adenine has been researched along with Hepatitis B in 382 studies
Hepatitis B: INFLAMMATION of the LIVER in humans caused by a member of the ORTHOHEPADNAVIRUS genus, HEPATITIS B VIRUS. It is primarily transmitted by parenteral exposure, such as transfusion of contaminated blood or blood products, but can also be transmitted via sexual or intimate personal contact.
| Excerpt | Relevance | Reference |
|---|---|---|
| "The aim of this study was to demonstrate how tenofovir alafenamide (TAF) and other hepatitis B treatment drugs differentially impact lipid profiles in chronic hepatitis B patients." | 9.41 | Risk of dyslipidemia in chronic hepatitis B patients taking tenofovir alafenamide: a systematic review and meta-analysis. ( Hwang, EG; Jung, EA; Kim, SG; Kim, YS; Yoo, JJ, 2023) |
| "Tenofovir alafenamide (TAF) is a new prodrug of tenofovir developed to treat patients with chronic hepatitis B virus (HBV) infection at a lower dose than tenofovir disoproxil fumarate (TDF) through more efficient delivery of tenofovir to hepatocytes." | 9.27 | 96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection. ( Agarwal, K; Ahn, SH; Bae, H; Bhardwaj, N; Brunetto, M; Buti, M; Cathcart, AL; Çelen, MK; Chan, HLY; Chuang, WL; Flaherty, JF; Fung, S; Furusyo, N; Gaggar, A; Gane, EJ; Izumi, N; Janssen, HLA; Lau, AH; Lim, YS; Lin, L; Mani Subramanian, G; Marcellin, P; Pan, CQ; Seto, WK; Shalimar, D; Sharma, M; Suri, V; Trinh, H; Yoon, KT, 2018) |
| "Adefovir, a nucleotide analog developed by John Martin, was a major breakthrough in the treatment of chronic Hepatitis B." | 9.22 | Adefovir for lamivudine-resistant hepatitis B. ( Dieterich, D; Roediger, R; Smyth, EK, 2022) |
| "Coformulated elvitegravir, cobicistat, emtricitabine, and tenofovir alafenamide (E/C/F/TAF) has high efficacy and improved renal and bone safety in multiple phase 3 trials; TAF single agent is being studied in 2 phase 3 trials in patients with chronic hepatitis B." | 9.22 | Brief Report: Efficacy and Safety of Switching to a Single-Tablet Regimen of Elvitegravir/Cobicistat/Emtricitabine/Tenofovir Alafenamide in HIV-1/Hepatitis B-Coinfected Adults. ( Benson, P; Brinson, C; Brunetta, J; Cheng, A; Crofoot, G; Das, M; Fordyce, M; Gallant, J; Garner, W; McCallister, S; Mills, A; Oka, S, 2016) |
| "To compare efficacy of combined lamivudine (LAM) and adefovir dipivoxil (ADV) therapy with that of entecavir (ETV) monotherapy for hepatitis B virus (HBV)-related decompensated liver cirrhosis." | 9.17 | De novo combined lamivudine and adefovir dipivoxil therapy vs entecavir monotherapy for hepatitis B virus-related decompensated cirrhosis. ( Chen, JY; Hu, JH; Jia, HY; Li, LJ; Lian, JS; Lu, YF; Xiang, DR; Yang, YD; Yu, L; Zeng, LY; Zhang, YM; Zheng, L, 2013) |
| " At month 24, virological response rate [hepatitis B virus (HBV) DNA <60 IU/ml] was higher in the adefovir-lamivudine combination group compared with entecavir group (56." | 9.17 | Adding adefovir vs. switching to entecavir for lamivudine-resistant chronic hepatitis B (ACE study): a 2-year follow-up randomized controlled trial. ( Baik, SK; Chae, HB; Hong, SP; Kim, CW; Kim, JH; Kim, MY; Kim, YS; Lee, CD; Lee, JI; Lee, JW; Lee, MS; Park, CK; Park, SH; Seo, YS; Um, SH; Yim, HJ; Yoon, EL, 2013) |
| "Adefovir dipivoxil (ADV) is effective in lamivudine (LAM)-resistant hepatitis B e antigen-negative (HBeAg(-)) chronic hepatitis B (CHB)." | 9.14 | Adefovir plus lamivudine are more effective than adefovir alone in lamivudine-resistant HBeAg- chronic hepatitis B patients: a 4-year study. ( Eugenidis, N; Giouleme, O; Gkisakis, D; Grammatikos, N; Katsinelos, P; Koumaras, H; Koumerkeridis, G; Mpoumponaris, A; Panderi, A; Patsiaoura, K; Theodoropoulos, K; Tziomalos, K; Vassiliadis, TG, 2010) |
| "To investigate the efficacy and safety of adefovir dipivoxil (ADV) in treating hepatic cirrhosis complicated with hepatitis B virus associated glomerulonephritis." | 9.13 | [Adefovir dipivoxil treatment of hepatic cirrhosis complicated with hepatitis B virus associated glomerulonephritis]. ( Chen, YS; Jin, ZJ; Li, DF; Qiao, LM; Zhou, J, 2008) |
| "The efficacy of long-term hepatitis B virus (HBV) treatment with tenofovir (TDF) in relation to lamivudine (LMV) resistance in HIV patients failing on LMV deserves further investigations." | 9.13 | Evidence of long-term suppression of hepatitis B virus DNA by tenofovir as rescue treatment in patients coinfected by HIV. ( Calabresi, A; Carosi, G; Cologni, G; Costarelli, S; Lapadula, G; Puoti, M; Quiros-Roldan, E; Tirelli, V; Torti, C; Zaltron, S, 2008) |
| "Adefovir dipivoxil (ADV) is a nucleotide analogue that is known to be effective for lamivudine-resistant hepatitis B virus (HBV) mutants as well as wild-type HBV." | 9.12 | Efficacy of adefovir dipivoxil in the treatment of lamivudine-resistant hepatitis B virus genotype C infection. ( Cho, YS; Kim, DH; Kim, DY; Kim, HJ; Lee, CK; Park, BK; Park, IS; Suh, JH; Won, SY, 2007) |
| "Wait-listed (n = 226) or post-liver transplantation (n = 241) chronic hepatitis B (CHB) patients with lamivudine-resistant hepatitis B virus (HBV) were treated with adefovir dipivoxil for a median of 39 and 99 weeks, respectively." | 9.12 | Adefovir dipivoxil for wait-listed and post-liver transplantation patients with lamivudine-resistant hepatitis B: final long-term results. ( Arterburn, S; Borroto-Esoda, K; Brosgart, C; Chuck, S; Colombo, M; Hadziyannis, S; Lai, CL; Neuhaus, P; Samuel, D; Schiff, E; Terrault, N; Tillmann, H; Villeneuve, JP; Zeuzem, S, 2007) |
| "Low-dose TDF monotherapy can control HBV viremia for an extended period of time without the emergence of resistance and is more potent than adefovir at the standard dosage." | 9.12 | Low-dose tenofovir is more potent than adefovir and is effective in controlling HBV viremia in chronic HBeAg-negative hepatitis B. ( Colombo, S; Del Poggio, P; Jamoletti, C; Oggionni, M; Puhalo, V; Zaccanelli, M, 2007) |
| "Adefovir monotherapy is an established treatment modality for lamivudine-experienced patients with chronic hepatitis B, but it carries a significant risk of resistance in the long term." | 9.12 | Low resistance to adefovir combined with lamivudine: a 3-year study of 145 lamivudine-resistant hepatitis B patients. ( Colombo, M; Iavarone, M; Lampertico, P; Manenti, E; Sablon, E; Viganò, M, 2007) |
| "Phase II and III clinical trials of adefovir dipivoxil (ADV) for the treatment of chronic hepatitis B have shown that this hepadnavirus polymerase inhibitor is well tolerated and effectively suppresses hepatitis B virus (HBV) replication." | 9.11 | Evolution of hepatitis B viral load and viral genome sequence during adefovir dipivoxil therapy. ( Cinquin, K; Marcellin, P; Maynard, M; Pol, S; Trépo, C; Werle, B; Zoulim, F, 2004) |
| "We describe 6 patients who were coinfected with human immunodeficiency virus (HIV) type 1 and wild-type hepatitis B virus (HBV), in whom complete and sustained antiviral activity against wild-type HBV strains was attained during 96 weeks of combination therapy with lamivudine and tenofovir." | 9.11 | Ninety-six-week efficacy of combination therapy with lamivudine and tenofovir in patients coinfected with HIV-1 and wild-type hepatitis B virus. ( Bani-Sadr, F; Molina, JM; Palmer, P; Scieux, C, 2004) |
| "The purpose of this prospective study was to evaluate the efficacy and safety of adefovir dipivoxil with or without ongoing lamivudine in decompensated lamivudine-resistant chronic hepatitis B patients." | 9.11 | Adefovir dipivoxil alone or in combination with ongoing lamivudine in patients with decompensated liver disease and lamivudine-resistant hepatitis B virus. ( Choi, WB; Chung, YH; Kim, KM; Lee, HC; Lee, YS; Lim, YS; Suh, DJ, 2005) |
