amodiaquine has been researched along with Schistosomiasis haematobia in 2 studies
Amodiaquine: A 4-aminoquinoline compound with anti-inflammatory properties.
amodiaquine : A quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position.
Schistosomiasis haematobia: A human disease caused by the infection of parasitic worms SCHISTOSOMA HAEMATOBIUM. It is endemic in AFRICA and parts of the MIDDLE EAST. Tissue damages most often occur in the URINARY TRACT, specifically the URINARY BLADDER.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Antimalarial treatments with artesunate-pyronaridine and artemether-lumefantrine reduced the excretion of S." | 5.51 | Effectiveness of antimalarial drug combinations in treating concomitant urogenital schistosomiasis in malaria patients in Lambaréné, Gabon: A non-randomised event-monitoring study. ( Adegnika, AA; Akinosho, MA; Davi, SD; Dimessa-Mbadinga, LB; Handrich, C; Kreidenweiss, A; Kremsner, PG; Lell, B; Mombo-Ngoma, G; Ndzebe-Ndoumba, WF; Nordmann, T; Okwu, DG; Ramharter, M; Stelzl, D; Veletzky, L; Zoleko-Manego, R, 2022) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 0 (0.00) | 18.2507 |
| 2000's | 1 (50.00) | 29.6817 |
| 2010's | 0 (0.00) | 24.3611 |
| 2020's | 1 (50.00) | 2.80 |
| Authors | Studies |
|---|---|
| Zoleko-Manego, R | 1 |
| Okwu, DG | 1 |
| Handrich, C | 1 |
| Dimessa-Mbadinga, LB | 1 |
| Akinosho, MA | 1 |
| Ndzebe-Ndoumba, WF | 1 |
| Davi, SD | 1 |
| Stelzl, D | 1 |
| Veletzky, L | 1 |
| Kreidenweiss, A | 1 |
| Nordmann, T | 1 |
| Adegnika, AA | 1 |
| Lell, B | 1 |
| Kremsner, PG | 1 |
| Ramharter, M | 1 |
| Mombo-Ngoma, G | 1 |
| Boulanger, D | 1 |
| Dieng, Y | 1 |
| Cisse, B | 1 |
| Remoue, F | 1 |
| Capuano, F | 1 |
| Dieme, JL | 1 |
| Ndiaye, T | 1 |
| Sokhna, C | 1 |
| Trape, JF | 1 |
| Greenwood, B | 1 |
| Simondon, F | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Evaluation of the Effect of Artemisinin-based Combination Therapies on Urinary Schistosoma Haematobium When Administered for the Treatment of Malaria Co-infection[NCT04264130] | Phase 2 | 54 participants (Actual) | Interventional | 2018-07-31 | Completed | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
2 trials available for amodiaquine and Schistosomiasis haematobia
| Article | Year |
|---|---|
Effectiveness of antimalarial drug combinations in treating concomitant urogenital schistosomiasis in malaria patients in Lambaréné, Gabon: A non-randomised event-monitoring study.
Topics: Amodiaquine; Antimalarials; Artemether; Artemether, Lumefantrine Drug Combination; Artesunate; Drug | 2022 |
Antischistosomal efficacy of artesunate combination therapies administered as curative treatments for malaria attacks.
Topics: Amodiaquine; Animals; Anthelmintics; Antimalarials; Artemisinins; Artesunate; Child; Child, Preschoo | 2007 |