alanine has been researched along with Inflammation in 66 studies
Alanine: A non-essential amino acid that occurs in high levels in its free state in plasma. It is produced from pyruvate by transamination. It is involved in sugar and acid metabolism, increases IMMUNITY, and provides energy for muscle tissue, BRAIN, and the CENTRAL NERVOUS SYSTEM.
alanine : An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2.
Inflammation: A pathological process characterized by injury or destruction of tissues caused by a variety of cytologic and chemical reactions. It is usually manifested by typical signs of pain, heat, redness, swelling, and loss of function.
| Excerpt | Relevance | Reference |
|---|---|---|
| "Enzymatic analysis of aspartate/alanine aminotransferase (AST/ALT) does not exactly represent the progression of liver fibrosis or inflammation." | 7.96 | Immunological measurement of aspartate/alanine aminotransferase in predicting liver fibrosis and inflammation. ( Baik, GH; Bang, CS; Choi, EY; Ham, YL; Kim, DJ; Kim, HJ; Kim, SY; Shin, SP; Suk, KT; Yang, YJ, 2020) |
| " In fact, two of the actually used drugs against SARS-CoV2, such as chloroquine and the combination lopinavir/ritonavir, might determine a QT (the time from the start of the Q wave to the end of the T wave) interval prolongation and they show several interactions with antiarrhythmic drugs and antipsychotic medications, making them prone to an increased risk of developing arrhythmias." | 5.12 | COVID-19 and the burning issue of drug interaction: never forget the ECG. ( Cameli, M; Cameli, P; Franchi, F; Mandoli, GE; Menci, D; Mondillo, S; Sciaccaluga, C; Sisti, N; Valente, S, 2021) |
| "Enzymatic analysis of aspartate/alanine aminotransferase (AST/ALT) does not exactly represent the progression of liver fibrosis or inflammation." | 3.96 | Immunological measurement of aspartate/alanine aminotransferase in predicting liver fibrosis and inflammation. ( Baik, GH; Bang, CS; Choi, EY; Ham, YL; Kim, DJ; Kim, HJ; Kim, SY; Shin, SP; Suk, KT; Yang, YJ, 2020) |
| "We evaluated the effects of chronic oral supplementation with l-glutamine and l-alanine in their free form or as the dipeptide l-alanyl-l-glutamine (DIP) on muscle damage, inflammation and cytoprotection, in rats submitted to progressive resistance exercise (RE)." | 3.83 | Determination of the anti-inflammatory and cytoprotective effects of l-glutamine and l-alanine, or dipeptide, supplementation in rats submitted to resistance exercise. ( Coqueiro, AY; Cruzat, VF; Hypólito, TM; Leite, JS; Newsholme, P; Raizel, R; Tirapegui, J, 2016) |
| " In rats with hindpaw inflammation, inhibitors of aminopeptidase N (APN; bestatin) or neutral endopeptidase (NEP; thiorphan), and a dual inhibitor, NH(2)-CH-Ph-P(O)(OH)CH(2)-CH-CH(2)Ph(p-Ph)-CONH-CH-CH(3)-COOH (P8B), were applied to injured paws." | 3.78 | Pain inhibition by blocking leukocytic and neuronal opioid peptidases in peripheral inflamed tissue. ( Fournie-Zaluski, MC; Gore, C; Labuz, D; Machelska, H; Roques, BP; Schreiter, A; Stein, C, 2012) |
| "Chronic inflammation affecting the lesser curvature of the corpus was significantly improved in the rebamipide group compared to in the untreated group (1." | 2.80 | Rebamipide improves chronic inflammation in the lesser curvature of the corpus after Helicobacter pylori eradication: a multicenter study. ( Akiyama, T; Haruma, K; Hata, J; Inoue, K; Ito, M; Kamada, T; Manabe, N; Matsumoto, H; Murao, T; Sato, M; Shiotani, A; Tanaka, S; Tokutomi, T; Watanabe, T, 2015) |