| "Randomised clinical trials addressing benefits and harms of lamivudine or adefovir dipivoxil alone or in combination with hepatitis B immunoglobulins (HBIg) for preventing recurrent HBV infection in patients who are liver transplanted due to HBV infection with or without hepatocellular carcinoma." | 8.86 | Lamivudine or adefovir dipivoxil alone or combined with immunoglobulin for preventing hepatitis B recurrence after liver transplantation. ( Guy, DG; Katz, LH; Paul, M; Tur-Kaspa, R, 2010) |
| "Switching to a tenofovir alafenamide (TAF)-containing regimen has been reported to be associated with body weight gain in human immunodeficiency virus-infected subjects." | 8.12 | Body weight changes in treated hepatitis B patients switching to tenofovir alafenamide ( Chuang, WL; Dai, CY; Hsieh, MY; Huang, CF; Huang, CI; Huang, JF; Liang, PC; Nguyen, MH; Trinh, S; Yeh, ML; Yu, ML, 2022) |
| "Data on long-term tenofovir alafenamide (TAF) therapy for pregnant women with active chronic hepatitis B (CHB) (immune clearance and reactivation phases, currently and previously diagnosed) and their infants are lacking." | 8.12 | Tenofovir Alafenamide for Pregnant Chinese Women With Active Chronic Hepatitis B: A Multicenter Prospective Study. ( Chen, ZM; Cui, GL; Feng, YH; Huang, S; Li, GM; Li, GT; Li, J; Li, W; Li, WZ; Li, ZQ; Liang, HX; Lin, WB; Liu, N; Liu, YM; Lv, J; Pan, YJ; Song, N; Sun, CY; Wang, FS; Wang, M; Xu, GH; Xu, JH; Yu, ZJ; Zeng, QL; Zeng, YL; Zhang, DW; Zhang, GF; Zhang, GQ; Zhang, HX; Zhang, JY; Zhou, YH, 2022) |
| "Antenatal antiviral therapy (AVT) is effective in preventing mother-to-child transmission (MTCT) in chronic hepatitis B (CHB); tenofovir disoproxil fumarate (TDF) is the preferred agent." | 8.12 | Plasma and breast milk pharmacokinetics of tenofovir alafenamide in mothers with chronic hepatitis B infection. ( Cottrell, M; Crane, H; Di Girolamo, J; Dumond, J; Gane, E; Kashuba, A; Kayes, T; Levy, MT; Lim, TH; Manandhar, S; Symonds, A, 2022) |
| "Although tenofovir alafenamide (TAF) and besifovir dipivoxil maleate (BSV) are potent antiviral agents in the treatment of chronic hepatitis B (CHB) infection, their renal safety profiles have not been previously compared." | 8.12 | Similar risk of kidney function decline between tenofovir alafenamide and besifovir dipivoxil maleate in chronic hepatitis B. ( Ahn, SH; Jung, CY; Kim, BS; Kim, HW; Kim, SU; Lee, HW; Lee, JI, 2022) |
| "To compare the reduction of hepatocellular carcinoma (HCC) risk between long-term treatment of entecavir and low genetic barrier antiviral agents in hepatitis B virus (HBV)-related cirrhotic patients." | 7.91 | Entecavir and Low Genetic Barrier Antiviral Agents for Hepatocellular Carcinoma in Hepatitis B Viral Cirrhosis: Propensity Score Matching. ( Li, T; Lin, C; Qu, Y; Wang, L; Wang, Y; Yang, B, 2019) |
| " She had a 7-year history of taking adefovir at 10 mg/day for chronic hepatitis B." | 7.88 | Adefovir-induced Fanconi syndrome associated with osteomalacia. ( Cha, SK; Cho, DH; Kim, HS; Kim, JH; Kim, WI; Kim, YJ; Lee, EY; Lee, JH; Lee, SM; Park, KS; Park, S, 2018) |
| "An increasing number of case reports suggest that acquired renal Fanconi syndrome may be associated with prolonged use of adefovir against hepatitis B virus." | 7.85 | Nephrolithiasis and Osteomalacia associated with adefovir-induced Fanconi syndrome in a patient with hepatitis B. ( Lin, J; Zhang, D; Zhuo, Y, 2017) |
| " This study was conducted to compare the effectiveness of lamivudine (LMV), adefovir dipivoxil (ADV), telbivudine (LdT), and entecavir (ETV) monotherapy in chronic HBeAg-negative hepatitis B patients with medium load of HBV DNA." | 7.85 | Comparing Efficacy of Lamivudine, Adefovir Dipivoxil, Telbivudine, and Entecavir in Treating Nucleoside Analogues Naïve for HBeAg-Negative Hepatitis B with Medium Hepatitis B Virus (HBV) DNA Levels. ( Han, Z; Huang, M; Liu, J; Shi, H; Xia, J; Xue, J; Zhang, S; Zhu, Z, 2017) |
| "Adefovir dipivoxil (ADV) is a nucleotide analogue that is effective against lamivudine-resistant hepatitis B virus (HBV)." | 7.80 | Rescue therapy with adefovir in decompensated liver cirrhosis patients with lamivudine-resistant hepatitis B virus. ( Cho, M; Choi, JY; Han, KH; Hwang, JS; Kim, BI; Kim, DJ; Lee, CK; Lee, HJ; Paik, SW; Suh, DJ; Um, SH; Woo, HY; Yoon, SK, 2014) |
| "Adefovir (ADV) resistance is more frequent in lamivudine (LMV)-resistant chronic hepatitis B (CHB) patients than in nucleos(t)ide analogue-naïve patients." | 7.80 | Different mechanism of selection of adefovir-resistant mutant viruses during adefovir monotherapy in patients with lamivudine-resistant chronic hepatitis B. ( Cho, YK; Cui, XJ; Jeong, SU; Song, BC, 2014) |
| "In this study, a tenofovir disoproxil fumarate (TDF) + hepatitis B immunoglobulin (HBIG) regimen was compared with lamivudine (LAM) + HBIG to determine the efficacy and safety of TDF in the prevention of hepatitis B virus (HBV) recurrence following liver transplantation (LT)." | 7.80 | The efficacy and safety of tenofovir in the prevention of hepatitis B virus recurrence following liver transplantation. ( Akarsu, M; Astarcıoğlu, İ; Hakim, GD; Karademir, S; Unek, T, 2014) |
| "Lamivudine (LAM) has been shown to prevent de novo hepatitis B virus (HBV) infection in recipients of hepatitis B core antibody (HBcAb)-positive liver transplants (LT) but primarily in small studies with limited follow-up." | 7.79 | Prevention of de novo hepatitis B in recipients of core antibody-positive livers with lamivudine and other nucleos(t)ides: a 12-year experience. ( Brown, RS; Brubaker, WD; Chang, MS; Emond, JC; Guarrera, JV; Olsen, SK; Pichardo, EM; Rosenthal-Cogan, L; Stiles, JB, 2013) |
| "This study assessed HIV-hepatitis B virus (HBV) coinfection in southern Africa in terms of prevalence, viral characteristics, occult HBV, and the effect of lamivudine- versus tenofovir-containing first-line combination antiretroviral treatment (cART) on HBV-related outcomes." | 7.79 | HIV-HBV coinfection in Southern Africa and the effect of lamivudine- versus tenofovir-containing cART on HBV outcomes. ( Botes, ME; Hamers, RL; Hoepelman, AI; Ive, P; Rinke de Wit, TF; Sigaloff, KC; Siwale, M; Stevens, WS; Wallis, CL; Zaaijer, HL, 2013) |
| "To evaluate the effects of tenofovir disoproxil fumarate (TDF) use during late pregnancy to reduce hepatitis B virus (HBV) transmission in highly viremic mothers." | 7.79 | Efficacy and safety of tenofovir disoproxil fumarate in pregnancy for the prevention of vertical transmission of HBV infection. ( Ay, M; Ayaz, C; Barcin, T; Celen, MK; Dal, MS; Dal, T; Gulsun, S; Kalkanli, S; Kaya, S; Mert, D; Yildirim, N, 2013) |
| "To evaluate the early virological response (EVR) to combined tenofovir-lamivudine or emtricitabine regimen in HBV/HIV-co-infected patients and the long-term efficacy of tenofovir." | 7.78 | Long-term outcome of primary non-responders to tenofovir therapy in HIV/HBV-co-infected patients: impact of HBV genotype G. ( Branger, M; Collin, G; Fraqueiro, G; Gervais, A; Hamet, G; Lada, O; Marcellin, P; Martinot-Peignoux, M; Matheron, S; Moucari, R; Peytavin, G; Roquebert, B, 2012) |
| "With the increasing use of tenofovir disoproxil in the management of HIV and hepatitis B, serious adverse effects, such as renal dysfunction, will inevitably increase in frequency." | 7.78 | Severe vitamin D deficiency in a patient treated for hepatitis B with tenofovir. ( Bower, M; Kumar, N; Nelson, M, 2012) |
| " entecavir (ETV) monotherapy in HBeAg-positive hepatitis B patients who fail to respond to sequential treatment with LAM and ADV." | 7.78 | Lamivudine plus adefovir vs. entecavir in HBeAg-positive hepatitis B with sequential treatment failure of lamivudine and adefovir. ( Ahn, SH; Chon, CY; Han, KH; Kim, DY; Lee, JM; Lee, MH; Park, JY; Ryu, HJ; Son, CY, 2012) |
