clofazimine has been researched along with Pulmonary Consumption in 29 studies
Clofazimine: A fat-soluble riminophenazine dye used for the treatment of leprosy. It has been used investigationally in combination with other antimycobacterial drugs to treat Mycobacterium avium infections in AIDS patients. Clofazimine also has a marked anti-inflammatory effect and is given to control the leprosy reaction, erythema nodosum leprosum. (From AMA Drug Evaluations Annual, 1993, p1619)
clofazimine : 3-Isopropylimino-3,5-dihydro-phenazine in which the hydrogen at position 5 is substituted substituted by a 4-chlorophenyl group, and that at position 2 is substituted by a (4-chlorophenyl)amino group. A dark red crystalline solid, clofazimine is an antimycobacterial and is one of the main drugs used for the treatment of multi-bacillary leprosy. However, it can cause red/brown discolouration of the skin, so other treatments are often preferred in light-skinned patients.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Clofazimine (Cfz) has shown activity against Mycobacterium tuberculosis, including multidrug-resistant (MDR) strains in vitro and in animal studies." | 2.80 | Clofazimine for the treatment of multidrug-resistant tuberculosis: prospective, multicenter, randomized controlled study in China. ( Gu, J; Hao, X; Li, F; Li, M; Liu, G; Liu, Y; Sun, H; Tang, S; Wang, X; Wu, M; Yao, L; Zeng, L; Zhang, Z; Zhu, Y, 2015) |
| " Tolerance to the drugs was generally good, apart from three cases of hepatic disturbances and three cases of ototoxicity, which required a decrease in clarithromycin dosage after a short interruption of treatment." | 2.69 | Clarithromycin with minocycline and clofazimine for Mycobacterium avium intracellulare complex lung disease in patients without the acquired immune deficiency syndrome. GETIM. Groupe d'Etude et de Traitement des Infections à Mycobactéries. ( Igual, J; Roussel, G, 1998) |
| " These drugs are associated with numerous adverse events that can cause severe morbidity, such as deafness, and in some instances can lead to death." | 2.66 | Drug-associated adverse events in the treatment of multidrug-resistant tuberculosis: an individual patient data meta-analysis. ( Ahmad, N; Baghaei, P; Barkane, L; Benedetti, A; Brode, SK; Brust, JCM; Campbell, JR; Chang, VWL; Falzon, D; Guglielmetti, L; Isaakidis, P; Kempker, RR; Kipiani, M; Kuksa, L; Lan, Z; Lange, C; Laniado-Laborín, R; Menzies, D; Nahid, P; Rodrigues, D; Singla, R; Udwadia, ZF, 2020) |
| "Clofazimine was widely distributed with a long elimination half-life." | 1.56 | Clofazimine pharmacokinetics in patients with TB: dosing implications. ( Abdelwahab, MT; Brust, JCM; Dawson, R; Denti, P; Diacon, A; Everitt, D; Gandhi, NR; Maartens, G; Meintjes, G; Svensson, EM; Wasserman, S; Wiesner, L, 2020) |