| "This study yielded a very safe S." | 1.91 | A highly-safe live auxotrophic vaccine protecting against disease caused by non-typhoidal Salmonella Typhimurium in mice. ( Bou, G; Fuentes-Valverde, V; García, P; Herrera-León, S; Moscoso, M; Rodicio, MR, 2023) |
| " The author here is proposing to test 5-FU in combination with a number of deoxynucleosides on animal models infected with this Covid-19." | 1.56 | 5-Fluorouracil in combination with deoxyribonucleosides and deoxyribose as possible therapeutic options for the Coronavirus, COVID-19 infection. ( Ahmad, SI, 2020) |
| "To determine the mucinogenic effect of dry eye (DE) treatment drugs currently in use, we compared the levels of mucin production and inflammatory cytokine expression on the ocular surfaces using a DE-induced mice model." | 1.48 | Comparison of Ocular Surface Mucin Expression After Topical Ophthalmic Drug Administration in Dry Eye-Induced Mouse Model. ( Ji, YW; Kang, HG; Kim, HC; Lee, HK; Moon, I; Noh, H; Song, JS; Yeo, A, 2018) |
| "Mucosal inflammation is a crucial factor for the recurrence of peptic ulcer." | 1.33 | Rebamipide reduces recurrence of experimental gastric ulcers: role of free radicals and neutrophils. ( Osaka, T; Sakurai, K; Yamasaki, K, 2005) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 5 (7.58) | 18.7374 |
| 1990's | 4 (6.06) | 18.2507 |
| 2000's | 9 (13.64) | 29.6817 |
| 2010's | 23 (34.85) | 24.3611 |
| 2020's | 25 (37.88) | 2.80 |
| Authors | Studies |
|---|---|
| Pereira, NMD | 1 |
| Heath, PT | 1 |
| Doerholt, K | 1 |
| Almario-Hernandez, AF | 1 |
| Gilmour, C | 1 |
| Drysdale, SB | 1 |
| Ferren, M | 1 |
| Favède, V | 1 |
| Decimo, D | 1 |
| Iampietro, M | 1 |
| Lieberman, NAP | 1 |
| Weickert, JL | 1 |
| Pelissier, R | 1 |
| Mazelier, M | 1 |
| Terrier, O | 1 |
| Moscona, A | 1 |
| Porotto, M | 1 |
| Greninger, AL | 1 |
| Messaddeq, N | 1 |
| Horvat, B | 1 |
| Mathieu, C | 1 |
| Chapoval, SP | 1 |
| Lee, M | 1 |
| Lemmer, A | 1 |
| Ajayi, O | 1 |
| Qi, X | 1 |
| Neuwald, AF | 1 |
| Keegan, AD | 1 |
| Wu, ML | 1 |
| Liu, FL | 1 |
| Sun, J | 1 |
| Li, X | 1 |
| Qin, JR | 1 |
| Yan, QH | 1 |
| Jin, X | 1 |
| Chen, XW | 1 |
| Zheng, YT | 1 |
| Zhao, JC | 1 |
| Wang, JH | 1 |
| Padilla, S | 1 |
| Polotskaya, K | 1 |
| Fernández, M | 1 |
| Gonzalo-Jiménez, N | 1 |
| de la Rica, A | 1 |
| García, JA | 1 |
| García-Abellán, J | 1 |
| Mascarell, P | 1 |
| Gutiérrez, F | 1 |
| Masiá, M | 1 |
| Xu, YY | 1 |
| Xu, CZ | 1 |
| Liang, YF | 1 |
| Jin, DQ | 1 |
| Ding, J | 1 |
| Sheng, Y | 1 |
| Zhang, L | 2 |
| Deng, F | 1 |
| Gonzalez Quesada, Y | 1 |
| DesGroseillers, L | 1 |
| García, P | 1 |
| Moscoso, M | 1 |
| Fuentes-Valverde, V | 1 |
| Rodicio, MR | 1 |
| Herrera-León, S | 1 |
| Bou, G | 1 |
| Su, JT | 1 |
| Simpson, SM | 1 |
| Sung, S | 1 |
| Tfaily, EB | 1 |
| Veazey, R | 1 |
| Marzinke, M | 1 |
| Qiu, J | 2 |
| Watrous, D | 1 |
| Widanapathirana, L | 1 |
| Pearson, E | 1 |
| Peet, MM | 1 |
| Karunakaran, D | 1 |
| Grasperge, B | 1 |
| Dobek, G | 1 |
| Cain, CM | 1 |
| Hope, T | 1 |
| Kiser, PF | 1 |
| Sung, PS | 1 |
| Li, YN | 1 |
| Su, Y | 1 |
| Nile, SH | 1 |
| Nile, A | 1 |
| Li, L | 1 |
| Jia, X | 1 |
| Kai, G | 1 |
| Ahmad, SI | 1 |
| Andreou, A | 1 |
| Trantza, S | 1 |
| Filippou, D | 1 |
| Sipsas, N | 1 |
| Tsiodras, S | 1 |
| Contini, C | 1 |
| Enrica Gallenga, C | 1 |
| Neri, G | 1 |
| Maritati, M | 1 |
| Conti, P | 1 |
| Magro, G | 1 |
| Sciaccaluga, C | 1 |
| Cameli, M | 1 |
| Menci, D | 1 |
| Mandoli, GE | 1 |
| Sisti, N | 1 |
| Cameli, P | 1 |
| Franchi, F | 1 |
| Mondillo, S | 1 |
| Valente, S | 1 |
| Dobrovolny, HM | 1 |
| Huang, J | 1 |
| Hume, AJ | 1 |
| Abo, KM | 1 |
| Werder, RB | 1 |
