albendazole has been researched along with Adverse Drug Event in 12 studies
| Excerpt | Relevance | Reference |
|---|---|---|
| "In this double-blind, placebo-controlled, phase 3 trial, patients with viable intraparenchymal neurocysticercosis were randomly assigned to receive 10 days of combined albendazole (15 mg/kg per day) plus praziquantel (50 mg/kg per day), standard albendazole (15 mg/kg per day), or increased dose albendazole (22·5 mg/kg per day)." | 9.19 | Efficacy of combined antiparasitic therapy with praziquantel and albendazole for neurocysticercosis: a double-blind, randomised controlled trial. ( Bustos, JA; Escalante, D; Garcia, HH; Gavidia, M; Gonzales, I; Lescano, AG; Najar, E; Pretell, EJ; Rodriguez, L; Saavedra, H; Umeres, H; Zimic, M, 2014) |
| " Due to heterogeneity in terms of study design, sample size, deworming drug, dosage and outcomes measured, data from these studies could not be pooled." | 6.61 | Systematic review of exposure to albendazole or mebendazole during pregnancy and effects on maternal and child outcomes, with particular reference to exposure in the first trimester. ( Gyorkos, TW; St-Denis, K, 2019) |
| "In this double-blind, placebo-controlled, phase 3 trial, patients with viable intraparenchymal neurocysticercosis were randomly assigned to receive 10 days of combined albendazole (15 mg/kg per day) plus praziquantel (50 mg/kg per day), standard albendazole (15 mg/kg per day), or increased dose albendazole (22·5 mg/kg per day)." | 5.19 | Efficacy of combined antiparasitic therapy with praziquantel and albendazole for neurocysticercosis: a double-blind, randomised controlled trial. ( Bustos, JA; Escalante, D; Garcia, HH; Gavidia, M; Gonzales, I; Lescano, AG; Najar, E; Pretell, EJ; Rodriguez, L; Saavedra, H; Umeres, H; Zimic, M, 2014) |
| " Adverse events (AEs) were monitored actively for two days and passively for five more days." | 3.01 | An open label, block randomized, community study of the safety and efficacy of co-administered ivermectin, diethylcarbamazine plus albendazole vs. diethylcarbamazine plus albendazole for lymphatic filariasis in India. ( Dwivedi, GP; Jambulingam, P; Krishnamoorthy, K; Kuttiatt, VS; Rahi, M; Raju, HKK; Somani, RK; Srividya, A; Subramanian, S; Suryaprakash, MK; Weil, GJ, 2021) |
| "Lymphatic filariasis has remained endemic in Fiji despite repeated mass drug administration using the well-established and safe combination of diethylcarbamazine and albendazole (DA) since 2002." | 2.94 | The safety of combined triple drug therapy with ivermectin, diethylcarbamazine and albendazole in the neglected tropical diseases co-endemic setting of Fiji: A cluster randomised trial. ( Grobler, AC; Hardy, M; Kaldor, JM; Kama, M; King, CL; Robinson, LJ; Romani, L; Samuela, J; Steer, AC; Tuicakau, M; Weil, GJ; Whitfeld, MJ, 2020) |
| " Adults were randomized into 2 treatment arms, DEC 6 mg/kg + ALB 400 mg (N = 12) or DEC 6 mg/kg + ALB 400 mg + IVM 200 μg/kg (N = 12), and monitored for microfilaria, parasite antigenemia, adverse events (AEs), and serum drug levels." | 2.82 | Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis. ( Baea, M; Fleckenstein, LL; Kazura, JW; King, CL; Lombore, B; Maki, E; Sanuku, N; Satofan, S; Schmidt, MS; Siba, PM; Thomsen, EK; Weil, GJ, 2016) |
| " About a fifth of the children reported adverse events, which were mainly mild." | 2.80 | Efficacy and safety of albendazole plus ivermectin, albendazole plus mebendazole, albendazole plus oxantel pamoate, and mebendazole alone against Trichuris trichiura and concomitant soil-transmitted helminth infections: a four-arm, randomised controlled t ( Albonico, M; Ali, SM; Alles, R; Ame, SM; Bogoch, II; Hattendorf, J; Huwyler, J; Keiser, J; Speich, B; Utzinger, J, 2015) |
| " No serious adverse events occurred, and the majority of adverse events were mild in intensity (mainly headache, abdominal pain, diarrhoea and "other signs/symptoms")." | 2.78 | A cluster randomized study of the safety of integrated treatment of trachoma and lymphatic filariasis in children and adults in Sikasso, Mali. ( Coulibaly, YI; Daou, A; Dicko, I; Doumbia, M; Haidara, FC; Horton, J; Keita, M; Keita, MM; Sankare, MH; Sow, SO; Whately-Smith, C, 2013) |
| "Nitazoxanide has been suggested as potential drug candidate." | 2.77 | Efficacy and safety of nitazoxanide, albendazole, and nitazoxanide-albendazole against Trichuris trichiura infection: a randomized controlled trial. ( Albonico, M; Ali, SM; Alles, R; Ame, SM; Hattendorf, J; Keiser, J; Speich, B; Utzinger, J, 2012) |
| " Due to heterogeneity in terms of study design, sample size, deworming drug, dosage and outcomes measured, data from these studies could not be pooled." | 2.61 | Systematic review of exposure to albendazole or mebendazole during pregnancy and effects on maternal and child outcomes, with particular reference to exposure in the first trimester. ( Gyorkos, TW; St-Denis, K, 2019) |
