amodiaquine has been researched along with Schistosoma haematobia Infection in 2 studies
Amodiaquine: A 4-aminoquinoline compound with anti-inflammatory properties.
amodiaquine : A quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Antimalarial treatments with artesunate-pyronaridine and artemether-lumefantrine reduced the excretion of S." | 5.51 | Effectiveness of antimalarial drug combinations in treating concomitant urogenital schistosomiasis in malaria patients in Lambaréné, Gabon: A non-randomised event-monitoring study. ( Adegnika, AA; Akinosho, MA; Davi, SD; Dimessa-Mbadinga, LB; Handrich, C; Kreidenweiss, A; Kremsner, PG; Lell, B; Mombo-Ngoma, G; Ndzebe-Ndoumba, WF; Nordmann, T; Okwu, DG; Ramharter, M; Stelzl, D; Veletzky, L; Zoleko-Manego, R, 2022) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 0 (0.00) | 18.2507 |
| 2000's | 1 (50.00) | 29.6817 |
| 2010's | 0 (0.00) | 24.3611 |
| 2020's | 1 (50.00) | 2.80 |
| Authors | Studies |
|---|---|
| Zoleko-Manego, R | 1 |
| Okwu, DG | 1 |
| Handrich, C | 1 |
| Dimessa-Mbadinga, LB | 1 |
| Akinosho, MA | 1 |
| Ndzebe-Ndoumba, WF | 1 |
| Davi, SD | 1 |
| Stelzl, D | 1 |
| Veletzky, L | 1 |
| Kreidenweiss, A | 1 |
| Nordmann, T | 1 |
| Adegnika, AA | 1 |
| Lell, B | 1 |
| Kremsner, PG | 1 |
| Ramharter, M | 1 |
| Mombo-Ngoma, G | 1 |
| Boulanger, D | 1 |
| Dieng, Y | 1 |
| Cisse, B | 1 |
| Remoue, F | 1 |
| Capuano, F | 1 |
| Dieme, JL | 1 |
| Ndiaye, T | 1 |
| Sokhna, C | 1 |
| Trape, JF | 1 |
| Greenwood, B | 1 |
| Simondon, F | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Evaluation of the Effect of Artemisinin-based Combination Therapies on Urinary Schistosoma Haematobium When Administered for the Treatment of Malaria Co-infection[NCT04264130] | Phase 2 | 54 participants (Actual) | Interventional | 2018-07-31 | Completed | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
2 trials available for amodiaquine and Schistosoma haematobia Infection
| Article | Year |
|---|---|
Effectiveness of antimalarial drug combinations in treating concomitant urogenital schistosomiasis in malaria patients in Lambaréné, Gabon: A non-randomised event-monitoring study.
Topics: Amodiaquine; Antimalarials; Artemether; Artemether, Lumefantrine Drug Combination; Artesunate; Drug | 2022 |
Antischistosomal efficacy of artesunate combination therapies administered as curative treatments for malaria attacks.
Topics: Amodiaquine; Animals; Anthelmintics; Antimalarials; Artemisinins; Artesunate; Child; Child, Preschoo | 2007 |