clofazimine has been researched along with Recrudescence in 45 studies
Clofazimine: A fat-soluble riminophenazine dye used for the treatment of leprosy. It has been used investigationally in combination with other antimycobacterial drugs to treat Mycobacterium avium infections in AIDS patients. Clofazimine also has a marked anti-inflammatory effect and is given to control the leprosy reaction, erythema nodosum leprosum. (From AMA Drug Evaluations Annual, 1993, p1619)
clofazimine : 3-Isopropylimino-3,5-dihydro-phenazine in which the hydrogen at position 5 is substituted substituted by a 4-chlorophenyl group, and that at position 2 is substituted by a (4-chlorophenyl)amino group. A dark red crystalline solid, clofazimine is an antimycobacterial and is one of the main drugs used for the treatment of multi-bacillary leprosy. However, it can cause red/brown discolouration of the skin, so other treatments are often preferred in light-skinned patients.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Twenty patients, ten suffering from disseminated granuloma anulare and ten from necrobiosis lipoidica, were treated with clofazimine 200 mg p." | 7.67 | [Clofazimine--therapeutic alternative in necrobiosis lipoidica and granuloma anulare]. ( Mensing, H, 1989) |
| "This paper summarises our clinical experience with clofazimine in the treatment of 25 cases of reactive states of lepromatous and borderline leprosy and 7 lepromatous patients not responding to dapsone." | 7.65 | Clinical trial with clofazimine in leprosy. ( Dongre, VV; Ganapati, R, 1976) |
| "We conducted a randomized, open-label trial in 42 French hospitals to compare the clinical and bacteriologic efficacy of combination therapy with clarithromycin/clofazimine (Clm/Clof) with that of combination therapy with clarithromycin/rifabutin/ethambutol (Clm/Rib/Eth) as treatment for Mycobacterium avium bacteremia." | 5.08 | Comparison of combination therapy regimens for treatment of human immunodeficiency virus-infected patients with disseminated bacteremia due to Mycobacterium avium. ANRS Trial 033 Curavium Group. Agence Nationale de Recherche sur le Sida. ( Beuscart, C; Brel, F; Dautzenberg, B; Doco-Lecompte, T; Grosset, J; May, T; Perronne, C; Saint-Marc, T; Vincent, V, 1997) |
| "Between 1989 and 1993, 136 multibacillary leprosy patients received a 6-week treatment regimen consisting of daily rifampicin 600 mg, ofloxacin 400 mg, clofazimine 100 mg and a weekly dose of 100 mg minocycline." | 3.71 | Relapse rates and a 10-year follow-up of a 6-week quadruple drug regimen for multibacillary leprosy. ( Grillone, S; Pattyn, S, 2002) |
| "The proportion of relapses among all patients detected each year increased steadily since the initiation of the national leprosy control program in China with dapsone monotherapy in 1955, reaching 18%-24% in the more leprosy-endemic provinces along the coast." | 3.68 | Problems of leprosy relapse in China. ( Li, HY, 1993) |
| "Twenty patients, ten suffering from disseminated granuloma anulare and ten from necrobiosis lipoidica, were treated with clofazimine 200 mg p." | 3.67 | [Clofazimine--therapeutic alternative in necrobiosis lipoidica and granuloma anulare]. ( Mensing, H, 1989) |