| " Age, underweight, and double dosing were associated with increase in ADE incidence, while gender and food intake were not associated with increase in ADE incidence." | 1.72 | Adverse drug effects among students following mass de-worming exercise involving administration of Praziquantel and Albendazole in KEEA Municipality, Ghana. ( Akrasi, W; Boye, A; Brah, AS; Essuman, MA; Osei, V, 2022) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 0 (0.00) | 18.2507 |
| 2000's | 0 (0.00) | 29.6817 |
| 2010's | 8 (66.67) | 24.3611 |
| 2020's | 4 (33.33) | 2.80 |
| Authors | Studies |
|---|---|
| Liu, Z | 3 |
| Shi, Q | 1 |
| Ding, D | 2 |
| Kelly, R | 1 |
| Fang, H | 1 |
| Tong, W | 1 |
| Morgan, RE | 1 |
| van Staden, CJ | 1 |
| Chen, Y | 4 |
| Kalyanaraman, N | 1 |
| Kalanzi, J | 1 |
| Dunn, RT | 1 |
| Afshari, CA | 1 |
| Hamadeh, HK | 1 |
| Akrasi, W | 1 |
| Brah, AS | 1 |
| Essuman, MA | 1 |
| Osei, V | 1 |
| Boye, A | 1 |
| Hardy, M | 1 |
| Samuela, J | 1 |
| Kama, M | 1 |
| Tuicakau, M | 1 |
| Romani, L | 1 |
| Whitfeld, MJ | 1 |
| King, CL | 2 |
| Weil, GJ | 3 |
| Grobler, AC | 1 |
| Robinson, LJ | 1 |
| Kaldor, JM | 1 |
| Steer, AC | 1 |
| Nguépy Keubo, FR | 1 |
| Mboua, PC | 1 |
| Djifack Tadongfack, T | 1 |
| Fokouong Tchoffo, E | 1 |
| Tasson Tatang, C | 1 |
| Ide Zeuna, J | 1 |
| Noupoue, EM | 1 |
| Tsoplifack, CB | 1 |
| Folefack, GO | 1 |
| Kettani, M | 1 |
| Bandelier, P | 1 |
| Huo, J | 1 |
| Li, H | 4 |
| Yu, D | 1 |
| Arulsamy, N | 1 |
| AlAbbad, S | 1 |
| Sardot, T | 1 |
| Lekashvili, O | 1 |
| Decato, D | 1 |
| Lelj, F | 1 |
| Alexander Ross, JB | 1 |
| Rosenberg, E | 1 |
| Nazir, H | 1 |
| Muthuswamy, N | 1 |
| Louis, C | 1 |
| Jose, S | 1 |
| Prakash, J | 1 |
| Buan, MEM | 1 |
| Flox, C | 1 |
| Chavan, S | 1 |
| Shi, X | 1 |
| Kauranen, P | 1 |
| Kallio, T | 1 |
| Maia, G | 1 |
| Tammeveski, K | 1 |
| Lymperopoulos, N | 1 |
| Carcadea, E | 1 |
| Veziroglu, E | 1 |
| Iranzo, A | 1 |
| M Kannan, A | 1 |
| Arunamata, A | 1 |
| Tacy, TA | 1 |
| Kache, S | 1 |
| Mainwaring, RD | 1 |
| Ma, M | 1 |
| Maeda, K | 1 |
| Punn, R | 1 |
| Noguchi, S | 1 |
| Hahn, S | 3 |
| Iwasa, Y | 3 |
| Ling, J | 2 |
| Voccio, JP | 2 |
| Kim, Y | 3 |
| Song, J | 3 |
| Bascuñán, J | 2 |
| Chu, Y | 1 |
| Tomita, M | 1 |
| Cazorla, M | 1 |
| Herrera, E | 1 |
| Palomeque, E | 1 |
| Saud, N | 1 |
| Hoplock, LB | 1 |
| Lobchuk, MM | 1 |
| Lemoine, J | 1 |
| Li, X | 10 |
| Henson, MA | 1 |
| Unsihuay, D | 1 |
| Qiu, J | 1 |
| Swaroop, S | 1 |
| Nagornov, KO | 1 |
| Kozhinov, AN | 1 |
| Tsybin, YO | 1 |
| Kuang, S | 1 |
| Laskin, J | 1 |
| Zin, NNINM | 1 |
| Mohamad, MN | 1 |
| Roslan, K | 1 |
| Abdul Wafi, S | 1 |
| Abdul Moin, NI | 1 |
| Alias, A | 1 |
| Zakaria, Y | 1 |
| Abu-Bakar, N | 1 |
| Naveed, A | 1 |
| Jilani, K | 1 |
| Siddique, AB | 1 |
| Akbar, M | 1 |
| Riaz, M | 1 |
| Mushtaq, Z | 1 |
| Sikandar, M | 1 |
| Ilyas, S | 1 |
| Bibi, I | 1 |
| Asghar, A | 1 |
| Rasool, G | 1 |
| Irfan, M | 1 |
| Li, XY | 1 |
| Zhao, S | 1 |
| Fan, XH | 1 |
| Chen, KP | 1 |
| Hua, W | 1 |
| Liu, ZM | 1 |
| Xue, XD | 1 |
| Zhou, B | 1 |
| Zhang, S | 2 |
| Xing, YL | 1 |
| Chen, MA | 1 |
| Sun, Y | 1 |
| Neradilek, MB | 1 |
| Wu, XT | 1 |
| Zhang, D | 2 |
| Huang, W | 1 |
| Cui, Y | 1 |
| Yang, QQ | 1 |
| Li, HW | 1 |
| Zhao, XQ | 1 |
| Hossein Rashidi, B | 1 |
| Tarafdari, A | 1 |
| Ghazimirsaeed, ST | 1 |
| Shahrokh Tehraninezhad, E | 1 |
| Keikha, F | 1 |
| Eslami, B | 1 |
| Ghazimirsaeed, SM | 1 |
| Jafarabadi, M | 1 |
| Silvani, Y | 1 |
| Lovita, AND | 1 |
| Maharani, A | 1 |
| Wiyasa, IWA | 1 |
| Sujuti, H | 1 |
| Ratnawati, R | 1 |
| Raras, TYM | 1 |
| Lemin, AS | 1 |
| Rahman, MM | 1 |
| Pangarah, CA | 1 |
| Kiyu, A | 1 |
| Zeng, C | 2 |
| Du, H | 1 |
| Lin, D | 1 |
| Jalan, D | 1 |
| Rubagumya, F | 1 |
| Hopman, WM | 1 |
| Vanderpuye, V | 1 |
| Lopes, G | 1 |
| Seruga, B | 1 |
| Booth, CM | 1 |
| Berry, S | 1 |
| Hammad, N | 1 |
| Sajo, EA | 1 |
| Okunade, KS | 1 |
| Olorunfemi, G | 1 |
| Rabiu, KA | 1 |
| Anorlu, RI | 1 |
| Xu, C | 2 |
| Xiang, Y | 1 |
| Xu, X | 1 |
| Zhou, L | 2 |
| Dong, X | 1 |
| Tang, S | 1 |
| Gao, XC | 1 |
| Wei, CH | 1 |
| Zhang, RG | 1 |
| Cai, Q | 1 |
| He, Y | 1 |
| Tong, F | 1 |
| Dong, JH | 1 |
| Wu, G | 1 |
| Dong, XR | 1 |
| Tang, X | 1 |
| Tao, F | 1 |
| Xiang, W | 1 |
| Zhao, Y | 2 |
| Jin, L | 1 |
| Tao, H | 1 |
| Lei, Y | 1 |
| Gan, H | 1 |
| Huang, Y | 1 |
| Chen, L | 3 |
| Shan, A | 1 |
| Zhao, H | 2 |
| Wu, M | 2 |
| Ma, Q | 1 |
| Wang, J | 4 |
| Zhang, E | 1 |
| Zhang, J | 3 |
| Li, Y | 5 |
| Xue, F | 1 |
| Deng, L | 1 |
| Liu, L | 2 |
| Yan, Z | 2 |
| Wang, Y | 2 |
| Meng, J | 1 |
| Chen, G | 2 |
| Anastassiadou, M | 1 |
| Bernasconi, G | 1 |
| Brancato, A | 1 |
| Carrasco Cabrera, L | 1 |
| Greco, L | 1 |
| Jarrah, S | 1 |
| Kazocina, A | 1 |
| Leuschner, R | 1 |
| Magrans, JO | 1 |
| Miron, I | 1 |
| Nave, S | 1 |
| Pedersen, R | 1 |
| Reich, H | 1 |
| Rojas, A | 1 |
| Sacchi, A | 1 |
| Santos, M | 1 |
| Theobald, A | 1 |
| Vagenende, B | 1 |
| Verani, A | 1 |
| Du, L | 1 |
| Liu, X | 1 |
| Ren, Y | 1 |
| Li, J | 7 |
| Li, P | 1 |
| Jiao, Q | 1 |
| Meng, P | 1 |
| Wang, F | 2 |
| Wang, YS | 1 |
| Wang, C | 3 |
| Zhou, X | 2 |
| Wang, W | 1 |
| Wang, S | 2 |
| Hou, J | 1 |
| Zhang, A | 1 |
| Lv, B | 1 |
| Gao, C | 1 |
| Pang, D | 1 |
