furosemide has been researched along with Water-Electrolyte Imbalance in 81 studies
Furosemide: A benzoic-sulfonamide-furan. It is a diuretic with fast onset and short duration that is used for EDEMA and chronic RENAL INSUFFICIENCY.
furosemide : A chlorobenzoic acid that is 4-chlorobenzoic acid substituted by a (furan-2-ylmethyl)amino and a sulfamoyl group at position 2 and 5 respectively. It is a diuretic used in the treatment of congestive heart failure.
Water-Electrolyte Imbalance: Disturbances in the body's WATER-ELECTROLYTE BALANCE.
| Excerpt | Relevance | Reference |
|---|---|---|
| "A new delivery mechanism provides subcutaneous infusion of furosemide to treat fluid overload in adults with heart failure." | 8.31 | New Delivery Route for Furosemide in Heart Failure. ( Aschenbrenner, DS, 2023) |
| "To assess safety and effectiveness of a clinical application of a furosemide infusion protocol in edematous critically ill patients." | 7.78 | Clinical outcomes of a furosemide infusion protocol in edematous patients in the intensive care unit. ( Bezdjian, L; Hopkins, RO; Rodriguez, L; Thomsen, G, 2012) |
| "Twenty-six patients were selected for treatment with minoxidil on the basis of hypertension which could not be controlled either because of (1) drug failures and/or (2) side effects of drugs." | 7.65 | Minoxidil in severe hypertension: value when conventional drugs have failed. ( Dormois, JC; Nies, AS; Young, JL, 1975) |
| "Furosemide remains the drug of choice for patients with the transurethral resection syndrome." | 5.06 | Furosemide-induced disturbances of renal function in patients undergoing TURP. ( Deshon, GE; Donatucci, CF; Hunt, M; Wade, CE, 1990) |
| "A new delivery mechanism provides subcutaneous infusion of furosemide to treat fluid overload in adults with heart failure." | 4.31 | New Delivery Route for Furosemide in Heart Failure. ( Aschenbrenner, DS, 2023) |
| "We give account of a patient, who works in health care, with bulimia nervosa (BN) and a long term abuse of Furosemide." | 3.81 | [Diuretic-Abuse in Chronic Bulimia Nervosa--Case Report and Clinical Management]. ( Bröckel-Ristevski, N; Cuntz, U; Fumi, M; Greetfeld, M; Voderholzer, U, 2015) |
| "To assess safety and effectiveness of a clinical application of a furosemide infusion protocol in edematous critically ill patients." | 3.78 | Clinical outcomes of a furosemide infusion protocol in edematous patients in the intensive care unit. ( Bezdjian, L; Hopkins, RO; Rodriguez, L; Thomsen, G, 2012) |
| " In the present paper we give the results of the comparison between TOBEC and total body water (TBW; assessed by the tritium dilution technique) in three groups of animals: (1) healthy (n 17), (2) expanded fluid volume by secondary biliary cirrhosis (SBC; n 9) and (3) Furosemide-treated rats (n 9)." | 3.68 | In vivo total body water assessment by total body electrical conductivity in rats suffering perturbations of water compartment equilibrium. ( Battistini, N; Bedogni, G; Bini, A; Gambella, GR; Virgili, F, 1993) |
| "In two patients with severe hypertension and moderately severe renal insufficiency, metolazone and furosemide were used in combination with propranolol, methyldopa, and hydralazine to augment control of blood pressure." | 3.66 | Severe electrolyte disturbances associated with metolazone and furosemide. ( Black, WD; Roman, J; Shiner, PT, 1978) |
| "Twenty-six patients were selected for treatment with minoxidil on the basis of hypertension which could not be controlled either because of (1) drug failures and/or (2) side effects of drugs." | 3.65 | Minoxidil in severe hypertension: value when conventional drugs have failed. ( Dormois, JC; Nies, AS; Young, JL, 1975) |
| "The furosemide group was 3 times more likely to have 10% fluid overload (odds ratio [OR], 3." | 2.84 | Peritoneal Dialysis vs Furosemide for Prevention of Fluid Overload in Infants After Cardiac Surgery: A Randomized Clinical Trial. ( Cooper, DS; Goldstein, SL; Krawczeski, CD; Kwiatkowski, DM; Morales, DL; Nelson, DP, 2017) |
| "Tolvaptan is an orally administered selective vasopressin 2 receptor antagonist that promotes aquaresis." | 2.82 | Efficacy and Safety Evaluation of Tolvaptan on Management of Fluid Balance after Cardiovascular Surgery Using Cardiopulmonary Bypass. ( Hirai, H; Hosono, M; Kaku, D; Kubota, Y; Nakahira, A; Sasaki, Y; Shibata, T; Suehiro, S; Suehiro, Y, 2016) |