| " We report the case of a 4-month-old infant who developed fulminant hepatitis B infection and recovered concomitant with tenofovir therapy without liver transplantation." | 7.77 | Successful tenofovir treatment for fulminant hepatitis B infection in an infant. ( Alterio, A; Comparcola, D; Corsetti, T; de Ville de Goyet, J; Diamanti, A; Iacono, A; Nobili, V; Pizzichemi, G; Sartorelli, MR; Torre, G, 2011) |
| " His HBV is unresponsive to tenofovir/emtricitabine treatment demonstrated by persistent viremia despite lacking known resistance mutations and while having an undetectable HIV-1 viral load." | 7.77 | HIV-HBV vaccine escape mutant infection with loss of HBV surface antibody and persistent HBV viremia on tenofovir/emtricitabine without antiviral resistance. ( Holodniy, M; Schirmer, P; Winters, M, 2011) |
| "Combination therapy with adefovir dipivoxil (ADV) and lamivudine (LAM) is recommended for patients infected with LAM-refractory hepatitis B virus (HBV)." | 7.76 | Add-on combination therapy with adefovir dipivoxil induces renal impairment in patients with lamivudine-refractory hepatitis B virus. ( Enomoto, M; Habu, D; Imanishi, Y; Iwai, S; Kawada, N; Kobayashi, S; Morikawa, H; Sakaguchi, H; Shiomi, S; Tamori, A, 2010) |
| "Tenofovir disoproxil fumarate (TDF) has demonstrated high antiviral efficacy in treatment-naive patients with chronic hepatitis B virus (HBV) infection but experience in nucleoside/nucleotide analogue (NA)-experienced patients is limited." | 7.76 | Long-term efficacy of tenofovir monotherapy for hepatitis B virus-monoinfected patients after failure of nucleoside/nucleotide analogues. ( Berg, T; Böcher, WO; Buggisch, P; de Man, RA; Deterding, K; Erhardt, A; Feucht, HH; Hüppe, D; Möller, B; Petersen, J; Reinders, JG; Rhode, P; Sarrazin, C; Spengler, U; Stein, K; Trojan, J; van Bömmel, F; Wasmuth, HE; Wedemeyer, H; Wiedenmann, B, 2010) |
| "This study analyzed the genotype distribution and frequency of lamivudine (LAM) and tenofovir (TDF) resistance mutations in a group of patients co-infected with HIV and hepatitis B virus (HBV)." | 7.76 | High frequency of lamivudine resistance mutations in Brazilian patients co-infected with HIV and hepatitis B. ( Gianini, RJ; Gomes-Gouvêa, MS; Leite, OM; Locarnini, S; Martins, LG; Mendes-Correa, MC; Pinho, JR; Santana, RA; Silva, MH; Sitnik, R; Uip, DE; Yuen, L, 2010) |
| "To investigate the resistance mutation patterns of hepatitis B virus(HBV) during adefovir dipivoxil (ADV) monotherapy or combination therapy after lamivudine(LAM) resistance." | 7.76 | [Resistance mutation patterns of hepatitis B virus in patients with suboptimal response to adefovir dipivoxil therapy after lamivudine resistance]. ( Du, Z; Gao, YT; Hang, T; Jing, L; Li, Y; Liu, L; Liu, T; Wu, ZP, 2010) |
| "To establish the efficacy and safety of entecavir (ETV) and/or tenofovir (TDF) in the treatment and prevention of hepatitis B virus (HBV) recurrence after liver transplantation." | 7.76 | Efficacy and safety of entecavir and/or tenofovir for prophylaxis and treatment of hepatitis B recurrence post-liver transplant. ( de la Cruz-Lombardo, J; Jiménez-Pérez, M; Lozano-Rey, JM; Mongil Poce, L; Rodrigo-López, JM; Sáez-Gómez, AB, 2010) |
| "To study the efficacy and safety of entecavir (ETV) as first-line therapy for hepatitis B virus (HBV) reactivation due to immunosuppression." | 7.76 | Entecavir as treatment for reactivation of hepatitis B in immunosuppressed patients. ( Brost, S; Eisenbach, C; Schnitzler, P; Stremmel, W, 2010) |
| "The aim of the study was to identify and characterize hepatitis B virus (HBV) polymerase gene mutations associated with ongoing HBV replication in HIV/HBV-coinfected individuals receiving tenofovir (TDF)." | 7.75 | Prolonged use of tenofovir in HIV/hepatitis B virus (HBV)-coinfected individuals does not lead to HBV polymerase mutations and is associated with persistence of lamivudine HBV polymerase mutations. ( Arrifin, N; Audsley, J; Ayres, A; Bartholomeusz, A; Crowe, SM; Lewin, SR; Locarnini, SA; Mijch, A; Sasadeusz, J; Yuen, LK, 2009) |
| "Tenofovir disoproxil fumarate (TDF) is active against hepatitis B virus (HBV) and HIV." | 7.75 | Long-term outcome of tenofovir disoproxil fumarate use against hepatitis B in an HIV-coinfected cohort. ( Alvarez-Uria, G; Ratcliffe, L; Vilar, J, 2009) |
| "Tenofovir is a new effective treatment option for patients with chronic hepatitis B, but could be potentially hampered by mutations in the hepatitis B virus (HBV) polymerase conferring drug resistance." | 7.75 | The rtA194T polymerase mutation impacts viral replication and susceptibility to tenofovir in hepatitis B e antigen-positive and hepatitis B e antigen-negative hepatitis B virus strains. ( Amini-Bavil-Olyaee, S; Herbers, U; Luedde, T; Sheldon, J; Tacke, F; Trautwein, C, 2009) |
| "The aims of this study were to select the patients with a potential for progression to hepatic failure due to lamivudine-resistant HBV and to standardize the treatment for patients with lamivudine-resistant HBV." | 7.74 | Predictive factors associated with the progression to hepatic failure caused by lamivudine-resistant HBV. ( Hino, T; Hisamochi, A; Ide, T; Koga, H; Koga, Y; Kumashiro, R; Kuwahara, R; Ogata, K; Sata, M; Takao, Y; Tanaka, K, 2008) |
| "The aim of our study was to assess the efficacy and safety of entecavir in kidney- and liver-transplant recipients with chronic hepatitis B virus (HBV) infection." | 7.74 | Entecavir therapy for adefovir-resistant hepatitis B virus infection in kidney and liver allograft recipients. ( Alric, L; Cointault, O; El Kahwaji, L; Izopet, J; Kamar, N; Lavayssière, L; Milioto, O; Rostaing, L; Sauné, K, 2008) |
| "We studied the impact of hepatitis B virus (HBV) polymerase/reverse transcriptase (Pol/Rt) heterogeneity on adefovir rescue therapy in 34 consecutive chronic hepatitis B patients with viral breakthrough during lamivudine monotherapy." | 7.74 | Emergence of hepatitis B virus quasispecies with lower susceptibility to nucleos(t)ide analogues during lamivudine treatment. ( Bonino, F; Brunetto, MR; Ciccorossi, P; Coco, B; Colombatto, P; Flichman, D; Maina, AM; Moriconi, F; Oliveri, F; Sacco, R, 2007) |
| "9-R-[2-(Phosphonomethoxy)propyl]-adenine (tenofovir) is an acyclic nucleoside phosphonate with antiviral activity against human immunodeficiency virus type 1 (HIV-1) and hepatitis B virus (HBV)." | 7.74 | Evaluation of hexadecyloxypropyl-9-R-[2-(Phosphonomethoxy)propyl]- adenine, CMX157, as a potential treatment for human immunodeficiency virus type 1 and hepatitis B virus infections. ( Aldern, KA; Almond, MR; Beadle, JR; De Clercq, E; Hostetler, KY; Korba, BE; Lampert, BM; Neyts, J; Painter, GR; Trost, LC, 2007) |
| "The most frequently used therapy for post-transplantation recurrence of hepatitis B virus (HBV) infection is lamivudine, but this drug is associated with a high resistance rate due to YMDD mutant." | 7.74 | Prophylaxis of hepatitis B recurrence in post-liver transplantation patients with lamivudine-resistant YMDD mutant. ( Cai, CJ; Chen, GH; Jiang, H; Jiang, N; Li, H; Li, X; Lu, MQ; Wang, GS; Xu, C; Yang, Y; Yi, HM; Yi, SH; Zhang, J; Zhang, JF; Zhang, Q; Zhang, YC, 2007) |
| "Emergence of a lamivudine (LAM)-resistant hepatitis B virus (HBV) with amino acid substitutions in the YMDD motif is a well-documented problem during long-term LAM therapy." | 7.74 | Successful treatment of an entecavir-resistant hepatitis B virus variant. ( Abe, H; Chayama, K; Fujimoto, Y; Hatakeyama, T; Hiraga, N; Imamura, M; Kumada, H; Maekawa, T; Mori, N; Ochi, H; Suzuki, F; Takahashi, S; Tsuge, M; Yatsuji, H, 2007) |
