dehydroepiandrosterone has been researched along with Depressive Disorder, Major in 41 studies
Dehydroepiandrosterone: A major C19 steroid produced by the ADRENAL CORTEX. It is also produced in small quantities in the TESTIS and the OVARY. Dehydroepiandrosterone (DHEA) can be converted to TESTOSTERONE; ANDROSTENEDIONE; ESTRADIOL; and ESTRONE. Most of DHEA is sulfated (DEHYDROEPIANDROSTERONE SULFATE) before secretion.
dehydroepiandrosterone : An androstanoid that is androst-5-ene substituted by a beta-hydroxy group at position 3 and an oxo group at position 17. It is a naturally occurring steroid hormone produced by the adrenal glands.
Depressive Disorder, Major: Disorder in which five (or more) of the following symptoms have been present during the same 2-week period and represent a change from previous functioning; at least one of the symptoms is either (1) depressed mood or (2) loss of interest or pleasure. Symptoms include: depressed mood most of the day, nearly every daily; markedly diminished interest or pleasure in activities most of the day, nearly every day; significant weight loss when not dieting or weight gain; Insomnia or hypersomnia nearly every day; psychomotor agitation or retardation nearly every day; fatigue or loss of energy nearly every day; feelings of worthlessness or excessive or inappropriate guilt; diminished ability to think or concentrate, or indecisiveness, nearly every day; or recurrent thoughts of death, recurrent suicidal ideation without a specific plan, or a suicide attempt. (DSM-5)
| Excerpt | Relevance | Reference |
|---|---|---|
| " DHEA dosing was flexible (100-400 mg/day)." | 2.72 | Placebo-controlled trial of dehydroepiandrosterone (DHEA) for treatment of nonmajor depression in patients with HIV/AIDS. ( Ferrando, SJ; McElhiney, MC; McGrath, PJ; Rabkin, JG; Rabkin, R, 2006) |
| "Metyrapone treatment was well tolerated without serious adverse effects." | 2.71 | Metyrapone as additive treatment in major depression: a double-blind and placebo-controlled trial. ( Jahn, H; Kellner, M; Kiefer, F; Schick, M; Wiedemann, K; Yassouridis, A, 2004) |
| "However, data on the impact of sleep deprivation on concentrations of neuroactive steroids are not available." | 2.71 | Neuroactive steroids in responders and nonresponders to sleep deprivation. ( Baghai, T; Bernardi, G; Di Michele, F; Padberg, F; Pasini, A; Romeo, E; Rupprecht, R; Schüle, C; Zwanzger, P, 2004) |
| "Sexual dysfunction is not a symptom of PTSD but is a common clinical complaint in trauma survivors with this disorder." | 1.43 | Sexual dysfunction and neuroendocrine correlates of posttraumatic stress disorder in combat veterans: Preliminary findings. ( Bierer, LM; Flory, JD; Lehrner, A; Makotkine, I; Marmar, CR; Yehuda, R, 2016) |
| "Abused women with PTSD had lower concentrations of cortisol during the afternoon hours (12-8 p." | 1.34 | Cortisol, dehydroepiandrosterone, and estradiol measured over 24 hours in women with childhood sexual abuse-related posttraumatic stress disorder. ( Bremner, D; Kelley, ME; Vermetten, E, 2007) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 2 (4.88) | 18.2507 |
| 2000's | 25 (60.98) | 29.6817 |
| 2010's | 11 (26.83) | 24.3611 |
| 2020's | 3 (7.32) | 2.80 |
| Authors | Studies |
|---|---|
| Kische, H | 1 |
| Voss, C | 1 |
| Haring, R | 1 |
| Ollmann, TM | 1 |
| Pieper, L | 1 |
| Kirschbaum, C | 1 |
| Beesdo-Baum, K | 1 |
| Ahmed, T | 1 |
| Qassem, M | 1 |
| Kyriacou, PA | 1 |
| Agorastos, A | 1 |