| "Aminophylline has not been studied as an adjunct diuretic in critically ill children." | 2.69 | Aminophylline in the treatment of fluid overload. ( Pollack, MM; Pretzlaff, RK; Vardis, RJ, 1999) |
| "Protocol-guided diuretic management, with individualized titration of dosage to defined physiologic endpoints can be readily and safely implemented in the ICU." | 2.68 | Protocol-guided diuretic management: comparison of furosemide by continuous infusion and intermittent bolus. ( Fine, D; Lynch, JP; Schuller, D, 1997) |
| " Actually, a significant association with ARD was not present in any CHF patient with dilated left ventricle treated with high dosage of iv FUR, whereas a highly significant association with ARD was observed in HFNEF patients (OR: 72 95% CI: 6." | 1.37 | In chronic heart failure with marked fluid retention, the i.v. high doses of loop diuretic are a predictor of aggravated renal dysfunction, especially in the set of heart failure with normal or only mildly impaired left ventricular systolic function. ( Ariano, C; Cantatrione, S; Ciccarelli, A; Cioppa, C; De Vecchis, R; Giasi, A; Pucciarelli, A, 2011) |
| "Furosemide was used in 206 (49." | 1.34 | Bodyweight change during the first 5 days of chemotherapy as an indicator of cisplatin renal toxicity. ( Kunitoh, H; Nokihara, H; Ohe, Y; Sekine, I; Tamura, T; Yamada, K; Yamamoto, N, 2007) |
| "Patients with severe decompensated congestive heart failure (CHF) commonly exhibit acid-base and electrolyte disturbances mainly due to the activation of several neurohumoral mechanisms as well as to drugs regularly used in this population." | 1.31 | Hypomagnesemia and concurrent acid-base and electrolyte abnormalities in patients with congestive heart failure. ( Alexandrides, GE; Bairaktari, ET; Elisaf, MS; Goudevenos, J; Liberopoulos, EN; Milionis, HJ, 2002) |
| "Sensorineural hearing loss was statistically associated (1) with greater amounts of furosemide administration for longer durations and in combination with aminoglycoside antibiotics and (2) with more episodes of low pH, hypoxemia, or both, higher total bilirubin levels, and substantially lower neonatal status scores." | 1.28 | Neonatal status and hearing loss in high-risk infants. ( Eldredge, L; Salamy, A; Tooley, WH, 1989) |
| "Forty patients with generalized cancer complicated by water and electrolyte retention were treated with "medium" and "large" doses of furosemide and bumetanide with 35% and 40% objective positive response, respectively." | 1.26 | Diuretics in malignant effusions and edemas of generalized cancer. ( Athanasiou, A; Dadiotis, L; Razis, DV, 1976) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 36 (44.44) | 18.7374 |
| 1990's | 16 (19.75) | 18.2507 |
| 2000's | 8 (9.88) | 29.6817 |
| 2010's | 13 (16.05) | 24.3611 |
| 2020's | 8 (9.88) | 2.80 |
| Authors | Studies |
|---|---|
| Kitajima, N | 1 |
| Yamada, H | 1 |
| Minami, T | 1 |
| Ohtsuru, S | 1 |
| Komiya, S | 1 |
| Katsumata, M | 1 |
| Ozawa, M | 1 |
| Haze, T | 1 |
| Kawano, R | 1 |
| Ohki, Y | 1 |
| Suzuki, S | 1 |
| Kobayashi, Y | 1 |
| Fujiwara, A | 1 |
| Saka, S | 1 |
| Tamura, K | 1 |
| Hirawa, N | 1 |
| Wichmann, S | 2 |
| Itenov, TS | 2 |
| Berthelsen, RE | 2 |
| Lange, T | 2 |
| Perner, A | 2 |
| Gluud, C | 2 |
| Lawson-Smith, P | 1 |
| Nebrich, L | 1 |
| Wiis, J | 2 |
| Brøchner, AC | 2 |
| Hildebrandt, T | 1 |
| Behzadi, MT | 1 |
| Strand, K | 1 |
| Andersen, FH | 1 |
| Strøm, T | 1 |
| Järvisalo, M | 1 |
| Damgaard, KAJ | 1 |
| Vang, ML | 1 |
| Wahlin, RR | 1 |
| Sigurdsson, MI | 1 |
| Thormar, KM | 1 |
| Ostermann, M | 1 |
| Keus, F | 1 |
| Bestle, MH | 2 |
| Schønemann-Lund, M | 1 |
| Aschenbrenner, DS | 1 |
| Pettit, KA | 1 |
| Schreiter, NA | 1 |
| Lushaj, EB | 1 |
| Hermsen, JL | 1 |
| Wilhelm, M | 1 |
| Mahon, ACR | 1 |
| Nelson, KL | 1 |
| DeGrave, JJ | 1 |
| Marka, N | 1 |
| Anagnostopoulos, PV | 1 |
| Bellino, MC | 1 |
| Massari, F | 1 |
| Albanese, M | 1 |
| Ursi, R | 1 |
| Angelini, G | 1 |
| Lisi, F | 1 |
| Amato, L | 1 |
| Scicchitano, P | 1 |
| Guida, P | 1 |
| Brunetti, ND | 1 |
| Di Serio, F | 1 |
| Ciccone, MM | 1 |
| Iacoviello, M | 1 |
| Liu, C | 1 |
| Peng, Z | 1 |
| Gao, X | 1 |
| Gajic, O | 1 |
| Dong, Y | 1 |
| Prokop, LJ | 1 |
| Murad, MH | 1 |
| Kashani, KB | 1 |
| Domecq, JP | 1 |
| García-Blas, S | 1 |
| Bonanad, C | 1 |
| Llàcer, P | 1 |
| Ventura, S | 1 |
| Núñez, JM | 1 |
| Sánchez, R | 1 |
| Chamorro, C | 1 |
| Fácila, L | 1 |
| de la Espriella, R | 1 |
| Vaquer, JM | 1 |
| Cordero, A | 1 |