| "Treatment of post-transplantation recurrence of hepatitis B virus (HBV) infection despite prophylaxis with hepatitis B immunoglobulin (HBIG) and lamivudine combination therapy is not easy." | 7.74 | Adefovir dipivoxil therapy in liver transplant recipients for recurrence of hepatitis B virus infection despite lamivudine plus hepatitis B immunoglobulin prophylaxis. ( Akyildiz, M; Aydin, U; Karasu, Z; Kilic, M; Ozacar, T; Zeytunlu, M, 2007) |
| "The aim of this study was to assess the therapeutic effectiveness of adefovir dipivoxil (ADV), administered in combination with lamivudine (LAM) or as monotherapy, and the rate of resistance to ADV, in hepatitis B e antigen (HBeAg)-negative adult patients with chronic hepatitis B virus (HBV) infection and clinical or virologic resistance to LAM." | 7.74 | Adefovir and lamivudine in combination compared with adefovir monotherapy in HBeAg-negative adults with chronic hepatitis B virus infection and clinical or virologic resistance to lamivudine: a retrospective, multicenter, nonrandomized, open-label study. ( Armignacco, O; Barbarini, G; Barbaro, G; Barlattani, A; Camporiondo, MP; Ferri, F; Francavilla, R; Mazzoni, E; Mecenate, F; Nauri, L; Nosotti, L; Paffetti, A; Pellicelli, AM; Romano, M; Soccorsi, F; Struglia, C; Villani, R, 2008) |
| "Lamivudine is a safe, effective treatment for hepatitis B virus (HBV) reactivation after renal transplantation." | 7.73 | Treatment with adefovir dipivoxil in a renal transplant patient with renal insufficiency and lamivudine-resistant hepatitis B infection. ( Ceballos, M; Diaz, F; Garcia, A; Garcia, T; González, P; Mazuecos, A; Rivero, M, 2005) |
| "Antiviral treatment can be complex in decompensated hepatitis B virus (HBV) cirrhosis because of potential emergence of lamivudine-resistant mutants and worsening liver function, and to multifactorial nephrotoxicity." | 7.73 | Successful treatment with tenofovir in a child C cirrhotic patient with lamivudine-resistant hepatitis B virus awaiting liver transplantation. Post-transplant results. ( Cañas, C; Casais, LA; Casanova, A; Chahri, N; Figueras, J; Gornals, J; Lopez, C; Taltavull, TC; Verdura, B, 2005) |
| "Adefovir dipivoxil is effective in patients with lamivudine-resistant hepatitis B virus (HBV)." | 7.73 | [Efficacy and safety of adefovir dipivoxil in patients with decompensated liver cirrhosis with Lamivudine resistance compared to patients with compensated liver disease]. ( Choi, MS; Koh, KC; Lee, JH; Moon, W; Moon, YM; Paik, SW; Rhee, JC; Shim, SG; Yoo, BC, 2005) |
| "The susceptibility of adefovir-resistant hepatitis B virus (HBV) mutants is only reduced by 3-10-fold in in vitro studies, suggesting that virologic breakthrough and clinical deterioration are unlikely." | 7.73 | Adefovir-resistant hepatitis B can be associated with viral rebound and hepatic decompensation. ( Andreone, P; Cursaro, C; Fung, SK; Han, SH; Hussain, M; Keeffe, EB; Lok, AS; Marrero, JA; Rajender Reddy, K; Regev, A; Richtmyer, P, 2005) |
| "Progression of hepatitis B in patients with lamivudine-resistant strains is slowed down by adefovir dipivoxil (ADV)." | 7.73 | Adefovir rapidly suppresses hepatitis B in HBeAg-negative patients developing genotypic resistance to lamivudine. ( Colombo, M; Iavarone, M; Lampertico, P; Lunghi, G; Manenti, E; Viganò, M, 2005) |
| "Tenofovir disoproxil fumarate (TDF) has shown in vitro activity against both HIV and hepatitis B virus (HBV)." | 7.73 | Anti-hepatitis B virus efficacy of tenofovir disoproxil fumarate in HIV-infected patients. ( Benhamou, Y; Fleury, H; Katlama, C; Le Teuff, G; Pellegrin, I; Piketty, C; Rozenbaum, W; Trimoulet, P; Trylesinski, A; Urbinelli, R, 2006) |
| "Incomplete virological response to adefovir dipivoxil (ADV) has been observed in patients with lamivudine-resistant hepatitis B virus (HBV) infection and may be associated with developing resistance and disease progression." | 7.73 | Tenofovir for patients with lamivudine-resistant hepatitis B virus (HBV) infection and high HBV DNA level during adefovir therapy. ( Berg, T; Feucht, HH; Hüppe, D; Möller, B; Sarrazin, C; Spengler, U; van Bömmel, F; Wiedenmann, B; Zöllner, B, 2006) |
| "We report the treatment outcome in six post-renal transplant patients with lamivudine-resistant hepatitis B virus (LR-HBV) infection using adefovir dipivoxil and followed for 6 to 18 months." | 7.73 | Treatment of lamivudine-resistant hepatitis B infection in post-renal transplant patients with adefovir dipivoxil: preliminary results. ( Dassanayake, AS; de Silva, AP; de Silva, HJ; Manamperi, A, 2006) |
| "We report a patient whose cryoglobulinemic vasculitis recurred due to reactivation of lamivudine-resistant HBV." | 7.73 | Successful treatment with adefovir of one patient whose cryoglobulinemic vasculitis relapsed under lamivudine therapy and who was diagnosed to have HBV virologic breakthrough with YMDD mutations. ( Cakir, N; Midilli, K; Pamuk, ON; Umit, H, 2006) |
| " A 40-year-old liver transplant recipient with hepatitis B virus reinfection, resistance to lamivudine, and fibrosing cholestatic hepatitis complicated by terminal renal impairment and spontaneous bacterial peritonitis was treated with adefovir dipivoxil 10 mg after every dialysis." | 7.72 | Successful treatment of fibrosing cholestatic hepatitis using adefovir dipivoxil in a patient with cirrhosis and renal insufficiency. ( Barg-Hock, H; Becker, T; Bleck, JS; Bock, CT; Böker, KH; Flemming, P; Klempnauer, J; Manns, MP; Rosenau, J; Tillmann, HL; Trautwein, C, 2003) |
| "Emergence of lamivudine-resistant hepatitis B virus (HBV) is a major concern in human immunodeficiency virus (HIV) and HBV coinfected patients." | 7.72 | In vitro susceptibility of lamivudine-resistant hepatitis B virus to adefovir and tenofovir. ( Benhamou, Y; Cahour, A; Katlama, C; Lada, O; Poynard, T; Thibault, V, 2004) |
| "ADV is an effective rescue therapy for patients with lamivudine-resistant hepatitis B post-liver transplant." | 7.72 | Adefovir dipivoxil as the rescue therapy for lamivudine-resistant hepatitis B post liver transplant. ( Da Costa, M; Dan, YY; Isaac, J; Lee, HL; Lee, KH; Lee, YM; Lim, SG; Mak, K; Prabhakaran, K; Sutedja, DS; Wai, CT; Wee, A, 2004) |
| "Adefovir dipivoxil (ADV) is a nucleoside analogue that inhibits wild-type hepatitis B virus (HBV) and lamivudine-resistant HBV mutants in vitro and in vivo." | 7.72 | Adefovir dipivoxil for treatment of breakthrough hepatitis caused by lamivudine-resistant mutants of hepatitis B virus. ( Akuta, N; Arase, Y; Hosaka, T; Ikeda, K; Kobayashi, M; Kumada, H; Saitoh, S; Sezaki, H; Someya, T; Suzuki, F; Suzuki, Y; Tsubota, A, 2004) |
| "Three HIV-infected patients with chronic hepatitis B (genotype A) were switched to adefovir therapy after unsuccessful lamivudine treatment." | 7.72 | Successful therapy of hepatitis B with tenofovir in HIV-infected patients failing previous adefovir and lamivudine treatment. ( Däumer, M; Kaiser, R; Matz, B; Rockstroh, JK; Schewe, CK; Schildgen, O; Vogel, M; Weitner, L, 2004) |
| "Failure of prophylaxis for hepatitis B virus (HBV) recurrence in liver transplant patients with HBV immunoglobulin (HBIG) or lamivudine or both can be associated with rapid development of liver failure." | 7.72 | Adefovir treatment in posttransplant hepatitis B virus infection resistant to lamivudine plus hepatitis B virus immunoglobulin. ( Akay, S; Akyildiz, M; Karasu, Z; Tokat, Y, 2004) |
| "Lamivudine-resistant hepatitis B virus (HBV) is found in about 15-32% of infected patients with or without co-infection with HIV-1 after 1 year of lamivudine therapy." | 7.71 | Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study. ( Benhamou, Y; Bochet, M; Brosgart, C; Calvez, V; Fievet, MH; Fry, J; Gibbs, CS; Katlama, C; Namini, H; Poynard, T; Thibault, V; Vig, P, 2001) |