| "Oral zinc sulfate was tried in Eight cases of recurrent Erythema Nodosum Leprosum." | 3.66 | Oral zinc in recurrent Erythema Nodosum Leprosum reaction. ( Bumb, RA; Mangal, HN; Mathur, NK, 1983) |
| " Reactive episodes continue to be a serious complication, but the availability of thalidomide to control erythema nodosum leprosum has markedly improved the prognosis." | 3.65 | The diagnosis and treatment of leprosy. ( Jacobson, RR; Trautman, JR, 1976) |
| "This paper summarises our clinical experience with clofazimine in the treatment of 25 cases of reactive states of lepromatous and borderline leprosy and 7 lepromatous patients not responding to dapsone." | 3.65 | Clinical trial with clofazimine in leprosy. ( Dongre, VV; Ganapati, R, 1976) |
| "No confirmed relapse has been observed within a follow-up period of 6 months to 7 years and 3 months [59 person-years at risk (PYR)] for TT/BT patients and of 4 months to 5 years and 10 months (100 PYR) for BB/BL/LL patients." | 2.68 | Daily multidrug therapy for leprosy; results of a fourteen-year experience. ( Cottenot, F; de Carsalade, GY; Flageul, B; Pennec, J; Spindler, E; Wallach, D, 1997) |
| "Relapses are an indicator of MDT effectiveness and can reflect Mycobacterium leprae persistence or re-infection." | 1.62 | Low rate of relapse after twelve-dose multidrug therapy for hansen's disease: A 20-year cohort study in a brazilian reference center. ( Hacker, MAVB; Illarramendi, X; Maia, RC; Moraes, MO; Nery, JAC; Sales, AM; Sarno, EN, 2021) |
| "Mice treated with clofazimine were culture-negative after 5 months, whereas all mice treated without clofazimine remained heavily culture-positive for the entire 9 months of the study." | 1.39 | Assessment of clofazimine activity in a second-line regimen for tuberculosis in mice. ( Almeida, DV; Ammerman, NC; Bishai, WR; Converse, PJ; Enarson, D; Grosset, JH; Li, SY; Trébucq, A; Tyagi, S, 2013) |
| "Leprosy is well controlled in Hong Kong but continued surveillance is required to detect relapses and to ensure good patient compliance with treatment." | 1.33 | Epidemiology of leprosy and response to treatment in Hong Kong. ( Ho, CK; Lo, KK, 2006) |
| "Areas of low endemicity of Hansen's disease, such as Texas, California, and Hawaii, exist due to immigration and rare autochthonous infections." | 1.32 | Short report: Treatment failure in Hansen's disease. ( Joyce, MP; Longfield, RN; Murray, CK, 2003) |
| "Th rate of recurrence of pyoderma gangrenosum was 46% independently of treatment." | 1.31 | [Pyoderma gangrenosum. 15 cases]. ( Azaiz, MI; Ben Osman-Dhahri, A; Cherif, F; El Euch, D; Haouet, S; Mokni, M; Riahi, I; Zitouna, MM, 2001) |
| "Pustular lesions are known to occur in Sweet's syndrome." | 1.29 | [Idiopathic pustular and bullous variants of Sweet syndrome]. ( Albrecht, HP; Diepgen, TL; Tacke, J; von den Driesch, P, 1994) |
| " The initial dosage of either of the drugs was 300 mg daily administered in divided doses of 100 mg three times a day." | 1.26 | Treatment of steroid dependant cases of recurrent lepra reaction with a combination of thalidomide and clofazimine. ( Girdhar, A; Ramu, G, 1979) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 15 (33.33) | 18.7374 |
| 1990's | 12 (26.67) | 18.2507 |
| 2000's | 10 (22.22) | 29.6817 |
