diazepam has been researched along with Sensitivity and Specificity in 60 studies
Diazepam: A benzodiazepine with anticonvulsant, anxiolytic, sedative, muscle relaxant, and amnesic properties and a long duration of action. Its actions are mediated by enhancement of GAMMA-AMINOBUTYRIC ACID activity.
diazepam : A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a methyl group at position 1 and a phenyl group at position 5.
Sensitivity and Specificity: Binary classification measures to assess test results. Sensitivity or recall rate is the proportion of true positives. Specificity is the probability of correctly determining the absence of a condition. (From Last, Dictionary of Epidemiology, 2d ed)
| Excerpt | Relevance | Reference |
|---|---|---|
| "A sensitive, selective and reproducible reversed-phase HPLC method with ultraviolet detection was developed for the quantification of diazepam in small plasma samples from children with severe malaria." | 7.71 | High-performance liquid chromatographic determination of diazepam in plasma of children with severe malaria. ( Kokwar, GO; Muchoh, SN; Newton, CR; Ogutu, BR, 2001) |
| "Diazepam (DZP) is one of the most commonly prescribed drugs for treating status epilepticus (SE)." | 3.72 | Simple and sensitive liquid chromatography/tandem mass spectrometry method for the determination of diazepam and its major metabolites in rat cerebrospinal fluid. ( Fenyk-Melody, J; Pivnichny, JV; Shen, X; Tong, X; Wang, J, 2003) |
| "A sensitive, selective and reproducible reversed-phase HPLC method with ultraviolet detection was developed for the quantification of diazepam in small plasma samples from children with severe malaria." | 3.71 | High-performance liquid chromatographic determination of diazepam in plasma of children with severe malaria. ( Kokwar, GO; Muchoh, SN; Newton, CR; Ogutu, BR, 2001) |
| " Pharmacokinetic and pharmacodynamic data were simultaneously fitted to a semiparametric model." | 2.68 | Simultaneous modeling of the pharmacokinetics and pharmacodynamics of midazolam and diazepam. ( Choma, N; Crews, T; DeFeo, TM; Limjuco, R; Milla, G; Mould, DR; Patel, IH; Reele, S, 1995) |
| " The method was fully validated and applied to a pharmacokinetic study of ipriflavone." | 1.38 | Determination of ipriflavone in human plasma by LC-MS and its application in a pharmacokinetic study. ( Ding, L; Leng, Y; Wen, A; Yang, L; Yun, C; Zhu, H, 2012) |
| " Pharmacokinetic studies in animal models are the important components in clinical development of this agent." | 1.38 | Application of a liquid chromatography-tandem mass spectrometry (LC-MS/MS) method to the pharmacokinetics, tissue distribution and excretion studies of felotaxel (SHR110008) in tumor-bearing mice. ( Ding, L; Ding, Y; Jia, Y; Jin, X; Lu, C; Ma, Z; Wang, C; Wen, A; Yang, J; Yang, L; Zhu, Y, 2012) |