| Heinig, A | 1 |
| Sommer, A | 1 |
| Wiedemann, K | 3 |
| Demiralay, C | 1 |
| Rasmusson, AM | 1 |
| King, MW | 1 |
| Valovski, I | 1 |
| Gregor, K | 1 |
| Scioli-Salter, E | 1 |
| Pineles, SL | 1 |
| Hamouda, M | 1 |
| Nillni, YI | 1 |
| Anderson, GM | 1 |
| Pinna, G | 1 |
| Kellner, M | 2 |
| Muhtz, C | 1 |
| Weinås, Å | 1 |
| Ćurić, S | 1 |
| Yassouridis, A | 2 |
| Van Voorhees, EE | 1 |
| Dennis, MF | 1 |
| Calhoun, PS | 1 |
| Beckham, JC | 1 |
| Ben Dor, R | 1 |
| Marx, CE | 1 |
| Shampine, LJ | 1 |
| Rubinow, DR | 2 |
| Schmidt, PJ | 2 |
| Lehrner, A | 1 |
| Flory, JD | 1 |
| Bierer, LM | 1 |
| Makotkine, I | 1 |
| Marmar, CR | 1 |
| Yehuda, R | 1 |
| Jin, RO | 1 |
| Mason, S | 1 |
| Mellon, SH | 2 |
| Epel, ES | 3 |
| Reus, VI | 4 |
| Mahan, L | 2 |
| Rosser, RL | 1 |
| Hough, CM | 2 |
| Burke, HM | 2 |
| Mueller, SG | 1 |
| Wolkowitz, OM | 4 |
| Lindqvist, D | 1 |
| Denis, MS | 1 |
| Bersani, FS | 1 |
| Rosser, R | 1 |
| Markopoulou, K | 1 |
| Papadopoulos, A | 1 |
| Juruena, MF | 1 |
| Poon, L | 1 |
| Pariante, CM | 1 |
| Cleare, AJ | 1 |
| Ravindran, AV | 1 |
| Lam, RW | 1 |
| Filteau, MJ | 1 |
| Lespérance, F | 1 |
| Kennedy, SH | 1 |
| Parikh, SV | 1 |
| Patten, SB | 1 |
| Morgan, ML | 1 |
| Rapkin, AJ | 1 |
| Biggio, G | 1 |
| Serra, M | 1 |
| Pisu, MG | 1 |
| Rasgon, N | 1 |
| Corrêa, MS | 1 |
| Balardin, JB | 1 |
| Caldieraro, MA | 1 |
| Fleck, MP | 1 |
| Argimon, I | 1 |
| Luz, C | 1 |
| Bromberg, E | 1 |
| Herbert, J | 4 |
| Kurita, H | 1 |
| Maeshima, H | 1 |
| Kida, S | 1 |
| Matsuzaka, H | 1 |
| Shimano, T | 1 |
| Nakano, Y | 1 |
| Baba, H | 1 |
| Suzuki, T | 1 |
| Arai, H | 1 |
| Karishma, KK | 1 |
| van Broekhoven, F | 1 |
| Verkes, RJ | 1 |
| Padberg, F | 3 |
| di Michele, F | 3 |
| Zwanzger, P | 3 |
| Romeo, E | 3 |
| Bernardi, G | 3 |
| Schüle, C | 3 |
| Baghai, TC | 1 |
| Ella, R | 1 |
| Pasini, A | 3 |
| Rupprecht, R | 3 |
| Baghai, T | 2 |
| Porter, RJ | 1 |
| Gallagher, P | 1 |
| Watson, S | 1 |
| Smith, MS | 1 |
| Young, AH | 2 |
| Goodyer, IM | 2 |
| Tamplin, A | 1 |
| Poór, V | 1 |
| Juricskay, S | 1 |
| Gáti, A | 1 |
| Osváth, P | 1 |
| Tényi, T | 1 |
| Ferrari, E | 1 |
| Mirani, M | 1 |
| Barili, L | 1 |
| Falvo, F | 1 |
| Solerte, SB | 1 |
| Cravello, L | 1 |
| Pini, L | 1 |
| Magri, F | 1 |
| Jahn, H | 1 |
| Schick, M | 1 |
| Kiefer, F | 1 |
| Daly, RC | 1 |
| Bloch, M | 1 |
| Smith, MJ | 1 |
| Danaceau, MA | 1 |
| St Clair, LS | 1 |
| Murphy, JH | 1 |
| Haq, N | 1 |
| Kahl, KG | 1 |
| Bens, S | 1 |
| Ziegler, K | 1 |
| Rudolf, S | 1 |
| Dibbelt, L | 1 |
| Kordon, A | 1 |
| Schweiger, U | 1 |
| Rabkin, JG | 1 |
| McElhiney, MC | 1 |
| Rabkin, R | 1 |
| McGrath, PJ | 1 |
| Ferrando, SJ | 1 |
| Hui, X | 1 |
| Zhou, CH | 1 |
| Wang, MW | 1 |
| Hsiao, CC | 1 |
| Angold, A | 1 |
| Costello, EJ | 1 |
| Bremner, D | 1 |
| Vermetten, E | 1 |
| Kelley, ME | 1 |
| Scott, LV | 1 |
| Salahuddin, F | 1 |
| Cooney, J | 1 |
| Svec, F | 1 |
| Dinan, TG | 1 |
| Bech, P | 1 |
| Raabaek Olsen, L | 1 |
| Jarløv, N | 1 |
| Hammer, M | 1 |
| Schütze, T | 1 |
| Breum, L | 1 |
| Maayan, R | 1 |
| Yagorowski, Y | 1 |
| Grupper, D | 1 |
| Weiss, M | 1 |
| Shtaif, B | 1 |
| Kaoud, MA | 1 |
| Weizman, A | 1 |
| Park, RJ | 1 |
| Fabian, TJ | 1 |
| Dew, MA | 1 |
| Pollock, BG | 1 |
| Reynolds, CF | 1 |
| Mulsant, BH | 1 |
| Butters, MA | 1 |
| Zmuda, MD | 1 |
| Linares, AM | 1 |
| Trottini, M | 1 |
