 |
| Roth, BJ | 1 |
| Irvine, TW | 1 |
| Liening, DA | 1 |
| Duncan, NO | 1 |
| Cragun, WH | 1 |
| van der Werf, TS | 1 |
| Meinesz, AF | 1 |
| Postmus, PE | 1 |
| Hoffman, LA | 1 |
| Reinke, LF | 1 |
| Wesmiller, SW | 1 |
| Sciurba, FC | 1 |
| Harrow, EM | 1 |
| Oldenburg, FA | 1 |
| Lingenfelter, MS | 1 |
| Leonard, J | 1 |
| Spurzem, JR | 1 |
| Thompson, AB | 1 |
| Daughton, DM | 1 |
| Mueller, M | 1 |
| Linder, J | 1 |
| Rennard, SI | 1 |
| Bolliger, CT | 1 |
| Perruchoud, AP | 1 |
| Garvin, JM | 1 |
| Davey, RT | 1 |
| Lundgren, B | 1 |
| Mullol, J | 1 |
| Logun, C | 1 |
| Baraniuk, J | 1 |
| Kaliner, MA | 2 |
| Shelhamer, JH | 1 |
| Wiles, FJ | 1 |
| Hnizdo, E | 1 |
| Piacentini, GL | 1 |
| Burton, GG | 1 |
| Wagshul, FA | 1 |
| Henderson, D | 1 |
| Kime, SW | 1 |
| Mah, MW | 1 |
| Jones, RL | 1 |
| Man, GC | 1 |
| Skippen, PW | 1 |
| York, EL | 1 |
| Bhaskar, KR | 1 |
| O'Sullivan, DD | 1 |
| Coles, SJ | 1 |
| Kozakewich, H | 1 |
| Vawter, GP | 1 |
| Reid, LM | 2 |
| Nadel, JA | 1 |
| Lin, DC | 1 |
| Hsu, L | 1 |
| Huang, PY | 1 |
| Agarwal, M | 1 |
| Shukla, JB | 1 |
| Sjaastad, O | 1 |
| Saunte, C | 1 |
| Salvesen, R | 1 |
| Fredriksen, TA | 1 |
| Seim, A | 1 |
| Røe, OD | 1 |
| Fostad, K | 1 |
| Løbben, OP | 1 |
| Zhao, JM | 1 |
| Velchik, MG | 1 |
| Tobin, M | 1 |
| Leadbeatter, S | 1 |
| Douglas-Jones, AG | 1 |
| Samuels, SI | 1 |
| Brodsky, JB | 1 |
| Davis, PB | 1 |
| Pride, NB | 1 |
| Ewy, GI | 1 |
| Kuruvilla, AC | 1 |
| Muller, AF | 1 |
| Mithal, A | 1 |
| Cohn, JR | 1 |
| Steiner, RM | 1 |
| Posuniak, E | 1 |
| Northrup, BE | 1 |
| Drazen, JM | 1 |
| Holgate, ST | 1 |
| Kaliner, M | 1 |
| O'Byrne, P | 1 |
| Valentine, M | 1 |
| Widdicombe, JH | 1 |
| Woolcock, A | 1 |
| Lockhart, JS | 1 |
| Griffin, C | 1 |
| Rubin, EM | 1 |
| Baier, H | 1 |
| Vereen, LE | 1 |
| Payne, DK | 1 |
| George, RB | 1 |
| Suez, D | 1 |
| Szefler, SJ | 1 |
| Paisner, HM | 1 |
| Dunnill, MS | 1 |
| Keal, E | 1 |
| Thurlbeck, WM | 2 |
| Blue, JA | 1 |
| Iravani, J | 1 |
| Matsuba, K | 1 |
| Madewell, JE | 1 |
| Montgomery, JL | 1 |
| Cavanagh, RC | 1 |
| Irwin, RS | 1 |
| Thomas, HM | 1 |
| McLaughlin, AD | 1 |
| Linhartovã, A | 1 |
| Anderson, AE | 1 |
| Foraker, AG | 1 |
| Piscicelli, I | 1 |
| Matturro, F | 1 |
| Genereux, GP | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| A Mechanistic Pilot Open-label Study to Evaluate the Effect of Benralizumab on Airway Function and Inflammation in Patients With Severe, Poorly-controlled Eosinophilic Asthma Using Inhaled Hyperpolarized 129-Xenon MRI[NCT03733535] | 29 participants (Actual) | Interventional | 2022-03-01 | Active, not recruiting | |||
| A Two-arm, Placebo-controlled, Randomized Clinical Trial to Evaluate the Effect of Tezepelumab on Airway Structure and Function in Patients With Uncontrolled Moderate-to-severe Asthma[NCT05280418] | Phase 3 | 30 participants (Anticipated) | Interventional | 2022-11-08 | Recruiting | ||
| Air Stacking Technique For Pulmonary Reexpansion In The Ventilator After Expiratory Pause During Aspiration In Closed System[NCT05702411] | 39 participants (Anticipated) | Interventional | 2021-09-01 | Recruiting | |||
| Bronchial Inflammation of Small Airways in Patients With Cystic Fibrosis[NCT01479166] | 20 participants (Actual) | Observational | 2011-06-30 | Completed | |||
| Endotracheal Tubes Cleaned With a Novel Mechanism for Secretions Removal[NCT01765530] | 74 participants (Actual) | Interventional | 2012-09-30 | Completed | |||
| Selecting the Best Ventilator Hyperinflation Settings Based on Physiologic Markers: Randomized Controlled Study[NCT03327610] | 30 participants (Actual) | Interventional | 2016-07-31 | Completed | |||
| Multicenter Randomized Controlled Trial: Evaluation of the Effects of Respiratory Physiotherapy, Placebo-controlled, in Infants With Moderate Acute Bronchiolitis[NCT03753802] | 168 participants (Anticipated) | Interventional | 2019-12-01 | Recruiting | |||
| Bronchial Thermoplasty: Mechanism of Action and Defining Asthma Phenotype[NCT02075151] | 50 participants (Anticipated) | Interventional | 2014-02-28 | Not yet recruiting | |||
| Clinical Trial of NAC in Asthma[NCT02605824] | Phase 4 | 1 participants (Actual) | Interventional | 2016-03-31 | Terminated (stopped due to The study was closed after we determined that this albuterol/NAC regimen may be associated with excessive bronchoconstriction.) | ||
| The Effect of NAC on Lung Function and CT Mucus Score[NCT03822637] | Phase 4 | 30 participants (Anticipated) | Interventional | 2019-02-20 | Recruiting | ||
| Inpatient Clinical Trial of NAC[NCT03581084] | Phase 4 | 1 participants (Actual) | Interventional | 2018-07-06 | Terminated (stopped due to The study was redesigned to be conducted in an outpatient setting.) | ||
| The Effects of Positive Airway Pressure on the Mucolytic Effects of NAC[NCT06152653] | Phase 4 | 20 participants (Anticipated) | Interventional | 2023-11-21 | Recruiting | ||
| Mechanical Insufflation-Exsufflation Compared With CPAP in Patients Admitted to an Intermediate Care Unit With Pneumonia: a Randomised Controlled Study.[NCT03714321] | 30 participants (Actual) | Interventional | 2014-01-01 | Completed | |||
| A Comparison of Three Methods for Improving Expiratory Cough Flow and Lung Volume in Children With Neuromuscular Diseases[NCT02342132] | 40 participants (Actual) | Interventional | 2014-08-31 | Completed | |||
| Chest Therapy and Postural Control in Children With Crhonic Neurological Patology[NCT03946137] | 30 participants (Actual) | Interventional | 2013-09-30 | Completed | |||
| "FIBARRIX Clinical Evaluation of the Response to Chest Physiotherapy in Infants With Acute Bronchiolitis"[NCT02458300] | 77 participants (Actual) | Interventional | 2015-01-31 | Completed | |||
| [NCT00005281] | 0 participants | Observational | 1977-09-30 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
For each patient a quantitative culture will be obtained from the ETT after extubation. Secretions will be retrieved from the ETT after CT scan and quantitative standard cultures will be performed. Microbial molecular diversity analysis and antibacterial resistance patterns will also be studied. (NCT01765530)
Timeframe: At extubation (An expected average of 5 days)
| Intervention | Log colony form unit (CFU)/ mL (Mean) |
|---|---|
| ETT Cleaning Manuver | 2.89 |
| Standard of Care | 3.35 |
The investigators will measure percentage of occlusion determined by the accumulation of secretion within the lumen of each ETT using a high definition Computed Tomography (CT) imaging of the extubated ETTs. The whole ETT will be analyzed through high-definition CT slices. 100% of occlusion means total occlusion of the lumen of the ETT and 0% means absence of any occlusion. (NCT01765530)
Timeframe: At extubation (An expected average of 5 days)
| Intervention | percentage of occlusion (Mean) |
|---|---|
| ETT Cleaning Manuver | 10.6 |
| Standard of Care | 17.7 |
Post-treatment FEV1 is reported. FEV1 is measured via spirometry. (NCT03581084)
Timeframe: end of the one week treatment period
| Intervention | liters (Number) |
|---|---|
| N-acetylcysteine | 0.86 |
40 reviews available for guaifenesin and Airway Obstruction
| Article | Year |
|---|---|
Managing secretions in dying patients.