| "Oral adefovir dipivoxil (ADV) reduced viral load in transgenic mice expressing hepatitis B virus (HBV)." | 7.71 | Characterizing antiviral activity of adefovir dipivoxil in transgenic mice expressing hepatitis B virus. ( Julander, JG; Morrey, JD; Sidwell, RW, 2002) |
| " Hepatitis B immunoglobulin and adefovir dipivoxil were initiated." | 7.70 | Fulminant hepatic failure resulting from lamivudine-resistant hepatitis B virus in a renal transplant recipient: durable response after orthotopic liver transplantation on adefovir dipivoxil and hepatitis B immune globulin. ( Gibbs, CS; Howard, T; Jacobsmeyer, S; Lamy, P; Murray, A; Peters, MG; Singer, G; Xiong, X, 1999) |
| "Our aim is to selectively deliver 9-(2-phosphonylmethoxyethyl)adenine (PMEA) to parenchymal liver cells, the primary site of hepatitis B virus (HBV) infection." | 7.70 | Carrier-mediated delivery of 9-(2-phosphonylmethoxyethyl)adenine to parenchymal liver cells: a novel therapeutic approach for hepatitis B. ( Balzarini, J; Biessen, EA; Bijsterbosch, MK; de Vrueh, RL; Rump, ET; van Berkel, TJ; van De Bilt, E; van Veghel, R, 2000) |
| "Among 3656 highly viremic mothers treated with TDF, hepatitis B virus DNA suppression to the levels <200,000 IU/mL at delivery was achieved in 34% to 100% of mothers." | 7.01 | The Use of Tenofovir Disoproxil Fumarate and Tenofovir Alafenamide for Preventing Vertical Transmission of Hepatitis B. ( Deng, Y; Pan, CQ; Park, J; Zhu, L, 2023) |
| " However, greater adverse effects on renal function were observed for TDF than ETV at 60 months compared to 12 months." | 7.01 | Renal and bone side effects of long-term use of entecavir, tenofovir disoproxil fumarate, and tenofovir alafenamide fumarate in patients with Hepatitis B: a network meta-analysis. ( Liu, S; Liu, Z; Ma, X; Xin, Y; Zhao, Z, 2023) |
| " In conclusion, a combination of LAM and ADV initiated at the time of wait listing provides safe and effective protection against recurrent HBV infection without the high costs and inconvenience associated with long-term HBIG therapy." | 6.78 | Combination of lamivudine and adefovir without hepatitis B immune globulin is safe and effective prophylaxis against hepatitis B virus recurrence in hepatitis B surface antigen-positive liver transplant candidates. ( Angus, PW; Gane, EJ; McCaughan, GW; Patterson, S; Strasser, SI, 2013) |
| "Long-term safety of treatment with hepatitis B virus (HBV) polymerase inhibitors is a concern." | 6.77 | Renal function during treatment with adefovir plus peginterferon alfa-2a vs either drug alone in hepatitis B/D co-infection. ( Bozkaya, H; Cakaloglu, Y; Chatzikyrkou, C; Dalekos, GN; Erhardt, A; Großhennig, A; Gurel, S; Manns, MP; Mederacke, I; Wedemeyer, H; Yalcin, K; Yurdaydin, C; Zachou, K; Zeuzem, S, 2012) |
| "Adefovir resistance was detected in two patients." | 6.76 | Long-term adefovir plus lamivudine therapy does not decrease creatinine clearance in HBeAg-negative chronic hepatitis B patients. ( Deutsch, M; Ketikoglou, I; Manesis, EK; Manolakopoulos, S; Mela, M; Papatheodoridis, GV; Striki, A; Tzourmakliotis, D, 2011) |
| "Following treatment of hepatitis B virus (HBV) infection with nucleos(t)ide reverse transcriptase inhibitors (NRTIs), there is a biphasic clearance of HBV, similar to that seen following treatment of human immunodeficiency virus-1 (HIV-1) and hepatitis C virus." | 6.74 | Viral dynamics of hepatitis B virus DNA in human immunodeficiency virus-1-hepatitis B virus coinfected individuals: similar effectiveness of lamivudine, tenofovir, or combination therapy. ( Avihingsanon, A; Bowden, S; Dore, GJ; Lewin, SR; Locarnini, SA; Marks, P; Matthews, G; Perelson, AS; Ribeiro, RM; Ruxrungtham, K, 2009) |
| "Adefovir dipivoxil (ADV) has shown its efficacy for treating 3TC-resistant (3TC-R) HBV in HIV-coinfected patients." | 6.73 | Efficacy and safety of adefovir dipivoxil plus pegylated interferon-alpha2a for the treatment of lamivudine-resistant hepatitis B virus infection in HIV-infected patients. ( Benhamou, Y; Dominguez, S; Duvivier, C; Ingiliz, P; Katlama, C; Poynard, T; Thibault, V; Valantin, MA, 2008) |
| " Adefovir dipivoxil (ADV) liquid suspension (GS-02-526), as a new form of oral ADV, not only has competent antiviral efficacy, but is also more convenient for patients with swallowing difficulties or patients with impaired renal function requiring dosage adjustment." | 6.50 | Liquid oral suspension adefovir dipivoxil (GS-02-526): an update on treatments for hepatitis B infection. ( Chen, EQ; Shi, Y; Tang, H; Wu, DB, 2014) |
| "Fatal lactic acidosis has been reported while on the treatment with Nucleoside/nucleotide analogues (NA) for the treatment of hepatitis B, C and HIV." | 5.48 | Tenofovir alafenamide associated fatal lactic acidosis in an autologous hematopoietic stem cell transplant recipient. ( Alsunaid, SR; Ashraf, H; Soubani, AO, 2018) |
| "The aim of this study was to demonstrate how tenofovir alafenamide (TAF) and other hepatitis B treatment drugs differentially impact lipid profiles in chronic hepatitis B patients." | 5.41 | Risk of dyslipidemia in chronic hepatitis B patients taking tenofovir alafenamide: a systematic review and meta-analysis. ( Hwang, EG; Jung, EA; Kim, SG; Kim, YS; Yoo, JJ, 2023) |
| "Tenofovir disoproxil fumarate (TDF) is a novel nucleotide reverse transcriptase inhibitor that is mainly used to treat human immunodeficiency virus (HIV) and hepatitis B virus (HBV) infections." | 5.41 | [Research progress on the effect of tenofovir disoproxil fumarate on blood lipid profile]. ( Duan, YQ; Hu, P, 2023) |
| "Adefovir dipivoxil (AD) is a nucleotide analogue of adenosine that has achieved significant results in virologic, biochemical, and clinical parameters in lamivudine-resistant HBV-infected patients." | 5.33 | Adefovir dipivoxil therapy in liver transplant recipients with lamivudine-resistant hepatitis B virus. ( Barrios Peinado, C; Cuervas-Mons Martínez, V; Herreros de Tejada Echanojáuregui, A; López Monclús, J; Lucena de la Poza, JL; Moreno Planas, JM; Portero Azorin, F; Revilla Negro, J; Rubio González, E; Sánchez Turrión, V, 2005) |
| "Treatment with lamivudine is initially efficient in both infections but the incidence of lamivudine-resistant HBV emergence increases over time." | 5.33 | Study on the efficacy and safety of adefovir dipivoxil treatment in post-liver transplant patients with hepatitis B virus infection and lamivudine-resistant hepatitis B virus. ( Avilés, JF; Bárcena, R; Barrios, C; Buti, M; Casanovas, T; Cuervas, V; De la Mata, M; Del Campo, S; Delgado, M; Dieguez, ML; Fraga, E; Gonzalez, A; Herrero, JI; Loinaz, C; Mas, A; Moraleda, G; Moreno, JM; Muñoz, R; Otero, A; Prieto, M; Rueda, M; Sousa, JM, 2005) |
| "Adefovir was administered for six consecutive days starting one day before or four days after DHBV inoculation." | 5.31 | Inhibitory effect of adefovir on viral DNA synthesis and covalently closed circular DNA formation in duck hepatitis B virus-infected hepatocytes in vivo and in vitro. ( Delmas, J; Gibbs, C; Hantz, O; Jamard, C; Schorr, O; Trépo, C; Zoulim, F, 2002) |
| "Tenofovir alafenamide (TAF) is a new prodrug of tenofovir developed to treat patients with chronic hepatitis B virus (HBV) infection at a lower dose than tenofovir disoproxil fumarate (TDF) through more efficient delivery of tenofovir to hepatocytes." | 5.27 | 96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection. ( Agarwal, K; Ahn, SH; Bae, H; Bhardwaj, N; Brunetto, M; Buti, M; Cathcart, AL; Çelen, MK; Chan, HLY; Chuang, WL; Flaherty, JF; Fung, S; Furusyo, N; Gaggar, A; Gane, EJ; Izumi, N; Janssen, HLA; Lau, AH; Lim, YS; Lin, L; Mani Subramanian, G; Marcellin, P; Pan, CQ; Seto, WK; Shalimar, D; Sharma, M; Suri, V; Trinh, H; Yoon, KT, 2018) |