| Villacorta-Martin, C | 1 |
| Alysandratos, KD | 1 |
| Beermann, ML | 1 |
| Simone-Roach, C | 1 |
| Lindstrom-Vautrin, J | 1 |
| Olejnik, J | 1 |
| Suder, EL | 1 |
| Bullitt, E | 1 |
| Hinds, A | 1 |
| Sharma, A | 1 |
| Bosmann, M | 1 |
| Wang, R | 1 |
| Hawkins, F | 1 |
| Burks, EJ | 1 |
| Saeed, M | 1 |
| Wilson, AA | 1 |
| Mühlberger, E | 1 |
| Kotton, DN | 1 |
| Pandolfi, L | 1 |
| Fossali, T | 1 |
| Frangipane, V | 1 |
| Bozzini, S | 1 |
| Morosini, M | 1 |
| D'Amato, M | 1 |
| Lettieri, S | 1 |
| Urtis, M | 1 |
| Di Toro, A | 1 |
| Saracino, L | 1 |
| Percivalle, E | 1 |
| Tomaselli, S | 1 |
| Cavagna, L | 1 |
| Cova, E | 1 |
| Mojoli, F | 1 |
| Bergomi, P | 1 |
| Ottolina, D | 1 |
| Lilleri, D | 1 |
| Corsico, AG | 1 |
| Arbustini, E | 1 |
| Colombo, R | 1 |
| Meloni, F | 1 |
| Kulkarni, NN | 1 |
| O'Neill, AM | 1 |
| Dokoshi, T | 1 |
| Luo, EWC | 1 |
| Wong, GCL | 1 |
| Gallo, RL | 1 |
| Qian, L | 1 |
| Li, JZ | 1 |
| Sun, X | 1 |
| Chen, JB | 1 |
| Dai, Y | 1 |
| Huang, QX | 1 |
| Jin, YJ | 1 |
| Duan, QN | 1 |
| Barratt-Due, A | 1 |
| Olsen, IC | 1 |
| Nezvalova-Henriksen, K | 1 |
| Kåsine, T | 1 |
| Lund-Johansen, F | 1 |
| Hoel, H | 1 |
| Holten, AR | 1 |
| Tveita, A | 1 |
| Mathiessen, A | 1 |
| Haugli, M | 1 |
| Eiken, R | 1 |
| Kildal, AB | 1 |
| Berg, Å | 1 |
| Johannessen, A | 1 |
| Heggelund, L | 1 |
| Dahl, TB | 1 |
| Skåra, KH | 1 |
| Mielnik, P | 1 |
| Le, LAK | 1 |
| Thoresen, L | 1 |
| Ernst, G | 1 |
| Hoff, DAL | 1 |
| Skudal, H | 1 |
| Kittang, BR | 1 |
| Olsen, RB | 1 |
| Tholin, B | 1 |
| Ystrøm, CM | 1 |
| Skei, NV | 1 |
| Tran, T | 1 |
| Dudman, S | 1 |
| Andersen, JT | 1 |
| Hannula, R | 1 |
| Dalgard, O | 1 |
| Finbråten, AK | 1 |
| Tonby, K | 1 |
| Blomberg, B | 1 |
| Aballi, S | 1 |
| Fladeby, C | 1 |
| Steffensen, A | 1 |
| Müller, F | 1 |
| Dyrhol-Riise, AM | 1 |
| Trøseid, M | 1 |
| Aukrust, P | 1 |
| Stoeckle, K | 1 |
| Witting, B | 1 |
| Kapadia, S | 1 |
| An, A | 1 |
| Marks, K | 1 |
| Liu, Y | 1 |
| Woodard, PK | 1 |
| Scandolera, A | 1 |
| Hubert, J | 1 |
| Humeau, A | 1 |
| Lambert, C | 1 |
| De Bizemont, A | 1 |
| Winkel, C | 1 |
| Kaouas, A | 1 |
| Renault, JH | 1 |
| Nuzillard, JM | 1 |
| Reynaud, R | 1 |
| Wang, F | 1 |
| Song, ZY | 1 |
| Qu, XJ | 1 |
| Li, F | 1 |
| Li, WB | 1 |
| Cui, SX | 1 |
| El-Bahy, AAZ | 1 |
| Aboulmagd, YM | 1 |
| Zaki, M | 1 |
| Moon, I | 1 |
| Kang, HG | 1 |
| Yeo, A | 1 |
| Noh, H | 1 |
| Kim, HC | 1 |
| Song, JS | 1 |
| Ji, YW | 1 |
| Lee, HK | 1 |
| Kim, HJ | 1 |
| Kim, SY | 2 |
| Shin, SP | 1 |
| Yang, YJ | 1 |
| Bang, CS | 1 |
| Baik, GH | 1 |
| Kim, DJ | 1 |
| Ham, YL | 1 |
| Choi, EY | 1 |
| Suk, KT | 1 |
| Zafar, MA | 1 |
| Hammond, AJ | 1 |
| Hamaguchi, S | 1 |
| Wu, W | 1 |
| Kono, M | 1 |
| Zhao, L | 1 |
| Weiser, JN | 1 |
| Ueta, M | 1 |
| Sotozono, C | 1 |
| Yokoi, N | 1 |
| Kinoshita, S | 1 |
| Ren, J | 1 |
| Chen, X | 1 |
| Chen, ZJ | 1 |
| Ross, EA | 1 |
| Smallie, T | 1 |
| Ding, Q | 1 |
| O'Neil, JD | 1 |
| Cunliffe, HE | 1 |
| Tang, T | 1 |
| Rosner, DR | 1 |
| Klevernic, I | 1 |
| Morrice, NA | 1 |
| Monaco, C | 1 |
| Cunningham, AF | 1 |
| Buckley, CD | 1 |
| Saklatvala, J | 1 |
| Dean, JL | 1 |
| Clark, AR | 1 |
| Kamada, T | 1 |
| Sato, M | 1 |
| Tokutomi, T | 1 |
| Watanabe, T | 1 |
| Murao, T | 1 |
| Matsumoto, H | 1 |
| Manabe, N | 1 |
| Ito, M | 1 |
| Tanaka, S | 1 |
| Inoue, K | 1 |
| Shiotani, A | 1 |
| Akiyama, T | 1 |
| Hata, J | 1 |
| Haruma, K | 1 |
| Tourville, TW | 1 |
| Poynter, ME | 1 |
| DeSarno, MJ | 1 |
| Struglics, A | 1 |
| Beynnon, BD | 1 |
| Liu, J | 1 |
| Du, J | 1 |
| Yang, Y | 1 |
| Wang, Y | 1 |
| Yoshihara, HA | 1 |
| Bastiaansen, JA | 1 |