| "This features mimic Gitelman's syndrome which is an autosomal recessive disorder affecting kidneys causing electrolyte disturbances." | 1.56 | Gitelman-like syndrome: A rare complication of using aminoglycosides in tuberculosis - A case report. ( E R, V; Keny, S; Lawande, D; Parrikar, A, 2020) |
| "Bedaquiline (BDQ) was approved for treatment of drug resistant TB (DR-TB) under Conditional Access Programme (CAP) of Revised National Tuberculosis Control Programme (RNTCP) and was also implemented in the National Institute of TB and Respiratory Diseases (NITRD)." | 1.51 | Initial experience of bedaquiline implementation under the National TB Programme at NITRD, Delhi, India. ( Khalid, UK; Kumar Verma, A; Mathuria, KK; Munjal, S; Myneedu, VP; Puri, MM; Sarin, R; Singla, N; Singla, R; Vohra, V, 2019) |
| "Clofazimine (CFZ) is a promising candidate drug for use in the management of multidrug-resistant tuberculosis (MDR-TB) patients." | 1.51 | Synergistic activities of clofazimine with moxifloxacin or capreomycin against Mycobacterium tuberculosis in China. ( Jiang, Y; Li, G; Li, M; Liu, H; Liu, Z; Wan, K; Wang, R; Xu, D; Xu, Z; Zhao, LL; Zhao, X, 2019) |
| "Mice treated with clofazimine were culture-negative after 5 months, whereas all mice treated without clofazimine remained heavily culture-positive for the entire 9 months of the study." | 1.39 | Assessment of clofazimine activity in a second-line regimen for tuberculosis in mice. ( Almeida, DV; Ammerman, NC; Bishai, WR; Converse, PJ; Enarson, D; Grosset, JH; Li, SY; Trébucq, A; Tyagi, S, 2013) |
| "Clofazimine has shown activity against Mycobacterium tuberculosis, including multidrug-resistant strains in vitro and in animal studies." | 1.38 | Clofazimine in the treatment of multidrug-resistant tuberculosis. ( Jiang, RH; Xiao, HP; Xu, HB, 2012) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 1 (3.45) | 18.7374 |
| 1990's | 6 (20.69) | 18.2507 |
| 2000's | 1 (3.45) | 29.6817 |
| 2010's | 14 (48.28) | 24.3611 |
| 2020's | 7 (24.14) | 2.80 |
| Authors | Studies |
|---|---|
| Heysell, SK | 1 |
| Mpagama, SG | 1 |
| Ogarkov, OB | 1 |
| Conaway, M | 1 |
| Ahmed, S | 1 |
| Zhdanova, S | 1 |
| Pholwat, S | 1 |
| Alshaer, MH | 1 |
| Chongolo, AM | 1 |
| Mujaga, B | 1 |
| Sariko, M | 1 |
| Saba, S | 1 |
| Rahman, SMM | 1 |
| Uddin, MKM | 1 |
| Suzdalnitsky, A | 1 |
| Moiseeva, E | 1 |
| Zorkaltseva, E | 1 |
| Koshcheyev, M | 1 |
| Vitko, S | 1 |
| Mmbaga, BT | 1 |
| Kibiki, GS | 1 |
| Pasipanodya, JG | 1 |
| Peloquin, CA | 1 |
| Banu, S | 1 |
| Houpt, ER | 1 |
| Van Deun, A | 2 |
| Decroo, T | 1 |
| Tahseen, S | 1 |
| Trébucq, A | 2 |
| Schwoebel, V | 1 |
| Ortuno-Gutierrez, N | 1 |
| de Jong, BC | 1 |
| Rieder, HL | 1 |
| Piubello, A | 1 |