| " The analytical method utilized pressurized liquid extraction (PLE) combined with silica gel cleanup, gel permeation chromatography, and gas chromatography ion-trap tandem mass spectrometry." | 1.37 | Simultaneous analysis of select pharmaceuticals and personal care products in fish tissue using pressurized liquid extraction combined with silica gel cleanup. ( Chambliss, CK; Mottaleb, MA; Subedi, B; Usenko, S, 2011) |
| "Oxazepam was detectable in the 5-900 ng mL(-1) range, with a detection limit of 4." | 1.34 | A rapid fluorimetric screening method for the 1,4-benzodiazepines: determination of their metabolite oxazepam in urine. ( Durand Alegría, JS; Fernández Hernando, P; Gil Tejedor, AM, 2007) |
| " The method was applied for the monitoring of pharmacokinetic profiles of intravenous administration of diazepam and its two main metabolites in dogs, and the results were compared with profiles determined by conventional methods." | 1.34 | Evaluation of bio-compatible poly(ethylene glycol)-based solid-phase microextraction fiber for in vivo pharmacokinetic studies of diazepam in dogs. ( Bagheri, H; Es-haghi, A; Musteata, FM; Pawliszyn, J; Zhang, X, 2007) |
| "Diazepam was used as the internal standard for quantitation." | 1.33 | Development and validation of a liquid chromatographic/electrospray ionization mass spectrometric method for the quantitation of prazepam and its main metabolites in human plasma. ( Atta-Politou, J; Panderi, I; Valavani, P, 2005) |
| "There are situations in drug development where one may wish to reduce the dimensionality and complexity of whole body physiologically based pharmacokinetic models." | 1.33 | Reducing whole body physiologically based pharmacokinetic models using global sensitivity analysis: diazepam case study. ( Gueorguieva, I; Nestorov, IA; Rowland, M, 2006) |
| " Uremic toxins were also incubated with purified human albumin, and dose-response experiments with the two most toxic agents in terms of protein damage (guanidine and guanidinopropionic acid) were carried out." | 1.32 | Plasma protein aspartyl damage is increased in hemodialysis patients: studies on causes and consequences. ( D'Aniello, A; De Santo, NG; Galletti, P; Ingrosso, D; Lombardi, C; Perna, AF; Satta, E, 2004) |
| "Oxazepam and diazepam was determined in serum and oxazepam in urine." | 1.29 | Determination of oxazepam and diazepam in body fluids by HPLC. ( Gajewska, M; Goldnik, A; Jaworska, M, 1993) |
| "Attacks of sustained dystonia of the limbs and trunk can be initiated by handling or mild environmental stimuli (e." | 1.29 | Alterations in pharmacological sensitivity of GABAergic but not dopaminergic and glutamatergic systems during ontogenesis in dystonic mutant hamsters. ( Löscher, W; Richter, A, 1993) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 17 (28.33) | 18.2507 |
| 2000's | 32 (53.33) | 29.6817 |
| 2010's | 11 (18.33) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Qi, ZH | 1 |
| Song, M | 1 |
| Wallace, MJ | 1 |
| Wang, D | 1 |
| Newton, PM | 1 |
| McMahon, T | 1 |
| Chou, WH | 1 |
| Zhang, C | 1 |
| Shokat, KM | 1 |
| Messing, RO | 1 |
