flutamide has been researched along with Bone Loss, Osteoclastic in 5 studies
Flutamide: An antiandrogen with about the same potency as cyproterone in rodent and canine species.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Ninety-five patients with prostate cancer were divided into one of three groups: 26 patients with bone metastasis (BM(+)), 35 patients without bone metastasis on nonhormonal therapy (BM(-)HT(-)) and 34 patients without bone metastasis on hormonal therapy (BM(-)HT(+))." | 1.31 | Biochemical markers for the detection of bone metastasis in patients with prostate cancer: diagnostic efficacy and the effect of hormonal therapy. ( Fukunaga, M; Jo, Y; Sone, T; Tamada, T; Tanaka, H; Tomomitsu, T, 2001) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 3 (60.00) | 18.2507 |
| 2000's | 2 (40.00) | 29.6817 |
| 2010's | 0 (0.00) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Michael, H | 1 |
| Härkönen, PL | 1 |
| Väänänen, HK | 1 |
| Hentunen, TA | 1 |
| Gallagher, AC | 1 |
| Chambers, TJ | 1 |
| Tobias, JH | 1 |
| Pederson, L | 1 |
| Kremer, M | 1 |
| Judd, J | 1 |
| Pascoe, D | 1 |
| Spelsberg, TC | 1 |
| Riggs, BL | 1 |
| Oursler, MJ | 1 |
| Moghetti, P | 1 |
| Castello, R | 1 |
| Zamberlan, N | 1 |
| Rossini, M | 1 |
| Gatti, D | 1 |
| Negri, C | 1 |
| Tosi, F | 1 |
| Muggeo, M | 1 |
| Adami, S | 1 |
| Tamada, T | 1 |
| Sone, T | 1 |
| Tomomitsu, T | 1 |
| Jo, Y | 1 |
| Tanaka, H | 1 |
| Fukunaga, M | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Denosumab Versus Zoledronic Acid for Patients With Beta-Thalassemia Major-Induced Osteoporosis[NCT03040765] | Phase 3 | 17 participants (Actual) | Interventional | 2018-05-14 | Terminated (stopped due to failed to recruit eligible subjects) | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
1 trial available for flutamide and Bone Loss, Osteoclastic
| Article | Year |
|---|---|
Spironolactone, but not flutamide, administration prevents bone loss in hyperandrogenic women treated with gonadotropin-releasing hormone agonist.
Topics: Adult; Bone and Bones; Bone Density; Bone Resorption; Female; Flutamide; Hirsutism; Humans; Polycyst | 1999 |
4 other studies available for flutamide and Bone Loss, Osteoclastic
| Article | Year |
|---|---|
Estrogen and testosterone use different cellular pathways to inhibit osteoclastogenesis and bone resorption.
Topics: Acid Phosphatase; Adult; Androgen Antagonists; Animals; Bone Resorption; Carrier Proteins; Cattle; C | 2005 |
Androgens contribute to the stimulation of cancellous bone formation by ovarian hormones in female rats.
Topics: Animals; Body Weight; Bone and Bones; Bone Resorption; Dihydrotestosterone; Diphosphonates; Female; | 1996 |
Androgens regulate bone resorption activity of isolated osteoclasts in vitro.
Topics: Acid Phosphatase; Androgen Antagonists; Androgens; Animals; Bone Resorption; Cathepsin B; Chickens; | 1999 |
Biochemical markers for the detection of bone metastasis in patients with prostate cancer: diagnostic efficacy and the effect of hormonal therapy.
Topics: Aged; Antineoplastic Agents, Hormonal; Antineoplastic Combined Chemotherapy Protocols; Biomarkers, T | 2001 |