| Roqué, M | 1 |
| Ortiz, V | 1 |
| Racugno, P | 1 |
| Bodí, V | 1 |
| Valero, E | 1 |
| Santas, E | 1 |
| Moreno, MDC | 1 |
| Miñana, G | 1 |
| Carratalá, A | 1 |
| Bondanza, L | 1 |
| Payá, A | 1 |
| Cardells, I | 1 |
| Heredia, R | 1 |
| Pellicer, M | 1 |
| Valls, G | 1 |
| Palau, P | 1 |
| Bosch, MJ | 1 |
| Raso, R | 1 |
| Sánchez, A | 1 |
| Bertomeu-González, V | 1 |
| Bertomeu-Martínez, V | 1 |
| Montagud-Balaguer, V | 1 |
| Albiach-Montañana, C | 1 |
| Pendás-Meneau, J | 1 |
| Marcaida, G | 1 |
| Cervantes-García, S | 1 |
| San Antonio, R | 1 |
| de Mingo, E | 1 |
| Chorro, FJ | 1 |
| Sanchis, J | 1 |
| Núñez, J | 1 |
| Jacobs, R | 1 |
| Jonckheer, J | 1 |
| Malbrain, MLNG | 1 |
| Ohara, K | 1 |
| Masuda, T | 1 |
| Murakami, T | 1 |
| Imai, T | 1 |
| Yoshizawa, H | 1 |
| Nakagawa, S | 1 |
| Okada, M | 1 |
| Miki, A | 1 |
| Myoga, A | 1 |
| Sugase, T | 1 |
| Sekiguchi, C | 1 |
| Miyazawa, Y | 1 |
| Maeshima, A | 1 |
| Akimoto, T | 1 |
| Saito, O | 1 |
| Muto, S | 1 |
| Nagata, D | 1 |
| Suehiro, Y | 1 |
| Hosono, M | 1 |
| Shibata, T | 1 |
| Sasaki, Y | 1 |
| Hirai, H | 1 |
| Nakahira, A | 1 |
| Kubota, Y | 1 |
| Kaku, D | 1 |
| Suehiro, S | 1 |
| Greetfeld, M | 1 |
| Bröckel-Ristevski, N | 1 |
| Fumi, M | 1 |
| Cuntz, U | 1 |
| Voderholzer, U | 1 |
| Kwiatkowski, DM | 1 |
| Goldstein, SL | 1 |
| Cooper, DS | 1 |
| Nelson, DP | 1 |
| Morales, DL | 1 |
| Krawczeski, CD | 1 |
| de Gregorio, C | 1 |
| Morabito, G | 1 |
| Cerrito, M | 1 |
| Dattilo, G | 1 |
| Oreto, G | 1 |
| De Vecchis, R | 1 |
| Ciccarelli, A | 1 |
| Ariano, C | 1 |
| Cioppa, C | 1 |
| Giasi, A | 1 |
| Pucciarelli, A | 1 |
| Cantatrione, S | 1 |
| Radojevic, N | 1 |
| Bjelogrlic, B | 1 |
| Aleksic, V | 1 |
| Rancic, N | 1 |
| Samardzic, M | 1 |
| Petkovic, S | 1 |
| Savic, S | 1 |
| Banerjee, P | 1 |
| Tanner, G | 1 |
| Williams, L | 1 |
| Vandergheynst, F | 1 |
| Brachet, C | 1 |
| Heinrichs, C | 1 |
| Decaux, G | 1 |
| Elser, HE | 1 |
| Thomsen, G | 1 |
| Bezdjian, L | 1 |
| Rodriguez, L | 1 |
| Hopkins, RO | 1 |
| Mank, A | 1 |
| Semin-Goossens, A | 1 |
| Lelie, Jv | 1 |
| Bakker, P | 1 |
| Vos, R | 1 |
| Vasavada, N | 1 |
| Agarwal, R | 1 |
| Grob, M | 1 |
| Trottier, JF | 1 |
| Mouginot, D | 2 |
| Haas, NA | 1 |
| Camphausen, CK | 1 |
| Sekine, I | 1 |
| Yamada, K | 1 |
| Nokihara, H | 1 |
| Yamamoto, N | 1 |
| Kunitoh, H | 1 |
| Ohe, Y | 1 |
| Tamura, T | 1 |
| Mehta, RL | 1 |
| Cantarovich, F | 1 |
| Shaw, A | 1 |
| Hoste, E | 1 |
| Murray, P | 1 |
| Prandota, J | 1 |
| Houin, G | 1 |
| Peiker, G | 1 |
| Traeger, A | 1 |
| Stiller, K | 1 |
| Müller, B | 1 |
| Bazzato, G | 1 |
| Coli, U | 1 |
| Landini, S | 1 |
| Lucatello, S | 1 |
| Fracasso, A | 1 |
| Righetto, F | 1 |
| Scanferla, F | 1 |
| Morachiello, P | 1 |
| Poe, TE | 1 |
| Scott, RB | 1 |
| Keith, JF | 1 |
| Tuck, S | 1 |
| Morselli, P | 1 |
| Broquaire, M | 1 |
| Vert, P | 1 |
| Aranda, JV | 2 |
| Lambert, C | 1 |
| Perez, J | 1 |
| Turmen, T | 1 |
| Sitar, DS | 1 |
| Haldy, P | 1 |
| Müller, J | 1 |
| Tufano, R | 1 |
| Scopa, M | 1 |
| Brando, G | 1 |
| Leone, D | 1 |
| Lindeman, RD | 1 |
| Klingler, EL | 1 |
| Kukes, VG | 1 |
| Shikh, EV | 1 |
| Missouris, CG | 1 |
| Belli, AM | 1 |
| Vallance, PJ | 1 |
| MacGregor, GA | 1 |
| Battistini, N | 1 |
| Virgili, F | 1 |
| Bedogni, G | 1 |
| Gambella, GR | 1 |
| Bini, A | 1 |
| Attah, CA | 1 |
| Martín Lesende, I | 1 |
| Sacristán Saiz-Aja, B | 1 |
| Angulo Fernández, J | 1 |
| Ando, K | 1 |
| Fujita, T | 1 |
| Polidori, C | 1 |
| Venturi, F | 1 |
| De Caro, G | 1 |
| Bissoli, F | 1 |
| Gini, G | 1 |
| Bosio, M | 1 |
| Ceriani, R | 1 |
| Riley, JA | 1 |
| Brown, AR | 1 |
| Walker, BE | 1 |
| Walter, RE | 1 |
| Anderson, RJ | 1 |
| Schuller, D | 1 |
| Lynch, JP | 1 |
| Fine, D | 1 |
| Schott, HC | 1 |
| Hinchcliff, KW | 1 |
| Pretzlaff, RK | 1 |
| Vardis, RJ | 1 |
| Pollack, MM | 1 |
| Charron, G | 1 |
| Laforest, S | 1 |
| Gagnon, C | 1 |
| Drolet, G | 1 |
| Milionis, HJ | 1 |
| Alexandrides, GE | 1 |
| Liberopoulos, EN | 1 |
| Bairaktari, ET | 1 |
| Goudevenos, J | 1 |
| Elisaf, MS | 1 |
| Norbiato, G | 1 |
| Sommariva, D | 1 |
| Gandini, R | 1 |
| Fasoli, A | 1 |
| Godin, M | 1 |
| Fillastre, JP | 1 |
| Black, WD | 1 |
| Shiner, PT | 1 |
| Roman, J | 1 |
| Plumb, VJ | 1 |
| James, TN | 1 |
| Patrick, J | 1 |
| Reulen, HJ | 1 |
| Coltorti, M | 1 |
| Radaeli, E | 1 |
| Ciaccio, S | 1 |
| Corsini, R | 1 |
| Trebbi, R | 1 |
| Sokolova, RI | 1 |
| Serebrovskaia, IuA | 1 |
| Vikhert, AM | 1 |