| Li, H | 1 |
| Sun, J | 1 |
| Sui, X | 1 |
| Liu, J | 1 |
| Yan, Z | 1 |
| Liu, X | 1 |
| Sun, Y | 1 |
| He, Z | 1 |
| de Araujo, FG | 1 |
| Bauerfeldt, GF | 1 |
| Marques, M | 1 |
| Martins, EM | 1 |
| Torikoshi, A | 1 |
| Namera, A | 1 |
| Arima, Y | 2 |
| Toubou, H | 1 |
| Tajima, T | 1 |
| Shiraishi, H | 1 |
| Nagao, M | 2 |
| Li, J | 2 |
| Zhang, J | 1 |
| Liu, H | 1 |
| Wu, L | 1 |
| Horii, Y | 1 |
| Kawaguchi, M | 1 |
| Majidi, MR | 1 |
| Ghaderi, S | 1 |
| Asadpour-Zeynali, K | 1 |
| Dastangoo, H | 1 |
| Rouini, MR | 1 |
| Ardakani, YH | 1 |
| Moghaddam, KA | 1 |
| Solatani, F | 1 |
| Umezawa, H | 1 |
| Lee, XP | 1 |
| Hasegawa, C | 1 |
| Marumo, A | 1 |
| Kumazawa, T | 1 |
| Sato, K | 1 |
| Kang, XJ | 1 |
| Chen, LQ | 1 |
| Wang, Y | 2 |
| Zhang, YY | 1 |
| Gu, ZZ | 1 |
| Casarrubea, M | 1 |
| Sorbera, F | 1 |
| Crescimanno, G | 1 |
| Zhang, X | 2 |
| Cai, J | 1 |
| Oakes, KD | 1 |
| Breton, F | 1 |
| Servos, MR | 1 |
| Pawliszyn, J | 4 |
| Yun, C | 1 |
| Ding, L | 2 |
| Leng, Y | 1 |
| Zhu, H | 1 |
| Wen, A | 2 |
| Yang, L | 2 |
| Armenta, S | 1 |
| Blanco, M | 1 |
| Subedi, B | 1 |
| Mottaleb, MA | 1 |
| Chambliss, CK | 1 |
| Usenko, S | 1 |
| Ding, Y | 1 |
| Lu, C | 1 |
| Yang, J | 1 |
| Jin, X | 1 |
| Wang, C | 1 |
| Ma, Z | 1 |
| Zhu, Y | 1 |
| Jia, Y | 1 |
| Mirnaghi, FS | 1 |
| Ryu, JK | 1 |
| Yoo, SD | 1 |
| Ferrer-Cañabate, J | 1 |
| Agulló-Ortuño, T | 1 |
| García-Mancebo, ML | 1 |
| Real-Panisello, M | 1 |
| Martínez-Hernández, P | 1 |
| Noguera-Velasco, JA | 1 |
| Pirker, C | 1 |
| Misic, A | 1 |
| Brinkmeier, T | 1 |
| Frosch, PJ | 1 |
| Wang, J | 1 |
| Shen, X | 1 |
| Fenyk-Melody, J | 1 |
| Pivnichny, JV | 1 |
| Tong, X | 1 |
| Rao, RN | 1 |
| Parimala, P | 1 |
| Khalid, S | 1 |
| Alvi, SN | 1 |
| Perna, AF | 1 |
| Ingrosso, D | 1 |
| Satta, E | 1 |
| Lombardi, C | 1 |
| Galletti, P | 1 |
| D'Aniello, A | 1 |
| De Santo, NG | 1 |
| Aurora Prado, MS | 1 |
| Steppe, M | 1 |
| Tavares, MF | 1 |
| Kedor-Hackmann, ER | 1 |
| Santoro, MI | 1 |
| Valavani, P | 1 |
| Atta-Politou, J | 1 |
| Panderi, I | 1 |
| Mortishire-Smith, RJ | 1 |
| O'Connor, D | 2 |
| Castro-Perez, JM | 1 |
| Kirby, J | 1 |
| Gueorguieva, I | 1 |
| Nestorov, IA | 1 |
| Rowland, M | 1 |
| Liawruangrath, S | 1 |
| Makchit, J | 1 |
| Liawruangrath, B | 1 |
| Mortishire-Smith, R | 1 |
| Morrison, D | 1 |
| Davies, A | 1 |
| Dominguez, M | 1 |
| Ariffin, MM | 1 |
| Miller, EI | 1 |
| Cormack, PA | 1 |
| Anderson, RA | 1 |
| Cordero, R | 1 |
| Paterson, S | 1 |
| Gil Tejedor, AM | 1 |
| Fernández Hernando, P | 1 |
| Durand Alegría, JS | 1 |
| Cleveland, NR | 1 |
| Krier, S | 1 |
| Heard, K | 1 |
| Es-haghi, A | 1 |
| Musteata, FM | 2 |
| Bagheri, H | 1 |
| Wang, N | 1 |
| Xu, F | 1 |
| Zhang, Z | 1 |
| Yang, C | 1 |
| Sun, X | 1 |
| de Lannoy, I | 1 |
| Gien, B | 1 |
| Gassner, P | 1 |
| Adler, ID | 1 |
| Acri, JB | 1 |
| Wong, G | 1 |
| Witkin, JM | 1 |
| Giardina, WJ | 1 |
| Wismer, CT | 1 |
| Mould, DR | 1 |
| DeFeo, TM | 1 |
| Reele, S | 1 |
