albendazole has been researched along with Cystic Echinococcosis in 820 studies
| Excerpt | Relevance | Reference |
|---|---|---|
| "We aimed to evaluate the effectiveness of nitazoxanide in disseminated cystic echinococcosis (DCE) that failed to respond to surgical and antiparasitic therapy." | 10.25 | Evaluation of nitazoxanide for the treatment of disseminated cystic echinococcosis: report of five cases and literature review. ( Ayala, AP; Díaz-Menéndez, M; Gallego, JI; López-Vélez, R; Monge-Maillo, B; Norman, F; Pérez-Molina, JA, 2011) |
| "To explore and compare the clinical effect and safety of liposomal albendazole (L-ABZ) and tablet-albendazole (T-ABZ) in the treatment of cystic echinococcosis (CE1, CE2, and CE3)." | 9.15 | [Clinical effect and safety of liposomal-albendazole and tablet-albendazole for the treatment of human cystic echinococcosis]. ( Ayifuhan, A; Li, HT; Ran, B; Shan, JY; Shao, YM; Tuergan, A; Wen, H, 2011) |
| "5 mg/kg dose of albendazole (Abz) in tablet form (AbzT) followed 2 weeks later by an equivalent dose of Abz emulsified in 30% soybean oil (AbzE) was administered orally 2 h after the first morning meal to 7 male adult patients with cystic echinococcosis caused by Echinococcus granulosus." | 9.10 | Albendazole-soybean oil emulsion for the treatment of human cystic echinococcosis: evaluation of bioavailability and bioequivalence. ( Bin, L; Cheng, F; Hotez, P; Junjie, C; Mingjie, W; Shuhua, X; Weixia, S, 2002) |
| "Concentrations of albendazole were measured, by high-pressure liquid chromatography, in 19 patients being treated for cystic echinococcosis." | 9.07 | Initial observation on albendazole in combination with cimetidine for the treatment of human cystic echinococcosis. ( Craig, PS; Muhmut, M; New, RR; Wen, H; Zhang, HW; Zou, PF, 1994) |
| "Data regarding albendazole monotherapy for cystic echinococcosis (CE) are scarce, especially in children." | 8.31 | Albendazole Monotherapy for Pediatric Cystic Echinococcosis: A Case Series. ( Assi, Z; Ben-Shimol, S; Elamour, S; Grupel, D; Sagi, O; Shmueli, M, 2023) |
| "Albendazole is known as the drug of choice for medical treatment of cystic echinococcosis (CE)." | 7.96 | Evaluation of the efficacy of albendazole sulfoxide (ABZ-SO)-loaded chitosan-PLGA nanoparticles in the treatment of cystic echinococcosis in laboratory mice. ( Abedi, M; Alizadeh, M; Darvishi, MM; Moazeni, M; Tamaddon, AM, 2020) |
| "Albendazole is the drug of choice for chemotherapy of cystic echinococcosis (CE) but 40% of patients do not respond to it satisfactorily." | 7.91 | Enhancement of the Therapeutic Effect of Albendazole on Cystic Echinococcosis using a Herbal Product. ( Borji, H; Moazeni, M; Saboor Darbandi, M, 2019) |
| "To investigate the preventive effect of the combination of albendazole (ABZ) and pomegranate peel aqueous extract (PGE) treatment in cystic echinococcosis, we assess in vivo the antihydatic and the anti-inflammatory effects of the combination of ABZ/ PGE in cystic echinococcosis mice model." | 7.91 | A preventive effect of the combination of albendazole and pomegranate peel aqueous extract treatment in cystic echinococcosis mice model: An alternative approach. ( Amir, ZC; Khelifi, L; Labsi, M; Soufli, I; Touil-Boukoffa, C, 2019) |
| "Hepatic injury is the major limitation of long-term albendazole administration in patients with cystic echinococcosis (CE), which could give rise to cessation of treatment." | 7.88 | Zataria multiflora would attenuate the hepatotoxicity of long-term albendazole treatment in mice with cystic echinococcosis. ( Atayi, Z; Borji, H; Heidarpour, M; Moazeni, M; Saboor Darbandi, M, 2018) |
| "Albendazole (ABZ) is the best drug available to treat cystic echinococcosis (CE), a neglected tropical disease." | 7.88 | Shortage of Albendazole and Its Consequences for Patients with Cystic Echinococcosis Treated at a Referral Center in Italy. ( Brunetti, E; Budke, CM; Lissandrin, R; Maestri, M; Manciulli, T; Mariconti, M; Tamarozzi, F; Vola, A, 2018) |
| "The tolerability and efficiency of specific chemotherapy with albendazole were analyzed in 18 patients with cystic echinococcosis at various sites." | 7.85 | [(EXPERIENCE WITH ALBENDAZOLE TREATMENT IN CHILDREN WITH CYSTIC ECHINOCOCCOSIS)]. ( Bronshtein, AM; Legonkov, YA, 2017) |
| "To describe therapeutic response to albendazole in a cohort of pediatric patients with abdominal cystic echinococcosis." | 7.83 | Abdominal Cystic Echinococcosis Treated with Albendazole. A Pediatric Cohort Study. ( Altcheh, J; Ballering, G; Bournissen, FG; Freilij, H; González, N; Moroni, S; Moscatelli, G; Salgueiro, F, 2016) |
| "The current chemotherapy of cystic echinococcosis (CE) is mainly based on the use of albendazole, and the results have been shown to be highly variable." | 7.81 | Combined flubendazole-nitazoxanide treatment of cystic echinococcosis: Pharmacokinetic and efficacy assessment in mice. ( Carlos, L; Celina, E; Guillermo, D; Laura, C; Luis, A; Sergio, SB, 2015) |
| "Therapeutic failures attributed to medical management of cystic echinococcosis (CE) with albendazole (ABZ) have been primarily linked to the poor drug absorption rate resulting in low drug level in plasma and hydatid cysts." | 7.81 | Cystic echinococcosis therapy: Albendazole-loaded lipid nanocapsules enhance the oral bioavailability and efficacy in experimentally infected mice. ( Allemandi, D; Alvarez, LI; Benoit, JP; Ceballos, L; Elissondo, MC; Fabbri, J; Palma, SD; Pensel, PE; Sanchez Bruni, S; Ullio Gamboa, G, 2015) |
| "To assess the therapeutic effects of long-term albendazole therapy in intraabdominal cystic echinococcosis." | 7.70 | Continuous long-term albendazole therapy in intraabdominal cystic echinococcosis. ( Liu, Y; Wang, X; Wu, J, 2000) |
| "Sixty-eight cystic echinococcosis patients were each treated with 800 mg albendazole/day in four 28-day courses separated by 14-day drug-free intervals." | 7.69 | Three- to 7-year follow-up after albendazole treatment of 68 patients with cystic echinococcosis (hydatid disease). ( el-On, J; Goldsmith, R; Nahmias, J; Soibelman, M, 1994) |
| "Pharmacokinetic data of 121 individual cysts were analysed." | 6.53 | Intra-cystic concentrations of albendazole-sulphoxide in human cystic echinococcosis: a systematic review and analysis of individual patient data. ( Auer, H; Groger, M; Kaczirek, K; Lötsch, F; Naderer, J; Ramharter, M; Skuhala, T; Waneck, F, 2016) |
| "Hydatidosis (cystic echinococcosis, CE) constitutes a serious public health problem worldwide." | 6.42 | Benzimidazole treatment of cystic echinococcosis. ( El-On, J, 2003) |
| "We aimed to evaluate the effectiveness of nitazoxanide in disseminated cystic echinococcosis (DCE) that failed to respond to surgical and antiparasitic therapy." | 6.25 | Evaluation of nitazoxanide for the treatment of disseminated cystic echinococcosis: report of five cases and literature review. ( Ayala, AP; Díaz-Menéndez, M; Gallego, JI; López-Vélez, R; Monge-Maillo, B; Norman, F; Pérez-Molina, JA, 2011) |
| "Permeation of the cysts and loss of turgidity was observed with the incubation with the different combinations of carvacrol:thymol." | 5.91 | Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole. ( Albanese, A; Albani, C; Elissondo, MC; Fabbri, J; Paladini, A; Pensel, P, 2023) |
| "Primary Renal hydatid cyst is a rare entity." | 5.91 | Renal Hydatid Cyst in a Child Managed with Albendazole. ( Acharya, S; Kc, SR; Pandey, U; Paudel, U; Pradhan, S; Timilsina, BR, 2023) |
| "Protoscoleces and microcysts were treated in vitro with free ABZ and ABZ-NLCs (concentrations of 1, 5, and 10 μg/ml), and the corresponding effects were monitored by methylene blue exclusion test and scanning and transmission electron microscopy." | 5.62 | In vitro evaluation of albendazole-loaded nanostructured lipid carriers on Echinococcus granulosus microcysts and their prophylactic efficacy on experimental secondary hydatidosis. ( Ahmadi, N; Farhadi, M; Haniloo, A; Rostamizadeh, K, 2021) |
| "Beta-myrcene is a monoterpene presented in the essential oils of different plants." | 5.48 | Could beta-myrcene be an alternative to albendazole for the treatment of experimental cystic echinococcosis? ( Albani, CM; Denegri, GM; Elissondo, MC; Fabbri, J; Maggiore, MA; Pensel, PE, 2018) |
| " Since 5-FU treatments did not cause toxic effect in mice, further in vivo studies will be performed by adjusting the dosage and the frequency of treatments." | 5.46 | Experimental cystic echinococcosis therapy: In vitro and in vivo combined 5-fluorouracil/albendazole treatment. ( Benoit, JP; Elissondo, MC; Elissondo, N; Gambino, G; Gamboa, GU; Pensel, PE, 2017) |
| "Thymol (40 mg/kg) was administered under two different therapeutic schemes: dosing every 24h over 20 days and treatment every 12h for 10 days." | 5.42 | Chemoprophylactic and therapeutic efficacy of thymol in murine cystic echinococcosis. ( Denegri, G; Elissondo, MC; Maggiore, M; Pensel, PE, 2015) |
| "Interest in mebendazole as an anticancer drug has stimulated research into new drug formulations to improve bioavailability and possibly reduce inter-individual variability in in-vivo drug levels, which may help its activity against cystic echinococcosis." | 5.41 | Medical management of cystic echinococcosis. ( Chiodini, PL, 2023) |
| "Cystic echinococcosis is a chronic, complex, and still neglected disease." | 5.40 | Enhanced chemoprophylactic and clinical efficacy of albendazole formulated as solid dispersions in experimental cystic echinococcosis. ( Allemandi, D; Bruni, SS; Castro, S; Elissondo, MC; Palma, SD; Pensel, PE, 2014) |
| "Herein, we report an isolated cardiac hydatid cyst in an 87-year-old man." | 5.39 | Inoperable isolated cardiac hydatid cyst controlled with albendazole in an older adult with dementia. ( Ariogul, S; Cankurtaran, M; Etgül, S; Halaçli, B; Halil, M; Hazirolan, T; Kuyumcu, ME; Sunman, H; Yavuz, BB; Yesil, Y, 2013) |
| "The incidence rate of cystic echinococcosis cases decreased from 38×100,000 in 1980 to 3." | 5.37 | Programme for ultrasound diagnoses and treatment with albendazole of cystic echinococcosis in asymptomatic carriers: 10 years of follow-up of cases. ( Araya, D; Del Carpio, M; Herrero, E; Labanchi, JL; Larrieu, E; Mancini, S; Mercapide, CH; Moguilensky, J; Mujica, G; Odriozola, M; Panomarenko, H; Salvitti, JC; Sustercic, J; Talmon, G; Uchiumi, L; Volpe, M, 2011) |
| "The pharmacokinetic (PK) behaviour and clinical efficacy of albendazole (ABZ) against hydatid cysts in mice were assessed after treatment with two different ABZ pharmaceutical formulations." | 5.35 | Albendazole treatment in cystic echinococcosis: pharmacokinetics and clinical efficacy of two different aqueous formulations. ( Alvarez, L; Ceballos, L; Denegri, G; Dopchiz, M; Elissondo, C; Lanusse, C; Moreno, L; Sánchez Bruni, S, 2008) |
| "Albendazole is a benzimidazole with wide spectrum coverage as an antiparasitic drug." | 5.33 | Death related to albendazole-induced pancytopenia: case report and review. ( Maclean, JD; Opatrny, L; Prichard, R; Snell, L, 2005) |
| "Albendazole was used at a dose of 10 mg/kg daily in cycles of 28 d for four cycles with 15 d between cycles." | 5.27 | Albendazole treatment of human cystic echinococcosis. ( Kolev, K; Mechkov, G; Petkov, D; Todorov, T; Vutova, K, 1988) |
| "Seeking better immunological markers indicating the long-term outcome of cystic echinococcosis (CE) after chemotherapy we studied 23 patients receiving albendazole, clinically followed for 8 years, and grouped ultrasonographically according to therapeutic outcome." | 5.10 | Long-term serological evaluation of patients with cystic echinococcosis treated with benzimidazole carbamates. ( Ali, MD; Di Vico, B; Ioppolo, S; Margutti, P; Ortona, E; Profumo, E; Riganò, R; Siracusano, A; Teggi, A, 2002) |
| "5 mg/kg dose of albendazole (Abz) in tablet form (AbzT) followed 2 weeks later by an equivalent dose of Abz emulsified in 30% soybean oil (AbzE) was administered orally 2 h after the first morning meal to 7 male adult patients with cystic echinococcosis caused by Echinococcus granulosus." | 5.10 | Albendazole-soybean oil emulsion for the treatment of human cystic echinococcosis: evaluation of bioavailability and bioequivalence. ( Bin, L; Cheng, F; Hotez, P; Junjie, C; Mingjie, W; Shuhua, X; Weixia, S, 2002) |
| "Concentrations of albendazole were measured, by high-pressure liquid chromatography, in 19 patients being treated for cystic echinococcosis." | 5.07 | Initial observation on albendazole in combination with cimetidine for the treatment of human cystic echinococcosis. ( Craig, PS; Muhmut, M; New, RR; Wen, H; Zhang, HW; Zou, PF, 1994) |
| "Albendazole has been used in various ways in the treatment of cystic echinococcosis (CE)." | 4.84 | Albendazole for the treatment of human echinococcosis: a review of comparative clinical trials. ( Bliziotis, IA; Falagas, ME, 2007) |
| " The introduction of oxamniquine and praziquantel constitutes a break through in the treatment of intestinal and urogenital schistosomiasis." | 4.76 | [Present status of the treatment of helminthiasis]. ( Coulaud, JP, 1984) |
| "Data regarding albendazole monotherapy for cystic echinococcosis (CE) are scarce, especially in children." | 4.31 | Albendazole Monotherapy for Pediatric Cystic Echinococcosis: A Case Series. ( Assi, Z; Ben-Shimol, S; Elamour, S; Grupel, D; Sagi, O; Shmueli, M, 2023) |
| " Case 2: A 52-year-old female patient presented multiple episodes of cholangitis in 30 years, with three liver resections and clinical treatment with albendazole for hydatidosis." | 4.12 | PRELIMINARY DATA ON LIVER TRANSPLANTATION IN HYDATIDOSIS DISEASE. ( Castro, AR; Coelho, GR; Garcia, JHP; Hyppolito, EB; Valença-Júnior, JT, 2022) |
| " This study aimed at determining the clinical tolerance and efficacy of albendazole in patients with cystic echinococcosis, depending on the volume of the previous one." | 4.12 | Comparative analysis of anti-relapse treatment regimens in 110 patients with hepatic and pulmonary hydatid echinococcosis. ( Galyavin, AV, 2022) |
| "Albendazole is appropriate chemotherapy for treatment and prophylaxis of cystic echinococcosis (CE)." | 3.96 | The combination of Cytokines and albendazole therapy for prophylaxis and treatment of experimental/hydatid cyst. ( Rafiei, A; Rahdar, M; Valipour-Nouroozi, R, 2020) |
| "Albendazole is the drug of choice for chemotherapy of cystic echinococcosis (CE) but 40% of patients do not respond to it satisfactorily." | 3.91 | Enhancement of the Therapeutic Effect of Albendazole on Cystic Echinococcosis using a Herbal Product. ( Borji, H; Moazeni, M; Saboor Darbandi, M, 2019) |
| "To investigate the preventive effect of the combination of albendazole (ABZ) and pomegranate peel aqueous extract (PGE) treatment in cystic echinococcosis, we assess in vivo the antihydatic and the anti-inflammatory effects of the combination of ABZ/ PGE in cystic echinococcosis mice model." | 3.91 | A preventive effect of the combination of albendazole and pomegranate peel aqueous extract treatment in cystic echinococcosis mice model: An alternative approach. ( Amir, ZC; Khelifi, L; Labsi, M; Soufli, I; Touil-Boukoffa, C, 2019) |
| "Hepatic injury is the major limitation of long-term albendazole administration in patients with cystic echinococcosis (CE), which could give rise to cessation of treatment." | 3.88 | Zataria multiflora would attenuate the hepatotoxicity of long-term albendazole treatment in mice with cystic echinococcosis. ( Atayi, Z; Borji, H; Heidarpour, M; Moazeni, M; Saboor Darbandi, M, 2018) |
| "Treatment failures of human cystic echinococcosis (CE) with albendazole (ABZ) have attributed to its low solubility and poor drug absorption rate, resulting in low drug level in plasma." | 3.83 | Scolicidal and apoptotic activities of albendazole sulfoxide and albendazole sulfoxide-loaded PLGA-PEG as a novel nanopolymeric particle against Echinococcus granulosus protoscoleces. ( Ahmadpour, E; Akbari, NA; Akbarzadeh, A; Mahami-Oskouei, M; Naseri, M; Spotin, A, 2016) |
| "The current chemotherapy of cystic echinococcosis (CE) is mainly based on the use of albendazole, and the results have been shown to be highly variable." | 3.81 | Combined flubendazole-nitazoxanide treatment of cystic echinococcosis: Pharmacokinetic and efficacy assessment in mice. ( Carlos, L; Celina, E; Guillermo, D; Laura, C; Luis, A; Sergio, SB, 2015) |
| "To observe the therapeutic effect of albendazole chitosan microspheres (ABZ-CS-MPs) on cystic echinococcosis in mice." | 3.80 | [Efficacy of albendazole chitosan microspheres against Echinococcus granulosus infection in mice]. ( Liang, W; Ma, X; Peng, XY; Sun, H; Wang, XC; Wu, XW; Zhang, SJ, 2014) |
| "A 24-year-old woman with a history of hydatid disease of the lung and brain, which was treated surgically and medically with albendazole, was admitted because of syncope." | 3.77 | Echocardiographic appearance of a hydatid cyst of the papillary muscle and chordae tendineae. ( Bulat, C; Carević, V; Fabijanić, D; Letica, D; Nenadić, D; Pešutić-Pisac, V, 2011) |
| "Modern treatment of cystic echinococcosis, except for surgical treatment and percutaneous drainage of cyst considers also administration of albendazole as a type of individual therapy." | 3.74 | [Adverse effects of longterm, continual administration of high doses of albendazole in the treatment of echinococcal disease]. ( Arsić-Komljenović, G; Janićijević-Hudomal, S; Jevtić, M; Mikić, D; Ristanović, E; Sjenicić, G; Stanković, N, 2008) |
| "According to the Brazilian Agricultural Ministry, the prevalence of cystic echinococcosis in the state of Rio Grande do Sul, Brazil has decreased between 1990 and 1998, possibly due to the common use of albendazole to control parasites in sheep." | 3.74 | The action of albendazole on hydatid cysts in sheep experimentally infected with eggs of Echinococcus granulosus. ( de la Rue, ML; Santos, AF; Santos, HT, 2008) |
| " While surgery remains the only approach for a radical cure, the chemotherapy with albendazole has became a useful advance in the management of cystic echinococcosis for the problem patient (inoperable disease, widely disseminated cysts, high surgical risk, etc." | 3.70 | [Efficacy of low-dose albendazole therapy in hydatic liver disease: a case report]. ( Grzeszczuk, A; Prokopowicz, D; Puzanowska, B; Sokolewicz-Bobrowska, E, 1999) |
| "To assess the therapeutic effects of long-term albendazole therapy in intraabdominal cystic echinococcosis." | 3.70 | Continuous long-term albendazole therapy in intraabdominal cystic echinococcosis. ( Liu, Y; Wang, X; Wu, J, 2000) |
| "Sixty-eight cystic echinococcosis patients were each treated with 800 mg albendazole/day in four 28-day courses separated by 14-day drug-free intervals." | 3.69 | Three- to 7-year follow-up after albendazole treatment of 68 patients with cystic echinococcosis (hydatid disease). ( el-On, J; Goldsmith, R; Nahmias, J; Soibelman, M, 1994) |
| "Most cysts are in the liver." | 3.01 | Pulmonary cystic echinococcosis. ( Junghanss, T; Stojković, M; Weber, TF, 2023) |
| "A safer and more effective treatment plan for echinococcosis is therefore urgently needed to compensate for this therapeutic shortfall." | 2.82 | Status and prospect of novel treatment options toward alveolar and cystic echinococcosis. ( Dai, Y; Li, F; Li, J; Ma, Y; Sun, H; Wang, S; Wang, W, 2022) |
| "Albendazole is an orally administered anti-parasitic medication with widespread usage in a variety of both programmatic and clinical contexts." | 2.82 | Factors associated with variation in single-dose albendazole pharmacokinetics: A systematic review and modelling analysis. ( Basáñez, MG; Boussinesq, M; Chesnais, CB; Kamgno, J; Pion, SDS; Walker, M; Whittaker, C, 2022) |
| "Treatment with albendazole, whether combined or not with praziquantel, is useful for smaller, uncomplicated cysts (< 5 cm)." | 2.82 | A review of the diagnosis and management of liver hydatid cyst. ( Ferrer Inaebnit, E; González Argenté, X; Molina Romero, FX; Morón Canis, JM; Segura Sampedro, JJ, 2022) |
| "Albendazole was given as 10 mg/kg daily continuously." | 2.73 | Management of multiple echinococcosis in childhood with albendazole and surgery. ( Belghith, M; Ben Brahim, M; El Ezzi, O; Krichene, I; Ksia, A; Mekki, M; Nouri, A, 2008) |
| "In patients with hepatic cystic echinococcosis (CE), treatment effectiveness, outcomes, complications, and recurrence rate are controversial." | 2.72 | Endocystectomy as a conservative surgical treatment for hepatic cystic echinococcosis: A systematic review with single-arm meta-analysis. ( Al-Saeedi, M; Ali-Hasan-Al-Saegh, S; El Rafidi, A; Ghamarnejad, O; Hoffmann, K; Khajeh, E; Mehrabi, A; Probst, P; Ramouz, A; Shafiei, S; Stojkovic, M; Weber, TF, 2021) |
| "As albendazole treatment had effects that were almost identical to those of mebendazole treatment, the results for the two drugs were combined." | 2.71 | The types and timing of the degenerative changes seen in the cysts during and after benzimidazole treatment of cystic echinococcosis. ( Donev, S; Ivanov, A; Katzarov, K; Takov, D; Todorov, T; Vutova, K, 2005) |
| "Albendazole is a poorly water soluble drug, with low oral bioavailability, used in pharmacological treatment of a systemic disease as hydatid parasitosis." | 2.69 | Lipidic matrix of albendazole: an alternative for systemic infections. ( Camarote, C; Domínguez, L; Fagiolino, P; Malanga, A; Ochoa, A; Quevedo, D; Saldaña, J; Savio, E, 1998) |
| "At the end of therapy, 74." | 2.69 | Long-term evaluation of patients with hydatidosis treated with benzimidazole carbamates. ( Di Vico, B; Franchi, C; Teggi, A, 1999) |
| "Human hydatid cyst or cystic echinococcosis is a life-threatening zoonotic disease that occurs in most countries worldwide and is recognized as a major public health problem." | 2.61 | Albendazole and Treatment of Hydatid Cyst: Review of the Literature. ( Darani, HY; Dehkordi, AB; Jafari, R; Safarnezhad, F; Sanei, B; Sharafi, SM; Yousefi, M, 2019) |
| "Albendazole was continued postoperatively in all patients for 12 weeks." | 2.58 | Surgical overview of cardiac echinococcosis: a rare entity. ( Doshi, C; Kothari, J; Lakhia, K; Ramani, J; Rathod, D; Shah, J; Tavar, R; Wadhawa, V, 2018) |
| "Albendazole chemotherapy was found to be the primary pharmacological treatment to consider in the medical management of CE." | 2.58 | Medical treatment of cystic echinococcosis: systematic review and meta-analysis. ( Alonso-Sardón, M; Belhassen-García, M; Burguillo, FJ; Carpio-Pérez, A; Cordero, M; Lopez-Bernus, A; Muñoz Bellido, JL; Muro, A; Pardo-Lledias, J; Romero-Alegría, Á; Velasco-Tirado, V, 2018) |
| "Only a few cases of hydatid cysts located in the infratemporal fossa have been reported in the literature." | 2.58 | Hydatidosis of infratemporal fossa with proptosis - an unusual presentation: a case report and review of the literature. ( Ghartimagar, D; Ghosh, A; Lalchan, S; Shrestha, S; Talwar, OP; Thapa, S, 2018) |
| "Pharmacokinetic data of 121 individual cysts were analysed." | 2.53 | Intra-cystic concentrations of albendazole-sulphoxide in human cystic echinococcosis: a systematic review and analysis of individual patient data. ( Auer, H; Groger, M; Kaczirek, K; Lötsch, F; Naderer, J; Ramharter, M; Skuhala, T; Waneck, F, 2016) |
| "Keywords used were hydatid disease, hydatid cyst, cutaneous fistulization, cysto-cutaneous fistulization, external rupture, and external fistulization." | 2.53 | Cutaneous fistulization of the hydatid disease: A PRISMA-compliant systematic review. ( Aday, U; Akbulut, S; Bahce, ZS; Demircan, F; Senol, A, 2016) |
| "We present a rare case of costal hydatidosis, the first one to be reported in Romania according to our review of the literature." | 2.52 | Cystic Hydatidosis of the Rib-Case Report and Review of the Literature. ( Georgiu, C; Nicolau, D; Precup, D; Roman, A; Sabha, W; Surariu, M, 2015) |
| "Hydatidosis or cystic echinococcosis (CE) is a parasitic zoonosis caused by Echinococcus granulosus." | 2.52 | [Hydatidosis: epidemiological, clinical, diagnostic and therapeutic aspects]. ( Armiñanzas, C; Fariñas, MC; Gutiérrez-Cuadra, M, 2015) |
| "Albendazole was by far the most frequently used agent in monotherapy with various dosages, while mebendazole in monotherapy was less frequent (32 cases)." | 2.50 | Treatment challenges associated with bone echinococcosis. ( Al-Mayahi, M; Dominguez, D; Hoffmeyer, P; Lew, D; Racloz, G; Schibler, M; Steinmetz, S; Stern, R; Uçkay, I, 2014) |
| "On histological examination, a hydatid cyst was diagnosed." | 2.50 | Primary subcutaneous hydatid cyst over thoracic spine: a case report and review of the literature. ( Bayri, Y; Ekşi, MŞ; Konya, D; Saraçoğlu, A; Uyar Bozkurt, S, 2014) |
| "Solitary subcutaneous hydatid cyst is not frequent and the only symptom is generally a silent growing mass." | 2.49 | Solitary subcutaneous hydatid cyst: review of the literature and report of a new case in the deltoid region. ( Ferla, F; Intagliata, E; Marchese, S; Spataro, L; Vecchio, R, 2013) |
| "Alveolar echinococcosis was seen as an inhomogeneous pseudotumor with irregular boundaries, an irregular central pseudocystic appearance, and infiltration into surrounding structures." | 2.49 | Extrahepatic primary adrenal alveolar echinococcosis: a review. ( Chu, ZG; Lv, FJ; Ouyang, Y; Zhu, ZY, 2013) |
| "Primary intradural extramedullary hydatid cyst is a rare form of parasitic infection, causing focal neurological signs, commonly observed in sheep-raising areas of the world." | 2.49 | Intradural extramedullary primary hydatid cyst of the spine: a case report and review of literature. ( Lotfinia, I; Mahdkhah, A; Sayyahmelli, S; Shoja, MM, 2013) |
| "Solitary hydatid cyst(s) localized in the skeletal muscles occur rarely and often mimic soft tissue tumours." | 2.48 | Saphenous neuropathy due to large hydatid cyst within long adductor muscle: case report and literature review. ( Alimehmeti, M; Alimehmeti, R; Rroji, A; Seferi, A, 2012) |
| "Diagnosing bone hydatid disease is challenging, even in endemic regions, and a high index of suspicion is required because the radiologic findings often mimic other bone pathologies." | 2.48 | Composite treatment for primary long-bone hydatidosis. ( Banerjee, S; Mondal, J; Nath, C; Pal, DK; Sabui, KK, 2012) |
| "Orbital hydatidosis is rare, accounting for only 1% of all hydatid cysts." | 2.46 | Primary orbital hydatid cyst in an elderly patient. ( Bellil, K; Bellil, S; Chelly, I; Haouet, S; Kchir, N; Khaldi, M; Limaiem, F; Mekni, A; Zitouna, M, 2010) |
| "Hydatid cyst is a parasitic disease caused by the tapeworm Echinococcus granulosus." | 2.46 | Role of irrigation with hypertonic saline for a recurrent skull base hydatid cyst: case report and review of the literature. ( Enam, A; Khan, A; Salahuddin, I; Zia, S, 2010) |
| "Pericardial tamponade due to a hydatid cyst has not yet been described in the literature." | 2.46 | Cardiac tamponade via a fistula to the pericardium from a hydatid cyst: case report and review of the literature. ( Demircan, A; Kahveci, FO; Keles, A; Ozsarac, M; Tulmac, M, 2010) |
| "We concluded that intracranial hydatid cyst should be entertained whenever a cystic lesion is found in an endemic region." | 2.45 | Unusual brain edema caused by an intracranial hydatid cyst: c ase report and literature review. ( Bahloul, K; Boudouara, MZ; Kammoun, B; Ouerchefani, N, 2009) |
| "The role of praziquantel in hydatid disease has not been well defined." | 2.45 | Praziquantel: neglected drug? Ineffective treatment? Or therapeutic choice in cystic hydatid disease? ( Bygott, JM; Chiodini, PL, 2009) |
| " The patient was started on albendazole (ABZ) at a daily dosage of 800 mg for 3 months." | 2.44 | Cerebral alveolar echinococcosis. A case report with MRI and review of the literature. ( Cerçi, A; Elmaci, I; Isik, N; Kalelioglu, M; Karabagli, P; Silav, G, 2007) |
| "Spinal hydatid cysts account for 1% of all cases of hydatid disease; primary intradural hydatid cysts are uncommon." | 2.43 | Primary intradural extramedullary hydatid cyst. ( Aydin, Z; Colpan, E; Egemen, N; Kahilogullari, G; Tuna, H, 2005) |
| "Hydatidosis (cystic echinococcosis, CE) constitutes a serious public health problem worldwide." | 2.42 | Benzimidazole treatment of cystic echinococcosis. ( El-On, J, 2003) |
| "Chemotherapy of cystic echinococcosis became a treatment option 25 years ago, when new anthelminthic drugs were introduced." | 2.42 | Echinococcus granulosus infection: clinical presentation, medical treatment and outcome. ( Kern, P, 2003) |
| "Albendazole has changed from being a drug for individuals with worms to one to treat communities and provide benefit in public health terms." | 2.41 | Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations. ( Horton, J, 2002) |
| "Surgical therapy in echinococcal hydatid disease is indicated for large cysts with multiple daughter cysts, superficially located single liver cysts which have a risk of rupture, complicated cysts such as those accompanied by infection, compression or obstruction, and cysts located in vital organs or which are exerting pressure on adjacent vital organs." | 2.41 | Treatment of hydatid disease. ( Anadol, D; Göçmen, A; Kiper, N; Ozçelik, U, 2001) |
| "Human echinococcoses, cystic echinococcosis and alveolar echinococcosis are due to infections with the cestodes Echinococcus granulosus and E." | 2.41 | [Echinococcoses]. ( Bresson-Hadni, S; Vuitton, DA, 2001) |
| "Unilocular hydatid disease occurs in humans after oral intake of eggs of the dog tapeworm, Echinococcus granulosus." | 2.40 | [Diagnosis and treatment of unilocular hydatid disease (Echinococcus granulosus infection)]. ( Kager, PA; Schipper, HG, 1997) |
| "Multiple hydatid cysts of the brain are uncommon and may be either primary or secondary." | 2.40 | Multiple hydatid cysts of the brain: a case report and review of the literature. ( Güven, MB; Yilmaz, H; Yüceer, N, 1998) |
| "Albendazole was less effective than mebendazole." | 2.37 | [Experimental therapy in Chinese hamsters and rats infected with larval Echinococcus multilocularis by using mebendazole, albendazole and ivermectin with brief review of chemotherapy of human multilocular echinococcosis]. ( Inaoka, T; Kutsumi, H; Nakao, M; Ohnishi, K, 1987) |
| " ABZ-BA relative bioavailability (Frel) in Sprague-Dawley (SD) rats was 26-fold higher than ABZ in vivo." | 1.91 | Improvement of Antialveolar echinococcosis efficacy of novel Albendazole-Bile acids Derivatives with Enhanced Oral Bioavailability. ( Du, T; Gan, X; Gao, R; Hu, C; Qin, M; Zhang, F, 2023) |
| "The efficiency of crocin in the case of cystic echinococcosis was investigated, and compared with that of albendazole, one of the few licensed anti-echinococcosis drugs that served as a positive control." | 1.91 | The anti-echinococcal activity of crocin in mice experimentally infected with Echinococcus granulosus. ( Aghighi, K; Borji, H; Heidarpour, M, 2023) |
| "Alveolar echinococcosis is an emerging zoonotic disease caused by the parasite Echinococcus multilocularis." | 1.91 | Case Report: Amphotericin B and Mefloquine as a Salvage Treatment of Alveolar Echinococcosis. ( Jelicic, K; Papic, N; Vince, A; Viskovic, K, 2023) |
| "Treatment with albendazole was administered to 94% of CE, while albendazole monotherapy was used in 27% (n = 18, including 4 cases with extra-hepatic cysts)." | 1.91 | Treatment of Cystic Echinococcosis in Children: A Single Center Experience. ( Assi, Z; Ben-Shimol, S; Fuxman, Y; Gazer, B; Sheves, A; Shmueli, M; Van Buren, J, 2023) |
| "Primary Renal hydatid cyst is a rare entity." | 1.91 | Renal Hydatid Cyst in a Child Managed with Albendazole. ( Acharya, S; Kc, SR; Pandey, U; Paudel, U; Pradhan, S; Timilsina, BR, 2023) |
| "Alveolar echinococcosis is an endemic parasitosis in Switzerland." | 1.91 | [Novelties on the management of alveolar echinococcosis]. ( Demartines, N; Halkic, N; Joliat, GR; Labgaa, I; Melloul, E; Roulin, D; Uldry, E, 2023) |
| "We included 49 patients, and 79 cysts that were all surgically treated." | 1.91 | The high burden of pediatric cystic echinococcosis in Kazakhstan: epidemiological and clinical consequences. ( Brunetti, E; Colpani, A; De Vito, A; Doszhanova, G; Duisenova, A; Juszkiewicz, K; Kaniyev, S; Katarbayev, A; Manciulli, T; Mustapayeva, A; Zhakenova, Z; Zholdybay, Z, 2023) |
| "Human hydatid disease typically occurs in organs such as the liver and kidney." | 1.91 | Giant muscle hydatid in lower extremity: a rare case with neurological symptoms as the first manifestation. ( Alimujiang, A; Guo, J; Jia, Q; Ma, C; Wang, Y; Wu, S; Xie, Z; Zhang, J; Zheng, H, 2023) |
| "During laparotomy, a hydatid cyst was located in the tail of the pancreas." | 1.91 | Management of a pancreatic tail hydatid cyst: a case report. ( Hasnaouia, A; Heni, S; Kammoun, H; Sassi, I; Trigui, R, 2023) |
| "Alveolar echinococcosis is a helminthic zoonosis caused by the larval stage of Echinococcus multilocularis." | 1.72 | The combination of carvacrol and albendazole enhanced the efficacy of monotherapy in experimental alveolar echinococcosis. ( Albani, CM; Elissondo, MC; Elissondo, N; Fabbri, J; Gambino, G; Lopez, LM; Pensel, PE, 2022) |
| "Spinal hydatid cyst (SHC) is a rare hydatid cyst involvement observed in 1% of all cases." | 1.72 | Hydatid Cyst of the Spine: A Rare Case Report ( Akgül, ÖS; Alkan Çeviker, S; Metineren, MH; Önder, T; Özel, Ç; Şener, A; Yüksel, C, 2022) |
| "Albendazole was given postoperatively for a period of one month." | 1.72 | A Large Hydatid Cyst in the Brain of a 10-year Child. ( Ahmad, A; Ahmad, S; Ahmed, S; Ashraf, M, 2022) |
| "Spinal cystic echinococcosis (CE) is a rare but devastating form of a neglected parasitic disease caused by the larval stage of the cestode Echinococcus granulosus." | 1.72 | A Case of Extensive Thoracolumbar Spinal Intradural Cystic Echinococcosis. ( Feng, H; Liu, J; Liu, P, 2022) |
| "The volume and weight of the cysts were significantly lower in the sumac group compared to the controls." | 1.72 | Anti-echinococcal effects of sumac, Rhus coriaria, in a murine model of cystic echinococcosis: Parasitological and molecular evaluation. ( Afgar, A; Fotoohi, S; Harandi, MF; Radfar, MH, 2022) |
| "multilocularis-causing cystic echinococcosis (CE) and alveolar echinococcosis (AE) in humans, respectively." | 1.72 | Comparison of local ablation with Albendazole or laparoscopic hepatectomy combined with Albendazole in the treatment of early hepatic alveolar echinococcosis. ( A, J; A, X; Chai, J; Shao, Z; Wang, H; Yang, J; Zhao, S, 2022) |
| "This suggested hydatid cyst." | 1.72 | [Hydatidosis of psoas muscle revealed by vascular axis compression in lower limb: About one case at the Ibn Sina University hospital, Rabat, Morocco]. ( Aoufi, S; Bouikhif, M; Farhane, S; Lyagoubi, M, 2022) |
| " Albendazole (ABZ) is the first-line treatment for CE; however therapeutic failure of ABZ against CE occurs because of size and location of formed cysts as well its low aqueous solubility and consequently its erratic bioavailability in plasma." | 1.72 | In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto. ( Ahmadpour, E; Akbarzadeh, A; Asadi, M; Asadi, N; Bakhtiar, NM; Casulli, A; de Lourdes Pereira, M; Ebrahimi, M; Mahami-Oskouei, M; Norouzi, R; Rodrigues Oliveira, SM; Spotin, A, 2022) |
| "Intramuscular hydatid disease is rarely reported in children." | 1.62 | Unusual intramuscular locations as a first presentation of hydatid cyst disease in children: a report of two cases. ( Henawi, YM; Khasawneh, RA; Mohaidat, ZM; Zoghoul, SB, 2021) |
| "Hepatic cystic echinococcosis (HCE), is a cosmopolitan parasitic zoonosis." | 1.62 | [Update on cystic echinococcosis of the liver]. ( Bastid, C; Bresson-Hadni, S; Chappuis, F; Spahr, L; Terraz, S; Toso, C, 2021) |
| "The cyst was approximately 7." | 1.62 | Rare Encounter of Renal Hydatid Cyst: A Case Report. ( Basnet, P; Chapagain, S; Neupane, R; Thapa, A, 2021) |
| "Fertile hydatid cysts were isolated from the liver of slaughtered sheep." | 1.62 | In vitro evaluation of albendazole nanocrystals against Echinococcus granulosus protoscolices. ( Adnani Sadati, SJ; Fateh, R; Fattahi Bafghi, A; Hamta, A; Khalifeh-Gholi, M; Mirzaei, E; Nawaz, M; Nissapatron, V; Norouzi, R; Siyadatpanah, A, 2021) |
| "Protoscoleces and microcysts were treated in vitro with free ABZ and ABZ-NLCs (concentrations of 1, 5, and 10 μg/ml), and the corresponding effects were monitored by methylene blue exclusion test and scanning and transmission electron microscopy." | 1.62 | In vitro evaluation of albendazole-loaded nanostructured lipid carriers on Echinococcus granulosus microcysts and their prophylactic efficacy on experimental secondary hydatidosis. ( Ahmadi, N; Farhadi, M; Haniloo, A; Rostamizadeh, K, 2021) |
| "When she presented with further seizures 6 months later, attempts to arrange neuroimaging and specialist assessment were unsuccessful owing to restrictions on routine healthcare services during the SARS-CoV-2 nationwide lockdown." | 1.62 | Hydatid brain cyst: A delayed diagnosis in a rural setting during COVID-19. ( Brink, AJ; Da Fonseca, SP; Enslin, JMN; Nuttall, J; Opperman, CJ; Tootla, HD, 2021) |
| "Treatment with albendazole was continued." | 1.62 | A rare presentation of hydatid cyst in abdominal wall: case report. ( Malaekah, H; Moshref, L, 2021) |
| "Solitary primary pelvic intraperitoneal hydatid cysts are rare." | 1.62 | Solitary pelvic primary intraperitoneal hydatid managed with a minimal access approach: A case report. ( Bhattacharjee, HK; Goyal, A; Parshad, R; Singla, V; Suhani, S, 2021) |
| "Treatment with albendazole prior to surgery was started." | 1.62 | Hepatic hydatidosis that debuts with a direct rupture to the pleural cavity. ( Dávila Arias, C; Duque Fernández De Vega, S; García Pérez, PV, 2021) |
| "Over one million people are living with cystic echinococcosis (CE) and alveolar echinococcosis (AE)." | 1.62 | Characterizing dynamic changes of plasma cell-free Echinococcus granulosus DNA before and after cystic echinococcosis treatment initiation. ( Cai, H; Chen, F; Chen, W; Danzeng, W; Gongsang, Q; Ji, J; Li, B; Li, J; Pang, H; Pei, N; Qi, F; Qiangba, G; Xie, J; Yin, J; Zhao, Y; Zhou, H, 2021) |
| "We report a case of giant primary hydatid cysts of the thigh and the gluteal region in an 82-year-old female, who presented with a painful multiple palpable mass." | 1.62 | Primary giant hydatid cysts of the thigh and the gluteal region: a case report. ( Abid, A; Chaouch, F; Koubaa, M; Othman, Y; Rabhi, S; Saadana, J; Zrig, M, 2021) |
| "Thirty patients with CE3b cysts and 37 patients with spontaneously-inactivated CE4-CE5 cysts were recruited (T0)." | 1.62 | Accuracy of an experimental whole-blood test for detecting reactivation of echinococcal cysts. ( Brunetti, E; Goletti, D; Gomez Morales, MA; Ludovisi, A; Mariconti, M; Najafi Fard, S; Petrone, L; Tamarozzi, F; Vola, A, 2021) |
| "Alveolar echinococcosis is the most severe worm disease primarily detected in the liver." | 1.62 | Clinical tolerance and efficacy of anti-parasitic treatment with albendazole in patients with alveolar echinococcosis: long-term follow-up observation in 117 patients. ( Tumolskaya, NI; Zavoikin, VD; Zelya, OP, 2021) |
| "Albendazole is a valuable treatment option for patients who are not candidates for surgical resection." | 1.62 | First Reported Case of Echinococcal Disease on a Renal Graft Successfully Treated With Albendazole. ( Akyuz Dagli, P; Arinsoy, T; Ayva, S; Boztepe Derici, U; Dalgic, A; Dizbay, M; Helvaci, O; Sozen, H, 2021) |