| Sidorenko, BA | 1 |
| Malinovskaia, SIa | 1 |
| Ivanova, AV | 1 |
| Kaĭtukova, LV | 1 |
| Thiel, G | 1 |
| Brunner, F | 1 |
| Wunderlich, P | 1 |
| Huguenin, M | 1 |
| Bienko, B | 1 |
| Torhorst, J | 1 |
| Peters-Haefeli, L | 1 |
| Kirchertz, EJ | 1 |
| Peters, G | 1 |
| Erben, J | 1 |
| Rezác, O | 1 |
| Razis, DV | 1 |
| Athanasiou, A | 1 |
| Dadiotis, L | 1 |
| Kontturi, MJ | 1 |
| Sotaniemi, EA | 1 |
| Dormois, JC | 1 |
| Young, JL | 1 |
| Nies, AS | 1 |
| Ayala, G | 1 |
| Chertow, BS | 1 |
| Shah, JH | 1 |
| Williams, GA | 1 |
| Kukreja, SC | 1 |
| Weiss, DJ | 1 |
| Geor, R | 1 |
| Smith, CM | 1 |
| McClay, CB | 1 |
| Donatucci, CF | 1 |
| Deshon, GE | 1 |
| Wade, CE | 1 |
| Hunt, M | 1 |
| Marangoni, E | 1 |
| Oddone, A | 1 |
| Surian, M | 1 |
| Panciroli, C | 1 |
| Galloni, G | 1 |
| Masa, A | 1 |
| Caizzi, V | 1 |
| Belletti, S | 1 |
| Cominesi, WR | 1 |
| Orlandi, M | 1 |
| Hancock, EW | 1 |
| Wald, H | 1 |
| Scherzer, P | 1 |
| Popovtzer, MM | 1 |
| Kamel, KS | 1 |
| Magner, PO | 1 |
| Ethier, JH | 1 |
| Halperin, ML | 1 |
| Salamy, A | 1 |
| Eldredge, L | 1 |
| Tooley, WH | 1 |
| Perlman, JM | 1 |
| Moore, V | 1 |
| Siegel, MJ | 1 |
| Dawson, J | 1 |
| Hoffman, JR | 1 |
| Reynolds, S | 1 |
| Green, TP | 1 |
| Chemtob, S | 1 |
| Laudignon, N | 1 |
| Sasyniuk, BI | 1 |
| Ziabreva, EV | 1 |
| Bol'shakova, TD | 1 |
| Gitel', EP | 1 |
| Lukovnikova, LP | 1 |
| Podzolkov, VI | 1 |
| Kerremans, AL | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Goal Directed Fluid Removal With Furosemide in Intensive Care Patients With Fluid Overload - A Randomised, Blinded, Placebo-controlled Trial (GODIF).[NCT04180397] | Phase 4 | 1,000 participants (Anticipated) | Interventional | 2020-08-17 | Recruiting | ||
| Incidence and Predictive Risk Factors of Acute Kidney Injury in Pediatric Polytrauma Patients Admitted to Assiut University Trauma Unit: a Cross-sectional Study[NCT06177886] | 100 participants (Anticipated) | Observational | 2024-01-01 | Not yet recruiting | |||
| Early Renal Replacement Therapy vs. Furosemide for Neonates With Oliguria After Cardiopulmonary Bypass[NCT01709227] | 73 participants (Actual) | Interventional | 2011-10-31 | Completed | |||
| Reliability and Utility of Fluid Balance Charting in Neonates Admitted to the Pediatric Ward.[NCT00962754] | Phase 4 | 170 participants (Actual) | Interventional | 2009-06-30 | Completed | ||
| Single Dose of Furosemide to Improve Respiratory Distress in Moderate to Severe Bronchiolitis[NCT02469597] | Phase 2 | 46 participants (Actual) | Interventional | 2013-10-31 | Completed | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
In-hospital mortality (NCT01709227)
Timeframe: duration of hospitalization (an average of 2 weeks)
| Intervention | Participants (Count of Participants) |
|---|---|
| Furosemide | 3 |
| Peritoneal Dialysis | 1 |
Total doses of potassium chloride or arginine chloride given during the first five postoperative days. (NCT01709227)
Timeframe: Postop day 0-5
| Intervention | doses given (Median) |
|---|---|
| Furosemide | 2 |
| Peritoneal Dialysis | 1 |
Total days of initial postoperative stay in cardiac ICU (NCT01709227)
Timeframe: Average 2 weeks
| Intervention | days (Median) |
|---|---|
| Furosemide | 9 |
| Peritoneal Dialysis | 7 |
Total days of initial postoperative stay in hospital (NCT01709227)
Timeframe: Average 4 weeks
| Intervention | days (Median) |
|---|---|
| Furosemide | 15 |
| Peritoneal Dialysis | 14 |
Difference of inputs and outputs, including urine output and PD drainage. (NCT01709227)
Timeframe: Postop day 1
| Intervention | Participants (Count of Participants) |
|---|---|
| Furosemide | 21 |
| Peritoneal Dialysis | 29 |
Total sum of renal and electrolyte abnormalities over the first 5 postoperative days as defined in the protocol (NCT01709227)
Timeframe: Postop morning 1-5
| Intervention | abnormalities (Median) |
|---|---|
| Furosemide | 6 |
| Peritoneal Dialysis | 4 |
Duration of initial course of postoperative mechanical ventilation (NCT01709227)
Timeframe: Duration of postoperative intubation (average time approximately- 1 week)
| Intervention | days (Median) |
|---|---|
| Furosemide | 4 |
| Peritoneal Dialysis | 3 |
BNP measured at 24 and 48 hours postoperatively (NCT01709227)
Timeframe: At 24hours and 48 hours postoperative
| Intervention | pg/ml (Mean) | |
|---|---|---|
| 24 hours | 48 hours | |
| Furosemide | 1334 | 1110 |
| Peritoneal Dialysis | 1168 | 663 |