| Milla, G | 1 |
| Limjuco, R | 1 |
| Crews, T | 1 |
| Choma, N | 1 |
| Patel, IH | 1 |
| Pierobon, P | 1 |
| Concas, A | 1 |
| Santoro, G | 1 |
| Marino, G | 1 |
| Minei, R | 1 |
| Pannaccione, A | 1 |
| Mostallino, MC | 1 |
| Biggio, G | 1 |
| Goldnik, A | 1 |
| Gajewska, M | 1 |
| Jaworska, M | 1 |
| Song, H | 1 |
| Abramson, FP | 1 |
| Aguayo, LG | 1 |
| Alarcón, JM | 1 |
| Richter, A | 1 |
| Löscher, W | 1 |
| McCrae, AF | 1 |
| Gallaher, EJ | 1 |
| Winter, PM | 1 |
| Firestone, LL | 1 |
| Tomita, M | 1 |
| Okuyama, T | 1 |
| Korolkiewicz, R | 1 |
| Kleinrok, Z | 1 |
| Mlynarczyk, M | 1 |
| Knoflach, F | 1 |
| Benke, D | 1 |
| Scheurer, L | 1 |
| Lüddens, H | 1 |
| Hamilton, BJ | 1 |
| Carter, DB | 1 |
| Mohler, H | 1 |
| Benson, JA | 1 |
| Whittemore, ER | 1 |
| Yang, W | 1 |
| Drewe, JA | 1 |
| Woodward, RM | 1 |
| Bringmann, G | 1 |
| Mader, T | 1 |
| Feineis, D | 1 |
| Keller, T | 1 |
| Schneider, A | 1 |
| Tutsch-Bauer, E | 1 |
| Bower, AL | 1 |
| Ripepi, A | 1 |
| Dilger, J | 1 |
| Boparai, N | 1 |
| Brody, FJ | 1 |
| Ponsky, JL | 1 |
| Inoue, H | 1 |
| Maeno, Y | 1 |
| Iwasa, M | 1 |
| Matoba, R | 1 |
| Ugland, HG | 1 |
| Krogh, M | 1 |
| Rasmussen, KE | 1 |
| Lorenti, A | 1 |
| Barbich, M | 1 |
| Hidalgo, A | 1 |
| Hyon, SH | 1 |
| Sorroche, P | 1 |
| Guinle, A | 1 |
| Schenone, A | 1 |
| Chamoles, N | 1 |
| Argibay, P | 1 |
| Muchoh, SN | 1 |
| Ogutu, BR | 1 |
| Newton, CR | 1 |
| Kokwar, GO | 1 |
| van Hout, MW | 1 |
| van Egmond, WM | 1 |
| Franke, JP | 1 |
| de Zeeuw, RA | 1 |
| de Jong, GJ | 1 |
| Korpi, ER | 1 |
| Uusi-Oukari, M | 1 |
| Wegelius, K | 1 |
| Hales, TG | 1 |
| Kim, H | 1 |
| Longoni, B | 1 |
| Olsen, RW | 1 |
| Tobin, AJ | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Bispectral Index Monitoring During Anesthesiologist - Directed Sedation in Scheduled Colonoscopies[NCT03461029] | 196 participants (Actual) | Observational [Patient Registry] | 2016-01-30 | Completed | |||
| Bispectral Index Monitoring for Sedation in Elective Colonoscopies of Adult Patients: a Randomized Controlled Trial[NCT03453359] | 180 participants (Actual) | Interventional | 2018-01-28 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
2 trials available for diazepam and Sensitivity and Specificity
| Article | Year |
|---|---|
Simultaneous modeling of the pharmacokinetics and pharmacodynamics of midazolam and diazepam.
Topics: Adult; Cross-Over Studies; Diazepam; Drug Administration Schedule; Drug Interactions; Humans; Infusi | 1995 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
Bispectral index monitoring of sedation during endoscopy.
Topics: Adult; Aged; Aged, 80 and over; Arousal; Cholangiopancreatography, Endoscopic Retrograde; Colonoscop | 2000 |
58 other studies available for diazepam and Sensitivity and Specificity
| Article | Year |
|---|---|
Protein kinase C epsilon regulates gamma-aminobutyrate type A receptor sensitivity to ethanol and benzodiazepines through phosphorylation of gamma2 subunits.