| " However, only about one-third of patients experience complete remission or cure with such treatments, largely because of the low oral bioavailability of ABZ caused by its very low solubility." | 1.56 | Improvement of Antialveolar Echinococcosis Efficacy of Albendazole by a Novel Nanocrystalline Formulation with Enhanced Oral Bioavailability. ( Fan, H; Hu, C; Liu, C; Liu, Z; Qian, F; Zhang, Y, 2020) |
| "Alveolar echinococcosis is a parasitic disease caused by the tapeworm larval stage of Echinococcus multilocularis." | 1.56 | Human Alveolar Echinococcosis, Croatia. ( Beck, R; Deplazes, P; Dušek, D; Kurelac, I; Papić, N; Vince, A; Višković, K, 2020) |
| "Menthol is a natural compound of low toxicity, used in industries such as cosmetics and gastronomy and generally recognized as safe by the Food and Drug Administration." | 1.56 | Anti-echinococcal activity of menthol and a novel prodrug, menthol-pentanol, against Echinococcus multilocularis. ( Clemente, CM; Elissondo, MC; Elissondo, N; Fabbri, J; Gambino, G; Hergert, LY; Palma, SD; Ravetti, S, 2020) |
| "Albendazole therapy was prescribed to patients diagnosed with AE 4-6 weeks after LT on the background of continuous suppressive therapy while following the protocol for managing patients after LT." | 1.56 | The importance of uninterrupted albendazole treatment in patients with unresectable alveolar echinococcosis undergoing liver transplantation. ( Tumolskaya, NI; Zavoikin, VD; Zelya, OP, 2020) |
| "In the surgical treatment of hydatidosis, the use of scolicidal agents is very important due to inactivating live protoscoleces and preventing the recurrence of infection." | 1.56 | Subcutaneous Hydatid Cyst in Laboratory Mice: Is it a Suitable Method for Evaluating Therapeutic Agents against Hydatid Cyst? ( Ahmadi, A; Moazeni, M; Shaddel, M, 2020) |
| "Alveolar echinococcosis is a neglected parasitic zoonosis caused by Echinococcus multilocularis." | 1.56 | Albendazole solid dispersions against alveolar echinococcosis: a pharmacotechnical strategy to improve the efficacy of the drug. ( Albani, CM; Bermudez, JM; Elissondo, MC; Fabbri, J; Lopez, LM; Palma, SD; Pensel, PE; Simonazzi, A, 2020) |
| "The cardiac involvement of hydatid cyst, which is rarely seen, with the location of asymptomatic huge cyst in the interventricular septum (IVS) is an extraordinary condition." | 1.56 | Asymptomatic Huge Cardiac Hydatid Cyst Located in the Interventricular Septum. ( İyigün, T; Karakurt, ST; Kutay, V; Kyaruzi, MM, 2020) |
| "Isolated cardiac hydatid cyst is a rare entity." | 1.56 | Surgical excision of an epicardial ventricular hydatid cyst. ( Ballal, P; Kumar, A; Nagamani, AC; Sheriff, SA, 2020) |
| "Giant-sized hydatid cysts of paraspinal muscles, though rare, cannot be ruled out on clinical ground alone." | 1.56 | Primary Giant Hydatid Cyst of Lumbar Paraspinal Muscles. ( Gupta, S; Gupta, V; Kalra, G; Singh, S, 2020) |
| "This is a report of 2 cases of human hydatidosis caused by Echinococcus ortleppi in Vietnam." | 1.56 | Two Human Cases of Echinococcus ortleppi Infection in the Lung and Heart in Vietnam. ( Bich, NN; Chai, JY; De, NV; Duyet, LV; Jung, BK; Minh, PN; Son, TN, 2020) |
| " We urge a coordination between stakeholders to find effective and feasible ways to take action to revise the benzimidazole dosage regimens for CE and AE and to ensure a fair, regular, and easy access to the appropriate treatment to those suffering from these serious diseases." | 1.56 | A case for adoption of continuous albendazole treatment regimen for human echinococcal infections. ( Bresson-Hadni, S; Brunetti, E; Gruener, B; Horton, J; Manciulli, T; Muhtarov, M; Ramharter, M; Siles-Lucas, M; Tamarozzi, F; Vuitton, DA, 2020) |
| "Almost all cases of renal hydatid cysts need surgical intervention for treatment." | 1.56 | Medical treatment for an isolated renal multilocular hydatid cyst in an elderly: a case report. ( Asefi, H; Moghtadaie, A; Mohraz, M; Razeghi, E; Yazdi, SAM, 2020) |
| "Humans are intermediate hosts, causing cystic echinococcosis." | 1.56 | Pancreatic cystic echinococcosis causing acute pancreatitis. ( Değer, KC; Destek, S, 2020) |
| "Alveolar echinococcosis is a parasitic anthropo-zoonosis which looks like a slow-growing liver cancer." | 1.56 | [Échinococcose alvéolaire]. ( Bresson-Hadni, S; Mantion, G; Million, L; Vuitton, DA, 2020) |
| "Recurrence of cystic echinococcosis as a result of treatment failure is frequently reported to cause a major problem in management of such serious parasitic infection." | 1.51 | Ultrastructural changes in hydatid cyst walls obtained from human cases, exposed to different therapeutic approaches. ( Aal, AAA; Badawi, MA; El-Ahl, SAHS; El-Dardiry, MA; Raouf, AMA; Shaheen, HAAAS, 2019) |
| " In this study, we endeavored to develop an optimized tablet formulation of ABZ to improve its dissolution and oral bioavailability from two aspects: a faster initial dissolution in the gastric pH condition (i." | 1.51 | Enhanced Oral Bioavailability and Anti-Echinococcosis Efficacy of Albendazole Achieved by Optimizing the "Spring" and "Parachute". ( Chen, C; Fan, H; Hu, C; Li, J; Liu, C; Liu, Z; Qian, F; Wang, Z; Xu, L, 2019) |
| "Musculoskeletal hydatidosis is a rare but severe disease in central Europe." | 1.51 | Osseous hydatidosis of the proximal femur: a rare diagnosis in revision total hip arthroplasty. ( Fischer, HP; Fröschen, FS; Gravius, N; Gravius, S; Hischebeth, GT; Randau, TM; Reiter-Owona, I, 2019) |
| "Río Negro Province is endemic for cystic echinococcosis (CE)." | 1.51 | Epidemiology, diagnosis, treatment and follow-up of cystic echinococcosis in asymptomatic carriers. ( Araya, D; Arezo, M; Cornejo, T; Del Carpio, M; Echenique, H; Galvan, JM; Grizmado, C; Herrero, E; Labanchi, JL; Larrieu, E; Mercapide, CH; Mujica, G; Panomarenko, O; Salvitti, JC; Seleiman, M; Sepulveda, L; Sobrino, M; Sustercic, J; Talmon, G; Tissot, H; Uchiumi, L, 2019) |
| "Intramuscular cystic echinococcosis is a very rare occurrence." | 1.51 | Cystic echinococcosis in the thigh: a case report. ( Bellmann-Weiler, R; Kurz, K; Schreieck, S; Schwabegger, A; Weiss, G; Zelger, B, 2019) |
| "In patients with hydatid disease, advanced radiological examinations such as lung X-ray, abdominal ultrasonography and brain magnetic resonance imaging and echocardiographic examination should be performed for other organ involvement." | 1.51 | A Rare Mass in the Brain in A Child: Hydatid Cyst ( Tural Kara, T, 2019) |
| "Intracranial hydatid disease is relatively rare; the incidence is approximately 1%-2%." | 1.51 | Giant Primary Intracranial Hydatid Cyst in Child with Hemiparesis. ( Başkurt, O; Gök, H, 2019) |
| "Frozen-section analysis revealed hydatid disease." | 1.48 | Coexisting Primary Ovarian and Omental Hydatid Disease Mimicking an Ovarian Neoplasm: A Case Report. ( Tas, EE; Yavuz, F; Yegin Akcay, GF; Yildirim, F, 2018) |
| "Hydatid disease is the most common mediterranean parasitic infection; it commonly affects the liver and lungs and rarely involves multiple organs." | 1.48 | Hydatid cyst involvement of both pulmonary arteries in a 14-year-old girl. ( Çetin, M; Geylan, H; Karaman, K; Özgökçe, M; Yildizeli, B, 2018) |
| "We report a rare hydatid disease case which presented with multiple lesions in right frontal lobe, an uncommon site, and in the liver and lungs." | 1.48 | Medical treatment of an unusual cerebral hydatid disease. ( Chen, Q; Chen, S; Hu, Y; Li, N; Liu, Y; Wang, X; Wu, J; Yang, F; Yu, S; Zheng, J, 2018) |
| " The enhanced chemoprophylactic and clinical efficacy of ABZ-NCs observed in this study could be attributed to an increase in the oral bioavailability of the drug." | 1.48 | Albendazole nanocrystals in experimental alveolar echinococcosis: Enhanced chemoprophylactic and clinical efficacy in infected mice. ( Albani, CM; Allemandi, D; Elissondo, MC; Palma, SD; Paredes, A; Pensel, P; Sanchez Bruni, S, 2018) |
| "The cysts were removed intact." | 1.48 | Hydatid Cyst of Skeletal Muscle Presenting as Soft Tissue Tumour. ( Alam, A; Bhatti, A; Khan, KM; Kumar, M; Minhas, MS; Moghul, FA; Mughal, A; Sangani, MM, 2018) |
| "Diagnosing a soft-tissue hydatid cyst may be challenging unless the mass possesses the characteristic features of a hydatid cyst." | 1.48 | Primary hydatid cyst in the posterior thigh, and its percutaneous treatment. ( Adamhasan, F; Arslan, M; Gulek, B; Ogur, HU, 2018) |
| "Alveolar echinococcosis is a zoonotic disease due to the tapeworm Echinococcus multilocularis." | 1.48 | [Multidisciplinary management of alveolar echinococcosis : Echino-Liege Working Group]. ( Bletard, N; Cambier, A; Delwaide, J; Detry, O; Giot, JB; Hayette, MP; Honore, P; Hustinx, R; Leonard, P; Losson, B; Meunier, P; Meurisse, N, 2018) |
| "There was no recurrence after 2 years from the last surgery." | 1.48 | Endless story of a spinal column hydatid cyst disease: A case report. ( Acik, V; Bilgin, E; Cavus, G; Gezercan, Y; Okten, AI, 2018) |
| "Management options for cystic echinococcosis (CE) remain a serious problem." | 1.48 | Management of cystic echinococcosis in the last two decades: what have we learned? ( Alonso-Sardón, M; Belhassen-García, M; Bellvis, LM; Iglesias Gomez, A; Iglesias-Iglesias, M; Jimenez Lopez, MF; Lopez-Bernus, A; Muñoz Bellido, JL; Muro, A; Pardo-Lledías, J; Romero-Alegria, A; Sampedro, JQ; Velasco-Tirado, V, 2018) |
| "Alveolar echinococcosis is a potentially lethal zoonosis caused by larval forms of the tapeworm Echinococcus multilocularis." | 1.46 | Disseminated alveolar echinococcosis resembling metastatic malignancy: a case report. ( Caire Nail, L; Chappuis, F; Ibrahim, YL; Lebowitz, D; Lobrinus, JA; Rodríguez Reimundes, E; Weibel Galluzzo, C, 2017) |
| "Operative finding revealed a hydatid cyst." | 1.46 | [Hydatid cyst of the posterior fossa]. ( Aggouri, M; Benzagmout, M; Chakour, K; Faizchaoui, ME; Saqui, AE, 2017) |
| "Intrathoracic rupture of hydatid cyst of the liver is a rare but severe complication of echinococcal disease." | 1.46 | A bronchobiliary fistula due to giant hydatid cyst. ( Delgado Valdueza, J; Di Martino, M; Laganá, C; Martín-Pérez, E, 2017) |
| "The only drugs available to treat alveolar echinococcosis (AE) are mostly parasitostatic and in many cases prescribed for life." | 1.46 | Screening of antigenic vesicular fluid proteins of Echinococcus multilocularis as potential viability biomarkers to monitor drug response in alveolar echinococcosis patients. ( Anelli, M; Baraquin, A; Bresson-Hadni, S; Gottstein, B; Grenouillet, F; Knapp, J; Millon, L; Prenel, A; Richou, C; Rognon, B; Valot, B; Vuitton, DA; Wang, J, 2017) |
| "Renal echinococcosis is a rare disease." | 1.46 | Primary renal echinococcosis with gross hydatiduria. ( Devkaran, B; Gupta, A; Gupta, J, 2017) |
| " Pharmacokinetic profiling of compounds 2 and 24 revealed low clearance and decent oral bioavailability (>70%)." | 1.46 | In vitro and in vivo efficacies of novel carbazole aminoalcohols in the treatment of cystic echinococcosis. ( Duan, L; Li, J; Li, S; Wang, T; Wang, W; Yao, J; Zhang, W; Zheng, X, 2017) |
| "Four other cysts (26." | 1.46 | Preliminary Evaluation of Percutaneous Treatment of Echinococcal Cysts without Injection of Scolicidal Agent. ( Brunetti, E; Firpo, G; Lissandrin, R; Tamarozzi, F; Vola, A, 2017) |
| "Orbital hydatid cyst is extremely rare and accounts for less than 1% of all hydatid cysts." | 1.46 | Primary Orbital Hydatid Cyst: A Case Report. ( Fallahi Motlagh, B; Fallahi Motlagh, M; Janghi Aghdam, H, 2017) |
| " Therapeutic drug monitoring of albendazole (ABZ) showed that a low dosage was appropriate." | 1.46 | Hints for control of infection in unique extrahepatic vertebral alveolar echinococcosis. ( Aubry, S; Blagosklonov, O; Bresson-Hadni, S; Brientini, MP; Chirouze, C; Descotes-Genon, C; Faucher, JF; Félix, S; Godard, J; Grenouillet, F; Hoen, B; Richou, C, 2017) |
| "Cystic hydatid disease is responsible for the loss of 1 to 3 million disability-adjusted life years every year." | 1.46 | Hydatid Cyst of the Heart. ( Majeed, A; Noaman, H; Rawaf, S; Salmasi, AM, 2017) |
| "Seven years later the patient presents hydatid cyst in portal vein with secondary cavernomatosis, which is a rare complication." | 1.46 | Portal hydatid with secondary cavernomatosis. ( Blanco Álvarez, CA; Rodríguez Sanz, MB; Roldán Cuena, MD; Sánchez Jiménez, R, 2017) |
| "A total of 27 extrahepatic hydatid cysts in 12 patients, the spleen in 8 patients, muscles and soft tissues in 3 patients each and right adrenal gland in 1 patient were treated with PAIR (puncture, aspiration, injection, respiration) or single puncture catheterization methods." | 1.46 | Successful percutaneous treatment of extrahepatic cystic echinococcosis through PAIR and single puncture catheter techniques. ( Arslan, S; Bakdik, S; Eryilmaz, MA; Oncu, F; Tolu, I, 2017) |
| "Treatment with albendazole and insulin show certain effects on the expression of Em-apo genes in E." | 1.43 | [Screening and Applications of qPCR Primers for apomucin Gene of Echinococcus multilocularis]. ( Ding, JT; Guo, XL; Luo, XN; Shao, ZW; Su, M; Sun, XL; Xiang, HT; Yang, J; Zheng, YD, 2016) |
| "Hydatid disease is a parasitic infection caused by the larvae of Echinococcus granulosus, which is still endemic in many developing countries." | 1.43 | Ruptured intracardiac hydatid cyst presenting as acute coronary syndrome. ( Garg, P; Lakhia, K; Malhotra, A; Sharma, P, 2016) |
| "We report a case of a hydatid cyst of the eyelid in a 12-year-old boy associated with cerebral involvement." | 1.43 | Swollen eyelid reveals multiple intracranial hydatid cysts associated with a palpebral cyst. ( Abboud, H; Ahbeddou, S; Ahmimech, J; Berraho, A; Boutarbouch, M; El Hassan, A; Tzili, N, 2016) |
| "Cystic echinococcosis is a widespread zoonotic parasitic disease especially in Tunisia which is one of the most endemic countries in the Mediterranean area." | 1.43 | First molecular evidence of the simultaneous human infection with two species of Echinococcus granulosus sensu lato: Echinococcus granulosus sensu stricto and Echinococcus canadensis. ( Babba, H; Ksia, A; Lamiri, R; M'rad, S; Mekki, M; Mezhoud, H; Nouri, A; Oudni-M'rad, M, 2016) |
| "Possibility of hydatid cyst should not be ignored at the differential diagnosis of cystic lesions in head and neck region, especially in endemic areas." | 1.43 | Hydatid cyst in unusual location: Pterygopalatine fossa-infratemporal fossa. ( Çomoğlu, Ş; Değer, K; Polat, B; Şahin, B, 2016) |
| "Hydatid disease, or echinococcosis, affects several organs in the body and can pose a major diagnostic dilemma." | 1.43 | Primary Subcutaneous Hydatid Cyst of the Thigh: An Unusual Site With a Diagnostic Dilemma. ( Prabhu, R; Rodrigues, G, 2016) |
| "The orbital hydatid cyst is a rare entity and although most of them are located in superolateral and superomedial angles of orbits, involvement of inferior sites is uncommon." | 1.43 | An orbital hydatid cyst involving inferior rectus muscle: A case report. ( Arefidoust, A; Heydarzadeh, S; Rajabi, MT; Sabouni, F; Saravi, SS; Yaftian, R, 2016) |
| "Despite the benign nature of hydatid cyst, invasion of critical areas may cause significant mortality and morbidity in some patients." | 1.43 | A life-threatening brainstem compression by cerebral Echinococcus granulosus. ( Alberti, A; Karakoç, ZC; Kasimcan, MO; Oruçkaptan, H; Pipia, AP; Sav, A; Tore, G; Varcasia, A, 2016) |
| "14-year-old male with hydatid disease of the kidney." | 1.43 | Renal hydatid cyst: medical treatment. ( Cabral, MJ; Carmona, L; Couto, C; Soares, AT; Vieira, I, 2016) |
| "Liver and lung hydatid disease accounts for 90% of all echinococcal cysts." | 1.43 | A primary subcutaneous hydatid cyst in the thigh A case report. ( Augello, G; Cocorullo, G; Di Carlo, P; Falco, N; Gulotta, G; Licari, L; Randisi, B; Raspanti, C; Salamone, G; Tutino, R, 2016) |
| "This is a case of an isolated hydatid cyst of breast in an 18-year old woman from the Amhara region, Ethiopia." | 1.43 | A RARE CASE OF HYDATID CYST DISEASE OF THE BREAST: A CASE REPORT AND REVIEW OF LITERATURE. ( Bekele, A; Firew, A, 2016) |
| "Human hydatid disease (cystic echinococcosis, CE) is a chronic parasitic infection caused by the larval stage of the cestode Echinococcus granulosus." | 1.43 | Construction of In Vivo Fluorescent Imaging of Echinococcus granulosus in a Mouse Model. ( Chen, X; Guo, J; Hou, J; Wang, S; Wang, X; Wu, X; Xia, J; Yang, T; Zhang, H; Zhang, X, 2016) |
| "The osthole- and ABZ-treated groups presented a significant reduction in wet weight of metacestodes, increase in the level of interleukin (IL)-4 and the percentage of eosinophils compared with the control group." | 1.43 | Efficacy of osthole for Echinococcus granulosus in vitro and Echinococcus multilocularis in vivo. ( Gao, H; Jing, T; Luo, Y; Xin, Q; Yuan, M; Zhang, G, 2016) |
| "Multiple hydatid cysts in the liver rarely occur in the pediatric population." | 1.42 | Surgical treatment of multiple hydatid cysts in the liver of a pediatric patient. ( Jiang, Y; Liu, G; Lv, H; Peng, X; Zhang, S, 2015) |
| "Isolated pancreatic hydatid cysts are a rare parasitic disease even in endemic areas." | 1.42 | Incidental isolated pancreatic hydatid cyst. ( Atamanalp, SS; Aydınlı, B; Kısaoğlu, A; Korkut, E; Özoğul, B; Pirimoğlu, B, 2015) |
| "While hepatic hydatid cysts are most common in occurrence, intracranial hydatid cyst is less common." | 1.42 | Simultaneous giant hydatid cysts of brain and liver. ( Ijaz, L; Mirza, B; Nadeem, MM; Saleem, M, 2015) |
| "Echinococcosis or hydatidosis is a zoonosis caused by cestodes from the genus Echinococcus; its habitat is the small intestine of the definitive host, represented by dogs/carnivorous animals, where it produces eggs which are eliminated in the environment." | 1.42 | The management of abdominal hydatidosis after the rupture of a pancreatic hydatid cyst: a case report. ( Bîrluţiu, RM; Bîrluţiu, V, 2015) |
| "Cardiac hydatid cyst is its rare manifestation." | 1.42 | Isolated cardiac hydatid cyst. ( Rehman, AU; Shahid, R; Shakil, U, 2015) |
| "Albendazole treatment was applied in preoperative and postoperative period to decrease local recurrence risk." | 1.42 | Gluteal Hydatid Cyst: Report of a Case. ( Kesici, S; Kesici, U; Zeren, S, 2015) |
| "Thymol (40 mg/kg) was administered under two different therapeutic schemes: dosing every 24h over 20 days and treatment every 12h for 10 days." | 1.42 | Chemoprophylactic and therapeutic efficacy of thymol in murine cystic echinococcosis. ( Denegri, G; Elissondo, MC; Maggiore, M; Pensel, PE, 2015) |
| "Echinococcosis is produced by the larval stage of Echinococcus granulosus; it is a parasitic disease which is seen rarely in humans and has adverse outcomes." | 1.42 | Eradication of advanced pelvic hydatid bone disease after limb salvage surgery - 5-year follow-up: a case report. ( Hashmi, PM; Khan, D; Khan, MS, 2015) |
| "The child was treated surgically and hydatid cyst of pancreas was found." | 1.42 | Isolated hydatid cyst of the pancreas masquerading as pancreatic pseudocyst. ( Chinya, A; Khanolkar, A; Kumar, J; Sinha, SK, 2015) |
| " CS-MPs As a new carrier exhibited improved absorption and increased bioavailability of ABZ in the treatment of E." | 1.42 | Efficacy of Albendazole-Chitosan Microsphere-based Treatment for Alveolar Echinococcosis in Mice. ( Abulaihaiti, M; Aduwayi, N; Lv, HL; Peng, XY; Qiao, L; Wang, XC; Wang, YJ; Wu, XW; Zhang, HW, 2015) |
| "We describe a case of isolated orbital hydatid disease." | 1.42 | Isolated primary orbital hydatid disease presenting as multiple cystic lesions: a rare cause of proptosis. ( Anandpara, KM; Aswani, Y; Hira, P; Sathe, PA, 2015) |
| "It was emphasized that once a hydatid cyst was diagnosed, family screening became important, in endemic regions in particular." | 1.42 | [Four Hydatid Cysts in One Family: Is Family Screening Necessary?]. ( Akpınar, F; Aydın, Ç; Birsen, O; Gürses, D; Herek, Ö; Karadağlı, E, 2015) |
| "Mediastinal hydatidosis is seen less than 0." | 1.40 | Primary mediastinal hydatid cysts. ( Tulay, CM, 2014) |
| "Primary hydatid cyst of the skeletal muscle is very rare and accounts for less than 1% of all cases." | 1.40 | Primary hydatid disease of brachialis and biceps brachii muscles: a case report. ( Acar, MA; Aydin, BK; Demir, NA; Erkocak, OF; Sumer, S; Ural, O, 2014) |
| "Cystic echinococcosis is a world wild zoonosis caused by Echinococcus granulosus, leading to hepatic and lung cysts with a usually slight growth rate." | 1.40 | Unusual growth rate during cystic echinococcosis. ( Cotte, E; Della-Schiava, N; Durieu, I; Durupt, S; Guibert, B; Khenifer, S; Valour, F; Wallon, M, 2014) |
| "Most (29 patients) had a hepatic hydatid cyst and underwent partial cystectomy with omentoplasty; surgery was open in 22 cases (73%), laparoscopic in six cases (20%) and laparoscopic converted to open in one case (3%); one patient with a splenic cyst underwent open splenectomy." | 1.40 | Abdominal echinococcosis: outcomes of conservative surgery. ( Chandra, A; Masood, S; Pandey, A, 2014) |
| "The spinal column is rarely affected by hydatid cyst; however, when involved, it has higher rates of recurrence particularly in case of osseous and paravertebral extensions." | 1.40 | Long-term disseminated recurrence in spinal hydatid cyst: a case report. ( Ayan, E; Berkman, MZ; Emon, ST; Somay, H; Turk, CC, 2014) |
| "Intra-peritoneal rupture of hydatid cyst is a rare complication and there is no consensus about its treatment." | 1.40 | Asymptomatic intra-peritoneal rupture of hydatid cyst of the liver: case report. ( Aalala, M; Ahallat, M; Elalaoui, M; Hrora, A; Majbar, AM; Raiss, M; Sabbah, F, 2014) |
| "Cystic echinococcosis is a chronic, complex, and still neglected disease." | 1.40 | Enhanced chemoprophylactic and clinical efficacy of albendazole formulated as solid dispersions in experimental cystic echinococcosis. ( Allemandi, D; Bruni, SS; Castro, S; Elissondo, MC; Palma, SD; Pensel, PE, 2014) |
| "Primary pleural hydatidosis is an extremely rare entity and we present a ruptured pleural hydatid cyst with unusual location." | 1.40 | A rare cause of pleural effusion: ruptured primary pleural hydatid cyst. ( Alkan, S; Erkoç, MF; Okur, A; Öztoprak, B, 2014) |
| "Hydatid disease is an endemic infection which can affect any organ, mainly the liver and lungs." | 1.40 | Isolated hydatid cyst of uterine cervix: A case report. ( Çaydere, M; Doğan, AÇ; Ergün, Y; Karcaaltincaba, D; Küçük, H; Küçük, Z, 2014) |
| " In this work, we analyze the adverse effects seen in 57 patients diagnosed with hydatidosis who were treated with praziquantel plus albendazole combined therapy between 2006 and 2010." | 1.40 | Safety of the combined use of praziquantel and albendazole in the treatment of human hydatid disease. ( Alvela-Suárez, L; Belhassen-Garcia, M; Cordero-Sánchez, M; Novo-Veleiro, I; Pardo-Lledías, J; Pérez del Villar, L; Romero-Alegría, A; Valverde-Merino, MP; Velasco-Tirado, V, 2014) |
| "Hydatid cysts are an endemic disease in our country and it should be kept in mind that they also have atypical localizations." | 1.40 | [Primary retroperitoneal hydatid cyst]. ( Çakır, M; Gündeş, E; Küçükkartallar, T, 2014) |
| "Hydatid disease is endemic in parts of India, yet genitourinary involvement is rare." | 1.40 | Laparoscopic management of a hydatid cyst of the adrenal gland. ( Gowda, KK; Kumar, S; Nanjappa, B, 2014) |
| "multiflora AW on development of hydatid cysts, the 40 infected mice were allocated into three treatment groups, including the albendazole group (10 mice that received 150 mg/kg body weight/day for 10 days), the Z." | 1.40 | In vivo study of the efficacy of the aromatic water of Zataria multiflora on hydatid cysts. ( Ansary Lari, M; Larki, S; Moazeni, M; Mootabi Alavi, A; Oryan, A; Saharkhiz, MJ, 2014) |
| "multiflora extract on development of hydatid cyst, the 40 infected animals were allocated into three treatment groups including Z." | 1.40 | Preventive and therapeutic effects of Zataria multiflora methanolic extract on hydatid cyst: an in vivo study. ( Larki, S; Moazeni, M; Oryan, A; Saharkhiz, MJ, 2014) |
| "The location of hydatid cysts in the tibia is seldom described in the medical literature, and its diagnosis is challenging and often presenting with a pathologic fracture simulating benign bone cystic lesion." | 1.40 | Tibial hydatidosis: a case report. ( Abraha, AH; Gebremariam, TT; Kassa, BG; Yeshi, MM, 2014) |
| "As a conclusion, in endemic areas, hydatid cysts should be considered for the diagnosis of a patient with cystic mass lesions." | 1.40 | Giant isolated mesenteric hydatid cyst case report without organ involvement. ( Akar, I; Cermik, H; Coşar, A; Diktaş, H; Kabalak, B; Tüfekçi, H; Velioğlu, M; Yalçin, B, 2014) |
| "We report a case diagnosed as hydatid disease of the chest wall and treated with radiation therapy (RT) after medical and surgical therapy had failed." | 1.39 | Radiation therapy for resistant sternal hydatid disease. ( Aydin, E; Aydınkarahaliloğlu, E; Barut, H; Gokcek, A; Karaoğlanoğlu, N; Tunc, M; Ulger, S, 2013) |
| "Only one patient had spinal hydatidosis." | 1.39 | Primary intracranial and spinal hydatidosis: a retrospective study of 21 cases. ( Luo, DH; Luo, K; Wen, H; Zhang, TR, 2013) |
| "Osseous hydatidosis is a very severe and recurrent complication of hydatidosis." | 1.39 | Two cases of femoral hydatidosis secondary to canine tapeworm treated by albendazole and prosthetic reconstruction. ( Dupouy-Camet, J; Leslé, F; Magrino, B; Sailhan, F, 2013) |
| "Renal hydatid disease is rare in children." | 1.39 | Video-assisted surgery in the management of hydatid renal cyst in children. ( Belguith, M; Chahed, J; Kerkeni, Y; Krichéne, I; Ksiaa, A; Laamiri, R; Maazoun, K; Mekki, M; Nouri, A; Sahnoun, L; Zitouni, H; Zrig, A, 2013) |
| "Vertebral hydatid cysts are found in <1% of all cases of hydatidosis." | 1.39 | Spinal manifestation of hydatid disease: a case series of 36 patients. ( Al-Zain, F; Al-Zain, T; Kafaji, A; Lemcke, J, 2013) |
| "We report a case of renal hydatidosis in a five-year-old child treated in a tertiary pediatric hospital in Argentina." | 1.39 | A five-year-old child with renal hydatidosis. ( Altcheh, J; Freilij, H; García Bournissen, F; Moroni, S; Moscatelli, G; Salgueiro, F, 2013) |
| "Herein, we report an isolated cardiac hydatid cyst in an 87-year-old man." | 1.39 | Inoperable isolated cardiac hydatid cyst controlled with albendazole in an older adult with dementia. ( Ariogul, S; Cankurtaran, M; Etgül, S; Halaçli, B; Halil, M; Hazirolan, T; Kuyumcu, ME; Sunman, H; Yavuz, BB; Yesil, Y, 2013) |
| "Hydatid disease is a life-threatening parasitic infestation caused by Echinococcus granulosus." | 1.39 | Primary multiple cerebral hydatid disease: still symptomatic despite pathologically confirmed death of the cyst. ( Akcakaya, MO; Aras, Y; Aydoseli, A; Hepgul, K; Imer, M; Sencer, A; Yaka, U, 2013) |
| "We report a case of an isolated hydatid cyst localized in the anterior triangle of the neck without any pulmonary or hepatic involvement." | 1.39 | Primary hydatid cyst of the neck. ( Faridi, N; Haroon, S; Mujtaba, SS, 2013) |
| "To the best of our knowledge, renal failure has never been reported in the literature as clinical manifestation of intrarenal hydatid cyst in adult population." | 1.39 | Renal failure: unusual clinical presentation of an isolated intrarenal hydatid cyst. ( Biyabani, SR; Nadeem, M; Pervez, S, 2013) |
| "However, hydatid disease of lesser sac in itself is a rare entity and its treatment with PAIR procedure has not been described before." | 1.39 | Successful treatment of hydatid cyst of lesser sac with PAIR therapy. ( Fayyaz, A; Ghani, UF, 2013) |
| "The present study reports three cases of hydatid cysts of the thyroid gland, in patient ranging from 18 to 25 years of age." | 1.39 | Hydatid cyst of the thyroid gland: report of three cases. ( Akbulut, S; Arabaci, E; Kayaalp, C; Sogutlu, G; Yilmaz, M, 2013) |
| "Isolated cardiac involvement in hydatid disease is very rare." | 1.39 | Left ventricular hydatid cyst: an uncommon cause of chest pain in young adults. ( Bhat, P; Moorthy, N; Nanjappa, MC; Shankarappa, RK, 2013) |
| "Bone involvement of hydatid disease is uncommon but when encountered, it presents few unique pathological features." | 1.39 | Multi-organ hydatidosis with extensive involvement of the hemi-pelvis and ipsilateral femur. ( Bharadwaj, M; Kapoor, S; Kapoor, SK; Kataria, H; Patra, SR; Vijay, V, 2013) |
| " Combined surgery and continuous administration of albendazole at high dosage may allow alveolar echinococcosis patients to survive more than 30 years after diagnosis despite multi-organ involvement." | 1.39 | 30-yr course and favorable outcome of alveolar echinococcosis despite multiple metastatic organ involvement in a non-immune suppressed patient. ( Bardonnet, K; Blagosklonov, O; Bresson-Hadni, S; Delabrousse, E; Grenouillet, F; Mantion, GA; Miguet, JP; Vuitton, DA, 2013) |
| "With hydatid cyst, the skeletal muscles and diaphragm are rarely affected, and hepatic and pulmonary hydatid cysts are far more common." | 1.38 | Co-occurrence of diaphragmatic and serratus anterior muscle hydatidosis: an unusual localization. ( Aydın, S; Cece, H; Kürkcüoglu, IC; Ozgonul, A; Sogut, O, 2012) |
| "Overall, the recurrence rate appears to be high (4." | 1.38 | Postoperative recurrence of cystic hydatidosis. ( Anthimidis, G; Fachantidis, E; Kapoutzis, K; Karamanlis, E; Kosmidis, C; Prousalidis, J, 2012) |
| "Albendazole was administered postoperatively in all cases." | 1.38 | Costal hydatidosis: management and outcome of five cases. ( Arsalane, A; El Hammoumi, M; El Oueriachi, F; Kabiri, el H; Traibi, A, 2012) |
| "Nine patients presented with hydatid disease of the spine between September 2001 and October 2010." | 1.38 | Hydatid disease of the spine: a report on nine patients. ( Hamdan, TA, 2012) |
| "Neurological examination revealed sixth nerve palsy and papilloedema." | 1.38 | [Two cases of rare cerebral hydatid cyst]. ( Işıkay, S; Ölmez, A; Yılmaz, K, 2012) |
| "Echinococcosis is a zoonotic infection, affecting humans in a characteristic geographic distribution." | 1.38 | Primary axillary hydatid cyst. ( Arsalane, A; Darbi, A; El Hammoumi, M; El Oueriachi, F; Kabiri, el H; Traibi, A, 2012) |
| "We present a case of a hydatid cyst with rib involvement in a 57-year-old man presented with thoracic pain and swelling mimicking chest wall tumor." | 1.38 | Pseudotumoral hydatid cyst of chest wall. ( Alloubi, I; Chadmi, T; Ezerrouki, A, 2012) |
| " In addition, dosing mice with the albendazole-honey mixture for 8 wk had antiparasitic activity comparable to earlier studies using gavage for drug administration." | 1.38 | Voluntary ingestion of antiparasitic drugs emulsified in honey represents an alternative to gavage in mice. ( Gottstein, B; Hemphill, A; Hermann, C; Küster, T; Theurillat, R; Thormann, W; Zumkehr, B, 2012) |
| "Intracranial hydatid cysts are more common in children and occur more frequently in the supratentorial space." | 1.38 | Hydatid cyst of the ambient cistern radiologically mimicking an arachnoid cyst. ( Gürer, B; Kertmen, H; Sanlı, AM; Türkoğlu, E, 2012) |
| "Cerebral hydatid disease is approximately 5% of alveolar hydatid cases and generally considered to be fatal." | 1.38 | Echinococcus alveolaris: presenting as a cerebral metastasis. ( Binici, DN; Kurt, A; Ozdemir, NG; Ozsoy, KM, 2012) |
| "We report a case of primary cervical hydatid cyst in 20 year old female." | 1.38 | Primary cervical hydatid cyst: a rare occurrence. ( Hashim, TK; Jan, SY; Khan, Z; Malik, T; Shah, W; Sultana, N, 2012) |
| "Serological testing revealed hydatid disease." | 1.38 | Primary retroperitoneal echinococcal cyst. ( Ananiadis, A; Barbanis, S; Gavriilidis, P; Theodoulidis, V, 2012) |
| "The incidence rate of cystic echinococcosis cases decreased from 38×100,000 in 1980 to 3." | 1.37 | Programme for ultrasound diagnoses and treatment with albendazole of cystic echinococcosis in asymptomatic carriers: 10 years of follow-up of cases. ( Araya, D; Del Carpio, M; Herrero, E; Labanchi, JL; Larrieu, E; Mancini, S; Mercapide, CH; Moguilensky, J; Mujica, G; Odriozola, M; Panomarenko, H; Salvitti, JC; Sustercic, J; Talmon, G; Uchiumi, L; Volpe, M, 2011) |
| "Spinal hydatid cyst is a serious and unusual infectious disease." | 1.37 | Primary spinal hydatid cyst in a patient with acquired immunodeficiency syndrome. ( Erayman, I; Erdi, F; Esen, H; Kalkan, E; Kerimoglu, Ü, 2011) |
| "Albendazole treatment has been found to be ineffective in some instances, is parasitostatic rather than parasiticidal, and usually involves the lifelong uptake of large doses of drugs." | 1.37 | In vitro and in vivo efficacies of mefloquine-based treatment against alveolar echinococcosis. ( Hemphill, A; Hermann, C; Keiser, J; Küster, T; Scholl, S; Stadelmann, B, 2011) |
| "The most frequent location of hydatid cystic lesions is in the liver (up to 80% of cases), followed by the lung (about 20% of cases), and with lower reported incidence, virtually in any other organ or tissue in the body." | 1.37 | Hydatid cyst disease: optimal management of complex liver involvement. ( Ahmed, MY; Gociman, B; Gupta, V; Moore, J, 2011) |
| "Cystic hydatidosis is a zoonosis endemic both to Sicily and other Mediterranean areas." | 1.37 | Cystic hydatidosis: a rare case of spine localization. ( Di Carlo, P; Giordano, S; Li Pani, G; Marasa, L; Odierna, A; Romano, A; Saporito, L; Scaglione, V; Scarlata, F, 2011) |
| "Hydatid disease is a zoonosis resulting from the growth in man of the larval form of Echinococcus granulosus." | 1.37 | [Hydatid disease of the ribs]. ( Achir, A; Alaziz, AS; Benosman, A; Bouchikh, M; Lakranbi, M; Msougar, Y; Ouadnouni, Y; Smahi, M, 2011) |
| "Pelvic hydatid cysts, although rare, must be considered when evaluating a pelvic mass in women living in an endemic area." | 1.37 | Infected tuboovarian hydatid cyst: a rare cause of tuboovarian abcess. ( Bolat, F; Haydardedeoglu, B; Parlakgumus, A; Parlakgumus, HA, 2011) |
| "It is extremely rare though hydatid cyst may affect every organ in human body." | 1.37 | Case report of primary retroperitoneal hydatid cyst. ( Liu, W; Mao, Y; Wang, X; Yang, G, 2011) |
| "Isolated renal echinococcosis is a rare acquired disease of the kidney, caused by the parasite Echinococcus." | 1.37 | A case of large renal hydatid cyst. ( Garge, S; Shukla, A; Verma, P, 2011) |
| "Both cystic echinococcosis (CE) and tuberculosis (Tbc) are important health problems in developing countries." | 1.37 | [Cystic echinococcosis mimicking tuberculosis in childhood]. ( Cobanoğlu, N; Doğru, D; Kiper, N; Köse, M; Ozçelik, U; Pekcan, S; Yalçın, E, 2011) |
| "Multiple thoracic hydatid disease is rare." | 1.37 | [Multiple pulmonary hydatid disease with cardiovascular localisation]. ( Afif, H; Aichane, A; Berrada, Z; Bouayad, Z; Khattabi, WE; Rhissassi, J, 2011) |
| "Primary extrahepatic hydatid cysts are rare, and primary splenic hydatid cysts even more so, constituting 2% to 3." | 1.37 | Primary splenic hydatidosis. ( Malik, AA; Rather, AA; ul Bari, S; Wani, KA; Younis, M, 2011) |
| "A cardiac hydatid cyst in pregnancy is a very rare condition." | 1.37 | A pericardial hydatid cyst and pregnancy. ( Altay, H; Erol, T; Tarim, E, 2011) |
| "While diaphragmatic hydatid disease is a rare condition, subcutaneous extension of the disease is very rare." | 1.37 | Primary hydatid disease of diaphragm with subcutenous extension. ( Böyük, A; Gümüş, H; Gümüş, M; Kapan, M; Onder, A; Yağmur, Y, 2011) |
| "Two forms of parasitic echinococcus infection widely responsible for infection in humans are Echinococcus granulosus and Echinococcus multilocularis." | 1.37 | Treatment of a case of mesangioproliferative glomerulonephritis secondary to Echinococcus alveolaris with albendazole. ( Arslan, M; Cansiz, M; Cansu, A; Kaynar, K; Köseoğlu, R; Mungan, S; Ozkan, G; Ulusoy, S, 2011) |
| "Disseminated intra-abdominal hydatid disease may occur with the rupture of the hydatid cyst into the peritoneal cavity, producing secondary echinococcosis." | 1.37 | Primary bilateral intrapelvic hydatid cyst presenting with adnexal cystic mass: a case report. ( Alimohamadi, S; Dehghan, A; Neghab, N, 2011) |
| "Albendazole treatment was begun after the operation." | 1.37 | [Primary pancreatic hydatid cyst resembling a pseudocyst]. ( Aksoy, F; Cakır, M; Küçükkartallar, T; Özalp, AH; Tekin, A; Yıldırım, MA, 2011) |
| "Treatment with Albendazole began after diagnosis during the postoperative period." | 1.37 | Primary cyst hydatid in the neck; report of one case. ( Burakgazi, G; Duman, A; Kesici, S; Kesici, U; Türkmen, ÜA; Ulusoy, H; Yavuz, E, 2011) |
| "Cystic hydatid disease results from infection with the larval or adult form of the Echinococcus granulosus tapeworm." | 1.37 | Large cardiac hydatid cyst in the interventricular septum. ( Balkanay, OO; Baskurt, M; Engin, E; Goksedef, D; Ipek, G; Kanbur, E; Kucukoglu, S; Omeroglu, SN, 2011) |
| "We believe that hydatid disease should be suspected when a patient from an endemic area presents with fever and cough, supposedly representing as community acquired pneumonia, unresponsive to empiric antibiotic treatment." | 1.37 | [Pneumonia unresponsive to treatment? A case report of intrathoracic hydatid cyst]. ( Ben, SS; Greenberg, D, 2011) |
| "Primary musculoskeletal hydatidosis is less frequent than hydatidosis of the parenchymal organs." | 1.36 | Giant primary muscular hydatid cyst with a secondary bone localization. ( Garofalo, R; Moretti, B; Moretti, L; Notarnicola, A; Panella, A, 2010) |
| "We report a very rare case of a hydatid cyst in the infratemporal fossa, causing visual loss over a 10-day period, which disappeared with rapid surgical and medical treatment." | 1.36 | Infratemporal hydatid cyst: a case presenting with blindness. ( Basam, A; Hasibi, M; Heidarali, M; Mokhtari, Z; Sharif Kashani, S; Yazdani, N, 2010) |
| "Bone hydatid disease is a rare pathology, characterized by its long clinical latency, the absence of radiological specificity as well as its challenging surgical treatment." | 1.36 | Pelvic bone hydatidosis. ( Ayedi, K; Bouzidi, R; Ellouze, Z; Gdoura, F; Keskes, H; Trigui, M; Zribi, W, 2010) |
| "We report a case of recurring femoral hydatid disease in a trisomic-21 patient 5 years after a primary surgery." | 1.36 | Recurrence of femoral echinococcosis 5 years after a primary surgical procedure. ( Bernard, E; Boileau, P; Gaertner, E; Pelegri, C; Trojani, C, 2010) |
| "The diagnosis of hydatid cyst was made based on his history and on pre-operative MRI and was confirmed by surgery and histopathological examination." | 1.36 | Skull base hydatid cyst with intracranial extension presenting as vocal cord palsy: a case report. ( Eapen, A; Keshava, SN; Sarawagi, R; Sureka, J; Vedantam, R, 2010) |
| "We present two unusual cases of hydatid cyst found in the posterior cervical region and in the breast." | 1.36 | Hydatid cysts at unusual sites: reports of two cases in the neck and breast. ( Ahmad, S; Chughtai, N; Jalil, S; Saleem, Y; Suleman, BA, 2010) |
| "Cardiac hydatidosis is an uncommon but potentially fatal disease." | 1.36 | Surgical treatment of cardiac hydatid disease in 13 patients. ( Aksut, M; Donmez, AA; Mataraci, I; Tas, SG; Tuncer, A; Tuncer, E; Yakut, C, 2010) |
| "We report 11 cases of cardiac hydatidosis who were treated medically and surgically." | 1.36 | Combined medical and surgical treatment of intracardiac hydatid cysts in 11 patients. ( Abbasi, M; Dastani, M; Ghahramani, S; Javan, H; Moghaddam, AA; Molavipour, A, 2010) |
| "Cardiac hydatidosis was diagnosed because of both the typical radiological findings and the positive serology for echinococcosis." | 1.36 | Cardiac hydatidosis. ( Collart, F; Grisoli, D; Jacquier, A; Lagier, JC; Neuville, M; Nicoud, A; Parola, P; Thomas, P, 2010) |