Product of Mean airway pressure delivered by mechanical ventilation and FiO2 of administered oxygen (NCT01709227)
Timeframe: at 24 and 48 hours postoperative
| Intervention | Units (Median) | |
|---|---|---|
| 24 Hours | 48 Hours | |
| Furosemide | 4 | 3.8 |
| Peritoneal Dialysis | 4 | 2.8 |
notifications of complications (NCT00962754)
Timeframe: duration of admission
| Intervention | participants (Number) |
|---|---|
| Physician Insight Fluid Balance | 2 |
| Physician no Insight Fluid Balance Chart | 5 |
Duration of hospital stay in days or duration of admission at the pediatric ward in days (NCT00962754)
Timeframe: 1-8 months
| Intervention | number of days (Median) |
|---|---|
| Intervention Group (no Insight in Fluid Balance) | 9 |
| Control Group (Insight in Fluid Balance) | 8 |
prescription of diuretic therapy (NCT00962754)
Timeframe: during days of admission
| Intervention | participants (Number) |
|---|---|
| Intervention Group (no Insight in Fluid Balance) | 0 |
| Control Group (Insight in Fluid Balance) | 0 |
(NCT02469597)
Timeframe: Participants will be followed for the duration of hospital stay up to 1 week
| Intervention | Days (Least Squares Mean) |
|---|---|
| Single Dose of Furosemide | 3.1 |
| Placebo | 3.0 |
(NCT02469597)
Timeframe: 2 hours after medication adminstration
| Intervention | Percentage change in oxygen saturation (Least Squares Mean) |
|---|---|
| Single Dose of Furosemide | -0.14 |
| Placebo | 0.2 |
(NCT02469597)
Timeframe: 4 hours after medication adminstration
| Intervention | Percentage change in oxygen saturation (Least Squares Mean) |
|---|---|
| Single Dose of Furosemide | -0.19 |
| Placebo | 0.29 |
(NCT02469597)
Timeframe: Within 72 hours of medication administration
| Intervention | participants (Number) |
|---|---|
| Single Dose of Furosemide | 0 |
| Placebo | 0 |
(NCT02469597)
Timeframe: 2 hours after medication adminstration
| Intervention | Percentage change in respiratory rate (Least Squares Mean) |
|---|---|
| Single Dose of Furosemide | -3.7 |
| Placebo | -1.7 |
(NCT02469597)
Timeframe: 4 hours after medication adminstration
| Intervention | Percentage change in respiratory rate (Least Squares Mean) |
|---|---|
| Single Dose of Furosemide | -2.8 |
| Placebo | -5.4 |
8 reviews available for furosemide and Water-Electrolyte Imbalance
| Article | Year |
|---|---|
Simultaneous Use of Hypertonic Saline and IV Furosemide for Fluid Overload: A Systematic Review and Meta-Analysis.
Topics: Diuretics; Dose-Response Relationship, Drug; Drug Administration Schedule; Furosemide; Heart Failure | 2021 |
Forensic aspects of water intoxication: four case reports and review of relevant literature.
Topics: Adult; Child; Child Abuse; Child, Preschool; Diuretics; Forensic Pathology; Furosemide; Humans; Male | 2012 |
Long-term treatment of hyponatremic patients with nephrogenic syndrome of inappropriate antidiuresis: personal experience and review of published case reports.
Topics: Adult; Aged; Diuretics; Furosemide; Genetic Diseases, X-Linked; Humans; Hyponatremia; Inappropriate | 2012 |
Is lasix after a blood transfusion necessary?
Topics: Blood Volume; Diuretics; Furosemide; Humans; Infant; Infant, Extremely Premature; Infant, Newborn; I | 2012 |
[Emergency therapy of acute kidney failure and water-electrolyte imbalance].
Topics: Acute Kidney Injury; Blood Component Removal; Calcium Gluconate; Diagnosis, Differential; Diuretics; | 1995 |
Treatments affecting fluid and electrolyte status during exercise.
Topics: Acetazolamide; Animals; Carbonic Anhydrase Inhibitors; Diuretics; Fluid Therapy; Furosemide; Horse D | 1998 |
The pharmacologic basis of diuretic therapy in the newborn.
Topics: Acute Kidney Injury; Diuretics; Furosemide; Humans; Infant, Newborn; Pulmonary Edema; Respiratory Di | 1987 |
Furosemide and vitamin E. Two problem drugs in neonatology.
Topics: Acid-Base Imbalance; Anemia; Bronchopulmonary Dysplasia; Cerebral Hemorrhage; Diuresis; Ductus Arter | 1986 |
12 trials available for furosemide and Water-Electrolyte Imbalance
| Article | Year |
|---|---|
Efficacy of tolvaptan on advanced chronic kidney disease with heart failure: a randomized controlled trial.
Topics: Antidiuretic Hormone Receptor Antagonists; Benzazepines; Diuretics; Furosemide; Heart Failure; Human | 2022 |
Goal directed fluid removal with furosemide versus placebo in intensive care patients with fluid overload: A trial protocol for a randomised, blinded trial (GODIF trial).