Topics: Adenosine Triphosphate; Allosteric Regulation; Animals; Benzodiazepines; Cells, Cultured; Enzyme Act | 2007 |
First-principle, structure-based prediction of hepatic metabolic clearance values in human.
Topics: Computational Biology; Drug Discovery; Hepatocytes; Humans; Hydrogen-Ion Concentration; Liver; Metab | 2009 |
Development and Validation of an Analytical Method for the Detection and Quantification of Bromazepam, Clonazepam and Diazepam by UPLC-MS/MS in Surface Water.
Topics: Anti-Anxiety Agents; Bromazepam; Chromatography, Liquid; Clonazepam; Diazepam; Fresh Water; Reproduc | 2019 |
[Cross-reactivity of Instant-View M-1 for detection of benzodiazepine-related drugs and their metabolites in urine].
Topics: Alprazolam; Benzodiazepines; Biomarkers; Cross Reactions; Diazepam; Humans; Immunoassay; Nitrazepam; | 2014 |
A comparative study of primary secondary amino (PSA) and multi-walled carbon nanotubes (MWCNTs) as QuEChERS absorbents for the rapid determination of diazepam and its major metabolites in fish samples by high-performance liquid chromatography-electrospray
Topics: Adsorption; Animals; Chromatography, High Pressure Liquid; Diazepam; Fishes; Food Contamination; Nan | 2016 |
Higher detection sensitivity of anxiolytic effects of diazepam by ledge-free open arm with opaque walled closed arm elevated plus maze in male rats.
Topics: Animals; Anti-Anxiety Agents; Anxiety; Diazepam; Drug Evaluation, Preclinical; Exploratory Behavior; | 2015 |
Synthesis of dendritic silver nanostructures supported by graphene nanosheets and its application for highly sensitive detection of diazepam.
Topics: Adsorption; Anti-Anxiety Agents; Biosensing Techniques; Conductometry; Dendrimers; Diazepam; Electro | 2015 |
An improved HPLC method for rapid quantitation of diazepam and its major metabolites in human plasma.
Topics: Adult; Chromatography, High Pressure Liquid; Diazepam; Humans; Male; Molecular Structure; Plasma; Se | 2008 |
Determination of diazepam and its metabolites in human urine by liquid chromatography/tandem mass spectrometry using a hydrophilic polymer column.
Topics: Administration, Oral; Adult; Anti-Anxiety Agents; Chromatography, Liquid; Diazepam; Drug Stability; | 2008 |
Design of packed-fiber solid-phase extraction device for analysis of the drug and its metabolite in plasma.
Topics: Animals; Chromatography, Liquid; Diazepam; Dogs; Humans; Plasma; Sensitivity and Specificity; Solid | 2009 |
Structure of rat behavior in hole-board: II) multivariate analysis of modifications induced by diazepam.
Topics: Animals; Anti-Anxiety Agents; Behavior, Animal; Behavioral Research; Cluster Analysis; Data Interpre | 2009 |
Development of the space-resolved solid-phase microextraction technique and its application to biological matrices.
Topics: Adipose Tissue; Animals; Calibration; Diazepam; Diffusion; Fishes; Gels; Muscles; Onions; Pharmaceut | 2009 |
Determination of ipriflavone in human plasma by LC-MS and its application in a pharmacokinetic study.
Topics: Adult; Area Under Curve; Chromatography, Liquid; Diazepam; Humans; Isoflavones; Linear Models; Liqui | 2012 |
Pros and cons of benzodiazepines screening in human saliva by ion mobility spectrometry.
Topics: Adult; Benzodiazepines; Diazepam; Humans; Hypnotics and Sedatives; Mass Spectrometry; Saliva; Sensit | 2011 |
Simultaneous analysis of select pharmaceuticals and personal care products in fish tissue using pressurized liquid extraction combined with silica gel cleanup.