| Kroboth, PD | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Feasibility, Acceptability and Effectiveness of a Structured Exercise + Psychoeducation Program for Students With Depression - A Proof of Concept Study[NCT04572035] | 60 participants (Actual) | Interventional | 2020-10-01 | Completed | |||
| Evaluation of Cognitive Effects Generated by Music Therapy for Older Adults With Cognitive Impairment Living in Care Homes - a Randomized Control Trial[NCT05856604] | 42 participants (Actual) | Interventional | 2018-02-01 | Completed | |||
| Effects of Pregnenolone on Perceived Social Isolation: A Double-blind Randomized Electrical Neuroimaging Study[NCT02826577] | Phase 2 | 96 participants (Anticipated) | Interventional | 2017-05-01 | Active, not recruiting | ||
| Double-Blind, Placebo Controlled Trial of Metyrapone as Augmenting Agent in the Treatment of Major Depression[NCT00125554] | Phase 2 | 63 participants | Interventional | 1998-05-31 | Completed | ||
| Effects of the Addition of Metyrapone to Antidepressant Therapy in Depression With Dexamethasone Suppression Test Non-suppression.[NCT03491696] | Phase 4 | 14 participants (Anticipated) | Interventional | 2018-12-22 | Recruiting | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
7 reviews available for dehydroepiandrosterone and Depressive Disorder, Major
| Article | Year |
|---|---|
Measuring stress: a review of the current cortisol and dehydroepiandrosterone (DHEA) measurement techniques and considerations for the future of mental health monitoring.
Topics: Dehydroepiandrosterone; Depressive Disorder, Major; Humans; Hydrocortisone; Mental Health; Stress, P | 2023 |
Cortisol and depression: three questions for psychiatry.
Topics: Animals; Antidepressive Agents; Brain; Brain-Derived Neurotrophic Factor; Chronobiology Disorders; C | 2013 |
Neurosteroids in depression: a review.
Topics: Animals; Dehydroepiandrosterone; Depressive Disorder, Major; Humans; Neurotransmitter Agents; Pregna | 2003 |
Stress hormone-related psychopathology: pathophysiological and treatment implications.
Topics: Antidepressive Agents; Cognition Disorders; Corticosterone; Cushing Syndrome; Dehydroepiandrosterone | 2001 |
Glucocorticoid receptor and treatment of psychotic major depression.
Topics: Animals; Brain; Dehydroepiandrosterone; Depressive Disorder, Major; Humans; Metyrapone; Mifepristone | 2005 |
Antiglucocoticoid treatments for depression.
Topics: Adrenocortical Hyperfunction; Dehydroepiandrosterone; Depressive Disorder, Major; Enzyme Inhibitors; | 2006 |
Puberty and depression.
Topics: Adolescent; Androgens; Dehydroepiandrosterone; Depressive Disorder, Major; Female; Gonadotropins; Hu | 2006 |
9 trials available for dehydroepiandrosterone and Depressive Disorder, Major
| Article | Year |
|---|---|
DHEA metabolism to the neurosteroid androsterone: a possible mechanism of DHEA's antidepressant action.
Topics: Androsterone; Antidepressive Agents; Cross-Over Studies; Dehydroepiandrosterone; Depressive Disorder | 2015 |
Neuroactive steroids after estrogen exposure in depressed postmenopausal women treated with sertraline and asymptomatic postmenopausal women.
Topics: Brain; Dehydroepiandrosterone; Depressive Disorder, Major; Desoxycorticosterone; Estrogens; Female; | 2010 |
Elevated prolactin responses to L-tryptophan infusion in medication-free depressed patients.
Topics: Adolescent; Adult; Dehydroepiandrosterone; Depressive Disorder, Major; Female; Humans; Hydrocortison | 2003 |
Metyrapone as additive treatment in major depression: a double-blind and placebo-controlled trial.