Topics: Adrenergic beta-Agonists; Airway Obstruction; Analgesics, Opioid; Anti-Inflammatory Agents; Expector | 2000 |
Mucus obstruction and inflammation in early cystic fibrosis lung disease: Emerging role of the IL-1 signaling pathway.
Topics: Airway Obstruction; Animals; Child; Child, Preschool; Cystic Fibrosis; Disease Models, Animal; Human | 2019 |
Autopsy and Imaging Studies of Mucus in Asthma. Lessons Learned about Disease Mechanisms and the Role of Mucus in Airflow Obstruction.
Topics: Airway Obstruction; Asthma; Autopsy; Cytokines; Eosinophils; Humans; Mucus; Multidetector Computed T | 2018 |
Airway clearance therapy: finding the evidence.
Topics: Airway Obstruction; Drainage, Postural; Humans; Mucociliary Clearance; Mucus; Respiratory Therapy | 2013 |
Plugs of the Air Passages: A Clinicopathologic Review.
Topics: Airway Obstruction; Bronchi; Bronchoscopy; Humans; Mucus | 2016 |
Novel approaches for inhibition of mucus hypersecretion in asthma.
Topics: Airway Obstruction; Animals; Anti-Asthmatic Agents; Anti-Inflammatory Agents; Asthma; Elasticity; Ex | 2007 |
Mucus hypersecretion in asthma: causes and effects.
Topics: Airway Obstruction; Asthma; Humans; Lung; Mucin 5AC; Mucin-5B; Mucus | 2009 |
Airway clearance in Duchenne muscular dystrophy.
Topics: Acute Disease; Airway Obstruction; Child; Cough; Humans; Mucus; Muscular Dystrophy, Duchenne; Respir | 2009 |
Case study: Asphyxia caused by inspissated oral and nasopharyngeal secretions.
Topics: Airway Obstruction; Asphyxia; Autopsy; Causality; Cause of Death; Cerebral Palsy; Diagnostic Errors; | 2009 |
Cystic fibrosis lung disease starts in the small airways: can we treat it more effectively?
Topics: Administration, Inhalation; Airway Obstruction; Airway Remodeling; Anti-Inflammatory Agents; Child; | 2010 |
CFTR, mucins, and mucus obstruction in cystic fibrosis.
Topics: Airway Obstruction; Animals; Cystic Fibrosis; Cystic Fibrosis Transmembrane Conductance Regulator; D | 2012 |
Chest physical therapy in acute viral bronchiolitis: an updated review.
Topics: Airway Obstruction; Algorithms; Bronchiolitis, Viral; Edema; Humans; Infant; Mucus; Nebulizers and V | 2013 |
Recurrent airway obstruction--heaves.
Topics: Adrenal Cortex Hormones; Airway Obstruction; Animals; Bronchoalveolar Lavage; Chronic Disease; Horse | 2003 |
[Mechanisms and control of airway remodeling].
Topics: Airway Obstruction; Asthma; Basement Membrane; Bronchi; Bronchial Hyperreactivity; Constriction, Pat | 2003 |
[Pathophysiology of chronic obstructive pulmonary disease].
Topics: Airway Obstruction; Ciliary Motility Disorders; Humans; Inflammation Mediators; Mucus; Pulmonary Dis | 2003 |
Airway mucus hypersecretion in asthma: an undervalued pathology?
Topics: Airway Obstruction; Asthma; Cytokines; Humans; Mucus; Phenotype; Pulmonary Disease, Chronic Obstruct | 2004 |
Airway clearance in children with neuromuscular weakness.
Topics: Airway Obstruction; Child; Child, Preschool; Cough; Humans; Infant; Mucus; Muscle Weakness; Neuromus | 2006 |
Novel medications for asthma: a look at the future.
Topics: Airway Obstruction; Animals; Anti-Inflammatory Agents; Asthma; Bronchodilator Agents; Drug Delivery | 2007 |
Mechanical insufflation-exsufflation for airway mucus clearance.
Topics: Airway Obstruction; Cough; Equipment Design; Humans; Insufflation; Mucus | 2007 |
Mechanical insufflation-exsufflation for airway mucus clearance.
Topics: Airway Obstruction; Cough; Equipment Design; Humans; Insufflation; Mucus | 2007 |
Mechanical insufflation-exsufflation for airway mucus clearance.
Topics: Airway Obstruction; Cough; Equipment Design; Humans; Insufflation; Mucus | 2007 |
Mechanical insufflation-exsufflation for airway mucus clearance.
Topics: Airway Obstruction; Cough; Equipment Design; Humans; Insufflation; Mucus | 2007 |
Airway clearance applications in the elderly and in patients with neurologic or neuromuscular compromise.
Topics: Aged; Aging; Airway Obstruction; Humans; Lung; Mucus; Nervous System Diseases; Neuromuscular Disease | 2007 |
Airway clearance applications in infants and children.
Topics: Age Factors; Airway Obstruction; Child; Child, Preschool; Humans; Infant; Mucus; Physical Therapy Mo | 2007 |
Airway clearance applications in infants and children.
Topics: Age Factors; Airway Obstruction; Child; Child, Preschool; Humans; Infant; Mucus; Physical Therapy Mo | 2007 |
Airway clearance applications in infants and children.