| Berthonneche, C | 1 |
| Comment, A | 1 |
| Schwitter, J | 1 |
| Kim, SK | 1 |
| Choe, JY | 1 |
| Park, KY | 1 |
| Raizel, R | 1 |
| Leite, JS | 1 |
| Hypólito, TM | 1 |
| Coqueiro, AY | 1 |
| Newsholme, P | 1 |
| Cruzat, VF | 1 |
| Tirapegui, J | 1 |
| Min, HK | 1 |
| Kim, JK | 1 |
| Lee, SY | 1 |
| Kim, EK | 2 |
| Lee, SH | 2 |
| Lee, J | 1 |
| Kwok, SK | 1 |
| Cho, ML | 2 |
| Park, SH | 1 |
| Choi, YH | 1 |
| Choi, YS | 1 |
| Kim, YK | 1 |
| Rahman, MS | 1 |
| Pradeep, GC | 1 |
| Yoo, JC | 1 |
| Suh, JW | 1 |
| Jhun, J | 1 |
| Kwon, JE | 1 |
| Jeong, JH | 1 |
| Na, HS | 1 |
| Jung, K | 1 |
| Min, JK | 1 |
| Bang, D | 1 |
| Choi, B | 1 |
| Kwon, HJ | 1 |
| Lee, ES | 1 |
| Lee, S | 1 |
| Sohn, S | 1 |
| Kang, DW | 1 |
| Min, G | 1 |
| Park, DY | 1 |
| Hong, KW | 1 |
| Min, do S | 1 |
| Gandy, S | 1 |
| Wustman, B | 1 |
| Kardara, D | 1 |
| Tousoulis, D | 1 |
| Antoniades, C | 1 |
| Koumallos, N | 1 |
| Xaplanteris, P | 1 |
| Kyvelou, SM | 1 |
| Papageorgiou, N | 1 |
| Vasiliadou, C | 1 |
| Vlachopoulos, C | 1 |
| Stefanadis, C | 1 |
| Montano, MA | 1 |
| da Cruz, IB | 1 |
| Duarte, MM | 1 |
| Krewer, Cda C | 1 |
| da Rocha, MI | 1 |
| Mânica-Cattani, MF | 1 |
| Soares, FA | 1 |
| Rosa, G | 1 |
| Maris, AF | 1 |
| Battiston, FG | 1 |
| Trott, A | 1 |
| Lera, JP | 1 |
| Schreiter, A | 1 |
| Gore, C | 1 |
| Labuz, D | 1 |
| Fournie-Zaluski, MC | 2 |
| Roques, BP | 2 |
| Stein, C | 1 |
| Machelska, H | 1 |
| Hata, AN | 1 |
| Lybrand, TP | 1 |
| Breyer, RM | 1 |
| Sakurai, K | 1 |
| Osaka, T | 1 |
| Yamasaki, K | 1 |
| Sappington, PL | 1 |
| Cruz, RJ | 1 |
| Harada, T | 1 |
| Yang, R | 1 |
| Han, Y | 1 |
| Englert, JA | 1 |
| Ajami, AA | 1 |
| Killeen, ME | 1 |
| Delude, RL | 1 |
| Fink, MP | 1 |
| Sroussi, HY | 1 |
| Berline, J | 1 |
| Dazin, P | 1 |
| Green, P | 1 |
| Palefsky, JM | 1 |
| Caparroz-Assef, SM | 1 |
| Bersani-Amado, CA | 1 |
| Kelmer-Bracht, AM | 1 |
| Bracht, A | 1 |
| Ishii-Iwamoto, EL | 1 |
| Okada, N | 1 |
| Asai, S | 1 |
| Hotta, A | 1 |
| Miura, N | 1 |
| Ohno, N | 1 |
| Farkas, I | 1 |
| Hau, L | 1 |
| Okada, H | 1 |
| Wang, JJ | 1 |
| Ross, RJ | 1 |
| Tuo, J | 1 |
| Burlutsky, G | 1 |
| Tan, AG | 1 |
| Chan, CC | 1 |
| Favaloro, EJ | 1 |
| Williams, A | 1 |
| Mitchell, P | 1 |
| Duncker, SC | 1 |
| Wang, L | 1 |
| Hols, P | 1 |
| Bienenstock, J | 1 |
| Neugebauer, V | 1 |
| Lücke, T | 1 |
| Schaible, HG | 1 |
| Noble, F | 1 |
| Smadja, C | 1 |
| Valverde, O | 1 |
| Maldonado, R | 1 |
| Coric, P | 1 |
| Turcaud, S | 1 |
| Sundaram, U | 1 |
| Wisel, S | 1 |
| Fromkes, JJ | 1 |
| Kriat, M | 1 |
| Vion-Dury, J | 1 |
| Fayre, R | 1 |
| Maraninchi, D | 1 |
| Harlé, JR | 1 |
| Confort-Gouny, S | 1 |
| Sciaky, M | 1 |
| Fontanarava, E | 1 |
| Viout, P | 1 |
| Cozzone, PJ | 1 |
| Hansson, UB | 1 |
| Lindström, FD | 1 |
| Melrose, GJ | 1 |
| Muller, HK | 1 |
| Vagg, WJ | 1 |
| Björnesjö, KB | 2 |
| Jarnulf, B | 1 |
| Lausing, E | 1 |
| Wagner, J | 1 |
| Potel, M | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Inhaled Interferon α2b Treatment in Mild-to-moderate COVID-19 Infected Children[NCT05381363] | Phase 1/Phase 2 | 24 participants (Actual) | Interventional | 2022-01-01 | Terminated (stopped due to The study was concluded as planned upon reaching its predetermined endpoint, which included the completion of data collection and achievement of the necessary sample size for statistical significance.) | ||
| Low-field Magnetic Resonance Imaging to Assess Changes in Pulmonary Function Parameters in Confirmed Pediatric SARS-CoV-2 Infection[NCT05445531] | 111 participants (Anticipated) | Interventional | 2022-07-08 | Recruiting | |||