| Lu, K | 1 |
| Ahmad, NH | 1 |
| Wang, L | 1 |
| Zhu, J | 2 |
| Zhang, L | 2 |
| Zhuang, T | 1 |
| Tu, J | 1 |
| Zhao, Z | 1 |
| Qu, Y | 1 |
| Yao, H | 1 |
| Wang, X | 5 |
| Lee, DF | 1 |
| Shen, J | 3 |
| Wen, L | 1 |
| Huang, G | 2 |
| Xie, X | 1 |
| Zhao, Q | 1 |
| Hu, W | 1 |
| Zhang, Y | 4 |
| Wu, X | 1 |
| Lu, J | 2 |
| Li, M | 1 |
| Li, W | 2 |
| Wu, W | 1 |
| Du, F | 1 |
| Ji, H | 1 |
| Yang, X | 2 |
| Xu, Z | 1 |
| Wan, L | 1 |
| Wen, Q | 1 |
| Cho, CH | 1 |
| Zou, C | 1 |
| Xiao, Z | 1 |
| Liao, J | 1 |
| Su, X | 1 |
| Bi, Z | 1 |
| Su, Q | 1 |
| Huang, H | 1 |
| Wei, Y | 2 |
| Gao, Y | 2 |
| Na, KJ | 1 |
| Choi, H | 1 |
| Oh, HR | 1 |
| Kim, YH | 1 |
| Lee, SB | 1 |
| Jung, YJ | 1 |
| Koh, J | 1 |
| Park, S | 1 |
| Lee, HJ | 1 |
| Jeon, YK | 1 |
| Chung, DH | 1 |
| Paeng, JC | 1 |
| Park, IK | 1 |
| Kang, CH | 1 |
| Cheon, GJ | 1 |
| Kang, KW | 1 |
| Lee, DS | 1 |
| Kim, YT | 1 |
| Pajuelo-Lozano, N | 1 |
| Alcalá, S | 1 |
| Sainz, B | 1 |
| Perona, R | 1 |
| Sanchez-Perez, I | 1 |
| Logotheti, S | 1 |
| Marquardt, S | 1 |
| Gupta, SK | 1 |
| Richter, C | 1 |
| Edelhäuser, BAH | 1 |
| Engelmann, D | 1 |
| Brenmoehl, J | 1 |
| Söhnchen, C | 1 |
| Murr, N | 1 |
| Alpers, M | 1 |
| Singh, KP | 1 |
| Wolkenhauer, O | 1 |
| Heckl, D | 1 |
| Spitschak, A | 1 |
| Pützer, BM | 1 |
| Liao, Y | 1 |
| Cheng, J | 1 |
| Kong, X | 1 |
| Li, S | 1 |
| Zhang, M | 4 |
| Zhang, H | 1 |
| Yang, T | 2 |
| Dong, Y | 1 |
| Xu, Y | 1 |
| Yuan, Z | 1 |
| Cao, J | 1 |
| Zheng, Y | 1 |
| Luo, Z | 1 |
| Mei, Z | 1 |
| Yao, Y | 1 |
| Liang, C | 1 |
| Yang, H | 1 |
| Song, Y | 1 |
| Yu, K | 1 |
| Zhu, C | 1 |
| Huang, Z | 1 |
| Qian, J | 1 |
| Ge, J | 1 |
| Hu, J | 2 |
| Wang, H | 2 |
| Liu, Y | 4 |
| Mi, Y | 1 |
| Kong, H | 1 |
| Xi, D | 1 |
| Yan, W | 1 |
| Luo, X | 1 |
| Ning, Q | 1 |
| Chang, X | 2 |
| Zhang, T | 2 |
| Wang, Q | 2 |
| Rathore, MG | 1 |
| Reddy, K | 1 |
| Chen, H | 1 |
| Shin, SH | 1 |
| Ma, WY | 1 |
| Bode, AM | 1 |
| Dong, Z | 1 |
| Mu, W | 1 |
| Liu, C | 3 |
| Gao, F | 1 |
| Qi, Y | 1 |
| Lu, H | 1 |
| Zhang, X | 4 |
| Cai, X | 1 |
| Ji, RY | 1 |
| Hou, Y | 3 |
| Tian, J | 2 |
| Shi, Y | 1 |
| Ying, S | 1 |
| Tan, M | 1 |
| Feng, G | 1 |
| Kuang, Y | 1 |
| Chen, D | 1 |
| Wu, D | 3 |
| Zhu, ZQ | 1 |
| Tang, HX | 1 |
| Shi, ZE | 1 |
| Kang, J | 1 |
| Liu, Q | 1 |
| Qi, J | 2 |
| Mu, J | 1 |
| Cong, Z | 1 |
| Chen, S | 2 |
| Fu, D | 1 |
| Li, Z | 2 |
| Celestrin, CP | 1 |
| Rocha, GZ | 1 |
| Stein, AM | 1 |
| Guadagnini, D | 1 |
| Tadelle, RM | 1 |
| Saad, MJA | 1 |
| Oliveira, AG | 1 |
| Bianconi, V | 1 |
| Bronzo, P | 1 |
| Banach, M | 1 |
| Sahebkar, A | 1 |
| Mannarino, MR | 1 |
| Pirro, M | 1 |
| Patsourakos, NG | 1 |
| Kouvari, M | 1 |
| Kotidis, A | 1 |
| Kalantzi, KI | 1 |
| Tsoumani, ME | 1 |
| Anastasiadis, F | 1 |
| Andronikos, P | 1 |
| Aslanidou, T | 1 |
| Efraimidis, P | 1 |
| Georgiopoulos, A | 1 |
| Gerakiou, K | 1 |
| Grigoriadou-Skouta, E | 1 |
| Grigoropoulos, P | 1 |
| Hatzopoulos, D | 1 |
| Kartalis, A | 1 |
| Lyras, A | 1 |
| Markatos, G | 1 |
| Mikrogeorgiou, A | 1 |
| Myroforou, I | 1 |
| Orkopoulos, A | 1 |
| Pavlidis, P | 1 |
| Petras, C | 1 |
| Riga, M | 1 |
| Skouloudi, M | 1 |
| Smyrnioudis, N | 1 |
| Thomaidis, K | 1 |
| Tsikouri, GE | 1 |
| Tsikouris, EI | 1 |
| Zisimos, K | 1 |
| Vavoulis, P | 1 |
| Vitali, MG | 1 |
| Vitsas, G | 1 |
| Vogiatzidis, C | 1 |
| Chantanis, S | 1 |
| Fousas, S | 1 |
| Panagiotakos, DB | 1 |
| Tselepis, AD | 1 |
| Jungen, C | 1 |
| Alken, FA | 1 |
| Eickholt, C | 1 |
| Scherschel, K | 1 |
| Kuklik, P | 1 |
| Klatt, N | 1 |
| Schwarzl, J | 1 |
| Moser, J | 1 |
| Jularic, M | 1 |
| Akbulak, RO | 1 |
| Schaeffer, B | 1 |
| Willems, S | 1 |
| Meyer, C | 1 |
| Nowak, JK | 1 |
| Szczepanik, M | 1 |
| Trypuć, M | 1 |
| Pogorzelski, A | 1 |
| Bobkowski, W | 1 |
| Grytczuk, M | 1 |
| Minarowska, A | 1 |
| Wójciak, R | 1 |
| Walkowiak, J | 1 |
| Lu, Y | 1 |
| Xi, J | 1 |
| Li, C | 1 |
| Chen, W | 2 |
| Hu, X | 1 |
| Zhang, F | 1 |
| Wei, H | 1 |
| Wang, Z | 1 |
| Gurzu, S | 1 |
| Jung, I | 1 |
| Sugimura, H | 2 |
| Stefan-van Staden, RI | 1 |
| Yamada, H | 1 |
| Natsume, H | 1 |
| Iwashita, Y | 1 |
| Szodorai, R | 1 |
| Szederjesi, J | 1 |
| Yari, D | 1 |
| Ehsanbakhsh, Z | 1 |
| Validad, MH | 1 |
| Langroudi, FH | 1 |
| Esfandiari, H | 1 |
| Prager, A | 1 |
| Hassanpour, K | 1 |
| Kurup, SP | 1 |
| Mets-Halgrimson, R | 1 |
| Yoon, H | 1 |
| Zeid, JL | 1 |
| Mets, MB | 1 |
| Rahmani, B | 1 |
| Araujo-Castillo, RV | 1 |
| Culquichicón, C | 1 |
| Solis Condor, R | 1 |
| Efendi, F | 1 |
| Sebayang, SK | 1 |
| Astutik, E | 1 |
| Hadisuyatmana, S | 1 |
| Has, EMM | 1 |
| Kuswanto, H | 1 |
| Foroutan, T | 1 |
| Ahmadi, F | 1 |
| Moayer, F | 1 |
| Khalvati, S | 1 |
| Zhang, Q | 2 |
| Lyu, Y | 1 |
| Huang, J | 1 |
| Yu, N | 1 |
| Wen, Z | 1 |
| Hou, H | 1 |
| Zhao, T | 1 |
| Gupta, A | 1 |
| Khosla, N | 1 |
| Govindasamy, V | 1 |
| Saini, A | 1 |
| Annapurna, K | 1 |
| Dhakate, SR | 1 |
| Akkaya, Ö | 1 |
| Chandgude, AL | 1 |
| Dömling, A | 1 |
| Harnett, J | 1 |
| Oakes, K | 1 |
| Carè, J | 1 |
| Leach, M | 1 |
| Brown, D | 1 |
| Cramer, H | 1 |
| Pinder, TA | 1 |