Topics: Age Factors; Airway Obstruction; Child; Child, Preschool; Humans; Infant; Mucus; Physical Therapy Mo | 2007 |
Airway clearance applications in infants and children.
Topics: Age Factors; Airway Obstruction; Child; Child, Preschool; Humans; Infant; Mucus; Physical Therapy Mo | 2007 |
Acute bronchial asthma.
Topics: Acute Disease; Adrenal Cortex Hormones; Adrenergic alpha-Antagonists; Adrenergic beta-Agonists; Aero | 1983 |
Expectorants and antitussive agents: are they helpful?
Topics: Airway Obstruction; Antitussive Agents; Bronchi; Cough; Expectorants; Humans; Immunoglobulin A; Immu | 1980 |
Cellular mechanisms in the pathogenesis and pathophysiology of asthma.
Topics: Aged; Airway Obstruction; Asthma; Atropine; Bronchial Spasm; Calcium; Eosinophils; Humans; Immunity, | 1981 |
Lung mucus: a clinician's view.
Topics: Airway Obstruction; Bronchial Diseases; Humans; Lung; Mucus; Sputum | 1997 |
The use of manual hyperinflation in airway clearance.
Topics: Airway Obstruction; Humans; Intubation, Intratracheal; Mucus; Physical Therapy Modalities; Respirati | 1999 |
Airway inflammation and remodeling in asthma.
Topics: Airway Obstruction; Asthma; Basement Membrane; Bronchi; Bronchial Hyperreactivity; Bronchitis; Const | 2000 |
Complications of noninvasive ventilation.
Topics: Acute Disease; Airway Obstruction; Humans; Incidence; Mucus; Positive-Pressure Respiration; Respirat | 2000 |
Airway mucus obstruction: mucin glycoproteins, MUC gene regulation and goblet cell hyperplasia.
Topics: Airway Obstruction; Gene Expression Regulation; Glycoproteins; Goblet Cells; Humans; Hyperplasia; Mu | 2001 |
Physiology and pharmacology of nasal function and mucus secretion.
Topics: Airway Obstruction; Anesthetics, Local; Headache; Hearing Disorders; Histamine H1 Antagonists; Human | 1976 |
Epidemiology of chronic mucus hypersecretion and obstructive airways disease.
Topics: Age Factors; Air Pollution; Airway Obstruction; Alcoholic Intoxication; Child; Female; Humans; Hyper | 1979 |
Lung defense mechanisms (first of two parts).
Topics: Airway Obstruction; Animals; Bronchi; Bronchitis; Cilia; Complement System Proteins; Cough; Cystic F | 1976 |
Postoperative pulmonary function.
Topics: Age Factors; Airway Obstruction; Airway Resistance; Anesthesia; Bronchi; Carbon Dioxide; Cardiac Out | 1975 |
Plastic bronchitis: an unusual cause of respiratory distress in children.
Topics: Airway Obstruction; Bronchitis; Bronchoscopy; Humans; Infant; Male; Mucus; Respiratory Insufficiency | 1992 |
Mucus production in the lower airways. A review of experimental studies.
Topics: Airway Obstruction; Autonomic Nervous System; Bronchi; Enzymes; Humans; Inflammation; Models, Biolog | 1992 |
The potential roles of leukotrienes in bronchial asthma.
Topics: Airway Obstruction; Asthma; Edema; Humans; Hypersensitivity, Immediate; Leukotriene Antagonists; Leu | 1991 |
Fatal airway obstruction caused by a mucous ball from a transtracheal oxygen catheter.
Topics: Airway Obstruction; Humans; Intubation, Intratracheal; Male; Middle Aged; Mucous Membrane; Mucus; Ox | 1991 |
Epidemiology of bronchial hypersecretion: recent studies.
Topics: Airway Obstruction; Anti-Bacterial Agents; Asthma; Bronchial Diseases; Bronchitis; Epidemiologic Met | 1987 |
Small airways disease.
Topics: Airway Obstruction; Airway Resistance; Animals; Bronchitis; Chronic Disease; Dogs; Humans; Inflammat | 1973 |
Sites and mechanisms of airway obstruction in COPD.
Topics: Adolescent; Adult; Age Factors; Aged; Airway Obstruction; Airway Resistance; Bronchi; Child; Child, | 1973 |
5 trials available for guaifenesin and Airway Obstruction
| Article | Year |
|---|---|
Asthma Control, Airway Mucus, and
Topics: Airway Management; Airway Obstruction; Anti-Asthmatic Agents; Antibodies, Monoclonal, Humanized; Ast | 2022 |
[Efficacy of early treatment via fiber bronchoscope in children with Mycoplasma pneumoniae pneumonia complicated by airway mucus obstruction].
Topics: Airway Obstruction; Bronchoscopes; Child; Child, Preschool; Female; Fiber Optic Technology; Humans; | 2018 |
Coughing, mucus accumulation, airway obstruction, and airway inflammation in control horses and horses affected with recurrent airway obstruction.
Topics: Airway Obstruction; Animals; Anti-Inflammatory Agents; Bronchoalveolar Lavage Fluid; Cough; Dexameth | 2003 |
Effect of ipratropium bromide on mucociliary clearance and pulmonary function in reversible airways obstruction.
Topics: Aged; Airway Obstruction; Atropine Derivatives; Cilia; Clinical Trials as Topic; Double-Blind Method | 1979 |
Problems in evaluating the effect of secretolytic agents on the mucociliary system by means of radioactive particles.
Topics: Airway Obstruction; Airway Resistance; Bromhexine; Bronchi; Bronchitis; Chronic Disease; Clinical Tr | 1977 |
163 other studies available for guaifenesin and Airway Obstruction
| Article | Year |
|---|---|
Mucus Plugging: A New Phenotype for Your Practice.
Topics: Airway Obstruction; Humans; Mucus; Phenotype | 2023 |
CT Mucus Score and
Topics: Airway Obstruction; Anti-Asthmatic Agents; Asthma; Humans; Magnetic Resonance Imaging; Mucus; Nitric | 2023 |
Airway obstruction in respiratory viral infections due to impaired mucociliary clearance.
Topics: Airway Obstruction; Humans; Lung; Mucociliary Clearance; Mucus | 2023 |
Airway-Occluding Mucus Plugs and Mortality in Patients With Chronic Obstructive Pulmonary Disease.
Topics: Aged; Aged, 80 and over; Airway Obstruction; Cigarette Smoking; Female; Forced Expiratory Volume; Hu | 2023 |
Montgomery T-tube for management of tracheomalacia: Impact on voice-related quality of life.
Topics: Aged; Airway Obstruction; Bronchoscopy; Case-Control Studies; Female; Humans; Intubation, Intratrach | 2020 |
Changes in airway diameter and mucus plugs in patients with asthma exacerbation.
Topics: Airway Obstruction; Asthma; Bronchi; Female; Humans; Male; Middle Aged; Mucus; Prognosis; Tomography | 2020 |
Acid exposure disrupts mucus secretion and impairs mucociliary transport in neonatal piglet airways.
Topics: Acetic Acid; Acid Sensing Ion Channel Blockers; Acid Sensing Ion Channels; Airway Obstruction; Anima | 2020 |
Neutrophil Extracellular Traps Increase Airway Mucus Viscoelasticity and Slow Mucus Particle Transit.