| Low-fielD magnEtiC Resonance Imaging of pulmonarY Parenchyma Changes Associated wiTh Confirmed SARS-CoV-2 Infection in Children and Adolescents[NCT04990531] | 68 participants (Anticipated) | Interventional | 2021-08-09 | Recruiting | |||
| The (Norwegian) NOR Solidarity Multicenter Trial on the Efficacy of Different Anti-viral Drugs in SARS-CoV-2 Infected Patients[NCT04321616] | Phase 2/Phase 3 | 700 participants (Anticipated) | Interventional | 2020-03-28 | Recruiting | ||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
4 reviews available for alanine and Inflammation
| Article | Year |
|---|---|
COVID-19: Pathogenesis, cytokine storm and therapeutic potential of interferons.
Topics: Adenosine Monophosphate; Alanine; Antibodies, Monoclonal; Antiviral Agents; Betacoronavirus; Coronav | 2020 |
COVID-19: The Potential Role of Copper and N-acetylcysteine (NAC) in a Combination of Candidate Antiviral Treatments Against SARS-CoV-2.
Topics: Acetylcysteine; Adenosine Monophosphate; Adjuvants, Immunologic; Alanine; Anti-Inflammatory Agents; | 2020 |
COVID-19: Review on latest available drugs and therapies against SARS-CoV-2. Coagulation and inflammation cross-talking.
Topics: Adenosine Monophosphate; Alanine; Anti-Inflammatory Agents; Antibodies, Monoclonal; Antibodies, Mono | 2020 |
COVID-19 and the burning issue of drug interaction: never forget the ECG.
Topics: Adenosine Monophosphate; Alanine; Antibodies, Monoclonal, Humanized; Antirheumatic Agents; Antiviral | 2021 |
2 trials available for alanine and Inflammation
| Article | Year |
|---|---|
Evaluation of the Effects of Remdesivir and Hydroxychloroquine on Viral Clearance in COVID-19 : A Randomized Trial.
Topics: Adenosine Monophosphate; Alanine; Antibodies, Viral; Antiviral Agents; Biomarkers; Cause of Death; C | 2021 |
Rebamipide improves chronic inflammation in the lesser curvature of the corpus after Helicobacter pylori eradication: a multicenter study.
Topics: Adult; Aged; Aged, 80 and over; Alanine; Female; Gastritis; Helicobacter Infections; Helicobacter py | 2015 |
60 other studies available for alanine and Inflammation
| Article | Year |
|---|---|
SARS-CoV-2 Infection in an Adolescent With X-linked Agammaglobulinemia.
Topics: Adenosine Monophosphate; Adolescent; Agammaglobulinemia; Alanine; Antibodies, Viral; Antiviral Agent | 2021 |
Hamster organotypic modeling of SARS-CoV-2 lung and brainstem infection.
Topics: Adenosine Monophosphate; Alanine; Alveolar Epithelial Cells; Animals; Antiviral Agents; Brain Stem; | 2021 |
Identifying Function Determining Residues in Neuroimmune Semaphorin 4A.
Topics: Alanine; Animals; Bayes Theorem; Forkhead Transcription Factors; Humans; Inflammation; Leukocytes, M | 2022 |
Combinational benefit of antihistamines and remdesivir for reducing SARS-CoV-2 replication and alleviating inflammation-induced lung injury in mice.
Topics: Adenosine Monophosphate; Alanine; Animals; Antiviral Agents; COVID-19; COVID-19 Drug Treatment; Endo | 2022 |
Survival benefit of remdesivir in hospitalized COVID-19 patients with high SARS-CoV-2 viral loads and low-grade systemic inflammation.
Topics: Adenosine Monophosphate; Alanine; Antiviral Agents; Cohort Studies; COVID-19 Drug Treatment; Dexamet | 2022 |
Ascorbic acid and hydrocortisone synergistically inhibit septic organ injury via improving oxidative stress and inhibiting inflammation.
Topics: Alanine; Animals; Anti-Inflammatory Agents; Ascorbic Acid; Aspartate Aminotransferases; Creatinine; | 2022 |
A Degradation Motif in STAU1 Defines a Novel Family of Proteins Involved in Inflammation.
