clonidine has been researched along with Anemia, Cooley's in 8 studies
Clonidine: An imidazoline sympatholytic agent that stimulates ALPHA-2 ADRENERGIC RECEPTORS and central IMIDAZOLINE RECEPTORS. It is commonly used in the management of HYPERTENSION.
clonidine (amino form) : A clonidine that is 4,5-dihydro-1H-imidazol-2-amine in which one of the amino hydrogens is replaced by a 2,6-dichlorophenyl group.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Hypocalcemia was detected in five of the 30 thalassemic patients: hypoparathyroidism was diagnosed in two of the five and rickets in the other three." | 2.69 | Bone mineral density in prepubertal children with beta-thalassemia: correlation with growth and hormonal data. ( Abdel Fattah, M; Ansari, BM; El Banna, N; ElZalabani, MM; Soliman, AT, 1998) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 6 (75.00) | 18.2507 |
| 2000's | 1 (12.50) | 29.6817 |
| 2010's | 1 (12.50) | 24.3611 |
| 2020's | 0 (0.00) | 2.80 |
| Authors | Studies |
|---|---|
| Mahachoklertwattana, P | 1 |
| Yimsumruay, T | 1 |
| Poomthavorn, P | 1 |
| Chuansumrit, A | 1 |
| Khlairit, P | 1 |
| Masala, A | 1 |
| Atzeni, MM | 1 |
| Alagna, S | 1 |
| Gallisai, D | 1 |
| Burrai, C | 1 |
| Mela, MG | 1 |
| Rovasio, PP | 1 |
| Gallo, P | 1 |
| Katzos, G | 1 |
| Harsoulis, F | 1 |
| Papadopoulou, M | 1 |
| Athanasiou, M | 1 |
| Sava, K | 1 |
| Cavallo, L | 1 |
| Gurrado, R | 1 |
| Gallo, F | 1 |
| Zacchino, C | 1 |
| De Mattia, D | 1 |
| Tatò, L | 1 |
| Soliman, AT | 3 |
| El Banna, N | 2 |
| Ansari, BM | 3 |
| Abdel Fattah, M | 1 |
| ElZalabani, MM | 1 |
| Theodoridis, C | 1 |
| Ladis, V | 1 |
| Papatheodorou, A | 1 |
| Berdousi, H | 1 |
| Palamidou, F | 1 |
| Evagelopoulou, C | 1 |
| Athanassaki, K | 1 |
| Konstantoura, O | 1 |
| Kattamis, C | 1 |
| elZalabany, MM | 1 |
| Mazloum, Y | 1 |
| Bedair, SM | 1 |
| Ragab, MS | 1 |
| Rogol, AD | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Denosumab Versus Zoledronic Acid for Patients With Beta-Thalassemia Major-Induced Osteoporosis[NCT03040765] | Phase 3 | 17 participants (Actual) | Interventional | 2018-05-14 | Terminated (stopped due to failed to recruit eligible subjects) | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
3 trials available for clonidine and Anemia, Cooley's
| Article | Year |
|---|---|
Growth hormone secretion in polytransfused prepubertal patients with homozygous beta-thalassemia. Effect of long-term recombinant GH (recGH) therapy.
Topics: Adolescent; Adrenergic alpha-Agonists; Age Determination by Skeleton; beta-Thalassemia; Blood Transf | 2003 |
GH response to provocation and circulating IGF-I and IGF-binding protein-3 concentrations, the IGF-I generation test and clinical response to GH therapy in children with beta-thalassaemia.
Topics: Adolescent; beta-Thalassemia; Child; Clonidine; Drug Resistance; Female; Glucagon; Growth Disorders; | 1998 |
Bone mineral density in prepubertal children with beta-thalassemia: correlation with growth and hormonal data.
Topics: Absorptiometry, Photon; Adolescent; Adrenocorticotropic Hormone; Age Factors; Alkaline Phosphatase; | 1998 |
5 other studies available for clonidine and Anemia, Cooley's
| Article | Year |
|---|---|
Acute effects of blood transfusion on growth hormone and insulin-like growth factor-1 levels in children with thalassemia.
Topics: Adolescent; Anemia; beta-Thalassemia; Blood Transfusion; Child; Child, Preschool; Clonidine; Cross-S | 2011 |
Circadian growth hormone secretion in short multitransfused prepubertal children with thalassaemia major.
Topics: Adolescent; beta-Thalassemia; Case-Control Studies; Child; Circadian Rhythm; Clonidine; Growth Disor | 1995 |
Growth deficiency in polytransfused beta-thalassaemia patients is not growth hormone dependent.
Topics: Adolescent; Adrenergic alpha-Agonists; Adult; beta-Thalassemia; Blood Transfusion; Body Height; Bone | 1997 |
Growth and management of short stature in thalassaemia major.
Topics: Adolescent; Adult; beta-Thalassemia; Blood Transfusion; Body Height; Child; Clonidine; Female; Growt | 1998 |
Spontaneous and provoked growth hormone (GH) secretion and insulin-like growth factor I (IGF-I) concentration in patients with beta thalassaemia and delayed growth.
Topics: Adolescent; Adult; beta-Thalassemia; Circadian Rhythm; Clonidine; Female; Glucagon; Growth Disorders | 1999 |