Topics: Adult; Airway Obstruction; Extracellular Traps; Humans; Mucus; Neutrophils; Oxidative Stress; Peroxi | 2021 |
Assisting PNA transport through cystic fibrosis human airway epithelia with biodegradable hybrid lipid-polymer nanoparticles.
Topics: 1,2-Dipalmitoylphosphatidylcholine; Airway Obstruction; Cystic Fibrosis; Cystic Fibrosis Transmembra | 2021 |
Eosinophil Extracellular Traps in the Casts of Plastic Bronchitis Associated With Influenza Virus Infection.
Topics: Airway Obstruction; Asthma; Bronchitis; Cell Aggregation; Cell Death; Child; Chromatin; Eosinophils; | 2021 |
VEGF receptor 2 (KDR) protects airways from mucus metaplasia through a Sox9-dependent pathway.
Topics: Airway Obstruction; Animals; Cell Transdifferentiation; Disease Models, Animal; Gene Expression Regu | 2021 |
Association of Standardized Tracheostomy Care Protocol Implementation and Reinforcement With the Prevention of Life-Threatening Respiratory Events.
Topics: Airway Obstruction; Clinical Protocols; Female; Humans; Male; Middle Aged; Mucus; North Carolina; Re | 2018 |
Persistent Atelectasis in a Patient With Cystic Fibrosis: Are Antibiotics Always Needed?
Topics: Adolescent; Adrenal Cortex Hormones; Airway Obstruction; Anti-Bacterial Agents; Antifungal Agents; C | 2019 |
Rabbit's ears sign: Mucoid impaction in bronchi.
Topics: Airway Obstruction; Bronchi; Diagnosis, Differential; Humans; Mucus; Tomography, X-Ray Computed | 2018 |
Plugs of the air passages.
Topics: Adult; Airway Obstruction; Bronchitis; Bronchoscopy; Female; Humans; Mucus | 2018 |
Targeting of cathepsin S reduces cystic fibrosis-like lung disease.
Topics: Airway Obstruction; Animals; Cathepsins; Cystic Fibrosis; Disease Models, Animal; Epithelial Sodium | 2019 |
CT and Functional MRI to Evaluate Airway Mucus in Severe Asthma.
Topics: Airway Management; Airway Obstruction; Asthma; Biomarkers; Correlation of Data; Eosinophils; Female; | 2019 |
A Single Center Experience of Feasibility of a Novel Self-Expanding Metallic Airway Stent (Bonastent): A Case Series.
Topics: Adult; Aged; Aged, 80 and over; Airway Obstruction; Alloys; Bronchi; Bronchoscopy; Cohort Studies; F | 2019 |
Obstructive inflammatory tracheal pseudomembrane.
Topics: Aged; Airway Obstruction; Anti-Inflammatory Agents; Bronchi; Combined Modality Therapy; Cough; Exuda | 2013 |
Beware of gloved fingers.
Topics: Aged; Airway Obstruction; Bronchoscopy; Carcinoma, Squamous Cell; Diagnosis, Differential; Fatal Out | 2013 |
Removal of endotracheal tube obstruction with a secretion clearance device.
Topics: Aged; Airway Obstruction; Catheters; Equipment Failure; Female; Humans; Intubation, Intratracheal; M | 2014 |
Lack of neutrophil elastase reduces inflammation, mucus hypersecretion, and emphysema, but not mucus obstruction, in mice with cystic fibrosis-like lung disease.
Topics: Airway Obstruction; Animals; Bronchiectasis; Cystic Fibrosis; Disease Models, Animal; Epithelial Sod | 2014 |
Airway mucus obstruction triggers macrophage activation and matrix metalloproteinase 12-dependent emphysema.
Topics: Airway Obstruction; Animals; Bronchoalveolar Lavage Fluid; Cystic Fibrosis; Dehydration; Genomics; M | 2014 |
Mucus plugging mimicking a left hilar mass.
Topics: Airway Obstruction; Asthma; Diagnosis, Differential; Humans; Lung; Lung Neoplasms; Male; Middle Aged | 2014 |
Nebulised N-acetylcysteine used in acute tracheostoma obstruction.
Topics: Acetylcysteine; Aged; Airway Obstruction; Drug Therapy, Combination; Expectorants; Female; Humans; L | 2014 |
Fatal endotracheal tube obstruction due to the ball valve effect.
Topics: Aged; Airway Obstruction; Equipment Failure; Fatal Outcome; Humans; Intubation, Intratracheal; Male; | 2015 |
Recombinant human deoxyribonuclease therapy improves airway resistance and reduces DNA extracellular traps in a murine acute asthma model.
Topics: Administration, Intranasal; Airway Obstruction; Airway Resistance; Allergens; Animals; Asthma; Bronc | 2016 |
Epithelial tethering of MUC5AC-rich mucus impairs mucociliary transport in asthma.
Topics: Airway Obstruction; Asthma; Case-Control Studies; Gels; Humans; Mucin 5AC; Mucin-5B; Mucociliary Cle | 2016 |
A 4-year-old child presenting morning onset of spontaneous tracheal rupture due to bronchial mucous plug occlusion during the nighttime sleep: a case report.
Topics: Airway Obstruction; Bronchial Diseases; Bronchoscopy; Child, Preschool; Humans; Male; Mediastinal Em | 2016 |
Not all mucous plugs are created equal!
Topics: Abdominal Wall; Airway Obstruction; Catheters; Equipment Failure; Female; Fundoplication; Hernias, D | 2017 |
Increased mucus accumulation in horses chronically affected with recurrent airway obstruction is not associated with up-regulation of CLCA1, EGFR, MUC5AC, Bcl-2, IL-13 and INF-gamma expression.
Topics: Airway Obstruction; Animals; Blood Gas Analysis; Bronchoalveolar Lavage Fluid; Cell Count; Chloride | 2008 |
[Effects of manually assisted coughing on respiratory mechanics in patients requiring full ventilatory support].
Topics: Adult; Aged; Airway Obstruction; Cough; Female; Humans; Intubation, Intratracheal; Male; Middle Aged | 2008 |
Ventilation patterns influence airway secretion movement.
Topics: Airway Obstruction; Humans; Models, Biological; Mucus; Respiration, Artificial; Suction | 2008 |
Expression of survivin in lung eosinophils is associated with pathology in a mouse model of allergic asthma.
Topics: Airway Obstruction; Allergens; Animals; Apoptosis; Asthma; Cell Adhesion; Cytokines; Disease Models, | 2009 |
Delayed endotracheal tube obstruction by mucus plug in a child.
Topics: Airway Obstruction; Child; Humans; Intubation, Intratracheal; Male; Mucus | 2009 |
Thoracic air leakage in the presentation of cast bronchitis.
Topics: Adrenal Cortex Hormones; Airway Obstruction; Bronchitis; Bronchoscopy; Child, Preschool; Drainage; F | 2009 |
Bronchial casts and pandemic (H1N1) 2009 virus infection.
Topics: Airway Obstruction; Child; Humans; Influenza A Virus, H1N1 Subtype; Influenza, Human; Japan; Male; M | 2010 |
Mucus hypersecretion in COPD: should we only rely on symptoms?