| "Association of nephrotic syndrome is described in pulmonary and hepatic hydatid cysts, but never reported in intracranial hydatidosis." | 1.36 | Primary extradural hydatid cyst associated with nephrotic syndrome in a pediatric patient. ( Brar, R; Khosla, VK; Sharma, T, 2010) |
| "vogeli andE." | 1.36 | A medically treated multiple cerebral hydatid cyst disease. ( Altas, M; Aras, M; Davran, R; Evirgen, O; Serarslan, Y; Yilmaz, N, 2010) |
| "We report a case of right ventricle hydatid cyst detected after syncopal attack in a pregnant woman by using echocardiography." | 1.35 | Hydatid cyst of the right ventricle in early pregnancy. ( Abbasi, A; Marzban, M; Sahebjam, M; Shirani, S; Soleimani, A, 2008) |
| "We report and discuss a case of primary hydatidosis of the pelvic cavity in a woman who presented with severe weight loss and abdominal pain." | 1.35 | Hydatidosis of the pelvic cavity: a big masquerade. ( Darabi, M; Larijani, T; Makhmalbaf, AO; Mousavi, SM; Nabavizadeh, SA; Saadat Mostafavi, SR; Saedi, D; Salouti, R; Samimi, K; Varedi, P, 2008) |
| "We report a case of primary hydatidosis of the proximal thigh involving both the soft tissues and the proximal femur in a 59-year-old man." | 1.35 | Primary hydatid cyst of the root of the thigh: a case report and review of the literature. ( Bacchini, P; Garagnani, L; Rimondi, E; Sudanese, A, 2008) |
| "Primary hydatid cyst of the parotid gland is extremely rare, even in the endemic areas." | 1.35 | Hydatid cyst of the parotid gland. ( Darabi, M; Erfan, A; Mahmoodi, S; Mohebi, AR; Mousavi, SM; Nabavizadeh, SA; Ostadali Makhmalbaf, A; Saadat Mostafavi, SR; Saedi, D; Varedi, P, 2009) |
| "Alveolar echinococcosis is a zoonosis which infects primarily the liver, and secondary involvement of other organs is common." | 1.35 | Isolated alveolar echinococcosis of the spleen - clinical presentation and management review. ( Azagury, DE; Groebli, Y; Karenovics, W, 2008) |
| "Cystic echinococcosis (hydatidosis, hydatid disease) belongs to the group of the most severe parasitic diseases of man and is caused by metacestodes (larvae) of Echinococcus granulosus." | 1.35 | Primary cystic echinococcosis in the subcutaneous gluteal region - a case report. ( Auer, H; Steurer, S, 2008) |
| "Hydatid disease is a parasitic infection caused by larvae of Echinococcus granulosus, which is still endemic in many cattle-raising areas." | 1.35 | Giant hydatid cyst of the interventricular septum mimicking acute myocardial infarction on ECG: an unusual cause of ST segment elevation. ( Degertekin, M; Ergenoglu, M; Eroglu, E; Gemici, G; Kucukaksu, S; Yildiz, C, 2009) |
| "Cerebral hydatidosis accounts for approximately 1-3% of all cases of hydatid disease." | 1.35 | Cranial epidural hydatid cysts: clinical report and review of the literature. ( Cemil, B; Gurcay, AG; Kaptanoglu, E; Tun, K; Uygur, A, 2009) |
| "Spillage of a hydatid cyst was previously reported in a symptomatic case of primary spinal hydatid disease." | 1.35 | Spontaneous drainage of an asymptomatic recurrent hydatid cyst of the sacrum. ( Ozer, AF; Sasani, M, 2009) |
| "Echinococcosis is a widespread zoonosis which is endemic in most sheep-raising countries." | 1.35 | [Isolated echinococcosis of the flexor digitorum profondus: a case report]. ( Amar, MF; Boutayeb, F; Chakour, K; Chbani, B; Daoudi, A; Elibrahimi, A; Elmrini, A; Lahrach, K; Loudiyi, WD; Shimi, M, 2009) |
| "Especially in the endemic areas, hydatid cyst should be remembered when evaluating cystic masses in the retroperitoneum." | 1.35 | [Giant retroperitoneal hydatid cyst]. ( Baumert, H; Campeggi, A; Chabenne, J; Iliescu, B; Kreitmann, L; Massoud, W; Molinie, V; Saheb, N, 2009) |
| "Primary intradural extramedullary hydatid disease is extremely rare; a 13-year-old girl with primary intradural hydatid cyst who presented with symptoms of paraparesis is discussed in this article." | 1.35 | A very rare cause of childhood paraparesis: primary intradural extramedullary spinal hydatid cyst. ( Gökçe, S; Midyat, L; Mir, S; Mursalov, G; Onder, A; Ozdemir, Y, 2009) |
| "Hydatidosis is one of the most important zoonotic parasitic diseases of Mediterranean and South American countries where they constitute a significant health problem." | 1.35 | [Hydatid disease in the Department of Health #2 of the Valencian Community (Spain)]. ( Moreno, J; Pardo, FJ; Téllez, CJ, 2009) |
| "Herein, we present a case of primary hydatid cyst occurring in the infratemporal fossa, which is an extremely rare localization." | 1.35 | Primary hydatid cyst of the infratemporal fossa. ( Baglam, T; Durucu, C; Kanlikama, M; Kara, F; Karatas, E; Sirikci, A, 2009) |
| "Cerebral hydatidosis is a rare larval infection of the central nervous system affecting mostly the children and young adults." | 1.35 | Gradual and complete delivery of a hydatid cyst of the brain through a single burr hole, a wrong happening! ( Abbassioun, K; Amirjamshidi, A; Anvari, M, 2009) |
| "He had undergone two hepatic hydatid cystectomy operations." | 1.35 | [Case report: secondary pleural hydatidosis]. ( Balci, AE; Cakmak, M; Koçyiğit, S; Ozsoy, IE; Ozyurtkan, MO, 2009) |
| "Spinal hydatid cyst is a serious form of hydatid disease affecting fewer than 1% of all patients with hydatid disease." | 1.35 | Spinal intradural extramedullary hydatidosis: report of three cases. ( Arkha, Y; Derraz, S; El Khamlichi, A; El Ouahabi, A; Lakhdar, F; Rifi, L, 2009) |
| "Albendazole treatment was markedly to moderately effective against hepatic and pulmonary AE lesions in both cases, whereas it had almost no effect against the bone lesion in one case." | 1.35 | Serological monitoring of progression of alveolar echinococcosis with multiorgan involvement by use of recombinant Em18. ( Ishikawa, Y; Ito, A; Itoh, S; Kohgo, Y; Matsuno, T; Miyokawa, N; Nakao, M; Nakaya, K; Ohsaki, Y; Ohtake, T; Sako, Y, 2009) |
| "We report a patient with bone hydatid disease that was refractory to both long-term daily treatment with albendazole, combined with cimetidine or administered as monotherapy ( approximately 15 years) and a relatively short course of nitazoxanide combined with albendazole (3 months)." | 1.35 | Bone hydatid disease refractory to nitazoxanide treatment. ( Schipper, HG; Simsek, S; van Agtmael, MA; van Lienden, KP, 2009) |
| "Echinococcus oligarthrus hydatid cyst disease was diagnosed in two imported wild-caught Brazilian agouti (Dasyprocta leporina)." | 1.35 | Echinococcus oligarthrus cystic hydatidosis in Brazilian agouti (Dasyprocta leporina). ( Douglass, M; Greiner, EC; Reavill, DR; Zimmerman, DM, 2009) |
| "The diagnosis of a hydatid cyst was confirmed by histopathology." | 1.35 | Giant hydatid cyst of spleen: a case report. ( Aypak, A; Cabadak, H; Erbay, A; Sen, S; Tekçe, AY, 2009) |
| "Therefore, metastastic colon cancer was suspected." | 1.35 | [Hydatid cyst of the chest wall mimicking metastatic colon cancer]. ( Ayadi, A; Ben M'rad, S; Ben Saad, S; Daghfous, H; Merai, S; Toujani, S; Tritar, F; Zendah, I, 2009) |
| "Only 0." | 1.35 | Hydatid cyst of the cranial vault. ( Bellil, K; Bellil, S; Chelly, I; Haouet, S; Kallel, J; Kchir, N; Limaiem, F; Mekni, A; Zitouna, M, 2009) |
| "Medical therapy for hydatid disease of the brain has been reported with encouraging results especially in small or medium-sized cysts." | 1.35 | Metabolic changes during successful medical therapy for brain hydatid cyst: case report. ( Kars, HZ; Seckin, H; Yagmurlu, B; Yigitkanli, K, 2008) |
| "The standard therapy of hydatid cyst is surgery but, in nonoperable patients and multiple organ involvement, medical therapy may be more useful." | 1.35 | The effect of combination therapy with albendazole and praziquantel on hydatid cyst treatment. ( Jamshidi, A; Jamshidi, M; Mohraz, M; Zangeneh, M, 2008) |
| "Furthermore, the rarity of muscle hydatidosis has unique implications in diagnosis and management." | 1.35 | Primary hydatidosis of the gluteus muscles: report of three cases. ( Bramis, C; Filis, K; Katergiannakis, V; Kekis, P; Lagoudianakis, EE; Larentzakis, A; Manouras, A; Markogiannakis, H, 2009) |
| " The authors treated the disseminated disease successfully with total T7-8 corpectomy, grafting with titanium cage and Texas Scottish Rite Hospital instrumentation, and long-term administration of albendazole (400 mg daily)." | 1.35 | Disseminated intraspinal hydatid disease. ( Farzanegan, G; Hashemi, F; Kharazi, HH; Moharamzad, Y; Namavari, A; Shobeiri, E, 2008) |
| "The pharmacokinetic (PK) behaviour and clinical efficacy of albendazole (ABZ) against hydatid cysts in mice were assessed after treatment with two different ABZ pharmaceutical formulations." | 1.35 | Albendazole treatment in cystic echinococcosis: pharmacokinetics and clinical efficacy of two different aqueous formulations. ( Alvarez, L; Ceballos, L; Denegri, G; Dopchiz, M; Elissondo, C; Lanusse, C; Moreno, L; Sánchez Bruni, S, 2008) |
| "The vertebral hydatidosis is uncommon." | 1.34 | An extensive vertebral hydatidosis revealed by a lumbosciatica. ( Bahiri, R; Benbouazza, K; Hajjaj-Hassouni, N; Rkain, H, 2007) |
| "Osseous hydatidosis (Echinococcus infection) is a rare parasitic bone infection that poses challenges in diagnosis and treatment." | 1.34 | Case report: Echinococcus disease of the bone presenting as a femoral shaft nonunion. ( Gardner, MJ; Grose, A; Helfet, DL; Mattern, CJ, 2007) |
| "Primary cardiac hydatid cysts are rarely diagnosed and seldom rupture to lungs via pulmonary vein resulting in multifocal cystic lesions." | 1.34 | Recurrent pulmonary microemboli secondary to primary cardiac hydatidosis. ( Demirbag, R; Ozturk, A; Ozturk, E; Temamogullari, AV; Zeyrek, F, 2007) |
| "Echinococcosis, or hydatid disease, of the craniovertebral junction and skull base is rare." | 1.34 | Diagnosis and treatment of multiple hydatid cysts at the craniovertebral junction. Case report. ( Lath, R; Ranjan, A; Ratnam, BG, 2007) |
| " Some adverse effects of albendazole are known." | 1.34 | Genotoxic effect of albendazole in pediatric patients with hepatic hydatid disease. ( Ertek, M; Kursad, H; Ocak, Z; Oztas, S; Salman, AB; Tatar, A; Yazgi, H; Yesilyurt, A; Yigiter, M, 2007) |
| "The primary bone hydatidosis is rare." | 1.34 | [Hydatid disease of bone: a report of 2 cases]. ( Abid, A; Bel Hadj Youssef, D; Ben Rhomdhane, F; Bouzouaia, N; Chakroun, M; Loussaief, C, 2007) |
| "Hydatid disease is a parasitic infection caused by Echinococcus granulosus characterised by cyst formation in any organ, although the liver is the most commonly involved." | 1.34 | Ruptured hydatid cyst following minimal trauma and few signs on presentation. ( Gokel, Y; Gulalp, B; Karcioglu, O; Koseoglu, Z; Sakman, G; Satar, S; Sebe, A; Toprak, N, 2007) |
| "A 40-year-old female suffering from hydatid disease located in the parotid gland is presented." | 1.34 | Hydatid disease of the parotid gland: a rare case report. ( Giannopoulos, A; Manti, Ch; Safioleas, K; Safioleas, M; Stamatakos, M; Stavrou, E, 2007) |
| "Primary hydatid disease of the skeletal muscle without systemic involvement is rare." | 1.34 | A primary hydatid cyst of the gracilis: a case report. ( Durakbasa, MO; Islam, NC; Kilicoglu, G; Kose, O, 2007) |
| "Cystic Echinococcosis is a disease of the middle aged." | 1.34 | Cystic echinococcosis in Central Saudi Arabia: a 5-year experience. ( Al Salamah, SM; Fahim, F, 2007) |
| "Next, the hydatid cysts collected from the peritoneal cavity of the animals were weighed and serum IL-4, IL-2, and IgE levels were analyzed." | 1.34 | Therapeutic effects of Sophora moorcroftiana alkaloids in combination with albendazole in mice experimentally infected with protoscolices of Echinococcus granulosus. ( Bao, GSh; Li, HY; Liao, DJ; Lu, XM; Ma, XM; Meng, XQ; Wan, JM; Yin, ShF; Zhou, GK, 2007) |
| "Hydatidosis is a major public health problem that can cause significant morbidity and mortality; however, it is possible to control and even eradicate the disease." | 1.34 | Hydatid disease in Iranian children. ( Mamishi, S; Pourakbari, B; Sagheb, S, 2007) |
| "Unfortunately, the hydatid cyst further progressed and could only be controlled with multiple decompression procedures and continuance of anti-helminthic therapy." | 1.34 | Long term follow-up of a patient with disseminated spinal hydatidosis. ( Bron, JL; van Kemenade, FJ; Verhoof, OJ; Wuisman, PI, 2007) |
| "Hydatid cysts are endemic in certain regions of the world." | 1.34 | Spermatic cord hydatid cyst: an unusual localization. ( Gündüz, M; Günel, E; Toy, H; Yurtçu, M, 2007) |
| "The papilledema was found in ophthalmoscopic examination and loss of vision was fixed." | 1.34 | Primary intraorbital hydatid cyst: an unusual location, case report and review of the literature. ( Keskin, T; Sabuncuoğlu, H; Sanli, M, 2007) |
| "Albendazole is a benzimidazole with wide spectrum coverage as an antiparasitic drug." | 1.33 | Death related to albendazole-induced pancytopenia: case report and review. ( Maclean, JD; Opatrny, L; Prichard, R; Snell, L, 2005) |
| "Cerebral involvement in hydatid disease occurs in 1-4% of cases." | 1.33 | Primary intracranial hydatid cyst in the interpeduncular cistern. ( Albayrak, L; Beskonakli, E; Solaroglu, I; Tun, K, 2005) |
| "At surgery procedure: a broken hydatid cyst is verified, surrounded of tissues inflammatory reaction that evolved to pancreatic fistula." | 1.33 | [Acute secundary abdomen to pancreatic hydatid cyst]. ( González Díez, G; Morán Penco, JM; Rincón Rodera, P; Sanjuán Rodríguez, S, 2005) |
| "The thyroid is a rare location for a hydatid cyst." | 1.33 | [Primary hydatid cyst of the thyroid, an unusual localisation of hydatidosis]. ( Arnaud, JP; Etienne, S; Hennekinne-Mucci, S; Lada, P; Lermite, E; Pessaux, P, 2005) |
| "A child with encysted peritoneal hydatidosis was found to be completely cured after 3 months of combined therapy with praziquantel and albendazole followed by resection of a huge peritoneal cyst and the removal of numerous, dead, daughter cysts." | 1.33 | Encysted peritoneal hydatidosis in a child -- the effectiveness of pre-operative therapy with a combination of praziquantel and albendazole. ( Horovitz, Y; Kawar, B; Lumelsky, D; Miron, D; Spiegel, R, 2005) |
| "Skeletal hydatid disease is a rare parasitic infection caused by the tapeworm Echinococcus granulosus." | 1.33 | Surgical and medical management of rare echinococcosis of the extremities: pre- and post-operative long-term chemotherapy. ( Grimm, D; Infanger, M; Kossmehl, P, 2005) |
| "Albendazole was given as adjuvant treatment." | 1.33 | [Hydatid disease of the femoral shaft treated with surgery and hypertonic solution wash-out combined with albendazole]. ( Balaguer, T; de Peretti, F; Jacquot, N; Winter, M, 2005) |
| "Albendazole was given preoperatively to patients with giant (>5 cm) or multiple cysts and postoperatively to all patients." | 1.33 | Long-term surgical outcome in patients with intracranial hydatid cyst. ( Ciurea, AV; Coman, TC; Fezoulidis, NI; Fountas, KN; Kapsalaki, EZ; Machinis, TG; Robinson, JS, 2006) |
| "The gynecologist should be aware of hydatid cyst when vaginally passing a grape like vesicle is presented by the patient." | 1.33 | A rare presentation of hydatid cyst. ( Alatas, E; Cetin, B; Sabir, N; Sengul, M; Yildirim, B, 2005) |
| "Spinal hydatid disease is a not uncommon cause of spinal cord compression in endemic countries; however, involvement of the epidural space with sparing of the vertebral column is rare." | 1.33 | Spinal hydatid disease, a rare but existent pathological entity: case report and review of the literature. ( Chloros, GD; Fountas, KN; Machinis, TG; Sapkas, GS; Themistocleous, GS; Vrettakos, G, 2006) |
| "Results of surgical treatment of echinococcosis of different location in 983 patients were analyzed." | 1.33 | [Recurrence of echinococcosis: pathogenesis, prophylaxis, early diagnosis and treatment]. ( Akhmedov, IG, 2006) |
| "Albendazole was postoperatively employed for 12 weeks." | 1.33 | Orbital hydatid cyst in childhood: a report of two cases. ( Ciurea, AV; Coman, TC; Fountas, KN; Giuseppe, G; Machinis, TG, 2006) |
| "We hereby represent an unusual case of hydatid disease located in the neck region in a 22-year-old female patient." | 1.33 | Unusual location of hydatid cyst: soft tissue mass in the neck. ( Altundag, K; Aslan, S; Celik, A; Cetin, A; Comert, E; Delibasi, T; Kutun, S; Mengi, N; Turanli, M, 2006) |
| "Intracranial hydatid cyst without primary foci in organs such as the liver and lungs is very rare." | 1.33 | Primary hydatid cyst of the brain during pregnancy. ( Etlik, O; Kiymaz, N; Yazici, T; Yilmaz, N, 2006) |
| "Albendazole was administered to 192 patients; 93 patients had open surgical procedure and 99 patients underwent percutaneous procedure." | 1.33 | Our experience in eight cases with urinary hydatid disease: a series of 372 cases held in nine different clinics. ( Arslan, H; Ceylan, K; Güneş, M; Kösem, M; Köseoglu, B; Söylemez, O; Yalçinkaya, I; Yilmaz, Y, 2006) |
| "To describe a unique case of orbital hydatid cyst that was located solely within the medial rectus muscle." | 1.32 | Intramuscular hydatid cyst of the medial rectus muscle. ( Aydin, O; Bilgiç, S; Kiratli, H; Oztürkmen, C, 2003) |
| "Primary skeletal muscle hydatidosis without involving the thoracic and abdominal organs is extremely rare." | 1.32 | Primary hydatid disease of the quadriceps muscle: a rare localization. ( Akpinar, S; Hersekli, MA; Ozalay, M; Ozkoç, G; Tandoğan, R, 2003) |
| "Approximately 70 % of hydatid cysts are situated in the liver, followed by the lung (25 %)." | 1.32 | Unusual localizations of hydatid disease. ( Cöl, C; Cöl, M; Lafçi, H, 2003) |
| "Cardiac echinococcosis is a rare pathology and in about half of cases it is not accompanied by other organs involvement." | 1.32 | Surgical treatment of isolated cardiac echinococciasis: report of five cases. ( Djooshev, K; Djoshibaev, S; Halikov, UM; Kudaiberdiev, T; Maralov, A; Shabraliev, S; Yankovskaya, L, 2003) |
| "Although many ruptured hydatid cysts of a primary organ have been reported, there is only one case of peritoneal hydatid cyst rupture in the literature." | 1.32 | Traumatic pelvic hydatid cyst rupture: report of a case. ( Aydin, C; Gökgöz, S; Koyuncu, A; Sen, M; Taş, F; Turan, M, 2003) |
| "Hydatid disease is primarily a disease of sheep and cattle." | 1.32 | Hepatic and splenic hydatid cyst during pregnancy: a case report. ( Can, D; Oztekin, O; Sanci, M; Tinar, S, 2003) |
| "Bone hydatidosis caused by the tapeworm larva, Echinococcus granulosis, is rare." | 1.32 | Extraspinal bone hydatidosis. ( Herrera, A; Martínez, AA, 2003) |
| "A case of primary hydatid disease of the right femur is reported that presented with pathological fracture and was diagnosed at the time of exploration for biopsy." | 1.32 | Hydatid disease of bone. ( Ahmad, M; Mishwani, AH; ud Din, AS, 2003) |
| "Osseous hydatid disease is defined as development within bone of multiple cysts that are the larval form of the tapeworm Echinococcus granulosus." | 1.32 | Hydatid disease of bone. Review of 11 cases. ( Aktaou, S; El-Bardouni, A; El-Manouar, M; Fizazi, M; Hajjaj-Hassouni, N; Hassikou, H; Loudiye, H; Tazi, A, 2003) |
| "Herein is reported a case of hydatidosis of the hip and pelvis with a follow-up of 25 years." | 1.32 | Hydatidosis of the pelvis: a case report with a 25-year follow-up. ( Brach del Prever, EM; Gallinaro, P; Massè, A; Parola, PG, 2004) |
| "Bone involvement in hydatid disease has been reported to be only 0." | 1.32 | A lasting solution is hard to achieve in primary hydatid disease of the spine: long-term results and an overview. ( Ogün, TC; Ozdemir, HM; Tasbas, B, 2004) |
| "Surgical treatment consisted in the treatment of the peritonitis, the ruptured hydatid cyst, the associated hydatid cysts in the liver and the spleen, and the hydatid cyst of the right lung in two cases." | 1.32 | [Acute rupture of hydatid cysts in the peritoneum: 17 cases]. ( Abbes, I; Ben Amar, M; Beyrouti, MI; Beyrouti, R; Chaabouni, M; Elleuch, S; Frikha, F; Gharbi, W; Ghorbel, A; Kharrat, M, 2004) |
| "Hydatidosis or cystic echinococcosis (CE) caused by Echinococcus granulosus is endemic in the Province of Río Negro, Argentina." | 1.32 | Ultrasonographic diagnosis and medical treatment of human cystic echinococcosis in asymptomatic school age carriers: 5 years of follow-up. ( Bigatti, R; Cantoni, G; Costa, M; Del Carpio, M; Herrero, E; Labanchi, J; Larrieu, E; Mercapide, C; Odriozola, M; Panomarenko, H; Perez, A; Salvitti, JC; Sustersic, J, 2004) |
| "Cases with cardiac hydatid cyst disease are uncommon, being approximately 0." | 1.32 | A case of asymptomatic cardiopericardial hydatid cyst. ( Cetinkaya, A; Guven, A; Kokoglu, OF; Koksal, N; Sokmen, G; Yuksel, M, 2004) |
| "Cardiac hydatid cysts are rarely seen." | 1.32 | Left ventricular hydatid cyst presenting with acute ischemic stroke: case report. ( Acartürk, E; Biçakci, S; Demir, M; Koç, M; öZeren, A; Yaliniz, H, 2004) |
| "Open heart surgery was performed and a hydatid cyst that involved the interatrial septum was enucleated." | 1.32 | The case of a cyst hydatid localized within the interatrial septum. ( Açikel, U; Algin, I; Erdal, CA; Itil, O; Karabay, O; Kilci, G; Onen, A; Sanli, A; Yildiz, F; Yilmaz, E, 2004) |
| "Cystic hydatid disease is a zoonotic infection of humans caused by infection with the larval stage of Echinococcus granulosus." | 1.32 | Review of surgical management of cystic hydatid disease in a resource limited setting: Turkana, Kenya. ( Cooney, RM; Flanagan, KP; Zehyle, E, 2004) |
| "The cerebral hydatid cysts caused by Echinococcus granulosus are rare and occur mostly during childhood in endemic areas." | 1.32 | Multiple organ involvement hydatid cysts in a 2-year-old boy. ( Ariturk, E; Bernay, F; Hokelek, M; Iyigun, O; Sancak, R; Uyar, Y; Uysal, S, 2004) |
| "Hydatidosis is an endemic disease caused by the larval form of Echinococcus Granulosus." | 1.32 | [Hydatid cyst of the kidney]. ( Ketata, H; Peyromaure, M, 2004) |
| "Human hydatid disease due to Echinococcus granulosus is frequently observed in Italy, especially in the central and southern areas and on the islands." | 1.32 | [Human hydatidosis: advances and report of four paediatric cases with unusual presentation]. ( Acierno, C; Celauro, MC; Giordano, S; Milazzo, M; Nasta, R; Scarlata, F; Troia, G, 2004) |
| "Isolated intracerebral manifestation of cystic echinococcosis is very rare." | 1.31 | [Isolated intracerebral cystic echinococcosis. Unusual presentation of a rare disease]. ( Böhmer, RH; Flügel, KA; Fuchs, HH; Lücking, MO; Nowak, DA; Schreiner, R, 2002) |
| "We report a case of hydatid disease at the proximal end of the clavicle of a 47-year-old woman." | 1.31 | Hydatid disease at the proximal end of the clavicle. ( Hirayama, T; Katsuki, M; Matsuno, T; Takakuwa, M; Yoshida, E, 2002) |
| "We present rupture of lung hydatid cyst in a patient with multiple organ involvement during albendazole treatment." | 1.31 | Complications of albendazole treatment in hydatid disease of lung. ( Eroglu, A; Karaoglanoglu, N; Kurkcuoglu, IC; Polat, P, 2002) |
| "A rare case of spinal hydatid disease presenting with paraparesis and sensory loss is reported." | 1.31 | Hydatid disease of the spine: case report. ( Bwombengi, OS; Khwa-Otsyula, BO; Kuremu, RT; Lelei, LK; Mathews, D; Svanvik, J, 2002) |
| "We report a case of hydatid cyst which had developed within the lattissimus dorsi presenting as a left parietal scapular mass diagnosed by ultrasound and CT scan, which remains the preferred primary examination for the investigation of masses of this type." | 1.31 | [Hydatid cyst of thoracic soft tissues]. ( Aghzadi, R; Kafih, M; Louzi, A; Mejjad, A; Ridai, M; Zerouali, NO, 2002) |
| "We report a child with cardiac hydatid cyst that developed during albendazole treatment for preceding multiple pulmonary hydatid lesions." | 1.31 | Cardiac hydatid cyst and pulmonary hydatidosis in a child. ( Akhan, O; Doğru, D; Göçmen, A; Kiper, N; Ozçelik, U; Yalçin, E, 2002) |
| " Four groups were treated with albendazole (Alb), albendazole liposome (L-Alb), albendazole sulfoxide liposome (L-Albso), and IL-Alb respectively at a dosage of 100 mg (Alb)/(kg." | 1.31 | [Efficacy of albendazole immunoliposome against echinococcosis granulosus in mice]. ( Mo, HM; Niu, RL; Xue, HX, 2001) |
| "Albendazole was efficacious in the treatment of one recurrent case, as well as in preventing recurrence." | 1.31 | Hydatid disease in children may have an atypical presentation. ( Gangopadhyay, AN; Gupta, DK; Rai, SN; Sahoo, SP; Sharma, SP; Sinha, CK, 2000) |
| "Hydatid pulmonary embolism is an uncommon condition resulting from the rupture of a hydatid heart cyst or the opening of a visceral hydatid cyst (often in the liver) into the venous circulation." | 1.31 | [Hydatid pulmonary embolism. Two case reports]. ( Abid, A; Ben Miled, K; Chebbi, ML; Dakhlaoui, R; Drira, I; El Mokhtar, E; Ellafi, A; Fennira, H; Hadoussa, J; Hamzaoui, A; Hantous, S; Kammoun, M; Keskes, H; Mistiri, I; Rekhis, O, 2000) |
| "The rate of recurrence was significantly lower after radical surgical procedures (p = 0." | 1.31 | Radical surgical therapy of abdominal cystic hydatid disease: factors of recurrence. ( Agstner, I; Aspöck, H; Auer, H; Gollackner, B; Karner, J; Langer, F; Längle, F; Loidolt, H; Maier, A; Mittlböck, M; Rockenschaub, S; Steininger, R, 2000) |
| "Spinal hydatid disease is a rare entity that frequently yields to severe, acute-onset neurological deficits." | 1.31 | A viable residual spinal hydatid cyst cured with albendazole. Case report. ( Baykaner, MK; Doğulu, F; Edali, N; Oztürk, G; Tali, T, 2000) |
| "The peritoneal hydatidosis was asymptomatic (n = 2), revealed by pain and/or fever (n = 9) and by hydatid peritonitis (n = 1)." | 1.31 | [Peritoneal hydatid cysts. Apropos of 12 cases]. ( Bounaim, A; el Mansari, O; Janati, IM; Sair, K; Sakit, F; Zentar, A, 2000) |
| "Multiple hydatidosis in a thoracic localization is unusual and a cardiac localization very exceptional." | 1.31 | [Multiple pulmonary hydatidosis with floating balloon appearance and cardiac localization]. ( Afif, H; Aichane, A; Bahlaoui, A; Bouayad, Z; Boumzebra, M; Maazouzi, W; Trombati, N, 2000) |
| "The management of orbital hydatid cyst is discussed." | 1.31 | Orbital hydatid cyst: treatment and prevention of recurrences with albendazole plus praziquantel. ( Alarcón-Cruz, JC; Jimenénez-Mejías, ME; Márquez-Rivas, FJ; Montero, JM; Pachón, J; Palomino-Nicás, J, 2000) |
| "We report a case of hydatid cyst of the pelvis in a 36-year-old woman presented with right adnexal cystic mass with similar cystic lesions in the liver." | 1.31 | Primary pelvic hydatid cyst. ( Ayan, C; Erhan, Y; Ozkinay, E; Terek, MC; Ulukuş, M; Zekioğlu, O, 2000) |
| "Early recurrence was observed despite additional medical therapy with albendazole." | 1.31 | Interventricular septal hydatid cyst. ( Akdemir, R; Basaran, Y; Dindar, I; Ermeydan, C; Kurtoglu, N, 2000) |
| "Until a short time ago, hydatidosis was considered a pathology that could only be resolved surgically." | 1.31 | [Asymptomatic carriers of hydatidosis: epidemiology, diagnosis, and treatment]. ( Cantoni, G; Costa, M; del Carpio, M; Frider, B; Larrieu, E; Mercapide, C; Odriozola, M; Pereyra, R; Pérez, A; Salvitti, JC; Sustercic, J, 2000) |
| "Albendazole has been used in cases of multiple involvement, with controversial results." | 1.31 | Brain hydatidosis: report on 117 cases. ( Kallel, J; Khaldi, M; Khouja, N; Mohamed, S, 2000) |
| "A patient had primary muscle hydatidosis of the thigh that was not detected radiologically or by fine-needle aspiration before surgery." | 1.31 | Primary muscle hydatidosis of the thigh: management of a complicated case with combination adjunctive albendazole and praziquantel chemotherapy. ( Thursky, K; Torresi, J, 2001) |
| "A comparison of the pharmacokinetic profiles of netobimin (NTB), albendazole sulfoxide (ABZSO) and albendazole sulfone (ABZSO2) was performed in gerbils (Meriones unguiculatus) with intra-abdominal hydatidosis and in healthy gerbils." | 1.31 | Pharmacokinetics of netobimin and microsomal metabolism of albendazole in infected gerbils with Echinococcus granulosus. ( Alvarez-de-Felipe, AI; García-Llamazares, JL; Larrode-Pellicer, O; Merino-Pelaez, G; Prieto-Fernández, JG; Redondo-Cardeña, PA, 2001) |
| "A case is described of splenic hydatid cyst in a 45 year old man that was excised laparoscopically; the related literature is reviewed." | 1.31 | Laparoscopic excision of splenic hydatid cyst. ( Gharaibeh, KI, 2001) |
| "Vertebral hydatidosis, the most frequent localization of skeletal hydatidosis, has an ominous prognosis with the risk of progressive but permanent neurological damage." | 1.31 | [Vertebral hydatidosis: three case reports]. ( Aboumaarouf, M; El Andaloussi, M; Yousri, B, 2001) |
| "Developed hydatid cysts were counted, weighed and processed for observation by transmission electron microscopy." | 1.31 | Combined praziquantel and albendazole chemoprophylaxis in experimental hydatidosis. ( Casado, N; Moreno, MJ; Rodríguez-Caabeiro, F; Urrea-París, MA, 2001) |
| "We report a 3-year-old patient with cystic echinococcosis of the tongue demonstrated by histopathology." | 1.31 | Cystic echinococcosis of the tongue leading to diagnosis of multiple localizations. ( Apt, W; Pinto, P; Saez, J; Zulantay, I, 2001) |
| "We report eight cases of osseous hydatidosis involving the pelvis and hip." | 1.31 | Hydatidosis of the pelvis and hip. ( Cuenca, J; Herrera, A; Herrero, L; Martínez, AA, 2001) |
| "We report a case of hydatid cyst of the neck in a child with multiple hydatid cysts in the liver, which was revealed by laryngeal dyspnea." | 1.31 | [Laryngeal dyspnea caused by cervical hydatidosis: apropos of a case]. ( Abdelhak, M; Amrani, A; Barahioui, M; Benhmamouch, N; Kaddouri, N; Zerhouni, H, 2001) |
| " AbzE-30 exhibited increased bioavailability and bioactivity in the treatment of murine Echinococcus hydatid cyst infections." | 1.31 | Augmented bioavailability and cysticidal activity of albendazole reformulated in soybean emulsion in mice infected with Echinococcus granulosus or Echinococcus multilocularis. ( Fanghua, G; Hotez, P; Jiqing, Y; Junjie, C; Mingjie, W; Pieying, J; Shuhua, X; Wei, J, 2002) |
| "Epidemiologically, hydatid cysts localized in the kidney occur far less often in northern Italy compared with the central-southern areas and the islands." | 1.31 | [Hydatid cyst of the kidney. Case report]. ( Bassi, GP; Geraci, E; Maj, L; Pallotti, S, 2002) |
| "Three patients diagnosed with hydatid cysts of the heart underwent surgical treatment." | 1.31 | Surgical treatment of echinococcal cysts of the heart: report of 3 cases. ( Balci, AY; Ceviz, M; Koçak, H; Ozyazicioğlu, A, 2002) |
| "The primary treatment of hydatid disease is surgical." | 1.30 | Orbital hydatid cysts: report of four cases. ( Ergün, R; Ergüngör, F; Evliyaoğlu, C; Gül, B; Okten, AI; Taşkin, Y; Yüksel, M, 1997) |
| "The incidence of hydatid disease in the vertebral column is unusual and rare in the cervical spine." | 1.30 | Treatment of progressive cervical spinal instability secondary to hydatid disease. A case report. ( Chappell, T; Helfend, LK; Keller, TM; Schweitzer, JS, 1997) |
| " These methods helped to evaluate treatment and showed that the long term administration of albendazole was effective." | 1.30 | Albendazole treatment and serological follow-up in hydatid disease of bone. ( Bonifacino, R; Craig, PS; Dogliani, E, 1997) |
| "Surgery for disease recurrence carries a high risk of mortality." | 1.30 | Medical decompression of vertebral hydatidosis. ( Faraj, A; Finch, RG; Lam, KS; Mulholland, RC, 1997) |
| "We report a case of cerebral hydatid disease demonstrated by CT and MRI, treated with albendazole." | 1.30 | Albendazole treatment of cerebral hydatid disease: evaluation of results with CT and MRI. ( Drevelengas, A; Kalaitzoglou, I; Palladas, P; Petridis, A, 1998) |
| "Hydatid cyst was suspected from the imaging results and the patient's origin from area endemic for Echinococcus." | 1.30 | [Surgical treatment of acute pericardial tamponade in an infestation of the heart by Echinococcus]. ( Höpfner, W; Rupp, G; Struck, E; Sumer, C; Vicol, C; Wagner, T, 1998) |
| "Based on the portal infection root, the hydatid disease of the spleen represents a rarity." | 1.30 | [Cystic echinococcosis of the spleen]. ( Lenner, V; Wolf, O, 1998) |
| "Standard treatment of cerebral alveolar hydatid disease consists of open brain surgery and systemic albendazole." | 1.30 | Gamma knife radiosurgery and albendazole for cerebral alveolar hydatid disease. ( Eustacchio, S; Pendl, G; Ranner, G; Reisinger, EC; Samonigg, H; Schmid, M, 1998) |
| "Albendazole treatment did not affect either the collagen content of skin lesions or the serum concentrations of ICTP and pentosidine, but it led to a pronounced decrease in pyridinoline level concomitant with the disappearance, observed by immunohistochemistry, of extensively cross-linked fibrotic type I collagen." | 1.30 | The level of the collagen cross-link pyridinoline reflects the improvement of cutaneous lesions in one case of skin alveolar echinococcosis. ( Bresson-Hadni, S; Carbillet, JP; Grenard, P; Humbert, P; Ricard-Blum, S; Risteli, L; Vuitton, DA, 1998) |
| "Eighty-six cases of polycystic echinococcosis are known in people from 11 countries from Nicaragua to Argentina: 32 due to E." | 1.30 | Neotropical echinococcosis in Suriname: Echinococcus oligarthrus in the orbit and Echinococcus vogeli in the abdomen. ( Basset, D; D'Alessandro, A; D'Hermies, F; Girou, C; Gordon, R; Hoang, C; Nozais, IP, 1998) |
| "Periventricular localization of hydatid cyst is very rarely seen." | 1.30 | Periventricular hydatid cyst. ( Gökalp, HZ; Yüceer, N, 1998) |
| "Albendazole treatment alone was used in six patients (five with uncomplicated recurrent or disseminated disease) and one patient has simply been observed." | 1.30 | Hydatid disease in New Zealand. What remains and how should we treat it? ( Lynch, AC; Stubbs, RS, 1999) |
| "In endemic areas of hydatid disease, hydatid cyst should be a differential diagnosis in cystic lesions of the pancreas in patients presenting with obstructive jaundice." | 1.30 | Case report: Percutaneous drainage of the pancreatic head hydatid cyst with obstructive jaundice. ( Bhat, FA; Khuroo, MS; Sofi, BA; Yattoo, GN; Zargar, SA, 1999) |
| "Cardiac hydatid cysts are rare and represent 0." | 1.30 | Hydatid disease and massive cardiac involvement. ( Aydin, H; Kula, S; Olguntürk, R; Ozdemir, H; Ozdogăn, ME; Sinci, V; Tunaoğlu, FS, 1999) |
| "Surgical exploration revealed a hydatid cyst in the left lobe of the thyroid gland with parasitic metastasis of the left lateral cervical lymph node chain." | 1.30 | A case of primary hydatidosis of the thyroid gland. ( Coppola, M; Cossu Rocca, P; Cossu, ML; Fais, E; Noya, G; Palermo, M; Ruggiu, M; Tanda, F, 1999) |
| "Percutaneous drainage of renal hydatid cysts is a safe and effective method for preventing renal loss, and decreasing morbidity and the duration of hospital stay." | 1.29 | Percutaneous drainage of renal hydatid cyst: early results and follow-up. ( Agarwal, MR; Goel, MC; Misra, A, 1995) |
| "The outcome of 5 children with visceral hydatid cysts treated with Albendazole and surgical therapy is reviewed." | 1.29 | [Echinococcosis/hydatidosis in children: combined medical and surgical treatment]. ( Boglino, C; Boldrini, R; Bosman, C; Ciprandi, G; Di Mario, M; Inserra, A; Silvano, A; Sommi, M, 1994) |
| " Larger proportion of grade I cysts were found in the group treated with albendazole at high dosage (33." | 1.29 | [Pathological studies on alveolar hydatid in gerbils treated with albendazole and praziquantel]. ( Guo, F; Li, Y; Liu, B; Sheng, Y; Zhang, J; Zheng, Q, 1994) |
| "Primary pelvic hydatid cyst is a rare entity." | 1.29 | Primary pelvic hydatid cyst presenting with obstructive uropathy and renal failure. ( Chandrashekhar, C; Jain, R; Misra, MC; Seenu, V; Tiwari, SC, 1994) |
| " The results also indicated that lower drug absorption rate and thickening of the adventitia during longer disease course are the two major factors affecting the efficacy of Meb and Alb, hence suggesting that increase of Meb absorption may be expected to raise the therapeutic effect of the drug." | 1.29 | Effects of benzimidazole compounds on mice infected with secondary cysts of Echinococcus granulosus. ( Chai, JJ; Jiao, W; Shen, BG; Xiao, SH; Yang, YQ; You, JQ, 1994) |
| "Percutaneous drainage of hydatid cysts is a relatively safe and cost-effective procedure." | 1.29 | Percutaneous treatment of hydatid cysts under sonographic guidance. ( Azar, C; Bastid, C; Doyer, M; Sahel, J, 1994) |
| " Other pharmacokinetic parameters were comparable to those found in other studies." | 1.29 | Pharmacokinetics of albendazole in children with hydatid disease. ( Hagos, B; Ng'ang'a, JN; Ogeto, JO; Okelo, GB, 1993) |
| "To determine the prevalence of human hydatidosis in New South Wales and the Australian Capital Territory." | 1.29 | Human hydatidosis in New South Wales and the Australian Capital Territory, 1987-1992. ( Jenkins, DJ; Power, K, 1996) |
| "Cerebral hydatidosis account for approximately 1-2% of patients with hydatid disease." | 1.29 | A case of thalamic hydatid cyst. ( Dermirtaş, E; Erşahin, Y; Mutluer, S; Yurtseven, T, 1995) |
| "Treatment with albendazole was used in three cases without significant results." | 1.29 | Cerebral hydatid cyst in children. Experience of 27 cases. ( Carp, N; Ciurea, AV; Nuteanu, L; Vasilescu, G, 1995) |
| "The role of Th2 cytokines in human hydatidosis was evaluated in ELISA determining IL-5 and IL-6 production in PBMC cultures from 27 pharmacologically treated hydatid patients and from 13 uninfected controls." | 1.29 | Production of IL-5 and IL-6 by peripheral blood mononuclear cells (PBMC) from patients with Echinococcus granulosus infection. ( Profumo, E; Riganò, R; Siracusano, A; Teggi, A, 1996) |
| "A case of hydatid disease of the intra and parasacral area is reported." | 1.29 | Endoscopic evacuation of sacral hydatid cysts: case report. ( Açikgöz, B; Berker, M; Camurdanoğlu, M; Ozgen, T; Sungur, C, 1996) |
| "Albendazole was administered (50 mg/kg daily) to prevent recurrence." | 1.29 | [Echinococcal hydatid cyst in the right ventricle]. ( Attarbaschi, M; Bolte, J; Simic, O; Strathausen, S, 1996) |
| "granulosus using hydatid cysts derived from in vitro culture of protoscoleces." | 1.29 | Development of chemotherapeutic model for the in vitro screening of drugs against Echinoccus granulosus cysts: the effects of an albendazole-albendazole sulphoxide combination. ( Casado, N; Denegri, G; Pérez-Serrano, J; Rodríguez-Caabeiro, F, 1996) |
| "Six patients with polycystic hydatid disease (PHD) were treated with 10 mg kg-1 day-1 albendazole." | 1.28 | Polycystic hydatid disease (Echinococcus vogeli). Treatment with albendazole. ( Bellucci, AD; Magro, JE; Martinelli, AL; Meneghelli, UG; Velludo, MA; Villanova, MG, 1992) |
| "Nine patients with complicated hydatid disease managed with surgery and mebendazole/albendazole are presented." | 1.28 | A clinical-radiological evaluation of benzimidazoles in the management of Echinococcus granulosus cysts. ( Al-Hokail, A; Ellis, M; Sieck, J; von Sinner, W, 1992) |
| "In planning the chemotherapy of hydatid disease, factors such as cyst condition and drug used should therefore be taken into consideration." | 1.28 | Factors influencing the response to chemotherapy in human cystic echinococcosis. ( Georgiev, P; Lazarova, I; Mechkov, G; Nedelkov, G; Todorov, T; Tonchev, Z; Vutova, K, 1992) |