Topics: Alanine; Amino Acids; Anaphase-Promoting Complex-Cyclosome; Cytoskeletal Proteins; Humans; Inflammat | 2022 |
A highly-safe live auxotrophic vaccine protecting against disease caused by non-typhoidal Salmonella Typhimurium in mice.
Topics: Alanine; Animals; Glutamic Acid; Humans; Immunoglobulin G; Inflammation; Mice; Salmonella typhimuriu | 2023 |
A Subcutaneous Implant of Tenofovir Alafenamide Fumarate Causes Local Inflammation and Tissue Necrosis in Rabbits and Macaques.
Topics: Adenine; Alanine; Animals; Anti-HIV Agents; Delayed-Action Preparations; Drug Implants; Female; Fuma | 2020 |
A different detection method reveals a new role of alanine aminotransferase as an indicator of liver fibrosis.
Topics: Alanine; Alanine Transaminase; Aspartate Aminotransferases; Aspartic Acid; Humans; Inflammation; Liv | 2020 |
Remdesivir attenuates high fat diet (HFD)-induced NAFLD by regulating hepatocyte dyslipidemia and inflammation via the suppression of STING.
Topics: Adenosine Monophosphate; Administration, Oral; Alanine; Animals; Antiviral Agents; Diet, High-Fat; D | 2020 |
5-Fluorouracil in combination with deoxyribonucleosides and deoxyribose as possible therapeutic options for the Coronavirus, COVID-19 infection.
Topics: Adenosine Monophosphate; Alanine; Betacoronavirus; Chloroquine; Clinical Trials as Topic; Coronaviru | 2020 |
A new pharmacological approach based on remdesivir aerosolized administration on SARS-CoV-2 pulmonary inflammation: A possible and rational therapeutic application.
Topics: Adenosine Monophosphate; Aerosols; Alanine; Animals; Antiviral Agents; COVID-19 Drug Treatment; Huma | 2020 |
Quantifying the effect of remdesivir in rhesus macaques infected with SARS-CoV-2.
Topics: Adenosine Monophosphate; Alanine; Animals; Antiviral Agents; Betacoronavirus; Coronavirus Infections | 2020 |
SARS-CoV-2 Infection of Pluripotent Stem Cell-Derived Human Lung Alveolar Type 2 Cells Elicits a Rapid Epithelial-Intrinsic Inflammatory Response.
Topics: Adenosine Monophosphate; Alanine; Alveolar Epithelial Cells; Animals; Antiviral Agents; Cells, Cultu | 2020 |
SARS-CoV-2 Infection of Pluripotent Stem Cell-Derived Human Lung Alveolar Type 2 Cells Elicits a Rapid Epithelial-Intrinsic Inflammatory Response.
Topics: Adenosine Monophosphate; Alanine; Alveolar Epithelial Cells; Animals; Antiviral Agents; Cells, Cultu | 2020 |
SARS-CoV-2 Infection of Pluripotent Stem Cell-Derived Human Lung Alveolar Type 2 Cells Elicits a Rapid Epithelial-Intrinsic Inflammatory Response.
Topics: Adenosine Monophosphate; Alanine; Alveolar Epithelial Cells; Animals; Antiviral Agents; Cells, Cultu | 2020 |
SARS-CoV-2 Infection of Pluripotent Stem Cell-Derived Human Lung Alveolar Type 2 Cells Elicits a Rapid Epithelial-Intrinsic Inflammatory Response.
Topics: Adenosine Monophosphate; Alanine; Alveolar Epithelial Cells; Animals; Antiviral Agents; Cells, Cultu | 2020 |
Broncho-alveolar inflammation in COVID-19 patients: a correlation with clinical outcome.
Topics: Adenosine Monophosphate; Adrenal Cortex Hormones; Aged; Alanine; Antibodies, Monoclonal, Humanized; | 2020 |
Sequence determinants in the cathelicidin LL-37 that promote inflammation via presentation of RNA to scavenger receptors.
Topics: Alanine; Amino Acid Sequence; Animals; Antimicrobial Cationic Peptides; Biophysical Phenomena; Cathe | 2021 |
Safinamide prevents lipopolysaccharide (LPS)-induced inflammation in macrophages by suppressing TLR4/NF-κB signaling.
Topics: Alanine; Anti-Inflammatory Agents; Benzylamines; Cyclooxygenase 2; Cytokines; Dinoprostone; Humans; | 2021 |
Elevated inflammatory markers are associated with poor outcomes in COVID-19 patients treated with remdesivir.
Topics: Adenosine Monophosphate; Aged; Alanine; Antiviral Agents; Biomarkers; C-Reactive Protein; COVID-19; | 2022 |
Chemokine receptors: Key for molecular imaging of inflammation in atherosclerosis.
Topics: Alanine; Animals; Apolipoproteins E; Atherosclerosis; Chemokines; Coordination Complexes; Heterocycl | 2019 |
GABA and GABA-Alanine from the Red Microalgae Rhodosorus marinus Exhibit a Significant Neuro-Soothing Activity through Inhibition of Neuro-Inflammation Mediators and Positive Regulation of TRPV1-Related Skin Sensitization.
Topics: Alanine; Cells, Cultured; gamma-Aminobutyric Acid; Humans; Inflammation; Inflammation Mediators; Int | 2018 |
M10, a novel derivative of Myricetin, prevents ulcerative colitis and colorectal tumor through attenuating robust endoplasmic reticulum stress.