Topics: Airway Obstruction; Cough; Humans; Mucus; Pulmonary Disease, Chronic Obstructive | 2010 |
Experience with a new device for clearing mucus from the endotracheal tube.
Topics: Adult; Aged, 80 and over; Airway Obstruction; Device Removal; Humans; Intubation, Intratracheal; Mal | 2011 |
In vivo monitoring of cystic fibrosis-like lung disease in mice by volumetric computed tomography.
Topics: Airway Obstruction; Animals; Bronchography; Cone-Beam Computed Tomography; Cystic Fibrosis; Disease | 2011 |
Muc5b is the major polymeric mucin in mucus from thoroughbred horses with and without airway mucus accumulation.
Topics: Airway Obstruction; Animals; Antibodies; Bacteria; Horse Diseases; Horses; Immune Sera; Inflammation | 2011 |
Do commonly used ventilator settings for mechanically ventilated adults have the potential to embed secretions or promote clearance?
Topics: Adult; Aged; Aged, 80 and over; Airway Obstruction; Female; Humans; Inspiratory Capacity; Male; Midd | 2011 |
Potentially lethal complications of tracheostomy: autopsy considerations.
Topics: Adolescent; Adult; Airway Obstruction; Equipment Failure; Female; Forensic Pathology; Hemorrhage; Hu | 2011 |
Practical aspects of oronasopharyngeal suction in children.
Topics: Adolescent; Airway Obstruction; Child; Child, Preschool; Humans; Infant; Infant, Newborn; Mucus; Nur | 2011 |
Correlation and discriminant analysis between clinical, endoscopic, thoracic X-ray and bronchoalveolar lavage fluid cytology scores, for staging horses with recurrent airway obstruction (RAO).
Topics: Airway Obstruction; Animals; Cough; Horse Diseases; Horses; Mucus; Pulmonary Disease, Chronic Obstru | 2012 |
Respiratory infections increase the risk of granulation tissue formation following airway stenting in patients with malignant airway obstruction.
Topics: Adolescent; Adult; Airway Obstruction; Bronchoscopy; Equipment Failure; Female; Foreign-Body Migrati | 2012 |
Genetically determined heterogeneity of lung disease in a mouse model of airway mucus obstruction.
Topics: Airway Obstruction; Animals; Disease Models, Animal; Epithelial Sodium Channels; Lung Diseases, Obst | 2012 |
Lack of humidification may harm the patient during continuous positive airway pressure.
Topics: Aged; Airway Obstruction; Continuous Positive Airway Pressure; Humans; Humidity; Male; Mucus; Respir | 2012 |
Failure of both suction catheter passage and bronchoscopy to diagnose an obstructing tracheal mucus plug.
Topics: Airway Obstruction; Bronchoscopy; Catheterization; Humans; Male; Middle Aged; Mucus; Suction; Trache | 2012 |
SLC26A9-mediated chloride secretion prevents mucus obstruction in airway inflammation.
Topics: 3' Untranslated Regions; Airway Obstruction; Animals; Antiporters; Asthma; Bronchitis; Calcium; Chil | 2012 |
CT evaluation of airway foreign bodies in children: emphasis on the delayed diagnosis and differentiation from airway mucus plugs.
Topics: Airway Obstruction; Bronchoscopy; Child, Preschool; Diagnosis, Differential; Female; Foreign Bodies; | 2013 |
Images in clinical medicine. Mucous plug in the bronchus causing lung collapse.
Topics: Aged; Airway Obstruction; Bronchi; Bronchial Diseases; Bronchiectasis; Bronchoscopy; Female; Humans; | 2002 |
Plastic bronchitis mimicking foreign body aspiration that needs a specific diagnostic procedure.
Topics: Acute Disease; Airway Obstruction; Bronchi; Bronchitis; Bronchoscopy; Causality; Child, Preschool; C | 2003 |
Mucin genes in horse airways: MUC5AC, but not MUC2, may play a role in recurrent airway obstruction.
Topics: Airway Obstruction; Animals; Female; Gene Expression; Horse Diseases; Horses; Lung; Male; Mucin 5AC; | 2003 |
Transfer for "pneumonia".
Topics: Airway Obstruction; Bronchial Spasm; Bronchiolitis; Diagnostic Errors; Emergencies; Emergency Servic | 2003 |
Influence of the rheological properties of airway mucus on cough sound generation.
Topics: Adult; Airway Obstruction; Case-Control Studies; Chronic Disease; Cough; Female; Humans; Male; Middl | 2003 |
Characterization of airway plugging in fatal asthma.
Topics: Adolescent; Adult; Aged; Airway Obstruction; Asthma; Bronchi; Cell Culture Techniques; Child; Humans | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
The role of mucus in fatal asthma.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchi; Humans; Mucins; Mucus; Muscle, Smooth | 2003 |
[Recurrent manifestations of bronchial obstruction by voluminous mucus plugs].
Topics: Airway Obstruction; Bronchi; Bronchial Diseases; Casts, Surgical; Disease; Humans; Mucus | 1958 |
[Bronchial obstruction caused by mucus plug: lobectomy].
Topics: Airway Obstruction; Blood Pressure; Bronchi; Bronchial Diseases; Disease; Humans; Mucus; Pneumonecto | 1959 |
Mucus and fatal asthma.
Topics: Airway Obstruction; Asthma; Cell Count; Goblet Cells; Humans; Mucin 5AC; Mucin-5B; Mucins; Mucus; Re | 2004 |
Breath condensate hydrogen peroxide correlates with both airway cytology and epithelial lining fluid ascorbic acid concentration in the horse.
Topics: Airway Obstruction; Animals; Ascorbic Acid; Breath Tests; Bronchoalveolar Lavage Fluid; Bronchoscopy | 2004 |
Total airway obstruction by a mucous plug relieved with extreme positive pressure: case report of a pediatric patient.
Topics: Airway Obstruction; Humans; Infant; Male; Mucus; Positive-Pressure Respiration | 2004 |
[Severe asthma complicated with large mucoid impaction: successful removal with balloon catheter].
Topics: Adult; Airway Obstruction; Asthma; Bronchoscopy; Catheterization; Female; Humans; Kidney Transplanta | 2004 |
[Concentrations of carcinoembryonic antigen in serum and bronchoalveolar lavage fluid of asthmatic patients with mucoid impaction].
Topics: Aged; Airway Obstruction; Asthma; Bronchial Diseases; Bronchiectasis; Bronchoalveolar Lavage Fluid; | 2004 |
Effect of disodium cromoglycate on airway mucus secretion during antigen-induced late asthmatic responses in a murine model of asthma.
Topics: Airway Obstruction; Animals; Anti-Asthmatic Agents; Antigens; Asthma; Bronchoalveolar Lavage Fluid; | 2005 |
[Intermittent asphyxia syndrome caused by a bronchial cast in the subglottic region].
Topics: Airway Obstruction; Asphyxia; Bronchi; Female; Glottis; Humans; Middle Aged; Mucus; Syndrome | 2005 |
Pressure-flow signatures of central-airway mucus plugging.
Topics: Adrenal Cortex Hormones; Adult; Airway Obstruction; Airway Resistance; Anti-Bacterial Agents; Bronch | 2006 |
Persistent mucus accumulation: a consequence of delayed bronchial mucous cell apoptosis in RAO-affected horses?