| "A case of hydatid cyst affecting the right ventricle is described and role of tomographic scanning highlighted as it demonstrated a typical multilocular cyst arising from the right ventricle in the patient discussed here." | 1.28 | Hydatid disease of the right ventricle and role of tomographic scanning in its diagnosis. ( Akhtar, MJ, 1991) |
| "In all 105 hydatid cysts were observed, and the follow-up periods ranged from six to 42 months." | 1.28 | Treatment of Echinococcus granulosus hydatid disease with albendazole. ( De Rosa, F; Teggi, A, 1990) |
| "Albendazole was the most effective agent in reducing cyst growth and was, when compared with other regimes significantly more effective than mebendazole (p less than 0." | 1.28 | Comparison of albendazole, mebendazole and praziquantel chemotherapy of Echinococcus multilocularis in a gerbil model. ( Morris, DL; Reffin, D; Richards, KS; Taylor, DH, 1989) |
| "Eight patients with hydatidosis treated with albendazol in daily doses of 10 mg/kg daily in courses of 28 days (4-6 courses) were analysed." | 1.28 | [Treatment of hydatidosis with albendazol]. ( Bygbjerg, IC; Gelletlie, R; Magnussen, P, 1989) |
| "Surgical treatment of hydatidosis carries the risk of dissemination and recidives." | 1.28 | [Drug and surgical therapy of hydatidosis]. ( Kostić, L; Lalji, P, 1989) |
| "Albendazole seems to be a safe and effective agent in the treatment of recurrent hydatid disease, exerting most of its cysticidal activity within the first 2-3 months of therapy." | 1.28 | Albendazole treatment of recurrent hydatid disease: serial evaluation with ultrasound. ( Antico, V; Cossetto, D; Gruenewald, S; Little, JM, 1989) |
| " A chemoprophylaxis of the secondary abdominal echinococcosis was practised by means of Mebendazole (Vermox) in a dosage of 50 mg/kg body weight daily for 90 days." | 1.28 | [Chemoprevention of secondary abdominal echinococcosis--experimental study and clinical observation]. ( Jurukowa, D; Meinhard, P; Stojanow, G, 1989) |
| "Two patients with recurrent hydatid disease had a 1-month course of albendazole before surgery." | 1.28 | Pre-operative albendazole therapy for recurrent hydatid disease. ( Brough, W; Hennessy, O; Kune, GA; Lightowlers, MW; Rickard, MD, 1989) |
| "Albendazole was administered daily in a 10 mg/kg dose for 5 months to 33 patients and for 2 months to 11 patients." | 1.28 | Albendazole in the conservative management of multiple hydatid disease. ( Bonatsos, G; Golematis, B; Lakiotis, G; Persidou-Golemati, P, 1989) |
| "The level in hydatid cyst fluid was 921 +/- 314 ng/ml." | 1.27 | Albendazole as a potential treatment for human hydatidosis. ( Coulaud, JP; Cremieux, AC; Delaitre, B; Giovanangeli, MD; Hay, JM; Meulemans, A; Saimot, AG, 1983) |
| "Eleven patients with abdominal hydatid disease were monitored by ultrasound and computed tomography during treatment with albendazole." | 1.27 | Abdominal hydatid disease: computed tomographic and ultrasound changes during albendazole therapy. ( Burrows, FG; Haynes, A; Morris, DL; Skene-Smith, H, 1984) |
| "Praziquantel 100 mg/kg was ineffective but 500 mg/kg significantly inhibited growth." | 1.27 | Echinococcus multilocularis: in vivo results of therapy with albendazole and praziquantel. ( Morris, DL; Reffin, D; Richards, KS; Taylor, DH, 1988) |
| "Albendazole was very well tolerated." | 1.27 | Albendazole treatment of multiple cerebral hydatid cysts: case report. ( Balkanski, G; Petkov, D; Todorov, T; Vutova, K, 1988) |
| "Albendazole was used at a dose of 10 mg/kg daily in cycles of 28 d for four cycles with 15 d between cycles." | 1.27 | Albendazole treatment of human cystic echinococcosis. ( Kolev, K; Mechkov, G; Petkov, D; Todorov, T; Vutova, K, 1988) |
| "Recurrence is an important problem following operations for hydatid disease in man." | 1.27 | Optimal timing of post-operative albendazole prophylaxis in E. granulosus. ( Morris, DL; Taylor, DH, 1988) |
| "Four cases of cystic hydatid disease treated with albendazole are described." | 1.27 | Albendazole in the treatment of cystic hydatid disease. ( Crocchiolo, P; D'Arminio Monforte, A; Esposito, R; Lazzarin, A; Moroni, M; Orlando, G, 1986) |
| "Surgical management of hydatid cyst is associated with recurrence in 10 per cent of patients." | 1.27 | Pre-operative albendazole therapy for hydatid cyst. ( Morris, DL, 1987) |
| "Post-operative recurrence of hydatid disease occurs in approximately 10% of patients." | 1.27 | Can albendazole reduce the risk of implantation of spilled protoscoleces? An animal study. ( Chinnery, JB; Hardcastle, JD; Morris, DL, 1986) |
| "Thirty-two patients with cysts caused by Echinococcus granulosus were treated with albendazole in a dosage of 10 mg/kg/day." | 1.27 | Albendazole--objective evidence of response in human hydatid disease. ( Bogan, J; Burrows, F; Clarkson, MJ; Dykes, PW; Marriner, S; Morris, DL; Skeene-Smith, H, 1985) |
| "Albendazole was well tolerated in both cases." | 1.27 | [Spinal hydatidosis treated by albendazole. A propos of 2 cases]. ( Bernard, E; Dellamonica, P; Fournier, JP; Le Fichoux, Y; Leloire, P; Marty, P, 1985) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 57 (6.95) | 18.7374 |
| 1990's | 121 (14.76) | 18.2507 |
| 2000's | 235 (28.66) | 29.6817 |
| 2010's | 308 (37.56) | 24.3611 |
| 2020's | 99 (12.07) | 2.80 |
| Authors | Studies |
|---|---|
| Spicher, M | 1 |
| Roethlisberger, C | 1 |
| Lany, C | 1 |
| Stadelmann, B | 3 |
| Keiser, J | 2 |
| Ortega-Mora, LM | 1 |
| Gottstein, B | 11 |
| Hemphill, A | 12 |
| Wang, S | 6 |
| Wang, W | 4 |
| Dai, Y | 2 |
| Qiu, Z | 1 |
| Ke, W | 1 |
| Geng, M | 1 |
| Li, J | 9 |
| Li, K | 1 |
| Ma, Q | 1 |
| Li, F | 2 |
| Khasawneh, RA | 2 |
| Mohaidat, ZM | 1 |
| Zoghoul, SB | 1 |
| Henawi, YM | 1 |
| Bastid, C | 2 |
| Terraz, S | 1 |
| Toso, C | 1 |
| Chappuis, F | 2 |
| Spahr, L | 1 |
| Bresson-Hadni, S | 10 |
| Basnet, P | 1 |
| Chapagain, S | 1 |
| Neupane, R | 1 |
| Thapa, A | 1 |
| Blatz, AM | 1 |
| Laycock, KM | 1 |
| Kaur, I | 1 |
| Swami, SK | 1 |
| Fateh, R | 1 |
| Norouzi, R | 4 |
| Mirzaei, E | 1 |
| Nissapatron, V | 1 |
| Nawaz, M | 1 |
| Khalifeh-Gholi, M | 1 |
| Hamta, A | 1 |
| Adnani Sadati, SJ | 1 |
| Siyadatpanah, A | 1 |
| Fattahi Bafghi, A | 1 |
| Farhadi, M | 1 |
| Haniloo, A | 2 |
| Rostamizadeh, K | 1 |
| Ahmadi, N | 1 |
| Lopez, LM | 2 |
| Pensel, PE | 9 |
| Fabbri, J | 8 |
| Albani, CM | 5 |
| Elissondo, N | 4 |
| Gambino, G | 4 |
| Elissondo, MC | 14 |
| Ma, Y | 1 |
| Sun, H | 4 |
| Zhang, Y | 3 |
| Wang, J | 3 |
| Yang, Q | 1 |
| Li, Z | 2 |
| Xu, X | 2 |
| Chen, C | 3 |
| Hou, Z | 1 |
| He, Q | 2 |
| Sheng, L | 2 |
| Ma, X | 3 |
| Luo, Y | 4 |
| Peña Huertas, M | 1 |
| Zafra Martín, J | 1 |
| Álvarez García de Quesada, I | 1 |
| Díaz Gavela, AA | 1 |
| Guerrero Gómez, LL | 1 |
| Sánchez García, S | 1 |
| Pardo Pérez, E | 1 |
| Couñago, F | 1 |
| Del Cerro Peñalver, E | 1 |
| Opperman, CJ | 1 |
| Enslin, JMN | 1 |
| Nuttall, J | 1 |
| Brink, AJ | 1 |
| Da Fonseca, SP | 1 |
| Tootla, HD | 1 |
| Fasihi Karami, M | 1 |
| Bahreini, A | 1 |
| Rafiei, A | 2 |
| Dastyar, AA | 1 |
| Beiromvand, M | 1 |
| Loos, JA | 1 |
| Coccimiglio, M | 1 |
| Nicolao, MC | 1 |
| Rodrigues, CR | 1 |
| Cumino, AC | 1 |
| Xin, Q | 3 |
| Li, H | 4 |
| Yuan, M | 3 |
| Song, X | 3 |
| Jing, T | 4 |
| Alkan Çeviker, S | 1 |
| Yüksel, C | 1 |
| Şener, A | 1 |
| Önder, T | 1 |
| Metineren, MH | 1 |
| Özel, Ç | 1 |
| Akgül, ÖS | 1 |
| Moshref, L | 1 |
| Malaekah, H | 1 |
| Ashraf, M | 1 |
| Ahmed, S | 1 |
| Ahmad, S | 2 |
| Ahmad, A | 1 |
| Liu, P | 1 |
| Feng, H | 1 |
| Liu, J | 1 |
| Castro, AR | 1 |
| Hyppolito, EB | 1 |
| Valença-Júnior, JT | 1 |
| Coelho, GR | 1 |
| Garcia, JHP | 1 |
| Lv, W | 1 |
| Xu, Y | 1 |
| Zhao, C | 1 |
| Wang, B | 1 |
| Maimaitinijiati, Y | 1 |
| Meng, Y | 1 |
| Chen, X | 3 |
| Tüz, AE | 1 |
| Ekemen Keleş, Y | 1 |
| Şahin, A | 1 |
| Üstündağ, G | 1 |
| Taşar, S | 1 |
| Karadağ Öncel, E | 1 |
| Kara Aksay, A | 1 |
| Öztan, MO | 1 |
| Köylüoğlu, G | 1 |
| Çapar, AE | 1 |
| Yılmaz Çiftdoğan, D | 1 |
| Moscatelli, G | 3 |
| Salgueiro, F | 3 |
| Moroni, S | 3 |
| González, N | 2 |
| Lascano, F | 1 |
| Altcheh, J | 3 |
| Fotoohi, S | 1 |
| Radfar, MH | 1 |
| Afgar, A | 2 |
| Harandi, MF | 2 |
| A, J | 1 |
| Chai, J | 2 |
| Shao, Z | 1 |
| Zhao, S | 1 |
| Wang, H | 2 |
| A, X | 1 |
| Yang, J | 3 |
| Bouikhif, M | 1 |
| Farhane, S | 1 |
| Lyagoubi, M | 1 |
| Aoufi, S | 1 |
| Whittaker, C | 1 |
| Chesnais, CB | 1 |
| Pion, SDS | 1 |
| Kamgno, J | 1 |
| Walker, M | 3 |
| Basáñez, MG | 1 |
| Boussinesq, M | 1 |
| Bakhtiar, NM | 4 |
| Akbarzadeh, A | 5 |
| Ahmadpour, E | 5 |
| Mahami-Oskouei, M | 5 |
| Casulli, A | 8 |
| Asadi, M | 3 |
| Ebrahimi, M | 3 |
| Asadi, N | 3 |
| Rodrigues Oliveira, SM | 3 |
| de Lourdes Pereira, M | 3 |
| Spotin, A | 5 |
| Albani, C | 3 |
| Pensel, P | 4 |
| Albanese, A | 3 |
| Paladini, A | 3 |
| Galyavin, AV | 3 |
| Mandal, KC | 2 |
| Halder, P | 2 |
| Mondal, G | 2 |
| Debnath, B | 3 |
| Mitra, D | 2 |
| Mukhopadhyay, B | 2 |
| Ma, G | 1 |
| Yan, M | 1 |
| Liu, H | 1 |
| Zhang, K | 1 |
| Lin, R | 1 |
| Lü, G | 1 |
| Hu, C | 3 |
| Qin, M | 1 |
| Zhang, F | 1 |
| Gao, R | 1 |
| Gan, X | 1 |
| Du, T | 1 |
| Aghighi, K | 1 |
| Heidarpour, M | 3 |
| Borji, H | 4 |
| Jelicic, K | 1 |
| Papic, N | 2 |
| Viskovic, K | 2 |
| Vince, A | 2 |
| Sheves, A | 1 |
| Fuxman, Y | 1 |
| Gazer, B | 1 |
| Shmueli, M | 2 |
| Van Buren, J | 1 |
| Ben-Shimol, S | 3 |
| Assi, Z | 2 |
| Odishelashvili, GD | 1 |
| Pakhnov, DV | 1 |
| Kostenko, NV | 1 |
| Nozdrin, VM | 1 |
| Odishelashvili, LG | 1 |
| Sogbe, M | 1 |
| Urtasun, C | 1 |
| Del Pozo, JL | 1 |
| Cui, Z | 1 |
| Ye, G | 1 |
| Yu, W | 1 |
| Wang, Z | 2 |
| Kong, F | 1 |
| Ren, L | 2 |
| Pandey, U | 1 |
| Timilsina, BR | 1 |
| Acharya, S | 1 |
| Paudel, U | 1 |
| Kc, SR | 1 |
| Pradhan, S | 1 |
| Joliat, GR | 1 |
| Roulin, D | 1 |
| Labgaa, I | 1 |
| Uldry, E | 1 |
| Demartines, N | 1 |
| Halkic, N | 1 |
| Melloul, E | 1 |
| Peulier-Maitre, E | 1 |
| Hervieux, E | 1 |
| Bigot, J | 1 |
| Sileo, C | 1 |
| Denamur, S | 1 |
| Corvol, H | 1 |
| Elamour, S | 1 |
| Sagi, O | 2 |
| Grupel, D | 1 |
| Luan, H | 1 |
| Liu, K | 1 |
| Tian, Q | 1 |
| Chen, Y | 1 |
| Peng, C | 1 |
| Sun, X | 1 |
| Weber, TF | 2 |
| Junghanss, T | 4 |
| Stojković, M | 3 |
| Monge-Maillo, B | 2 |
| Lopez-Velez, R | 2 |
| Chiodini, PL | 2 |
| Doszhanova, G | 1 |
| Colpani, A | 1 |
| Duisenova, A | 1 |
| De Vito, A | 1 |
| Zholdybay, Z | 1 |
| Juszkiewicz, K | 1 |
| Brunetti, E | 10 |
| Katarbayev, A | 1 |
| Kaniyev, S | 2 |
| Zhakenova, Z | 1 |
| Manciulli, T | 4 |
| Mustapayeva, A | 1 |
| Jia, Q | 1 |
| Wu, S | 1 |
| Guo, J | 3 |
| Alimujiang, A | 1 |
| Zheng, H | 2 |
| Zhang, J | 2 |
| Wang, Y | 1 |
| Xie, Z | 1 |
| Ma, C | 1 |
| Hasnaouia, A | 1 |
| Trigui, R | 1 |
| Heni, S | 1 |
| Kammoun, H | 1 |
| Sassi, I | 1 |
| Chen, Q | 2 |
| Liu, C | 3 |
| Li, C | 1 |
| Zhang, B | 1 |
| Fan, H | 3 |
| Nami, S | 1 |
| Rostami, A | 1 |
| Kaya, HE | 1 |
| Kerimoğlu, Ü | 2 |
| Olivier, CJ | 1 |
| Auer, RN | 1 |
| Dixit, D | 1 |
| Liu, Z | 2 |
| Qian, F | 2 |
| Shaheen, HAAAS | 1 |
| El-Ahl, SAHS | 1 |
| Raouf, AMA | 1 |
| El-Dardiry, MA | 1 |
| Badawi, MA | 1 |
| Aal, AAA | 1 |
| Rahdar, M | 1 |
| Valipour-Nouroozi, R | 1 |
| Pinard, C | 1 |
| Cuq, B | 1 |
| Gibson, T | 1 |
| Brisson, B | 1 |
| Plattner, B | 1 |
| Lillie, B | 1 |
| Bienzle, D | 1 |
| Brouwer, E | 1 |
| Peregrine, A | 1 |
| Xu, L | 1 |
| Karlas, T | 1 |
| Reinhardt, F | 1 |
| Blank, V | 1 |
| Lippmann, N | 1 |
| Seehofer, D | 1 |
| Lübbert, C | 1 |
| Kamiyama, T | 3 |
| Madisson-Bernardo, M | 1 |
| Bernardo, D | 1 |
| Trad, HS | 1 |
| Meneghelli, U | 1 |
| Villanova, M | 1 |
| Schmidt, A | 1 |
| Grandjean Lapierre, S | 1 |
| Barkati, S | 1 |
| Desjardins, M | 1 |
| Ndao, M | 1 |
| Libman, M | 1 |
| Poirier, L | 1 |
| Mottard, S | 1 |
| Désy, D | 1 |
| Dufresne, SF | 1 |
| Dušek, D | 1 |
| Kurelac, I | 1 |
| Deplazes, P | 2 |
| Beck, R | 1 |
| Sarr, SA | 1 |
| Aw, F | 1 |
| Ndiaye, M | 1 |
| Mingou, J | 1 |
| Bodian, M | 1 |
| Dioum, M | 1 |
| Ngaidé, AA | 1 |
| Ndiaye, MB | 1 |
| Kane, A | 1 |
| Diao, M | 1 |
| Ba, SA | 1 |
| Clemente, CM | 1 |
| Ravetti, S | 1 |
| Hergert, LY | 1 |
| Palma, SD | 7 |
| Zavoikin, VD | 2 |
| Zelya, OP | 2 |
| Tumolskaya, NI | 2 |
| Ahmadi, A | 1 |
| Moazeni, M | 7 |
| Shaddel, M | 1 |
| Simonazzi, A | 1 |
| Bermudez, JM | 1 |
| İyigün, T | 1 |
| Kyaruzi, MM | 1 |
| Kutay, V | 1 |
| Karakurt, ST | 1 |
| Kumar, A | 1 |
| Ballal, P | 1 |
| Nagamani, AC | 1 |
| Sheriff, SA | 1 |
| Gao, Q | 1 |
| Zhang, G | 2 |
| Singh, S | 2 |
| Kalra, G | 1 |
| Gupta, V | 2 |
| Gupta, S | 2 |
| Schleenvoigt, BT | 1 |
| Theis, B | 1 |
| Wüst, M | 1 |
| Forstner, C | 1 |
| Pletz, MW | 1 |
| Hagel, S | 1 |
| Lundström-Stadelmann, B | 4 |
| Rufener, R | 4 |
| Zhang, X | 4 |
| Wei, X | 1 |
| Ran, L | 1 |
| Tang, H | 1 |
| Vural, G | 1 |
| Yardimci, M | 1 |
| Kocak, M | 1 |
| Yasar, TÖ | 1 |
| Kurt, A | 2 |
| Harem, IS | 1 |
| Carradori, S | 1 |
| Sciamanna, I | 1 |
| Siles-Lucas, M | 3 |
| Fabiani, M | 1 |
| Cirilli, R | 2 |
| El Aoufir, O | 1 |
| Hassani, S | 1 |
| Asfalou, I | 1 |
| Nouali, HEN | 1 |
| De, NV | 1 |
| Minh, PN | 1 |
| Duyet, LV | 1 |
| Bich, NN | 1 |
| Son, TN | 1 |
| Jung, BK | 1 |
| Chai, JY | 1 |
| Yadav, MK | 2 |
| Tamarozzi, F | 6 |
| Horton, J | 4 |
| Muhtarov, M | 1 |
| Ramharter, M | 2 |
| Gruener, B | 1 |
| Vuitton, DA | 10 |
| Darvishi, MM | 1 |
| Alizadeh, M | 1 |
| Abedi, M | 1 |
| Tamaddon, AM | 1 |
| Yu, Q | 1 |
| Xiao, N | 1 |
| Han, S | 2 |
| Tian, T | 1 |
| Zhou, XN | 1 |
| Moghtadaie, A | 1 |
| Yazdi, SAM | 1 |
| Mohraz, M | 2 |
| Asefi, H | 1 |
| Razeghi, E | 1 |
| Singla, V | 1 |
| Suhani, S | 1 |
| Bhattacharjee, HK | 1 |
| Goyal, A | 1 |
| Parshad, R | 1 |
| Destek, S | 1 |
| Değer, KC | 1 |
| Luo, YX | 1 |
| Du, CN | 1 |
| Yang, MF | 1 |
| Zhang, Q | 2 |
| Wei, XX | 1 |
| Shirgholami, Z | 1 |
| Mohebalian, H | 1 |
| García Pérez, PV | 1 |
| Dávila Arias, C | 1 |
| Duque Fernández De Vega, S | 1 |
| Zhao, Y | 2 |
| Gongsang, Q | 1 |
| Ji, J | 1 |
| Qi, F | 1 |
| Qiangba, G | 1 |
| Danzeng, W | 1 |
| Chen, F | 1 |
| Zhou, H | 1 |
| Yin, J | 1 |
| Pei, N | 1 |
| Xie, J | 1 |
| Cai, H | 2 |
| Pang, H | 1 |
| Chen, W | 1 |
| Li, B | 1 |
| Baimakhanov, Z | 1 |
| Doskhanov, M | 1 |
| Kausova, G | 1 |
| Baimakhanov, B | 1 |
| Dezsényi, B | 1 |
| Dubóczki, Z | 1 |
| Strausz, T | 1 |
| Csulak, E | 1 |
| Czoma, V | 1 |
| Káposztás, Z | 1 |
| Fehérvári, M | 1 |
| Somorácz, Á | 1 |
| Csilek, A | 1 |
| Oláh, A | 1 |
| Almási, K | 1 |
| Patonai, A | 1 |
| Görög, D | 1 |
| Széll, Z | 1 |
| Tolnai, Z | 1 |
| Sréter, T | 1 |
| Danka, J | 1 |
| Auer, H | 4 |
| Grüner, B | 1 |
| Barth, TFE | 1 |
| He, J | 1 |
| Yang, C | 1 |
| Mantion, G | 1 |
| Million, L | 1 |
| Maliqari, N | 1 |
| Teneqexhi, L | 1 |
| Koja, A | 1 |
| Veshti, A | 1 |
| Baboci, A | 1 |
| Haxhiu, A | 1 |
| Kuci, S | 1 |
| Ibrahimi, A | 1 |
| Cela, D | 1 |
| Vanini, V | 1 |
| Enkai, S | 1 |
| Kouguchi, H | 1 |
| Inaoka, DK | 1 |
| Irie, T | 1 |
| Yagi, K | 1 |
| Kita, K | 1 |
| Al-Saeedi, M | 1 |
| Ramouz, A | 1 |
| Khajeh, E | 1 |
| El Rafidi, A | 1 |
| Ghamarnejad, O | 1 |
| Shafiei, S | 1 |
| Ali-Hasan-Al-Saegh, S | 1 |
| Probst, P | 1 |
| Hoffmann, K | 1 |
| Mehrabi, A | 1 |
| Ferrer Inaebnit, E | 1 |
| Molina Romero, FX | 1 |
| Segura Sampedro, JJ | 1 |
| González Argenté, X | 1 |
| Morón Canis, JM | 1 |
| Wu, J | 3 |
| Ma, HZ | 1 |
| Apaer, S | 1 |
| Anweier, N | 1 |
| Zeng, Q | 1 |
| Fulati, X | 1 |
| Li, T | 1 |
| Zhao, JM | 2 |
| Wen, H | 6 |
| Tuxun, T | 2 |
| Mantadakis, E | 1 |
| Totikidis, G | 1 |
| Deftereos, S | 1 |
| Cambier, A | 2 |
| Hayette, MP | 2 |
| Léonard, P | 2 |
| Kurth, W | 1 |
| Lovinfosse, P | 1 |
| Giot, JB | 2 |
| Permana, AD | 1 |
| Paredes, AJ | 1 |
| Zanutto, FV | 1 |
| Amir, MN | 1 |
| Ismail, I | 1 |
| Bahar, MA | 1 |
| Donnelly, RF | 1 |
| Rabhi, S | 1 |
| Saadana, J | 1 |
| Chaouch, F | 1 |
| Othman, Y | 1 |
| Zrig, M | 2 |
| Koubaa, M | 2 |
| Abid, A | 4 |
| Petrone, L | 1 |
| Vola, A | 3 |
| Gomez Morales, MA | 1 |
| Ludovisi, A | 1 |
| Najafi Fard, S | 1 |
| Mariconti, M | 3 |
| Goletti, D | 1 |
| Solomon, N | 1 |
| Kachani, M | 1 |
| Zeyhle, E | 2 |
| Macpherson, CNL | 1 |
| Caire Nail, L | 1 |
| Rodríguez Reimundes, E | 1 |
| Weibel Galluzzo, C | 1 |
| Lebowitz, D | 1 |
| Ibrahim, YL | 1 |
| Lobrinus, JA | 1 |
| Budke, CM | 3 |
| Kern, P | 3 |
| Colovic Calovski, I | 1 |
| Barac, A | 1 |
| Golubovic, Z | 1 |
| Karamarkovic, A | 1 |
| Mitrovic, S | 1 |
| Milicevic, M | 1 |
| Cvetkovic, M | 1 |
| Dzamic, AM | 1 |
| Padmanabhan, TNC | 1 |
| Kumar, KVK | 1 |
| Sadiq Azam, M | 1 |
| Kumar Bilolikar, A | 1 |
| Saqui, AE | 1 |
| Aggouri, M | 1 |
| Benzagmout, M | 1 |
| Chakour, K | 2 |
| Faizchaoui, ME | 1 |
| Di Martino, M | 1 |
| Laganá, C | 1 |
| Delgado Valdueza, J | 1 |
| Martín-Pérez, E | 1 |
| Kastengren, M | 1 |
| Liska, J | 1 |
| Svenarud, P | 1 |
| Dalén, M | 1 |
| Ramos Pascua, L | 1 |
| Santos Sanchez, JA | 1 |
| Samper Wamba, JD | 1 |
| Alvarez Castro, A | 1 |
| Rodriguez Altonaga, J | 1 |
| Valot, B | 1 |
| Rognon, B | 1 |
| Prenel, A | 1 |
| Baraquin, A | 1 |
| Knapp, J | 2 |
| Anelli, M | 1 |
| Richou, C | 2 |
| Grenouillet, F | 4 |
| Millon, L | 1 |
| Tas, EE | 1 |
| Yegin Akcay, GF | 1 |
| Yildirim, F | 1 |
| Yavuz, F | 1 |
| Meinel, TR | 1 |
| Geib, V | 1 |
| Keel, MJ | 1 |
| Biral, R | 1 |
| Mohaupt, M | 1 |
| Brügger, J | 1 |
| Gupta, A | 3 |
| Gupta, J | 1 |
| Devkaran, B | 1 |
| Gezercan, Y | 2 |
| Ökten, AI | 3 |
| Çavuş, G | 2 |
| Açık, V | 2 |
| Bilgin, E | 2 |
| Gamboa, GU | 1 |
| Benoit, JP | 3 |
| Yao, J | 1 |
| Wang, T | 1 |
| Li, S | 1 |
| Zheng, X | 1 |
| Duan, L | 2 |
| Zhang, W | 2 |
| Saboor Darbandi, M | 2 |
| Firpo, G | 1 |
| Lissandrin, R | 3 |
| Fallahi Motlagh, M | 1 |
| Janghi Aghdam, H | 1 |
| Fallahi Motlagh, B | 1 |
| Çetin, M | 1 |
| Karaman, K | 1 |
| Özgökçe, M | 1 |
| Geylan, H | 1 |
| Yildizeli, B | 1 |
| García, MSSM | 1 |
| Ordoñez, MDCL | 1 |
| Diaz-Zorita, B | 1 |
| Baeza, ML | 1 |
| Atayi, Z | 1 |
| Chen, S | 1 |
| Li, N | 1 |
| Yang, F | 1 |
| Hu, Y | 1 |
| Yu, S | 1 |
| Wang, X | 6 |
| Liu, Y | 3 |
| Zheng, J | 1 |
| Paredes, A | 1 |
| Allemandi, D | 3 |
| Sanchez Bruni, S | 4 |
| Salman, F | 1 |
| Khan, MI | 1 |
| Hussain, I | 1 |
| Abdullah, HMA | 1 |
| Baldo, S | 1 |
| Tacconi, L | 1 |
| Mughal, A | 2 |
| Minhas, MS | 1 |
| Bhatti, A | 1 |
| Moghul, FA | 1 |
| Sangani, MM | 1 |
| Khan, KM | 1 |
| Alam, A | 1 |
| Kumar, M | 1 |
| Arslan, M | 2 |
| Gulek, B | 1 |
| Ogur, HU | 1 |
| Adamhasan, F | 1 |
| Wadhawa, V | 1 |
| Shah, J | 1 |
| Doshi, C | 1 |
| Ramani, J | 1 |
| Lakhia, K | 2 |
| Rathod, D | 1 |
| Tavar, R | 1 |
| Kothari, J | 1 |
| Zhou, RX | 1 |
| Hu, HJ | 1 |
| Ma, WJ | 1 |
| Jiang, Y | 3 |
| Li, FY | 1 |
| Bletard, N | 1 |
| Meunier, P | 1 |
| Hustinx, R | 1 |
| Delwaide, J | 1 |
| Meurisse, N | 1 |
| Honore, P | 1 |
| Losson, B | 1 |
| Detry, O | 1 |
| Torabi, N | 1 |
| Dobakhti, F | 1 |
| Faghihzadeh, S | 1 |
| Kohlmaier, B | 1 |
| Trobisch, A | 1 |
| Pfurtscheller, K | 1 |
| Knez, I | 1 |
| Klepetko, W | 1 |
| Pilhatsch, A | 1 |
| Schweintzger, S | 1 |
| Zenz, W | 1 |
| Carmena, D | 1 |
| Dang, Z | 1 |
| Xu, S | 2 |
| Zhang, H | 3 |
| Gui, W | 1 |
| Hu, W | 1 |
| Velasco-Tirado, V | 3 |
| Romero-Alegria, A | 3 |
| Pardo-Lledías, J | 3 |
| Alonso-Sardón, M | 2 |
| Lopez-Bernus, A | 2 |
| Sampedro, JQ | 1 |
| Bellvis, LM | 1 |
| Iglesias Gomez, A | 1 |
| Muro, A | 2 |
| Muñoz Bellido, JL | 2 |
| Iglesias-Iglesias, M | 1 |
| Jimenez Lopez, MF | 1 |
| Belhassen-García, M | 3 |
| Ozsay, O | 1 |
| Gungor, F | 1 |
| Karaisli, S | 1 |
| Kokulu, I | 1 |
| Dilek, ON | 1 |
| Dehkordi, AB | 1 |
| Sanei, B | 1 |
| Yousefi, M | 1 |
| Sharafi, SM | 1 |
| Safarnezhad, F | 1 |
| Jafari, R | 1 |
| Darani, HY | 1 |
| Burguillo, FJ | 1 |
| Carpio-Pérez, A | 1 |
| Cordero, M | 1 |
| Maestri, M | 2 |
| Maggiore, MA | 1 |
| Denegri, GM | 1 |
| Fröschen, FS | 1 |
| Fischer, HP | 1 |
| Hischebeth, GT | 1 |
| Reiter-Owona, I | 1 |
| Randau, TM | 1 |
| Gravius, S | 1 |
| Gravius, N | 1 |
| Su, M | 1 |
| Guo, XL | 1 |
| Shao, ZW | 1 |
| Ding, JT | 1 |
| Xiang, HT | 1 |
| Luo, XN | 1 |
| Zheng, YD | 1 |
| Sun, XL | 1 |
| Regaieg, K | 1 |
| Bahloul, M | 1 |
| Turki, O | 1 |
| Kammoun, B | 2 |
| Toumi, N | 1 |
| Bouaziz, M | 1 |
| Thapa, S | 1 |
| Ghosh, A | 1 |
| Ghartimagar, D | 1 |
| Shrestha, S | 1 |
| Lalchan, S | 1 |
| Talwar, OP | 1 |
| Tersigni, C | 2 |
| Venturini, E | 2 |
| Montagnani, C | 1 |
| Bianchi, L | 1 |
| Chiappini, E | 1 |
| de Martino, M | 2 |
| Galli, L | 2 |
| Tezcan, MA | 1 |
| Ozsoy, IE | 2 |
| Dick, L | 1 |
| D'Ascoli, L | 1 |
| Ritler, D | 1 |
| Hizem, A | 1 |
| Wells, TNC | 1 |
| Heendeniya, A | 1 |
| Bogoch, II | 1 |
| Larrieu, E | 5 |
| Uchiumi, L | 3 |
| Salvitti, JC | 5 |
| Sobrino, M | 1 |
| Panomarenko, O | 1 |
| Tissot, H | 1 |
| Mercapide, CH | 3 |
| Sustercic, J | 4 |
| Arezo, M | 1 |
| Mujica, G | 3 |
| Herrero, E | 4 |
| Labanchi, JL | 3 |
| Grizmado, C | 1 |
| Araya, D | 3 |
| Talmon, G | 3 |
| Galvan, JM | 1 |
| Sepulveda, L | 1 |
| Seleiman, M | 1 |
| Cornejo, T | 1 |
| Echenique, H | 1 |
| Del Carpio, M | 5 |
| Semeraro, A | 1 |
| Caremani, M | 2 |
| Defilippi, C | 1 |
| Singh, SK | 1 |
| Singh, V | 1 |
| Kumar, S | 2 |
| Devenraj, V | 1 |
| Bhandari, M | 1 |
| Pandey, AK | 1 |
| Kurz, K | 1 |
| Schwabegger, A | 1 |
| Schreieck, S | 1 |
| Zelger, B | 1 |
| Weiss, G | 1 |
| Bellmann-Weiler, R | 1 |
| Lopez Luis, BA | 1 |
| Valdivia-Cayoja, AR | 1 |
| Belaunzaran-Zamudio, PF | 1 |
| Soto-Ramírez, LE | 1 |
| Mansfield, BS | 1 |
| Pieton, K | 1 |
| Pather, S | 1 |
| Cattaneo, L | 1 |
| Cretu, CM | 1 |
| Giordani, MT | 1 |
| Angheben, A | 1 |
| Bartoloni, A | 1 |
| Zammarchi, L | 1 |
| Bartalesi, F | 1 |
| Richter, J | 1 |
| Chiodini, P | 1 |
| Godbole, G | 1 |
| Sammarchi, L | 1 |
| Dore, R | 1 |
| Vercelli, A | 1 |
| Benazzo, F | 1 |
| Cuzzocrea, F | 1 |
| Helvaci, O | 1 |
| Akyuz Dagli, P | 1 |
| Ayva, S | 1 |
| Dalgic, A | 1 |
| Sozen, H | 1 |
| Dizbay, M | 1 |
| Arinsoy, T | 1 |
| Boztepe Derici, U | 1 |
| Legonkov, YA | 1 |
| Bronshtein, AM | 1 |
| Vuitton, L | 1 |
| McManus, DP | 3 |
| Ullio Gamboa, GV | 1 |
| Sanchez Bruni, SF | 1 |
| Allemandi, DA | 1 |
| Gui, WF | 1 |
| Dang, ZS | 1 |
| Zhao, YM | 1 |
| Hermelin, D | 1 |
| Demske, M | 1 |
| Chamberland, RR | 1 |
| Sotelo-Avila, C | 1 |
| Cai, X | 1 |
| Gan, Q | 1 |
| Chang, W | 1 |
| Yuan, F | 1 |
| Luo, W | 1 |
| Sun, J | 1 |
| An, J | 1 |
| Akhavan, R | 1 |
| Chavoshi, K | 1 |
| Farrokh, D | 1 |
| Nekooei, S | 1 |
| Abbasi, B | 1 |
| Mortezaei, S | 1 |
| Mohammadi, MA | 1 |
| Mousavi, SM | 3 |
| Sadeghi, B | 1 |
| Wenker, C | 1 |
| Hoby, S | 1 |
| Wyss, F | 1 |
| Mengiardi, B | 1 |
| Vögtli, R | 1 |
| Posthaus, H | 1 |
| Labsi, M | 1 |
| Soufli, I | 1 |
| Khelifi, L | 1 |
| Amir, ZC | 1 |
| Touil-Boukoffa, C | 1 |
| Tural Kara, T | 1 |
| Gök, H | 1 |
| Başkurt, O | 1 |
| Bozkurt, M | 1 |
| Bozkurt, DK | 1 |
| Çil, AS | 1 |
| Karaman, M | 1 |
| González-Redondo, R | 1 |
| DiCaudo, C | 1 |
| García-García, D | 1 |
| Zubieta, JL | 1 |
| Viteri-Torres, C | 1 |
| Dhingra, D | 1 |
| Sethi, GR | 1 |
| Mantan, M | 1 |
| Darwazah, AK | 1 |
| Zaghari, M | 1 |
| Eida, M | 1 |
| Batrawy, M | 1 |
| Ulger, S | 1 |
| Barut, H | 1 |
| Tunc, M | 1 |
| Aydin, E | 2 |
| Aydınkarahaliloğlu, E | 1 |
| Gokcek, A | 1 |
| Karaoğlanoğlu, N | 2 |
| Sfaihi, L | 1 |
| Kamoun, F | 1 |
| Hentati, Y | 1 |
| Tiss, O | 1 |
| Kamoun, T | 1 |
| Mnif, Z | 2 |
| Hachicha, M | 1 |
| Bhattacharyya, SK | 1 |
| Bhattacharya, S | 1 |
| Alam, H | 1 |
| Patua, B | 1 |
| Chattopadhyay, P | 1 |
| Piarroux, M | 1 |
| Piarroux, R | 3 |
| Bardonnet, K | 2 |
| Dumortier, J | 1 |
| Watelet, J | 1 |
| Gerard, A | 1 |
| Beytout, J | 1 |
| Abergel, A | 1 |
| Gaudart, J | 1 |
| Luo, K | 1 |
| Luo, DH | 1 |
| Zhang, TR | 1 |
| Ceballos, L | 4 |
| Virkel, G | 1 |
| Elissondo, C | 3 |
| Canton, C | 1 |
| Canevari, J | 1 |
| Murno, G | 1 |
| Denegri, G | 6 |
| Lanusse, C | 3 |
| Alvarez, L | 3 |
| Dencker, D | 1 |
| Ewertsen, C | 1 |
| Nielsen, HV | 1 |
| Dragsted, UB | 1 |
| Karstrup, S | 1 |
| Leslé, F | 1 |
| Magrino, B | 1 |
| Dupouy-Camet, J | 1 |
| Sailhan, F | 1 |
| Ksiaa, A | 1 |
| Zitouni, H | 1 |
| Zrig, A | 2 |
| Kerkeni, Y | 1 |
| Sahnoun, L | 1 |
| Chahed, J | 1 |
| Laamiri, R | 1 |
| Maazoun, K | 1 |
| Krichéne, I | 2 |
| Mekki, M | 3 |
| Belguith, M | 1 |
| Nouri, A | 3 |
| Küster, T | 3 |
| Hermann, C | 3 |
| Spiliotis, M | 2 |
| de Almeida, FB | 1 |
| Corrêa, CL | 1 |
| de Siqueira, NG | 1 |
| de Carvalho, NV | 1 |
| Rodrigues-Silva, R | 2 |
| de Andrade, AF | 1 |
| Machado-Silva, JR | 1 |
| Karam, N | 1 |
| Azarine, A | 1 |
| Menasché, P | 1 |
| Hagège, AA | 1 |
| Tulay, CM | 1 |
| Vecchio, R | 1 |
| Marchese, S | 1 |
| Ferla, F | 1 |
| Spataro, L | 1 |
| Intagliata, E | 1 |
| Kafaji, A | 1 |
| Al-Zain, T | 1 |
| Lemcke, J | 1 |
| Al-Zain, F | 1 |
| Chu, ZG | 1 |
| Lv, FJ | 1 |
| Zhu, ZY | 1 |
| Ouyang, Y | 1 |
| Freilij, H | 2 |
| García Bournissen, F | 1 |
| Siqueira, NG | 1 |
| Siqueira, CM | 1 |
| Soares, Mdo C | 1 |
| Póvoa, MM | 1 |
| Ahmadnia, S | 1 |
| Mohammadi-Samani, S | 1 |
| Oryan, A | 3 |
| Kuyumcu, ME | 1 |
| Yesil, Y | 1 |
| Etgül, S | 1 |
| Halaçli, B | 1 |
| Sunman, H | 1 |
| Yavuz, BB | 1 |
| Hazirolan, T | 1 |
| Halil, M | 1 |
| Cankurtaran, M | 1 |
| Ariogul, S | 1 |
| Kaloostian, PE | 1 |
| Gokaslan, ZL | 1 |
| Skiepko, R | 1 |
| Zietkowski, Z | 1 |
| Skiepko, U | 1 |
| Tomasiak-Lozowska, MM | 1 |
| Bodzenta-Lukaszyk, A | 1 |
| Concha, F | 1 |
| Maguiña, C | 1 |
| Seas, C | 1 |
| Hall, WA | 1 |
| Yaka, U | 1 |
| Aras, Y | 1 |
| Aydoseli, A | 1 |
| Akcakaya, MO | 1 |
| Sencer, A | 1 |
| Imer, M | 1 |
| Hepgul, K | 1 |
| Mujtaba, SS | 1 |
| Faridi, N | 1 |
| Haroon, S | 1 |
| Steinmetz, S | 1 |
| Racloz, G | 1 |
| Stern, R | 1 |
| Dominguez, D | 1 |
| Al-Mayahi, M | 1 |
| Schibler, M | 1 |
| Lew, D | 1 |
| Hoffmeyer, P | 1 |
| Uçkay, I | 1 |
| Aydin, BK | 1 |
| Acar, MA | 1 |
| Sumer, S | 1 |
| Demir, NA | 1 |
| Erkocak, OF | 1 |
| Ural, O | 1 |
| Nadeem, M | 1 |
| Biyabani, SR | 1 |
| Pervez, S | 1 |
| Valour, F | 1 |
| Khenifer, S | 1 |
| Della-Schiava, N | 1 |
| Cotte, E | 1 |
| Guibert, B | 1 |
| Wallon, M | 1 |
| Durupt, S | 1 |
| Durieu, I | 1 |
| Koza, Y | 1 |
| Tüfekçioğlu, O | 1 |
| Birincioğlu, L | 1 |
| Okten, S | 1 |
| Başar, V | 1 |
| Fayyaz, A | 1 |
| Ghani, UF | 1 |
| Bogdanovic, A | 1 |
| Radojkovic, M | 1 |
| Tomasevic, RJ | 1 |
| Pesic, I | 1 |
| Petkovic, TR | 1 |
| Kovacevic, P | 1 |
| Rancic, Z | 1 |
| Vlaar, AP | 1 |
| Hovius, JW | 1 |
| Stijnis, K | 1 |
| van Vugt, M | 1 |
| Choudhary, NS | 1 |
| Kumar, N | 1 |
| Puri, R | 1 |
| Pandey, A | 1 |
| Chandra, A | 1 |
| Masood, S | 1 |
| Pousibet-Puerto, J | 1 |
| Salas-Coronas, J | 1 |
| Viciana-Martínez-Lage, MJ | 1 |
| Villarejo-Ordóñez, A | 1 |
| Somay, H | 1 |
| Ayan, E | 1 |
| Turk, CC | 1 |
| Emon, ST | 1 |
| Berkman, MZ | 1 |
| Majbar, AM | 1 |
| Aalala, M | 1 |
| Elalaoui, M | 1 |
| Sabbah, F | 1 |
| Raiss, M | 1 |
| Hrora, A | 1 |
| Ahallat, M | 1 |
| Castro, S | 1 |
| Bruni, SS | 1 |
| Erkoç, MF | 1 |
| Öztoprak, B | 1 |
| Alkan, S | 1 |
| Okur, A | 1 |
| Küçük, Z | 1 |
| Karcaaltincaba, D | 1 |
| Ergün, Y | 1 |
| Doğan, AÇ | 1 |
| Çaydere, M | 1 |
| Küçük, H | 1 |
| Alvela-Suárez, L | 1 |
| Novo-Veleiro, I | 1 |
| Pérez del Villar, L | 1 |
| Valverde-Merino, MP | 1 |
| Cordero-Sánchez, M | 1 |
| Gündeş, E | 1 |
| Küçükkartallar, T | 2 |
| Çakır, M | 2 |
| Kitai, T | 1 |
| Ito, S | 1 |
| Koyama, T | 1 |
| Furukawa, Y | 1 |
| Rajabi, MT | 2 |
| Akbari-Kamrani, M | 1 |
| Gharib, MH | 1 |
| Rajabi, MB | 1 |
| Amoli, FA | 1 |
| Abrishami, Y | 1 |
| Oestreicher, J | 1 |
| Mai, HA | 1 |
| Wang, YH | 1 |
| Bai, L | 1 |
| Karadas, S | 1 |
| Cumhur, DA | 1 |
| Bilge, G | 1 |
| Mehmet, B | 1 |
| Mustafa, K | 1 |
| Gocen, U | 1 |
| Atalay, A | 1 |
| Basturk, Y | 1 |
| Topcuoglu, MS | 1 |
| Yaliniz, H | 2 |
| Salih, OK | 1 |
| Vejdani, M | 1 |
| Vejdani, S | 1 |
| Lotfi, S | 1 |
| Najafi, F | 1 |
| Nazari, N | 1 |
| Hamzavi, Y | 1 |
| Nanjappa, B | 1 |
| Gowda, KK | 1 |
| Larki, S | 2 |
| Saharkhiz, MJ | 2 |
| Ansary Lari, M | 1 |
| Mootabi Alavi, A | 1 |
| María, AC | 1 |
| Celina, EM | 1 |
| Tirnea, L | 1 |
| Minciu, R | 1 |
| Olariu, TR | 1 |
| Dumitrascu, V | 1 |
| Neghina, AM | 1 |
| Neghina, R | 1 |
| Kassa, BG | 1 |
| Yeshi, MM | 1 |
| Abraha, AH | 1 |
| Gebremariam, TT | 1 |
| Liang, W | 1 |
| Wang, XC | 2 |
| Wu, XW | 2 |
| Zhang, SJ | 2 |
| Peng, XY | 3 |
| Velioğlu, M | 1 |
| Diktaş, H | 1 |
| Kabalak, B | 1 |
| Tüfekçi, H | 1 |
| Cermik, H | 1 |
| Akar, I | 1 |
| Yalçin, B | 1 |
| Coşar, A | 1 |
| Mohammadi, A | 1 |
| Ghasemi-Rad, M | 1 |
| Oklu, R | 1 |
| Bouassria, A | 1 |
| Mazine, K | 1 |
| Elbouhaddouti, H | 1 |
| Mouaqit, O | 1 |
| Ousadden, A | 1 |
| Mazaz, K | 1 |
| Benjelloun, E | 1 |
| Taleb, KA | 1 |
| El Madi, A | 1 |
| Bouabdallah, Y | 1 |
| Boubaker, G | 1 |
| Müller, J | 1 |
| Müller, N | 1 |
| Gorgas, D | 2 |
| Lv, H | 2 |
| Liu, G | 1 |
| Zhang, S | 3 |
| Peng, X | 2 |
| Koca, T | 1 |
| Akcam, M | 1 |
| Anandpara, KM | 2 |
| Aswani, Y | 2 |
| Hira, P | 3 |
| Ekşi, MŞ | 1 |
| Bayri, Y | 1 |
| Saraçoğlu, A | 1 |
| Uyar Bozkurt, S | 1 |
| Konya, D | 1 |
| Diwan, R | 1 |
| Mogra, N | 1 |
| Purohit, M | 1 |
| Senhaji, L | 1 |
| Karhate, M | 1 |
| Amara, B | 1 |
| El Biaze, M | 1 |
| Benjelloun, MC | 1 |
| Tizniti, S | 1 |
| Lahlou, I | 1 |
| Serraj, M | 1 |
| Kısaoğlu, A | 1 |
| Özoğul, B | 1 |
| Atamanalp, SS | 1 |
| Pirimoğlu, B | 1 |
| Aydınlı, B | 1 |
| Korkut, E | 1 |
| Laura, C | 1 |
| Celina, E | 1 |
| Sergio, SB | 1 |
| Guillermo, D | 1 |
| Carlos, L | 1 |
| Luis, A | 1 |
| Ijaz, L | 1 |
| Mirza, B | 1 |
| Nadeem, MM | 1 |
| Saleem, M | 1 |
| Groothuis, I | 1 |
| van de Ven, C | 1 |
| Maat, LP | 1 |
| Paleru, C | 1 |
| de Jongste, JC | 1 |
| Bîrluţiu, V | 1 |
| Bîrluţiu, RM | 1 |
| Roman, A | 1 |
| Georgiu, C | 1 |
| Nicolau, D | 1 |
| Sabha, W | 1 |
| Surariu, M | 1 |
| Precup, D | 1 |
| Shakil, U | 1 |
| Rehman, AU | 1 |
| Shahid, R | 1 |
| Armiñanzas, C | 1 |
| Gutiérrez-Cuadra, M | 1 |
| Fariñas, MC | 1 |
| Sharma, P | 1 |
| Malhotra, A | 1 |
| Garg, P | 1 |
| Zeren, S | 1 |
| Kesici, U | 2 |
| Kesici, S | 2 |
| Maggiore, M | 1 |
| Bozok, Ş | 1 |
| Ozan Karakisi, S | 1 |
| Yılmaz, Y | 2 |
| Ergene, Ş | 1 |
| Tüfekçi, N | 1 |
| Karamustafa, H | 1 |
| Ilhan, G | 1 |
| Kazdal, H | 1 |
| Khan, MS | 1 |
| Hashmi, PM | 1 |
| Khan, D | 1 |
| Song, T | 1 |
| Qin, Y | 1 |
| Liu, W | 2 |
| Li, X | 1 |
| Shao, Y | 1 |
| Chinya, A | 1 |
| Khanolkar, A | 1 |
| Kumar, J | 1 |
| Sinha, SK | 1 |
| Raj, DH | 1 |
| Dash, PK | 1 |
| Abulaihaiti, M | 1 |
| Qiao, L | 1 |
| Lv, HL | 2 |
| Zhang, HW | 2 |
| Aduwayi, N | 1 |
| Wang, YJ | 1 |
| Ullio Gamboa, G | 1 |
| Alvarez, LI | 1 |
| Ortonobes Roig, S | 1 |
| López García, B | 1 |
| Solano Luque, MF | 1 |
| Ferrández Quirante, O | 1 |
| Erol, B | 1 |
| Onay, T | 1 |
| Çalışkan, E | 1 |
| Okay, E | 1 |
| Musetti, C | 1 |
| Guglielmetti, G | 1 |
| Quaglia, M | 1 |
| Izzo, C | 1 |
| Cantaluppi, V | 1 |
| Mohanty, S | 1 |
| Behera, B | 1 |
| Sasmal, PK | 1 |
| Praharaj, AK | 1 |
| Arce, MA | 1 |
| Limaylla, H | 1 |
| Valcarcel, M | 1 |
| Garcia, HH | 1 |
| Santivañez, SJ | 1 |
| Suffee, T | 1 |
| Chader, H | 1 |
| Foulet, F | 1 |
| Herruela, C | 1 |
| Djabbari, M | 1 |
| Chosidow, O | 1 |
| Zehou, O | 1 |
| Sathe, PA | 1 |
| Tzili, N | 1 |
| Ahbeddou, S | 1 |
| Ahmimech, J | 1 |
| Abboud, H | 1 |
| Boutarbouch, M | 1 |
| El Hassan, A | 1 |
| Berraho, A | 1 |
| Oudni-M'rad, M | 1 |
| M'rad, S | 1 |
| Ksia, A | 2 |
| Lamiri, R | 1 |
| Mezhoud, H | 1 |
| Babba, H | 1 |
| Basyigit, S | 1 |
| Sapmaz, F | 1 |
| Bora, F | 1 |
| Bali, B | 1 |
| Najjar, M | 1 |
| Şahin, B | 1 |
| Çomoğlu, Ş | 1 |
| Polat, B | 1 |
| Değer, K | 1 |
| Ye, J | 1 |
| Ma, L | 1 |
| Rodrigues, G | 1 |
| Prabhu, R | 1 |
| Houri, O | 1 |
| Bazarsky, E | 2 |
| Berkowitz, A | 1 |
| Bulkowstein, S | 1 |
| Barrett, C | 1 |
| Greenberg, D | 2 |
| Karadağlı, E | 1 |
| Gürses, D | 1 |
| Akpınar, F | 1 |
| Herek, Ö | 1 |
| Birsen, O | 1 |
| Aydın, Ç | 2 |
| Saravi, SS | 1 |
| Sabouni, F | 1 |
| Arefidoust, A | 1 |
| Yaftian, R | 1 |
| Heydarzadeh, S | 1 |
| Karakoç, ZC | 1 |
| Kasimcan, MO | 1 |
| Pipia, AP | 1 |
| Tore, G | 1 |
| Alberti, A | 1 |
| Varcasia, A | 1 |
| Sav, A | 1 |
| Oruçkaptan, H | 1 |
| Soares, AT | 1 |
| Couto, C | 1 |
| Cabral, MJ | 1 |
| Carmona, L | 1 |
| Vieira, I | 1 |
| Salamone, G | 1 |
| Licari, L | 1 |
| Randisi, B | 1 |
| Di Carlo, P | 2 |
| Tutino, R | 1 |
| Falco, N | 1 |
| Augello, G | 1 |
| Raspanti, C | 1 |
| Cocorullo, G | 1 |
| Gulotta, G | 1 |
| Lötsch, F | 1 |
| Naderer, J | 1 |
| Skuhala, T | 1 |
| Groger, M | 1 |
| Kaczirek, K | 1 |
| Waneck, F | 1 |
| Yang, T | 2 |
| Xia, J | 2 |
| Hou, J | 2 |
| Wu, X | 2 |
| Wassermann, M | 1 |
| Woldeyes, D | 1 |
| Gerbi, BM | 1 |
| Ebi, D | 1 |
| Mackenstedt, U | 1 |
| Petros, B | 1 |
| Tilahun, G | 1 |
| Romig, T | 2 |
| Bekele, A | 1 |
| Firew, A | 1 |
| Narra, R | 1 |
| Nicoletti, GJ | 1 |
| Rinaldi, F | 1 |
| Demirel, M | 1 |
| Toprak, C | 1 |
| Tabakçı, MM | 1 |
| Öcal, L | 1 |
| Gao, H | 1 |
| Bournissen, FG | 1 |
| Ballering, G | 1 |
| Naseri, M | 1 |
| Akbari, NA | 1 |
| Bahce, ZS | 1 |
| Akbulut, S | 3 |
| Aday, U | 1 |
| Demircan, F | 1 |
| Senol, A | 1 |
| Kadihasanoglu, M | 1 |
| Kilciler, M | 1 |
| Atahan, O | 1 |
| Spahn, S | 1 |
| Helmchen, B | 1 |
| Zingg, U | 1 |
| Zhou, Y | 1 |
| Su, L | 1 |
| Liu, B | 2 |
| Faucher, JF | 1 |
| Descotes-Genon, C | 1 |
| Hoen, B | 1 |
| Godard, J | 1 |
| Félix, S | 1 |
| Aubry, S | 1 |
| Blagosklonov, O | 3 |
| Brientini, MP | 1 |
| Chirouze, C | 1 |
| Noaman, H | 1 |
| Rawaf, S | 1 |
| Majeed, A | 1 |
| Salmasi, AM | 1 |
| Rodríguez Sanz, MB | 1 |
| Roldán Cuena, MD | 1 |
| Blanco Álvarez, CA | 1 |
| Sánchez Jiménez, R | 1 |
| Patel, J | 1 |
| Ali, M | 1 |
| Marreros, N | 1 |
| Arslan, S | 1 |
| Bakdik, S | 1 |
| Oncu, F | 1 |
| Tolu, I | 1 |
| Eryilmaz, MA | 1 |
| Pan, D | 1 |
| Bhattacharya, D | 1 |
| Bera, AK | 1 |
| Gudewar, J | 1 |
| De, S | 1 |
| Das, SK | 1 |
| Ozkan, H | 1 |
| Dogramaci, Y | 1 |
| Kose, O | 2 |
| Esen, E | 1 |
| Erdem, H | 1 |
| Komurcu, M | 1 |
| Bahloul, K | 1 |
| Ouerchefani, N | 1 |
| Boudouara, MZ | 1 |
| Sayilir, K | 1 |
| Iskender, G | 1 |
| Oğan, C | 1 |
| Arik, AI | 1 |
| Pak, I | 1 |
| Jevtić, M | 1 |
| Mikić, D | 1 |
| Arsić-Komljenović, G | 1 |
| Stanković, N | 1 |
| Ristanović, E | 1 |
| Sjenicić, G | 1 |
| Janićijević-Hudomal, S | 1 |
| Erkut, B | 1 |
| Unlu, Y | 1 |
| Ozden, K | 1 |
| Acikel, M | 1 |
| Soleimani, A | 1 |
| Sahebjam, M | 1 |
| Marzban, M | 1 |
| Shirani, S | 1 |
| Abbasi, A | 1 |
| Varedi, P | 3 |
| Saadat Mostafavi, SR | 2 |
| Salouti, R | 1 |
| Saedi, D | 2 |
| Nabavizadeh, SA | 2 |
| Samimi, K | 1 |
| Larijani, T | 1 |
| Darabi, M | 2 |
| Makhmalbaf, AO | 1 |
| Garagnani, L | 1 |
| Sudanese, A | 1 |
| Rimondi, E | 1 |
| Bacchini, P | 1 |
| Ben Brahim, M | 1 |
| El Ezzi, O | 1 |
| Belghith, M | 1 |
| Mohebi, AR | 1 |
| Mahmoodi, S | 1 |
| Erfan, A | 1 |
| Ostadali Makhmalbaf, A | 1 |
| Karenovics, W | 1 |
| Azagury, DE | 1 |
| Groebli, Y | 1 |
| Steurer, S | 1 |
| Yang, HQ | 1 |
| Li, BJ | 1 |
| Liu, YK | 1 |
| Stamatakos, M | 3 |
| Sargedi, C | 1 |
| Stefanaki, Ch | 1 |
| Safioleas, C | 1 |
| Matthaiopoulou, I | 1 |
| Safioleas, M | 3 |
| Savini, H | 1 |
| Bonin-Guillaume, S | 1 |
| Rossi, P | 1 |
| Lagier, JC | 2 |
| Chaumoitre, K | 1 |
| Bagnères, D | 1 |
| Demoux, AL | 1 |
| Francès, Y | 1 |
| Granel, B | 1 |
| Eroglu, E | 1 |
| Gemici, G | 1 |
| Ergenoglu, M | 1 |
| Yildiz, C | 1 |
| Kucukaksu, S | 1 |
| Degertekin, M | 1 |
| Cemil, B | 1 |
| Tun, K | 2 |
| Gurcay, AG | 1 |
| Uygur, A | 1 |
| Kaptanoglu, E | 1 |
| Sasani, M | 1 |
| Ozer, AF | 1 |
| Molina Infante, J | 1 |
| Fernández Bermejo, M | 1 |
| Martín Noguerol, E | 1 |
| Pérez Gallardo, B | 1 |
| Donegani, E | 1 |
| Pisani, P | 1 |
| Radaelli, S | 1 |
| Pula, G | 1 |
| Portella, G | 1 |
| Bygott, JM | 1 |
| Daoudi, A | 1 |
| Shimi, M | 1 |
| Lahrach, K | 1 |
| Elibrahimi, A | 1 |
| Loudiyi, WD | 1 |
| Amar, MF | 1 |
| Chbani, B | 1 |
| Boutayeb, F | 2 |
| Elmrini, A | 1 |
| Turgut, AT | 1 |
| Turgut, M | 2 |
| Massoud, W | 1 |
| Saheb, N | 1 |
| Iliescu, B | 1 |
| Kreitmann, L | 1 |
| Chabenne, J | 1 |
| Campeggi, A | 1 |
| Molinie, V | 1 |
| Baumert, H | 1 |
| Bakshi, J | 1 |
| Panda, NK | 1 |
| Saravanan, K | 1 |
| Vasishta, RK | 1 |
| Sachdeva, MU | 1 |
| Goenka, AH | 1 |
| Das, CJ | 1 |
| Goel, P | 1 |
| Srinivas, M | 1 |
| Pangtey, GS | 1 |
| Sharif, MA | 1 |
| Mahmood, A | 1 |
| Murtaza, B | 1 |
| Malik, IB | 1 |
| Khan, A | 2 |
| Asghar, Z | 1 |
| Arif, A | 1 |
| Younan, T | 1 |
| Sfeir, S | 1 |
| Kheir, C | 1 |
| Slaba, S | 1 |
| Midyat, L | 1 |
| Gökçe, S | 1 |
| Onder, A | 2 |
| Ozdemir, Y | 1 |
| Mursalov, G | 1 |
| Mir, S | 1 |
| Moreno, J | 1 |
| Téllez, CJ | 1 |
| Pardo, FJ | 1 |
| Baglam, T | 1 |
| Karatas, E | 1 |
| Durucu, C | 1 |
| Sirikci, A | 1 |
| Kara, F | 1 |
| Kanlikama, M | 1 |
| Anvari, M | 1 |
| Amirjamshidi, A | 1 |
| Abbassioun, K | 1 |
| Ozyurtkan, MO | 1 |
| Koçyiğit, S | 1 |
| Cakmak, M | 1 |
| Balci, AE | 1 |
| Lakhdar, F | 1 |
| Arkha, Y | 1 |
| Rifi, L | 1 |
| Derraz, S | 1 |
| El Ouahabi, A | 1 |
| El Khamlichi, A | 1 |
| Babady, NE | 1 |
| Pritt, BS | 1 |
| Walker, RC | 1 |
| Rosenblatt, JE | 1 |
| Binnicker, MJ | 1 |
| Ishikawa, Y | 1 |
| Sako, Y | 1 |
| Itoh, S | 1 |
| Ohtake, T | 1 |
| Kohgo, Y | 1 |
| Matsuno, T | 2 |
| Ohsaki, Y | 1 |
| Miyokawa, N | 1 |
| Nakao, M | 2 |
| Nakaya, K | 1 |
| Ito, A | 1 |
| Akhan, O | 3 |
| Canyigit, M | 1 |
| Kaya, D | 1 |
| Koksal, A | 1 |
| Akgoz, A | 1 |
| Yucesoy, C | 1 |
| Akinci, D | 1 |
| Carter, C | 1 |
| Bonatti, H | 1 |
| Hranjec, T | 1 |
| Barroso, LF | 1 |
| Donowitz, G | 1 |
| Sawyer, RG | 1 |
| Schirmer, B | 1 |
| Uchikova, E | 1 |
| Pehlivanov, B | 1 |
| Uchikov, A | 1 |
| Shipkov, C | 1 |
| Poriazova, E | 1 |
| Ozaras, R | 2 |
| Vanli, E | 1 |
| Kantarci, F | 2 |
| Ramazanoglu, R | 1 |
| Mete, B | 1 |
| Schipper, HG | 2 |
| Simsek, S | 1 |
| van Agtmael, MA | 1 |
| van Lienden, KP | 1 |
| Zimmerman, DM | 1 |
| Douglass, M | 1 |
| Reavill, DR | 1 |
| Greiner, EC | 1 |
| Cabadak, H | 1 |
| Erbay, A | 1 |
| Aypak, A | 1 |
| Tekçe, AY | 1 |
| Sen, S | 1 |
| Cevirme, D | 1 |
| Yerebakan, C | 1 |
| Bayraktar, S | 1 |
| Sunar, H | 1 |
| Moretti, B | 1 |
| Panella, A | 1 |
| Moretti, L | 1 |
| Garofalo, R | 1 |
| Notarnicola, A | 1 |
| Crouzet, J | 1 |
| Delabrousse, E | 2 |
| Thevenot, T | 1 |
| Di Martino, V | 1 |
| Mantion, GA | 2 |
| Yazdani, N | 1 |
| Basam, A | 1 |
| Heidarali, M | 1 |
| Sharif Kashani, S | 1 |
| Hasibi, M | 1 |
| Mokhtari, Z | 1 |
| Zendah, I | 1 |
| Ben Saad, S | 1 |
| Daghfous, H | 1 |
| Ayadi, A | 1 |
| Toujani, S | 1 |
| Merai, S | 1 |
| Ben M'rad, S | 1 |
| Tritar, F | 1 |
| Limaiem, F | 2 |
| Bellil, S | 2 |
| Bellil, K | 2 |
| Chelly, I | 2 |
| Mekni, A | 2 |
| Kallel, J | 2 |
| Haouet, S | 2 |
| Zitouna, M | 2 |
| Kchir, N | 2 |
| Khaldi, M | 2 |
| Cataño, J | 1 |
| Gdoura, F | 1 |
| Trigui, M | 1 |
| Zribi, W | 1 |
| Ellouze, Z | 1 |
| Bouzidi, R | 1 |
| Ayedi, K | 1 |
| Keskes, H | 2 |
| Pelegri, C | 1 |
| Gaertner, E | 1 |
| Bernard, E | 2 |
| Boileau, P | 1 |
| Trojani, C | 1 |
| Gavidia, CM | 1 |
| Gonzalez, AE | 1 |
| Barron, EA | 1 |
| Ninaquispe, B | 1 |
| Llamosas, M | 1 |
| Verastegui, MR | 1 |
| Robinson, C | 1 |
| Gilman, RH | 1 |
| Ozgonul, A | 1 |
| Sogut, O | 2 |
| Cece, H | 2 |
| Aydın, S | 1 |
| Kürkcüoglu, IC | 2 |
| Sureka, J | 1 |
| Sarawagi, R | 1 |
| Eapen, A | 1 |
| Keshava, SN | 1 |
| Vedantam, R | 1 |
| Jalil, S | 1 |
| Saleem, Y | 1 |
| Suleman, BA | 1 |
| Chughtai, N | 1 |
| Kotil, K | 1 |
| Tari, R | 1 |
| Savas, Y | 1 |
| Tuncer, E | 1 |
| Tas, SG | 1 |
| Mataraci, I | 1 |
| Tuncer, A | 2 |
| Donmez, AA | 1 |
| Aksut, M | 1 |
| Yakut, C | 1 |
| Molavipour, A | 1 |
| Javan, H | 1 |
| Moghaddam, AA | 1 |
| Dastani, M | 1 |
| Abbasi, M | 1 |
| Ghahramani, S | 1 |
| Ekiz, F | 1 |
| Coban, S | 1 |
| Onder, EO | 1 |
| Turan, D | 1 |
| Yuksel, İ | 1 |
| Yuksel, O | 1 |