Topics: Adult; Critical Care; Furosemide; Goals; Humans; Quality of Life; Randomized Controlled Trials as To | 2022 |
Goal-directed fluid removal with furosemide versus placebo in intensive care patients with fluid overload: A randomised, blinded trial (GODIF trial-First version).
Topics: Adult; Critical Care; Diuretics; Furosemide; Goals; Humans; Water-Electrolyte Imbalance | 2023 |
Diuretic Strategies in Acute Heart Failure and Renal Dysfunction: Conventional vs Carbohydrate Antigen 125-guided Strategy. Clinical Trial Design.
Topics: Acetazolamide; Acute Disease; CA-125 Antigen; Cardio-Renal Syndrome; Chlorthalidone; Creatinine; Diu | 2017 |
Efficacy and Safety Evaluation of Tolvaptan on Management of Fluid Balance after Cardiovascular Surgery Using Cardiopulmonary Bypass.
Topics: Aged; Antidiuretic Hormone Receptor Antagonists; Cardiopulmonary Bypass; Cardiovascular Surgical Pro | 2016 |
Peritoneal Dialysis vs Furosemide for Prevention of Fluid Overload in Infants After Cardiac Surgery: A Randomized Clinical Trial.
Topics: Cardiac Surgical Procedures; Diuretics; Female; Furosemide; Humans; Infant; Intensive Care Units; Le | 2017 |
Peritoneal Dialysis vs Furosemide for Prevention of Fluid Overload in Infants After Cardiac Surgery: A Randomized Clinical Trial.
Topics: Cardiac Surgical Procedures; Diuretics; Female; Furosemide; Humans; Infant; Intensive Care Units; Le | 2017 |
Peritoneal Dialysis vs Furosemide for Prevention of Fluid Overload in Infants After Cardiac Surgery: A Randomized Clinical Trial.
Topics: Cardiac Surgical Procedures; Diuretics; Female; Furosemide; Humans; Infant; Intensive Care Units; Le | 2017 |
Peritoneal Dialysis vs Furosemide for Prevention of Fluid Overload in Infants After Cardiac Surgery: A Randomized Clinical Trial.
Topics: Cardiac Surgical Procedures; Diuretics; Female; Furosemide; Humans; Infant; Intensive Care Units; Le | 2017 |
Role of excess volume in the pathophysiology of hypertension in chronic kidney disease.
Topics: Aged; Blood Pressure; Body Fluids; Cross-Over Studies; Diuretics; Female; Furosemide; Humans; Hypert | 2003 |
[Use of potassium canrenoate in cardiosurgery].
Topics: Adult; Aged; Canrenoic Acid; Cardiac Surgical Procedures; Extracorporeal Circulation; Female; Furose | 1981 |
Protocol-guided diuretic management: comparison of furosemide by continuous infusion and intermittent bolus.
Topics: Adult; Aged; Aged, 80 and over; APACHE; Critical Care; Diuretics; Female; Furosemide; Hemodynamics; | 1997 |
Aminophylline in the treatment of fluid overload.
Topics: Adjuvants, Pharmaceutic; Aminophylline; Cardiotonic Agents; Child, Preschool; Creatinine; Critical C | 1999 |
Furosemide-induced disturbances of renal function in patients undergoing TURP.
Topics: Aged; Aldosterone; Chlorides; Creatinine; Diuresis; Dyspnea; Furosemide; Humans; Hyponatremia; Male; | 1990 |
Effect of high-dose furosemide in refractory congestive heart failure.
Topics: Administration, Oral; Adult; Aged; Drug Administration Schedule; Female; Follow-Up Studies; Furosemi | 1990 |
61 other studies available for furosemide and Water-Electrolyte Imbalance
| Article | Year |
|---|---|
Optimal Evidence Grading of Simultaneous Use of Hypertonic Saline and Furosemide for Fluid Overload.
Topics: Diuretics; Furosemide; Heart Failure; Humans; Saline Solution, Hypertonic; Water-Electrolyte Imbalan | 2022 |
New Delivery Route for Furosemide in Heart Failure.
Topics: Adult; Diuretics; Furosemide; Heart Failure; Humans; Water-Electrolyte Imbalance | 2023 |
Prophylactic Peritoneal Drainage is Associated with Improved Fluid Output after Congenital Heart Surgery.
Topics: Acute Kidney Injury; Cardiopulmonary Bypass; Diuretics; Drainage; Female; Furosemide; Heart Defects, | 2020 |
Baseline and incident hypochloremia in chronic heart failure outpatients: Clinical correlates and prognostic role.
Topics: Furosemide; Heart Failure; Humans; Outpatients; Prognosis; Water-Electrolyte Imbalance | 2021 |
Fluid overload FADEs away! Time for fluid stewardship.
Topics: Albumins; Diuresis; Edema; Furosemide; Humans; Pilot Projects; Water-Electrolyte Imbalance | 2018 |
Effects of the sodium-glucose cotransporter 2 inhibitor dapagliflozin on fluid distribution: A comparison study with furosemide and tolvaptan.
Topics: Aged; Antidiuretic Hormone Receptor Antagonists; Benzhydryl Compounds; Body Composition; Female; Flu | 2019 |
[Diuretic-Abuse in Chronic Bulimia Nervosa--Case Report and Clinical Management].
Topics: Adult; Bulimia Nervosa; Chronic Disease; Diuretics; Female; Furosemide; Humans; Substance-Related Di | 2015 |
Citalopram-induced long QT syndrome and torsade de pointes: role for concomitant therapy and disease.
Topics: Antidepressive Agents, Second-Generation; Citalopram; Depressive Disorder, Major; Diuretics; Drug Th | 2011 |
In chronic heart failure with marked fluid retention, the i.v. high doses of loop diuretic are a predictor of aggravated renal dysfunction, especially in the set of heart failure with normal or only mildly impaired left ventricular systolic function.
Topics: Aged; Aged, 80 and over; Algorithms; Analysis of Variance; Biomarkers; Case-Control Studies; Chronic | 2011 |
Intravenous diuretic day-care treatment for patients with heart failure.