Topics: Alanine; Animals; Anticarcinogenic Agents; Colitis, Ulcerative; Colon; Colorectal Neoplasms; Disease | 2018 |
Diabetex: A novel approach for diabetic wound healing.
Topics: Alanine; Animals; Ascorbic Acid; Blood Coagulation; Blood Glucose; Collagen; Diabetes Mellitus, Expe | 2018 |
Comparison of Ocular Surface Mucin Expression After Topical Ophthalmic Drug Administration in Dry Eye-Induced Mouse Model.
Topics: Administration, Topical; Alanine; Animals; Anti-Inflammatory Agents; Cyclosporine; Disease Models, A | 2018 |
Immunological measurement of aspartate/alanine aminotransferase in predicting liver fibrosis and inflammation.
Topics: Alanine; Alanine Transaminase; Aspartate Aminotransferases; Aspartic Acid; Biomarkers; Biopsy; Hepat | 2020 |
Identification of Pneumococcal Factors Affecting Pneumococcal Shedding Shows that the
Topics: Alanine; Animals; Animals, Newborn; Bacterial Proteins; Bacterial Shedding; Disease Models, Animal; | 2019 |
Rebamipide suppresses PolyI:C-stimulated cytokine production in human conjunctival epithelial cells.
Topics: Alanine; Animals; Antioxidants; Conjunctiva; Conjunctivitis, Allergic; Cytokines; Disease Models, An | 2013 |
IKKβ is an IRF5 kinase that instigates inflammation.
Topics: Alanine; Animals; Cytokines; HEK293 Cells; Humans; I-kappa B Kinase; Inflammation; Interferon Regula | 2014 |
Dominant Suppression of Inflammation via Targeted Mutation of the mRNA Destabilizing Protein Tristetraprolin.
Topics: Alanine; Amino Acid Substitution; Animals; Cell Line; Cytokines; Female; Gene Expression; Inflammati | 2015 |
Relationship between synovial fluid ARGS-aggrecan fragments, cytokines, MMPs, and TIMPs following acute ACL injury: A cross-sectional study.
Topics: Adolescent; Adult; Aggrecans; Alanine; Anterior Cruciate Ligament Injuries; Arginine; Body Mass Inde | 2015 |
Phosphorylation of TRPV1 by cyclin-dependent kinase 5 promotes TRPV1 surface localization, leading to inflammatory thermal hyperalgesia.
Topics: Alanine; Animals; Calcium; Cells, Cultured; Cyclin-Dependent Kinase 5; Disease Models, Animal; Freun | 2015 |
An intact small animal model of myocardial ischemia-reperfusion: Characterization of metabolic changes by hyperpolarized 13C MR spectroscopy.
Topics: Alanine; Animals; Bicarbonates; Carbon Isotopes; Disease Models, Animal; Hemodynamics; Inflammation; | 2015 |
Rebamipide Suppresses Monosodium Urate Crystal-Induced Interleukin-1β Production Through Regulation of Oxidative Stress and Caspase-1 in THP-1 Cells.
Topics: Alanine; Ascorbic Acid; Caspase 1; Cell Line; Colchicine; Dexamethasone; Enzyme Activation; Gout; Hu | 2016 |
Determination of the anti-inflammatory and cytoprotective effects of l-glutamine and l-alanine, or dipeptide, supplementation in rats submitted to resistance exercise.
Topics: Alanine; Animals; Anti-Inflammatory Agents; Creatine Kinase; Cytokines; Dietary Supplements; Dipepti | 2016 |
Rebamipide prevents peripheral arthritis and intestinal inflammation by reciprocally regulating Th17/Treg cell imbalance in mice with curdlan-induced spondyloarthritis.
Topics: Alanine; Animals; Arthritis, Experimental; beta-Glucans; Cytokines; Inflammation; Inflammation Media | 2016 |
A multifunctional alanine-rich anti-inflammatory peptide BCP61 showed potent inhibitory effects by inhibiting both NF-κB and MAPK expression.
Topics: Alanine; Animals; Anti-Inflammatory Agents; Bacterial Infections; Bacterial Proteins; Cytokines; Dos | 2017 |
Rebamipide ameliorates atherosclerosis by controlling lipid metabolism and inflammation.
Topics: Alanine; Animals; Antioxidants; Aorta; Apolipoproteins E; Arthritis; Atherosclerosis; Collagen; Foam | 2017 |
Rebamipide affects the efficiency of colchicine for the herpes simplex virus-induced inflammation in a Behcet's disease mouse model.
Topics: Alanine; Animals; Anti-Inflammatory Agents, Non-Steroidal; Behcet Syndrome; Colchicine; Enzyme-Linke | 2008 |
Rebamipide-induced downregulation of phospholipase D inhibits inflammation and proliferation in gastric cancer cells.
Topics: Alanine; Cell Line, Tumor; Cell Proliferation; Down-Regulation; Gene Expression Regulation, Neoplast | 2010 |
New pathway links γ-secretase to inflammation and memory while sparing notch.
Topics: Alanine; Alzheimer Disease; Amyloid Precursor Protein Secretases; Animals; Azepines; CREB-Binding Pr | 2011 |
Effects of the Ala379Val polymorphism of lipoprotein-associated phospholipase A2 on thrombosis and inflammation in hypertensive patients.