| Uçar, O | 1 |
| Ciçekçioğlu, H | 1 |
| Demirçelik, B | 1 |
| Aydoğdu, S | 2 |
| Sudo, H | 1 |
| Minami, A | 1 |
| Neuville, M | 1 |
| Grisoli, D | 1 |
| Nicoud, A | 1 |
| Jacquier, A | 1 |
| Collart, F | 1 |
| Thomas, P | 1 |
| Parola, P | 1 |
| Sharma, T | 2 |
| Khosla, VK | 1 |
| Brar, R | 1 |
| Erbey, F | 1 |
| Bayram, I | 1 |
| Soyupak, S | 1 |
| Tanyeli, A | 1 |
| Goz, M | 1 |
| Hazar, A | 1 |
| Demirbag, R | 2 |
| Moguilensky, J | 2 |
| Panomarenko, H | 3 |
| Volpe, M | 2 |
| Mancini, S | 2 |
| Odriozola, M | 3 |
| Zia, S | 1 |
| Enam, A | 1 |
| Salahuddin, I | 1 |
| Zahed, HM | 1 |
| Mizanur, RM | 1 |
| Mohammad, BS | 1 |
| Santra, G | 1 |
| Erayman, I | 1 |
| Kalkan, E | 1 |
| Erdi, F | 1 |
| Esen, H | 1 |
| Nayil, K | 1 |
| Ramzan, A | 1 |
| Jain, A | 1 |
| Sharma, M | 1 |
| Mahadevan, B | 1 |
| Scholl, S | 1 |
| Jellali, MA | 1 |
| Mnif, H | 1 |
| Hmida, B | 1 |
| Golli, M | 1 |
| Pérez-Molina, JA | 1 |
| Díaz-Menéndez, M | 1 |
| Gallego, JI | 1 |
| Norman, F | 1 |
| Ayala, AP | 1 |
| Moore, J | 1 |
| Ahmed, MY | 1 |
| Gociman, B | 1 |
| Altas, M | 1 |
| Aras, M | 1 |
| Serarslan, Y | 1 |
| Davran, R | 1 |
| Evirgen, O | 1 |
| Yilmaz, N | 2 |
| Karaca, G | 1 |
| Pekcici, R | 1 |
| Köklü, S | 1 |
| Pirti, O | 1 |
| Güler, O | 1 |
| Samadian, M | 1 |
| Alavi, E | 1 |
| Sharifi, G | 1 |
| Rezaee, O | 1 |
| Faramarzi, F | 1 |
| Nickavar, A | 1 |
| Scarlata, F | 2 |
| Giordano, S | 2 |
| Saporito, L | 1 |
| Marasa, L | 1 |
| Li Pani, G | 1 |
| Odierna, A | 1 |
| Scaglione, V | 1 |
| Romano, A | 1 |
| Ouadnouni, Y | 1 |
| Bouchikh, M | 1 |
| Achir, A | 1 |
| Smahi, M | 1 |
| Msougar, Y | 1 |
| Lakranbi, M | 1 |
| Alaziz, AS | 1 |
| Benosman, A | 1 |
| Parlakgumus, HA | 1 |
| Parlakgumus, A | 1 |
| Haydardedeoglu, B | 1 |
| Bolat, F | 1 |
| Fabijanić, D | 1 |
| Bulat, C | 1 |
| Letica, D | 1 |
| Nenadić, D | 1 |
| Pešutić-Pisac, V | 1 |
| Carević, V | 1 |
| Yang, G | 1 |
| Mao, Y | 1 |
| Shukla, A | 1 |
| Garge, S | 1 |
| Verma, P | 1 |
| Breijo, M | 1 |
| Isnardi, F | 1 |
| Brauer, M | 1 |
| Schenker, R | 1 |
| Ferrari, M | 1 |
| Ferreira, AM | 1 |
| Pekcan, S | 1 |
| Kiper, N | 3 |
| Köse, M | 1 |
| Cobanoğlu, N | 1 |
| Yalçın, E | 2 |
| Doğru, D | 2 |
| Ozçelik, U | 3 |
| Khattabi, WE | 1 |
| Afif, H | 2 |
| Berrada, Z | 1 |
| Rhissassi, J | 1 |
| Aichane, A | 2 |
| Bouayad, Z | 2 |
| Malik, AA | 1 |
| ul Bari, S | 1 |
| Younis, M | 1 |
| Wani, KA | 1 |
| Rather, AA | 1 |
| Erol, T | 1 |
| Altay, H | 1 |
| Tarim, E | 1 |
| Ozkan, M | 1 |
| Astarcioglu, MA | 1 |
| Gursoy, O | 1 |
| Aykan, AC | 1 |
| Ellouze, S | 1 |
| Bahri, M | 1 |
| Abdennadher, M | 1 |
| Kossentini, M | 1 |
| Abid, N | 1 |
| Chaabouni, S | 1 |
| Khabir, A | 1 |
| Boudawara, T | 1 |
| Gümüş, M | 1 |
| Yağmur, Y | 1 |
| Gümüş, H | 1 |
| Kapan, M | 1 |
| Böyük, A | 1 |
| Ulusoy, S | 1 |
| Ozkan, G | 1 |
| Mungan, S | 1 |
| Cansu, A | 1 |
| Cansiz, M | 1 |
| Köseoğlu, R | 1 |
| Kaynar, K | 1 |
| Prousalidis, J | 1 |
| Kosmidis, C | 1 |
| Anthimidis, G | 1 |
| Kapoutzis, K | 1 |
| Karamanlis, E | 1 |
| Fachantidis, E | 1 |
| Tekin, R | 1 |
| Kara, AF | 1 |
| Tekin, RC | 1 |
| Cimen, D | 1 |
| Cogan, A | 1 |
| Ilharreborde, B | 1 |
| Lenoir, T | 1 |
| Hoffmann, E | 1 |
| Dauzac, C | 1 |
| Guigui, P | 1 |
| Alimohamadi, S | 1 |
| Dehghan, A | 1 |
| Neghab, N | 1 |
| Akkoyun, I | 1 |
| Akbıyık, F | 1 |
| Altunkeser, A | 1 |
| Li, HT | 1 |
| Shan, JY | 1 |
| Shao, YM | 1 |
| Tuergan, A | 1 |
| Ayifuhan, A | 1 |
| Ran, B | 1 |
| de Lavaissiere, M | 1 |
| Voronca, C | 1 |
| Ranz, I | 1 |
| Pirame, M | 1 |
| Hounieu, H | 1 |
| Carreiro, M | 1 |
| El Oueriachi, F | 2 |
| Traibi, A | 2 |
| El Hammoumi, M | 2 |
| Arsalane, A | 3 |
| Kabiri, el H | 2 |
| Tekin, A | 1 |
| Özalp, AH | 1 |
| Yıldırım, MA | 1 |
| Aksoy, F | 1 |
| Türkmen, ÜA | 1 |
| Ulusoy, H | 1 |
| Duman, A | 1 |
| Burakgazi, G | 1 |
| Yavuz, E | 1 |
| Ipek, G | 1 |
| Omeroglu, SN | 1 |
| Goksedef, D | 1 |
| Balkanay, OO | 1 |
| Kanbur, E | 1 |
| Engin, E | 1 |
| Baskurt, M | 1 |
| Kucukoglu, S | 1 |
| Ma, ZL | 1 |
| Ma, LG | 1 |
| Ni, Y | 1 |
| Karapolat, S | 1 |
| Dumlu, T | 1 |
| Yildirim, U | 1 |
| Karapolat, B | 1 |
| Erbas, M | 1 |
| Calabro, A | 1 |
| Chiosso, C | 1 |
| Saad, R | 1 |
| Goblirsch, S | 1 |
| Hamdan, TA | 1 |
| Ben, SS | 1 |
| Kaya, H | 1 |
| Işıkay, S | 1 |
| Yılmaz, K | 1 |
| Ölmez, A | 1 |
| Lahiani, D | 1 |
| Abid, L | 2 |
| Mâaloul, I | 1 |
| Kahla, SB | 1 |
| Bradii, M | 1 |
| Marrakchi, Ch | 1 |
| Hammami, B | 1 |
| Mnif, J | 1 |
| Kammoun, S | 1 |
| Jemâa, MB | 1 |
| Darbi, A | 1 |
| Alloubi, I | 1 |
| Chadmi, T | 1 |
| Ezerrouki, A | 1 |
| Sharma, R | 2 |
| Mathur, A | 1 |
| Sinha, P | 1 |
| Chhaya, V | 1 |
| Alimehmeti, R | 1 |
| Seferi, A | 1 |
| Rroji, A | 1 |
| Alimehmeti, M | 1 |
| Lotfinia, I | 1 |
| Sayyahmelli, S | 1 |
| Mahdkhah, A | 1 |
| Shoja, MM | 1 |
| Canpolat, U | 1 |
| Yorgun, H | 1 |
| Şahiner, L | 1 |
| Aytemir, K | 1 |
| Sogunuru, G | 1 |
| Murty, DS | 1 |
| Chinta, VR | 1 |
| Vuddanda, K | 1 |
| Moka, N | 1 |
| Zumkehr, B | 1 |
| Theurillat, R | 2 |
| Thormann, W | 3 |
| Sanlı, AM | 1 |
| Türkoğlu, E | 1 |
| Kertmen, H | 1 |
| Gürer, B | 1 |
| Yilmaz, M | 2 |
| Sogutlu, G | 1 |
| Arabaci, E | 1 |
| Kayaalp, C | 1 |
| Ozdemir, NG | 1 |
| Binici, DN | 1 |
| Ozsoy, KM | 1 |
| Shetty, R | 1 |
| Vivek, G | 1 |
| Nayak, S | 1 |
| Dias, L | 1 |
| Asadi Gharabaghi, M | 1 |
| Ayoobi Yazdi, N | 1 |
| Jafari, S | 1 |
| Liao, M | 1 |
| Shankarappa, RK | 1 |
| Moorthy, N | 1 |
| Bhat, P | 1 |
| Nanjappa, MC | 1 |
| Kapoor, SK | 1 |
| Kataria, H | 1 |
| Patra, SR | 1 |
| Bharadwaj, M | 1 |
| Vijay, V | 1 |
| Kapoor, S | 1 |
| Braggion-Santos, MF | 1 |
| Abdel-Aty, H | 1 |
| Hofmann, N | 1 |
| Katus, HA | 1 |
| Steen, H | 1 |
| de Olaiz Navarro, B | 1 |
| Jiménez Hiscock, L | 1 |
| Ruiz Sierra, AY | 1 |
| Sultana, N | 1 |
| Hashim, TK | 1 |
| Jan, SY | 1 |
| Khan, Z | 1 |
| Malik, T | 1 |
| Shah, W | 1 |
| Gavriilidis, P | 1 |
| Ananiadis, A | 1 |
| Theodoulidis, V | 1 |
| Barbanis, S | 1 |
| Agliata, S | 1 |
| Banerjee, S | 1 |
| Sabui, KK | 1 |
| Mondal, J | 1 |
| Nath, C | 1 |
| Pal, DK | 1 |
| Razzaghi, MR | 1 |
| Mazloomfard, MM | 1 |
| Bahrami-Motlagh, H | 1 |
| Javanmard, B | 1 |
| Khorgami, Z | 1 |
| Shoar, S | 1 |
| Hosseini Araghi, N | 1 |
| Soroush, A | 1 |
| Miguet, JP | 1 |
| Nowak, DA | 1 |
| Lücking, MO | 1 |
| Böhmer, RH | 1 |
| Schreiner, R | 1 |
| Fuchs, HH | 1 |
| Flügel, KA | 1 |
| Dilege, S | 1 |
| Bayrak, Y | 1 |
| Toker, A | 1 |
| Kalayci, G | 1 |
| Takakuwa, M | 1 |
| Katsuki, M | 1 |
| Hirayama, T | 1 |
| Yoshida, E | 1 |
| Riganò, R | 4 |
| Ioppolo, S | 3 |
| Ortona, E | 2 |
| Margutti, P | 1 |
| Profumo, E | 4 |
| Ali, MD | 1 |
| Di Vico, B | 2 |
| Teggi, A | 10 |
| Siracusano, A | 4 |
| Eroglu, A | 1 |
| Polat, P | 1 |
| Kuremu, RT | 1 |
| Khwa-Otsyula, BO | 1 |
| Svanvik, J | 1 |
| Bwombengi, OS | 1 |
| Lelei, LK | 1 |
| Mathews, D | 1 |
| Escudero, MD | 1 |
| Sabater, L | 1 |
| Calvete, J | 1 |
| Camps, B | 1 |
| Labiós, M | 1 |
| Lledó, S | 1 |
| Zamani, A | 1 |
| Aydemir, Y | 1 |
| Gormus, N | 1 |
| Odev, K | 1 |
| Solak, H | 1 |
| Ridai, M | 1 |
| Louzi, A | 1 |
| Mejjad, A | 1 |
| Kafih, M | 1 |
| Aghzadi, R | 1 |
| Zerouali, NO | 1 |
| Kiratli, H | 1 |
| Bilgiç, S | 1 |
| Oztürkmen, C | 1 |
| Aydin, O | 1 |
| Göçmen, A | 2 |
| Gao, J | 2 |
| Zhai, Z | 1 |
| Niu, RL | 1 |
| Xue, HX | 1 |
| Mo, HM | 1 |
| Tang, QK | 1 |
| Wang, XZ | 1 |
| Gaym, A | 1 |
| Abebe, D | 1 |
| Degefe, DA | 1 |
| El-On, J | 3 |
| Kulkarni, D | 1 |
| Kulkarni, H | 1 |
| Deshpande, AA | 1 |
| Karyakarte, R | 1 |
| Mishrikotkar, P | 1 |
| Kandi, J | 1 |
| Sato, N | 2 |
| Ogasawara, K | 1 |
| Matsushita, M | 1 |
| Todo, S | 2 |
| Ozkoç, G | 1 |
| Akpinar, S | 1 |
| Hersekli, MA | 1 |
| Ozalay, M | 1 |
| Tandoğan, R | 1 |
| Cöl, C | 1 |
| Cöl, M | 1 |
| Lafçi, H | 1 |
| Djoshibaev, S | 1 |
| Kudaiberdiev, T | 1 |
| Maralov, A | 1 |
| Shabraliev, S | 1 |
| Djooshev, K | 1 |
| Halikov, UM | 1 |
| Yankovskaya, L | 1 |
| Koyuncu, A | 1 |
| Turan, M | 1 |
| Taş, F | 1 |
| Gökgöz, S | 1 |
| Sen, M | 1 |
| Can, D | 1 |
| Oztekin, O | 2 |
| Tinar, S | 1 |
| Sanci, M | 1 |
| Herrera, A | 2 |
| Martínez, AA | 2 |
| Mishwani, AH | 1 |
| Ahmad, M | 1 |
| ud Din, AS | 1 |
| Chawla, A | 1 |
| Maheshwari, M | 1 |
| Parmar, H | 1 |
| Hanchate, V | 1 |
| Loudiye, H | 1 |
| Aktaou, S | 1 |
| Hassikou, H | 1 |
| El-Bardouni, A | 1 |
| El-Manouar, M | 1 |
| Fizazi, M | 1 |
| Tazi, A | 1 |
| Hajjaj-Hassouni, N | 2 |
| Daniel-Mwuambete, K | 1 |
| Ponce-Gordo, F | 1 |
| Torrado, J | 1 |
| Torrado, S | 1 |
| Cuesta-Bandera, C | 1 |
| Kolyvanos Naumann, U | 1 |
| Käser, L | 1 |
| Vetter, W | 1 |
| Massè, A | 1 |
| Parola, PG | 1 |
| Brach del Prever, EM | 1 |
| Gallinaro, P | 1 |
| Rena, O | 1 |
| Garavoglia, M | 1 |
| Francini, M | 1 |
| Bellora, P | 1 |
| Oliaro, A | 1 |
| Casadio, C | 1 |
| Yildirim, E | 1 |
| Dural, K | 1 |
| Baldemir, M | 1 |
| Sakinci, U | 1 |
| Baykan, A | 1 |
| Yildirim, S | 1 |
| Koksal, HM | 1 |
| Celayir, F | 1 |
| Oner, M | 1 |
| Pintor-Holguín, E | 1 |
| García-Méndez, P | 1 |
| Moral-Pascual, JM | 1 |
| Barbosa-Rodríguez, JL | 1 |
| Stettler, M | 1 |
| Rossignol, JF | 2 |
| Fink, R | 1 |
| Merli, M | 1 |
| Dricot, E | 1 |
| Segers, R | 1 |
| Ozdemir, HM | 1 |
| Ogün, TC | 1 |
| Tasbas, B | 1 |
| Beyrouti, MI | 1 |
| Beyrouti, R | 1 |
| Abbes, I | 1 |
| Kharrat, M | 1 |
| Ben Amar, M | 1 |
| Frikha, F | 1 |
| Elleuch, S | 1 |
| Gharbi, W | 1 |
| Chaabouni, M | 1 |
| Ghorbel, A | 1 |
| Hosch, W | 2 |
| Werner, J | 1 |
| Düx, M | 1 |
| Mercapide, C | 2 |
| Sustersic, J | 1 |
| Costa, M | 2 |
| Bigatti, R | 1 |
| Labanchi, J | 1 |
| Cantoni, G | 2 |
| Perez, A | 2 |
| Buyukbebeci, O | 1 |
| Gulec, A | 1 |
| Gokalp, A | 1 |
| Karakurum, G | 1 |
| Guven, A | 1 |
| Sokmen, G | 1 |
| Yuksel, M | 2 |
| Kokoglu, OF | 1 |
| Koksal, N | 1 |
| Cetinkaya, A | 1 |
| Torgerson, P | 1 |
| Maiocchi, L | 1 |
| Garlaschelli, AL | 1 |
| Gulizia, R | 1 |
| Filice, C | 1 |
| Guven, GS | 1 |
| Simsek, H | 1 |
| Cakir, B | 1 |
| Abbasoglu, O | 1 |
| Acartürk, E | 1 |
| öZeren, A | 1 |
| Koç, M | 1 |
| Biçakci, S | 1 |
| Demir, M | 1 |
| Karabay, O | 1 |
| Onen, A | 1 |
| Yildiz, F | 1 |
| Yilmaz, E | 1 |
| Erdal, CA | 1 |
| Sanli, A | 1 |
| Kilci, G | 1 |
| Algin, I | 1 |
| Itil, O | 1 |
| Açikel, U | 1 |
| Bildirici, K | 1 |
| Peker, B | 1 |
| Ozden, H | 1 |
| Dvoroznáková, E | 1 |
| Hrcková, G | 1 |
| Borosková, Z | 1 |
| Velebný, S | 1 |
| Dubinský, P | 1 |
| Cooney, RM | 1 |
| Flanagan, KP | 1 |
| Zehyle, E | 1 |
| Iyigun, O | 1 |
| Uysal, S | 1 |
| Sancak, R | 1 |
| Hokelek, M | 1 |
| Uyar, Y | 1 |
| Bernay, F | 1 |
| Ariturk, E | 1 |
| Liubchenko, PN | 1 |
| Legon'kov, IuA | 1 |
| Musaev, GKh | 1 |
| Mal'tseva, LM | 1 |
| Poliakova, EA | 1 |
| Bauer, T | 1 |
| David, T | 1 |
| Lortat-Jacob, A | 1 |
| Ketata, H | 1 |
| Peyromaure, M | 1 |
| Lidove, O | 1 |
| Chauveheid, MP | 1 |
| Papo, T | 1 |
| Hernigou, A | 1 |
| Charlotte, F | 1 |
| Piette, JC | 1 |
| Penaud, D | 1 |
| Scheublé, C | 1 |
| Acierno, C | 1 |
| Milazzo, M | 1 |
| Nasta, R | 1 |
| Celauro, MC | 1 |
| Troia, G | 1 |
| Kühne, R | 1 |
| Stäubli, M | 1 |
| Schmid, W | 1 |
| Opatrny, L | 1 |
| Prichard, R | 1 |
| Snell, L | 1 |
| Maclean, JD | 1 |
| Kahilogullari, G | 1 |
| Tuna, H | 1 |
| Aydin, Z | 1 |
| Colpan, E | 1 |
| Egemen, N | 1 |
| Beskonakli, E | 1 |
| Solaroglu, I | 1 |
| Albayrak, L | 1 |
| Sanjuán Rodríguez, S | 1 |
| Morán Penco, JM | 1 |
| Rincón Rodera, P | 1 |
| González Díez, G | 1 |
| Sirmali, M | 1 |
| Gezer, S | 1 |
| Kaya, S | 1 |
| Garg, B | 1 |
| Krishnakiran, E | 1 |
| Malhotra, R | 1 |
| Bhan, S | 1 |
| Husen, YA | 1 |
| Nadeem, N | 1 |
| Aslam, F | 1 |
| Bhaila, I | 1 |
| Lada, P | 1 |
| Lermite, E | 1 |
| Hennekinne-Mucci, S | 1 |
| Etienne, S | 1 |
| Pessaux, P | 1 |
| Arnaud, JP | 1 |
| Emilio, C | 1 |
| Losurdo, G | 1 |
| Mollero, L | 1 |
| Giacchino, R | 1 |
| Combalia, A | 1 |
| Sastre-Solsona, S | 1 |
| Miron, D | 1 |
| Kawar, B | 1 |
| Lumelsky, D | 1 |
| Spiegel, R | 1 |
| Horovitz, Y | 1 |
| Todorov, T | 6 |
| Vutova, K | 6 |
| Donev, S | 1 |
| Ivanov, A | 1 |
| Katzarov, K | 1 |
| Takov, D | 1 |
| Galitza, Z | 1 |
| Sneier, R | 1 |
| Peiser, J | 1 |
| Matowicka-Karna, J | 2 |
| Kemona, H | 2 |
| Dymicka-Piekarska, V | 2 |
| Butkiewicz, A | 2 |
| Infanger, M | 1 |
| Kossmehl, P | 1 |
| Grimm, D | 1 |
| Arru, E | 1 |
| Leoni, A | 1 |
| Garippa, G | 1 |
| Scardavi, M | 1 |
| Affronti, M | 1 |
| Peralta, S | 1 |
| Occhino, C | 1 |
| Di Rosa, S | 2 |
| Rotolo, G | 1 |
| Vassallo, L | 1 |
| Rini, GB | 1 |
| Mansueto, S | 2 |
| Winter, M | 1 |
| Jacquot, N | 1 |
| Balaguer, T | 1 |
| de Peretti, F | 1 |
| Zerem, E | 1 |
| Nuhanović, A | 1 |
| Caluk, J | 1 |
| Ciurea, AV | 3 |
| Fountas, KN | 3 |
| Coman, TC | 2 |
| Machinis, TG | 3 |
| Kapsalaki, EZ | 1 |
| Fezoulidis, NI | 1 |
| Robinson, JS | 1 |
| Sabir, N | 1 |
| Yildirim, B | 1 |
| Cetin, B | 1 |
| Sengul, M | 1 |
| Alatas, E | 1 |
| Sapkas, GS | 1 |
| Chloros, GD | 1 |
| Themistocleous, GS | 1 |
| Vrettakos, G | 1 |
| Akhmedov, IG | 1 |
| Awofeso, N | 1 |
| Giuseppe, G | 1 |
| Celik, A | 1 |
| Turanli, M | 1 |
| Kutun, S | 1 |
| Delibasi, T | 1 |
| Mengi, N | 1 |
| Comert, E | 1 |
| Aslan, S | 1 |
| Altundag, K | 1 |
| Cetin, A | 1 |
| Zervas, A | 1 |
| Agapitos, E | 1 |
| Prabhakar, MM | 1 |
| Acharya, AJ | 1 |
| Modi, DR | 1 |
| Jadav, B | 1 |
| Kiymaz, N | 1 |
| Etlik, O | 1 |
| Yazici, T | 1 |
| Rkain, H | 1 |
| Bahiri, R | 1 |
| Benbouazza, K | 1 |
| Kösem, M | 1 |
| Ceylan, K | 1 |
| Köseoglu, B | 1 |
| Yalçinkaya, I | 1 |
| Arslan, H | 1 |
| Güneş, M | 1 |
| Söylemez, O | 1 |
| Dagli, AF | 1 |
| Ozercan, MR | 1 |
| Kocakoc, E | 1 |
| Elbiaze, M | 1 |
| Ayadi-Kaddour, A | 1 |
| Braham, E | 1 |
| Smati, B | 1 |
| Ismail, O | 1 |
| Djilani, H | 1 |
| El-Mezni, F | 1 |
| Mattern, CJ | 1 |
| Gardner, MJ | 1 |
| Grose, A | 1 |
| Helfet, DL | 1 |
| Divisi, D | 1 |
| Di Tommaso, S | 1 |
| Garramone, M | 1 |
| Salvemini, S | 1 |
| Crisci, R | 1 |
| Pacheco-Tenza, I | 1 |
| González-Escoda, E | 1 |
| López-García, F | 1 |
| Navarro-López, V | 1 |
| Antonio Barreras, J | 1 |
| Alemdaroğlu, KB | 1 |
| Iltar, S | 1 |
| Pulat, H | 1 |
| Atlihan, D | 1 |
| Ozturk, E | 1 |
| Ozturk, A | 1 |
| Zeyrek, F | 1 |
| Temamogullari, AV | 1 |
| Lath, R | 1 |
| Ratnam, BG | 1 |
| Ranjan, A | 1 |
| Oztas, S | 1 |
| Salman, AB | 1 |
| Tatar, A | 1 |
| Yigiter, M | 1 |
| Yazgi, H | 1 |
| Ertek, M | 1 |
| Yesilyurt, A | 1 |
| Ocak, Z | 1 |
| Kursad, H | 1 |
| Nimeri, NA | 1 |
| Ali, SK | 1 |
| Bel Hadj Youssef, D | 1 |
| Loussaief, C | 1 |
| Ben Rhomdhane, F | 1 |
| Chakroun, M | 1 |
| Bouzouaia, N | 1 |
| Demircin, M | 1 |
| Doğan, OF | 1 |
| Kanbak, M | 1 |
| Zhou, HX | 1 |
| Mo, JJ | 1 |
| Chen, G | 1 |
| Bao, GS | 1 |
| Shi, DZ | 1 |
| Zhang, R | 1 |
| Aybar, Y | 1 |
| Mert, A | 1 |
| Bilir, M | 1 |
| Kouskos, E | 1 |
| Chatziantoniou, J | 1 |
| Chrissafis, I | 1 |
| Anitsakis, C | 1 |
| Zamtrakis, S | 1 |
| Gulalp, B | 1 |
| Koseoglu, Z | 1 |
| Toprak, N | 1 |
| Satar, S | 1 |
| Sebe, A | 1 |
| Gokel, Y | 1 |
| Sakman, G | 1 |
| Karcioglu, O | 1 |
| Giannopoulos, A | 1 |
| Manti, Ch | 1 |
| Safioleas, K | 1 |
| Stavrou, E | 1 |
| Durakbasa, MO | 1 |
| Islam, NC | 1 |
| Kilicoglu, G | 1 |
| Fahim, F | 1 |
| Al Salamah, SM | 1 |
| Patnaik, MM | 1 |
| Deshpande, AK | 1 |
| Zidane, A | 1 |
| Atoini, F | 1 |
| El Mostarchid, B | 1 |
| Kabiri, EH | 1 |
| Cruz-Gonzalez, I | 1 |
| Martin-Herrero, F | 1 |
| Gonzalez-Santos, JM | 1 |
| Gutierrez-Diez, JA | 1 |
| Sanchez-Ledesma, M | 1 |
| Maree, AO | 1 |
| Isik, N | 1 |
| Silav, G | 1 |
| Cerçi, A | 1 |
| Karabagli, P | 1 |
| Elmaci, I | 1 |
| Kalelioglu, M | 1 |
| Ma, XM | 1 |
| Bao, GSh | 1 |
| Wan, JM | 1 |
| Liao, DJ | 1 |
| Yin, ShF | 1 |
| Meng, XQ | 1 |
| Zhou, GK | 1 |
| Lu, XM | 1 |
| Li, HY | 1 |
| Falagas, ME | 1 |
| Bliziotis, IA | 1 |
| Mamishi, S | 1 |
| Sagheb, S | 1 |
| Pourakbari, B | 1 |
| Heye, T | 1 |
| Lichtenberg, A | 1 |
| Joshi, N | 1 |
| Hernandez-Martinez, A | 1 |
| Seijas-Vazquez, R | 1 |
| Bron, JL | 1 |
| van Kemenade, FJ | 1 |
| Verhoof, OJ | 1 |
| Wuisman, PI | 1 |
| Demircan, A | 1 |
| Keles, A | 1 |
| Kahveci, FO | 1 |
| Tulmac, M | 1 |
| Ozsarac, M | 1 |
| Yurtçu, M | 1 |
| Gündüz, M | 1 |
| Toy, H | 1 |
| Günel, E | 1 |
| Santos, HT | 1 |
| Santos, AF | 1 |
| de la Rue, ML | 1 |
| Truong Cong, T | 1 |
| Faivre, V | 1 |
| Nguyen, TT | 1 |
| Heras, H | 1 |
| Pirot, F | 1 |
| Walchshofer, N | 1 |
| Sarciron, ME | 1 |
| Falson, F | 1 |
| Sanli, M | 1 |
| Sabuncuoğlu, H | 1 |
| Keskin, T | 1 |
| Seckin, H | 1 |
| Yagmurlu, B | 1 |
| Yigitkanli, K | 1 |
| Kars, HZ | 1 |
| Rahman, A | 1 |
| Yücel, A | 1 |
| Yüksel, BC | 1 |
| Hengirmen, S | 1 |
| Jamshidi, M | 1 |
| Zangeneh, M | 1 |
| Jamshidi, A | 1 |
| Mittal, P | 1 |
| Rishi, JP | 1 |
| Agarwal, K | 1 |
| Manouras, A | 1 |
| Lagoudianakis, EE | 1 |
| Markogiannakis, H | 1 |
| Larentzakis, A | 1 |
| Kekis, P | 1 |
| Filis, K | 1 |
| Bramis, C | 1 |
| Katergiannakis, V | 1 |
| Moharamzad, Y | 1 |
| Kharazi, HH | 1 |
| Shobeiri, E | 1 |
| Farzanegan, G | 1 |
| Hashemi, F | 1 |
| Namavari, A | 1 |
| Ntusi, NA | 1 |
| Horsfall, C | 1 |
| Moreno, L | 1 |
| Dopchiz, M | 1 |
| Singh, RK | 1 |
| Saimot, AG | 2 |
| Meulemans, A | 1 |
| Cremieux, AC | 1 |
| Giovanangeli, MD | 1 |
| Hay, JM | 1 |
| Delaitre, B | 1 |
| Coulaud, JP | 3 |
| Puntis, MC | 1 |
| Hughes, LE | 1 |
| Dickson, B | 3 |
| Braithwaite, PA | 1 |
| Morris, DL | 26 |
| Dykes, PW | 2 |
| Marriner, SE | 2 |
| Bogan, JA | 2 |
| Burrows, FG | 2 |
| Skene-Smith, H | 1 |
| Haynes, A | 1 |
| Euzéby, J | 1 |
| Xiao, S | 2 |
| Feng, J | 2 |
| Guo, H | 1 |
| Yao, M | 2 |
| Gutermuth, L | 1 |
| Corvin, S | 1 |
| Bauer, H | 1 |
| Notargiacomo, S | 2 |
| Goel, MC | 1 |
| Agarwal, MR | 1 |
| Misra, A | 1 |
| Inserra, A | 1 |
| Ciprandi, G | 1 |
| Sommi, M | 1 |
| Silvano, A | 1 |
| Di Mario, M | 1 |
| Boldrini, R | 1 |
| Bosman, C | 1 |
| Boglino, C | 1 |
| Feng, JJ | 4 |
| Guo, HF | 5 |
| Yao, MY | 4 |
| Xiao, SH | 7 |
| Jain, BK | 1 |
| Taneja, K | 1 |
| Bhargava, SK | 1 |
| Sheng, Y | 1 |
| Zheng, Q | 1 |
| Guo, F | 1 |
| Li, Y | 1 |
| Seenu, V | 1 |
| Misra, MC | 1 |
| Tiwari, SC | 1 |
| Jain, R | 1 |
| Chandrashekhar, C | 1 |
| Nahmias, J | 1 |
| Goldsmith, R | 1 |
| Soibelman, M | 1 |
| Yang, YQ | 2 |
| You, JQ | 3 |
| Shen, BG | 1 |
| Jiao, W | 4 |
| Chai, JJ | 3 |
| Jiao, PY | 5 |
| Kager, PA | 2 |
| Azar, C | 1 |
| Doyer, M | 1 |
| Sahel, J | 1 |
| Xu, M | 1 |
| Dharnidharka, VR | 1 |
| Agrawal, M | 1 |
| Dandge, VP | 1 |
| Okelo, GB | 2 |
| Hagos, B | 1 |
| Ng'ang'a, JN | 1 |
| Ogeto, JO | 1 |
| Muhmut, M | 1 |
| Zou, PF | 1 |
| New, RR | 1 |
| Craig, PS | 3 |
| Qui, MD | 1 |
| Wen, LC | 1 |
| Cheng, DJ | 1 |
| Lastilla, MG | 1 |
| De Rosa, F | 3 |
| Bondiau, PY | 1 |
| Peyrade, F | 1 |
| Birswitle, I | 1 |
| Thyss, A | 1 |
| Bruneton, JN | 1 |
| Marcy, PY | 1 |
| Mondain, V | 1 |
| Yasawy, MI | 1 |
| al Karawi, MA | 1 |
| Mohamed, AR | 1 |
| el-Mufti, M | 1 |
| Kamag, A | 1 |
| Ibrahim, H | 1 |
| Taktuk, S | 1 |
| Swaisi, I | 1 |
| Zaidan, A | 1 |
| Sameen, A | 1 |
| Shimbish, F | 1 |
| Bouzghaiba, W | 1 |
| Haasi, S | 1 |
| Heinzl, S | 1 |
| Tomás, S | 1 |
| Montserrat, M | 1 |
| Segarra, M | 1 |
| Casademont, J | 1 |
| Moskopp, D | 1 |
| Lotterer, E | 1 |
| Jenkins, DJ | 1 |
| Power, K | 1 |
| Donovan, SM | 1 |
| Mickiewicz, N | 1 |
| Meyer, RD | 1 |
| Panosian, CB | 1 |
| Erşahin, Y | 1 |
| Mutluer, S | 1 |
| Dermirtaş, E | 1 |
| Yurtseven, T | 1 |
| John, M | 1 |
| Poole, JE | 1 |
| Friedland, IR | 1 |
| Vasilescu, G | 1 |
| Nuteanu, L | 1 |
| Carp, N | 1 |
| Agarwal, DK | 1 |
| Agarwal, R | 1 |
| Barthwal, SP | 1 |
| Martin, RM | 1 |
| Colebrook, AL | 1 |
| Gasser, RB | 1 |
| Lightowlers, MW | 2 |
| Açikgöz, B | 1 |
| Sungur, C | 1 |
| Ozgen, T | 1 |
| Camurdanoğlu, M | 1 |
| Berker, M | 1 |
| Simic, O | 1 |
| Strathausen, S | 1 |
| Attarbaschi, M | 1 |
| Bolte, J | 1 |
| Singh, H | 1 |
| Qasim, M | 1 |
| Chugh, JC | 1 |
| Shembesh, AH | 1 |
| Carpintero, P | 1 |
| Kindelan, J | 1 |
| Montero, R | 1 |
| Carpintero, A | 1 |
| Zaiman, H | 1 |
| Weisse, ME | 1 |
| Raszka, WV | 1 |
| Ozdemir, M | 1 |
| Diker, E | 1 |
| Göksel, S | 1 |
| Martínez, G | 1 |
| Sánchez, M | 1 |
| Castells, A | 1 |
| Ergün, R | 1 |
| Gül, B | 1 |
| Evliyaoğlu, C | 1 |
| Ergüngör, F | 1 |
| Taşkin, Y | 1 |
| Horton, RJ | 1 |
| Belzunegui, J | 1 |
| Maíz, O | 1 |
| López, L | 1 |
| Plazaola, I | 1 |
| González, C | 1 |
| Figueroa, M | 1 |
| Keller, TM | 1 |
| Schweitzer, JS | 1 |
| Helfend, LK | 1 |
| Chappell, T | 1 |
| Ilias, I | 1 |
| Filippou, N | 1 |
| Luchi, S | 1 |
| Vincenti, A | 1 |
| Messina, F | 1 |
| Parenti, M | 1 |
| Scasso, A | 1 |
| Campatelli, A | 1 |
| Bonifacino, R | 1 |
| Dogliani, E | 1 |
| Casado, N | 7 |
| Pérez-Serrano, J | 2 |
| Rodríguez-Caabeiro, F | 7 |
| Biswas, S | 1 |
| Das, S | 1 |
| Samanta, N | 1 |
| Jover, R | 1 |
| Gutiérrez, A | 1 |
| de Zárate, V | 1 |
| Zaragoza, J | 1 |
| Martínez, J | 1 |
| Pérez-Mateo, M | 1 |
| Benci, A | 1 |
| Maestrini, R | 1 |
| Accorsi, A | 1 |
| Caremani, D | 1 |
| Lapini, L | 1 |
| Lam, KS | 1 |
| Faraj, A | 1 |
| Mulholland, RC | 2 |
| Finch, RG | 1 |
| Frossard, JL | 1 |
| Armenian, B | 1 |
| Diebold-Berger, S | 1 |
| Khan, H | 1 |
| Vine, R | 1 |
| Hadengue, A | 1 |
| Struillou, L | 1 |
| Rabaud, C | 1 |
| Bischoff, N | 1 |
| Preiss, MA | 1 |
| May, T | 1 |
| Canton, P | 1 |
| Crundwell, MC | 1 |
| Blacklock, AR | 1 |
| Giattino, M | 1 |
| Franchi, C | 2 |
| Lastilla, M | 1 |
| Kalaitzoglou, I | 1 |
| Drevelengas, A | 1 |
| Petridis, A | 1 |
| Palladas, P | 1 |
| Vicol, C | 1 |
| Rupp, G | 1 |
| Wagner, T | 1 |
| Sumer, C | 1 |
| Höpfner, W | 1 |
| Struck, E | 1 |
| Venkatesan, P | 1 |
| Aguilar, X | 1 |
| Fernández-Muixí, J | 1 |
| Magarolas, R | 1 |
| Saurí, A | 1 |
| Vidal, F | 1 |
| Richart, C | 1 |
| Wolf, O | 1 |
| Lenner, V | 1 |
| García-Llamazares, JL | 2 |
| Alvarez-de-Felipe, AI | 2 |
| Redondo-Cardeña, PA | 2 |
| Prieto-Fernández, JG | 2 |
| Rovira, E | 1 |
| Garcia, M | 1 |
| Casterá, DE | 1 |
| Schmid, M | 1 |
| Pendl, G | 1 |
| Samonigg, H | 1 |
| Ranner, G | 1 |
| Eustacchio, S | 1 |
| Reisinger, EC | 1 |
| Cobo, F | 1 |
| Yarnoz, C | 1 |
| Sesma, B | 1 |
| Fraile, P | 1 |
| Aizcorbe, M | 1 |
| Trujillo, R | 1 |
| Diaz-de-Liaño, A | 1 |
| Ciga, MA | 1 |
| Ockenga, J | 1 |
| Gebel, M | 1 |
| Caselitz, M | 1 |
| Topalidis, T | 1 |
| Boozari, B | 1 |
| Bleck, J | 1 |
| Manns, MP | 1 |
| Ciardullo, MA | 1 |
| Ricard-Blum, S | 1 |
| Grenard, P | 1 |
| Humbert, P | 1 |
| Carbillet, JP | 1 |
| Risteli, L | 1 |
| Yüceer, N | 2 |
| Güven, MB | 1 |
| Yilmaz, H | 1 |
| Basset, D | 1 |
| Girou, C | 1 |
| Nozais, IP | 1 |
| D'Hermies, F | 1 |
| Hoang, C | 1 |
| Gordon, R | 1 |
| D'Alessandro, A | 1 |
| Savio, E | 1 |
| Domínguez, L | 1 |
| Malanga, A | 1 |
| Quevedo, D | 1 |
| Saldaña, J | 1 |
| Camarote, C | 1 |
| Ochoa, A | 1 |
| Fagiolino, P | 1 |
| Shozui, T | 1 |
| Gökalp, HZ | 1 |
| Ingold, K | 1 |
| Bigler, P | 1 |
| Cavaliero, T | 1 |
| Lynch, AC | 1 |
| Stubbs, RS | 1 |
| Schantz, PM | 4 |
| Prokopowicz, D | 1 |
| Puzanowska, B | 1 |
| Sokolewicz-Bobrowska, E | 1 |
| Grzeszczuk, A | 1 |
| Yattoo, GN | 1 |
| Khuroo, MS | 1 |
| Zargar, SA | 1 |
| Bhat, FA | 1 |
| Sofi, BA | 1 |
| Sinci, V | 1 |
| Ozdogăn, ME | 1 |
| Tunaoğlu, FS | 1 |
| Kula, S | 1 |
| Aydin, H | 1 |
| Ozdemir, H | 1 |
| Olguntürk, R | 1 |
| Börner, H | 1 |
| Demertzis, S | 1 |
| Heisel, A | 1 |
| Berg, G | 1 |
| Schneider, G | 1 |
| Schäfers, HJ | 1 |
| Ammann, RW | 1 |
| Gangopadhyay, AN | 1 |
| Sahoo, SP | 1 |
| Sharma, SP | 1 |
| Gupta, DK | 1 |
| Sinha, CK | 1 |
| Rai, SN | 1 |
| Maffeis, GR | 1 |
| Petrucci, O | 1 |
| Carandina, R | 1 |
| Leme, CA | 1 |
| Truffa, M | 1 |
| Vieira, R | 1 |
| Schelini, F | 1 |
| Metze, K | 1 |
| Nogueira, EA | 1 |
| Drira, I | 1 |
| Fennira, H | 1 |
| Hantous, S | 1 |
| El Mokhtar, E | 1 |
| Rekhis, O | 1 |
| Hadoussa, J | 1 |
| Mistiri, I | 1 |
| Ellafi, A | 1 |
| Dakhlaoui, R | 1 |
| Ben Miled, K | 1 |
| Kammoun, M | 1 |
| Hamzaoui, A | 1 |
| Chebbi, ML | 1 |
| Hiller, N | 1 |
| Zagal, I | 1 |
| Hadas-Halpern, I | 1 |
| Gollackner, B | 1 |
| Längle, F | 1 |
| Maier, A | 1 |
| Mittlböck, M | 1 |
| Agstner, I | 1 |
| Karner, J | 1 |
| Langer, F | 1 |
| Aspöck, H | 1 |
| Loidolt, H | 1 |
| Rockenschaub, S | 1 |
| Steininger, R | 1 |
| Abendstein, B | 1 |
| Zeimet, A | 1 |
| Rieger, M | 1 |
| Widschwendter, M | 1 |
| Offner, F | 1 |
| Müller-Holzner, E | 1 |
| Baykaner, MK | 1 |
| Doğulu, F | 1 |
| Oztürk, G | 1 |
| Edali, N | 1 |
| Tali, T | 1 |
| el Mansari, O | 1 |
| Zentar, A | 1 |
| Sair, K | 1 |
| Sakit, F | 1 |
| Bounaim, A | 1 |
| Janati, IM | 1 |
| Oliviero, U | 1 |
| Scordino, F | 1 |
| Scherillo, G | 1 |
| Tosone, G | 1 |
| Orlando, R | 1 |
| Fazio, S | 1 |
| Cossu, ML | 1 |
| Palermo, M | 1 |
| Coppola, M | 1 |
| Fais, E | 1 |
| Ruggiu, M | 1 |
| Tanda, F | 1 |
| Cossu Rocca, P | 1 |
| Noya, G | 1 |
| Trombati, N | 1 |
| Bahlaoui, A | 1 |
| Boumzebra, M | 1 |
| Maazouzi, W | 1 |
| Yadav, BS | 1 |
| Garg, N | 1 |
| Raj, D | 1 |
| Jimenénez-Mejías, ME | 1 |
| Alarcón-Cruz, JC | 1 |
| Márquez-Rivas, FJ | 1 |
| Palomino-Nicás, J | 1 |
| Montero, JM | 1 |
| Pachón, J | 1 |
| Terek, MC | 1 |
| Ayan, C | 1 |
| Ulukuş, M | 1 |
| Zekioğlu, O | 1 |
| Ozkinay, E | 1 |
| Erhan, Y | 1 |
| Emir, L | 1 |
| Karabulut, A | 1 |
| Balci, U | 1 |
| Germiyanoğlu, C | 1 |
| Erol, D | 1 |
| Kurtoglu, N | 1 |
| Ermeydan, C | 1 |
| Akdemir, R | 1 |
| Basaran, Y | 1 |
| Dindar, I | 1 |
| Sihota, R | 1 |
| Urrea-París, MA | 5 |
| Moreno, MJ | 5 |
| Frider, B | 1 |
| Pereyra, R | 1 |
| Mohamed, S | 1 |
| Khouja, N | 1 |
| Thursky, K | 1 |
| Torresi, J | 1 |
| Yao, Y | 1 |
| Yu, D | 1 |
| Merino-Pelaez, G | 1 |
| Larrode-Pellicer, O | 1 |
| Gharaibeh, KI | 1 |
| Narayan, R | 1 |
| Mathew, JT | 1 |
| Shetty, PK | 1 |
| Gluncić, I | 1 |
| Roje, Z | 1 |
| Bradarić, N | 1 |
| Petricević, A | 1 |
| Pisac, VP | 1 |
| Gluncić, V | 1 |
| Anadol, D | 1 |
| Sviridova, ON | 1 |
| Shipulin, PP | 1 |
| Güney, O | 1 |
| Acar, O | 1 |
| Kocaogullar, Y | 1 |
| Miquel, J | 1 |
| Gil-Grande, LA | 2 |
| Retamar, A | 1 |
| García-Hoz, F | 1 |
| del Pozo, D | 1 |
| Peña, E | 1 |
| El Andaloussi, M | 1 |
| Yousri, B | 1 |
| Aboumaarouf, M | 1 |
| Chiboub, H | 1 |
| Wahbi, S | 1 |
| El Yacoubi, M | 1 |
| Ouazzani, N | 1 |
| Hermas, M | 1 |
| Takeuchi, T | 1 |
| Saez, J | 1 |
| Pinto, P | 1 |
| Apt, W | 1 |
| Zulantay, I | 1 |
| Aslan, B | 1 |
| Aslan, G | 1 |
| Ozardali, I | 1 |
| Cuenca, J | 1 |
| Herrero, L | 1 |
| Poyanli, A | 1 |
| Akan, K | 1 |
| Poyanli, O | 1 |
| Sencer, S | 1 |
| Sayrak, H | 1 |
| Zerhouni, H | 1 |
| Amrani, A | 1 |
| Kaddouri, N | 1 |
| Abdelhak, M | 1 |
| Benhmamouch, N | 1 |
| Barahioui, M | 1 |
| Roche, F | 1 |
| Crusells, MJ | 1 |
| Cuesta, J | 1 |
| Letona, S | 1 |
| Sanjoaquín, I | 1 |
| De Miguel, R | 1 |
| Amiguet, JA | 1 |
| Shuhua, X | 2 |
| Jiqing, Y | 1 |
| Mingjie, W | 2 |
| Pieying, J | 1 |
| Fanghua, G | 1 |
| Junjie, C | 2 |
| Wei, J | 1 |
| Hotez, P | 2 |
| Ayles, HM | 1 |
| Corbett, EL | 1 |
| Taylor, I | 1 |
| Cowie, AG | 2 |
| Bligh, J | 1 |
| Walmsley, K | 1 |
| Bryceson, AD | 3 |
| Warmann, S | 1 |
| Meier, PN | 1 |
| Kardorff, R | 1 |
| Fuchs, J | 1 |
| Laghzaoui, M | 1 |
| Aderdour, M | 2 |
| Bouhya, S | 1 |
| Zinoun, N | 1 |
| Hermas, S | 1 |
| Geraci, E | 1 |
| Pallotti, S | 1 |
| Bassi, GP | 1 |
| Maj, L | 1 |
| Karunajeewa, HA | 1 |
| Jones, RM | 1 |
| Hardy, KJ | 1 |
| Buxton, BF | 1 |
| Richards, MJ | 1 |
| García-Alvarez, F | 1 |
| Torcal, J | 1 |
| Salinas, JC | 1 |
| Navarro, A | 1 |
| García-Alvarez, I | 1 |
| Navarro-Zorraquino, M | 1 |
| Sousa, R | 1 |
| Tejero, E | 1 |
| Lozano, R | 1 |
| Ozyazicioğlu, A | 1 |
| Koçak, H | 1 |
| Ceviz, M | 1 |
| Balci, AY | 1 |
| Bin, L | 1 |
| Cheng, F | 1 |
| Weixia, S | 1 |
| Singounas, EG | 1 |
| Leventis, AS | 1 |
| Sakas, DE | 1 |
| Hadley, DM | 1 |
| Lampadarios, DA | 1 |
| Karvounis, PC | 1 |
| Meneghelli, UG | 1 |
| Martinelli, AL | 1 |
| Bellucci, AD | 1 |
| Villanova, MG | 1 |
| Velludo, MA | 1 |
| Magro, JE | 1 |
| Cakmakçi, M | 1 |
| Sayek, I | 1 |
| Wilson, JF | 1 |
| Rausch, RL | 1 |
| McMahon, BJ | 1 |
| Lanzoni, AM | 1 |
| Barrios, V | 1 |
| Moya, JL | 1 |
| Epeldegui, A | 1 |
| Celemin, D | 1 |
| Lafuente, C | 1 |
| Asin-Cardiel, E | 1 |
| Rivierez, M | 1 |
| el-Azhari, A | 1 |
| el Tantaoui, M | 1 |
| Alaoui, M | 1 |
| Ellis, M | 1 |
| von Sinner, W | 2 |
| Al-Hokail, A | 1 |
| Sieck, J | 1 |
| Mechkov, G | 4 |
| Georgiev, P | 2 |
| Petkov, D | 4 |
| Tonchev, Z | 3 |
| Nedelkov, G | 3 |
| Matossian, RM | 2 |
| Awar, GN | 2 |
| Radwan, H | 2 |
| Meshefedjian, GA | 2 |
| Lazarova, I | 1 |
| Wasunna, KM | 1 |
| Were, JB | 1 |
| Rees, PH | 1 |
| Sherwood, JA | 1 |
| Akhtar, MJ | 1 |
| Wang, MJ | 1 |
| Yang, B | 1 |
| López-Brea, M | 1 |
| Sanz, J | 1 |
| te Strake, L | 1 |
| Clark, D | 1 |
| Sharif, H | 1 |
| Zhang, CW | 1 |
| Ranganadham, P | 1 |
| Dinakar, I | 1 |
| Sundaram, C | 1 |
| Ratnakar, KS | 1 |
| Vivekananda, T | 1 |
| Brandt, FH | 1 |
| Dickinson, CM | 1 |
| Allen, CR | 1 |
| Roberts, JM | 1 |
| Eberhard, ML | 1 |
| Richards, KS | 9 |
| Taylor, DH | 12 |
| Vanparijs, O | 1 |
| Cotting, J | 1 |
| Zeugin, T | 1 |
| Steiger, U | 1 |
| Reichen, J | 1 |
| Clarkson, MJ | 2 |
| Vildósola, H | 1 |
| Sanchéz, L | 2 |
| Espinoza, R | 2 |
| Vildósola Gonzales, H | 1 |
| Sánchez-Ruano, JJ | 1 |
| Pardo, A | 1 |
| Barcena, R | 1 |
| Coronel, P | 1 |
| Moneo, I | 1 |
| Dal-Ré, R | 1 |
| Reffin, D | 2 |
| Magnussen, P | 1 |
| Gelletlie, R | 1 |
| Bygbjerg, IC | 1 |
| Lalji, P | 1 |
| Kostić, L | 1 |
| Cossetto, D | 1 |
| Gruenewald, S | 1 |
| Antico, V | 1 |
| Little, JM | 1 |
| Stojanow, G | 1 |
| Jurukowa, D | 1 |
| Meinhard, P | 1 |
| Brough, W | 1 |
| Hennessy, O | 1 |
| Rickard, MD | 1 |
| Kune, GA | 1 |
| Golematis, B | 2 |
| Lakiotis, G | 1 |
| Persidou-Golemati, P | 1 |
| Bonatsos, G | 1 |
| Seville, P | 1 |
| Taylor, D | 1 |
| Lanzalone, CM | 1 |
| De Rinaldis, ML | 1 |
| Balkanski, G | 1 |
| Guermouche, S | 2 |
| Guermouche, MH | 2 |
| Belkaid, M | 2 |
| Jilali, G | 2 |
| Wilcox, MH | 1 |
| Bailey, JW | 1 |
| Kolev, K | 1 |
| Davidson, RN | 1 |
| Farinella, E | 1 |
| Orsini, S | 1 |
| Hamrioui, B | 1 |
| Chami, K | 1 |
| Dellamonica, P | 2 |
| Le Fichoux, Y | 2 |
| Inaoka, T | 1 |
| Ohnishi, K | 1 |
| Kutsumi, H | 1 |
| Rahemtulla, A | 1 |
| Ellis, DS | 1 |
| Esposito, R | 1 |
| Orlando, G | 1 |
| Crocchiolo, P | 1 |
| Lazzarin, A | 1 |
| D'Arminio Monforte, A | 1 |
| Moroni, M | 1 |
| Smith, PG | 1 |
| Chinnery, JB | 2 |
| Hardcastle, JD | 1 |
| Georgiou, G | 1 |
| Stamatakis, G | 1 |
| Szypryt, EP | 1 |
| Marriner, S | 1 |
| Bogan, J | 1 |
| Burrows, F | 1 |
| Skeene-Smith, H | 1 |
| Fournier, JP | 1 |
| Marty, P | 1 |
| Leloire, P | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Pharmacokinetics, Pharmacodynamics, Safety and Tolerability of Single Dose Treatment With Diethylcarbamazine, Albendazole and Ivermectin in Humans With and Without Wuchereria Bancrofti Infection in Côte d'Ivoire[NCT02845713] | Phase 1 | 66 participants (Actual) | Interventional | 2016-04-17 | Completed | ||
| Comparison of Ivermectin Alone With Albendazole (ALB) Plus Ivermectin (IVM) in Their Efficacy Against Onchocerciasis[NCT03238131] | Phase 3 | 272 participants (Actual) | Interventional | 2012-04-30 | Completed | ||
| Alternative Chemotherapies for Lymphatic Filariasis (LF) Treatment and Elimination in Africa [Cote d'Ivoire][NCT02974049] | 189 participants (Actual) | Interventional | 2015-01-31 | Completed | |||
| A Clinical Trial to Assess the Safety and Efficacy of Moxidectin Combination Treatments vs. Ivermectin Combination Treatments for Bancroftian Filariasis[NCT04410406] | Phase 3 | 164 participants (Actual) | Interventional | 2020-08-20 | Active, not recruiting | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
78 reviews available for albendazole and Cystic Echinococcosis
| Article | Year |
|---|---|
Status and prospect of novel treatment options toward alveolar and cystic echinococcosis.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Echinococcus multilocularis; Mebendaz | 2022 |
Factors associated with variation in single-dose albendazole pharmacokinetics: A systematic review and modelling analysis.
Topics: Administration, Oral; Adult; Albendazole; Anthelmintics; Child; Echinococcosis; Humans | 2022 |
[Progress of researches on albendazole for treatment of alveolar echinococcosis].
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus multilocularis; Humans | 2022 |
Pulmonary cystic echinococcosis.
Topics: Albendazole; Cysts; Echinococcosis; Echinococcosis, Hepatic; Humans; Lung | 2023 |
Cystic echinococcosis of the bone.
Topics: Albendazole; Echinococcosis; Humans | 2023 |
Medical management of cystic echinococcosis.
Topics: Albendazole; Animals; Echinococcosis; Europe; Humans; Mebendazole; Sheep; Zoonoses | 2023 |
[Traditional Chinese medicine for treatment of echinococcosis: a review].
Topics: Albendazole; Animals; Echinococcosis; Echinococcus multilocularis; Humans; Medicine, Chinese Traditi | 2023 |
Therapeutic efficacy of nanocompounds in the treatment of cystic and alveolar echinococcoses: challenges and future prospects.
Topics: Albendazole; Animals; Antiprotozoal Agents; Biological Availability; Drug Delivery Systems; Drug Des | 2019 |
Recent advances in surgical strategies for alveolar echinococcosis of the liver.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Cyclosporine; Echinococcosis; Echinococcosis, Hepatic; H | 2020 |
Endocystectomy as a conservative surgical treatment for hepatic cystic echinococcosis: A systematic review with single-arm meta-analysis.
Topics: Albendazole; Animals; Anticestodal Agents; Cysts; Echinococcosis; Echinococcosis, Hepatic; Echinococ | 2021 |
A review of the diagnosis and management of liver hydatid cyst.
Topics: Albendazole; Cysts; Echinococcosis; Echinococcosis, Hepatic; Humans; Liver Diseases | 2022 |
Vertebral alveolar echinococcosis-a case report, systematic analysis, and review of the literature.
Topics: Aged; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus multilocularis; Female; Huma | 2018 |
Surgical overview of cardiac echinococcosis: a rare entity.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Cardiopulmonary Bypass; Echinococcosis; Echocardiogra | 2018 |
Albendazole and Treatment of Hydatid Cyst: Review of the Literature.
Topics: Albendazole; Animals; Anticestodal Agents; Case-Control Studies; Clinical Trials as Topic; Disease M | 2019 |
Medical treatment of cystic echinococcosis: systematic review and meta-analysis.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Databases, Factual; Drug Therapy, Combination; Echinococ | 2018 |
Hydatidosis of infratemporal fossa with proptosis - an unusual presentation: a case report and review of the literature.
Topics: Aged; Albendazole; Anthelmintics; Cranial Fossa, Anterior; Diagnosis, Differential; Echinococcosis; | 2018 |
Should Pediatricians Be Aware of Cystic Echinococcosis? A Literature Review.
Topics: Albendazole; Anthelmintics; Child; Child, Preschool; Echinococcosis; Female; Humans; Immunoblotting; | 2019 |
Echinococcosis: Advances in the 21st Century.
Topics: Albendazole; Animals; China; Clinical Trials as Topic; Cystectomy; Disease Management; Echinococcosi | 2019 |
Solitary subcutaneous hydatid cyst: review of the literature and report of a new case in the deltoid region.
Topics: Aged; Albendazole; Animals; Anthelmintics; Deltoid Muscle; Diagnosis, Differential; Echinococcosis; | 2013 |
Extrahepatic primary adrenal alveolar echinococcosis: a review.
Topics: Abdomen; Adrenal Gland Diseases; Adult; Albendazole; Anticestodal Agents; Echinococcosis; Echinococc | 2013 |
Treatment challenges associated with bone echinococcosis.
Topics: Albendazole; Animals; Anthelmintics; Bone Diseases; Debridement; Echinococcosis; Echinococcus granul | 2014 |
Presentation of pericardial hydatid cyst as acute cardiac tamponade.
Topics: Acute Disease; Albendazole; Cardiac Tamponade; Chest Pain; Diagnosis, Differential; Drainage; Dyspne | 2017 |
Treatment of echinococcosis: albendazole and mebendazole--what else?
Topics: Albendazole; Animals; Anthelmintics; Cell Division; Clarithromycin; Cytostatic Agents; Drug Design; | 2014 |
Primary subcutaneous hydatid cyst over thoracic spine: a case report and review of the literature.
Topics: Albendazole; Anticestodal Agents; Echinococcosis; Female; Humans; Magnetic Resonance Imaging; Middle | 2014 |
[Multiple lung nodules and mediastinal widening of unusual etiology].
Topics: Albendazole; Anthelmintics; Cardiac Surgical Procedures; Cardiomyopathies; Combined Modality Therapy | 2015 |
Cystic Hydatidosis of the Rib-Case Report and Review of the Literature.
Topics: Adult; Albendazole; Anthelmintics; Combined Modality Therapy; Echinococcosis; Humans; Male; Ribs; Th | 2015 |
[Hydatidosis: epidemiological, clinical, diagnostic and therapeutic aspects].
Topics: Albendazole; Animal Diseases; Animals; Animals, Domestic; Animals, Wild; Anthelmintics; Antibodies, | 2015 |
Peripheral arterial embolism due to involvement of the aortic arch with hydatid cyst.
Topics: Adult; Albendazole; Anthelmintics; Aorta, Thoracic; Aortic Diseases; Aortography; Biopsy; Blood Vess | 2015 |
Primary Giant Splenic Echinococcal Cyst Treated by Laparoscopy.
Topics: Aged; Albendazole; Anthelmintics; Cysts; Echinococcosis; Female; Humans; Splenic Diseases | 2016 |
Intra-cystic concentrations of albendazole-sulphoxide in human cystic echinococcosis: a systematic review and analysis of individual patient data.
Topics: Albendazole; Animals; Anthelmintics; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Praziqu | 2016 |
Cutaneous fistulization of the hydatid disease: A PRISMA-compliant systematic review.
Topics: Albendazole; Antiprotozoal Agents; Cutaneous Fistula; Diagnosis, Differential; Echinococcosis; Femal | 2016 |
Alveolar echinococcosis of the right adrenal gland: a case report and review of the literature.
Topics: Adrenal Gland Diseases; Adrenal Glands; Adrenalectomy; Aged; Albendazole; Animals; Anthelmintics; Co | 2016 |
Unusual brain edema caused by an intracranial hydatid cyst: c ase report and literature review.
Topics: Albendazole; Anthelmintics; Brain Edema; Child; Echinococcosis; Humans; Male; Neurosurgical Procedur | 2009 |
Benzimidazoles for the treatment of cystic and alveolar echinococcosis: what is the consensus?
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Clinical Protocols; Consensus; Echinococcosis; | 2009 |
Anthelminthic treatment: an adjuvant therapeutic strategy against Echinococcus granulosus.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Humans; Mebendazole; S | 2009 |
Praziquantel: neglected drug? Ineffective treatment? Or therapeutic choice in cystic hydatid disease?
Topics: Albendazole; Animals; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Humans; Praziquantel | 2009 |
Giant primary posterior mediastinal hydatid cyst in a child: report of a case and review of literature.
Topics: Albendazole; Anthelmintics; Child; Diagnosis, Differential; Echinococcosis; Humans; Male; Mediastinu | 2009 |
Long-term follow-up of the percutaneous treatment of hydatid cyst in the adrenal gland: a case report and review of the literature.
Topics: Adrenal Gland Diseases; Aged; Albendazole; Anticestodal Agents; Combined Modality Therapy; Drainage; | 2011 |
Primary orbital hydatid cyst in an elderly patient.
Topics: Aged; Agriculture; Albendazole; Anthelmintics; Echinococcosis; Eye Infections, Parasitic; Head; Huma | 2010 |
Role of irrigation with hypertonic saline for a recurrent skull base hydatid cyst: case report and review of the literature.
Topics: Abscess; Adult; Albendazole; Anthelmintics; Drainage; Echinococcosis; Female; Humans; Magnetic Reson | 2010 |
Evaluation of nitazoxanide for the treatment of disseminated cystic echinococcosis: report of five cases and literature review.