Topics: Airway Obstruction; Animals; Apoptosis; Bronchi; Bronchoalveolar Lavage Fluid; Horse Diseases; Horse | 2006 |
The effects of low dose leukotriene receptor antagonist therapy on airway remodeling and cysteinyl leukotriene expression in a mouse asthma model.
Topics: Acetates; Airway Obstruction; Animals; Anti-Asthmatic Agents; Asthma; Collagen; Cyclopropanes; Cyste | 2006 |
Pulmonary atelectasis manifested after induction of anesthesia: a contribution of sinobronchial syndrome?
Topics: Adult; Airway Obstruction; Analgesics, Opioid; Anesthesia, General; Anesthetics, Intravenous; Blood | 2007 |
A new link to airway obstruction in asthma.
Topics: Airway Obstruction; Asthma; gamma-Aminobutyric Acid; Humans; Mucus; Respiratory System; Signal Trans | 2007 |
Bronchoscopic removal of mucus casts in a boy with plastic bronchitis.
Topics: Airway Obstruction; Bronchitis; Bronchoscopy; Diagnosis, Differential; Foreign Bodies; Humans; Infan | 2007 |
Airway clearance: physiology, pharmacology, techniques, and practice.
Topics: Airway Obstruction; Expectorants; Humans; Mucus; Physical Therapy Modalities; Respiratory Therapy | 2007 |
Airway clearance: physiology, pharmacology, techniques, and practice.
Topics: Airway Obstruction; Expectorants; Humans; Mucus; Physical Therapy Modalities; Respiratory Therapy | 2007 |
Airway clearance: physiology, pharmacology, techniques, and practice.
Topics: Airway Obstruction; Expectorants; Humans; Mucus; Physical Therapy Modalities; Respiratory Therapy | 2007 |
Airway clearance: physiology, pharmacology, techniques, and practice.
Topics: Airway Obstruction; Expectorants; Humans; Mucus; Physical Therapy Modalities; Respiratory Therapy | 2007 |
Adenovirus IL-13-induced airway disease in mice: a corticosteroid-resistant model of severe asthma.
Topics: Adenoviridae; Adenoviridae Infections; Airway Obstruction; Animals; Cell Culture Techniques; Cell Di | 2008 |
Chronic airflow obstruction: pathophysiology and management.
Topics: Adrenal Cortex Hormones; Adrenergic beta-Agonists; Airway Obstruction; Atropine; Blood Gas Analysis; | 1980 |
Mucus hypersecretion, airways obstruction, and mortality from chronic lung disease.
Topics: Airway Obstruction; Humans; Lung Diseases, Obstructive; Mucus; Respiratory Function Tests; Smoking | 1984 |
Mucus hypersecretion, airways obstruction.
Topics: Adult; Airway Obstruction; Ciliary Motility Disorders; Humans; Mucus; Smoking | 1984 |
Mast cells and asthma. The role of mast cell mediators in the pathogenesis of allergic asthma.
Topics: Airway Obstruction; Asthma; Bradykinin; Capillary Permeability; Histamine; Humans; Leukotriene E4; M | 1983 |
The "mucous plug syndrome". A pulmonary embolism mimic.
Topics: Adult; Airway Obstruction; Bronchi; Diagnosis, Differential; Female; Humans; Male; Middle Aged; Mucu | 1984 |
Neonatal high-frequency jet ventilation.
Topics: Airway Obstruction; Bronchial Fistula; Fistula; Humans; Infant, Newborn; Mucus; Pleural Diseases; Pu | 1983 |
Regional mucociliary removal of inhaled particles in smokers with small airways disease.
Topics: Adult; Aerosols; Airway Obstruction; Cilia; Humans; Lung Diseases, Obstructive; Microspheres; Middle | 1983 |
Mucous plugging simulating pulmonary embolism in patients with quadriplegia.
Topics: Adult; Airway Obstruction; Bronchial Diseases; Diagnosis, Differential; Humans; Hypoxia; Lung; Male; | 1984 |
Mucus in the bronchi and respiratory pathophysiology.
Topics: Airway Obstruction; Bronchi; Humans; Mucus; Respiratory Tract Diseases | 1980 |
Membranous laryngotracheobronchitis.
Topics: Airway Obstruction; Child; Croup; Diagnosis, Differential; Endoscopy; Female; Foreign Bodies; Humans | 1982 |
Tracheobronchial mucus: abnormalities related to asthma and its treatment.
Topics: Airway Obstruction; Animals; Asthma; Biological Transport; Bronchi; Cilia; Constriction, Pathologic; | 1981 |
Sleep hypoxemia. Growing clinical awareness.
Topics: Airway Obstruction; Humans; Hypoxia; Mucus; Obesity; Respiration Disorders; Sleep; Sleep Apnea Syndr | 1980 |
Rapid reocclusion of left primary bronchus by fibrinomucinous cast in a case of large cell lung cancer.
Topics: Airway Obstruction; Bronchi; Bronchoscopy; Carcinoma, Non-Small-Cell Lung; Humans; Lung Neoplasms; L | 1995 |
Massive atelectasis with respiratory arrest due to transtracheal oxygen catheter-related mass formation.
Topics: Aged; Airway Obstruction; Catheters, Indwelling; Humans; Male; Mucus; Oxygen Inhalation Therapy; Pul | 1994 |
Acoustic method to estimate the longitudinal area profile of endotracheal tubes.
Topics: Acoustics; Airway Obstruction; Evaluation Studies as Topic; Humans; Intubation, Intratracheal; Linea | 1994 |
A nearly fatal tracheal obstruction resulting from a transtracheal oxygen catheter.
Topics: Aged; Airway Obstruction; Catheters, Indwelling; Equipment Failure; Humans; Male; Mucus; Oxygen Inha | 1993 |
Fontan's operation complications.
Topics: Airway Obstruction; Child, Preschool; Female; Heart Atria; Humans; Mucus; Postoperative Complication | 1993 |
[Dangerous complication of transtracheal oxygen therapy with the SCOOP(R) system].
Topics: Aged; Airway Obstruction; Bronchoscopy; Catheters, Indwelling; Equipment Failure; Female; Humans; In | 1996 |
Obliterative bronchiolitis: individual CT signs of small airways disease and functional correlation.
Topics: Adult; Aged; Airway Obstruction; Bronchi; Bronchiolitis Obliterans; Bronchography; Female; Forced Ex | 1997 |
Mucoid impaction following nasal intubation in a child with an upper respiratory infection.
Topics: Airway Obstruction; Bronchoscopy; Child, Preschool; Fiber Optic Technology; Humans; Intubation, Gast | 1998 |
Inspissated secretions: a life-threatening complication of prolonged noninvasive ventilation.
Topics: Aged; Airway Obstruction; Humans; Laryngoscopy; Male; Mouth Mucosa; Mucus; Pharynx; Positive-Pressur | 2000 |
Metabolic consequences of adenosine deaminase deficiency in mice are associated with defects in alveogenesis, pulmonary inflammation, and airway obstruction.
Topics: Adenosine; Adenosine Deaminase; Airway Obstruction; Animals; Bronchoalveolar Lavage Fluid; Eosinophi | 2000 |
Tracheobronchial mucus viscoelasticity during environmental challenge in horses with recurrent airway obstruction.