Topics: 1-Alkyl-2-acetylglycerophosphocholine Esterase; Alanine; Fibrinogen; Gene Frequency; Genotype; Heter | 2011 |
Inflammatory cytokines in vitro production are associated with Ala16Val superoxide dismutase gene polymorphism of peripheral blood mononuclear cells.
Topics: Alanine; Amino Acid Substitution; Cells, Cultured; Culture Media; Cytokines; Enzyme-Linked Immunosor | 2012 |
Pain inhibition by blocking leukocytic and neuronal opioid peptidases in peripheral inflamed tissue.
Topics: Alanine; Amino Acid Sequence; Animals; Antibodies; CD13 Antigens; Dose-Response Relationship, Drug; | 2012 |
Identification of determinants of ligand binding affinity and selectivity in the prostaglandin D2 receptor CRTH2.
Topics: Alanine; Animals; Anti-Inflammatory Agents, Non-Steroidal; Binding, Competitive; Cell Line; Cell Mov | 2005 |
Rebamipide reduces recurrence of experimental gastric ulcers: role of free radicals and neutrophils.
Topics: Acetic Acid; Alanine; Animals; Anti-Ulcer Agents; Free Radicals; Gastric Mucosa; Glutathione Peroxid | 2005 |
The ethyl pyruvate analogues, diethyl oxaloproprionate, 2-acetamidoacrylate, and methyl-2-acetamidoacrylate, exhibit anti-inflammatory properties in vivo and/or in vitro.
Topics: Acrylates; Alanine; Animals; Anti-Inflammatory Agents; Cell Line; Drug Evaluation, Preclinical; Este | 2005 |
S100A8 triggers oxidation-sensitive repulsion of neutrophils.
Topics: Alanine; Animals; Calgranulin A; Cells, Cultured; Chemotaxis, Leukocyte; Cysteine; Flow Cytometry; H | 2006 |
The metabolic changes caused by dexamethasone in the adjuvant-induced arthritic rat.
Topics: Alanine; Ammonia; Animals; Arthritis, Experimental; Blood Glucose; Body Weight; Dexamethasone; Fasti | 2007 |
Increased inhibitory capacity of an anti-C5a complementary peptide following acetylation of N-terminal alanine.
Topics: Acetylation; Alanine; Animals; Complement C5a; Guinea Pigs; Inflammation; Peptide Fragments; Skin | 2007 |
The LOC387715 polymorphism, inflammatory markers, smoking, and age-related macular degeneration. A population-based case-control study.
Topics: Aged; Aged, 80 and over; Alanine; Biomarkers; C-Reactive Protein; Case-Control Studies; Genetic Pred | 2008 |
The D-alanine content of lipoteichoic acid is crucial for Lactobacillus plantarum-mediated protection from visceral pain perception in a rat colorectal distension model.
Topics: Abdominal Pain; Alanine; Animals; Colon; Cytokines; Dilatation, Pathologic; Heart Rate; Inflammation | 2008 |
Requirement of metabotropic glutamate receptors for the generation of inflammation-evoked hyperexcitability in rat spinal cord neurons.
Topics: Acute Disease; Afferent Pathways; Alanine; alpha-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic Acid; | 1994 |
Pain-suppressive effects on various nociceptive stimuli (thermal, chemical, electrical and inflammatory) of the first orally active enkephalin-metabolizing enzyme inhibitor RB 120.
Topics: Administration, Oral; Alanine; Animals; Disulfides; Dose-Response Relationship, Drug; Electric Stimu | 1997 |
Unique mechanism of inhibition of Na+-amino acid cotransport during chronic ileal inflammation.
Topics: Alanine; Amino Acid Transport Systems; Amino Acid Transport Systems, Neutral; Animals; Biological Tr | 1998 |
Variations of plasma sialic acid and N-acetylglucosamine levels in cancer, inflammatory diseases and bone marrow transplantation: a proton NMR spectroscopy study.
Topics: Acetylglucosamine; Alanine; Bone Marrow Transplantation; Humans; Inflammation; Longitudinal Studies; | 1991 |
Some factors affecting precipitation and complex formation of an IgG cryoglobulin.
Topics: Adult; Alanine; Albumins; Antigen-Antibody Complex; Blood Protein Electrophoresis; Blood Sedimentati | 1973 |
Correlation of bradykinin structure with ability to increase vascular permeability.
Topics: Alanine; Animals; Arginine; Binding Sites; Bradykinin; Capillary Permeability; Guinea Pigs; Histamin | 1970 |
The erythrocyte plasma distribution of amino acids in health and disease.
Topics: Acute Disease; Adolescent; Adult; Alanine; Amino Acids; Anemia, Hemolytic; Anemia, Pernicious; Bronc | 1968 |
Uptake of labelled amino acids into human erythrocytes in disease.
Topics: Acute Disease; Alanine; Amino Acids; Anemia; Bronchitis; Bronchopneumonia; Carbon Isotopes; Erythroc | 1968 |
[Separation of low molecular weight ninhydrine positive substances in pleural punctates. Contribution to the problem of inflammation].
Topics: Alanine; Amino Acids; Animals; Aspartic Acid; Chromatography; Chromatography, Gel; Electrophoresis; | 1968 |