| Steel, A | 1 |
| Anheyer, D | 1 |
| Cantu, J | 1 |
| Valle, J | 1 |
| Flores, K | 1 |
| Gonzalez, D | 1 |
| Valdes, C | 1 |
| Lopez, J | 1 |
| Padilla, V | 1 |
| Alcoutlabi, M | 1 |
| Parsons, J | 1 |
| Núñez, K | 1 |
| Hamed, M | 1 |
| Fort, D | 1 |
| Bruce, D | 1 |
| Thevenot, P | 1 |
| Cohen, A | 1 |
| Weber, P | 1 |
| Menezes, AMB | 1 |
| Gonçalves, H | 1 |
| Perez-Padilla, R | 1 |
| Jarvis, D | 1 |
| de Oliveira, PD | 1 |
| Wehrmeister, FC | 1 |
| Mir, S | 1 |
| Wong, J | 1 |
| Ryan, CM | 1 |
| Bellingham, G | 1 |
| Singh, M | 2 |
| Waseem, R | 1 |
| Eckert, DJ | 1 |
| Chung, F | 1 |
| Hegde, H | 1 |
| Shimpi, N | 1 |
| Panny, A | 1 |
| Glurich, I | 1 |
| Christie, P | 1 |
| Acharya, A | 1 |
| English, KL | 1 |
| Downs, M | 1 |
| Goetchius, E | 1 |
| Buxton, R | 1 |
| Ryder, JW | 1 |
| Ploutz-Snyder, R | 1 |
| Guilliams, M | 1 |
| Scott, JM | 1 |
| Ploutz-Snyder, LL | 1 |
| Martens, C | 1 |
| Goplen, FK | 1 |
| Aasen, T | 1 |
| Gjestad, R | 1 |
| Nordfalk, KF | 1 |
| Nordahl, SHG | 1 |
| Inoue, T | 1 |
| Soshi, S | 1 |
| Kubota, M | 1 |
| Marumo, K | 1 |
| Mortensen, NP | 1 |
| Caffaro, MM | 1 |
| Patel, PR | 2 |
| Uddin, MJ | 1 |
| Aravamudhan, S | 1 |
| Sumner, SJ | 1 |
| Fennell, TR | 1 |
| Gal, RL | 1 |
| Cohen, NJ | 1 |
| Kruger, D | 1 |
| Beck, RW | 1 |
| Bergenstal, RM | 1 |
| Calhoun, P | 1 |
| Cushman, T | 1 |
| Haban, A | 1 |
| Hood, K | 1 |
| Johnson, ML | 1 |
| McArthur, T | 1 |
| Olson, BA | 1 |
| Weinstock, RS | 1 |
| Oser, SM | 1 |
| Oser, TK | 1 |
| Bugielski, B | 1 |
| Strayer, H | 1 |
| Aleppo, G | 1 |
| Maruyama, H | 1 |
| Hirayama, K | 1 |
| Yamashita, M | 1 |
| Ohgi, K | 1 |
| Tsujimoto, R | 1 |
| Takayasu, M | 1 |
| Shimohata, H | 1 |
| Kobayashi, M | 1 |
| Buscagan, TM | 1 |
| Rees, DC | 1 |
| Jaborek, JR | 1 |
| Zerby, HN | 1 |
| Wick, MP | 1 |
| Fluharty, FL | 1 |
| Moeller, SJ | 1 |
| Razavi, P | 1 |
| Dickler, MN | 1 |
| Shah, PD | 1 |
| Toy, W | 1 |
| Brown, DN | 1 |
| Won, HH | 1 |
| Li, BT | 1 |
| Shen, R | 1 |
| Vasan, N | 1 |
| Modi, S | 1 |
| Jhaveri, K | 1 |
| Caravella, BA | 1 |
| Patil, S | 1 |
| Selenica, P | 1 |
| Zamora, S | 1 |
| Cowan, AM | 1 |
| Comen, E | 1 |
| Singh, A | 1 |
| Covey, A | 1 |
| Berger, MF | 1 |
| Hudis, CA | 1 |
| Norton, L | 1 |
| Nagy, RJ | 1 |
| Odegaard, JI | 1 |
| Lanman, RB | 1 |
| Solit, DB | 1 |
| Robson, ME | 1 |
| Lacouture, ME | 1 |
| Brogi, E | 1 |
| Reis-Filho, JS | 1 |
| Moynahan, ME | 1 |
| Scaltriti, M | 1 |
| Chandarlapaty, S | 1 |
| Papouskova, K | 1 |
| Moravcova, M | 1 |
| Masrati, G | 1 |
| Ben-Tal, N | 1 |
| Sychrova, H | 1 |
| Zimmermannova, O | 1 |
| Fang, J | 1 |
| Fan, Y | 1 |
| Luo, T | 2 |
| Su, H | 1 |
| Tsetseris, L | 1 |
| Anthopoulos, TD | 1 |
| Liu, SF | 1 |
| Zhao, K | 1 |
| Sacan, O | 1 |
| Turkyilmaz, IB | 1 |
| Bayrak, BB | 1 |
| Mutlu, O | 1 |
| Akev, N | 1 |
| Yanardag, R | 1 |
| Gruber, S | 1 |
| Kamnoedboon, P | 1 |
| Özcan, M | 1 |
| Srinivasan, M | 1 |
| Jo, YH | 1 |
| Oh, HK | 1 |
| Jeong, SY | 1 |
| Lee, BG | 1 |
| Zheng, J | 1 |
| Guan, H | 1 |
| Li, D | 2 |
| Tan, H | 1 |
| Maji, TK | 1 |
| J R, A | 1 |
| Mukherjee, S | 1 |
| Alexander, R | 1 |
| Mondal, A | 1 |
| Das, S | 1 |
| Sharma, RK | 1 |
| Chakraborty, NK | 1 |
| Dasgupta, K | 1 |
| Sharma, AMR | 1 |
| Hawaldar, R | 1 |
| Pandey, M | 1 |
| Naik, A | 1 |
| Majumdar, K | 1 |
| Pal, SK | 1 |
| Adarsh, KV | 1 |
| Ray, SK | 1 |
| Karmakar, D | 1 |
| Ma, Y | 2 |
| Gao, W | 1 |
| Ma, S | 1 |
| Lin, W | 1 |
| Zhou, T | 1 |
| Wu, T | 1 |
| Wu, Q | 1 |
| Ye, C | 1 |
| He, X | 1 |
| Jiang, F | 1 |
| Yuan, D | 1 |
| Chen, Q | 1 |
| Hong, M | 1 |
| Chen, K | 1 |
| Hussain, M | 1 |
| Razi, SS | 1 |
| Yildiz, EA | 1 |
| Zhao, J | 1 |
| Yaglioglu, HG | 1 |
| Donato, MD | 1 |
| Jiang, J | 1 |
| Jamil, MI | 1 |
| Zhan, X | 1 |
| Chen, F | 1 |
| Cheng, D | 1 |
| Wu, CT | 1 |
| Utsunomiya, T | 1 |
| Ichii, T | 1 |
| Fujinami, S | 1 |
| Nakajima, K | 1 |
| Sanchez, DM | 1 |
| Raucci, U | 1 |
| Ferreras, KN | 1 |
| Martínez, TJ | 1 |
| Mordi, NA | 1 |
| Mordi, IR | 1 |
| Singh, JS | 1 |
| McCrimmon, RJ | 1 |
| Struthers, AD | 1 |
| Lang, CC | 1 |
| Wang, XW | 1 |
| Yuan, LJ | 1 |
| Yang, Y | 1 |
| Chen, WF | 1 |
| Luo, R | 1 |
| Yang, K | 1 |
| Amarasiri, SS | 1 |
| Attanayake, AP | 1 |
| Arawwawala, LDAM | 1 |
| Jayatilaka, KAPW | 1 |
| Mudduwa, LKB | 1 |
| Ogunsuyi, O | 2 |
| Akanni, O | 1 |
| Alabi, O | 1 |
| Alimba, C | 1 |
| Adaramoye, O | 1 |
| Cambier, S | 1 |
| Eswara, S | 1 |
| Gutleb, AC | 1 |
| Bakare, A | 1 |
| Gu, Z | 1 |
| Cong, J | 1 |
| Pellegrini, M | 1 |
| Palmieri, S | 1 |
| Ricci, A | 1 |
| Serio, A | 1 |
| Paparella, A | 1 |
| Lo Sterzo, C | 1 |
| Jadeja, SD | 1 |
| Vaishnav, J | 1 |
| Mansuri, MS | 1 |
| Shah, C | 1 |
| Mayatra, JM | 1 |
| Shah, A | 1 |
| Begum, R | 1 |
| Song, H | 2 |
| Lian, Y | 1 |
| Wan, T | 1 |
| Schultz-Lebahn, A | 1 |
| Skipper, MT | 1 |
| Hvas, AM | 1 |
| Larsen, OH | 1 |
| Hijazi, Z | 1 |
| Granger, CB | 1 |
| Hohnloser, SH | 1 |
| Westerbergh, J | 1 |
| Lindbäck, J | 1 |
| Alexander, JH | 1 |
| Keltai, M | 1 |
| Parkhomenko, A | 1 |
| López-Sendón, JL | 1 |
| Lopes, RD | 1 |
| Siegbahn, A | 1 |