| 2010's | 6 (13.33) | 24.3611 |
| 2020's | 2 (4.44) | 2.80 |
| Authors | Studies |
|---|---|
| Yu, W | 1 |
| Chiwala, G | 1 |
| Gao, Y | 1 |
| Liu, Z | 1 |
| Sapkota, S | 1 |
| Lu, Z | 1 |
| Guo, L | 1 |
| Khan, SA | 1 |
| Zhong, N | 1 |
| Zhang, T | 1 |
| Nery, JAC | 1 |
| Sales, AM | 1 |
| Hacker, MAVB | 1 |
| Moraes, MO | 1 |
| Maia, RC | 1 |
| Sarno, EN | 1 |
| Illarramendi, X | 1 |
| Penna, GO | 1 |
| Bührer-Sékula, S | 1 |
| Kerr, LRS | 1 |
| Stefani, MMA | 1 |
| Rodrigues, LC | 1 |
| de Araújo, MG | 1 |
| Ramos, AMC | 1 |
| de Andrade, ARC | 1 |
| Costa, MB | 1 |
| Rosa, PS | 1 |
| Gonçalves, HS | 1 |
| Cruz, R | 1 |
| Barreto, ML | 1 |
| Pontes, MAA | 1 |
| Penna, MLF | 1 |
| Ahmad, N | 1 |
| Ahuja, SD | 1 |
| Akkerman, OW | 1 |
| Alffenaar, JC | 1 |
| Anderson, LF | 1 |
| Baghaei, P | 1 |
| Bang, D | 1 |
| Barry, PM | 1 |
| Bastos, ML | 1 |
| Behera, D | 1 |
| Benedetti, A | 1 |
| Bisson, GP | 1 |
| Boeree, MJ | 1 |
| Bonnet, M | 1 |
| Brode, SK | 1 |
| Brust, JCM | 1 |
| Cai, Y | 1 |
| Caumes, E | 1 |
| Cegielski, JP | 1 |
| Centis, R | 1 |
| Chan, PC | 1 |
| Chan, ED | 1 |
| Chang, KC | 1 |
| Charles, M | 1 |
| Cirule, A | 1 |
| Dalcolmo, MP | 1 |
| D'Ambrosio, L | 1 |
| de Vries, G | 1 |
| Dheda, K | 1 |
| Esmail, A | 1 |
| Flood, J | 1 |
| Fox, GJ | 1 |
| Fréchet-Jachym, M | 1 |
| Fregona, G | 1 |
| Gayoso, R | 1 |
| Gegia, M | 1 |
| Gler, MT | 1 |
| Gu, S | 1 |
| Guglielmetti, L | 1 |
| Holtz, TH | 1 |
| Hughes, J | 1 |
| Isaakidis, P | 1 |
| Jarlsberg, L | 1 |
| Kempker, RR | 1 |
| Keshavjee, S | 1 |
| Khan, FA | 1 |
| Kipiani, M | 1 |
| Koenig, SP | 1 |
| Koh, WJ | 1 |
| Kritski, A | 1 |
| Kuksa, L | 1 |
| Kvasnovsky, CL | 1 |
| Kwak, N | 1 |
| Lan, Z | 1 |
| Lange, C | 1 |
| Laniado-Laborín, R | 1 |
| Lee, M | 1 |
| Leimane, V | 1 |
| Leung, CC | 1 |
| Leung, EC | 1 |
| Li, PZ | 1 |
| Lowenthal, P | 1 |
| Maciel, EL | 1 |
| Marks, SM | 1 |
| Mase, S | 1 |
| Mbuagbaw, L | 1 |
| Migliori, GB | 1 |
| Milanov, V | 1 |
| Miller, AC | 1 |
| Mitnick, CD | 1 |
| Modongo, C | 1 |
| Mohr, E | 1 |
| Monedero, I | 1 |
| Nahid, P | 1 |
| Ndjeka, N | 1 |
| O'Donnell, MR | 1 |
| Padayatchi, N | 1 |
| Palmero, D | 1 |
| Pape, JW | 1 |
| Podewils, LJ | 1 |
| Reynolds, I | 1 |
| Riekstina, V | 1 |
| Robert, J | 1 |
| Rodriguez, M | 1 |
| Seaworth, B | 1 |
| Seung, KJ | 1 |
| Schnippel, K | 1 |
| Shim, TS | 1 |
| Singla, R | 1 |
| Smith, SE | 1 |
| Sotgiu, G | 1 |
| Sukhbaatar, G | 1 |
| Tabarsi, P | 1 |
| Tiberi, S | 1 |
| Trajman, A | 1 |
| Trieu, L | 1 |
| Udwadia, ZF | 1 |
| van der Werf, TS | 1 |
| Veziris, N | 1 |
| Viiklepp, P | 1 |
| Vilbrun, SC | 1 |
| Walsh, K | 1 |
| Westenhouse, J | 1 |
| Yew, WW | 1 |
| Yim, JJ | 1 |
| Zetola, NM | 1 |
| Zignol, M | 1 |
| Menzies, D | 1 |
| Grosset, JH | 1 |
| Tyagi, S | 1 |
| Almeida, DV | 1 |
| Converse, PJ | 1 |
| Li, SY | 1 |
| Ammerman, NC | 1 |
| Bishai, WR | 1 |
| Enarson, D | 1 |
| Trébucq, A | 1 |
| Patton, PH | 1 |
| Parker, CE | 1 |
| MacDonald, JK | 1 |
| Chande, N | 1 |
| Maghanoy, A | 1 |
| Mallari, I | 1 |
| Balagon, M | 2 |
| Saunderson, P | 1 |
| Saunderson, PR | 1 |
| Gelber, RH | 1 |
| Pattyn, S | 1 |
| Grillone, S | 1 |
| Murray, CK | 1 |
| Joyce, MP | 1 |
| Longfield, RN | 1 |
| Schreuder, PA | 1 |
| Naafs, B | 1 |