Topics: Airway Obstruction; Animals; Bronchi; Bronchoalveolar Lavage Fluid; Chronic Disease; Horse Diseases; | 2000 |
Mucus plugging as a cause of acute lobar overdistension.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchoscopy; Child, Preschool; Cough; Diagnosis, Differe | 2001 |
[Plastic bronchitis and mucoid impaction--uncommon disease syndromes with expectoration mucus plugs].
Topics: Adult; Aged; Aged, 80 and over; Airway Obstruction; Aspergillosis, Allergic Bronchopulmonary; Asthma | 2001 |
Rescue use of DNase in critical lung atelectasis and mucus retention in premature neonates.
Topics: Administration, Inhalation; Airway Obstruction; Deoxyribonuclease I; Expectorants; Humans; Infant, N | 2001 |
Persistent mucin glycoprotein alterations in equine recurrent airway obstruction.
Topics: Airway Obstruction; Animals; Blood; Bronchoalveolar Lavage Fluid; Dialysis; Enzyme-Linked Immunosorb | 2001 |
Histopathology of fatal asthma: drowning in mucus.
Topics: Adolescent; Adult; Airway Obstruction; Asthma; Drowning; Female; Humans; Male; Middle Aged; Mucus | 2001 |
Atelectasis and mucus plugging in spinal cord injury: case report and therapeutic approaches.
Topics: Acetylcysteine; Airway Obstruction; Bronchodilator Agents; Bronchoscopy; Combined Modality Therapy; | 2001 |
British phlegm, British bronchi.
Topics: Adult; Airway Obstruction; Bronchi; Bronchitis; Diagnosis, Differential; Humans; Male; Middle Aged; | 1977 |
[Tracheobronchial care in the newborn infant--aid to the nurse].
Topics: Aerosols; Airway Obstruction; Humans; Infant, Newborn; Mucus; Physical Therapy Modalities; Posture; | 1979 |
[Inter-alpha-trypsin inhibitor in serum and bronchial mucus inhibitor in sputum in chronic airway obstruction (author's transl)].
Topics: Airway Obstruction; alpha 1-Antitrypsin; Bronchi; Chronic Disease; Humans; Lung Diseases, Obstructiv | 1978 |
Large bronchial casts.
Topics: Adult; Airway Obstruction; Bronchi; Bronchoscopy; Fiber Optic Technology; Hemorrhage; Humans; Male; | 1979 |
Mucoid impaction (inspissated secretions) in segmental bronchial obstruction.
Topics: Adenoma; Airway Obstruction; Bronchi; Bronchial Diseases; Bronchial Neoplasms; Bronchopulmonary Sequ | 1979 |
[Conclusions of an international symposium held at Aachen on 4 and 5 May about mucolytic agents, especially oral acetylcysteine].
Topics: Acetylcysteine; Airway Obstruction; Bronchi; Evaluation Studies as Topic; Expectorants; Humans; Mucu | 1979 |
Acetylcysteine for life-threatening acute bronchial obstruction.
Topics: Acetylcysteine; Acute Disease; Adult; Airway Obstruction; Bronchial Diseases; Female; Humans; Male; | 1978 |
[Bronchial obstruction by mucoid impaction--a frequent cause of atelectasis (author's transl)].
Topics: Adult; Airway Obstruction; Child; Female; Humans; Lung; Mucus; Penicillins; Pulmonary Atelectasis; R | 1978 |
The natural history of chronic airflow obstruction.
Topics: Adult; Age Factors; Airway Obstruction; Bronchial Diseases; Chronic Disease; Forced Expiratory Volum | 1977 |
Treatment of mucus hypersecretion in human disease.
Topics: Airway Obstruction; Atropine; Bronchial Diseases; Cystic Fibrosis; Exudates and Transudates; Glycopr | 1977 |
Bronchorrhea responsive to aerosolized atropine.
Topics: Aerosols; Airway Obstruction; Atropine; Bronchi; Humans; Male; Middle Aged; Mucus; Secretory Rate | 1976 |
Bronchocentric granulomatosis, mucoid impaction, and hypersensitivity reactions to fungi.
Topics: Airway Obstruction; Aspergillosis; Aspergillus fumigatus; Bronchi; Bronchial Diseases; Eosinophils; | 1975 |
Tracheal mucociliary transport in patients with cystic fibrosis and its stimulation by terbutaline.
Topics: Adolescent; Adult; Airway Obstruction; Bronchoscopy; Cilia; Cystic Fibrosis; Female; Humans; Male; M | 1975 |
Mucoid impaction of the bronchi. Case reports.
Topics: Adult; Airway Obstruction; Bronchial Diseases; Diagnosis, Differential; Humans; Male; Mucus; Radiogr | 1975 |
Familial non-cystic fibrosis mucus inspissation of respiratory tract.
Topics: Airway Obstruction; Ampicillin; Bronchitis; Bronchopneumonia; Child; Child, Preschool; Chronic Disea | 1975 |
Chronic bronchitis.
Topics: Airway Obstruction; Bronchitis; Environmental Pollution; Humans; Mucus; Smoking | 1975 |
Contribution of morphometry, bronchial casts and electron microscopy to study of airway obstruction in chronic obstructive lung disease.
Topics: Airway Obstruction; Bronchi; Humans; Lung Diseases, Obstructive; Mucus | 1976 |
Airway mucous plug mimicking diaphragmatic herniation.
Topics: Airway Obstruction; Diagnosis, Differential; Hernia, Diaphragmatic, Traumatic; Humans; Male; Middle | 1992 |
Acute respiratory compromise resulting from tracheal mucous impaction secondary to a transtracheal oxygen catheter.
Topics: Acute Disease; Aged; Airway Obstruction; Female; Humans; Intubation, Intratracheal; Mucus; Oxygen In | 1992 |
Airway obstruction by a mucus ball from a transtracheal oxygen catheter.
Topics: Adult; Airway Obstruction; Catheterization; Female; Humans; Intubation, Intratracheal; Mucus; Oxygen | 1992 |
Airway obstruction by a mucus ball from a transtracheal oxygen catheter.
Topics: Airway Obstruction; Catheterization; Humans; Intubation, Intratracheal; Mucus; Oxygen Inhalation The | 1992 |
Respiratory failure and cor pulmonale associated with tracheal mucoid accumulation from a SCOOP transtracheal oxygen catheter.
Topics: Airway Obstruction; Female; Humans; Intubation, Intratracheal; Male; Middle Aged; Mucus; Oxygen; Pul | 1992 |
Chronic inflammation is associated with an increased proportion of goblet cells recovered by bronchial lavage.
Topics: Airway Obstruction; Bronchi; Bronchitis; Bronchoalveolar Lavage Fluid; Bronchoscopy; Cell Count; Chr | 1991 |
Transient unilateral hyperlucent lung due to mucus plugs.
Topics: Airway Obstruction; Female; Humans; Humidity; Lung; Middle Aged; Mucus; Radiography; Tracheostomy | 1991 |
Nearly fatal partial obstruction of the upper airway.