Topics: Aged; Aged, 80 and over; Cost Savings; Day Care, Medical; Disease Management; Disease Progression; D | 2012 |
Clinical outcomes of a furosemide infusion protocol in edematous patients in the intensive care unit.
Topics: Adult; Aged; Aged, 80 and over; Cohort Studies; Critical Care; Critical Illness; Diuretics; Dose-Res | 2012 |
Monitoring hyperhydration during high-dose chemotherapy: body weight or fluid balance?
Topics: Adolescent; Adult; Aged; Antineoplastic Agents; Body Water; Body Weight; Cohort Studies; Confounding | 2003 |
Heterogeneous co-localization of AT 1A receptor and Fos protein in forebrain neuronal populations responding to acute hydromineral deficit.
Topics: Analysis of Variance; Animals; Cell Count; Furosemide; Immunohistochemistry; In Situ Hybridization; | 2004 |
Fenoldapam after pediatric cardiac surgery: what is conventional diuretic therapy?
Topics: Aminophylline; Diuretics; Dopamine Agonists; Drug Therapy, Combination; Fenoldopam; Furosemide; Hear | 2006 |
Bodyweight change during the first 5 days of chemotherapy as an indicator of cisplatin renal toxicity.
Topics: Adolescent; Adult; Aged; Antineoplastic Combined Chemotherapy Protocols; Body Weight; Cisplatin; Dru | 2007 |
Pharmacologic approaches for volume excess in acute kidney injury (AKI).
Topics: Acute Kidney Injury; Ascites; Bumetanide; Diuretics; Fluid Therapy; Furosemide; Heart Failure; Hepat | 2008 |
Kinetics of urinary furosemide elimination in infants.
Topics: Anti-Bacterial Agents; Female; Furosemide; Half-Life; Humans; Infant; Infant, Newborn; Kidney; Kinet | 1984 |
[Pharmacokinetics and electrolyte balance following administration of furosemide in pregnant women with E gestosis].
Topics: Calcium; Chlorides; Creatinine; Female; Furosemide; Humans; Kinetics; Models, Biological; Potassium; | 1984 |
Restoration of ultrafiltration capacity of peritoneal membrane in patients on CAPD.
Topics: Body Weight; Female; Furosemide; Humans; Male; Peritoneal Dialysis; Peritoneal Dialysis, Continuous | 1984 |
Interaction of indomethacin with furosemide.
Topics: Aged; Arthritis; Drug Interactions; Female; Furosemide; Gout; Heart Failure; Humans; Indomethacin; W | 1983 |
Plasma and urinary kinetics of furosemide in newborn infants.
Topics: Furosemide; Half-Life; Humans; Infant, Newborn; Infant, Newborn, Diseases; Kinetics; Water-Electroly | 1983 |
Metabolism and renal elimination of furosemide in the newborn infant.
Topics: Female; Furosemide; Humans; Infant, Newborn; Infant, Premature, Diseases; Kidney; Male; Time Factors | 1982 |
Stimulation of the conversion of corticosterone to aldosterone by sodium and water depletion of potassium-deficient rats. Comparison of different experimental procedures.
Topics: Adrenal Glands; Aldosterone; Angiotensin II; Animals; Corticosterone; Dehydration; Diet, Sodium-Rest | 1981 |
Combating sodium and potassium imbalance in older patients.
Topics: Acute Disease; Aged; Furosemide; Humans; Hyperkalemia; Hypernatremia; Hypokalemia; Hyponatremia; Pot | 1981 |
[The use of Lasix in current medical practice].
Topics: Diuresis; Dose-Response Relationship, Drug; Furosemide; Humans; Water-Electrolyte Imbalance | 1995 |
Oedema after renal artery angioplasty.
Topics: Angioplasty; Edema; Female; Furosemide; Humans; Middle Aged; Postoperative Complications; Renal Arte | 1993 |
In vivo total body water assessment by total body electrical conductivity in rats suffering perturbations of water compartment equilibrium.
Topics: Animals; Body Composition; Body Water; Electric Conductivity; Extracellular Space; Furosemide; Least | 1993 |
Effect of continuous irrigation with normal saline after prostatectomy.
Topics: Adult; Aged; Aged, 80 and over; Furosemide; Humans; Male; Middle Aged; Postoperative Complications; | 1993 |
[Home management of hyperosmolar decompensation induced by furosemide].
Topics: Aged; Aged, 80 and over; Diuretics; Female; Furosemide; Home Care Services; Humans; Osmolar Concentr | 1995 |
Sex difference in sensitivity to exogenous oxytocin in different models of sodium appetite in the rat.
Topics: Adrenalectomy; Animals; Desoxycorticosterone; Female; Furosemide; Injections, Intraventricular; Male | 1994 |
Concurrent use of phenytoin and furosemide: problems in a patient with congestive cardiac failure, chronic renal failure, liver cirrhosis and fluid overload.
Topics: Anticonvulsants; Diuretics; Drug Interactions; Drug Therapy, Combination; Furosemide; Heart Failure; | 1996 |
Congestive cardiac failure following laxative withdrawal.
Topics: Angiotensin-Converting Enzyme Inhibitors; Captopril; Cathartics; Diuretics; Female; Furosemide; Hear | 1996 |
Optimally managing fluid overload in intensive care.
Topics: Critical Care; Diuretics; Furosemide; Humans; Intensive Care Units; Pulmonary Edema; Renal Insuffici | 1997 |
Acute sodium deficit triggers plasticity of the brain angiotensin type 1 receptors.
Topics: Animals; Brain; Furosemide; Hypothalamus; Immunohistochemistry; In Situ Hybridization; Models, Neuro | 2002 |
Hypomagnesemia and concurrent acid-base and electrolyte abnormalities in patients with congestive heart failure.
Topics: Acid-Base Imbalance; Aged; Cohort Studies; Diuretics; Dose-Response Relationship, Drug; Female; Foll | 2002 |
Letter: Diuretic-induced oedema.