| Norman, G | 1 |
| Joseph, G | 1 |
| Richard, J | 1 |
| Armour, KS | 1 |
| Scolyer, RA | 1 |
| Barnetson, RS | 1 |
| Ho, CK | 1 |
| Lo, KK | 1 |
| Nenoff, P | 1 |
| Uhlemann, R | 1 |
| Grünewald, T | 1 |
| Nenning, H | 1 |
| Grunewald, S | 1 |
| Paasch, U | 1 |
| Levy, L | 1 |
| Mathur, NK | 1 |
| Bumb, RA | 1 |
| Mangal, HN | 1 |
| Bentley-Phillips, CB | 1 |
| Cooper, RC | 1 |
| Hallett, AF | 1 |
| Kemper, CA | 1 |
| Havlir, D | 1 |
| Bartok, AE | 1 |
| Kane, C | 1 |
| Camp, B | 1 |
| Lane, N | 1 |
| Deresinski, SC | 1 |
| Dautzenberg, B | 2 |
| Saint-Marc, T | 2 |
| Durant, J | 1 |
| Reynes, J | 1 |
| Meyohas, MC | 1 |
| Legrand, MF | 1 |
| Truffot, C | 1 |
| Chauvin, JP | 1 |
| Tacke, J | 1 |
| Diepgen, TL | 1 |
| Albrecht, HP | 1 |
| von den Driesch, P | 1 |
| Pattyn, SR | 2 |
| Ghys, P | 1 |
| Janssens, L | 1 |
| Tshilumba, K | 1 |
| Kuykens, L | 1 |
| Karibushi, N | 1 |
| Denis, P | 1 |
| Li, HY | 1 |
| Wollina, U | 1 |
| Karte, K | 1 |
| Geyer, A | 1 |
| Stuhlert, A | 1 |
| Bocker, T | 1 |
| de Carsalade, GY | 1 |
| Wallach, D | 2 |
| Spindler, E | 1 |
| Pennec, J | 2 |
| Cottenot, F | 2 |
| Flageul, B | 2 |
| May, T | 1 |
| Brel, F | 1 |
| Beuscart, C | 1 |
| Vincent, V | 1 |
| Perronne, C | 1 |
| Doco-Lecompte, T | 1 |
| Grosset, J | 1 |
| Shaw, IN | 2 |
| Ebenezer, G | 1 |
| Rao, GS | 2 |
| Natrajan, MM | 2 |
| Balasundaram, B | 1 |
| Riahi, I | 1 |
| Mokni, M | 1 |
| Haouet, S | 1 |
| Cherif, F | 1 |
| El Euch, D | 1 |
| Azaiz, MI | 1 |
| Zitouna, MM | 1 |
| Ben Osman-Dhahri, A | 1 |
| Jesudasan, K | 1 |
| Christian, M | 1 |
| Kavitha, M | 1 |
| Faber, WR | 1 |
| Leiker, DL | 2 |
| Ramu, G | 2 |
| Girdhar, A | 1 |
| Jacobson, RR | 1 |
| Trautman, JR | 1 |
| Iyer, CG | 1 |
| Ganapati, R | 1 |
| Dongre, VV | 1 |
| Becx-Bleumink, M | 1 |
| Blok, LM | 1 |
| Bloos, LJ | 1 |
| van den Berg, G | 1 |
| Afdhal, NH | 1 |
| Long, A | 1 |
| Lennon, J | 1 |
| Crowe, J | 1 |
| O'Donoghue, DP | 1 |
| Vignon-Pennamen, MD | 1 |
| Mensing, H | 1 |
| Ekambaram, V | 1 |
| Rao, MK | 1 |
| Rao, CK | 1 |
| Mittal, BN | 1 |
| Dharmshaktu, NS | 1 |
| Onsun, N | 1 |
| Saylan, T | 1 |
| Revill, WD | 1 |
| Morrow, RH | 1 |
| Pike, MC | 1 |
| Ateng, J | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Independent Study to Establish the Efficacy of the Six Doses Uniform MDT Regimen (U-MDT) for Leprosy Patients[NCT00669643] | Phase 4 | 859 participants (Actual) | Interventional | 2007-02-28 | Completed | ||
| Effect of Vitamin D3 Supplementation on Chronic Granulomatous Disease Patients With BCGosis/Itis[NCT03984890] | Phase 2/Phase 3 | 50 participants (Anticipated) | Interventional | 2019-08-01 | Recruiting | ||
| Beta-Lactam Containing Regimen for the Shortening of Buruli Ulcer Disease Therapy: Comparison of 8 Weeks Standard Therapy (Rifampicin Plus Clarithromycin) vs. 4 Weeks Standard Plus Amoxicillin/Clavulanate Therapy [RC8 vs. RCA4][NCT05169554] | Phase 2 | 140 participants (Anticipated) | Interventional | 2021-12-01 | Recruiting | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
4 reviews available for clofazimine and Recrudescence
| Article | Year |
|---|---|
Treatment correlates of successful outcomes in pulmonary multidrug-resistant tuberculosis: an individual patient data meta-analysis.