Topics: Animals; Carbamazepine; Chemical Fractionation; Chromatography, Gel; Cosmetics; Diazepam; Drug Resid | 2011 |
Application of a liquid chromatography-tandem mass spectrometry (LC-MS/MS) method to the pharmacokinetics, tissue distribution and excretion studies of felotaxel (SHR110008) in tumor-bearing mice.
Topics: Animals; Antineoplastic Agents; Chromatography, Liquid; Diazepam; Drug Stability; Lung Neoplasms; Ma | 2012 |
Reusable solid-phase microextraction coating for direct immersion whole-blood analysis and extracted blood spot sampling coupled with liquid chromatography-tandem mass spectrometry and direct analysis in real time-tandem mass spectrometry.
Topics: Biocompatible Materials; Blood Chemical Analysis; Chromatography, Liquid; Diazepam; Humans; Sensitiv | 2012 |
Simultaneous determination of levocetirizine and pseudoephedrine in dog plasma by liquid chromatography-mass spectrometry in the presence of dextrocetirizine.
Topics: Administration, Oral; Animals; Calibration; Cetirizine; Chromatography, Liquid; Diazepam; Dogs; Male | 2012 |
Propylene glycol interference in the Vidas HIV DUO assay.
Topics: AIDS Serodiagnosis; Diazepam; False Positive Reactions; HIV Antibodies; HIV Antigens; HIV Core Prote | 2002 |
Tetrazepam drug sensitivity -- usefulness of the patch test.
Topics: Administration, Oral; Adult; Aged; Allergens; Anti-Anxiety Agents; Benzodiazepines; Diazepam; Dose-R | 2002 |
Simple and sensitive liquid chromatography/tandem mass spectrometry method for the determination of diazepam and its major metabolites in rat cerebrospinal fluid.
Topics: Animals; Chromatography, Liquid; Diazepam; Male; Mass Spectrometry; Molecular Structure; Rats; Rats, | 2003 |
Detection of the adulteration of traditional alcoholic beverages by the separation and determination of alprazolam, chloralhydrate and diazepam using reversed-phase high-performance liquid chromatography.
Topics: Alcoholic Beverages; Alprazolam; Chloral Hydrate; Chromatography, High Pressure Liquid; Diazepam; Re | 2004 |
Plasma protein aspartyl damage is increased in hemodialysis patients: studies on causes and consequences.
Topics: Asparagine; Aspartic Acid; Biomarkers; Blood Chemical Analysis; Blood Proteins; Diazepam; Female; Hu | 2004 |
Comparison of capillary electrophoresis and reversed-phase liquid chromatography methodologies for determination of diazepam in pharmaceutical tablets.
Topics: Chromatography, Liquid; Diazepam; Electrophoresis, Capillary; Reproducibility of Results; Sensitivit | 2005 |
Development and validation of a liquid chromatographic/electrospray ionization mass spectrometric method for the quantitation of prazepam and its main metabolites in human plasma.
Topics: Calibration; Chromatography, Liquid; Diazepam; Humans; Molecular Structure; Nordazepam; Oxazepam; Pr | 2005 |
Accelerated throughput metabolic route screening in early drug discovery using high-resolution liquid chromatography/quadrupole time-of-flight mass spectrometry and automated data analysis.
Topics: Animals; Automation; Chromatography, Liquid; Diazepam; Drug Evaluation, Preclinical; Indinavir; Mass | 2005 |
Reducing whole body physiologically based pharmacokinetic models using global sensitivity analysis: diazepam case study.
Topics: Animals; Diazepam; Models, Biological; Physiology; Rats; Sensitivity and Specificity; Tissue Distrib | 2006 |
A simple flow injection spectrophotometric procedure for the determination of diazepam in pharmaceutical formulation.
Topics: Diazepam; Equipment Design; Flow Injection Analysis; Pharmaceutical Preparations; Sensitivity and Sp | 2006 |
Ultra-performance liquid chromatography coupled to time-of-flight mass spectrometry for robust, high-throughput quantitative analysis of an automated metabolic stability assay, with simultaneous determination of metabolic data.