| Chiang, CY | 2 |
| Lan, Z | 2 |
| Ahmad, N | 2 |
| Baghaei, P | 2 |
| Barkane, L | 1 |
| Benedetti, A | 2 |
| Brode, SK | 2 |
| Brust, JCM | 3 |
| Campbell, JR | 1 |
| Chang, VWL | 1 |
| Falzon, D | 1 |
| Guglielmetti, L | 2 |
| Isaakidis, P | 2 |
| Kempker, RR | 2 |
| Kipiani, M | 2 |
| Kuksa, L | 2 |
| Lange, C | 2 |
| Laniado-Laborín, R | 2 |
| Nahid, P | 2 |
| Rodrigues, D | 1 |
| Singla, R | 3 |
| Udwadia, ZF | 2 |
| Menzies, D | 2 |
| Ahmad, S | 1 |
| Bhattacharya, D | 1 |
| Gupta, N | 1 |
| Rawat, V | 1 |
| Tousif, S | 1 |
| Van Kaer, L | 2 |
| Das, G | 2 |
| Abdelwahab, MT | 1 |
| Wasserman, S | 1 |
| Gandhi, NR | 1 |
| Meintjes, G | 1 |
| Everitt, D | 1 |
| Diacon, A | 1 |
| Dawson, R | 1 |
| Wiesner, L | 1 |
| Svensson, EM | 1 |
| Maartens, G | 1 |
| Denti, P | 1 |
| Saroha, D | 1 |
| Garg, D | 1 |
| Singh, AK | 1 |
| Dhamija, RK | 1 |
| E R, V | 1 |
| Parrikar, A | 1 |
| Keny, S | 1 |
| Lawande, D | 1 |
| Bouzid, F | 1 |
| Astier, H | 1 |
| Osman, DA | 1 |
| Javelle, E | 1 |
| Hassan, MO | 1 |
| Simon, F | 1 |
| Garnotel, E | 1 |
| Drancourt, M | 1 |
| Ahuja, SD | 1 |
| Akkerman, OW | 1 |
| Alffenaar, JC | 1 |
| Anderson, LF | 1 |
| Bang, D | 1 |
| Barry, PM | 1 |
| Bastos, ML | 1 |
| Behera, D | 1 |
| Bisson, GP | 1 |
| Boeree, MJ | 1 |
| Bonnet, M | 1 |
| Cai, Y | 1 |
| Caumes, E | 1 |
| Cegielski, JP | 1 |
| Centis, R | 1 |
| Chan, PC | 1 |
| Chan, ED | 1 |
| Chang, KC | 1 |
| Charles, M | 1 |
| Cirule, A | 1 |
| Dalcolmo, MP | 1 |
| D'Ambrosio, L | 1 |
| de Vries, G | 1 |
| Dheda, K | 1 |
| Esmail, A | 1 |
| Flood, J | 1 |
| Fox, GJ | 1 |
| Fréchet-Jachym, M | 1 |
| Fregona, G | 1 |
| Gayoso, R | 1 |
| Gegia, M | 1 |
| Gler, MT | 1 |
| Gu, S | 1 |
| Holtz, TH | 1 |
| Hughes, J | 1 |
| Jarlsberg, L | 1 |
| Keshavjee, S | 1 |
| Khan, FA | 1 |
| Koenig, SP | 1 |
| Koh, WJ | 1 |
| Kritski, A | 1 |
| Kvasnovsky, CL | 1 |
| Kwak, N | 1 |
| Lee, M | 1 |
| Leimane, V | 1 |
| Leung, CC | 1 |
| Leung, EC | 1 |
| Li, PZ | 1 |
| Lowenthal, P | 1 |
| Maciel, EL | 1 |
| Marks, SM | 1 |
| Mase, S | 1 |
| Mbuagbaw, L | 1 |
| Migliori, GB | 1 |
| Milanov, V | 1 |
| Miller, AC | 1 |
| Mitnick, CD | 1 |
| Modongo, C | 1 |
| Mohr, E | 1 |
| Monedero, I | 1 |
| Ndjeka, N | 1 |
| O'Donnell, MR | 1 |
| Padayatchi, N | 1 |
| Palmero, D | 1 |
| Pape, JW | 1 |
| Podewils, LJ | 1 |
| Reynolds, I | 1 |
| Riekstina, V | 1 |
| Robert, J | 1 |
| Rodriguez, M | 1 |
| Seaworth, B | 1 |
| Seung, KJ | 1 |
| Schnippel, K | 1 |
| Shim, TS | 1 |
| Smith, SE | 1 |
| Sotgiu, G | 1 |
| Sukhbaatar, G | 1 |
| Tabarsi, P | 1 |
| Tiberi, S | 1 |
| Trajman, A | 1 |
| Trieu, L | 1 |
| van der Werf, TS | 2 |
| Veziris, N | 1 |
| Viiklepp, P | 1 |
| Vilbrun, SC | 1 |
| Walsh, K | 1 |
| Westenhouse, J | 1 |
| Yew, WW | 1 |
| Yim, JJ | 1 |
| Zetola, NM | 1 |