Topics: Adult; Aged; Albendazole; Animals; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Echinoc | 2011 |
Extension of echinococcal spinal infestation extra- and intradurally after a decade of extinction.
Topics: Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Decompression, Surgical; Echinococco | 2010 |
Can albendazole be the only treatment for cardiac echinococcosis with multiple organ involvement?
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Heart Dise | 2012 |
Saphenous neuropathy due to large hydatid cyst within long adductor muscle: case report and literature review.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Femoral Neuropathy; Humans; Male; Muscular D | 2012 |
Intradural extramedullary primary hydatid cyst of the spine: a case report and review of literature.
Topics: Albendazole; Animals; Anthelmintics; Central Nervous System Infections; Decompression, Surgical; Ech | 2013 |
Composite treatment for primary long-bone hydatidosis.
Topics: Albendazole; Bone Diseases, Infectious; Combined Modality Therapy; Echinococcosis; Female; Humans; M | 2012 |
Advances in experimental studies on albendazole and other drugs against hydatid disease.
Topics: Albendazole; Animals; Anticestodal Agents; Cyclosporine; Drug Therapy, Combination; Echinococcosis; | 1999 |
Benzimidazole treatment of cystic echinococcosis.
Topics: Albendazole; Animals; Antibody Formation; Benzimidazoles; Drug Resistance; Drug Therapy, Combination | 2003 |
Albendazole for the treatment of echinococcosis.
Topics: Albendazole; Animals; Anthelmintics; Clinical Trials as Topic; Echinococcosis; Humans | 2003 |
[Echinococcosis].
Topics: Albendazole; Animals; Diagnosis, Differential; Diagnostic Imaging; Echinococcosis; Echinococcus; Fox | 2003 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Albendazole: a broad spectrum anthelminthic for treatment of individuals and populations.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Child; Cysticercosis; Echinococcosis; Hel | 2002 |
Echinococcus granulosus infection: clinical presentation, medical treatment and outcome.
Topics: Albendazole; Animals; Anthelmintics; Diagnostic Imaging; Echinococcosis; Echinococcosis, Hepatic; Fe | 2003 |
[Echinococcus granulosus (cystic echinococcosis)].
Topics: Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Echinococcosis, Hepatic; | 2003 |
[Imaging methods in the diagnosis and therapy of cystic echinococcosis].
Topics: Albendazole; Anticestodal Agents; Diagnosis, Differential; Drainage; Echinococcosis; Echinococcosis, | 2004 |
[Overview of therapeutic options for cystic echinococcosis].
Topics: Albendazole; Anthelmintics; Catheter Ablation; Drainage; Echinococcosis; Hepatectomy; Humans; Laparo | 2004 |
Primary intradural extramedullary hydatid cyst.
Topics: Adult; Albendazole; Anthelmintics; Dura Mater; Echinococcosis; Epidural Space; Female; Humans; Lamin | 2005 |
Spinal hydatid disease: a case series.
Topics: Adult; Albendazole; Anthelmintics; Decompression, Surgical; Echinococcosis; Echinococcus granulosus; | 2005 |
Cerebral alveolar echinococcosis. A case report with MRI and review of the literature.
Topics: Albendazole; Animals; Antiprotozoal Agents; Brain Diseases; Echinococcosis; Echinococcus multilocula | 2007 |
Albendazole for the treatment of human echinococcosis: a review of comparative clinical trials.
Topics: Albendazole; Anthelmintics; Clinical Trials as Topic; Controlled Clinical Trials as Topic; Echinococ | 2007 |
Cardiac tamponade via a fistula to the pericardium from a hydatid cyst: case report and review of the literature.
Topics: Albendazole; Anthelmintics; Cardiac Tamponade; Echinococcosis; Female; Fistula; Humans; Mediastinal | 2010 |
[Present status of the treatment of helminthiasis].
Topics: Albendazole; Anthelmintics; Benzimidazoles; Cestode Infections; Echinococcosis; Helminthiasis; Human | 1984 |
Albendazole.
Topics: Albendazole; Cysticercosis; Echinococcosis; Humans; Nervous System Diseases | 1993 |
[Fox and dog tapeworm].
Topics: Albendazole; Animals; Dogs; Echinococcosis; Echinococcus; Foxes; Host-Parasite Interactions; Humans; | 1993 |
Cestode infection in children.
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Anticestodal Agents; Antiplatyhelmintic Agents; Ces | 1996 |
Albendazole in treatment of human cystic echinococcosis: 12 years of experience.
Topics: Albendazole; Antiplatyhelmintic Agents; Echinococcosis; Female; Humans; Male | 1997 |
[Diagnosis and treatment of unilocular hydatid disease (Echinococcus granulosus infection)].
Topics: Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Dogs; Echinococcosis; Echinococcus; | 1997 |
A case of alveolar echinococcosis restricted to the pancreas.
Topics: Acute Disease; Aged; Albendazole; Animals; Anthelmintics; Biopsy, Needle; Echinococcosis; Echinococc | 1997 |
Albendazole.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Cysticercosis; Echinococcosis; Giardiasis | 1998 |
[Hydatid cyst of the liver].
Topics: Albendazole; Antinematodal Agents; Combined Modality Therapy; Echinococcosis; Humans; Laparoscopy; M | 1998 |
Multiple hydatid cysts of the brain: a case report and review of the literature.
Topics: Albendazole; Anthelmintics; Brain Diseases; Child; Combined Modality Therapy; Echinococcosis; Humans | 1998 |
[Echinococcosis].
Topics: Albendazole; Animals; Anticestodal Agents; Diagnosis, Differential; Echinococcosis; Echinococcus; He | 1999 |
[Chemotherapy alone or as adjuvant treatment to surgery for alveolar and cystic echinococcosis].
Topics: Aged; Albendazole; Anthelmintics; Chemotherapy, Adjuvant; Combined Modality Therapy; Echinococcosis; | 2000 |
Treatment of hydatid disease.
Topics: Albendazole; Anticestodal Agents; Benzimidazoles; Carbamates; Echinococcosis; Echinococcosis, Hepati | 2001 |
[Echinococcosis, hydatid disease].
Topics: Albendazole; Animals; Anthelmintics; Diagnosis, Differential; Echinococcosis; Humans; Prognosis; Sur | 2001 |
[Echinococcoses].
Topics: Abdominal Pain; Albendazole; Anticestodal Agents; Biopsy, Needle; Combined Modality Therapy; Echinoc | 2001 |
Musculoskeletal hydatid disease: a report of 13 cases.
Topics: Adult; Aged; Aged, 80 and over; Albendazole; Anthelmintics; Antinematodal Agents; Echinococcosis; Fe | 2002 |
Successful treatment of intracerebral hydatid cysts with albendazole: case report and review of the literature.
Topics: Adult; Albendazole; Brain Diseases; Echinococcosis; Female; Humans; Tomography, X-Ray Computed | 1992 |
[Experimental therapy in Chinese hamsters and rats infected with larval Echinococcus multilocularis by using mebendazole, albendazole and ivermectin with brief review of chemotherapy of human multilocular echinococcosis].
Topics: Albendazole; Animals; Benzimidazoles; Cricetinae; Cricetulus; Echinococcosis; Humans; Ivermectin; La | 1987 |
15 trials available for albendazole and Cystic Echinococcosis
| Article | Year |
|---|---|
A pharmacology-based comparison of the activity of albendazole and flubendazole against Echinococcus granulosus metacestode in sheep.
Topics: Albendazole; Animals; Anthelmintics; Area Under Curve; Echinococcosis; Echinococcus granulosus; Half | 2013 |
Management of multiple echinococcosis in childhood with albendazole and surgery.
Topics: Adolescent; Albendazole; Anthelmintics; Calcinosis; Child; Child, Preschool; Combined Modality Thera | 2008 |
Evaluation of oxfendazole, praziquantel and albendazole against cystic echinococcosis: a randomized clinical trial in naturally infected sheep.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Drug Therapy, Combination; Echinococcosis; Echi | 2010 |
Evaluation of nitazoxanide for the treatment of disseminated cystic echinococcosis: report of five cases and literature review.
Topics: Adult; Aged; Albendazole; Animals; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Echinoc | 2011 |
[Clinical effect and safety of liposomal-albendazole and tablet-albendazole for the treatment of human cystic echinococcosis].
Topics: Adolescent; Adult; Aged; Albendazole; Echinococcosis; Female; Humans; Liposomes; Male; Middle Aged; | 2011 |
Long-term serological evaluation of patients with cystic echinococcosis treated with benzimidazole carbamates.
Topics: Adult; Aged; Albendazole; Animals; Antibodies, Helminth; Anticestodal Agents; Biomarkers; Cysts; Dis | 2002 |
The types and timing of the degenerative changes seen in the cysts during and after benzimidazole treatment of cystic echinococcosis.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Anticestodal Agents; Benzimidazoles; Child; Cys | 2005 |
Initial observation on albendazole in combination with cimetidine for the treatment of human cystic echinococcosis.
Topics: Albendazole; Anthelmintics; Bile; Chromatography, High Pressure Liquid; Cimetidine; Drug Therapy, Co | 1994 |
Therapy of human hydatid disease with mebendazole and albendazole.
Topics: Adolescent; Adult; Albendazole; Child; Child, Preschool; Echinococcosis; Female; Humans; Infant; Mal | 1993 |
Lipidic matrix of albendazole: an alternative for systemic infections.
Topics: Administration, Oral; Adult; Albendazole; Animals; Anthelmintics; Biological Availability; Cross-Ove | 1998 |
Long-term evaluation of patients with hydatidosis treated with benzimidazole carbamates.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anthelmintics; Benzimidazoles; Car | 1999 |
Albendazole-soybean oil emulsion for the treatment of human cystic echinococcosis: evaluation of bioavailability and bioequivalence.
Topics: Administration, Oral; Adult; Albendazole; Animals; Anthelmintics; Area Under Curve; Biological Avail | 2002 |
Evaluation of response to chemotherapy of human cystic echinococcosis.
Topics: Adolescent; Adult; Albendazole; Child; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Live | 1990 |
Lupus anticoagulant induced by hydatidosis?
Topics: Albendazole; Benzimidazoles; Blood Coagulation Factors; Clinical Trials as Topic; Echinococcosis; Hu | 1989 |
Sensitivity to albendazole sulphoxide of Echinococcus granulosus scoleces in man.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Clinical Trials as Topic; Echinococcosis; Echinococcus; | 1986 |
728 other studies available for albendazole and Cystic Echinococcosis
| Article | Year |
|---|---|
In vitro and in vivo treatments of echinococcus protoscoleces and metacestodes with artemisinin and artemisinin derivatives.
Topics: Albendazole; Animals; Anti-Infective Agents; Antiparasitic Agents; Artemisinins; Drug Therapy, Combi | 2008 |
Topics: Albendazole; Animals; Chitosan; Echinococcosis; Echinococcus granulosus; Microspheres; Radiotherapy, | 2021 |
Unusual intramuscular locations as a first presentation of hydatid cyst disease in children: a report of two cases.
Topics: Albendazole; Animals; Child; Echinococcosis; Echinococcus; Female; Humans; Magnetic Resonance Imagin | 2021 |
[Update on cystic echinococcosis of the liver].
Topics: Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Humans; Liver; Zoonoses | 2021 |
Rare Encounter of Renal Hydatid Cyst: A Case Report.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Female; Humans; Kidney Neoplas | 2021 |
Acute Respiratory Failure With Hemoptysis in a Teenager Due to Cystic Echinococcosis.
Topics: Adolescent; Albendazole; Echinococcosis; Hemoptysis; Humans; Male; Respiratory Insufficiency | 2022 |
In vitro evaluation of albendazole nanocrystals against Echinococcus granulosus protoscolices.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Echinococcus granulosus; Nanoparticles; Sheep | 2021 |
In vitro evaluation of albendazole-loaded nanostructured lipid carriers on Echinococcus granulosus microcysts and their prophylactic efficacy on experimental secondary hydatidosis.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Lipids; Mice | 2021 |
The combination of carvacrol and albendazole enhanced the efficacy of monotherapy in experimental alveolar echinococcosis.
Topics: Albendazole; Animals; Anthelmintics; Cymenes; Echinococcosis; Echinococcus multilocularis; Mice | 2022 |
Synergism therapeutic and immunoregulatory effects of Albendazole + rAd-mIL-28B against Echinococcosis in experiment-infected mice with protoscoleces.
Topics: Adenoviridae; Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Cytokines; Echinococco | 2021 |
IJRadiation therapy for recurrent hydatid cyst of the pelvic bone: a case report.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Female; Humans; Middle Aged; Neoplasm Recurrence | 2022 |
Hydatid brain cyst: A delayed diagnosis in a rural setting during COVID-19.
Topics: Albendazole; Anticestodal Agents; Brain Diseases; Child; COVID-19; Delayed Diagnosis; Echinococcosis | 2021 |
Primary disseminated intraabdominal hydatidosis: a case report.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Humans; Iran; Male; Middle Aged; Zoon | 2022 |
Metformin improves the therapeutic efficacy of low-dose albendazole against experimental alveolar echinococcosis.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus multilocularis; Metformin | 2022 |
Effects of Echinococcus multilocularis metacestodes infection and drug treatment on the activities of biotransformation enzymes in mouse liver.
Topics: Albendazole; Animals; Biotransformation; Cytochrome P-450 CYP2B1; Echinococcosis; Echinococcus multi | 2022 |
Hydatid Cyst of the Spine: A Rare Case Report
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Humans; Male; Middle Aged; Spine; Zoonoses | 2022 |
A rare presentation of hydatid cyst in abdominal wall: case report.
Topics: Abdominal Wall; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Female; Humans; R | 2021 |
A Large Hydatid Cyst in the Brain of a 10-year Child.
Topics: Albendazole; Animals; Brain; Child; Echinococcosis; Echinococcus; Head; Humans; Male | 2022 |
A Case of Extensive Thoracolumbar Spinal Intradural Cystic Echinococcosis.
Topics: Adult; Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Female; Humans; Laminectomy; S | 2022 |
PRELIMINARY DATA ON LIVER TRANSPLANTATION IN HYDATIDOSIS DISEASE.
Topics: Albendazole; Cholangitis; Echinococcosis; Female; Humans; Liver Transplantation; Middle Aged; Prelim | 2022 |
2-Deoxy-D-glucose and combined 2-Deoxy-D-glucose/albendazole exhibit therapeutic efficacy against Echinococcus granulosus protoscoleces and experimental alveolar echinococcosis.
Topics: Albendazole; Animals; Deoxyglucose; Echinococcosis; Echinococcus granulosus; Echinococcus multilocul | 2022 |
Is long-term follow-up without surgical treatment a valid option for hepatic alveolar echinococcosis?
Topics: Albendazole; Echinococcosis; Echinococcosis, Hepatic; Follow-Up Studies; Humans | 2022 |
Hydatid Disease in Children from Diagnosis to Treatment: A 10-year Single Center Experience
Topics: Albendazole; Animals; Child; Cysts; Echinococcosis; Echinococcus granulosus; Female; Humans; Male; R | 2022 |
Pancreatic echinococcosis in a 5-year-old girl.
Topics: Abdomen; Albendazole; Child; Child, Preschool; Echinococcosis; Female; Humans; Pancreas; Pancreatic | 2023 |
Anti-echinococcal effects of sumac, Rhus coriaria, in a murine model of cystic echinococcosis: Parasitological and molecular evaluation.
Topics: Albendazole; Animals; Cysts; Disease Models, Animal; Echinococcosis; Echinococcus; Echinococcus gran | 2022 |
Comparison of local ablation with Albendazole or laparoscopic hepatectomy combined with Albendazole in the treatment of early hepatic alveolar echinococcosis.
Topics: Adolescent; Adult; Aged; Albendazole; Benzimidazoles; Child, Preschool; Echinococcosis; Echinococcos | 2022 |
[Hydatidosis of psoas muscle revealed by vascular axis compression in lower limb: About one case at the Ibn Sina University hospital, Rabat, Morocco].
Topics: Abdominal Pain; Albendazole; Animals; Dogs; Echinococcosis; Echinococcus; Echinococcus granulosus; H | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
In vitro efficacy of albendazole-loaded β-cyclodextrin against protoscoleces of Echinococcus granulosus sensu stricto.
Topics: Albendazole; Animals; beta-Cyclodextrins; Caspase 3; Dogs; Echinococcosis; Echinococcus granulosus; | 2022 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Experimental treatment of cystic echinococcosis: Combination therapy with carvacrol and thymol versus albendazole.
Topics: Albendazole; Animals; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Mice; Thymol | 2023 |
Comparative analysis of anti-relapse treatment regimens in 110 patients with hepatic and pulmonary hydatid echinococcosis.
Topics: Albendazole; Chemical and Drug Induced Liver Injury; Echinococcosis; Humans; Retrospective Studies | 2022 |
Comparative analysis of anti-relapse treatment regimens in 110 patients with hepatic and pulmonary hydatid echinococcosis.
Topics: Albendazole; Chemical and Drug Induced Liver Injury; Echinococcosis; Humans; Retrospective Studies | 2022 |
Comparative analysis of anti-relapse treatment regimens in 110 patients with hepatic and pulmonary hydatid echinococcosis.
Topics: Albendazole; Chemical and Drug Induced Liver Injury; Echinococcosis; Humans; Retrospective Studies | 2022 |
Comparative analysis of anti-relapse treatment regimens in 110 patients with hepatic and pulmonary hydatid echinococcosis.
Topics: Albendazole; Chemical and Drug Induced Liver Injury; Echinococcosis; Humans; Retrospective Studies | 2022 |
Atypical presentations of hydatid cyst in children and their management.
Topics: Albendazole; Child; Cysts; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Male | 2022 |
Atypical presentations of hydatid cyst in children and their management.
Topics: Albendazole; Child; Cysts; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Male | 2022 |
Atypical presentations of hydatid cyst in children and their management.
Topics: Albendazole; Child; Cysts; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Male | 2022 |
Atypical presentations of hydatid cyst in children and their management.
Topics: Albendazole; Child; Cysts; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Male | 2022 |
Subcutaneous infection mouse model could be applied into real time monitoring the efficacy of anti-cystic echinococcosis drug in vivo.
Topics: Administration, Oral; Albendazole; Animals; Disease Models, Animal; Echinococcosis; Echinococcus gra | 2023 |
Improvement of Antialveolar echinococcosis efficacy of novel Albendazole-Bile acids Derivatives with Enhanced Oral Bioavailability.
Topics: Albendazole; Animals; Biological Availability; Echinococcosis; Rats; Rats, Sprague-Dawley | 2023 |
The anti-echinococcal activity of crocin in mice experimentally infected with Echinococcus granulosus.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Echinococcus granulosus; Mice; Mice, Inbred BALB | 2023 |
Case Report: Amphotericin B and Mefloquine as a Salvage Treatment of Alveolar Echinococcosis.
Topics: Albendazole; Amphotericin B; Animals; Anthelmintics; Echinococcosis; Echinococcus multilocularis; Hu | 2023 |
Treatment of Cystic Echinococcosis in Children: A Single Center Experience.
Topics: Albendazole; Anthelmintics; Child; Cysts; Echinococcosis; Humans; Retrospective Studies | 2023 |
[Rare complication of echinococcosis in clinical practice].
Topics: Albendazole; Echinococcosis; Humans; Lumbar Vertebrae; Spinal Stenosis | 2023 |
[Role of preoperative albendazole in the treatment of primary muscular hydatidosis].
Topics: Albendazole; Echinococcosis; Humans; Musculoskeletal System | 2023 |
Renal Hydatid Cyst in a Child Managed with Albendazole.
Topics: Adolescent; Albendazole; Child; Cysts; Echinococcosis; Female; Humans; Kidney; Kidney Neoplasms; Nep | 2023 |
[Novelties on the management of alveolar echinococcosis].
Topics: Albendazole; Echinococcosis; Hepatectomy; Humans; Liver | 2023 |
Pulmonary cystic echinococcosis in a child.
Topics: Adolescent; Albendazole; Animals; Child; Cysts; Echinococcosis; Echinococcosis, Pulmonary; Echinococ | 2023 |
Albendazole Monotherapy for Pediatric Cystic Echinococcosis: A Case Series.
Topics: Albendazole; Child; Cysts; Echinococcosis; Echinococcosis, Hepatic; Humans; Retrospective Studies | 2023 |
Palliative Treatment for the Management of Advanced Pelvic Hydatid Bone Disease.
Topics: Albendazole; Animals; Antiparasitic Agents; Bone Diseases; Echinococcosis; Humans; Palliative Care; | 2023 |
The high burden of pediatric cystic echinococcosis in Kazakhstan: epidemiological and clinical consequences.
Topics: Albendazole; Animals; Child; Cysts; Echinococcosis; Echinococcus granulosus; Humans; Kazakhstan | 2023 |
Giant muscle hydatid in lower extremity: a rare case with neurological symptoms as the first manifestation.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Humans; Lower Extremity; Muscles | 2023 |
Management of a pancreatic tail hydatid cyst: a case report.
Topics: Aged; Albendazole; Animals; Dogs; Echinococcosis; Echinococcus granulosus; Female; Humans; Pancreas; | 2023 |
Case 269: Sacroiliac Joint Hydatid Disease.
Topics: Adult; Albendazole; Anthelmintics; Contrast Media; Diagnosis, Differential; Echinococcosis; Female; | 2019 |
Disseminated alveolar echinococcosis in a 74-year-old woman presenting with focal seizure.
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Seizures | 2019 |
Improvement of Antialveolar Echinococcosis Efficacy of Albendazole by a Novel Nanocrystalline Formulation with Enhanced Oral Bioavailability.
Topics: Albendazole; Animals; Anthelmintics; Biological Availability; Dogs; Echinococcosis; Humans; Nanopart | 2020 |
Ultrastructural changes in hydatid cyst walls obtained from human cases, exposed to different therapeutic approaches.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Humans | 2019 |
The combination of Cytokines and albendazole therapy for prophylaxis and treatment of experimental/hydatid cyst.
Topics: Albendazole; Animals; Anthelmintics; Cytokines; Disease Models, Animal; Echinococcosis; Echinococcus | 2020 |
Alveolar echinococcosis in an Ontario dog resembling an hepatic abscess.
Topics: Albendazole; Animals; Dog Diseases; Dogs; Echinococcosis; Echinococcosis, Hepatic; Liver Abscess; On | 2019 |
Enhanced Oral Bioavailability and Anti-Echinococcosis Efficacy of Albendazole Achieved by Optimizing the "Spring" and "Parachute".
Topics: Albendazole; Animals; Dogs; Echinococcosis; Echinococcus multilocularis; Hydrogen-Ion Concentration; | 2019 |
Frequency and clinical presentation of alveolar and cystic echinococcosis in a tertiary medical center in Germany 2004-2018: lessons from a low-prevalence area.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis, Pulmon | 2019 |
Intense Pericardial Involvement in Polycystic Echinococcosis Submitted to Successful Medical Treatment.
Topics: Albendazole; Anticestodal Agents; Cardiomyopathies; Echinococcosis; Humans; Male; Mediastinal Cyst; | 2019 |
Isolated muscular cystic echinococcosis mimicking neoplasia.
Topics: Aged; Albendazole; Animals; Anthelmintics; Canada; Echinococcosis; Echinococcus granulosus; Humans; | 2020 |
Human Alveolar Echinococcosis, Croatia.
Topics: Aged; Albendazole; Animals; Anthelmintics; Croatia; Echinococcosis; Echinococcus multilocularis; Hum | 2020 |
[Chronic Right Ventricular Failure Revealing a Large Compressive Hydatid Cyst at the Cardiology Department of the Aristide le Dantec Hospital (Dakar, Senegal)].
Topics: Aged; Albendazole; Diuretics; Echinococcosis; Echocardiography; Fatal Outcome; Female; Humans; Seneg | 2019 |
Anti-echinococcal activity of menthol and a novel prodrug, menthol-pentanol, against Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Carboxymethylcellulose Sodium; Dose-Response Re | 2020 |
The importance of uninterrupted albendazole treatment in patients with unresectable alveolar echinococcosis undergoing liver transplantation.
Topics: Adult; Albendazole; Animals; Antiprotozoal Agents; Drug Administration Schedule; Echinococcosis; Ech | 2020 |
Subcutaneous Hydatid Cyst in Laboratory Mice: Is it a Suitable Method for Evaluating Therapeutic Agents against Hydatid Cyst?
Topics: Albendazole; Animals; Anticestodal Agents; Disease Models, Animal; Echinococcosis; Echinococcus; Emu | 2020 |
Albendazole solid dispersions against alveolar echinococcosis: a pharmacotechnical strategy to improve the efficacy of the drug.
Topics: Albendazole; Animals; Antiprotozoal Agents; Drug Carriers; Echinococcosis; Echinococcus multilocular | 2020 |
Asymptomatic Huge Cardiac Hydatid Cyst Located in the Interventricular Septum.
Topics: Adolescent; Albendazole; Echinococcosis; Echocardiography; Humans; Magnetic Resonance Imaging; Male; | 2020 |
Surgical excision of an epicardial ventricular hydatid cyst.
Topics: Adult; Albendazole; Anticestodal Agents; Cardiac Surgical Procedures; Echinococcosis; Female; Heart | 2020 |
The immunotherapy with hMASP-2 DNA nanolipoplexes against echinococcosis in experimentally protoscolex-infected mice.
Topics: Albendazole; Animals; DNA; Echinococcosis; Female; Immunotherapy; Liposomes; Mannose-Binding Protein | 2020 |
Primary Giant Hydatid Cyst of Lumbar Paraspinal Muscles.
Topics: Adult; Albendazole; Diagnosis, Differential; Echinococcosis; Humans; Lumbosacral Region; Magnetic Re | 2020 |
Intermittent pain of the pelvis in a Syrian woman.
Topics: Aged; Albendazole; Animals; Anthelmintics; Biopsy; Bone and Bones; Echinococcosis; Echinococcus gran | 2020 |
Drug repurposing applied: Activity of the anti-malarial mefloquine against Echinococcus multilocularis.
Topics: Albendazole; Animals; Anticestodal Agents; Antimalarials; Disease Models, Animal; Drug Evaluation, P | 2020 |
A rare case of cardiac alveolar echinococcosis.
Topics: Albendazole; Echinococcosis; Heart; Humans | 2020 |
Efficacy of novel albendazole salt formulations against secondary cystic echinococcosis in experimentally infected mice.
Topics: Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echinococcus granulosus; Female; Mice; Mi | 2020 |
Topics: Adult; Albendazole; Combined Modality Therapy; Diagnosis, Differential; Echinococcosis; Humans; Male | 2020 |
Two Human Cases of Echinococcus ortleppi Infection in the Lung and Heart in Vietnam.
Topics: Albendazole; Animals; Biomarkers; C-Reactive Protein; Child; DNA, Helminth; DNA, Mitochondrial; Echi | 2020 |
Extensive myocardial calcification mimicking giant honey-bee associated with cardiac hydatid cyst.
Topics: Adult; Albendazole; Anticestodal Agents; Calcinosis; Echinococcosis; Echocardiography; Heart Disease | 2021 |
A case for adoption of continuous albendazole treatment regimen for human echinococcal infections.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Humans | 2020 |
Evaluation of the efficacy of albendazole sulfoxide (ABZ-SO)-loaded chitosan-PLGA nanoparticles in the treatment of cystic echinococcosis in laboratory mice.
Topics: Administration, Oral; Albendazole; Animals; Antiplatyhelmintic Agents; Chitosan; Drug Delivery Syste | 2020 |
Progress on the national echinococcosis control programme in China: analysis of humans and dogs population intervention during 2004-2014.
Topics: Albendazole; Animals; Anthelmintics; China; Dog Diseases; Dogs; Echinococcosis; Echinococcus; Humans | 2020 |
Medical treatment for an isolated renal multilocular hydatid cyst in an elderly: a case report.
Topics: Aged; Albendazole; Animals; Anticestodal Agents; Drug Therapy, Combination; Echinococcosis; Echinoco | 2020 |
Solitary pelvic primary intraperitoneal hydatid managed with a minimal access approach: A case report.
Topics: Albendazole; Anticestodal Agents; Echinococcosis; Female; Humans; Pelvis; Peritoneal Diseases; Ultra | 2021 |
Pancreatic cystic echinococcosis causing acute pancreatitis.
Topics: Albendazole; Anticestodal Agents; Diagnosis, Differential; Echinococcosis; Humans; Male; Middle Aged | 2020 |
[Alveolar echinococcosis metastatic to the brain: a case report].
Topics: Albendazole; Brain; Echinococcosis; Humans; Recurrence | 2020 |
Effects of Allium sativum on IFN-γ and IL4 concentrations in mice with cystic echinococcosis.
Topics: Administration, Oral; Albendazole; Animals; Anticestodal Agents; Drinking Water; Echinococcosis; Ech | 2021 |
Hepatic hydatidosis that debuts with a direct rupture to the pleural cavity.
Topics: Albendazole; Echinococcosis; Echinococcosis, Hepatic; Humans; Pleural Cavity; Ultrasonography | 2021 |
Characterizing dynamic changes of plasma cell-free Echinococcus granulosus DNA before and after cystic echinococcosis treatment initiation.
Topics: Adolescent; Adult; Albendazole; Animals; Anticestodal Agents; Cell-Free Nucleic Acids; DNA, Helminth | 2021 |
RECENT TREATMENT RESULTS OF LIVER ECHINOCOCCOSIS BY PAIR METHOD (PUNCTURE, ASPIRATION, INJECTION, REASPIRATION).
Topics: Albendazole; Echinococcosis; Echinococcosis, Hepatic; Humans; Punctures; Retrospective Studies | 2020 |
Emerging human alveolar echinococcosis in Hungary (2003-2018): a retrospective case series analysis from a multi-centre study.
Topics: Adult; Aged; Albendazole; Animals; Antiprotozoal Agents; Delayed Diagnosis; Diagnosis, Differential; | 2021 |
Treatment of retroperitoneal echinococcosis: the experience of a single center.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Male; Mi | 2021 |
[Échinococcose alvéolaire].
Topics: Albendazole; Animals; Early Detection of Cancer; Echinococcosis; Echinococcosis, Hepatic; Europe; Hu | 2020 |
Echinococcosis in both heart and lungs, the first case reported in Albania.
Topics: Albania; Albendazole; Cardiac Surgical Procedures; Child; Echinococcosis; Humans; Lung; Male | 2021 |
In vivo efficacy of combination therapy with albendazole and atovaquone against primary hydatid cysts in mice.
Topics: Albendazole; Animals; Antiparasitic Agents; Atovaquone; Drug Therapy, Combination; Echinococcosis; E | 2021 |
Impact of Albendazole on Cytokine and Chemokine Response Profiles in
Topics: Albendazole; Animals; Chemokines; Cytokines; Disease Models, Animal; Echinococcosis; Echinococcosis, | 2021 |
Disseminated Cystic Echinococcosis Cured With Lengthy Albendazole and Praziquantel Oral Therapy.
Topics: Albendazole; Anthelmintics; Child; Drug Therapy, Combination; Duration of Therapy; Echinococcosis; H | 2021 |
Isolated pelvic bone involvement as a presentation of alveolar echinococcosis.
Topics: Aged, 80 and over; Albendazole; Animals; Antiprotozoal Agents; Bone Diseases; Bone Transplantation; | 2021 |
Albendazole Nanocrystal-Based Dissolving Microneedles with Improved Pharmacokinetic Performance for Enhanced Treatment of Cystic Echinococcosis.
Topics: Administration, Oral; Albendazole; Animals; Biological Availability; Echinococcosis; Nanoparticles; | 2021 |
Primary giant hydatid cysts of the thigh and the gluteal region: a case report.
Topics: Aged, 80 and over; Albendazole; Anthelmintics; Buttocks; Combined Modality Therapy; Echinococcosis; | 2021 |
Accuracy of an experimental whole-blood test for detecting reactivation of echinococcal cysts.
Topics: Adult; Aged; Albendazole; Animals; Cysts; Cytokines; Echinococcosis; Echinococcus granulosus; Female | 2021 |
Clinical tolerance and efficacy of anti-parasitic treatment with albendazole in patients with alveolar echinococcosis: long-term follow-up observation in 117 patients.
Topics: Albendazole; Echinococcosis; Echinococcosis, Hepatic; Follow-Up Studies; Humans; Retrospective Studi | 2021 |
The natural history of cystic echinococcosis in untreated and albendazole-treated patients.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Kenya; Male; Mass Screening; Medi | 2017 |
Disseminated alveolar echinococcosis resembling metastatic malignancy: a case report.
Topics: Albendazole; Animals; Anthelmintics; Bile Ducts; Cats; Diagnosis, Differential; Drainage; Echinococc | 2017 |
Cystic and alveolar echinococcosis: Successes and continuing challenges.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Global Health; Host-Parasite Inte | 2017 |
Case-series study of hepatic echinococcal cysts in Serbia: viability of scolices, seropositivity and epidemiological characteristics.
Topics: Adolescent; Adult; Aged; Albendazole; Animals; Case-Control Studies; Child; Dog Diseases; Dogs; Echi | 2018 |
Primary echinococcus infection of the heart: a rare type of cystic echinococcosis.
Topics: Albendazole; Anticestodal Agents; Echinococcosis; Heart Diseases; Humans; Magnetic Resonance Imaging | 2017 |
[Hydatid cyst of the posterior fossa].
Topics: Albendazole; Anthelmintics; Brain; Child; Cranial Fossa, Posterior; Echinococcosis; Humans; Male; Mo | 2017 |
A bronchobiliary fistula due to giant hydatid cyst.
Topics: Albendazole; Animals; Biliary Fistula; Biliary Tract Surgical Procedures; Bronchial Fistula; Cholang | 2017 |
Intraventricular Septal Echinococcosis.
Topics: Adult; Albendazole; Cardiac Surgical Procedures; Chest Pain; Echinococcosis; Echocardiography; Follo | 2017 |
Atypical image findings in a primary subcutaneous hydatid cyst in the gluteal area.
Topics: Aged; Albendazole; Anthelmintics; Buttocks; Combined Modality Therapy; Contrast Media; Diagnosis, Di | 2017 |
Screening of antigenic vesicular fluid proteins of Echinococcus multilocularis as potential viability biomarkers to monitor drug response in alveolar echinococcosis patients.
Topics: Adult; Aged; Aged, 80 and over; Albendazole; Animals; Biomarkers; Blotting, Western; Echinococcosis; | 2017 |
Coexisting Primary Ovarian and Omental Hydatid Disease Mimicking an Ovarian Neoplasm: A Case Report.
Topics: Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Frozen Sections; | 2018 |
Primary renal echinococcosis with gross hydatiduria.
Topics: Albendazole; Animals; Antiprotozoal Agents; Echinococcosis; Echinococcus granulosus; Humans; Kidney | 2017 |
Spinal Hydatid Cyst Disease.
Topics: Adolescent; Adult; Albendazole; Anticestodal Agents; Echinococcosis; Female; Follow-Up Studies; Huma | 2017 |
Experimental cystic echinococcosis therapy: In vitro and in vivo combined 5-fluorouracil/albendazole treatment.
Topics: Albendazole; Animals; Dose-Response Relationship, Drug; Drug Therapy, Combination; Echinococcosis; E | 2017 |
In vitro and in vivo efficacies of novel carbazole aminoalcohols in the treatment of cystic echinococcosis.
Topics: Administration, Oral; Albendazole; Amino Alcohols; Animals; Carbazoles; Dose-Response Relationship, | 2017 |
Enhancement of the Therapeutic Effect of Albendazole on Cystic Echinococcosis using a Herbal Product.
Topics: Albendazole; Animals; Anticestodal Agents; Disease Models, Animal; Drug Evaluation, Preclinical; Dru | 2019 |
Preliminary Evaluation of Percutaneous Treatment of Echinococcal Cysts without Injection of Scolicidal Agent.
Topics: Administration, Cutaneous; Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anthelm | 2017 |
Primary Orbital Hydatid Cyst: A Case Report.
Topics: Albendazole; Animals; Craniotomy; Echinococcosis; Echinococcus; Exophthalmos; Humans; Magnetic Reson | 2017 |
Hydatid cyst involvement of both pulmonary arteries in a 14-year-old girl.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Female; Heart Ventricles; Humans; Pulmonary | 2018 |
An infrequent case of anaphylaxis.
Topics: Adult; Albendazole; Allergens; Anaphylaxis; Animals; Antibodies, Helminth; Anticestodal Agents; Anti | 2018 |
Zataria multiflora would attenuate the hepatotoxicity of long-term albendazole treatment in mice with cystic echinococcosis.
Topics: Albendazole; Animals; Chemical and Drug Induced Liver Injury; Echinococcosis; Glutathione; Lamiaceae | 2018 |
Medical treatment of an unusual cerebral hydatid disease.
Topics: Adult; Albendazole; Anticestodal Agents; Brain; Echinococcosis; Female; Humans; Liver; Lung; Magneti | 2018 |
Albendazole nanocrystals in experimental alveolar echinococcosis: Enhanced chemoprophylactic and clinical efficacy in infected mice.
Topics: Albendazole; Animals; Chemoprevention; Echinococcosis; Echinococcus multilocularis; Mice; Nanopartic | 2018 |
Pathological fracture of femoral neck in a middle-aged woman: a rare presentation of primary hydatid cyst disease in humans.
Topics: Administration, Oral; Adult; Albendazole; Animals; Anthelmintics; Biopsy; Bone Transplantation; Echi | 2018 |
Spinal hydatid cysts: a long-life disease?
Topics: Aged; Albendazole; Anticestodal Agents; Disease Progression; Echinococcosis; Humans; Male; Spinal Di | 2020 |
Hydatid Cyst of Skeletal Muscle Presenting as Soft Tissue Tumour.
Topics: Albendazole; Animals; Anthelmintics; Biopsy; Cysts; Diagnosis, Differential; Echinococcosis; Echinoc | 2018 |
Primary hydatid cyst in the posterior thigh, and its percutaneous treatment.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Humans; Magnetic Resonance Imaging; Male; Patient | 2018 |
Alveolar echinococcosis in the head of pancreas: A case report.
Topics: Albendazole; Antiparasitic Agents; Combined Modality Therapy; Echinococcosis; Humans; Magnetic Reson | 2018 |
[Multidisciplinary management of alveolar echinococcosis : Echino-Liege Working Group].
Topics: Albendazole; Animals; Anthelmintics; Diagnostic Imaging; DNA, Protozoan; Echinococcosis; Echinococcu | 2018 |
In vitro and in vivo effects of chitosan-praziquantel and chitosan-albendazole nanoparticles on Echinococcus granulosus Metacestodes.
Topics: Albendazole; Animals; Anthelmintics; Chitosan; Echinococcosis; Echinococcus granulosus; Humans; Male | 2018 |
Cardiac and Pulmonary Cystic Echinococcosis With Massive Obstruction of the Pulmonary Vessel System in a 16-Year-Old Girl.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Endarterectomy; Female; Heart Ventricles; Hu | 2018 |
Progress in the pharmacological treatment of human cystic and alveolar echinococcosis: Compounds and therapeutic targets.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Echinococcosis; Echinococcus multilocularis; Hu | 2018 |
In vitro and in vivo efficacies of carbazole aminoalcohols in the treatment of alveolar echinococcosis.
Topics: Albendazole; Animals; Carbazoles; Echinococcosis; Echinococcus multilocularis; Male; Mebendazole; Mi | 2018 |
Endless story of a spinal column hydatid cyst disease: A case report.
Topics: Adult; Albendazole; Anthelmintics; Decompression, Surgical; Echinococcosis; Humans; Magnetic Resonan | 2018 |
Management of cystic echinococcosis in the last two decades: what have we learned?
Topics: Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anthelmintics; Clinical Protocols; Combined Mo | 2018 |
Hydatid cyst of the pancreas causing both acute pancreatitis and splenic vein thrombosis.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Fistula; Humans; Hypertension, Portal; Ma | 2018 |
Shortage of Albendazole and Its Consequences for Patients with Cystic Echinococcosis Treated at a Referral Center in Italy.
Topics: Albendazole; Animals; Anthelmintics; Drug Costs; Drug Utilization; Echinococcosis; Echinococcus gran | 2018 |
Could beta-myrcene be an alternative to albendazole for the treatment of experimental cystic echinococcosis?
Topics: Acyclic Monoterpenes; Albendazole; Animals; Cells, Cultured; Cysts; Echinococcosis; Echinococcus gra | 2018 |
Osseous hydatidosis of the proximal femur: a rare diagnosis in revision total hip arthroplasty.
Topics: Adolescent; Albendazole; Algeria; Anticestodal Agents; Arthroplasty, Replacement, Hip; Bone Diseases | 2019 |
[Screening and Applications of qPCR Primers for apomucin Gene of Echinococcus multilocularis].
Topics: Albendazole; Animals; Echinococcosis; Echinococcus multilocularis; Gastric Mucins; Real-Time Polymer | 2016 |
Echinococcosis and Albendazole: A Case for Suitable Treatment.
Topics: Albendazole; Anthelmintics; Drug Administration Schedule; Echinococcosis; Humans; Practice Guideline | 2018 |
Giant Intracranial Cystic Lesion in a Child.
Topics: Albendazole; Animals; Anthelmintics; Antigens, Helminth; Child, Preschool; Craniotomy; Diagnosis, Di | 2018 |
Simultaneous Multiple Locations of Hydatid Cyst: Extrapleural, Intrapulmonary and Subcutaneous.
Topics: Adult; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcosis, Pulmonary; Echinococcus | 2018 |
Repurposing of an old drug: In vitro and in vivo efficacies of buparvaquone against Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; Antiprotozoal Agents; Drug Evaluation, Preclinical; Drug Reposi | 2018 |
Multiple Hepatic Hydatid Cysts in an Iraqi Refugee.
Topics: Albendazole; Animals; Canada; Echinococcosis; Echinococcosis, Hepatic; Echinococcus; Female; Humans; | 2018 |
Epidemiology, diagnosis, treatment and follow-up of cystic echinococcosis in asymptomatic carriers.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Anthelmintics; Argentina; Asymptomatic Dise | 2019 |
Case Report: Percutaneous Treatment of Multiple Echinococcal Cysts Presenting as Abdominal Palpable Mass.
Topics: Abdomen; Abdominal Pain; Administration, Cutaneous; Adolescent; Albendazole; Animals; Anticestodal A | 2019 |
Right ventricular hydatid cyst presented as tachyarrhythmia.
Topics: Albendazole; Anti-Arrhythmia Agents; Anticestodal Agents; Echinococcosis; Echocardiography, Transeso | 2019 |
Cystic echinococcosis in the thigh: a case report.
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Austria; Echinococcosis; Echinococcus granulosus; | 2019 |
An immunocompromised patient & multiorgan cystic echinococcosis.
Topics: Albendazole; Animals; Anticestodal Agents; Echinococcosis; Humans; Immunocompromised Host; Leukemia, | 2019 |
Spinal Cystic Echinococcosis.
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Back Pain; Echinococcosis; Echinococcus granulosus | 2019 |
Cystic Echinococcosis of the Bone: A European Multicenter Study.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Bone Diseases; Child; Echinococcosis; Europe; Female; | 2019 |
First Reported Case of Echinococcal Disease on a Renal Graft Successfully Treated With Albendazole.
Topics: Adult; Albendazole; Creatinine; Echinococcosis; Female; Humans; Immunosuppression Therapy; Kidney Tr | 2021 |
[(EXPERIENCE WITH ALBENDAZOLE TREATMENT IN CHILDREN WITH CYSTIC ECHINOCOCCOSIS)].
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Child; Child, Preschool; Cysts; Echinococcosis; Ech | 2017 |
Albendazole-lipid nanocapsules: Optimization, characterization and chemoprophylactic efficacy in mice infected with Echinococcus granulosus.
Topics: Albendazole; Animals; Anticestodal Agents; Cattle; Chromatography, High Pressure Liquid; Echinococco | 2019 |
In Vitro and in Vivo Effect of MAPK Signal Transduction Pathway Inhibitors on Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; Benzamides; Body Weight; Cell Line; Disease Models, Animal; Ech | 2019 |
The Brief Case: Incidental Finding of Cystic Echinococcosis during Evaluation for Hepatitis.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Female; Hepatitis; Humans | 2019 |
Case Report: Rare Presentation of Multivisceral Echinococcosis.
Topics: Abdomen; Adult; Albendazole; Anthelmintics; Echinococcosis; Humans; Liver; Magnetic Resonance Imagin | 2019 |
Hydatid Pulmonary Embolism.
Topics: Albendazole; Animals; Dyspnea; Echinococcosis; Echinococcus; Emergency Service, Hospital; Female; He | 2019 |
The effect of albendazole sulfoxide on the expression of miR-61 and let-7 in different in vitro developmental stages of Echinococcus granulosus.
Topics: Albendazole; Animals; Anthelmintics; Cell Culture Techniques; Echinococcosis; Echinococcus granulosu | 2019 |
ALVEOLAR ECHINOCOCCOSIS IN WESTERN LOWLAND GORILLAS (
Topics: Albendazole; Animals; Animals, Zoo; Anthelmintics; Ape Diseases; Echinococcosis; Female; Gorilla gor | 2019 |
A preventive effect of the combination of albendazole and pomegranate peel aqueous extract treatment in cystic echinococcosis mice model: An alternative approach.
Topics: Albendazole; Animals; Disease Models, Animal; Echinococcosis; Female; Lythraceae; Mice; Plant Extrac | 2019 |
A Rare Mass in the Brain in A Child: Hydatid Cyst
Topics: Administration, Oral; Albendazole; Animals; Anthelmintics; Brain; Child; Echinococcosis; Echinococcu | 2019 |
Giant Primary Intracranial Hydatid Cyst in Child with Hemiparesis.
Topics: Albendazole; Anticestodal Agents; Brain Diseases; Child; Craniotomy; Echinococcosis; Female; Humans; | 2019 |
Primary ovarian and pararectal hydatid cysts mimicking pelvic endometriosis.
Topics: Albendazole; Anticestodal Agents; Diagnostic Errors; Echinococcosis; Endometriosis; Female; Gynecolo | 2012 |
Spinal hydatidosis relapse related to albendazole withdrawal after 20-year treatment.
Topics: Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Middle Aged; Recurrence; Spinal Cord Dis | 2013 |
Intracranial hydatid cyst.
Topics: Albendazole; Anthelmintics; Brain Diseases; Child; Echinococcosis; Frontal Lobe; Humans; Male; Treat | 2014 |
Left ventricular endocardial ecchinococcosis associated with multiple intracranial hydatid cysts.
Topics: Adolescent; Albendazole; Anticestodal Agents; Brain Diseases; Cardiac Surgical Procedures; Cardiopul | 2013 |
Radiation therapy for resistant sternal hydatid disease.
Topics: Albendazole; Anthelmintics; Bone Diseases; Drug Resistance; Echinococcosis; Follow-Up Studies; Human | 2013 |
[Prolonged fever in a 2-year-old child. Disseminated hydatidosis treated with albendazole].
Topics: Albendazole; Anticestodal Agents; Child, Preschool; Diagnosis, Differential; Echinococcosis; Echinoc | 2013 |
Dilemmas encountered while dealing a pregnancy complicated by pelvic Hydatid disease.
Topics: Adult; Albendazole; Anticestodal Agents; Cesarean Section; Dystocia; Echinococcosis; Female; Humans; | 2013 |
Populations at risk for alveolar echinococcosis, France.
Topics: Adult; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Echinococcus mu | 2013 |
Primary intracranial and spinal hydatidosis: a retrospective study of 21 cases.
Topics: Adolescent; Adult; Albendazole; Animals; Anthelmintics; Brain Diseases; Central Nervous System Cysts | 2013 |
Ultrasound-guided treatment of cystic echinococcosis in the spleen.
Topics: Adult; Albendazole; Combined Modality Therapy; Echinococcosis; Emigrants and Immigrants; Female; Fol | 2013 |
Two cases of femoral hydatidosis secondary to canine tapeworm treated by albendazole and prosthetic reconstruction.
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Arthroplasty, Replacement, Hip; Bone Diseases, Inf | 2013 |
Video-assisted surgery in the management of hydatid renal cyst in children.
Topics: Adolescent; Albendazole; Anthelmintics; Child; Echinococcosis; Echinococcosis, Hepatic; Endemic Dise | 2013 |
Subcutaneous infection model facilitates treatment assessment of secondary Alveolar echinococcosis in mice.
Topics: Albendazole; Animals; Anthelmintics; Disease Models, Animal; Drug Monitoring; Echinococcosis; Echino | 2013 |
Histopathological findings of an uncommon co-infection: Echinococcus vogeli, HIV, hepatitis C virus, and hepatitis B virus.
Topics: Albendazole; Anti-HIV Agents; Anticestodal Agents; Antiretroviral Therapy, Highly Active; Coinfectio | 2013 |
An egg-shaped cyst of the right interventricular septum.
Topics: Albendazole; Anthelmintics; Asymptomatic Diseases; Combined Modality Therapy; Echinococcosis; Heart | 2013 |
Primary mediastinal hydatid cysts.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Male; Mediastinal Cys | 2014 |
Spinal manifestation of hydatid disease: a case series of 36 patients.
Topics: Adolescent; Adult; Albendazole; Antiprotozoal Agents; Child; Decompression, Surgical; Echinococcosis | 2013 |
A five-year-old child with renal hydatidosis.
Topics: Albendazole; Animals; Argentina; Child, Preschool; Cysts; Echinococcosis; Echinococcus granulosus; E | 2013 |
Polycystic echinococcosis in the state of Acre, Brazil: contribution to patient diagnosis, treatment and prognosis.
Topics: Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anticestodal Agents; Brazil; Cohort Studies; D | 2013 |
In vivo evaluation of the efficacy of albendazole sulfoxide and albendazole sulfoxide loaded solid lipid nanoparticles against hydatid cyst.
Topics: Albendazole; Animals; Anticestodal Agents; Disease Models, Animal; Echinococcosis; Echinococcus gran | 2013 |
Inoperable isolated cardiac hydatid cyst controlled with albendazole in an older adult with dementia.
Topics: Aged, 80 and over; Albendazole; Anticestodal Agents; Dementia; Echinococcosis; Heart Diseases; Human | 2013 |
Spinal hydatid disease: a multidisciplinary pathology.
Topics: Albendazole; Decompression, Surgical; Echinococcosis; Female; Humans; Male; Spinal Diseases | 2015 |
Echinococcus multilocularis infection in a patient treated with omalizumab.
Topics: Albendazole; Animals; Anthelmintics; Anti-Allergic Agents; Antibodies, Anti-Idiotypic; Antibodies, M | 2013 |
Disseminated intra-abdominal hydatidosis.
Topics: Abdomen; Adult; Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Humans; Male; Peru; T | 2013 |
Spinal parasites.
Topics: Albendazole; Decompression, Surgical; Echinococcosis; Female; Humans; Male; Spinal Diseases | 2015 |
Primary multiple cerebral hydatid disease: still symptomatic despite pathologically confirmed death of the cyst.
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Diplopia; Echinococcosis; Echinococcus granulosus; | 2013 |
Primary hydatid cyst of the neck.
Topics: Albendazole; Animals; Child; Diagnosis, Differential; Echinococcosis; Echinococcus granulosus; Human | 2013 |
Primary hydatid disease of brachialis and biceps brachii muscles: a case report.
Topics: Aged; Albendazole; Animals; Anthelmintics; Arm; Echinococcosis; Echinococcus; Humans; Magnetic Reson | 2014 |
Renal failure: unusual clinical presentation of an isolated intrarenal hydatid cyst.
Topics: Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Humans; Kidney; Kidney | 2013 |
Unusual growth rate during cystic echinococcosis.
Topics: Aged, 80 and over; Albendazole; Algeria; Animals; Anticestodal Agents; Echinococcosis; Echinococcus | 2014 |
A cardiac cyst presented with subacute anterior myocardial infarction. Hydatid cyst.
Topics: Albendazole; Anthelmintics; Coronary Artery Bypass; Diagnosis, Differential; Echinococcosis; Echocar | 2013 |
Successful treatment of hydatid cyst of lesser sac with PAIR therapy.
Topics: Adolescent; Albendazole; Animals; Anticestodal Agents; Biopsy, Fine-Needle; Combined Modality Therap | 2013 |
Pareses, paralysis and parasites. Echinococcus granulosus infection.
Topics: Adult; Albendazole; Animals; Anthelmintics; Diagnosis, Differential; Disease Progression; Drug Thera | 2013 |
An unusual cause of a pancreatic space-occupying lesion.
Topics: Albendazole; Animals; Anticestodal Agents; Biopsy, Fine-Needle; Echinococcosis; Echinococcus granulo | 2014 |
Abdominal echinococcosis: outcomes of conservative surgery.
Topics: Adolescent; Adult; Aged; Albendazole; Animals; Antinematodal Agents; Child; Child, Preschool; Echino | 2014 |
[Primary muscle hydatidosis].
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Echinococcosis; Female; | 2014 |
Long-term disseminated recurrence in spinal hydatid cyst: a case report.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Internal Fixators; Laminectomy; M | 2014 |
Asymptomatic intra-peritoneal rupture of hydatid cyst of the liver: case report.