| "Adefovir, a nucleotide analog developed by John Martin, was a major breakthrough in the treatment of chronic Hepatitis B." | 5.22 | Adefovir for lamivudine-resistant hepatitis B. ( Dieterich, D; Roediger, R; Smyth, EK, 2022) |
| "Coformulated elvitegravir, cobicistat, emtricitabine, and tenofovir alafenamide (E/C/F/TAF) has high efficacy and improved renal and bone safety in multiple phase 3 trials; TAF single agent is being studied in 2 phase 3 trials in patients with chronic hepatitis B." | 5.22 | Brief Report: Efficacy and Safety of Switching to a Single-Tablet Regimen of Elvitegravir/Cobicistat/Emtricitabine/Tenofovir Alafenamide in HIV-1/Hepatitis B-Coinfected Adults. ( Benson, P; Brinson, C; Brunetta, J; Cheng, A; Crofoot, G; Das, M; Fordyce, M; Gallant, J; Garner, W; McCallister, S; Mills, A; Oka, S, 2016) |
| "In patients with hepatitis B-related HCC, adefovir antiviral therapy reduced late HCC recurrence and significantly improved overall survival after R0 hepatic resection." | 5.20 | Antiviral therapy improves postoperative survival in patients with hepatocellular carcinoma: a randomized controlled trial. ( Huang, G; Lau, WY; Pan, ZY; Shen, F; Wang, ZG; Wu, MC; Yuan, SX; Zhou, WP, 2015) |
| "We examined the durability of the virological response after discontinuing lamivudine (LVD) in chronic hepatitis B (CHB) patients with LVD-resistant hepatitis B virus (HBV), who responded to LVD plus adefovir (ADV) combination therapy, and the outcome of switching to ADV monotherapy compared to maintaining combination therapy." | 5.19 | Maintaining remission in lamivudine-resistant patients with a virological response to adefovir add-on lamivudine after stopping lamivudine therapy. ( Ahn, SH; Chon, CY; Han, KH; Kim, DY; Kim, HS; Kim, MN; Kim, SU; Lee, CK; Lee, S; Park, JY, 2014) |
| "To investigate the efficacy and safety of combined de novo lamivudine (LAM) and adefovir dipivoxil (ADV) therapy in hepatitis B virus (HBV)-related decompensated liver cirrhosis patients." | 5.17 | Efficacy of combined therapy in patients with hepatitis B virus-related decompensated cirrhosis. ( Chen, Y; Li, LJ; Lv, GC; Sheng, JF; Yang, YD; Yao, JM; Zheng, L, 2013) |
| " Tenofovir dipivoxil, a novel ester prodrug of tenofovir, can be used for treatment for hepatitis B and HIV infection and it was necessary to evaluate the effect of its treatment on carnitine homeostasis." | 5.17 | Impact on L-carnitine Homeostasis of Short-term Treatment with the Pivalate Prodrug Tenofovir Dipivoxil. ( Feng, J; Hang, TJ; Jia, YY; Lu, CT; Song, Y; Sun, Y; Wang, S; Wen, AD; Yang, ZF; Zhao, JY, 2013) |
| "To compare efficacy of combined lamivudine (LAM) and adefovir dipivoxil (ADV) therapy with that of entecavir (ETV) monotherapy for hepatitis B virus (HBV)-related decompensated liver cirrhosis." | 5.17 | De novo combined lamivudine and adefovir dipivoxil therapy vs entecavir monotherapy for hepatitis B virus-related decompensated cirrhosis. ( Chen, JY; Hu, JH; Jia, HY; Li, LJ; Lian, JS; Lu, YF; Xiang, DR; Yang, YD; Yu, L; Zeng, LY; Zhang, YM; Zheng, L, 2013) |
| " At month 24, virological response rate [hepatitis B virus (HBV) DNA <60 IU/ml] was higher in the adefovir-lamivudine combination group compared with entecavir group (56." | 5.17 | Adding adefovir vs. switching to entecavir for lamivudine-resistant chronic hepatitis B (ACE study): a 2-year follow-up randomized controlled trial. ( Baik, SK; Chae, HB; Hong, SP; Kim, CW; Kim, JH; Kim, MY; Kim, YS; Lee, CD; Lee, JI; Lee, JW; Lee, MS; Park, CK; Park, SH; Seo, YS; Um, SH; Yim, HJ; Yoon, EL, 2013) |
| "Adefovir dipivoxil has activity against wild-type and lamivudine-resistant hepatitis B virus (HBV) and is frequently used to manage HBV infection in transplant recipients." | 5.14 | Pharmacokinetics of tacrolimus co-administered with adefovir dipivoxil to liver transplant recipients. ( Brown, RS; Enejosa, J; McGuire, BM; Ramanathan, S; Schiff, E; Terrault, NA; Tran, TT; Tupper, R; Zhong, L; Zong, J, 2009) |
| "Adefovir dipivoxil (ADV) is effective in lamivudine (LAM)-resistant hepatitis B e antigen-negative (HBeAg(-)) chronic hepatitis B (CHB)." | 5.14 | Adefovir plus lamivudine are more effective than adefovir alone in lamivudine-resistant HBeAg- chronic hepatitis B patients: a 4-year study. ( Eugenidis, N; Giouleme, O; Gkisakis, D; Grammatikos, N; Katsinelos, P; Koumaras, H; Koumerkeridis, G; Mpoumponaris, A; Panderi, A; Patsiaoura, K; Theodoropoulos, K; Tziomalos, K; Vassiliadis, TG, 2010) |
| "To investigate the efficacy and safety of adefovir dipivoxil (ADV) in treating hepatic cirrhosis complicated with hepatitis B virus associated glomerulonephritis." | 5.13 | [Adefovir dipivoxil treatment of hepatic cirrhosis complicated with hepatitis B virus associated glomerulonephritis]. ( Chen, YS; Jin, ZJ; Li, DF; Qiao, LM; Zhou, J, 2008) |
| "The efficacy of long-term hepatitis B virus (HBV) treatment with tenofovir (TDF) in relation to lamivudine (LMV) resistance in HIV patients failing on LMV deserves further investigations." | 5.13 | Evidence of long-term suppression of hepatitis B virus DNA by tenofovir as rescue treatment in patients coinfected by HIV. ( Calabresi, A; Carosi, G; Cologni, G; Costarelli, S; Lapadula, G; Puoti, M; Quiros-Roldan, E; Tirelli, V; Torti, C; Zaltron, S, 2008) |
| "We previously reported that 48 weeks of combination therapy with pegylated interferon-alpha2b (PEG-IFN-alpha2b) and adefovir dipivoxil (ADV) in patients with chronic hepatitis B led to marked decreases of hepatitis B virus (HBV) covalently closed circular DNA (cccDNA) (-2." | 5.13 | Sequential combination therapy leads to biochemical and histological improvement despite low ongoing intrahepatic hepatitis B virus replication. ( Dandri, M; Fischer, C; Lutgehetmann, M; Petersen, J; Quaas, A; Volzt, T; Zankel, M, 2008) |
| "The addition of adefovir dipivoxil (ADV) to ongoing lamivudine therapy is effective against lamivudine-resistant virus in patients with hepatitis B virus (HBV) infection." | 5.12 | Changes in viral loads of lamivudine-resistant mutants and evolution of HBV sequences during adefovir dipivoxil therapy. ( Kumada, H; Nakamura, H; Suzuki, F, 2006) |
| "Adefovir dipivoxil (ADV) is a nucleotide analogue that is known to be effective for lamivudine-resistant hepatitis B virus (HBV) mutants as well as wild-type HBV." | 5.12 | Efficacy of adefovir dipivoxil in the treatment of lamivudine-resistant hepatitis B virus genotype C infection. ( Cho, YS; Kim, DH; Kim, DY; Kim, HJ; Lee, CK; Park, BK; Park, IS; Suh, JH; Won, SY, 2007) |
| "Wait-listed (n = 226) or post-liver transplantation (n = 241) chronic hepatitis B (CHB) patients with lamivudine-resistant hepatitis B virus (HBV) were treated with adefovir dipivoxil for a median of 39 and 99 weeks, respectively." | 5.12 | Adefovir dipivoxil for wait-listed and post-liver transplantation patients with lamivudine-resistant hepatitis B: final long-term results. ( Arterburn, S; Borroto-Esoda, K; Brosgart, C; Chuck, S; Colombo, M; Hadziyannis, S; Lai, CL; Neuhaus, P; Samuel, D; Schiff, E; Terrault, N; Tillmann, H; Villeneuve, JP; Zeuzem, S, 2007) |
| "Low-dose TDF monotherapy can control HBV viremia for an extended period of time without the emergence of resistance and is more potent than adefovir at the standard dosage." | 5.12 | Low-dose tenofovir is more potent than adefovir and is effective in controlling HBV viremia in chronic HBeAg-negative hepatitis B. ( Colombo, S; Del Poggio, P; Jamoletti, C; Oggionni, M; Puhalo, V; Zaccanelli, M, 2007) |