| Wallentin, L | 1 |
| El-Tarabany, MS | 1 |
| Saleh, AA | 1 |
| El-Araby, IE | 1 |
| El-Magd, MA | 1 |
| van Ginkel, MPH | 1 |
| Schijven, MP | 1 |
| van Grevenstein, WMU | 1 |
| Schreuder, HWR | 1 |
| Pereira, EDM | 1 |
| da Silva, J | 1 |
| Carvalho, PDS | 1 |
| Grivicich, I | 1 |
| Picada, JN | 1 |
| Salgado Júnior, IB | 1 |
| Vasques, GJ | 1 |
| Pereira, MADS | 1 |
| Reginatto, FH | 1 |
| Ferraz, ABF | 1 |
| Vasilenko, EA | 1 |
| Gorshkova, EN | 1 |
| Astrakhantseva, IV | 1 |
| Drutskaya, MS | 1 |
| Tillib, SV | 1 |
| Nedospasov, SA | 1 |
| Mokhonov, VV | 1 |
| Nam, YW | 1 |
| Cui, M | 1 |
| Orfali, R | 1 |
| Viegas, A | 1 |
| Nguyen, M | 1 |
| Mohammed, EHM | 1 |
| Zoghebi, KA | 1 |
| Rahighi, S | 1 |
| Parang, K | 1 |
| Patterson, KC | 1 |
| Kahanovitch, U | 1 |
| Gonçalves, CM | 1 |
| Hablitz, JJ | 1 |
| Staruschenko, A | 1 |
| Mulkey, DK | 1 |
| Olsen, ML | 1 |
| Gu, L | 1 |
| Cao, X | 1 |
| Mukhtar, A | 1 |
| Wu, K | 1 |
| Zhang, YY | 1 |
| Zhu, Y | 1 |
| Lu, DZ | 1 |
| Dong, W | 1 |
| Bi, WJ | 1 |
| Feng, XJ | 1 |
| Wen, LM | 1 |
| Sun, H | 1 |
| Qi, MC | 1 |
| Chang, CC | 1 |
| Dinh, TK | 1 |
| Lee, YA | 1 |
| Wang, FN | 1 |
| Sung, YC | 1 |
| Yu, PL | 1 |
| Chiu, SC | 1 |
| Shih, YC | 1 |
| Wu, CY | 1 |
| Huang, YD | 1 |
| Lu, TT | 1 |
| Wan, D | 1 |
| Sakizadeh, J | 1 |
| Cline, JP | 1 |
| Snyder, MA | 1 |
| Kiely, CJ | 1 |
| McIntosh, S | 1 |
| Jiang, X | 1 |
| Cao, JW | 1 |
| Zhao, CK | 1 |
| Yang, R | 1 |
| Zhang, QY | 1 |
| Chen, KJ | 2 |
| Liu, H | 1 |
| He, Z | 1 |
| Chen, B | 1 |
| Wu, J | 1 |
| Du, X | 1 |
| Moore, J | 1 |
| Blank, BR | 1 |
| Eksterowicz, J | 1 |
| Sutimantanapi, D | 1 |
| Yuen, N | 1 |
| Metzger, T | 1 |
| Chan, B | 1 |
| Huang, T | 1 |
| Chen, X | 1 |
| Duong, F | 1 |
| Kong, W | 1 |
| Chang, JH | 1 |
| Sun, J | 1 |
| Zavorotinskaya, T | 1 |
| Ye, Q | 1 |
| Junttila, MR | 1 |
| Ndubaku, C | 1 |
| Friedman, LS | 1 |
| Fantin, VR | 1 |
| Sun, D | 1 |
| Fei, P | 1 |
| Xie, Q | 1 |
| Jiang, Y | 1 |
| Feng, H | 1 |
| Chang, Y | 1 |
| Kang, H | 1 |
| Xing, M | 1 |
| Chen, J | 1 |
| Shao, Z | 1 |
| Yuan, C | 1 |
| Wu, Y | 1 |
| Allan, R | 1 |
| Canham, K | 1 |
| Wallace, R | 1 |
| Singh, D | 1 |
| Ward, J | 1 |
| Cooper, A | 1 |
| Newcomb, C | 1 |
| Nammour, S | 1 |
| El Mobadder, M | 1 |
| Maalouf, E | 1 |
| Namour, M | 1 |
| Namour, A | 1 |
| Rey, G | 1 |
| Matamba, P | 1 |
| Matys, J | 1 |
| Zeinoun, T | 1 |
| Grzech-Leśniak, K | 1 |
| Segabinazi Peserico, C | 1 |
| Garozi, L | 1 |
| Zagatto, AM | 1 |
| Machado, FA | 1 |
| Hirth, JM | 1 |
| Dinehart, EE | 1 |
| Lin, YL | 1 |
| Kuo, YF | 1 |
| Nouri, SS | 1 |
| Ritchie, C | 1 |
| Volow, A | 1 |
| Li, B | 2 |
| McSpadden, S | 1 |
| Dearman, K | 1 |
| Kotwal, A | 1 |
| Sudore, RL | 1 |
| Ward, L | 1 |
| Thakur, A | 1 |
| Kondadasula, SV | 1 |
| Ji, K | 1 |
| Schalk, DL | 1 |
| Bliemeister, E | 1 |
| Ung, J | 1 |
| Aboukameel, A | 1 |
| Casarez, E | 1 |
| Sloane, BF | 1 |
| Lum, LG | 1 |
| Xiao, M | 1 |
| Feng, X | 1 |
| Gao, R | 1 |
| Du, B | 1 |
| Brooks, T | 1 |
| Zwirner, J | 1 |
| Hammer, N | 1 |
| Ondruschka, B | 1 |
| Jermy, M | 1 |
| Luengo, A | 1 |
| Marzo, I | 1 |
| Reback, M | 1 |
| Daubit, IM | 1 |
| Fernández-Moreira, V | 1 |
| Metzler-Nolte, N | 1 |
| Gimeno, MC | 1 |
| Tonchev, I | 1 |
| Heberman, D | 1 |
| Peretz, A | 1 |
| Medvedovsky, AT | 1 |
| Gotsman, I | 1 |
| Rashi, Y | 1 |
| Poles, L | 1 |
| Goland, S | 1 |
| Perlman, GY | 1 |
| Danenberg, HD | 1 |
| Beeri, R | 1 |
| Shuvy, M | 1 |
| Fu, Q | 1 |
| Yang, D | 1 |
| Sarapulova, A | 1 |
| Pang, Q | 1 |
| Meng, Y | 1 |
| Wei, L | 1 |
| Ehrenberg, H | 1 |
| Kim, CC | 1 |
| Jeong, SH | 1 |
| Oh, KH | 1 |
| Nam, KT | 1 |
| Sun, JY | 1 |
| Ning, J | 1 |
| Duan, Z | 1 |
| Kershaw, SV | 1 |
| Rogach, AL | 1 |
| Gao, Z | 1 |
| Wang, T | 1 |
| Li, Q | 1 |
| Cao, T | 1 |
| Guo, L | 1 |
| Fu, Y | 1 |
| Seeger, ZL | 1 |
| Izgorodina, EI | 1 |
| Hue, S | 1 |
| Beldi-Ferchiou, A | 1 |
| Bendib, I | 1 |
| Surenaud, M | 1 |
| Fourati, S | 1 |
| Frapard, T | 1 |
| Rivoal, S | 1 |
| Razazi, K | 1 |
| Carteaux, G | 1 |
| Delfau-Larue, MH | 1 |
| Mekontso-Dessap, A | 1 |
| Audureau, E | 1 |
| de Prost, N | 1 |
| Gao, SS | 1 |
| Duangthip, D | 1 |
| Lo, ECM | 1 |
| Chu, CH | 1 |
| Roberts, W | 1 |
| Rosenheck, RA | 1 |
| Miyake, T | 1 |
| Kimoto, E | 1 |
| Luo, L | 1 |
| Mathialagan, S | 1 |
| Horlbogen, LM | 1 |
| Ramanathan, R | 1 |
| Wood, LS | 1 |
| Johnson, JG | 1 |
| Le, VH | 1 |
| Vourvahis, M | 1 |
| Rodrigues, AD | 1 |
| Muto, C | 1 |
| Furihata, K | 1 |
| Sugiyama, Y | 1 |
| Kusuhara, H | 1 |
| Gong, Q | 1 |
| Song, W | 1 |
| Sun, B | 1 |
| Cao, P | 1 |
| Gu, S | 1 |
| Sun, X | 1 |
| Zhou, G | 1 |
| Toma, C | 1 |
| Khandhar, S | 1 |
| Zalewski, AM | 1 |
| D'Auria, SJ | 1 |
| Tu, TM | 1 |
| Jaber, WA | 1 |
| Cho, J | 2 |
| Suwandaratne, NS | 1 |
| Razek, S | 1 |
| Choi, YH | 1 |
| Piper, LFJ | 1 |
| Watson, DF | 1 |
| Banerjee, S | 1 |
| Xie, S | 1 |
| Lindsay, AP | 1 |
| Bates, FS | 1 |
| Lodge, TP | 1 |
| Hao, Y | 1 |
| Chapovetsky, A | 1 |
| Liu, JJ | 1 |
| Welborn, M | 1 |
| Luna, JM | 1 |
| Do, T | 1 |
| Haiges, R | 1 |
| Miller Iii, TF | 1 |
| Marinescu, SC | 1 |