| Zignol, M | 1 |
| Sarin, R | 1 |
| Singla, N | 1 |
| Vohra, V | 1 |
| Puri, MM | 1 |
| Munjal, S | 1 |
| Khalid, UK | 1 |
| Myneedu, VP | 1 |
| Kumar Verma, A | 1 |
| Mathuria, KK | 1 |
| Li, G | 1 |
| Xu, Z | 1 |
| Jiang, Y | 1 |
| Liu, H | 1 |
| Zhao, LL | 1 |
| Li, M | 2 |
| Xu, D | 1 |
| Zhao, X | 1 |
| Liu, Z | 1 |
| Wang, R | 1 |
| Wan, K | 1 |
| Grosset, JH | 2 |
| Tyagi, S | 1 |
| Almeida, DV | 2 |
| Converse, PJ | 1 |
| Li, SY | 1 |
| Ammerman, NC | 2 |
| Bishai, WR | 2 |
| Enarson, D | 1 |
| Nunn, AJ | 1 |
| Rusen, ID | 1 |
| Torrea, G | 1 |
| Phillips, PP | 1 |
| Squire, SB | 1 |
| Madan, J | 1 |
| Meredith, SK | 1 |
| Tang, S | 1 |
| Yao, L | 1 |
| Hao, X | 1 |
| Liu, Y | 1 |
| Zeng, L | 1 |
| Liu, G | 1 |
| Li, F | 1 |
| Wu, M | 1 |
| Zhu, Y | 1 |
| Sun, H | 1 |
| Gu, J | 1 |
| Wang, X | 1 |
| Zhang, Z | 1 |
| Markowitz, N | 1 |
| Agarwal, U | 1 |
| Baxa, D | 1 |
| Singh, DK | 1 |
| Dwivedi, VP | 1 |
| Ranganathan, A | 1 |
| McNaughton, A | 1 |
| Blackmore, T | 1 |
| McNaughton, H | 1 |
| Swanson, RV | 1 |
| Tapley, A | 1 |
| Moodley, C | 1 |
| Ngcobo, B | 1 |
| Adamson, J | 1 |
| Dorasamy, A | 1 |
| Moodley, S | 1 |
| Mgaga, Z | 1 |
| Bester, LA | 1 |
| Singh, SD | 1 |
| Bolhuis, MS | 1 |
| van Altena, R | 1 |
| Uges, DR | 1 |
| Kosterink, JG | 1 |
| Alffenaar, JW | 1 |
| Xu, HB | 1 |
| Jiang, RH | 1 |
| Xiao, HP | 1 |
| Xu, J | 1 |
| Lu, Y | 1 |
| Fu, L | 1 |
| Zhu, H | 1 |
| Wang, B | 1 |
| Mdluli, K | 1 |
| Upton, AM | 1 |
| Jin, H | 1 |
| Zheng, M | 1 |
| Zhao, W | 1 |
| Li, P | 1 |
| Alves-Rodrigues, EN | 1 |
| Ribeiro, LC | 1 |
| Silva, MD | 1 |
| Takiuchi, A | 1 |
| Rabel-Filho, OC | 1 |
| Martini-Filho, D | 1 |
| Fontes, CJ | 1 |
| Webster, AD | 1 |
| Goolamali, SK | 1 |
| Michałowska-Mitczuk, D | 1 |
| Shah, A | 1 |
| Bhagat, R | 1 |
| Panchal, N | 1 |
| Fisher, M | 1 |
| Tomlinson, DR | 1 |
| Coker, RJ | 1 |
| Roussel, G | 1 |
| Igual, J | 1 |
| Rastogi, N | 1 |
| Ross, BC | 1 |
| Dwyer, B | 1 |
| Goh, KS | 1 |
| Clavel-Sérès, S | 1 |
| Jeantils, V | 1 |
| Cruaud, P | 1 |
| O'Brien, RJ | 1 |
| Geiter, LJ | 1 |
| Lyle, MA | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Effect of Vitamin D3 Supplementation on Chronic Granulomatous Disease Patients With BCGosis/Itis[NCT03984890] | Phase 2/Phase 3 | 50 participants (Anticipated) | Interventional | 2019-08-01 | Recruiting | ||
| Pharmacometrics to Advance Novel Regimens for Drug-resistant Tuberculosis[NCT03827811] | 625 participants (Anticipated) | Observational | 2020-01-30 | Recruiting | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
3 reviews available for clofazimine and Pulmonary Consumption
| Article | Year |
|---|---|
Drug-associated adverse events in the treatment of multidrug-resistant tuberculosis: an individual patient data meta-analysis.