| "Adefovir monotherapy is an established treatment modality for lamivudine-experienced patients with chronic hepatitis B, but it carries a significant risk of resistance in the long term." | 5.12 | Low resistance to adefovir combined with lamivudine: a 3-year study of 145 lamivudine-resistant hepatitis B patients. ( Colombo, M; Iavarone, M; Lampertico, P; Manenti, E; Sablon, E; Viganò, M, 2007) |
| "Phase II and III clinical trials of adefovir dipivoxil (ADV) for the treatment of chronic hepatitis B have shown that this hepadnavirus polymerase inhibitor is well tolerated and effectively suppresses hepatitis B virus (HBV) replication." | 5.11 | Evolution of hepatitis B viral load and viral genome sequence during adefovir dipivoxil therapy. ( Cinquin, K; Marcellin, P; Maynard, M; Pol, S; Trépo, C; Werle, B; Zoulim, F, 2004) |
| "We describe 6 patients who were coinfected with human immunodeficiency virus (HIV) type 1 and wild-type hepatitis B virus (HBV), in whom complete and sustained antiviral activity against wild-type HBV strains was attained during 96 weeks of combination therapy with lamivudine and tenofovir." | 5.11 | Ninety-six-week efficacy of combination therapy with lamivudine and tenofovir in patients coinfected with HIV-1 and wild-type hepatitis B virus. ( Bani-Sadr, F; Molina, JM; Palmer, P; Scieux, C, 2004) |
| "The purpose of this prospective study was to evaluate the efficacy and safety of adefovir dipivoxil with or without ongoing lamivudine in decompensated lamivudine-resistant chronic hepatitis B patients." | 5.11 | Adefovir dipivoxil alone or in combination with ongoing lamivudine in patients with decompensated liver disease and lamivudine-resistant hepatitis B virus. ( Choi, WB; Chung, YH; Kim, KM; Lee, HC; Lee, YS; Lim, YS; Suh, DJ, 2005) |
| "Tenofovir (TFV) is the cornerstone of the treatment and prophylaxis of HIV infections." | 4.98 | Role of tenofovir alafenamide (TAF) in the treatment and prophylaxis of HIV and HBV infections. ( De Clercq, E, 2018) |
| "The antiviral agent tenofovir is highly effective for the treatment of HIV and hepatitis B virus infections, and the older prodrug tenofovir disoproxil fumarate (TDF) is also a component of daily preexposure prophylaxis (PrEP) to reduce the risk of HIV infection in high-risk populations." | 4.98 | Potential kidney toxicity from the antiviral drug tenofovir: new indications, new formulations, and a new prodrug. ( Asriel, B; Chan, L; Eaton, EF; Wyatt, CM, 2018) |
| "Lamivudine and tenofovir disoproxil fumarate (TDF) are both active against hepatitis B virus (HBV)." | 4.91 | Breastfeeding while taking lamivudine or tenofovir disoproxil fumarate: a review of the evidence. ( Ehrhardt, S; Guo, N; Nelson, K; Thio, CL; Xie, C, 2015) |
| "Antiviral therapy using newer nucleos(t)ide analogues with lower resistance rates such as entecavir or tenofovir could suppress hepatitis B virus (HBV) replication, improve liver function, delay or obviate the need for liver transplantation in some patients, and reduce the risk of HBV recurrence." | 4.90 | Prevention of hepatitis B virus reinfection in liver transplant recipients. ( Roche, B; Samuel, D, 2014) |
| "The use of the acyclic nucleoside phosphonates, starting with (S)-HPMPA as the prototype, yielded three clinically approved antiviral drugs, cidofovir for the treatment of CMV retinitis in AIDS patients, adefovir dipivoxil for the treatment of chronic hepatitis B and tenofovir disoproxil fumarate for the treatment of HIV infections (AIDS) and HBV infections." | 4.87 | The clinical potential of the acyclic (and cyclic) nucleoside phosphonates: the magic of the phosphonate bond. ( De Clercq, E, 2011) |
| "Randomised clinical trials addressing benefits and harms of lamivudine or adefovir dipivoxil alone or in combination with hepatitis B immunoglobulins (HBIg) for preventing recurrent HBV infection in patients who are liver transplanted due to HBV infection with or without hepatocellular carcinoma." | 4.86 | Lamivudine or adefovir dipivoxil alone or combined with immunoglobulin for preventing hepatitis B recurrence after liver transplantation. ( Guy, DG; Katz, LH; Paul, M; Tur-Kaspa, R, 2010) |
| "The established gold standard for prophylaxis against hepatitis B virus (HBV) recurrence post-liver transplant is combination hepatitis B immune globulin (HBIG) and lamivudine." | 4.85 | Post-liver transplant hepatitis B prophylaxis: the role of oral nucleos(t)ide analogues. ( Angus, PW; Patterson, SJ, 2009) |
| " In the last few years the therapeutic options in chronic hepatitis B have increased and currently six treatments are authorized: standard interferon (IFN)-alpha, pegylated interferon-alpha (PEG-IFNalpha), lamivudine, adefovir, entecavir, and telbivudine." | 4.84 | [Interferon in hepatitis B]. ( García Buey, L; González Mateos, F; Moreno Otero, R, 2008) |
| " Chronic hepatitis C can be treated preferably with a combination therapy (pegylated interferons + Ribavirin)." | 4.82 | [Hepatitis: associated diseases. Risk groups -- prevention -- treatment]. ( Maier, KP, 2003) |
| "In this article, we review modeling and interpretation of kinetics data obtained from patients with chronic hepatitis B virus infection that has been treated with lamivudine, adefovir dipivoxil, and lamivudine plus famciclovir combination therapy." | 4.82 | Hepatitis B virus kinetics and mathematical modeling. ( Perelson, AS; Ribeiro, RM, 2004) |
| "Switching to a tenofovir alafenamide (TAF)-containing regimen has been reported to be associated with body weight gain in human immunodeficiency virus-infected subjects." | 4.12 | Body weight changes in treated hepatitis B patients switching to tenofovir alafenamide ( Chuang, WL; Dai, CY; Hsieh, MY; Huang, CF; Huang, CI; Huang, JF; Liang, PC; Nguyen, MH; Trinh, S; Yeh, ML; Yu, ML, 2022) |
| "Data on long-term tenofovir alafenamide (TAF) therapy for pregnant women with active chronic hepatitis B (CHB) (immune clearance and reactivation phases, currently and previously diagnosed) and their infants are lacking." | 4.12 | Tenofovir Alafenamide for Pregnant Chinese Women With Active Chronic Hepatitis B: A Multicenter Prospective Study. ( Chen, ZM; Cui, GL; Feng, YH; Huang, S; Li, GM; Li, GT; Li, J; Li, W; Li, WZ; Li, ZQ; Liang, HX; Lin, WB; Liu, N; Liu, YM; Lv, J; Pan, YJ; Song, N; Sun, CY; Wang, FS; Wang, M; Xu, GH; Xu, JH; Yu, ZJ; Zeng, QL; Zeng, YL; Zhang, DW; Zhang, GF; Zhang, GQ; Zhang, HX; Zhang, JY; Zhou, YH, 2022) |
| "Antenatal antiviral therapy (AVT) is effective in preventing mother-to-child transmission (MTCT) in chronic hepatitis B (CHB); tenofovir disoproxil fumarate (TDF) is the preferred agent." | 4.12 | Plasma and breast milk pharmacokinetics of tenofovir alafenamide in mothers with chronic hepatitis B infection. ( Cottrell, M; Crane, H; Di Girolamo, J; Dumond, J; Gane, E; Kashuba, A; Kayes, T; Levy, MT; Lim, TH; Manandhar, S; Symonds, A, 2022) |
| "Although tenofovir alafenamide (TAF) and besifovir dipivoxil maleate (BSV) are potent antiviral agents in the treatment of chronic hepatitis B (CHB) infection, their renal safety profiles have not been previously compared." | 4.12 | Similar risk of kidney function decline between tenofovir alafenamide and besifovir dipivoxil maleate in chronic hepatitis B. ( Ahn, SH; Jung, CY; Kim, BS; Kim, HW; Kim, SU; Lee, HW; Lee, JI, 2022) |
| "To compare the reduction of hepatocellular carcinoma (HCC) risk between long-term treatment of entecavir and low genetic barrier antiviral agents in hepatitis B virus (HBV)-related cirrhotic patients." | 3.91 | Entecavir and Low Genetic Barrier Antiviral Agents for Hepatocellular Carcinoma in Hepatitis B Viral Cirrhosis: Propensity Score Matching. ( Li, T; Lin, C; Qu, Y; Wang, L; Wang, Y; Yang, B, 2019) |