| Lopez, SA | 1 |
| Compter, I | 1 |
| Eekers, DBP | 1 |
| Hoeben, A | 1 |
| Rouschop, KMA | 1 |
| Reymen, B | 1 |
| Ackermans, L | 1 |
| Beckervordersantforth, J | 1 |
| Bauer, NJC | 1 |
| Anten, MM | 1 |
| Wesseling, P | 1 |
| Postma, AA | 1 |
| De Ruysscher, D | 1 |
| Lambin, P | 1 |
| Qiang, L | 1 |
| Yang, S | 1 |
| Cui, YH | 1 |
| He, YY | 1 |
| Kumar, SK | 1 |
| Jacobus, SJ | 1 |
| Cohen, AD | 1 |
| Weiss, M | 1 |
| Callander, N | 1 |
| Singh, AK | 1 |
| Parker, TL | 1 |
| Menter, A | 1 |
| Parsons, B | 1 |
| Kumar, P | 1 |
| Kapoor, P | 1 |
| Rosenberg, A | 1 |
| Zonder, JA | 1 |
| Faber, E | 1 |
| Lonial, S | 1 |
| Anderson, KC | 1 |
| Richardson, PG | 1 |
| Orlowski, RZ | 1 |
| Wagner, LI | 1 |
| Rajkumar, SV | 1 |
| Li, G | 1 |
| Hou, G | 1 |
| Cui, J | 1 |
| Xie, H | 1 |
| Sun, Z | 1 |
| Fang, Z | 1 |
| Dunstand-Guzmán, E | 1 |
| Hallal-Calleros, C | 1 |
| Hernández-Velázquez, VM | 1 |
| Canales-Vargas, EJ | 1 |
| Domínguez-Roldan, R | 1 |
| Pedernera, M | 1 |
| Peña-Chora, G | 1 |
| Flores-Pérez, I | 1 |
| Kim, MJ | 1 |
| Han, C | 1 |
| White, K | 1 |
| Park, HJ | 1 |
| Boyd, K | 1 |
| Rothenberger, C | 1 |
| Bose, U | 1 |
| Carmichael, P | 1 |
| Linser, PJ | 1 |
| Tanokura, M | 1 |
| Salvi, R | 1 |
| Someya, S | 1 |
| Samuni, A | 1 |
| Goldstein, S | 1 |
| Divya, KP | 1 |
| Dharuman, V | 1 |
| Feng, J | 2 |
| Qian, Y | 1 |
| Cheng, Q | 1 |
| Ma, H | 1 |
| Ren, X | 1 |
| Wei, Q | 1 |
| Pan, W | 1 |
| Guo, J | 1 |
| Situ, B | 1 |
| An, T | 1 |
| Zheng, L | 1 |
| Augusto, S | 1 |
| Ratola, N | 1 |
| Tarín-Carrasco, P | 1 |
| Jiménez-Guerrero, P | 1 |
| Turco, M | 1 |
| Schuhmacher, M | 1 |
| Costa, S | 1 |
| Teixeira, JP | 1 |
| Costa, C | 1 |
| Syed, A | 1 |
| Marraiki, N | 1 |
| Al-Rashed, S | 1 |
| Elgorban, AM | 1 |
| Yassin, MT | 1 |
| Chankhanittha, T | 1 |
| Nanan, S | 1 |
| Sorokina, KN | 1 |
| Samoylova, YV | 1 |
| Gromov, NV | 1 |
| Ogorodnikova, OL | 1 |
| Parmon, VN | 1 |
| Ye, J | 1 |
| Liao, W | 1 |
| Zhang, P | 1 |
| Nabi, M | 1 |
| Cai, Y | 1 |
| Li, F | 1 |
| Alsbou, EM | 1 |
| Omari, KW | 1 |
| Adeosun, WA | 1 |
| Asiri, AM | 1 |
| Marwani, HM | 1 |
| Barral, M | 1 |
| Jemal-Turki, A | 1 |
| Beuvon, F | 1 |
| Soyer, P | 1 |
| Camparo, P | 1 |
| Cornud, F | 1 |
| Atwater, BD | 1 |
| Jones, WS | 1 |
| Loring, Z | 1 |
| Friedman, DJ | 1 |
| Namburath, M | 1 |
| Papirio, S | 1 |
| Moscariello, C | 1 |
| Di Costanzo, N | 1 |
| Pirozzi, F | 1 |
| Alappat, BJ | 1 |
| Sreekrishnan, TR | 1 |
| Volpin, F | 1 |
| Woo, YC | 1 |
| Kim, H | 1 |
| Freguia, S | 1 |
| Jeong, N | 1 |
| Choi, JS | 1 |
| Phuntsho, S | 1 |
| Shon, HK | 1 |
| Domínguez-Zambrano, E | 1 |
| Pedraza-Chaverri, J | 1 |
| López-Santos, AL | 1 |
| Medina-Campos, ON | 1 |
| Cruz-Rivera, C | 1 |
| Bueno-Hernández, F | 1 |
| Espinosa-Cuevas, A | 1 |
| Bulavaitė, A | 1 |
| Dalgediene, I | 1 |
| Michailoviene, V | 1 |
| Pleckaityte, M | 1 |
| Sauerbier, P | 1 |
| Köhler, R | 1 |
| Renner, G | 1 |
| Militz, H | 1 |
| Jambulingam, P | 1 |
| Kuttiatt, VS | 1 |
| Krishnamoorthy, K | 1 |
| Subramanian, S | 1 |
| Srividya, A | 1 |
| Raju, HKK | 1 |
| Rahi, M | 1 |
| Somani, RK | 1 |
| Suryaprakash, MK | 1 |
| Dwivedi, GP | 1 |
| Gyorkos, TW | 1 |
| St-Denis, K | 1 |
| Coulibaly, YI | 1 |
| Dicko, I | 1 |
| Keita, M | 1 |
| Keita, MM | 1 |
| Doumbia, M | 1 |
| Daou, A | 1 |
| Haidara, FC | 1 |
| Sankare, MH | 1 |
| Horton, J | 1 |
| Whately-Smith, C | 1 |
| Sow, SO | 1 |
| Garcia, HH | 1 |
| Gonzales, I | 1 |
| Lescano, AG | 1 |
| Bustos, JA | 1 |
| Zimic, M | 1 |
| Escalante, D | 1 |
| Saavedra, H | 1 |
| Gavidia, M | 1 |
| Rodriguez, L | 1 |
| Najar, E | 1 |
| Umeres, H | 1 |
| Pretell, EJ | 1 |
| Speich, B | 2 |
| Ali, SM | 2 |
| Ame, SM | 2 |
| Bogoch, II | 1 |
| Alles, R | 2 |
| Huwyler, J | 1 |
| Albonico, M | 2 |
| Hattendorf, J | 2 |
| Utzinger, J | 2 |
| Keiser, J | 2 |
| Thomsen, EK | 1 |
| Sanuku, N | 1 |
| Baea, M | 1 |
| Satofan, S | 1 |
| Maki, E | 1 |
| Lombore, B | 1 |
| Schmidt, MS | 1 |
| Siba, PM | 1 |
| Kazura, JW | 1 |
| Fleckenstein, LL | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| AZIVAL 2: A Double-blind Cluster-randomized Placebo-controlled Study on the Safety of Integrated Treatment of Trachoma and Lymphatic Filariasis in Children and Adults With Azithromycin, Ivermectin and Albendazole[NCT01903057] | Phase 4 | 0 participants (Actual) | Interventional | 2014-02-28 | Withdrawn (stopped due to As of November 2013, the security situation in rural Northern Mozambique is no longer suitable for this clinical trial.) | ||
| A Pharmacovigilance Study on the Safety of Integrated Treatment of Trachoma and Lymphatic Filariasis in Children and Adults Living in the Sikasso Region of Mali[NCT01586169] | 3,000 participants (Actual) | Interventional | 2010-02-28 | Completed | |||
| Clinical, Laboratory and Imaging Features, Treatment Trends and Long Term Outcomes in Patients With Parenchymal and Extraparenchymal Neurocysticercosis-A Registry Based Study[NCT04706819] | 1,000 participants (Anticipated) | Observational [Patient Registry] | 2021-01-15 | Not yet recruiting | |||