Topics: Abdominal Injuries; Adult; Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Echinococ | 2014 |
Enhanced chemoprophylactic and clinical efficacy of albendazole formulated as solid dispersions in experimental cystic echinococcosis.
Topics: Albendazole; Animals; Anthelmintics; Chemoprevention; Echinococcosis; Echinococcus granulosus; Micro | 2014 |
A rare cause of pleural effusion: ruptured primary pleural hydatid cyst.
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Pleura; Pleural Diseases; Pleural Ef | 2014 |
Isolated hydatid cyst of uterine cervix: A case report.
Topics: Adult; Albendazole; Anthelmintics; Cervix Uteri; Combined Modality Therapy; Cysts; Diagnosis, Differ | 2014 |
Safety of the combined use of praziquantel and albendazole in the treatment of human hydatid disease.
Topics: Adult; Aged; Albendazole; Drug Combinations; Echinococcosis; Female; Humans; Magnetic Resonance Imag | 2014 |
[Primary retroperitoneal hydatid cyst].
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Female; Humans; Middle | 2014 |
Echinococcosis of the heart.
Topics: Adult; Albendazole; Anticestodal Agents; Cardiac Imaging Techniques; Cardiomyopathies; Echinococcosi | 2014 |
Intraosseous orbital hydatid cyst: report of a rare case.
Topics: Aged; Albendazole; Antiprotozoal Agents; Combined Modality Therapy; Echinococcosis; Eye Infections, | 2014 |
[Effect of different drugs on Echinococcus multilocularis metacestodes in vitro ].
Topics: Albendazole; Animals; Anticestodal Agents; Drug Therapy, Combination; Echinococcosis; Echinococcus m | 2011 |
A case of Budd-Chiari syndrome associated with alveolar echinococcosis.
Topics: Albendazole; Anthelmintics; Budd-Chiari Syndrome; Echinococcosis; Echinococcosis, Hepatic; Humans; M | 2014 |
Urgent surgery for cardiac hydatid cyst located in interventricular septum.
Topics: Albendazole; Anticestodal Agents; Cardiac Surgical Procedures; Child; Echinococcosis; Female; Heart | 2014 |
Study of operated primary and secondary (recurrence) hydatidosis in hospitals of Kermanshah, west of Islamic Republic of Iran.
Topics: Adolescent; Age Distribution; Aged; Aged, 80 and over; Albendazole; Anthelmintics; Child; Child, Pre | 2013 |
Laparoscopic management of a hydatid cyst of the adrenal gland.
Topics: Adrenal Gland Diseases; Albendazole; Anticestodal Agents; Combined Modality Therapy; Echinococcosis; | 2014 |
In vivo study of the efficacy of the aromatic water of Zataria multiflora on hydatid cysts.
Topics: Albendazole; Animals; Chromatography, Gas; Cyclohexane Monoterpenes; Cymenes; Echinococcosis; Gas Ch | 2014 |
Preventive and therapeutic effects of Zataria multiflora methanolic extract on hydatid cyst: an in vivo study.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Lamiaceae; Male; Mice; Mice, Inbred BALB C; Pla | 2014 |
Efficacy of albendazole in combination with thymol against Echinococcus multilocularis protoscoleces and metacestodes.
Topics: Albendazole; Animals; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Echinococcosis, Hepa | 2014 |
A rare case of renal hydatidosis in a child with congenital solitary kidney.
Topics: Adolescent; Albendazole; Anticestodal Agents; Echinococcosis; Humans; Kidney; Kidney Diseases; Male | 2014 |
Tibial hydatidosis: a case report.
Topics: Albendazole; Anthelmintics; Bone Diseases; Echinococcosis; Female; Humans; Middle Aged; Tibia | 2014 |
[Efficacy of albendazole chitosan microspheres against Echinococcus granulosus infection in mice].
Topics: Albendazole; Animals; Chitosan; Echinococcosis; Echinococcus granulosus; Male; Mice; Microspheres | 2014 |
Giant isolated mesenteric hydatid cyst case report without organ involvement.
Topics: Abdominal Pain; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Mesentery; Tomography, X-R | 2014 |
Primary hydatid cyst in the adrenal gland.
Topics: Adrenal Gland Diseases; Adrenal Glands; Aged; Albendazole; Anthelmintics; Diagnosis, Differential; E | 2014 |
[Small bowel volvulus on peritoneal hydatid disease: a rare cause of obstruction].
Topics: Albendazole; Combined Modality Therapy; Echinococcosis; Female; Humans; Ileal Diseases; Ileostomy; I | 2014 |
Peritoneal hydatidosis in an adolescent.
Topics: Adolescent; Albendazole; Anthelmintics; Combined Modality Therapy; Echinococcosis; Humans; Male; Ome | 2014 |
Surgical treatment of multiple hydatid cysts in the liver of a pediatric patient.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Female; Humans | 2015 |
Albendazole-induced autoimmune hepatitis.
Topics: Albendazole; Anticestodal Agents; Child; Echinococcosis; Female; Hepatitis, Autoimmune; Humans; Tran | 2015 |
Disseminated hydatidosis.
Topics: Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Humans; Liver; Lung; Mal | 2015 |
Primary hydatid cyst of the parotid gland.
Topics: Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Humans; Male; Parotid Gl | 2015 |
Incidental isolated pancreatic hydatid cyst.
Topics: Abdominal Pain; Albendazole; Alkaline Phosphatase; Animals; Anticestodal Agents; Cholecystectomy; Di | 2015 |
Combined flubendazole-nitazoxanide treatment of cystic echinococcosis: Pharmacokinetic and efficacy assessment in mice.
Topics: Albendazole; Animals; Antinematodal Agents; Antiparasitic Agents; Drug Therapy, Combination; Echinoc | 2015 |
Simultaneous giant hydatid cysts of brain and liver.
Topics: Albendazole; Animals; Anthelmintics; Brain; Central Nervous System Helminthiasis; Child; Cystectomy; | 2015 |
A Girl with Disseminated Thoracic Echinococcosis.
Topics: Albendazole; Anticestodal Agents; Child; Echinococcosis; Female; Humans; Lung Diseases, Parasitic | 2015 |
The management of abdominal hydatidosis after the rupture of a pancreatic hydatid cyst: a case report.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Humans; Intraabdominal Infections; Male; Middle | 2015 |
Isolated cardiac hydatid cyst.
Topics: Albendazole; Animals; Antiprotozoal Agents; Echinococcosis; Echocardiography; Female; Heart Diseases | 2015 |
Ruptured intracardiac hydatid cyst presenting as acute coronary syndrome.
Topics: Acute Coronary Syndrome; Albendazole; Anticestodal Agents; Cardiopulmonary Bypass; Coronary Angiogra | 2016 |
Gluteal Hydatid Cyst: Report of a Case.
Topics: Adult; Albendazole; Animals; Echinococcosis; Echinococcus; Female; Humans | 2015 |
Chemoprophylactic and therapeutic efficacy of thymol in murine cystic echinococcosis.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Mice; Microscopy, Electron, Scanning; Microscop | 2015 |
Eradication of advanced pelvic hydatid bone disease after limb salvage surgery - 5-year follow-up: a case report.
Topics: Adult; Albendazole; Anthelmintics; Bone Diseases; Echinococcosis; Female; Follow-Up Studies; Hemipel | 2015 |
In vivo activity of albendazole in combination with thymol against Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Echinococcus multilo | 2015 |
Efficiency of liposomal albendazole for the treatment of the patients with complex alveolar echinococcosis: a comparative analysis of CEUS, CT, and PET/CT.
Topics: Adolescent; Adult; Albendazole; Animals; Anthelmintics; Contrast Media; Echinococcosis; Echinococcos | 2015 |
Isolated hydatid cyst of the pancreas masquerading as pancreatic pseudocyst.
Topics: Albendazole; Anthelmintics; Child; Diagnosis, Differential; Echinococcosis; Female; Humans; Pancreat | 2015 |
Hydatid disease of bone: a dangerous crippling disease.
Topics: Adult; Albendazole; Anthelmintics; Biopsy; Bone Diseases; Echinococcosis; Humans; Ilium; Male; Pelvi | 2015 |
Efficacy of Albendazole-Chitosan Microsphere-based Treatment for Alveolar Echinococcosis in Mice.
Topics: Administration, Oral; Albendazole; Animals; Anthelmintics; Chitosan; Disease Models, Animal; Drug Ca | 2015 |
Cystic echinococcosis therapy: Albendazole-loaded lipid nanocapsules enhance the oral bioavailability and efficacy in experimentally infected mice.
Topics: Administration, Oral; Albendazole; Animals; Anthelmintics; Biological Availability; Chemistry, Pharm | 2015 |
[Haematological toxicity during treatment with albendazole].
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Humans; Male; Middle A | 2016 |
Oncological approach with antihelminthic chemotherapy and wide resection in the treatment of musculoskeletal hydatidosis. A review of 10 cases with mean follow-up of 64 months.
Topics: Adolescent; Adult; Aged; Albendazole; Animals; Anthelmintics; Bone and Bones; Bone Diseases, Infecti | 2015 |
Membranous material in the urine: A diagnosis of cystic echinococcosis at first glance.
Topics: Albendazole; Anticestodal Agents; Echinococcosis; Female; Humans; Kidney Diseases, Cystic; Magnetic | 2016 |
Staining of hydatid elements: a useful adjunct in the diagnosis of hydatid disease.
Topics: Aged; Albendazole; Echinococcosis; Humans; Male; Staining and Labeling; Tomography, X-Ray Computed; | 2016 |
A suspicious subcutaneous tumor.
Topics: Aged; Albendazole; Animals; Antiprotozoal Agents; Connective Tissue Diseases; Echinococcosis; Echino | 2015 |
Isolated primary orbital hydatid disease presenting as multiple cystic lesions: a rare cause of proptosis.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Exophthalmos; Female; Humans; Middle Aged; Treat | 2015 |
Swollen eyelid reveals multiple intracranial hydatid cysts associated with a palpebral cyst.
Topics: Albendazole; Brain Diseases; Central Nervous System Helminthiasis; Child; Cysts; Echinococcosis; Ede | 2016 |
First molecular evidence of the simultaneous human infection with two species of Echinococcus granulosus sensu lato: Echinococcus granulosus sensu stricto and Echinococcus canadensis.
Topics: Albendazole; Animals; Anticestodal Agents; Canidae; Child; DNA, Helminth; DNA, Intergenic; Dogs; Ech | 2016 |
Eosinophilic Peritonitis Caused by Echinococcus granulosus in a Patient Receiving Maintenance Peritoneal Dialysis.
Topics: Albendazole; Animals; Antiparasitic Agents; Ascitic Fluid; Blood Cell Count; Echinococcosis; Echinoc | 2016 |
Preoperative diagnosis of cerebral hydatid cyst and its therapeutic implications.
Topics: Albendazole; Anthelmintics; Brain Diseases; Child; Craniotomy; Echinococcosis; Humans; Magnetic Reso | 2016 |
Hydatid cyst in unusual location: Pterygopalatine fossa-infratemporal fossa.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Endoscopy; Humans; Magnetic Resonance Imagin | 2016 |
Immunological Characteristics of Recurrent Echinococcosis-Induced Anaphylactic Shock.
Topics: Adult; Albendazole; Albuterol; Anaphylaxis; Anthelmintics; Anti-Inflammatory Agents; Bronchodilator | 2016 |
Primary Subcutaneous Hydatid Cyst of the Thigh: An Unusual Site With a Diagnostic Dilemma.
Topics: Albendazole; Anticestodal Agents; Diabetic Foot; Diagnosis, Differential; Echinococcosis; Female; Hu | 2016 |
Cystic echinococcosis in Southern Israel.
Topics: Albendazole; Anthelmintics; Diagnostic Tests, Routine; Echinococcosis; Endemic Diseases; Ethnicity; | 2016 |
[Four Hydatid Cysts in One Family: Is Family Screening Necessary?].
Topics: Abdominal Pain; Adult; Albendazole; Animals; Anthelmintics; Child; Dogs; Echinococcosis; Echinococcu | 2015 |
An orbital hydatid cyst involving inferior rectus muscle: A case report.
Topics: Albendazole; Animals; Anthelmintics; Child; Combined Modality Therapy; Echinococcosis; Echinococcus | 2016 |
A life-threatening brainstem compression by cerebral Echinococcus granulosus.
Topics: Adolescent; Albendazole; Animals; Anticestodal Agents; Brain Stem; Echinococcosis; Echinococcus gran | 2016 |
Renal hydatid cyst: medical treatment.
Topics: Adolescent; Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Humans; Kidney; Kidney Di | 2016 |
A primary subcutaneous hydatid cyst in the thigh A case report.
Topics: Aged; Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echinococcus granulosus; Female; Hu | 2016 |
A Rapid and Convenient Method for in Vivo Fluorescent Imaging of Protoscolices of Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Carbocyanines; Disease Models, Animal; Echinoco | 2016 |
A novel zoonotic genotype related to Echinococcus granulosus sensu stricto from southern Ethiopia.
Topics: Albendazole; Animals; Anticestodal Agents; Chemotherapy, Adjuvant; Cyclooxygenase 1; DNA, Helminth; | 2016 |
A RARE CASE OF HYDATID CYST DISEASE OF THE BREAST: A CASE REPORT AND REVIEW OF LITERATURE.
Topics: Adolescent; Albendazole; Anthelmintics; Biopsy, Fine-Needle; Breast; Breast Diseases; Diagnosis, Dif | 2016 |
Costs Associated with Surgically Treated Cases of Abdominal Cystic Echinococcosis: A Single Center's Experience from 2008 to 2014, Pavia, Italy.
Topics: Adult; Aged; Albendazole; Animals; Anthelmintics; Cost-Benefit Analysis; Echinococcosis; Echinococcu | 2016 |
Case images: Cardiac hydatid cyst presenting as double-chambered left ventricle.
Topics: Albendazole; Anticestodal Agents; Diagnosis, Differential; Echinococcosis; Female; Heart; Heart Dise | 2016 |
Construction of In Vivo Fluorescent Imaging of Echinococcus granulosus in a Mouse Model.
Topics: Albendazole; Animals; Anthelmintics; Disease Models, Animal; Drug Monitoring; Echinococcosis; Echino | 2016 |
Efficacy of osthole for Echinococcus granulosus in vitro and Echinococcus multilocularis in vivo.
Topics: Albendazole; Animals; Antiprotozoal Agents; Blood Chemical Analysis; Calcium Channel Blockers; Cell | 2016 |
Abdominal Cystic Echinococcosis Treated with Albendazole. A Pediatric Cohort Study.
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Argentina; Child; Child, Preschool; Echinococcosis; | 2016 |
Scolicidal and apoptotic activities of albendazole sulfoxide and albendazole sulfoxide-loaded PLGA-PEG as a novel nanopolymeric particle against Echinococcus granulosus protoscoleces.
Topics: Albendazole; Animals; Anthelmintics; Apoptosis; Caspase 3; Echinococcosis; Echinococcus granulosus; | 2016 |
Endoscopic Treatment of Renal Hydatid Cyst with Percutaneous Access through an All Seeing Needle.
Topics: Adult; Albendazole; Combined Modality Therapy; Echinococcosis; Equipment Design; Female; Fluoroscopy | 2016 |
In vivo evaluation of the efficacy of combined albedazole-IFN-α treatment for cystic echinococcosis in mice.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Female; Humans; Interferon-alpha; Mic | 2017 |
Hints for control of infection in unique extrahepatic vertebral alveolar echinococcosis.
Topics: Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echinococcosis, Hepatic; Echinococcus mul | 2017 |
Hydatid Cyst of the Heart.
Topics: Adolescent; Adult; Albendazole; Cardiac Surgical Procedures; Child; Child, Preschool; Echinococcosis | 2017 |
Portal hydatid with secondary cavernomatosis.
Topics: Aged, 80 and over; Albendazole; Antiparasitic Agents; Echinococcosis; Hemangioma, Cavernous; Humans; | 2017 |
Hydatid cyst: hepatitis B and D coinfection accelerating the course of the disease.
Topics: Adult; Albendazole; Anthelmintics; Bile Ducts, Intrahepatic; Cholangitis; Coinfection; Disease Progr | 2017 |
To see or not to see: non-invasive imaging for improved readout of drug treatment trials in the murine model of secondary alveolar echinococcosis.
Topics: Albendazole; Animals; Anticestodal Agents; Disease Models, Animal; Echinococcosis; Echinococcus mult | 2017 |
Successful percutaneous treatment of extrahepatic cystic echinococcosis through PAIR and single puncture catheter techniques.
Topics: Adolescent; Adrenal Gland Diseases; Adult; Aged; Albendazole; Anthelmintics; Catheterization; Child; | 2017 |
Stressor-induced changes to the protoscoleces of Echinococcus granulosus of Indian buffalo origin.
Topics: Albendazole; Animals; Anthelmintics; Buffaloes; Drug Therapy, Combination; Echinococcosis; Echinococ | 2008 |
Primary hydatid disease of the humerus.
Topics: Albendazole; Anthelmintics; Bone Diseases, Infectious; Bone Plates; Curettage; Echinococcosis; Human | 2008 |
A case of isolated renal hydatid disease.
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Humans; Kidney; Kidne | 2009 |
[Adverse effects of longterm, continual administration of high doses of albendazole in the treatment of echinococcal disease].
Topics: Adolescent; Adult; Aged; Albendazole; Anticestodal Agents; Child; Echinococcosis; Female; Humans; Ma | 2008 |
Cardiac echinococcosis: recurrent intramyocardial-extracardiac hydatid cysts with pericardial protrusion.
Topics: Adult; Albendazole; Animals; Chest Pain; Echinococcosis; Echinococcus; Echocardiography; Heart Disea | 2008 |
Hydatid cyst of the right ventricle in early pregnancy.
Topics: Abortion, Spontaneous; Adult; Albendazole; Cardiac Surgical Procedures; Combined Modality Therapy; E | 2008 |
Hydatidosis of the pelvic cavity: a big masquerade.
Topics: Abdominal Pain; Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; | 2008 |
Primary hydatid cyst of the root of the thigh: a case report and review of the literature.
Topics: Albendazole; Anthelmintics; Biopsy; Bone Diseases; Calcinosis; Echinococcosis; Humans; Magnetic Reso | 2008 |
Hydatid cyst of the parotid gland.
Topics: Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Humans; Parotid Disease | 2009 |
Isolated alveolar echinococcosis of the spleen - clinical presentation and management review.
Topics: Aged; Albendazole; Anticestodal Agents; Echinococcosis; Follow-Up Studies; Humans; Laparotomy; Magne | 2008 |
Primary cystic echinococcosis in the subcutaneous gluteal region - a case report.
Topics: Albendazole; Animals; Antibodies, Helminth; Austria; Buttocks; Combined Modality Therapy; Diagnosis, | 2008 |
[Effect of the liposome albendazole and Huai-Er fungus extract on hepatic infection of Echinococcus granulosus in mice].
Topics: Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Female; Liposomes; Liver Diseases; Mi | 2008 |
[Ascites of unusual etiology].
Topics: Aged, 80 and over; Albendazole; Animals; Anticestodal Agents; Ascites; Echinococcosis; Echinococcus | 2009 |
Giant hydatid cyst of the interventricular septum mimicking acute myocardial infarction on ECG: an unusual cause of ST segment elevation.
Topics: Albendazole; Anticestodal Agents; Cardiac Surgical Procedures; Combined Modality Therapy; Diagnosis, | 2009 |
Cranial epidural hydatid cysts: clinical report and review of the literature.
Topics: Adult; Albendazole; Animals; Anthelmintics; Brain; Craniotomy; Decompression, Surgical; Dura Mater; | 2009 |
Spontaneous drainage of an asymptomatic recurrent hydatid cyst of the sacrum.
Topics: Adult; Albendazole; Animals; Anthelmintics; Bone Cysts; Echinococcosis; Echinococcus; Humans; Lumbar | 2009 |
Biliary hydatidosis.
Topics: Adolescent; Albendazole; Anthelmintics; Anti-Bacterial Agents; Cholangiopancreatography, Endoscopic | 2009 |
Right ventricular hydatid cyst: a case report.
Topics: Adolescent; Albendazole; Anticestodal Agents; Cardiac Surgical Procedures; Echinococcosis; Heart Dis | 2009 |
[Isolated echinococcosis of the flexor digitorum profondus: a case report].
Topics: Adult; Albendazole; Antiprotozoal Agents; Echinococcosis; Female; Forearm; Humans; Muscular Diseases | 2009 |
Intradural extramedullary primary hydatid cyst of the spine in a child: a very rare presentation.
Topics: Albendazole; Anthelmintics; Child; Decompression, Surgical; Echinococcosis; Humans; Lumbar Vertebrae | 2009 |
[Giant retroperitoneal hydatid cyst].
Topics: Albendazole; Antiprotozoal Agents; Echinococcosis; Humans; Male; Middle Aged; Retroperitoneal Space | 2009 |
Cysticercosis: a rare cause of orbital infection.
Topics: Adolescent; Albendazole; Antiprotozoal Agents; Child, Preschool; Echinococcosis; Exophthalmos; Femal | 2009 |
Primary perisplenic hydatid cyst.
Topics: Adult; Albendazole; Animals; Antiprotozoal Agents; Dogs; Echinococcosis; Eosinophilia; Humans; Immun | 2009 |
[Infectious spondylodiscitis as a presentation for paravertebral hydatid cyst].
Topics: Aged; Albendazole; Anticestodal Agents; Bone Transplantation; Diagnosis, Differential; Discitis; Ech | 2009 |
A very rare cause of childhood paraparesis: primary intradural extramedullary spinal hydatid cyst.
Topics: Adolescent; Albendazole; Antiprotozoal Agents; Echinococcosis; Female; Humans; Laminectomy; Magnetic | 2009 |
[Hydatid disease in the Department of Health #2 of the Valencian Community (Spain)].
Topics: Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Combined | 2009 |
Primary hydatid cyst of the infratemporal fossa.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Magnetic Resonance Imaging; Skull | 2009 |
Gradual and complete delivery of a hydatid cyst of the brain through a single burr hole, a wrong happening!
Topics: Albendazole; Anthelmintics; Brain; Child, Preschool; Diagnosis, Differential; Echinococcosis; Female | 2009 |
[Case report: secondary pleural hydatidosis].
Topics: Aged; Albendazole; Anticestodal Agents; Echinococcosis; Humans; Magnetic Resonance Imaging; Male; Pl | 2009 |
Spinal intradural extramedullary hydatidosis: report of three cases.
Topics: Albendazole; Anthelmintics; Child; Child, Preschool; Decompression, Surgical; Dura Mater; Echinococc | 2009 |
A 48-year-old Somali woman with hip pain.
Topics: Albendazole; Anthelmintics; Bone Diseases; Diagnosis, Differential; Echinococcosis; Female; Hip; Hum | 2009 |
Serological monitoring of progression of alveolar echinococcosis with multiorgan involvement by use of recombinant Em18.
Topics: Adult; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Antigens, Helminth; Bone and Bones | 2009 |
Epigastric cystic echinococcus involving stomach, liver, diaphragm, and spleen in an immigrant from Afghanistan.
Topics: Afghanistan; Albendazole; Animals; Anthelmintics; Diagnostic Errors; Diaphragm; Echinococcosis; Echi | 2009 |
A primary ovarian hydatid cyst.
Topics: Abdominal Pain; Albendazole; Echinococcosis; Fallopian Tubes; Female; Humans; Middle Aged; Ovarian C | 2009 |
Medical image. Hydatid cyst of the thigh.
Topics: Adult; Albendazole; Antiprotozoal Agents; Echinococcosis; Eosinophilia; Humans; Male; Muscular Disea | 2009 |
Bone hydatid disease refractory to nitazoxanide treatment.
Topics: Adult; Albendazole; Anthelmintics; Bone Diseases; Cimetidine; Drug Resistance; Echinococcosis; Hista | 2009 |
Echinococcus oligarthrus cystic hydatidosis in Brazilian agouti (Dasyprocta leporina).
Topics: Albendazole; Animals; Animals, Wild; Anticestodal Agents; Brazil; Disease Reservoirs; Echinococcosis | 2009 |
Giant hydatid cyst of spleen: a case report.
Topics: Adult; Albendazole; Antiprotozoal Agents; Diagnostic Imaging; Echinococcosis; Female; Humans; Spleni | 2009 |
Cardiac hydatid cyst of the interatrial septum.
Topics: Albendazole; Angina Pectoris; Anticestodal Agents; Cardiomyopathies; Combined Modality Therapy; Diag | 2009 |
Giant primary muscular hydatid cyst with a secondary bone localization.
Topics: Aged; Albendazole; Animals; Anticestodal Agents; Bone Diseases, Infectious; Echinococcosis; Echinoco | 2010 |
Personalized management of patients with inoperable alveolar echinococcosis undergoing treatment with albendazole: usefulness of positron-emission-tomography combined with serological and computed tomography follow-up.
Topics: Adult; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Drug Monitoring; Echinococcosis; E | 2010 |
Infratemporal hydatid cyst: a case presenting with blindness.
Topics: Adolescent; Albendazole; Anthelmintics; Blindness; Echinococcosis; Female; Humans; Maxillary Sinus; | 2010 |
[Hydatid cyst of the chest wall mimicking metastatic colon cancer].
Topics: Aged; Albendazole; Anthelmintics; Colonic Neoplasms; Diagnosis, Differential; Echinococcosis; Endemi | 2009 |
Hydatid cyst of the cranial vault.
Topics: Albendazole; Animals; Antiprotozoal Agents; Craniotomy; Diagnosis, Differential; Echinococcosis; Ech | 2009 |
Cardiac echinococcosis, an unusual echocardiographic finding.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Echocardiography, Transesophageal; Female; H | 2010 |
Pelvic bone hydatidosis.
Topics: Adult; Albendazole; Anthelmintics; Arthrodesis; Bone Diseases; Bone Screws; Combined Modality Therap | 2010 |
Recurrence of femoral echinococcosis 5 years after a primary surgical procedure.
Topics: Albendazole; Anthelmintics; Combined Modality Therapy; Down Syndrome; Echinococcosis; Femur; Humans; | 2010 |
Co-occurrence of diaphragmatic and serratus anterior muscle hydatidosis: an unusual localization.
Topics: Adult; Albendazole; Anticestodal Agents; Diaphragm; Echinococcosis; Empyema; Female; Humans; Muscle, | 2012 |
Skull base hydatid cyst with intracranial extension presenting as vocal cord palsy: a case report.
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Echinococcosis; Humans; Magnetic Resonance Imaging | 2010 |
Hydatid cysts at unusual sites: reports of two cases in the neck and breast.
Topics: Albendazole; Animals; Antiprotozoal Agents; Breast; Breast Diseases; Echinococcosis; Echinococcus gr | 2010 |
Medical treatment of primary extradural solitary lumbar hydatid disease.
Topics: Adult; Albendazole; Bone Cysts; Echinococcosis; Female; Humans; Lumbar Vertebrae; Magnetic Resonance | 2010 |
Surgical treatment of cardiac hydatid disease in 13 patients.
Topics: Adolescent; Adult; Aged; Albendazole; Anticestodal Agents; Cardiac Surgical Procedures; Cardiopulmon | 2010 |
Combined medical and surgical treatment of intracardiac hydatid cysts in 11 patients.
Topics: Adolescent; Adult; Albendazole; Anticestodal Agents; Cardiac Surgical Procedures; Cardiomyopathies; | 2010 |
A rare cause of dysphagia: esophageal hydatidosis.
Topics: Adult; Albendazole; Anticestodal Agents; Deglutition Disorders; Echinococcosis; Esophageal Diseases; | 2010 |
Mitral regurgitation due to a hydatid cyst located in the left ventricular papillary muscle.
Topics: Adult; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Echocardiograph | 2010 |
Neurological picture. A widespread echinococcosis of the spine.
Topics: Aged; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Echinococcus mul | 2010 |
Cardiac hydatidosis.
Topics: Adult; Albendazole; Animals; Combined Modality Therapy; Echinococcosis; General Surgery; Heart; Huma | 2010 |
Primary extradural hydatid cyst associated with nephrotic syndrome in a pediatric patient.
Topics: Albendazole; Anthelmintics; Brain Diseases; Child; Echinococcosis; Female; Humans; Nephrotic Syndrom | 2010 |
Coexistence of non-Hodgkin lymphoma and cyst hydatid disease and successful medical treatment.
Topics: Albendazole; Antineoplastic Agents; Antiprotozoal Agents; Echinococcosis; Humans; Lymphoma, Non-Hodg | 2010 |
Multivesicular intrapericardial hydatidosis.
Topics: Albendazole; Anticestodal Agents; Echinococcosis; Heart Diseases; Humans; Male; Middle Aged; Pericar | 2011 |
Programme for ultrasound diagnoses and treatment with albendazole of cystic echinococcosis in asymptomatic carriers: 10 years of follow-up of cases.
Topics: Adolescent; Albendazole; Anthelmintics; Argentina; Asymptomatic Infections; Carrier State; Child; Dr | 2011 |
Cranial hydatid abscess.
Topics: Albendazole; Anticestodal Agents; Brain Abscess; Echinococcosis; Exophthalmos; Female; Humans; Thera | 2010 |
Hydatid cyst in right iliac fossa.
Topics: Adult; Albendazole; Echinococcosis; Humans; Male; Pelvis; Treatment Outcome; Ultrasonography | 2010 |
Primary spinal hydatid cyst in a patient with acquired immunodeficiency syndrome.
Topics: Acquired Immunodeficiency Syndrome; Adult; Albendazole; Anticestodal Agents; Echinococcosis; Humans; | 2011 |
Footprint in brain.
Topics: Adolescent; Albendazole; Antiprotozoal Agents; Brain Diseases; Craniotomy; Echinococcosis; Epilepsy, | 2011 |
An unusual cause of jaundice in a tropical country. Intrabiliary rupture of hydatid cyst.
Topics: Adult; Albendazole; Alkaline Phosphatase; Bilirubin; Cholangiopancreatography, Endoscopic Retrograde | 2011 |
In vitro and in vivo efficacies of mefloquine-based treatment against alveolar echinococcosis.
Topics: Albendazole; Animals; Antiparasitic Agents; Disease Models, Animal; Echinococcosis; Echinococcosis, | 2011 |
[Pathological humeral fracture revealing bone hydatic cyst].
Topics: Adolescent; Albendazole; Anthelmintics; Bone Diseases, Infectious; Combined Modality Therapy; Curett | 2011 |
Hydatid cyst disease: optimal management of complex liver involvement.
Topics: Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Humans; Male; Middle Aged | 2011 |
A medically treated multiple cerebral hydatid cyst disease.
Topics: Albendazole; Anthelmintics; Brain Diseases; Echinococcosis; Humans; Male; Middle Aged; Tomography, X | 2010 |
Isolated splenic hydatid cyst.
Topics: Adult; Albendazole; Combined Modality Therapy; Echinococcosis; Follow-Up Studies; Humans; Male; Post | 2010 |
Hydatid disease and tubulointerstitial nephritis.
Topics: Acute Kidney Injury; Adrenal Cortex Hormones; Albendazole; Anthelmintics; Child; Combined Modality T | 2011 |
Cystic hydatidosis: a rare case of spine localization.
Topics: Adult; Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Decompression, Surgical; Echi | 2011 |
[Hydatid disease of the ribs].
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Curettage; Echinococcosis; Echinococcus granulosus | 2011 |
Infected tuboovarian hydatid cyst: a rare cause of tuboovarian abcess.
Topics: Abdominal Abscess; Albendazole; Antiprotozoal Agents; Echinococcosis; Female; Humans; Laparotomy; Li | 2011 |
Echocardiographic appearance of a hydatid cyst of the papillary muscle and chordae tendineae.
Topics: Albendazole; Animals; Cardiac Surgical Procedures; Chordae Tendineae; Combined Modality Therapy; Ech | 2011 |
Case report of primary retroperitoneal hydatid cyst.
Topics: Adolescent; Albendazole; Anaphylaxis; Animals; Animals, Domestic; Anticestodal Agents; Diagnosis, Di | 2011 |
A case of large renal hydatid cyst.
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Female; Humans; Kidney Diseases; Laparoscop | 2011 |
An insect growth inhibitor--lufenuron--enhances albendazole activity against hydatid cyst.
Topics: Albendazole; Animals; Anthelmintics; Benzamides; Drug Synergism; Drug Therapy, Combination; Echinoco | 2011 |
[Cystic echinococcosis mimicking tuberculosis in childhood].
Topics: Albendazole; Anthelmintics; Antitubercular Agents; Bronchoalveolar Lavage; Bronchoscopy; Child; Diag | 2011 |
[Multiple pulmonary hydatid disease with cardiovascular localisation].
Topics: Albendazole; Anthelmintics; Cardiomyopathies; Combined Modality Therapy; Echinococcosis; Echinococco | 2011 |
Primary splenic hydatidosis.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Male; Middle Aged; Retrospective | 2011 |
A pericardial hydatid cyst and pregnancy.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Female; Heart Diseases; | 2011 |
Cardiac cyst hydatid: a multimodality approach.
Topics: Adult; Albendazole; Antiparasitic Agents; Cardiac Surgical Procedures; Echinococcosis; Female; Heart | 2012 |
[Rare cause of pulmonary embolism in a child].
Topics: Adolescent; Albendazole; Anticestodal Agents; Echinococcosis; Heart Diseases; Humans; Male; Pulmonar | 2011 |
Primary hydatid disease of diaphragm with subcutenous extension.
Topics: Adult; Albendazole; Animals; Anthelmintics; Diaphragm; Echinococcosis; Echinococcus; Female; Humans; | 2011 |
Treatment of a case of mesangioproliferative glomerulonephritis secondary to Echinococcus alveolaris with albendazole.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Glomerulonephritis, Membranoproliferative; Human | 2011 |
Comparative performances of flubendazole and albendazole in cystic echinococcosis: ex vivo activity, plasma/cyst disposition, and efficacy in infected mice.
Topics: Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echinococcus granulosus; Mebendazole; Mic | 2011 |
Postoperative recurrence of cystic hydatidosis.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Child; Echinococcosis; Enzyme-Linked Immunosorb | 2012 |
Cardiac hydatid cyst case recovered with medical treatment.
Topics: Albendazole; Animals; Anthelmintics; Child; Diagnosis, Differential; Drug Administration Schedule; E | 2011 |
Hydatid disease drug therapy primarily to reconstruction of a multilevel thoracolumbar vertebral lesion.
Topics: Adult; Albendazole; Anticestodal Agents; Debridement; Echinococcosis; Humans; Internal Fixators; Lum | 2011 |
Primary bilateral intrapelvic hydatid cyst presenting with adnexal cystic mass: a case report.
Topics: Abdominal Pain; Adnexal Diseases; Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echinoc | 2011 |
Laparoscopic cystectomy for splenic hydatid cyst: a case report.
Topics: Albendazole; Anthelmintics; Child; Combined Modality Therapy; Early Diagnosis; Echinococcosis; Femal | 2011 |
[Pelvic hydatid cyst: differential diagnosis with a bacterial abscess with cutaneous fistula].
Topics: Abscess; Adult; Albendazole; Animals; Anthelmintics; Anti-Bacterial Agents; Antibodies, Helminth; Co | 2012 |
Costal hydatidosis: management and outcome of five cases.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Male; Radiography, Thoracic; Retr | 2012 |
[Primary pancreatic hydatid cyst resembling a pseudocyst].
Topics: Albendazole; Animals; Anthelmintics; Diagnosis, Differential; Echinococcosis; Echinococcus; Humans; | 2011 |
Primary cyst hydatid in the neck; report of one case.
Topics: Adolescent; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Humans; Nec | 2011 |
Large cardiac hydatid cyst in the interventricular septum.
Topics: Adult; Albendazole; Anticestodal Agents; Cardiopulmonary Bypass; Echinococcosis; Female; Heart Disea | 2011 |
Cerebral alveolar echinococcosis: a report of two cases.
Topics: Adult; Albendazole; Anthelmintics; Brain; Central Nervous System Diseases; Echinococcosis; Echinococ | 2012 |
Primary hydatid cyst of the chest wall.
Topics: Aged; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Female; Humans; | 2012 |
Early diagnosis, treatment and follow-up of cystic echinococcosis in remote rural areas in Patagonia: impact of ultrasound training of non-specialists.
Topics: Abdomen; Adolescent; Albendazole; Animals; Anthelmintics; Argentina; Child; Early Diagnosis; Echinoc | 2012 |
Hydatid disease of the spine: a report on nine patients.
Topics: Adult; Albendazole; Anthelmintics; Blood Sedimentation; Decompression, Surgical; Echinococcosis; Fem | 2012 |
[Pneumonia unresponsive to treatment? A case report of intrathoracic hydatid cyst].
Topics: Albendazole; Anticestodal Agents; Child; Echinococcosis; Female; Humans; Lung Diseases, Parasitic; P | 2011 |
Primary giant intracranial extracerebral hydatid disease in a child.
Topics: Albendazole; Animals; Brain Diseases; Child; Craniotomy; Echinococcosis; Echinococcus granulosus; Fr | 2011 |
[Two cases of rare cerebral hydatid cyst].
Topics: Abducens Nerve Diseases; Adolescent; Albendazole; Anthelmintics; Brain Diseases; Chemotherapy, Adjuv | 2012 |
Primary axillary hydatid cyst.
Topics: Adult; Albendazole; Anthelmintics; Axilla; Echinococcosis; Humans; Male; Tomography, X-Ray Computed; | 2012 |
Pseudotumoral hydatid cyst of chest wall.
Topics: Albendazole; Anthelmintics; Bone Neoplasms; Combined Modality Therapy; Diagnostic Errors; Echinococc | 2012 |
Osseous hydatid cyst.
Topics: Adult; Albendazole; Animals; Bone Diseases; Echinococcosis; Echinococcus granulosus; Humans; Immunog | 2011 |
A farmer with fever and right upper quadrant pain.
Topics: Abdominal Pain; Agricultural Workers' Diseases; Albendazole; Animals; Anthelmintics; Biliary Fistula | 2012 |
Hydatid cyst of the interventricular septum presenting as supraventricular tachycardia.
Topics: Albendazole; Anticestodal Agents; Chemotherapy, Adjuvant; Diagnosis, Differential; Echinococcosis; E | 2012 |
Cardiac hydatidosis presenting as an acute coronary syndrome.
Topics: Acute Coronary Syndrome; Albendazole; Anthelmintics; Coronary Angiography; Diagnosis, Differential; | 2010 |
Voluntary ingestion of antiparasitic drugs emulsified in honey represents an alternative to gavage in mice.
Topics: Administration, Oral; Albendazole; Animals; Anticestodal Agents; Carboxymethylcellulose Sodium; Chro | 2012 |
Hydatid cyst of the ambient cistern radiologically mimicking an arachnoid cyst.
Topics: Albendazole; Anticestodal Agents; Arachnoid Cysts; Child; Cisterna Magna; Coma; Diagnosis, Different | 2012 |
Hydatid cyst of the thyroid gland: report of three cases.
Topics: Adolescent; Adult; Albendazole; Anticestodal Agents; Carcinoma, Papillary; Diagnosis, Differential; | 2013 |
Echinococcus alveolaris: presenting as a cerebral metastasis.
Topics: Adult; Albendazole; Animals; Anthelmintics; Brain; Brain Diseases; Brain Edema; Brain Neoplasms; Dia | 2012 |
A mysterious visitor to the heart.
Topics: Administration, Oral; Albendazole; Anthelmintics; Dyspnea; Echinococcosis; Electrocardiography; Huma | 2012 |
Lung hydatid cysts.
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis, Pu | 2012 |
In vitro and in vivo treatments of Echinococcus granulosus with Huaier aqueous extract and albendazole liposome.
Topics: Albendazole; Animals; Anthelmintics; Disease Models, Animal; Drug Carriers; Drug Therapy, Combinatio | 2013 |
Left ventricular hydatid cyst: an uncommon cause of chest pain in young adults.
Topics: Adolescent; Albendazole; Anthelmintics; Chest Pain; Diagnosis, Differential; Echinococcosis; Echocar | 2013 |
Multi-organ hydatidosis with extensive involvement of the hemi-pelvis and ipsilateral femur.
Topics: Albendazole; Anthelmintics; Bone Diseases; Echinococcosis; Femur; Humans; India; Male; Middle Aged; | 2013 |
Cardiac hydatidosis: a follow-up with cardiovascular magnetic resonance.
Topics: Adult; Albendazole; Animals; Anthelmintics; Cardiac Tamponade; Cardiomyopathies; Combined Modality T | 2012 |
Secondary mediastinal hydatidosis.
Topics: Albendazole; Animals; Anthelmintics; Chest Pain; Combined Modality Therapy; Deglutition Disorders; E | 2013 |
Primary cervical hydatid cyst: a rare occurrence.
Topics: Albendazole; Anticestodal Agents; Biopsy; Diagnosis, Differential; Echinococcosis; Female; Humans; M | 2012 |
Primary retroperitoneal echinococcal cyst.
Topics: Aged; Albendazole; Anticestodal Agents; Diagnosis, Differential; Echinococcosis; Humans; Male; Retro | 2012 |
Secondary peritoneal echinococcosis causing massive bilateral hydronephrosis and renal failure.
Topics: Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Echinococcosis; Echinococcosis, Hepatic; | 2013 |
Isolated renal hydatid cyst: diagnosis and management.
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Humans; Kidney Diseases; Male; Tomography, | 2012 |
Multiple hydatid cysts of the liver.
Topics: Albendazole; Anthelmintics; Combined Modality Therapy; Echinococcosis; Female; Humans; Liver Disease | 2014 |
30-yr course and favorable outcome of alveolar echinococcosis despite multiple metastatic organ involvement in a non-immune suppressed patient.
Topics: Adult; Albendazole; Antinematodal Agents; Echinococcosis; Echinococcosis, Hepatic; Follow-Up Studies | 2013 |
[Isolated intracerebral cystic echinococcosis. Unusual presentation of a rare disease].
Topics: Albendazole; Anthelmintics; Brain; Brain Diseases; Diagnosis, Differential; Echinococcosis; Female; | 2002 |
Cystic mass in soft tissue: is further investigation needed?
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Neck; Soft Tissue Infections | 2002 |
Hydatid disease at the proximal end of the clavicle.
Topics: Albendazole; Biopsy, Needle; Clavicle; Combined Modality Therapy; Echinococcosis; Female; Follow-Up | 2002 |
Complications of albendazole treatment in hydatid disease of lung.
Topics: Adult; Albendazole; Anthelmintics; Central Nervous System Cysts; Echinococcosis; Echinococcosis, Pul | 2002 |
Hydatid disease of the spine: case report.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Spinal Diseases | 2002 |
Arterial hypertension due to primary adrenal hydatid cyst.
Topics: Adrenal Gland Diseases; Adrenalectomy; Adult; Albendazole; Anticestodal Agents; Echinococcosis; Fema | 2002 |
Cardiac hydatid cyst in a patient with pulmonary tuberculosis.
Topics: Albendazole; Anticestodal Agents; Antitubercular Agents; Cardiac Surgical Procedures; Echinococcosis | 2002 |
[Hydatid cyst of thoracic soft tissues].
Topics: Albendazole; Anticestodal Agents; Echinococcosis; Follow-Up Studies; Humans; Male; Middle Aged; Musc | 2002 |
Intramuscular hydatid cyst of the medial rectus muscle.
Topics: Adult; Albendazole; Antiprotozoal Agents; Echinococcosis; Eye Infections, Parasitic; Female; Humans; | 2003 |
Cardiac hydatid cyst and pulmonary hydatidosis in a child.
Topics: Albendazole; Cardiac Surgical Procedures; Cardiomyopathies; Child; Combined Modality Therapy; Echino | 2002 |
[Efficacy of albendazole immunoliposome against echinococcosis granulosus in mice].
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Female; Liposomes; Mice; Mice, Inbred Strains; | 2001 |
[Curative effect of combined treatments with albendazole and surgery in 1518 cases of cystic echinococcosis].
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Child; Child, Preschool; Combined Modality Ther | 2001 |
Hydatid cyst an unusual cause of ovarian enlargement.
Topics: Adult; Albendazole; Anticestodal Agents; Biopsy; Combined Modality Therapy; Echinococcosis; Ethiopia | 2002 |
Hydatid cyst of orbit--a case report.
Topics: Adult; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Exophthalmos; Female; Huma | 2002 |
Primary hydatid disease of the quadriceps muscle: a rare localization.
Topics: Albendazole; Antiprotozoal Agents; Echinococcosis; Humans; Male; Middle Aged; Muscular Diseases | 2003 |
Unusual localizations of hydatid disease.
Topics: Adult; Albendazole; Antinematodal Agents; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis, P | 2003 |
Surgical treatment of isolated cardiac echinococciasis: report of five cases.
Topics: Adult; Albendazole; Anthelmintics; Cardiac Surgical Procedures; Cardiomyopathies; Child; Diagnosis, | 2003 |
Traumatic pelvic hydatid cyst rupture: report of a case.
Topics: Abdominal Injuries; Adult; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Pelvis; Periton | 2003 |
Hepatic and splenic hydatid cyst during pregnancy: a case report.
Topics: Adult; Albendazole; Anthelmintics; Delivery, Obstetric; Diagnosis, Differential; Echinococcosis; Ech | 2003 |
Extraspinal bone hydatidosis.
Topics: Albendazole; Anthelmintics; Bone Diseases; Combined Modality Therapy; Echinococcosis; Female; Follow | 2003 |
Hydatid disease of bone.
Topics: Administration, Topical; Albendazole; Anticestodal Agents; Cetrimonium; Cetrimonium Compounds; Echin | 2003 |
Imaging features of disseminated peritoneal hydatidosis before and after medical treatment.
Topics: Aged; Albendazole; Anticestodal Agents; Drug Therapy, Combination; Echinococcosis; Female; Follow-Up | 2003 |
Hydatid disease of bone. Review of 11 cases.
Topics: Adult; Albendazole; Anticestodal Agents; Bone Diseases, Infectious; Echinococcosis; Female; Humans; | 2003 |
Effect of two formulations of benzimidazole carbamates on the viability of cysts of Echinococcus granulosus in vivo.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Biological Availability; Dose-Response Relation | 2003 |
Hydatidosis of the pelvis: a case report with a 25-year follow-up.
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Follow-Up Studies; Humans; Ischium; Male; O | 2004 |
Solitary pericardial hydatid cyst.
Topics: Africa, Northern; Aged; Albendazole; Anticestodal Agents; Atrial Fibrillation; Chest Tubes; Combined | 2004 |
Hydatid disease of a rib in a rare location.
Topics: Adult; Albendazole; Anticestodal Agents; Bone Diseases; Combined Modality Therapy; Echinococcosis; E | 2004 |
Intrapelvic-perianal hydatid disease in an unusual location: report of a case.
Topics: Albendazole; Anal Canal; Anthelmintics; Diagnosis, Differential; Echinococcosis; Humans; Male; Middl | 2004 |
[Spontaneous resolution of a retrovesical hydatidic cyst].
Topics: Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Mebendazole; Mi | 2004 |
Secondary and primary murine alveolar echinococcosis: combined albendazole/nitazoxanide chemotherapy exhibits profound anti-parasitic activity.
Topics: Albendazole; Animals; Antiparasitic Agents; Drug Therapy, Combination; Echinococcosis; Mice; Mice, I | 2004 |
A lasting solution is hard to achieve in primary hydatid disease of the spine: long-term results and an overview.
Topics: Adult; Aged; Albendazole; Anthelmintics; Back Pain; Combined Modality Therapy; Diagnosis, Differenti | 2004 |
[Acute rupture of hydatid cysts in the peritoneum: 17 cases].
Topics: Acute Disease; Adolescent; Adult; Aged; Albendazole; Anthelmintics; Child; Child, Preschool; Echinoc | 2004 |
Ultrasonographic diagnosis and medical treatment of human cystic echinococcosis in asymptomatic school age carriers: 5 years of follow-up.
Topics: Abdomen; Adolescent; Albendazole; Animals; Anthelmintics; Argentina; Carrier State; Child; Echinococ | 2004 |
Combined treatment of primary hydatid disease of the vastus lateralis muscle.
Topics: Adult; Albendazole; Antiprotozoal Agents; Combined Modality Therapy; Echinococcosis; Female; Humans; | 2004 |
A case of asymptomatic cardiopericardial hydatid cyst.
Topics: Adult; Albendazole; Anthelmintics; Cardiomyopathies; Drug Administration Schedule; Echinococcosis; E | 2004 |
In vitro effects of nitazoxanide on Echinococcus granulosus protoscoleces and metacestodes.
Topics: Albendazole; Animals; Anthelmintics; Anticestodal Agents; Dose-Response Relationship, Drug; Echinoco | 2004 |
A hydatid cyst presenting as an axillary mass.
Topics: Albendazole; Anticestodal Agents; Axilla; Biopsy, Needle; Combined Modality Therapy; Echinococcosis; | 2004 |
Left ventricular hydatid cyst presenting with acute ischemic stroke: case report.
Topics: Acute Disease; Adolescent; Albendazole; Animals; Anthelmintics; Brain Ischemia; Echinococcosis; Echo | 2004 |
The case of a cyst hydatid localized within the interatrial septum.
Topics: Adult; Albendazole; Anticestodal Agents; Brain Diseases; Cardiac Surgical Procedures; Cardiomyopathi | 2004 |
Primary hydatid cysts of muscle and retroperitoneum.
Topics: Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Humans; Middle A | 2004 |
Effect of treatment with free and liposomized albendazole on selected immunological parameters and cyst growth in mice infected with Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; B-Lymphocytes; Echinococcosis; Echinococcus multilocularis; Int | 2004 |
Review of surgical management of cystic hydatid disease in a resource limited setting: Turkana, Kenya.
Topics: Abdomen; Adolescent; Adult; Aged; Albendazole; Anticestodal Agents; Child; Child, Preschool; Echinoc | 2004 |
Multiple organ involvement hydatid cysts in a 2-year-old boy.
Topics: Albendazole; Central Nervous System Parasitic Infections; Child, Preschool; Combined Modality Therap | 2004 |
[Prolonged treatment of multiple Echinococcus granulosus infection].
Topics: Albendazole; Animals; Anticestodal Agents; Drainage; Echinococcosis; Echinococcus granulosus; Female | 2004 |
[Extensive hydatid disease of the femur: a case report].
Topics: Adult; Albendazole; Anthelmintics; Bone Diseases; Echinococcosis; Femur; Humans; Male | 2004 |
[Hydatid cyst of the kidney].
Topics: Albendazole; Anthelmintics; Echinococcosis; Humans; Kidney Diseases; Magnetic Resonance Imaging; Meb | 2004 |
Echinococcus multilocularis massive pericardial infection: late and dramatic improvement under albendazole therapy.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Echinococcus multilocularis; Humans; Male; Perica | 2005 |
[Human hydatidosis: advances and report of four paediatric cases with unusual presentation].
Topics: Adolescent; Albendazole; Anthelmintics; Antibodies, Helminth; Child; Combined Modality Therapy; Echi | 2004 |
[Echinococcosis -- a differential diagnosis of calf swelling].
Topics: Albendazole; Anticestodal Agents; Diagnosis, Differential; Echinococcosis; Female; Follow-Up Studies | 2005 |
Death related to albendazole-induced pancytopenia: case report and review.
Topics: Aged; Albendazole; Anthelmintics; Autopsy; Biopsy; Echinococcosis; Esophageal and Gastric Varices; F | 2005 |
Primary intracranial hydatid cyst in the interpeduncular cistern.
Topics: Adult; Albendazole; Brain Diseases; Central Nervous System Parasitic Infections; Combined Modality T | 2005 |
[Acute secundary abdomen to pancreatic hydatid cyst].
Topics: Abdomen, Acute; Adolescent; Albendazole; Anthelmintics; Combined Modality Therapy; Echinococcosis; H | 2005 |
Giant primary mediastinal hydatid cyst causing Horner's syndrome: report of a case.
Topics: Albendazole; Combined Modality Therapy; Echinococcosis; Follow-Up Studies; Horner Syndrome; Humans; | 2005 |
Productive sinus of the proximal humerus.
Topics: Albendazole; Anthelmintics; Bone Diseases, Infectious; Calcinosis; Diagnosis, Differential; Echinoco | 2005 |
Primary splenic hydatid cyst: a case report with characteristic imaging appearance.
Topics: Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Humans; Middle Aged; Sp | 2005 |
[Primary hydatid cyst of the thyroid, an unusual localisation of hydatidosis].
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Follow-Up Studies; Humans; Male; Recurrence; Thyr | 2005 |
Multiorgan echinococcosis in a pediatric patient.
Topics: Albendazole; Animals; Antibodies, Helminth; Anticestodal Agents; Child, Preschool; Diagnosis, Differ | 2005 |
An up-to-date on clinical management of human cystic echinococcosis.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anthelmintics; Case Management; Ch | 2004 |
Hydatid cyst of gluteus muscle. Two cases. Review of the literature.