Topics: Adult; Aminosalicylic Acid; Antitubercular Agents; Canada; Clofazimine; Diarylquinolines; Drug-Relat | 2020 |
Treatment correlates of successful outcomes in pulmonary multidrug-resistant tuberculosis: an individual patient data meta-analysis.
Topics: Amikacin; Antitubercular Agents; Capreomycin; Carbapenems; Clofazimine; Diarylquinolines; Drug Thera | 2018 |
[Patients with chronic sputum positive tuberculosis-a therapeutic problem].
Topics: Amikacin; Amoxicillin; Antitubercular Agents; Chronic Disease; Clarithromycin; Clofazimine; Humans; | 1995 |
4 trials available for clofazimine and Pulmonary Consumption
| Article | Year |
|---|---|
Evaluation of a standardized treatment regimen of anti-tuberculosis drugs for patients with multi-drug-resistant tuberculosis (STREAM): study protocol for a randomized controlled trial.
Topics: Antitubercular Agents; Bangladesh; Clinical Protocols; Clofazimine; Drug Administration Schedule; Dr | 2014 |
Clofazimine for the treatment of multidrug-resistant tuberculosis: prospective, multicenter, randomized controlled study in China.
Topics: Adolescent; Adult; Antitubercular Agents; China; Clofazimine; Female; Humans; Male; Microbial Sensit | 2015 |
Clarithromycin with minocycline and clofazimine for Mycobacterium avium intracellulare complex lung disease in patients without the acquired immune deficiency syndrome. GETIM. Groupe d'Etude et de Traitement des Infections à Mycobactéries.
Topics: Adult; Aged; Anti-Bacterial Agents; Clarithromycin; Clofazimine; Drug Administration Schedule; Drug | 1998 |
Rifabutin (ansamycin LM427) for the treatment of pulmonary Mycobacterium avium complex.
Topics: Adolescent; Adult; Age Factors; Aged; Aged, 80 and over; Antitubercular Agents; Clofazimine; Cyclose | 1990 |
22 other studies available for clofazimine and Pulmonary Consumption
| Article | Year |
|---|---|
Pharmacokinetic-Pharmacodynamic Determinants of Clinical Outcomes for Rifampin-Resistant Tuberculosis: A Multisite Prospective Cohort Study.
Topics: Adult; Antitubercular Agents; Clofazimine; Humans; Microbial Sensitivity Tests; Mycobacterium tuberc | 2023 |
World Health Organization 2018 treatment guidelines for rifampicin-resistant tuberculosis: uncertainty, potential risks and the way forward.
Topics: Antitubercular Agents; Clofazimine; Diarylquinolines; Humans; Linezolid; Mycobacterium tuberculosis; | 2020 |
Clofazimine enhances the efficacy of BCG revaccination via stem cell-like memory T cells.
Topics: Animals; BCG Vaccine; Clofazimine; Drug Therapy, Combination; Female; Immunization, Secondary; Immun | 2020 |
Clofazimine pharmacokinetics in patients with TB: dosing implications.
Topics: Antitubercular Agents; Chromatography, Liquid; Clofazimine; Female; Humans; Tandem Mass Spectrometry | 2020 |
Irreversible neuropathy in extremely-drug resistant tuberculosis: An unfortunate clinical conundrum.
Topics: Adult; Aminosalicylic Acid; Antitubercular Agents; Clofazimine; Cycloserine; Deprescriptions; Diaryl | 2020 |
Gitelman-like syndrome: A rare complication of using aminoglycosides in tuberculosis - A case report.