Topics: Amikacin; Antitubercular Agents; Capreomycin; Carbapenems; Clofazimine; Diarylquinolines; Drug Thera | 2018 |
Anti-tuberculous therapy for maintenance of remission in Crohn's disease.
Topics: Antitubercular Agents; Clarithromycin; Clofazimine; Crohn Disease; Ethambutol; Glucocorticoids; Huma | 2016 |
Evolution of the modern chemotherapy of leprosy.
Topics: Animals; Clofazimine; Dapsone; Drug Evaluation; Drug Evaluation, Preclinical; Drug Resistance, Micro | 1983 |
Relapses among leprosy patients treated with multidrug therapy: experience in the leprosy control program of the All Africa Leprosy and Rehabilitation Training Center (ALERT) in Ethiopia; practical difficulties with diagnosing relapses; operational proced
Topics: Clofazimine; Dapsone; Epidemiologic Methods; Ethiopia; Humans; Incidence; Leprostatic Agents; Lepros | 1992 |
11 trials available for clofazimine and Recrudescence
| Article | Year |
|---|---|
Uniform multidrug therapy for leprosy patients in Brazil (U-MDT/CT-BR): Results of an open label, randomized and controlled clinical trial, among multibacillary patients.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Brazil; Child; Child, Preschool; Clofazimine; Dapsone; D | 2017 |
Relapses in multibacillary patients treated with multi-drug therapy until smear negativity: findings after twenty years.
Topics: Acedapsone; Aged; Clofazimine; Dapsone; Drug Therapy, Combination; Female; Follow-Up Studies; Humans | 2004 |
Transient bacteremia due to Mycobacterium avium complex in patients with AIDS.
Topics: Adult; AIDS-Related Opportunistic Infections; Bacteremia; Clofazimine; Drug Therapy, Combination; Et | 1994 |
[Treatment with clarithromycin of 173 HIV+ patients with disseminated Mycobacterium avium intracellulare infection].
Topics: Adolescent; Adult; AIDS-Related Opportunistic Infections; Anti-Infective Agents; Antitubercular Agen | 1994 |
A randomized clinical trial of two single-dose treatments for paucibacillary leprosy.
Topics: Adolescent; Adult; Aged; Child; Child, Preschool; Clofazimine; Dapsone; Drug Administration Schedule | 1994 |
Daily multidrug therapy for leprosy; results of a fourteen-year experience.
Topics: Adolescent; Adult; Aged; Child; Child, Preschool; Clofazimine; Dapsone; Drug Resistance, Microbial; | 1997 |
Comparison of combination therapy regimens for treatment of human immunodeficiency virus-infected patients with disseminated bacteremia due to Mycobacterium avium. ANRS Trial 033 Curavium Group. Agence Nationale de Recherche sur le Sida.
Topics: Adult; AIDS-Related Opportunistic Infections; Bacteremia; Clarithromycin; Clofazimine; Drug Therapy, | 1997 |
Long-term follow up of multibacillary leprosy patients with high BI treated with WHO/MDT regimen for a fixed duration of two years.