Topics: Adult; Aged, 80 and over; Albendazole; Anticestodal Agents; Buttocks; Echinococcosis; Female; Humans | 2005 |
Encysted peritoneal hydatidosis in a child -- the effectiveness of pre-operative therapy with a combination of praziquantel and albendazole.
Topics: Administration, Oral; Adolescent; Albendazole; Anthelmintics; Drug Therapy, Combination; Echinococco | 2005 |
Repeated treatment of cystic echinococcosis in patients with a long-term immunological response after successful surgical cyst removal.
Topics: Adult; Albendazole; Antibodies, Helminth; Anticestodal Agents; Antigens, Helminth; Echinococcosis; E | 2006 |
[The secretory activity of blood platelets--beta-thromboglobulin and platelet factor 4 in echinococcosis].
Topics: Adult; Aged; Albendazole; Anthelmintics; beta-Thromboglobulin; Blood Platelets; Echinococcosis; Echi | 2005 |
Surgical and medical management of rare echinococcosis of the extremities: pre- and post-operative long-term chemotherapy.
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Combined Modality Therapy; Echinococcosis; Echinoc | 2005 |
Morphobiology of Echinococcus granulosus and therapeutic trials in sheep.
Topics: Albendazole; Animals; Antinematodal Agents; Echinococcosis; Echinococcus granulosus; Mebendazole; Sh | 1989 |
Ultrasound examination in patients with hydatid cysts during albendazole treatment.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Male; Middle Aged; Ultrasonograph | 1989 |
Albendazole in the treatment of hydatid disease.
Topics: Albendazole; Anthelmintics; Echinococcosis; Humans; Treatment Outcome | 1989 |
[Hydatid disease of the femoral shaft treated with surgery and hypertonic solution wash-out combined with albendazole].
Topics: Adolescent; Albendazole; Anthelmintics; Bone Nails; Bone Plates; Echinococcosis; Female; Femoral Fra | 2005 |
Activation of blood platelets in echinococcosis--CD62P and CD63 expression.
Topics: Adult; Aged; Albendazole; Anthelmintics; Blood Platelets; Echinococcosis; Female; Gene Expression Re | 2006 |
Modified pair technique for treatment of hydatid cysts in the spleen.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Child; Drainage; Echinococcosis; Female; Follow-Up St | 2005 |
Long-term surgical outcome in patients with intracranial hydatid cyst.
Topics: Adult; Albendazole; Anticestodal Agents; Brain; Child; Diagnosis, Differential; Echinococcosis; Fema | 2006 |
A rare presentation of hydatid cyst.
Topics: Adolescent; Albendazole; Animals; Biopsy, Needle; Echinococcosis; Female; Follow-Up Studies; Humans; | 2005 |
Spinal hydatid disease, a rare but existent pathological entity: case report and review of the literature.
Topics: Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Echinococcus granulosus; Follow | 2006 |
[Recurrence of echinococcosis: pathogenesis, prophylaxis, early diagnosis and treatment].
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Animals; Anticestodal Agents; Child; Child, | 2006 |
Doctors, prison torture and the "war on terror".
Topics: Adult; Albendazole; Anthelmintics; Axilla; Echinococcosis; Female; Humans | 2006 |
Orbital hydatid cyst in childhood: a report of two cases.
Topics: Adolescent; Albendazole; Antiprotozoal Agents; Echinococcosis; Exophthalmos; Female; Humans; Magneti | 2006 |
Unusual location of hydatid cyst: soft tissue mass in the neck.
Topics: Adult; Albendazole; Animals; Antiparasitic Agents; Combined Modality Therapy; Echinococcosis; Echino | 2006 |
Hydatid disease of the seminal vesicle: a rare presentation of hydatid cyst.
Topics: Adult; Albendazole; Disease-Free Survival; Echinococcosis; Echinococcosis, Hepatic; Humans; Male; Se | 2006 |
Primary hydatid cyst of the brain during pregnancy.
Topics: Adult; Albendazole; Antiprotozoal Agents; Brain; Echinococcosis; Female; Humans; Pregnancy; Pregnanc | 2006 |
An extensive vertebral hydatidosis revealed by a lumbosciatica.
Topics: Adult; Albendazole; Antiprotozoal Agents; Echinococcosis; Humans; Low Back Pain; Magnetic Resonance | 2007 |
Our experience in eight cases with urinary hydatid disease: a series of 372 cases held in nine different clinics.
Topics: Adult; Albendazole; Antiprotozoal Agents; Brain Diseases; Child; Echinococcosis; Humans; Retrospecti | 2006 |
Hydatid cyst of the breast mimicking inflammatory carcinoma and mastitis.
Topics: Adult; Albendazole; Anthelmintics; Breast Diseases; Breast Neoplasms; Diagnosis, Differential; Echin | 2006 |
[Thoracic hydatid cysts: news].
Topics: Albendazole; Animals; Anthelmintics; Anticestodal Agents; Antinematodal Agents; Benzimidazoles; Dise | 2006 |
[A rare localization of chest wall hydatidosis: Sternal hydatidosis].
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Humans; Male; Radiogr | 2006 |
Case report: Echinococcus disease of the bone presenting as a femoral shaft nonunion.
Topics: Albendazole; Animals; Anti-Bacterial Agents; Bone Diseases; Echinococcosis; Echinococcus; Femoral Fr | 2007 |
Pulmonary and parotid hydatid cyst: an unusual double localization.
Topics: Aged, 80 and over; Albendazole; Anticestodal Agents; Echinococcosis; Echinococcosis, Pulmonary; Foll | 2006 |
[A 31-year-old woman with a mass in the thigh muscle].
Topics: Adult; Albendazole; Anthelmintics; Combined Modality Therapy; Echinococcosis; Female; Hemagglutinati | 2007 |
Intermittent leg pain and swelling in a 30-year-old man.
Topics: Adamantinoma; Adult; Albendazole; Animals; Anticestodal Agents; Bone Neoplasms; Diagnosis, Different | 2007 |
Recurrent pulmonary microemboli secondary to primary cardiac hydatidosis.
Topics: Adult; Albendazole; Animals; Anticestodal Agents; Dyspnea; Echinococcosis; Echinococcosis, Pulmonary | 2007 |
Diagnosis and treatment of multiple hydatid cysts at the craniovertebral junction. Case report.
Topics: Adult; Albendazole; Anticestodal Agents; Atlanto-Occipital Joint; Decompression, Surgical; Echinococ | 2007 |
Genotoxic effect of albendazole in pediatric patients with hepatic hydatid disease.
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Child; Echinococcosis; Echinococcosis, Hepatic; Ech | 2007 |
Diagnosis and management of pediatric cardiac hydatid cyst.
Topics: Albendazole; Animals; Antiprotozoal Agents; Child; Echinococcosis; Echocardiography; Electrocardiogr | 2007 |
[Hydatid disease of bone: a report of 2 cases].
Topics: Albendazole; Anthelmintics; Bone Diseases; Echinococcosis; Female; Humans; Male; Middle Aged | 2007 |
An unusual localization of cyst hydatidosis associated with cardiac hydatid disease.
Topics: Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Echocardiography; Female; Heart | 2007 |
[Effect of combined pentoxifylline and albendazole against echinococcus multilocularis infection in mice].
Topics: Albendazole; Animals; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Echinococcus multilo | 2006 |
[An approach to the mechanism of matrine and albendazole against Echinococcus multilocularis infection in mice].
Topics: Albendazole; Alkaloids; Animals; Anthelmintics; Ca(2+) Mg(2+)-ATPase; Drug Therapy, Combination; Ech | 2006 |
Hydatid cyst of the lesser sac.
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Peritoneal Cavity; Pulmonary Disease | 2007 |
Uncommon locations of hydatid cysts.
Topics: Abdomen; Aged; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Male; Middle Aged; Thigh; | 2007 |
Ruptured hydatid cyst following minimal trauma and few signs on presentation.
Topics: Accidental Falls; Adolescent; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus gran | 2007 |
Hydatid disease of the parotid gland: a rare case report.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Parotid Diseases; Parotid Gland; | 2007 |
A primary hydatid cyst of the gracilis: a case report.
Topics: Adult; Albendazole; Echinococcosis; Female; Humans; Magnetic Resonance Imaging; Musculoskeletal Dise | 2007 |
Cystic echinococcosis in Central Saudi Arabia: a 5-year experience.
Topics: Abdominal Pain; Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Antiprotozoal Agents; Cough | 2007 |
Diagnosis--hydatid cyst disease.
Topics: Albendazole; Animals; Antiprotozoal Agents; Cysts; Echinococcosis; Echinococcus; Humans; India; Live | 2007 |
[Multifocal (spinal cord, thorax, abdomen) severe complicated hydatid disease].
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis, Pu | 2007 |
Images in cardiovascular medicine. Anaphylaxis and recurrent hydatid disease.
Topics: Albendazole; Anaphylaxis; Combined Modality Therapy; Echinococcosis; Heart Diseases; Humans; Middle | 2007 |
Therapeutic effects of Sophora moorcroftiana alkaloids in combination with albendazole in mice experimentally infected with protoscolices of Echinococcus granulosus.
Topics: Albendazole; Alkaloids; Animals; Anticestodal Agents; Disease Models, Animal; Drug Therapy, Combinat | 2007 |
Hydatid disease in Iranian children.
Topics: Albendazole; Animals; Anthelmintics; Child; Contact Tracing; Dogs; Echinococcosis; Endemic Diseases; | 2007 |
Cardiac manifestation of cystic echinococcosis: comparison of dual-source cardio-computed tomography and cardiac magnetic resonance imaging and their impact on disease management.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Heart Diseases; Humans; Magnetic Resonance Imagin | 2007 |
Primary sacral hydatid cyst. A case report.
Topics: Albendazole; Animals; Antiparasitic Agents; Combined Modality Therapy; Echinococcosis; Echinococcus; | 2007 |
Long term follow-up of a patient with disseminated spinal hydatidosis.
Topics: Adult; Albendazole; Animals; Anti-Bacterial Agents; Antiparasitic Agents; Combined Modality Therapy; | 2007 |
Spermatic cord hydatid cyst: an unusual localization.
Topics: Albendazole; Biopsy, Needle; Child; Combined Modality Therapy; Echinococcosis; Follow-Up Studies; Ge | 2007 |
The action of albendazole on hydatid cysts in sheep experimentally infected with eggs of Echinococcus granulosus.
Topics: Albendazole; Animals; Anticestodal Agents; Brazil; Disease Models, Animal; Echinococcosis; Echinococ | 2008 |
Study on the hydatid cyst membrane: permeation of model molecules and interactions with drug-loaded nanoparticles.
Topics: Albendazole; Diffusion; Echinococcosis; Nanoparticles; Permeability | 2008 |
Primary intraorbital hydatid cyst: an unusual location, case report and review of the literature.
Topics: Adult; Albendazole; Animals; Anthelmintics; Craniotomy; Decompression, Surgical; Echinococcosis; Env | 2007 |
Metabolic changes during successful medical therapy for brain hydatid cyst: case report.
Topics: Acetic Acid; Alanine; Albendazole; Animals; Anticestodal Agents; Brain; Echinococcosis; Echinococcus | 2008 |
[A case of secondary localized pericardial cyst hydatic disease and determination of cyst hydatic scoleces and hooks with various stains].
Topics: Aged; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus granulosus; Heart Atria; Hum | 2008 |
A minimally invasive treatment option in primary muscular hydatid cyst: report of 2 cases.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Huma | 2008 |
The effect of combination therapy with albendazole and praziquantel on hydatid cyst treatment.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Female; Hu | 2008 |
Disseminated abdominal hydatidosis.
Topics: Abdominal Pain; Adult; Albendazole; Animals; Echinococcosis; Echinococcus granulosus; Female; Hepato | 2007 |
Primary hydatidosis of the gluteus muscles: report of three cases.
Topics: Aged; Albendazole; Animals; Antiprotozoal Agents; Buttocks; Echinococcosis; Echinococcus granulosus; | 2009 |
Disseminated intraspinal hydatid disease.
Topics: Albendazole; Anthelmintics; Bone Transplantation; Echinococcosis; Follow-Up Studies; Humans; Laminec | 2008 |
Severe disseminated hydatid disease successfully treated medically with prolonged administration of albendazole.
Topics: Administration, Oral; Adult; Albendazole; Anthelmintics; Brain; Brain Diseases; Central Nervous Syst | 2008 |
Albendazole treatment in cystic echinococcosis: pharmacokinetics and clinical efficacy of two different aqueous formulations.
Topics: Albendazole; Animals; Anthelmintics; Chemistry, Pharmaceutical; Disease Models, Animal; Drug Adminis | 2008 |
A case of disseminated abdominal hydatidosis.
Topics: Abdomen; Albendazole; Anticestodal Agents; Child; Echinococcosis; Female; Follow-Up Studies; Humans; | 2008 |
Albendazole as a potential treatment for human hydatidosis.
Topics: Administration, Oral; Adult; Albendazole; Anthelmintics; Antibodies; Benzimidazoles; Child; Echinoco | 1983 |
Albendazole.
Topics: Adult; Albendazole; Anticestodal Agents; Benzimidazoles; Echinococcosis; Female; Humans | 1983 |
Albendazole for hydatid cysts.
Topics: Albendazole; Anticestodal Agents; Benzimidazoles; Echinococcosis; Humans | 1984 |
Albendazole: worms and hydatid disease.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Female; Humans; Nematode Infections; Pre | 1984 |
Hydatid disease and albendazole.
Topics: Albendazole; Benzimidazoles; Echinococcosis; Humans | 1984 |
Albendazole in hydatid disease.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Female; Humans | 1983 |
Abdominal hydatid disease: computed tomographic and ultrasound changes during albendazole therapy.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Humans; Tomography, X-Ray Computed; Ultr | 1984 |
Chemotherapy of hydatid disease.
Topics: Albendazole; Benzimidazoles; Echinococcosis; Humans; Mebendazole | 1983 |
[Preventive and curative efficacy of a albendazole in hepatico-peritoneal cysticercosis in rabbit. A laboratory model for chemotherapy of hydatidosis (author's transl)].
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Cysticercosis; Disease Models, Animal; Echinoco | 1981 |
Effects of mebendazole, albendazole and praziquantel on alanine aminotransferase and aspartate aminotransferase of Echinococcus granulosus cyst wall harbored in mice.
Topics: Alanine Transaminase; Albendazole; Animals; Anthelmintics; Aspartate Aminotransferases; Echinococcos | 1995 |
[A retroperitoneal hydatid cyst--a rare manifestation of Echinococcus granulosus].
Topics: Albendazole; Anthelmintics; Combined Modality Therapy; Echinococcosis; Humans; Male; Middle Aged; Pe | 1995 |
Immunological markers indicating the effectiveness of pharmacological treatment in human hydatid disease.
Topics: Adult; Aged; Albendazole; Animals; Antibodies, Helminth; Antigens, Helminth; Biomarkers; Echinococco | 1995 |
Percutaneous drainage of renal hydatid cyst: early results and follow-up.
Topics: Adult; Albendazole; Ciprofloxacin; Drainage; Echinococcosis; Female; Follow-Up Studies; Humans; Kidn | 1995 |
[Echinococcosis/hydatidosis in children: combined medical and surgical treatment].
Topics: Albendazole; Child; Child, Preschool; Combined Modality Therapy; Echinococcosis; Echinococcosis, Hep | 1994 |
Effects of mebendazole, albendazole, and praziquantel on glutathione S-transferase and superoxide dismutase of Echinococcus granulosus cyst wall harbored in mice.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Female; Glutathione Transferase; Male; Mebendazo | 1995 |
Hydatid cyst of the breast.
Topics: Adult; Albendazole; Breast Diseases; Diagnosis, Differential; Echinococcosis; Female; Humans; Mammog | 1994 |
[Pathological studies on alveolar hydatid in gerbils treated with albendazole and praziquantel].
Topics: Albendazole; Animals; Echinococcosis; Female; Gerbillinae; Liver; Male; Praziquantel | 1994 |
Primary pelvic hydatid cyst presenting with obstructive uropathy and renal failure.
Topics: Adult; Albendazole; Echinococcosis; Female; Humans; Kidney Failure, Chronic; Male; Pelvic Inflammato | 1994 |
Three- to 7-year follow-up after albendazole treatment of 68 patients with cystic echinococcosis (hydatid disease).
Topics: Adolescent; Adult; Age Factors; Albendazole; Child; Echinococcosis; Echinococcosis, Hepatic; Echinoc | 1994 |
Effects of benzimidazole compounds on mice infected with secondary cysts of Echinococcus granulosus.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Female; In Vitro Techniques; Mebe | 1994 |
Effects of mebendazole, albendazole, and praziquantel on fumarate hydratase, pyruvate kinase, and phosphoenolpyruvate carboxykinase of Echinococcus granulosus cyst wall harbored in mice.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Female; Fumarate Hydratase; Mebendazole; Mice; P | 1994 |
[Moderate results in albendazole treatment of echinococcosis in 7 patients].
Topics: Albendazole; Drug Administration Schedule; Echinococcosis; Humans; Prognosis; Time Factors | 1994 |
Percutaneous treatment of hydatid cysts under sonographic guidance.
Topics: Adult; Aged; Albendazole; Drainage; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Male; M | 1994 |
[Improvement of echinococcosis control and treatment in China].
Topics: Albendazole; Animals; China; Echinococcosis; Humans | 1993 |
Pharmacokinetics of albendazole in children with hydatid disease.
Topics: Administration, Oral; Adolescent; Adult; Age Factors; Albendazole; Anthelmintics; Child; Drug Monito | 1993 |
Brain alveococcosis. Therapeutic experience in 14 cases.
Topics: Adult; Aged; Albendazole; Brain; Brain Diseases; Echinococcosis; Female; Humans; Male; Middle Aged; | 1994 |
[Bone hydatidosis. Pseudosarcomatous aspect].
Topics: Albendazole; Bone Diseases; Combined Modality Therapy; Diagnosis, Differential; Echinococcosis; Huma | 1993 |
Combination of praziquantel and albendazole in the treatment of hydatid disease.
Topics: Adult; Albendazole; Drug Therapy, Combination; Echinococcosis; Female; Humans; Male; Middle Aged; Pr | 1993 |
Albendazole therapy of hydatid disease: 2-year follow-up of 40 cases.
Topics: Adolescent; Adult; Albendazole; Alkaline Phosphatase; Chemical and Drug Induced Liver Injury; Child; | 1993 |
Effects of mebendazole, albendazole, and praziquantel on succinate dehydrogenase, fumarate reductase, and malate dehydrogenase in Echinococcus granulosus cysts harbored in mice.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Female; Malate Dehydrogenase; Mebendazole; Mice; | 1993 |
[Alopecia and albendazole].
Topics: Aged; Albendazole; Alopecia; Drug Eruptions; Echinococcosis; Humans; Male | 1993 |
Concentrations of albendazole in serum, cerebrospinal fluid and hydatidous brain cyst.
Topics: Albendazole; Blood-Brain Barrier; Brain Diseases; Cerebrospinal Fluid Shunts; Child; Combined Modali | 1993 |
Human hydatidosis in New South Wales and the Australian Capital Territory, 1987-1992.
Topics: Adolescent; Adult; Age Distribution; Aged; Aged, 80 and over; Albendazole; Anthelmintics; Australia; | 1996 |
Imported echinococcosis in southern California.
Topics: Adult; Aged; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; California; China; Complemen | 1995 |
Effect of antihydatid drugs on carbohydrate metabolism of metacestode of echinococcus granulosus.
Topics: Adenosine Triphosphatases; Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echinococcus; | 1995 |
A case of thalamic hydatid cyst.
Topics: Albendazole; Anthelmintics; Child, Preschool; Echinococcosis; Humans; Magnetic Resonance Imaging; Ma | 1995 |
Posterior neck mass in a four-year-old boy.
Topics: Albendazole; Animals; Anthelmintics; Antitubercular Agents; Biopsy, Needle; Child, Preschool; Echino | 1995 |
Cerebral hydatid cyst in children. Experience of 27 cases.
Topics: Adolescent; Albendazole; Anthelmintics; Brain Diseases; Cerebral Cortex; Child; Child, Preschool; Ec | 1995 |
Interventricular septal hydatid cyst presenting as complete heart block.
Topics: Adult; Albendazole; Cardiomyopathies; Echinococcosis; Echocardiography; Heart Block; Heart Septum; H | 1996 |
Production of IL-5 and IL-6 by peripheral blood mononuclear cells (PBMC) from patients with Echinococcus granulosus infection.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Female; Humans; Immunoglobulin Isotypes; Interle | 1996 |
Antibody responses of patients with cystic hydatid disease to recombinant myophilin of Echinococcus granulosus.
Topics: Adult; Aged; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Antigens, Helminth; Blotting | 1996 |
Endoscopic evacuation of sacral hydatid cysts: case report.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Female; Humans; Kidney; Magnetic Resonance I | 1996 |
[Echinococcal hydatid cyst in the right ventricle].
Topics: Adult; Albendazole; Animals; Anthelmintics; Antigens, Helminth; Chest Pain; Diagnosis, Differential; | 1996 |
Albendazole therapy in liver hydatidosis.
Topics: Albendazole; Anthelmintics; Child; Echinococcosis; Humans; Liver Diseases; Male; Ultrasonography | 1995 |
Primary hydatidosis of the peripheral muscles: treatment with albendazole.
Topics: Administration, Oral; Adult; Albendazole; Animals; Anthelmintics; Biopsy; Diagnosis, Differential; E | 1997 |
Presentation of parasites and the radiology of parasitic diseases.
Topics: Albendazole; Anthelmintics; Brain Diseases; Child; Echinococcosis; Fatal Outcome; Female; Humans | 1997 |
Complete heart block caused by cardiac echinococcosis and successfully treated with albendazole.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Echocardiography; Echocardiography, Doppler; Elec | 1997 |
[Treatment of intra-abdominal hydatidosis with albendazole].
Topics: Abdomen; Aged; Aged, 80 and over; Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepati | 1996 |
Orbital hydatid cysts: report of four cases.
Topics: Adolescent; Albendazole; Anthelmintics; Child, Preschool; Combined Modality Therapy; Echinococcosis; | 1997 |
Hydatid disease of bone with adjacent joint involvement. A radiological follow-up of 12 years.
Topics: Albendazole; Anthelmintics; Antinematodal Agents; Bone Diseases; Combined Modality Therapy; Echinoco | 1997 |
Treatment of progressive cervical spinal instability secondary to hydatid disease. A case report.
Topics: Adult; Albendazole; Anthelmintics; Bone Plates; Bone Screws; Bone Transplantation; Cervical Vertebra | 1997 |
[E. Multilocularis infection under treatment with albendazole for very long durations].
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Time Factors | 1997 |
Albendazole treatment of human hydatid tissue.
Topics: Adult; Aged; Albendazole; Echinococcosis; Female; Humans; Male; Middle Aged | 1997 |
Albendazole treatment and serological follow-up in hydatid disease of bone.
Topics: Administration, Oral; Adult; Aged; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Antige | 1997 |
Development of chemotherapeutic model for the in vitro screening of drugs against Echinoccus granulosus cysts: the effects of an albendazole-albendazole sulphoxide combination.
Topics: Albendazole; Animals; Anthelmintics; Dose-Response Relationship, Drug; Drug Evaluation, Preclinical; | 1996 |
Splenic hydatid cyst in children--a report of two cases.
Topics: Albendazole; Anthelmintics; Child; Echinococcosis; Humans; Male; Splenic Diseases | 1997 |
Reduction of abdominal hydatid disease with prolonged treatment.
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; Peritonea | 1997 |
Ultrasound imaging in cystic echinococcosis. Proposal of a new sonographic classification.
Topics: Albendazole; Echinococcosis; Ethanol; Humans; Ultrasonography | 1997 |
Medical decompression of vertebral hydatidosis.
Topics: Aged; Albendazole; Anthelmintics; Contraindications; Drug Therapy, Combination; Echinococcosis; Fema | 1997 |
[Complications of cardiac hydatid cyst. 2 cases].
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Brain Diseases; Cardiac Tamponade; Cardiomyopathies; | 1997 |
In vivo effect of oral albendazole and albendazole sulphoxide on development of secondary echinococcosis in mice.
Topics: Administration, Oral; Albendazole; Animals; Anthelmintics; Drug Combinations; Echinococcosis; Female | 1997 |
Retroperitoneal hydatid cyst mimicking retrocaval ureter.
Topics: Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Humans; Hydronephrosis; Male; M | 1998 |
[A hypothesis on the significance of an increase in serum transaminases in patients with hydatidosis treated with benzimidazole carbamates].
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Anticestodal Agents; Child; Child, Preschoo | 1997 |
Albendazole treatment of cerebral hydatid disease: evaluation of results with CT and MRI.
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Follow-Up Studies; Humans; Magnetic Resonance Imag | 1998 |
[Surgical treatment of acute pericardial tamponade in an infestation of the heart by Echinococcus].
Topics: Acute Disease; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Cardiac Tamponade; Echinoc | 1998 |
An unusual presentation of secondary pleural hydatidosis.
Topics: Aged; Albendazole; Anthelmintics; Echinococcosis; Humans; Lung Diseases; Male; Pleural Diseases; Ple | 1998 |
[Cystic echinococcosis of the spleen].
Topics: Aged; Albendazole; Bacterial Vaccines; Combined Modality Therapy; Echinococcosis; Female; Humans; Pn | 1998 |
Echinococcus granulosus: membrane permeability of secondary hydatid cysts to albendazole sulfoxide.
Topics: Albendazole; Animals; Anticestodal Agents; Drug Therapy, Combination; Echinococcosis; Echinococcus; | 1998 |
[Aplastic anemia induced by albendazole].
Topics: Aged; Albendazole; Anemia, Aplastic; Anthelmintics; Echinococcosis; Humans; Male | 1998 |
Gamma knife radiosurgery and albendazole for cerebral alveolar hydatid disease.
Topics: Adult; Albendazole; Anthelmintics; Brain Diseases; Combined Modality Therapy; Echinococcosis; Female | 1998 |
Albendazole plus praziquantel versus albendazole alone as a pre-operative treatment in intra-abdominal hydatisosis caused by Echinococcus granulosus.
Topics: Abdomen; Adult; Aged; Albendazole; Anthelmintics; Antiplatyhelmintic Agents; Drug Therapy, Combinati | 1998 |
3D-ultrasound in imaging, diagnosis and follow-up of an atypical hydatid cyst.
Topics: Adult; Albendazole; Diagnosis, Differential; Drainage; Drug Administration Schedule; Echinococcosis; | 1998 |
The level of the collagen cross-link pyridinoline reflects the improvement of cutaneous lesions in one case of skin alveolar echinococcosis.
Topics: Albendazole; Amino Acids; Anticestodal Agents; Antiparasitic Agents; Arginine; Biopsy; Collagen; Ech | 1998 |
Neotropical echinococcosis in Suriname: Echinococcus oligarthrus in the orbit and Echinococcus vogeli in the abdomen.
Topics: Abdomen; Adult; Albendazole; Animals; Animals, Wild; Anticestodal Agents; Cats; Child; Disease Vecto | 1998 |
Periventricular hydatid cyst.
Topics: Albendazole; Animals; Anthelmintics; Brain Diseases; Cerebral Ventricles; Cerebral Ventriculography; | 1998 |
Serum cytokine detection in the clinical follow up of patients with cystic echinococcosis.
Topics: Adult; Aged; Albendazole; Anticestodal Agents; Cytokines; Echinococcosis; Female; Follow-Up Studies; | 1999 |
Efficacies of albendazole sulfoxide and albendazole sulfone against In vitro-cultivated Echinococcus multilocularis metacestodes.
Topics: Albendazole; Animals; Anthelmintics; Chromatography, High Pressure Liquid; Echinococcosis; Echinococ | 1999 |
Hydatid disease in New Zealand. What remains and how should we treat it?
Topics: Adult; Aged; Aged, 80 and over; Albendazole; Algorithms; Anticestodal Agents; Decision Trees; Diseas | 1999 |
Editorial response: Treatment of cystic echinococcosis--improving but still limited.
Topics: Albendazole; Anthelmintics; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis, Pulmonary; Foll | 1999 |
[Efficacy of low-dose albendazole therapy in hydatic liver disease: a case report].
Topics: Aged; Albendazole; Anthelmintics; Dose-Response Relationship, Drug; Echinococcosis; Female; Humans; | 1999 |
Case report: Percutaneous drainage of the pancreatic head hydatid cyst with obstructive jaundice.
Topics: Adolescent; Albendazole; Anthelmintics; Antibiotic Prophylaxis; Cholestasis; Cholestasis, Extrahepat | 1999 |
Hydatid disease and massive cardiac involvement.
Topics: Adolescent; Albendazole; Cardiac Surgical Procedures; Combined Modality Therapy; Drainage; Echinococ | 1999 |
[Acute pericardial tamponade in cardiac echinococcosis].
Topics: Adult; Albendazole; Anthelmintics; Cardiac Tamponade; Cardiomyopathies; Combined Modality Therapy; D | 1999 |
Hydatid disease in children may have an atypical presentation.
Topics: Adolescent; Albendazole; Anthelmintics; Child; Child, Preschool; Choledochal Cyst; Echinococcosis; E | 2000 |
Cardiac echinococcosis.
Topics: Albendazole; Animals; Anticestodal Agents; Echinococcosis; Echocardiography, Transesophageal; Heart | 2000 |
[Hydatid pulmonary embolism. Two case reports].
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Chronic Disease; Combined Modality Therapy; Echinococ | 2000 |
Echinococcal ovarian cyst. A case report.
Topics: Adult; Albendazole; Anthelmintics; Diagnosis, Differential; Echinococcosis; Female; Humans; Ovarian | 2000 |
Radical surgical therapy of abdominal cystic hydatid disease: factors of recurrence.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Anthelmintics; Antinematodal Agents; Echino | 2000 |
Alveolar echinococcosis with bulky peritoneal spread--a rare but important diagnosis in gynaecological practice.
Topics: Adult; Albendazole; Animals; Anthelmintics; Blotting, Western; Echinococcosis; Echinococcosis, Hepat | 2000 |
A viable residual spinal hydatid cyst cured with albendazole. Case report.
Topics: Adolescent; Albendazole; Anthelmintics; Back Pain; Echinococcosis; Female; Follow-Up Studies; Humans | 2000 |
[Peritoneal hydatid cysts. Apropos of 12 cases].
Topics: Abscess; Adult; Albendazole; Anticestodal Agents; Biliary Fistula; Echinococcosis; Echinococcosis, H | 2000 |
Myocardial ischemia caused by an hydatid cyst of the interventricular septum successfully treated with albendazole.
Topics: Adult; Albendazole; Antiparasitic Agents; Echinococcosis; Echocardiography, Transesophageal; Heart S | 2000 |
A case of primary hydatidosis of the thyroid gland.
Topics: Albendazole; Anthelmintics; Biopsy, Needle; Combined Modality Therapy; Echinococcosis; Female; Human | 1999 |
[Multiple pulmonary hydatidosis with floating balloon appearance and cardiac localization].
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Echinococcosis, Pulmonary; Female; Heart Di | 2000 |
Hydatid cyst of heart presenting as ventricular tachycardia.
Topics: Adolescent; Albendazole; Amiodarone; Anthelmintics; Anti-Arrhythmia Agents; Diagnosis, Differential; | 1999 |
Primary intracranial extradural hydatid cyst extending above and below the tentorium.
Topics: Albendazole; Central Nervous System Helminthiasis; Diagnosis, Differential; Echinococcosis; Humans; | 1997 |
Orbital hydatid cyst: treatment and prevention of recurrences with albendazole plus praziquantel.
Topics: Adult; Agricultural Workers' Diseases; Albendazole; Anthelmintics; Antibodies, Helminth; Drug Therap | 2000 |
Primary pelvic hydatid cyst.
Topics: Adnexal Diseases; Adult; Albendazole; Animals; Diagnosis, Differential; Echinococcosis; Echinococcos | 2000 |
An unusual cause of urinary retention: a primary retrovesical echinococcal cyst.
Topics: Adult; Albendazole; Echinococcosis; Follow-Up Studies; Humans; Hydronephrosis; Lung; Male; Tomograph | 2000 |
Interventricular septal hydatid cyst.
Topics: Adult; Albendazole; Animals; Anthelmintics; Cardiomyopathies; Echinococcosis; Echocardiography; Hear | 2000 |
Albendazole therapy for a recurrent orbital hydatid cyst.
Topics: Adolescent; Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Echinococcosis; Echinococcus; | 2000 |
In vitro effect of praziquantel and albendazole combination therapy on the larval stage of Echinococcus granulosus.
Topics: Albendazole; Animals; Anticestodal Agents; Cytoplasm; Drug Therapy, Combination; Echinococcosis; Ech | 2000 |
[Asymptomatic carriers of hydatidosis: epidemiology, diagnosis, and treatment].
Topics: Albendazole; Animals; Anthelmintics; Antibodies, Helminth; Argentina; Body Fluids; Carrier State; Co | 2000 |
Brain hydatidosis: report on 117 cases.
Topics: Adolescent; Albendazole; Brain Diseases; Central Nervous System Helminthiasis; Child; Child, Prescho | 2000 |
Primary muscle hydatidosis of the thigh: management of a complicated case with combination adjunctive albendazole and praziquantel chemotherapy.
Topics: Albendazole; Anthelmintics; Chemotherapy, Adjuvant; Drug Therapy, Combination; Echinococcosis; Human | 2001 |
Reevaluation of effect of albendazole on echinococcus multilocularis infection in mice and gerbils.
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Female; Gerbillinae; Liver; Lung; Mice; Random | 1998 |
Pharmacokinetics of netobimin and microsomal metabolism of albendazole in infected gerbils with Echinococcus granulosus.
Topics: Albendazole; Animals; Anticestodal Agents; Disease Models, Animal; Echinococcosis; Echinococcus; Ger | 2001 |
Laparoscopic excision of splenic hydatid cyst.
Topics: Albendazole; Antiprotozoal Agents; Chemotherapy, Adjuvant; Echinococcosis; Humans; Male; Middle Aged | 2001 |
Cardiac echinococcosis.
Topics: Adult; Albendazole; Anticestodal Agents; Echinococcosis; Echocardiography; Female; Heart Diseases; H | 2001 |
Primary echinococcosis of the sternocleidomastoid muscle.
Topics: Albendazole; Combined Modality Therapy; Croatia; Echinococcosis; Follow-Up Studies; Humans; Male; Mi | 2001 |
[Observation of echinococcosis of the mediastinum].
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Humans; Male; Mediastinum | 2000 |
Praziquantel and albendazole in the combined treatment of experimental hydatid disease.
Topics: Albendazole; Animals; Anthelmintics; Disease Models, Animal; Drug Therapy, Combination; Echinococcos | 2001 |
Echinococcus infestation of the splenius capitis.
Topics: Albendazole; Antiprotozoal Agents; Echinococcosis; Female; Humans; Magnetic Resonance Imaging; Middl | 2001 |
[Response of multiorganic hydatdosis to combined therapy with albendazoleand praziquantel].
Topics: Albendazole; Anthelmintics; Drug Therapy, Combination; Echinococcosis; Humans; Male; Middle Aged; Pr | 2001 |
[Vertebral hydatidosis: three case reports].
Topics: Adolescent; Albendazole; Anticestodal Agents; Child; Combined Modality Therapy; Disease Progression; | 2001 |
[Echinococcosis of the pelvic bone: four cases].
Topics: Adult; Albendazole; Anti-Infective Agents, Local; Anticestodal Agents; Bone Diseases, Infectious; Co | 2001 |
Combined praziquantel and albendazole chemoprophylaxis in experimental hydatidosis.
Topics: Albendazole; Animals; Anthelmintics; Disease Models, Animal; Drug Therapy, Combination; Echinococcos | 2001 |
Albendazole: new indication. Useful adjunct in hydatid disease.
Topics: Albendazole; Anthelmintics; Australia; Clinical Trials as Topic; Echinococcosis; Europe; Humans; Tre | 2000 |
Cystic echinococcosis of the tongue leading to diagnosis of multiple localizations.
Topics: Albendazole; Anthelmintics; Child, Preschool; Diagnosis, Differential; Echinococcosis; Echinococcosi | 2001 |
Multilocular echinococcosis in humerus: a case report.
Topics: Adult; Albendazole; Anthelmintics; Bone Diseases; Echinococcosis; Female; Humans; Humerus; Radiograp | 2001 |
Continuous long-term albendazole therapy in intraabdominal cystic echinococcosis.
Topics: Abdominal Abscess; Abdominal Pain; Adolescent; Adult; Albendazole; Animals; Anorexia; Anticestodal A | 2000 |
Hydatidosis of the pelvis and hip.
Topics: Aged; Albendazole; Combined Modality Therapy; Drainage; Echinococcosis; Female; Hip; Humans; Ilium; | 2001 |
Primary hydatid disease of the femur: unsuspected and incidental MRI findings with long-term curative results on medical treatment alone.
Topics: Adolescent; Albendazole; Anthelmintics; Echinococcosis; Female; Femur; Humans; Magnetic Resonance Im | 2001 |
[Laryngeal dyspnea caused by cervical hydatidosis: apropos of a case].
Topics: Albendazole; Child; Diagnosis, Differential; Dyspnea; Echinococcosis; Echinococcosis, Hepatic; Human | 2001 |
[Osseous hydatidosis: Apropos of two cases].
Topics: Aged; Albendazole; Arthroplasty, Replacement, Hip; Combined Modality Therapy; Drug Resistance; Echin | 2002 |
Augmented bioavailability and cysticidal activity of albendazole reformulated in soybean emulsion in mice infected with Echinococcus granulosus or Echinococcus multilocularis.
Topics: Albendazole; Animals; Anthelmintics; Biological Availability; Echinococcosis; Emulsions; Female; Mal | 2002 |
Could ivermectin have a synergic effect with albendazole in hydatidosis therapy?
Topics: Albendazole; Animals; Anticestodal Agents; Drug Synergism; Drug Therapy, Combination; Echinococcosis | 2002 |
A combined medical and surgical approach to hydatid disease: 12 years' experience at the Hospital for Tropical Diseases, London.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Anticestodal Agents; Child; Combined Modality T | 2002 |
Cystic echinococcosis with perforation into the biliary tract in an eight-year-old girl.
Topics: Albendazole; Anthelmintics; Biliary Tract Diseases; Child; Cholangiopancreatography, Endoscopic Retr | 2002 |
[Hydatic cyst of the fallopian tube: a case report].
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Fallopian Tube Diseases; Female; Humans; Laparosc | 2002 |
[Hydatid cyst of the kidney. Case report].
Topics: Adult; Albendazole; Animals; Anthelmintics; Combined Modality Therapy; Dogs; Echinococcosis; Humans; | 2002 |
Hydatid disease invading the inferior vena cava: successful combined medical and surgical treatment.
Topics: Aged; Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Female; Humans; Vascular Di | 2002 |
Surgical treatment of echinococcal cysts of the heart: report of 3 cases.
Topics: Adult; Albendazole; Anthelmintics; Echinococcosis; Fibrin Tissue Adhesive; Heart Diseases; Humans; M | 2002 |
Could ivermectin have a synergic effect with albendazole in hydatidosis therapy?
Topics: Albendazole; Animals; Anticestodal Agents; Cysts; Drug Synergism; Drug Therapy, Combination; Echinoc | 2002 |
Effects of mebendazole, albendazole, and praziquantel on alkaline phosphatase, acid phosphatase, and adenosine triphosphatase of Echinococcus granulosus cysts harbored in mice.
Topics: Acid Phosphatase; Adenosine Triphosphatases; Albendazole; Alkaline Phosphatase; Animals; Echinococco | 1992 |
Polycystic hydatid disease (Echinococcus vogeli). Treatment with albendazole.
Topics: Adult; Albendazole; Echinococcosis; Female; Follow-Up Studies; Humans; Male; Middle Aged; Tomography | 1992 |
Prophylactic effect of albendazole in experimental peritoneal hydatidosis.
Topics: Albendazole; Animals; Echinococcosis; Female; Male; Mice; Mice, Inbred Strains; Peritoneal Diseases; | 1992 |
Parasiticidal effect of chemotherapy in alveolar hydatid disease: review of experience with mebendazole and albendazole in Alaskan Eskimos.
Topics: Adult; Aged; Aged, 80 and over; Alaska; Albendazole; Echinococcosis; Follow-Up Studies; Humans; Inui | 1992 |
Dynamic left ventricular outflow obstruction caused by cardiac echinococcosis.
Topics: Aged; Albendazole; Cardiac Catheterization; Combined Modality Therapy; Echinococcosis; Echocardiogra | 1992 |
[Hydatid cyst of the cavernous sinus. A case].
Topics: Adult; Albendazole; Brain Diseases; Cavernous Sinus; Echinococcosis; Female; Humans; Magnetic Resona | 1992 |
A clinical-radiological evaluation of benzimidazoles in the management of Echinococcus granulosus cysts.
Topics: Abdomen; Adult; Aged; Albendazole; Child; Debridement; Drug Therapy, Combination; Echinococcosis; Ec | 1992 |
Chemotherapy of human cystic echinococcosis: comparative efficacy of mebendazole and albendazole.
Topics: Abdomen; Adolescent; Adult; Albendazole; Central Nervous System Diseases; Child; Drug Administration | 1992 |
Immune status during albendazole therapy for hydatidosis.
Topics: Adolescent; Adult; Albendazole; Animals; Antibodies, Helminth; Antigen-Antibody Complex; Combined Mo | 1992 |
Factors influencing the response to chemotherapy in human cystic echinococcosis.
Topics: Adolescent; Adult; Aged; Albendazole; Child; Echinococcosis; Female; Humans; Male; Mebendazole; Midd | 1992 |
Bacterial infection of hydatid cyst following albendazole treatment.
Topics: Adult; Albendazole; Echinococcosis; Escherichia coli Infections; Humans; Klebsiella Infections; Male | 1991 |
Hydatid disease of the right ventricle and role of tomographic scanning in its diagnosis.
Topics: Aged; Albendazole; Cardiomyopathies; Echinococcosis; Echocardiography; Electrocardiography; Heart Ve | 1991 |
[Pharmacokinetics of four benzimidazoles administered intragastrically to mice infected with secondary cysts of Echinococcus granulosus].
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Female; Mebendazole; Mice; Stomach | 1991 |
[Chemotherapy in echinococcosis].
Topics: Albendazole; Anthelmintics; Chemotherapy, Adjuvant; Combined Modality Therapy; Drug Therapy, Combina | 1991 |
MR imaging in hydatid disease.
Topics: Albendazole; Drug Therapy, Combination; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis, Pul | 1991 |
Monitored medico-surgical approach to the treatment of cystic hydatidosis.
Topics: Abdomen; Adolescent; Adult; Albendazole; Antibodies, Helminth; Antigen-Antibody Complex; Combined Mo | 1991 |
[Effect of mebendazole, albendazole and albendazole sulfoxide on glycogen contents of Echinococcus granulosus cysts in infected mice].
Topics: Albendazole; Animals; Anthelmintics; Echinococcosis; Echinococcus; Female; Glycogen; Mebendazole; Mi | 1990 |
Posterior mediastinal paravertebral hydatid cyst presenting as spinal compression. A case report.
Topics: Adult; Albendazole; Echinococcosis; Female; Humans; Radiography; Spinal Diseases | 1990 |
Effects of albendazole on Echinococcus multilocularis infection in the Mongolian jird.
Topics: Albendazole; Animals; Echinococcosis; Echinococcus; Female; Gerbillinae; Liver; Lung; Random Allocat | 1990 |
Treatment of Echinococcus granulosus hydatid disease with albendazole.
Topics: Adolescent; Adult; Aged; Albendazole; Child; Echinococcosis; Echinococcosis, Hepatic; Echinococcosis | 1990 |
Effect of albendazole on human hydatid cysts: an ultrastructural study.
Topics: Albendazole; Animals; Echinococcosis; Echinococcosis, Hepatic; Echinococcus; Humans; Microscopy, Ele | 1990 |
Perioperative prophylactic chemotherapy of Echinococcus granulosus: determination of minimum effective length of albendazole therapy in in vitro protoscolex culture.
Topics: Albendazole; Animals; Anthelmintics; Dose-Response Relationship, Drug; Drug Administration Schedule; | 1990 |
Chemotherapy of experimental Echinococcus multilocularis in jirds.
Topics: Albendazole; Animals; Anticestodal Agents; Antinematodal Agents; Benzimidazoles; Echinococcosis; Fem | 1990 |
Albendazole kinetics in patients with echinococcosis: delayed absorption and impaired elimination in cholestasis.
Topics: Adult; Aged; Albendazole; Cholestasis; Echinococcosis; Female; Half-Life; Humans; Intestinal Absorpt | 1990 |
Comparison of Albendazole and Praziquantel therapy of Echinococcus granulosus in naturally infected sheep.
Topics: Albendazole; Animals; Disease Models, Animal; Echinococcosis; Echinococcus; Microscopy, Electron; Pr | 1990 |
Echinococcus granulosus: development of resistance to albendazole in an animal model.
Topics: Albendazole; Animals; Disease Models, Animal; Drug Resistance; Echinococcosis; Echinococcus; Gerbill | 1990 |
[Albendazole in the treatment of hepatic and intra-abdominal hydatidosis].
Topics: Abdomen; Adult; Aged; Albendazole; Drug Evaluation; Echinococcosis; Echinococcosis, Hepatic; Female; | 1989 |
[Albendazole for the treatment of hepatic and intra-abdominal hydatidosis].
Topics: Albendazole; Drug Administration Schedule; Echinococcosis; Echinococcosis, Hepatic; Female; Humans; | 1989 |
Comparison of albendazole, mebendazole and praziquantel chemotherapy of Echinococcus multilocularis in a gerbil model.
Topics: Albendazole; Animals; Anthelmintics; Disease Models, Animal; Echinococcosis; Echinococcus; Gerbillin | 1989 |
[Treatment of hydatidosis with albendazol].
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Denmark; Echinococcosis; Echinococcosis, Hepati | 1989 |
Rapid recovery of Echinococcus granulosus following 'successful' albendazole therapy in a gerbil model.
Topics: Albendazole; Animals; Disease Models, Animal; Dose-Response Relationship, Drug; Echinococcosis; Echi | 1989 |
[Drug and surgical therapy of hydatidosis].
Topics: Albendazole; Combined Modality Therapy; Echinococcosis; Humans | 1989 |
Albendazole is effective against established Echinococcus granulosus in gerbils: comparison of serum concentrations achieved by gavage and feed administration.
Topics: Administration, Oral; Albendazole; Animal Feed; Animals; Dose-Response Relationship, Drug; Echinococ | 1989 |
Albendazole treatment of recurrent hydatid disease: serial evaluation with ultrasound.
Topics: Adult; Albendazole; Drug Administration Schedule; Drug Evaluation; Echinococcosis; Echinococcosis, H | 1989 |
Echinococcus multilocularis: ultrastructural effect of in vivo albendazole and praziquantel therapy, singly and in combination.
Topics: Albendazole; Animals; Arvicolinae; Drug Therapy, Combination; Echinococcosis; Echinococcus; Microsco | 1989 |
[Chemoprevention of secondary abdominal echinococcosis--experimental study and clinical observation].
Topics: Administration, Oral; Adult; Albendazole; Animals; Anthelmintics; Benzimidazoles; Echinococcosis; Ec | 1989 |
Pre-operative albendazole therapy for recurrent hydatid disease.
Topics: Abdomen; Adult; Albendazole; Benzimidazoles; Echinococcosis; Echinococcosis, Hepatic; Female; Humans | 1989 |
Albendazole in the conservative management of multiple hydatid disease.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Female; Humans; Male; Middle Aged | 1989 |
Combination chemotherapy is more effective in postspillage prophylaxis for hydatid disease than either albendazole or praziquantel alone.
Topics: Albendazole; Animals; Drug Therapy, Combination; Echinococcosis; Gerbillinae; Praziquantel | 1989 |
Albendazole and echinococcal disease.
Topics: Albendazole; Drug Administration Schedule; Echinococcosis; Humans; Medication Errors; Publishing | 1989 |
Albendazole treatment of hydatid disease--follow-up at 5 years.
Topics: Albendazole; Echinococcosis; Follow-Up Studies; Humans | 1989 |
[Human hydatidosis caused by Echinococcus granulosus: problems of medical and surgical therapy].
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Benzimidazoles; Child; Child, Preschool; Drug Therapy | 1987 |
Echinococcus multilocularis: in vivo results of therapy with albendazole and praziquantel.
Topics: Albendazole; Animals; Anthelmintics; Arvicolinae; Benzimidazoles; Body Weight; Echinococcosis; Echin | 1988 |
Albendazole treatment of multiple cerebral hydatid cysts: case report.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Brain Diseases; Echinococcosis; Humans; Male; Middle Age | 1988 |
Combination chemotherapy of Echinococcus granulosus--in vitro studies.
Topics: Albendazole; Animals; Benzimidazoles; Drug Therapy, Combination; Echinococcosis; Praziquantel | 1988 |
In vitro culture of Echinococcus multilocularis: protoscolicidal action of praziquantel and albendazole sulphoxide.
Topics: Albendazole; Animals; Benzimidazoles; Echinococcosis; In Vitro Techniques; Parasitology; Praziquante | 1988 |
[Study of the distribution of albendazole sulfoxide by liquid chromatography in plasma and cyst fluid in hydatidosis].
Topics: Albendazole; Anthelmintics; Benzimidazoles; Chromatography, Liquid; Echinococcosis; Humans | 1988 |
Serology in patients treated with albendazole for hydatid disease.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Antibodies, Helminth; Benzimidazoles; Complemen | 1988 |
Albendazole treatment of human cystic echinococcosis.
Topics: Adult; Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Echinococcosis, Hepatic; Female; | 1988 |
Pre-operative albendazole therapy and hydatid cysts.
Topics: Adult; Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Female; Humans; Male; Middle Aged | 1988 |
Optimal timing of post-operative albendazole prophylaxis in E. granulosus.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Drug Administration Schedule; Echinococcosis; G | 1988 |
Albendazole in the treatment of hydatid disease: more than a hope.
Topics: Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Humans | 1987 |
[Variation of albendazole sulfoxide concentrations in serum, hydatid cyst membrane and liquid as a function of time. Liquid phase chromatographic study].
Topics: Albendazole; Animals; Benzimidazoles; Chromatography, High Pressure Liquid; Echinococcosis; Mice | 1987 |
[Spinal hydatidosis. Failure of albendazole].
Topics: Albendazole; Benzimidazoles; Echinococcosis; Female; Follow-Up Studies; Male; Spinal Diseases | 1986 |
Albendazole in the treatment of hydatid disease.
Topics: Adult; Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Female; Humans | 1987 |
Albendazole in the treatment of cystic hydatid disease.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Echinococcosis, | 1986 |
Albendazole in hydatid disease--hepatocellular toxicity.
Topics: Aged; Aged, 80 and over; Albendazole; Anthelmintics; Benzimidazoles; Chemical and Drug Induced Liver | 1987 |
Pre-operative albendazole therapy for hydatid cyst.
Topics: Albendazole; Benzimidazoles; Combined Modality Therapy; Echinococcosis; Female; Humans; Male; Premed | 1987 |
Pharmacokinetics of albendazole in man.
Topics: Absorption; Adipose Tissue; Adult; Albendazole; Anthelmintics; Benzimidazoles; Echinococcosis; Femal | 1986 |
Hydatid disease: research and control in Turkana, III. Albendazole in the treatment of inoperable hydatid disease in Kenya--a report on 12 cases.
Topics: Adolescent; Adult; Albendazole; Anthelmintics; Benzimidazoles; Child; Child, Preschool; Echinococcos | 1986 |
Can albendazole reduce the risk of implantation of spilled protoscoleces? An animal study.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Disease Models, Animal; Echinococcosis; Echinoc | 1986 |
Penetration of albendazole sulphoxide into hydatid cysts.
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Biological Availability; Echinococcosis; Gerbil | 1987 |
Combined chemotherapy and surgery for hydatid bone disease.
Topics: Adolescent; Aged; Albendazole; Benzimidazoles; Bone Diseases; Combined Modality Therapy; Echinococco | 1987 |
[Treatment of echinococcosis (E. granulosus) with albendazole].
Topics: Adult; Aged; Albendazole; Benzimidazoles; Child; Echinococcosis; Female; Humans; Male; Middle Aged | 1985 |
Albendazole--objective evidence of response in human hydatid disease.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Benzimidazoles; Complement Fixation Tests; Echi | 1985 |
[Spinal hydatidosis treated by albendazole. A propos of 2 cases].
Topics: Adult; Albendazole; Benzimidazoles; Echinococcosis; Female; Humans; Male; Middle Aged; Spinal Diseas | 1985 |
Effective medical treatment for hydatid disease?
Topics: Albendazole; Animals; Anthelmintics; Benzimidazoles; Echinococcosis; Humans; United States; Zoonoses | 1985 |