Topics: Adrenocorticotropic Hormone; Adult; Antidepressive Agents; Cortodoxone; Dehydroepiandrosterone; Depr | 2004 |
Metyrapone as additive treatment in major depression: a double-blind and placebo-controlled trial.
Topics: Adrenocorticotropic Hormone; Adult; Antidepressive Agents; Cortodoxone; Dehydroepiandrosterone; Depr | 2004 |
Metyrapone as additive treatment in major depression: a double-blind and placebo-controlled trial.
Topics: Adrenocorticotropic Hormone; Adult; Antidepressive Agents; Cortodoxone; Dehydroepiandrosterone; Depr | 2004 |
Metyrapone as additive treatment in major depression: a double-blind and placebo-controlled trial.
Topics: Adrenocorticotropic Hormone; Adult; Antidepressive Agents; Cortodoxone; Dehydroepiandrosterone; Depr | 2004 |
Neuroactive steroids in responders and nonresponders to sleep deprivation.
Topics: Adult; Affect; Aged; Dehydroepiandrosterone; Depressive Disorder, Major; Female; Humans; Male; Middl | 2004 |
Dehydroepiandrosterone monotherapy in midlife-onset major and minor depression.
Topics: Aged; Ambulatory Care; Cross-Over Studies; Dehydroepiandrosterone; Depressive Disorder; Depressive D | 2005 |
Placebo-controlled trial of dehydroepiandrosterone (DHEA) for treatment of nonmajor depression in patients with HIV/AIDS.
Topics: Acquired Immunodeficiency Syndrome; Adjuvants, Immunologic; Adolescent; Adult; Aged; Dehydroepiandro | 2006 |
Difference in pre- and post-treatment plasma DHEA levels were significantly and positively correlated with difference in pre- and post-treatment Hamilton depression scores following successful therapy for major depression.
Topics: Adolescent; Adult; Antidepressive Agents, Second-Generation; Chi-Square Distribution; Cyclohexanols; | 2006 |
Endogenous concentrations of DHEA and DHEA-S decrease with remission of depression in older adults.
Topics: Aged; Dehydroepiandrosterone; Dehydroepiandrosterone Sulfate; Depressive Disorder, Major; Dose-Respo | 2001 |
25 other studies available for dehydroepiandrosterone and Depressive Disorder, Major
| Article | Year |
|---|---|
Hair androgen concentrations and depressive disorders in adolescents from the general population.
Topics: Adolescent; Adult; Androgens; Cohort Studies; Cross-Sectional Studies; Dehydroepiandrosterone; Depre | 2023 |
Morning salivary dehydroepiandrosterone (DHEA) qualifies as the only neuroendocrine biomarker separating depressed patients with and without prior history of depression: An HPA axis challenge study.
Topics: Adrenocorticotropic Hormone; Biomarkers; Dehydroepiandrosterone; Depression; Depressive Disorder, Ma | 2023 |
Relationships between cerebrospinal fluid GABAergic neurosteroid levels and symptom severity in men with PTSD.
Topics: 5-alpha-Dihydroprogesterone; Adult; Cholestenone 5 alpha-Reductase; Dehydroepiandrosterone; Dehydroe | 2019 |
Impact of physical or sexual childhood abuse on plasma DHEA, DHEA-S and cortisol in a low-dose dexamethasone suppression test and on cardiovascular risk parameters in adult patients with major depression or anxiety disorders.
Topics: Adrenal Cortex Hormones; Adult; Adult Survivors of Child Abuse; Anxiety Disorders; Cardiovascular Di | 2018 |
Association of DHEA, DHEAS, and cortisol with childhood trauma exposure and post-traumatic stress disorder.
Topics: Adult; Child; Child Abuse; Dehydroepiandrosterone; Dehydroepiandrosterone Sulfate; Depressive Disord | 2014 |
Sexual dysfunction and neuroendocrine correlates of posttraumatic stress disorder in combat veterans: Preliminary findings.
Topics: Adult; Combat Disorders; Comorbidity; Cross-Sectional Studies; Dehydroepiandrosterone; Depressive Di | 2016 |
Cortisol/DHEA ratio and hippocampal volume: A pilot study in major depression and healthy controls.
Topics: Aged; Dehydroepiandrosterone; Dehydroepiandrosterone Sulfate; Depressive Disorder, Major; Female; He | 2016 |
Higher serum DHEA concentrations before and after SSRI treatment are associated with remission of major depression.
Topics: Adult; Aged; Antidepressive Agents; Dehydroepiandrosterone; Dehydroepiandrosterone Sulfate; Depressi | 2017 |
The ratio of cortisol/DHEA in treatment resistant depression.