Topics: Adult; Clofazimine; Cohort Studies; Dapsone; Drug Therapy, Combination; Female; Follow-Up Studies; H | 2000 |
Evaluation of treatment of lepromatous leprosy patients in the Netherlands.
Topics: Clinical Trials as Topic; Clofazimine; Dapsone; Drug Evaluation; Humans; Leprostatic Agents; Leprosy | 1979 |
Controlled trial of antimycobacterial therapy in Crohn's disease. Clofazimine versus placebo.
Topics: Adult; Clofazimine; Crohn Disease; Double-Blind Method; Drug Evaluation; Female; Humans; Male; Middl | 1991 |
A controlled trial of the treatment of Mycobacterium ulcerans infection with clofazimine.
Topics: Clinical Trials as Topic; Clofazimine; Culture Media; Drug Evaluation; Humans; Mycobacterium; Mycoba | 1973 |
30 other studies available for clofazimine and Recrudescence
| Article | Year |
|---|---|
TB47 and clofazimine form a highly synergistic sterilizing block in a second-line regimen for tuberculosis in mice.
Topics: Animals; Antitubercular Agents; Clofazimine; Disease Models, Animal; Drug Synergism; Female; Imidazo | 2020 |
Low rate of relapse after twelve-dose multidrug therapy for hansen's disease: A 20-year cohort study in a brazilian reference center.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Brazil; Child; Child, Preschool; Clofazimine; Dapsone; D | 2021 |
Assessment of clofazimine activity in a second-line regimen for tuberculosis in mice.
Topics: Animals; Antitubercular Agents; Clofazimine; Drug Resistance, Multiple, Bacterial; Female; Lung; Mic | 2013 |
Relapse study in smear positive multibacillary (MB) leprosy after 1 year WHO-multi-drug therapy (MDT) in Cebu, Philippines.
Topics: Adolescent; Adult; Aged; Child; Clofazimine; Dapsone; Drug Therapy, Combination; Female; Humans; Lep | 2011 |
Does clofazimine prevent erythema nodosum leprosum (ENL) in leprosy? A retrospective study, comparing the experience of multibacillary patients receiving either 12 or 24 months WHO-MDT.
Topics: Adolescent; Adult; Age Distribution; Aged; Child; Clofazimine; Drug Therapy, Combination; Erythema N | 2011 |
Relapse rates and a 10-year follow-up of a 6-week quadruple drug regimen for multibacillary leprosy.
Topics: Belgium; Clofazimine; Drug Administration Schedule; Drug Therapy, Combination; Follow-Up Studies; Hu | 2002 |
Short report: Treatment failure in Hansen's disease.
Topics: Adolescent; Adult; Aged; Child; Clofazimine; Dapsone; Drug Therapy, Combination; Female; Humans; Lep | 2003 |
Chronic recurrent ENL, steroid dependent: long-term treatment with high dose clofazimine.
Topics: Anti-Inflammatory Agents, Non-Steroidal; Chronic Disease; Clofazimine; Dose-Response Relationship, D | 2003 |
Borderline lepromatous leprosy presenting as a single cutaneous plaque.
Topics: Administration, Oral; Adult; Clofazimine; Dapsone; Drug Therapy, Combination; Forearm; Glucocorticoi | 2005 |
Epidemiology of leprosy and response to treatment in Hong Kong.
Topics: Clofazimine; Dapsone; Drug Resistance, Bacterial; Drug Therapy, Combination; Hong Kong; Humans; Inci | 2006 |
[Atypical mycobacteriosis of the skin caused by Mycobacterium abscessus in an immunocompetent woman].
Topics: Antitubercular Agents; Biopsy; Buruli Ulcer; Clofazimine; Drug Therapy, Combination; Female; Follow- | 2007 |
Oral zinc in recurrent Erythema Nodosum Leprosum reaction.
Topics: Administration, Oral; Adult; Clofazimine; Dapsone; Drug Therapy, Combination; Erythema Nodosum; Fema | 1983 |
Pharmacological modulation of neutrophil phagocytic function in a patient with recurrent sepsis, pyoderma gangrenosum and impaired phagocytosis.