| Antiparasitic Therapy for Neurocysticercosis: Phase II/III Study on Safety and Efficacy of Combined Treatment With Praziquantel and Albendazole[NCT00441285] | Phase 2/Phase 3 | 156 participants (Actual) | Interventional | 2010-01-31 | Completed | ||
| Safety and Efficacy of Combination Therapy With Ivermectin, Diethylcarbamazine, and Albendazole (IDA) for Individuals With Onchocerciasis[NCT04188301] | Phase 2 | 154 participants (Actual) | Interventional | 2019-12-06 | Completed | ||
| Evaluate Triple-Drug Therapy With Diethylcarbamize (DEC), Albendazole (ALB) and Ivermectin (IVM) That Could Accelerate LF Elimination Outside of Africa[NCT01975441] | Phase 2 | 182 participants (Actual) | Interventional | 2014-05-31 | Completed | ||
| Community Based Safety Study of 2-drug (Diethylcarbamazine and Albendazole) Versus 3-drug (Ivermectin, Diethylcarbamazine and Albendazole) Therapy for Lymphatic Filariasis[NCT02899936] | 23,789 participants (Actual) | Interventional | 2016-07-31 | Completed | |||
| Safety and Efficacy of Novel Combination Regimens for Treatment of Onchocerciasis[NCT06070116] | Phase 2 | 300 participants (Anticipated) | Interventional | 2024-01-15 | Not yet recruiting | ||
| Microfilarial Clearance From the Eye and Ocular Changes Associated With Ivermectin Treatment in Individuals With Onchocerciasis[NCT03517462] | 231 participants (Actual) | Interventional | 2018-08-06 | Completed | |||
| A Clinical Trial to Assess the Safety and Efficacy of Moxidectin Combination Treatments vs. Ivermectin Combination Treatments for Bancroftian Filariasis[NCT04410406] | Phase 3 | 164 participants (Actual) | Interventional | 2020-08-20 | Active, not recruiting | ||
| Community Studies to Monitor the Impact of Triple Drug Therapy Relative to Double Drug Therapy on Lymphatic Filariasis Infection Indicators[NCT03352206] | 20,092 participants (Actual) | Observational | 2017-10-18 | Completed | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
Proportion of patients whose 6 month MR does not show viable parasites anymore (NCT00441285)
Timeframe: Day 180
| Intervention | participants (Number) |
|---|---|
| Phase III Trial - ABZ+PZQ | 25 |
| Phase III Trial - Increased ABZ | 19 |
| Phase III Trial - Standard ABZ | 15 |
- To evaluate kinetic disposition of Albendazole we calculated the Area under the curve of the active metabolite of Albendazole (Albendazole Sulphoxide) with Praziquantel or Placebo (of Praziquantel). (NCT00441285)
Timeframe: 0.5, 1, 1.5, 2, 3, 4, 8, 10, 12, 24 and 36 hours post dose on Treatment days 10-11
| Intervention | ng*h/ml (Mean) |
|---|---|
| Albendazole + Praziquantel | 4925.3 |
| Albendazole + Placebo | 2969.6 |
- To evaluate kinetic disposition of Albendazole we calculated the Area under the curve of the active metabolite of Albendazole (Albendazole Sulphoxide) with Praziquantel or Placebo (of Praziquantel). (NCT00441285)
Timeframe: 0, 0.5, 1, 1.5, 2, 3, 4, 8, 10 and 12 hours post dose on Treatment day 1
| Intervention | ng*h/mL (Mean) |
|---|---|
| Albendazole + Praziquantel | 1412.2 |
| Albendazole + Placebo | 1111 |
- To evaluate the kinetic disposition of Praziquantel by antiepileptic drug after the last praziquantel dose, we calculated the Area Under the Curve of Praziquantel with Carbamazepine or Phenytoin (NCT00441285)
Timeframe: 0.5, 1, 1.5, 2, 3, 4, 8, 10, 12, 24 and 36 hours post dose on treatment days 10-11
| Intervention | ng*h/ml (Mean) |
|---|---|
| Carbamazepine | 240.2 |
| Phenytoin | 550.1 |
Highest serum level of Albendazole measured from all level assessments in the curve. (NCT00441285)
Timeframe: Treatment day 1 and Treatment days 10-11
| Intervention | ng/mL (Mean) |
|---|---|
| Albendazole + Praziquantel | 1293.9 |
| Albendazole + Placebo | 2232.8 |
- Describe if some Serious Adverse Event was associated to combined Albendazole plus Praziquantel therapy. (NCT00441285)
Timeframe: 90 days post tx
| Intervention | Events (Number) |
|---|---|
| Albendazole + Praziquantel | 0 |
| Albendazole + Placebo | 0 |
- To evaluate the kinetic disposition of Praziquantel by antiepileptic drug after the last praziquantel dose, we calculated the Area Under the Curve of Praziquantel with Carbamazepine or Phenytoin (NCT00441285)
Timeframe: 0, 0.5, 1, 1.5, 2, 3, 4, 8, 10 and 12 hours post dose in treatment day 1
| Intervention | ng*h / mL (Mean) | |
|---|---|---|
| Carbamazepine (n=8) | Phenytoin (n=8) | |
| Albendazole + Praziquantel | 548.3 | 923.7 |
The effectiveness of three treatment regimens for killing adult female O. volvulus worms based on the percentage of all adult female worms in nodules that are alive 18 months after treatment. (NCT04188301)
Timeframe: 18 months following treatment
| Intervention | Female worms in nodule (Count of Units) |
|---|---|
| IVM + ALB | 127 |
| IDA x 1 Dose | 142 |
| IDA x 3 Doses | 159 |
The effect of three treatment regimens for killing adult female O. volvulus worms will be compared based on the percentage of all adult female worms in nodules that are alive with embryos in the uterus 18 months after treatment. (NCT04188301)
Timeframe: 18 months following treatment.