Topics: Animals; Chromatography, High Pressure Liquid; Diazepam; Drug Evaluation, Preclinical; Drug Stabilit | 2006 |
Molecularly imprinted solid-phase extraction of diazepam and its metabolites from hair samples.
Topics: Benzodiazepines; Chromatography, High Pressure Liquid; Diazepam; Enzyme-Linked Immunosorbent Assay; | 2007 |
Simultaneous quantification of opiates, amphetamines, cocaine and metabolites and diazepam and metabolite in a single hair sample using GC-MS.
Topics: Amphetamine; Cocaine; Diazepam; Gas Chromatography-Mass Spectrometry; Hair; Humans; Opioid Peptides; | 2007 |
A rapid fluorimetric screening method for the 1,4-benzodiazepines: determination of their metabolite oxazepam in urine.
Topics: Clorazepate Dipotassium; Diazepam; Humans; Oxazepam; Sensitivity and Specificity; Spectrometry, Fluo | 2007 |
Ziprasidone, diazepam, or the combination for prevention of cocaine toxicity in a mouse model.
Topics: Animals; Cocaine; Cocaine-Related Disorders; Confidence Intervals; Diazepam; Disease Models, Animal; | 2007 |
Evaluation of bio-compatible poly(ethylene glycol)-based solid-phase microextraction fiber for in vivo pharmacokinetic studies of diazepam in dogs.
Topics: Animals; Anticonvulsants; Calibration; Chromatography, Liquid; Diazepam; Dogs; Polyethylene Glycols; | 2007 |
Simultaneous determination of dipyridamole and salicylic acid in human plasma by high performance liquid chromatography-mass spectrometry.
Topics: Chromatography, High Pressure Liquid; Diazepam; Dipyridamole; Humans; Reproducibility of Results; Ro | 2008 |
Blood sampling without blood draws for in vivo pharmacokinetic studies in rats.
Topics: Acetonitriles; Animals; Anti-Anxiety Agents; Area Under Curve; Buffers; Calibration; Diazepam; Half- | 2008 |
Analysis of chemically induced spindle aberrations in male mouse germ cells: comparison of differential and immunofluorescent staining procedures.
Topics: Acrylamide; Acrylamides; Aneuploidy; Animals; Chromosome Aberrations; Diazepam; Evaluation Studies a | 1995 |
Stereospecific transduction of behavioral effects via diazepam-insensitive GABAA receptors.
Topics: Animals; Behavior, Animal; Benzodiazepines; Benzodiazepinones; Binding Sites; Binding, Competitive; | 1995 |
The rat-pull test procedure: a method for assessing the strength of rats.
Topics: Acrylamide; Acrylamides; Animals; Diazepam; Ergometry; Evaluation Studies as Topic; Gentamicins; Mal | 1995 |
Biochemical and functional identification of GABA receptors in Hydra vulgaris.
Topics: Animals; Baclofen; Bicuculline; Binding, Competitive; Diazepam; Feeding Behavior; gamma-Aminobutyric | 1995 |
Determination of oxazepam and diazepam in body fluids by HPLC.
Topics: Chromatography, High Pressure Liquid; Clonazepam; Diazepam; Humans; Oxazepam; Regression Analysis; R | 1993 |
Selective detection of chlorine-containing compounds by gas chromatography/chemical reaction interface mass spectrometry.
Topics: Acids; Adult; Anti-Anxiety Agents; Chlorine; Diazepam; Gas Chromatography-Mass Spectrometry; Humans; | 1993 |
Modulation of the developing rat sympathetic GABAA receptor by Zn++, benzodiazepines, barbiturates and ethanol.
Topics: Aging; Animals; Barbiturates; Benzodiazepines; Bicuculline; Diazepam; Ethanol; GABA-A Receptor Antag | 1993 |
Alterations in pharmacological sensitivity of GABAergic but not dopaminergic and glutamatergic systems during ontogenesis in dystonic mutant hamsters.