Topics: Adrenal Cortex Hormones; Bacterial Infections; Clofazimine; Humans; In Vitro Techniques; Levamisole; | 1982 |
[Idiopathic pustular and bullous variants of Sweet syndrome].
Topics: Biopsy; Clofazimine; Diagnosis, Differential; Dose-Response Relationship, Drug; Drug Administration | 1994 |
Problems of leprosy relapse in China.
Topics: China; Clofazimine; Dapsone; Drug Therapy, Combination; Follow-Up Studies; Humans; Leprosy; Recurren | 1993 |
Clofazimine in inflammatory facial dermatosis--granuloma faciale and lipogranulomatosis subcutanea (Rothmann-Makai)
Topics: Adult; Anti-Inflammatory Agents, Non-Steroidal; Clofazimine; Disease Progression; Facial Dermatoses; | 1996 |
Relapse as histoid leprosy after receiving multidrug therapy (MDT); a report of three cases.
Topics: Acedapsone; Adolescent; Adult; Animals; Child; Clofazimine; Dapsone; Drug Resistance, Microbial; Dru | 2000 |
[Pyoderma gangrenosum. 15 cases].
Topics: Adolescent; Adult; Anti-Inflammatory Agents; Anti-Inflammatory Agents, Non-Steroidal; Child; Child, | 2001 |
Workshop on "chemotherapy of leprosy" at the Central Leprosy Teaching and Research Institute, Chengalpattu (Tamil Nadu) on 21 January 1978.
Topics: Clofazimine; Dapsone; Humans; India; Leprosy; Recurrence; Rifampin; Thalidomide | 1979 |
Treatment of steroid dependant cases of recurrent lepra reaction with a combination of thalidomide and clofazimine.
Topics: Adult; Clofazimine; Dapsone; Drug Therapy, Combination; Humans; Leprosy; Male; Recurrence; Steroids; | 1979 |
The diagnosis and treatment of leprosy.
Topics: Biopsy; Clofazimine; Dapsone; Erythema Nodosum; Humans; Immunotherapy; Leprosy; Recurrence; Rifampin | 1976 |
An open trial with clofazimine in the management of recurrent lepra reaction using thalidomide as a control drug.
Topics: Adolescent; Adult; Clofazimine; Humans; Leprosy; Male; Middle Aged; Recurrence; Thalidomide | 1976 |
Clinical trial with clofazimine in leprosy.
Topics: Adolescent; Adrenal Cortex Hormones; Adult; Child; Clofazimine; Dapsone; Drug Therapy, Combination; | 1976 |
A retrospective study on seven years of multiple drug treatment for paucibacillary and multibacillary leprosy, in Bayara General Hospital, Nigeria.
Topics: Adolescent; Adult; Clofazimine; Dapsone; Drug Administration Schedule; Drug Resistance, Microbial; D | 1991 |
[Late reversal reactions in leprosy].
Topics: Clofazimine; Dapsone; Drug Combinations; Ethionamide; Female; Humans; Leprosy; Male; Recurrence; Rif | 1990 |
[Clofazimine--therapeutic alternative in necrobiosis lipoidica and granuloma anulare].
Topics: Administration, Oral; Adult; Clofazimine; Drug Administration Schedule; Female; Granuloma; Humans; M | 1989 |
Changing picture of leprosy in North Arcot District, Tamil Nadu after M.D.T.
Topics: Clofazimine; Cohort Studies; Dapsone; Drug Therapy, Combination; Follow-Up Studies; Humans; India; L | 1989 |
Leprosy control based on multi drug treatment in India.
Topics: Allied Health Personnel; Clofazimine; Dapsone; Data Collection; Drug Administration Schedule; Drug T | 1988 |
Combined chemotherapy of multibacillary leprosy of 6 months' duration.
Topics: Adolescent; Adult; Child; Child, Preschool; Clofazimine; Dapsone; Drug Therapy, Combination; Female; | 1986 |
Preliminary results of treatment of leprosy patients in The Netherlands with daily rifampicin, dapsone and clofazimine.
Topics: Clofazimine; Dapsone; Drug Therapy, Combination; Humans; Leprosy; Netherlands; Recurrence; Rifampin | 1986 |