Topics: Adult; Antidepressive Agents; Biomarkers, Pharmacological; Dehydroepiandrosterone; Depressive Disord | 2009 |
Canadian Network for Mood and Anxiety Treatments (CANMAT) Clinical guidelines for the management of major depressive disorder in adults. V. Complementary and alternative medicine treatments.
Topics: Acupuncture Therapy; Adult; Antidepressive Agents; Complementary Therapies; Dehydroepiandrosterone; | 2009 |
Contextual recognition memory deficits in major depression are suppressed by cognitive support at encoding.
Topics: Adult; Cognition; Cues; Dehydroepiandrosterone; Depressive Disorder, Major; Female; Humans; Hydrocor | 2012 |
Serum dehydroepiandrosterone (DHEA) and DHEA-sulfate (S) levels in medicated patients with major depressive disorder compared with controls.
Topics: Adult; Aged; Antidepressive Agents; Case-Control Studies; Dehydroepiandrosterone; Dehydroepiandroste | 2013 |
Dehydroepiandrosterone (DHEA) stimulates neurogenesis in the hippocampus of the rat, promotes survival of newly formed neurons and prevents corticosterone-induced suppression.
Topics: Age Factors; Androstenediol; Animals; Cell Death; Cell Differentiation; Cell Division; Cell Survival | 2002 |
Plasma concentrations of neuroactive steroids before and after repetitive transcranial magnetic stimulation (rTMS) in major depression.
Topics: Adult; Aged; Analysis of Variance; Dehydroepiandrosterone; Depressive Disorder, Major; Electromagnet | 2002 |
Influence of sleep deprivation on neuroactive steroids in major depression.
Topics: Adult; Aged; Analysis of Variance; Dehydroepiandrosterone; Depressive Disorder, Major; Female; Human | 2003 |
Psychoendocrine antecedents of persistent first-episode major depression in adolescents: a community-based longitudinal enquiry.
Topics: Adolescent; Adolescent Psychiatry; Biomarkers; Child; Circadian Rhythm; Dehydroepiandrosterone; Depr | 2003 |
Neurotransmitters, neurosteroids and neurotrophins: new models of the pathophysiology and treatment of depression.
Topics: Antidepressive Agents; Corticotropin-Releasing Hormone; Dehydroepiandrosterone; Depressive Disorder, | 2003 |
Urinary steroid metabolites and 11beta-hydroxysteroid dehydrogenase activity in patients with unipolar recurrent major depression.
Topics: 11-beta-Hydroxysteroid Dehydrogenases; Adrenal Cortex Hormones; Adult; Arousal; Corticosterone; Dehy | 2004 |
Cognitive and affective disorders in the elderly: a neuroendocrine study.
Topics: Aged; Aged, 80 and over; Aging; Circadian Rhythm; Cognition Disorders; Comorbidity; Dehydroepiandros | 2004 |
Cortisol, the cortisol-dehydroepiandrosterone ratio, and pro-inflammatory cytokines in patients with current major depressive disorder comorbid with borderline personality disorder.
Topics: Adult; Borderline Personality Disorder; Comorbidity; Dehydroepiandrosterone; Depressive Disorder, Ma | 2006 |
Cortisol, dehydroepiandrosterone, and estradiol measured over 24 hours in women with childhood sexual abuse-related posttraumatic stress disorder.
Topics: Adolescent; Adult; Bulimia; Child; Child Abuse, Sexual; Child, Preschool; Circadian Rhythm; Comorbid | 2007 |
Differences in adrenal steroid profile in chronic fatigue syndrome, in depression and in health.
Topics: Adult; Dehydroepiandrosterone; Depressive Disorder, Major; Fatigue Syndrome, Chronic; Female; Health | 1999 |
A case of sequential anti-stress medication in a patient with major depression resistant to amine-reuptake inhibitors.
Topics: Amines; Antidepressive Agents; Anxiety Disorders; Dehydroepiandrosterone; Depressive Disorder, Major | 1999 |
Basal plasma dehydroepiandrosterone sulfate level: a possible predictor for response to electroconvulsive therapy in depressed psychotic inpatients.
Topics: Adult; Dehydroepiandrosterone; Dehydroepiandrosterone Sulfate; Depressive Disorder, Major; Electroco | 2000 |
Psychosocial and endocrine features of chronic first-episode major depression in 8-16 year olds.
Topics: Adolescent; Child; Chronic Disease; Circadian Rhythm; Comorbidity; Dehydroepiandrosterone; Depressiv | 2001 |