Topics: Aging; Aminooxyacetic Acid; Animals; Cricetinae; Diazepam; Dopamine Antagonists; Dystonia; Mesocrice | 1993 |
Volatile anesthetic requirements differ in mice selectively bred for sensitivity or resistance to diazepam: implications for the site of anesthesia.
Topics: Anesthesia, Inhalation; Animals; Diazepam; Drug Resistance; Enflurane; Halothane; Male; Mice; Select | 1993 |
Application of capillary electrophoresis to the simultaneous screening and quantitation of benzodiazepines.
Topics: Autoanalysis; Benzodiazepines; Bromazepam; Buffers; Diazepam; Electrophoresis, Capillary; Estazolam; | 1996 |
Intracerebroventricular pertussis toxin enhances sensitivity to chemical convulsants and decreases the protective efficacy of carbamazepine in mice.
Topics: Animals; Anticonvulsants; Carbamazepine; Convulsants; Diazepam; Drug Synergism; GTP-Binding Proteins | 1996 |
Pharmacological modulation of the diazepam-insensitive recombinant gamma-aminobutyric acidA receptors alpha 4 beta 2 gamma 2 and alpha 6 beta 2 gamma 2.
Topics: Animals; Azides; Benzodiazepines; Benzodiazepinones; Binding Sites; Carbolines; Diazepam; Furosemide | 1996 |
Pharmacology of the human gamma-aminobutyric acidA receptor alpha 4 subunit expressed in Xenopus laevis oocytes.
Topics: Animals; Benzodiazepines; Binding Sites; Diazepam; Electrophysiology; Flumazenil; GABA Agonists; GAB | 1996 |
Determination of viridicatin in Penicillium cyclopium by capillary gas chromatography.
Topics: Benzodiazepines; Capillary Action; Chromatography, Gas; Diazepam; Gas Chromatography-Mass Spectromet | 1997 |
Fatal intoxication due to dothiepin.
Topics: Adult; Anti-Anxiety Agents; Antidepressive Agents, Tricyclic; Autopsy; Body Fluids; Diazepam; Dothie | 2000 |
Screening and determination of benzodiazepines in whole blood using solid-phase extraction and gas chromatography/mass spectrometry.
Topics: Anti-Anxiety Agents; Benzodiazepines; Calibration; Chromatography, Ion Exchange; Diazepam; Estazolam | 2000 |
Liquid-phase microextraction as a sample preparation technique prior to capillary gas chromatographic-determination of benzodiazepines in biological matrices.
Topics: Chromatography, Gas; Diazepam; Humans; Nordazepam; Reproducibility of Results; Sensitivity and Speci | 2000 |
Culture of porcine hepatocytes: the dogma of exogenous matrix revisited.
Topics: Animals; Cell Division; Cells, Cultured; Culture Media; Diazepam; Extracellular Matrix; Hepatocytes; | 2001 |
High-performance liquid chromatographic determination of diazepam in plasma of children with severe malaria.
Topics: Anticonvulsants; Antimalarials; Calibration; Chromatography, High Pressure Liquid; Diazepam; Humans; | 2001 |
Feasibility of the direct coupling of solid-phase extraction-pipette tips with a programmed-temperature vaporiser for gas chromatographic analysis of drugs in plasma.
Topics: Chromatography, Gas; Diazepam; Feasibility Studies; Lidocaine; Mass Spectrometry; Reproducibility of | 2002 |
Substrate specificity of diazepam-insensitive cerebellar [3H]Ro 15-4513 binding sites.
Topics: Animals; Azides; Behavior, Animal; Benzodiazepines; Binding Sites; Binding, Competitive; Cerebellum; | 1992 |
Immortalized hypothalamic GT1-7 neurons express functional gamma-aminobutyric acid type A receptors.
Topics: Anesthetics; Animals; Barbiturates; Base Sequence; Bicuculline; Cell Line, Transformed; Cell Membran | 1992 |