Topics: Alkalosis; Antitubercular Agents; Capreomycin; Clofazimine; Cycloserine; Deprescriptions; Ethionamid | 2020 |
Extended spectrum of antibiotic susceptibility for tuberculosis, Djibouti.
Topics: Adult; Antitubercular Agents; Chloramphenicol; Clofazimine; Djibouti; Female; Humans; Male; Microbia | 2018 |
Initial experience of bedaquiline implementation under the National TB Programme at NITRD, Delhi, India.
Topics: Adult; Antitubercular Agents; Cardiotoxicity; Clofazimine; Cycloserine; Diarylquinolines; Drug Thera | 2019 |
Synergistic activities of clofazimine with moxifloxacin or capreomycin against Mycobacterium tuberculosis in China.
Topics: Antitubercular Agents; Capreomycin; China; Clofazimine; Drug Synergism; Drug Therapy, Combination; H | 2019 |
Assessment of clofazimine activity in a second-line regimen for tuberculosis in mice.
Topics: Animals; Antitubercular Agents; Clofazimine; Drug Resistance, Multiple, Bacterial; Female; Lung; Mic | 2013 |
Hypothesis: Can clofazimine prevent IRIS in HIV/TB co-infected individuals?
Topics: Anti-Inflammatory Agents; Anti-Retroviral Agents; Antitubercular Agents; Clofazimine; Coinfection; H | 2014 |
Blockade of the Kv1.3 K+ Channel Enhances BCG Vaccine Efficacy by Expanding Central Memory T Lymphocytes.
Topics: Adjuvants, Immunologic; Animals; BCG Vaccine; CD4-Positive T-Lymphocytes; Clofazimine; Immunologic M | 2016 |
Comprehensive cost of treating one patient with MDR/pre-XDR-TB in Wellington, New Zealand.
Topics: Adult; Amikacin; Aminosalicylic Acid; Anti-Bacterial Agents; Antitubercular Agents; Bronchoscopy; Cl | 2016 |
Clofazimine has delayed antimicrobial activity against Mycobacterium tuberculosis both in vitro and in vivo.
Topics: Animals; Antitubercular Agents; Bacterial Load; Clofazimine; Isoniazid; Lung; Mice; Mice, Inbred BAL | 2017 |
Clarithromycin significantly increases linezolid serum concentrations.
Topics: Acetamides; Adult; Chromatography, Liquid; Clarithromycin; Clofazimine; Cycloserine; Drug Interactio | 2010 |
Clofazimine in the treatment of multidrug-resistant tuberculosis.
Topics: Adult; Animals; Antitubercular Agents; China; Clofazimine; Drug Resistance, Multiple, Bacterial; Dru | 2012 |
In vitro and in vivo activity of clofazimine against Mycobacterium tuberculosis persisters.
Topics: Animals; Antitubercular Agents; Aza Compounds; Chronic Disease; Clofazimine; Disease Models, Animal; | 2012 |
Renal hypersensitivity vasculitis associated with dapsone.
Topics: Adult; Anti-Bacterial Agents; Antitubercular Agents; Clofazimine; Cyclophosphamide; Dapsone; Drug Hy | 2005 |
BCG'osis.
Topics: BCG Vaccine; Child, Preschool; Clofazimine; Female; Humans; Tuberculosis, Pulmonary | 1981 |
Resistant tuberculosis: successful treatment with amikacin, ofloxacin, clofazimine, and pas.
Topics: Adult; Amikacin; Aminosalicylic Acid; Antitubercular Agents; Clofazimine; Drug Resistance, Microbial | 1993 |
The management of mycobacterial infections in HIV seropositive individuals. Jefferiss Wing Therapeutics and Protocols Group.
Topics: Adrenal Cortex Hormones; Amikacin; Anti-Bacterial Agents; Anti-Infective Agents; Antibiotics, Antitu | 1996 |
Emergence during unsuccessful chemotherapy of multiple drug resistance in a strain of Mycobacterium tuberculosis.
Topics: Adult; Anti-Bacterial Agents; Anti-Infective Agents; Antibiotics, Antitubercular; Antitubercular Age | 1992 |