Topics: Adult; Airway Obstruction; Asthma; Bronchi; Female; Histamine H1 Antagonists; Humans; Mucus; Nonpres | 1990 |
Eosinophil cationic protein stimulates and major basic protein inhibits airway mucus secretion.
Topics: Airway Obstruction; Animals; Asthma; Blood Proteins; Cats; Dose-Response Relationship, Drug; Enzyme- | 1991 |
Relevance of airflow obstruction and mucus hypersecretion to mortality.
Topics: Airway Obstruction; Cause of Death; Coronary Disease; Follow-Up Studies; Forced Expiratory Volume; G | 1991 |
Immediate postextubation upper airway obstruction by a mucous cast.
Topics: Adolescent; Airway Obstruction; Bronchoscopy; Female; Humans; Intubation, Intratracheal; Mucus | 1990 |
Characterization of airway mucus from a fatal case of status asthmaticus.
Topics: Adolescent; Airway Obstruction; Asthma; Centrifugation, Density Gradient; Chromatography, Thin Layer | 1988 |
Regulation of airway secretions.
Topics: Airway Obstruction; Asthma; Biological Transport; Epithelium; Humans; Ion Channels; Mucus; Respirato | 1985 |
Insidious onset of airway obstruction of an endotracheal tube by blood-mucus plugs.
Topics: Adult; Airway Obstruction; Blood Coagulation; Humans; Intubation, Intratracheal; Male; Mucus | 1989 |
Mucus transport in a miniaturized simulated cough machine: effect of constriction and serous layer simulant.
Topics: Airway Obstruction; Airway Resistance; Biological Transport; Cough; Humans; Models, Biological; Mucu | 1989 |
Shortlasting unilateral neuralgiform headache attacks with conjunctival injection, tearing, sweating, and rhinorrhea.
Topics: Aged; Airway Obstruction; Cluster Headache; Conjunctival Diseases; Humans; Male; Middle Aged; Mucus; | 1989 |
Reversible acute unilateral diminished pulmonary ventilation and perfusion caused by a mucous plug.
Topics: Aged; Airway Obstruction; Angiography; Bronchoscopy; Diagnosis, Differential; Humans; Lung; Male; Mu | 1989 |
Asphyxiation by glottic impaction of nasal secretions.
Topics: Aged; Aged, 80 and over; Airway Obstruction; Asphyxia; Female; Glottis; Humans; Mucus; Nasopharynx | 1989 |
Profound intraoperative atelectasis.
Topics: Adult; Airway Obstruction; Femoral Fractures; Humans; Hypoxia; Intraoperative Complications; Male; M | 1989 |
Physiologic implications of the autonomic aberrations in cystic fibrosis.
Topics: Adult; Airway Obstruction; Airway Resistance; Asthma; Autonomic Nervous System; Bronchi; Bronchial P | 1986 |
Tracheal plugs in oligohydramnios.
Topics: Airway Obstruction; Amniotic Fluid; Diagnosis, Differential; Female; Fetal Distress; Humans; Infant, | 1988 |
A case of plastic bronchitis.
Topics: Airway Obstruction; Bronchitis; Female; Humans; Middle Aged; Mucus; Suction | 1988 |
Obstructive emphysema due to mucus plugging in quadriplegia.
Topics: Adult; Airway Obstruction; Bronchoscopy; Emphysema; Humans; Male; Mucus; Quadriplegia; Suction; Ther | 1987 |
The presence or absence of bronchial mucus in fatal asthma.
Topics: Airway Obstruction; Asthma; Bronchi; Humans; Mucus | 1987 |
The pathogenesis of severe asthma: a consensus report from the Workshop on Pathogenesis.
Topics: Acute Disease; Airway Obstruction; Asthma; Bronchial Spasm; Humans; Lung; Mast Cells; Mucus; Pulmona | 1987 |
Occluded trach tube.
Topics: Airway Obstruction; Emergencies; Humans; Mucus; Postoperative Complications; Tracheotomy | 1987 |
Unilateral pulmonary hyperinflation from mucus check-valve mechanism.
Topics: Adult; Airway Obstruction; Bronchi; Humans; Lung Diseases; Male; Mucus; Respiration; Suction; Therap | 1986 |
Unilateral absence of ventilation and perfusion associated with a bronchial mucous plug.
Topics: Adult; Airway Obstruction; Bronchi; Female; Humans; Lung; Mucus; Paraplegia; Radiography; Radionucli | 1987 |
Excessive accumulation of mucus in children with asthma: a potential role for erythromycin? A case discussion.
Topics: Airway Obstruction; Asthma; Child, Preschool; Erythromycin; Glucocorticoids; Humans; Male; Mucus; Re | 1986 |
Nasal obstruction.
Topics: Adenoids; Airway Obstruction; Ephedrine; Foreign Bodies; Hematoma; Histamine H1 Antagonists; Humans; | 1972 |
The contribution of morphology to the study of chronic obstructive lung disease.
Topics: Adult; Age Factors; Aged; Airway Obstruction; Biopsy; Bronchi; Bronchitis; Cilia; Exudates and Trans | 1974 |
[Letter: Mucoid impactation of the bronchi].
Topics: Airway Obstruction; Bronchi; Humans; Mucus; Pulmonary Atelectasis | 1974 |
Criteria for the testing of mucolytic agents.
Topics: Airway Obstruction; Bronchitis; Chronic Disease; Circadian Rhythm; Expectorants; Humans; Mucus; Neur | 1974 |
Rare complications of bronchial asthma.
Topics: Adult; Aged; Airway Obstruction; Allergens; Asthma; Bronchial Neoplasms; Bronchiectasis; Bronchitis; | 1972 |
[Effect of a bronchosecretolytic agent on the tracheobronchial expectoration].
Topics: Airway Obstruction; Animals; Bronchi; Bronchodilator Agents; Cilia; Cricetinae; Epithelium; Expector | 1972 |
Disease of the small airways in chronic bronchitis.
Topics: Airway Obstruction; Airway Resistance; Autopsy; Bronchi; Bronchitis; Chronic Disease; Humans; Method | 1973 |
RPC from the AFIP.
Topics: Adenoma; Adult; Airway Obstruction; Arteriovenous Fistula; Bronchi; Bronchial Diseases; Carcinoma, B | 1973 |
Mucoid inpaction of the bronchus. Diagnosis and treatment.
Topics: Acetylcysteine; Adult; Airway Obstruction; Asthma; Bronchial Diseases; Bronchitis; Female; Humans; I | 1973 |
Infant cot deaths.
Topics: Airway Obstruction; Cough; Death, Sudden; Humans; Infant, Newborn; Mucus; Respiratory Tract Infectio | 1971 |
Intraluminal exudates of nonrespiratory bronchioles in pulmonary emphysema.
Topics: Airway Obstruction; Bronchi; Exudates and Transudates; Histiocytes; Humans; Leukocytes; Male; Middle | 1971 |
[Case of tracheal obstruction by a mucous concretion. Tracheotomy--recovery].
Topics: Airway Obstruction; Female; Humans; Intubation, Intratracheal; Middle Aged; Mucus; Postoperative Com | 1971 |
Bronchial atresia: a rare cause of unilateral lung hypertranslucency.
Topics: Adult; Airway Obstruction; Angiography; Bronchi; Bronchial Diseases; Bronchial Neoplasms; Bronchogra | 1971 |