Topics: Adult; Edema; Female; Furosemide; Humans; Water-Electrolyte Imbalance | 1975 |
[Treatment of severe hypercalcemia].
Topics: Acute Disease; Calcitonin; Furosemide; Humans; Hypercalcemia; Plicamycin; Renal Dialysis; Water-Elec | 1978 |
Severe electrolyte disturbances associated with metolazone and furosemide.
Topics: Adult; Aged; Diuretics; Drug Therapy, Combination; Female; Furosemide; Heart Failure; Humans; Hypert | 1978 |
Clinical hazards of powerful diuretics. Furosemide and ethacrynic acid.
Topics: Ethacrynic Acid; Furosemide; Hemodynamics; Humans; Water-Electrolyte Imbalance | 1978 |
Drugs for hypertension.
Topics: Antihypertensive Agents; Benzothiadiazines; Clonidine; Depression; Diuretics; Drug Combinations; Dru | 1977 |
Death during recovery from severe malnutrition and its possible relationship to sodium pump activity in the leucocyte.
Topics: Child, Preschool; Death, Sudden; Digoxin; Female; Furosemide; Humans; Infant; Leukocytes; Male; Nutr | 1977 |
[Development and correction of water-electrolyte and acid base equilibrium disorders in brain edema (proceedings)].
Topics: Acid-Base Imbalance; Adult; Brain Edema; Child; Dexamethasone; Furosemide; Humans; Water-Electrolyte | 1977 |
[Therapeutic report on an injectable aldosterone antagonist (K-canrenoate) in states of water-salf retention].
Topics: Adult; Aged; Ascites; Canrenoic Acid; Drug Evaluation; Drug Therapy, Combination; Edema; Ethacrynic | 1976 |
[Interstitial cells of the medulla and the renin-angiotensin system in disorders of water-salt homeostasis].
Topics: Angiotensin II; Animals; Diuresis; Furosemide; Hematocrit; Juxtaglomerular Apparatus; Kidney; Kidney | 1976 |
[Diuretics in the treatment of circulatory insufficiency].
Topics: Benzothiadiazines; Cardiovascular Diseases; Diuretics; Drug Combinations; Ethacrynic Acid; Furosemid | 1976 |
[Importance of correction of water-electrolyte metabolism in the complex treatment of severe forms of late pregnancy toxemias].
Topics: Adolescent; Adult; Female; Furosemide; Glucose Solution, Hypertonic; Humans; Pre-Eclampsia; Pregnanc | 1976 |
Protection of rat kidneys against HgCl2-induced acute renal failure by induction of high urine flow without renin suppression.
Topics: Acetazolamide; Acute Kidney Injury; Animals; Body Weight; Desoxycorticosterone; Diuresis; Furosemide | 1976 |
The role of water and electrolytes in the treatment of acute neurosurgical cases.
Topics: Adult; Aged; Brain Diseases; Female; Furosemide; Humans; Male; Middle Aged; Nervous System Diseases; | 1975 |
Diuretics in malignant effusions and edemas of generalized cancer.
Topics: Ascites; Body Weight; Bumetanide; Diuretics; Drinking; Edema; Furosemide; Humans; Neoplasms; Pleuris | 1976 |
Prevention of body fluid retention by furosemide during estrogen therapy of prostatic cancer.
Topics: Castration; Diethylstilbestrol; Furosemide; Humans; Male; Postoperative Care; Prostatic Neoplasms; W | 1975 |
Minoxidil in severe hypertension: value when conventional drugs have failed.
Topics: Adult; Dose-Response Relationship, Drug; Drug Evaluation; Drug Therapy, Combination; Edema; Female; | 1975 |
Letter: Acute hyperphosphatemia and acute persistent renal insufficiency induced by oral phosphate therapy.
Topics: Acute Disease; Acute Kidney Injury; Creatinine; Furosemide; Humans; Hypercalcemia; Hyperparathyroidi | 1975 |
Furosemide-induced electrolyte depletion associated with echinocytosis in horses.
Topics: Animals; Desiccation; Epinephrine; Erythrocytes; Furosemide; Horse Diseases; Horses; In Vitro Techni | 1992 |
Long Q-T interval in an Asian immigrant.
Topics: Aged; Arrhythmias, Cardiac; Diet, Sodium-Restricted; Electrocardiography; Female; Furosemide; Humans | 1989 |
Inhibition of thick ascending limb Na+-K+-ATPase activity in salt-loaded rats by furosemide.
Topics: Animals; Furosemide; Kidney Tubules; Loop of Henle; Male; Rats; Sodium-Potassium-Exchanging ATPase; | 1989 |
Urine electrolytes in the assessment of extracellular fluid volume contraction.
Topics: Ammonium Chloride; Animals; Bicarbonates; Electrolytes; Furosemide; Male; Potassium Chloride; Random | 1989 |
Neonatal status and hearing loss in high-risk infants.
Topics: Aminoglycosides; Anti-Bacterial Agents; Audiometry, Evoked Response; Bilirubin; Furosemide; Hearing | 1989 |
Is chloride depletion an important contributing cause of death in infants with bronchopulmonary dysplasia?
Topics: Acid-Base Imbalance; Body Weight; Bronchopulmonary Dysplasia; Cardiomegaly; Chlorides; Furosemide; H | 1986 |
Comparison of nitroglycerin, morphine and furosemide in treatment of presumed pre-hospital pulmonary edema.
Topics: Aged; Drug Therapy, Combination; Emergencies; Female; Furosemide; Humans; Male; Middle Aged; Morphin | 1987 |
[Role of prolactin in disorders of water and salt metabolism in patients with hypertension].
Topics: Adolescent; Adult; Bromocriptine; Circadian Rhythm; Furosemide; Humans; Hyperprolactinemia; Hyperten | 1986 |
[Furosemide].
Topics: Furosemide; Heart Failure; Humans; Intestinal Absorption; Nephrotic Syndrome; Water-Electrolyte Imba | 1986 |