| Intervention | Female worms in nodules (Count of Units) |
|---|---|
| IVM + ALB | 127 |
| IDA x 1 Dose | 142 |
| IDA x 3 Doses | 159 |
The effect of three treatment regimens for sterilizing adult female O. volvulus worms will be compared based on the percentage of all adult female worms that are fertile in the nodules 18 months after treatment. (NCT04188301)
Timeframe: 18 months following treatment.
| Intervention | Female worms with intact uterus (Count of Units) |
|---|---|
| IVM + ALB | 41 |
| IDA x 1 Dose | 40 |
| IDA x 3 Doses | 34 |
Rates of ocular adverse events of any grade within 3 months will be compared by treatment group. (NCT04188301)
Timeframe: within 3 months of treatment with IDA
| Intervention | Participants (Count of Participants) |
|---|---|
| IVM + ALB | 4 |
| IDA x 1 Dose | 4 |
| IDA x 3 Doses | 3 |
Rates of adverse events grade 3 or higher that occur within 7 days of treatment in the subset of participants who have intraocular microfilariae just prior to treatment with IDA will be compared by treatment group. (NCT04188301)
Timeframe: within 7 days following end of treatment
| Intervention | Participants (Count of Participants) |
|---|---|
| IVM + ALB | 0 |
| IDA x 1 Dose | 0 |
| IDA x 3 Doses | 0 |
Rates of severe adverse events (grade 3 or higher) following 1-day or 3-day triple drug treatment will be compared against those of the comparator regimen of 1 day of IVM/ALB. (NCT04188301)
Timeframe: Within 7 days following end of treatment
| Intervention | Participants (Count of Participants) |
|---|---|
| IVM + ALB | 0 |
| IDA x 1 Dose | 0 |
| IDA x 3 Doses | 0 |
The effectiveness of three treatment regimens for preventing reappearance of microfilariae in the skin as determined by skin snips at 12 and 18 months after treatment will be compared by treatment arm. Measured by the presence of microfilariae in skin snips. (NCT04188301)
Timeframe: Baseline, 12 months, and 18 months following treatment
| Intervention | Count of microfilarae+ participants (Number) | ||
|---|---|---|---|
| Baseline | Month 12 | Month 18 | |
| IDA x 1 Dose | 6 | 21 | 15 |
| IDA x 3 Doses | 0 | 21 | 17 |
| IVM + ALB | 7 | 23 | 20 |
The effectiveness of three treatment regimens for complete clearance of microfilariae from the skin as determined by skin snips at 3, 12, and 18 months after treatment with IDA will be compared by treatment arm. (NCT04188301)
Timeframe: Baseline, 3 months, 12 months, & 18 months following treatment.
| Intervention | Count of Skin Microfilaria (Geometric Mean) | |||
|---|---|---|---|---|
| Baseline | Month 3 | Month 12 | Month 18 | |
| IDA x 1 Dose | 1.7 | 3 | 2.5 | 9.0 |
| IDA x 3 Doses | NA | 2.1 | 4.7 | 8.6 |
| IVM + ALB | 3.1 | 1.9 | 4.9 | 7.0 |
2 reviews available for albendazole and Adverse Drug Event
| Article | Year |
|---|---|
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
Systematic review of exposure to albendazole or mebendazole during pregnancy and effects on maternal and child outcomes, with particular reference to exposure in the first trimester.
Topics: Albendazole; Anthelmintics; Drug-Related Side Effects and Adverse Reactions; Female; Humans; Mebenda | 2019 |
8 trials available for albendazole and Adverse Drug Event
| Article | Year |
|---|---|
The safety of combined triple drug therapy with ivermectin, diethylcarbamazine and albendazole in the neglected tropical diseases co-endemic setting of Fiji: A cluster randomised trial.
Topics: Adolescent; Adult; Aged; Aged, 80 and over; Albendazole; Antiparasitic Agents; Child; Child, Prescho | 2020 |
Psychological distress among health care professionals of the three COVID-19 most affected Regions in Cameroon: Prevalence and associated factors.
Topics: 3' Untranslated Regions; 5'-Nucleotidase; A549 Cells; Accidental Falls; Acetylcholinesterase; Acryli | 2021 |
An open label, block randomized, community study of the safety and efficacy of co-administered ivermectin, diethylcarbamazine plus albendazole vs. diethylcarbamazine plus albendazole for lymphatic filariasis in India.
Topics: Adolescent; Adult; Albendazole; Animals; Child; Diethylcarbamazine; Drug-Related Side Effects and Ad | 2021 |
A cluster randomized study of the safety of integrated treatment of trachoma and lymphatic filariasis in children and adults in Sikasso, Mali.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Anti-Bacterial Agents; Azithromycin; Chemopreve | 2013 |
A cluster randomized study of the safety of integrated treatment of trachoma and lymphatic filariasis in children and adults in Sikasso, Mali.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Anti-Bacterial Agents; Azithromycin; Chemopreve | 2013 |
A cluster randomized study of the safety of integrated treatment of trachoma and lymphatic filariasis in children and adults in Sikasso, Mali.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Anti-Bacterial Agents; Azithromycin; Chemopreve | 2013 |
A cluster randomized study of the safety of integrated treatment of trachoma and lymphatic filariasis in children and adults in Sikasso, Mali.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Anti-Bacterial Agents; Azithromycin; Chemopreve | 2013 |
Efficacy of combined antiparasitic therapy with praziquantel and albendazole for neurocysticercosis: a double-blind, randomised controlled trial.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Double-Blind Method; Drug-Related Side Effects | 2014 |
Efficacy of combined antiparasitic therapy with praziquantel and albendazole for neurocysticercosis: a double-blind, randomised controlled trial.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Double-Blind Method; Drug-Related Side Effects | 2014 |
Efficacy of combined antiparasitic therapy with praziquantel and albendazole for neurocysticercosis: a double-blind, randomised controlled trial.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Double-Blind Method; Drug-Related Side Effects | 2014 |
Efficacy of combined antiparasitic therapy with praziquantel and albendazole for neurocysticercosis: a double-blind, randomised controlled trial.
Topics: Adolescent; Adult; Aged; Albendazole; Anthelmintics; Double-Blind Method; Drug-Related Side Effects | 2014 |
Efficacy and safety of albendazole plus ivermectin, albendazole plus mebendazole, albendazole plus oxantel pamoate, and mebendazole alone against Trichuris trichiura and concomitant soil-transmitted helminth infections: a four-arm, randomised controlled t
Topics: Administration, Oral; Adolescent; Albendazole; Animals; Anthelmintics; Child; Drug Therapy, Combinat | 2015 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy, Safety, and Pharmacokinetics of Coadministered Diethylcarbamazine, Albendazole, and Ivermectin for Treatment of Bancroftian Filariasis.
Topics: Adult; Albendazole; Animals; Diethylcarbamazine; Drug-Related Side Effects and Adverse Reactions; El | 2016 |
Efficacy and safety of nitazoxanide, albendazole, and nitazoxanide-albendazole against Trichuris trichiura infection: a randomized controlled trial.
Topics: Administration, Oral; Adolescent; Albendazole; Animals; Anthelmintics; Child; Double-Blind Method; D | 2012 |
3 other studies available for albendazole and Adverse Drug Event
| Article | Year |
|---|---|
Translating clinical findings into knowledge in drug safety evaluation--drug induced liver injury prediction system (DILIps).
Topics: Animals; Anti-Infective Agents; Anti-Inflammatory Agents; Chemical and Drug Induced Liver Injury; Da | 2011 |
A multifactorial approach to hepatobiliary transporter assessment enables improved therapeutic compound development.
Topics: Animals; ATP Binding Cassette Transporter, Subfamily B; ATP Binding Cassette Transporter, Subfamily | 2013 |
Adverse drug effects among students following mass de-worming exercise involving administration of Praziquantel and Albendazole in KEEA Municipality, Ghana.
Topics: Albendazole; Drug-Related Side Effects and Adverse Reactions; Elephantiasis, Filarial; Female; Ghana | 2022 |