| "Adefovir dipivoxil is a nucleotide analogue that is approved for treatment of chronic hepatitis B." | 3.91 | Denosumab improves clinical manifestations of hypophosphatemic osteomalacia by adefovir-induced Fanconi syndrome: a case report. ( Aso, Y; Iijima, T; Jojima, T; Kase, M; Kogai, T; Kunii, T; Sakurai, S; Shimizu, M; Usui, I, 2019) |
| "The present study aimed to prepare proliposomal formulae for improving the oral bioavailability of adefovir dipivoxil (AD), a nucleoside reverse transcriptase inhibitor effective against hepatitis B virus (HBV)." | 3.88 | Adefovir dipivoxil loaded proliposomal powders with improved hepatoprotective activity: formulation, optimization, pharmacokinetic, and biodistribution studies. ( Abdelbary, GA; Amin, MM; El Awdan, SA; Zakaria, MY, 2018) |
| " She had a 7-year history of taking adefovir at 10 mg/day for chronic hepatitis B." | 3.88 | Adefovir-induced Fanconi syndrome associated with osteomalacia. ( Cha, SK; Cho, DH; Kim, HS; Kim, JH; Kim, WI; Kim, YJ; Lee, EY; Lee, JH; Lee, SM; Park, KS; Park, S, 2018) |
| "An increasing number of case reports suggest that acquired renal Fanconi syndrome may be associated with prolonged use of adefovir against hepatitis B virus." | 3.85 | Nephrolithiasis and Osteomalacia associated with adefovir-induced Fanconi syndrome in a patient with hepatitis B. ( Lin, J; Zhang, D; Zhuo, Y, 2017) |
| " This study was conducted to compare the effectiveness of lamivudine (LMV), adefovir dipivoxil (ADV), telbivudine (LdT), and entecavir (ETV) monotherapy in chronic HBeAg-negative hepatitis B patients with medium load of HBV DNA." | 3.85 | Comparing Efficacy of Lamivudine, Adefovir Dipivoxil, Telbivudine, and Entecavir in Treating Nucleoside Analogues Naïve for HBeAg-Negative Hepatitis B with Medium Hepatitis B Virus (HBV) DNA Levels. ( Han, Z; Huang, M; Liu, J; Shi, H; Xia, J; Xue, J; Zhang, S; Zhu, Z, 2017) |
| "Low-dose hepatitis B immunoglobulin (HBIG) and nucleos(t)ides analogs (lamivudine/adefovir) used for the prevention of hepatitis B virus (HBV) recurrence after liver transplantation (LT) are associated with some risk of HBV recurrence and antiviral resistance." | 3.81 | Low-dose short-term hepatitis B immunoglobulin with high genetic barrier antivirals: the ideal post-transplant hepatitis B virus prophylaxis? ( Choudhary, NS; Goja, S; Menon, PB; Mohanka, R; Rastogi, A; Saigal, S; Saraf, N; Soin, AS, 2015) |
| "Adefovir dipivoxil (ADV) is used as first-line monotherapy or rescue therapy in chronic hepatitis B (CHB) patients." | 3.81 | A novel baseline hepatitis B virus sequencing-based strategy for predicting adefovir antiviral response. ( Chen, J; Deng, H; Guo, JJ; Huang, A; Huang, WX; Huang, Y; Shan, X; Shan, YL; Tang, N; Wang, YW; Zhang, DZ, 2015) |
| "The present report describes a case of a patient with hepatitis B virus (HBV)-human immunodeficiency virus (HIV) co-infection who was treated with tenofovir disoproxil (TDF)-based highly active antiretroviral therapy (HAART) and who achieved HBs antigen (Ag)/antibody (Ab) seroconversion." | 3.80 | An HBV-HIV co-infected patient treated with tenofovir-based therapy who achieved HBs antigen/antibody seroconversion. ( Abe, M; Hiasa, Y; Hirooka, M; Ikeda, Y; Koizumi, Y; Kumagi, T; Matsuura, B; Ochi, H; Tada, F; Takada, K; Tokumoto, Y; Watanabe, T, 2014) |
| "Adefovir dipivoxil (ADV) is a nucleotide analogue that is effective against lamivudine-resistant hepatitis B virus (HBV)." | 3.80 | Rescue therapy with adefovir in decompensated liver cirrhosis patients with lamivudine-resistant hepatitis B virus. ( Cho, M; Choi, JY; Han, KH; Hwang, JS; Kim, BI; Kim, DJ; Lee, CK; Lee, HJ; Paik, SW; Suh, DJ; Um, SH; Woo, HY; Yoon, SK, 2014) |
| "Adefovir (ADV) resistance is more frequent in lamivudine (LMV)-resistant chronic hepatitis B (CHB) patients than in nucleos(t)ide analogue-naïve patients." | 3.80 | Different mechanism of selection of adefovir-resistant mutant viruses during adefovir monotherapy in patients with lamivudine-resistant chronic hepatitis B. ( Cho, YK; Cui, XJ; Jeong, SU; Song, BC, 2014) |
| " Three of the 12 patients who were treated with combination therapy group were carriers of YMDD mutants and all three showed improvement in liver function and hepatic histology after receiving adefovir dipivoxil,instead of lamivudine,in the early stage of recurrent hepatitis B after OLT." | 3.80 | [Clinical pathology of recurrent hepatitis B after liver transplantation]. ( Jiao, Z; Yan, L; Zhang, D, 2014) |
| "In this study, a tenofovir disoproxil fumarate (TDF) + hepatitis B immunoglobulin (HBIG) regimen was compared with lamivudine (LAM) + HBIG to determine the efficacy and safety of TDF in the prevention of hepatitis B virus (HBV) recurrence following liver transplantation (LT)." | 3.80 | The efficacy and safety of tenofovir in the prevention of hepatitis B virus recurrence following liver transplantation. ( Akarsu, M; Astarcıoğlu, İ; Hakim, GD; Karademir, S; Unek, T, 2014) |
| "Lamivudine (LAM) has been shown to prevent de novo hepatitis B virus (HBV) infection in recipients of hepatitis B core antibody (HBcAb)-positive liver transplants (LT) but primarily in small studies with limited follow-up." | 3.79 | Prevention of de novo hepatitis B in recipients of core antibody-positive livers with lamivudine and other nucleos(t)ides: a 12-year experience. ( Brown, RS; Brubaker, WD; Chang, MS; Emond, JC; Guarrera, JV; Olsen, SK; Pichardo, EM; Rosenthal-Cogan, L; Stiles, JB, 2013) |
| "This study assessed HIV-hepatitis B virus (HBV) coinfection in southern Africa in terms of prevalence, viral characteristics, occult HBV, and the effect of lamivudine- versus tenofovir-containing first-line combination antiretroviral treatment (cART) on HBV-related outcomes." | 3.79 | HIV-HBV coinfection in Southern Africa and the effect of lamivudine- versus tenofovir-containing cART on HBV outcomes. ( Botes, ME; Hamers, RL; Hoepelman, AI; Ive, P; Rinke de Wit, TF; Sigaloff, KC; Siwale, M; Stevens, WS; Wallis, CL; Zaaijer, HL, 2013) |
| "To evaluate the effects of tenofovir disoproxil fumarate (TDF) use during late pregnancy to reduce hepatitis B virus (HBV) transmission in highly viremic mothers." | 3.79 | Efficacy and safety of tenofovir disoproxil fumarate in pregnancy for the prevention of vertical transmission of HBV infection. ( Ay, M; Ayaz, C; Barcin, T; Celen, MK; Dal, MS; Dal, T; Gulsun, S; Kalkanli, S; Kaya, S; Mert, D; Yildirim, N, 2013) |
| "To investigate the molecular mechanisms underlying the influence of DNA polymerase from different genotypes of hepatitis B virus (HBV) on the binding affinity of adefovir (ADV)." | 3.79 | Binding sensitivity of adefovir to the polymerase from different genotypes of HBV: molecular modeling, docking and dynamics simulation studies. ( Du, Y; Huang, AL; Jiang, HL; Li, J; Liu, X; Luo, XM; Shen, QC; Zheng, MY, 2013) |
| "To evaluate the early virological response (EVR) to combined tenofovir-lamivudine or emtricitabine regimen in HBV/HIV-co-infected patients and the long-term efficacy of tenofovir." | 3.78 | Long-term outcome of primary non-responders to tenofovir therapy in HIV/HBV-co-infected patients: impact of HBV genotype G. ( Branger, M; Collin, G; Fraqueiro, G; Gervais, A; Hamet, G; Lada, O; Marcellin, P; Martinot-Peignoux, M; Matheron, S; Moucari, R; Peytavin, G; Roquebert, B, 2012) |
| "With the increasing use of tenofovir disoproxil in the management of HIV and hepatitis B, serious adverse effects, such as renal dysfunction, will inevitably increase in frequency." | 3.78 | Severe vitamin D deficiency in a patient treated for hepatitis B with tenofovir. ( Bower, M; Kumar, N; Nelson, M, 2012) |
| " Treatment naive chronic hepatitis C patients should initially receive pegylated interferon and ribavirin dual combination therapy." | 3.78 | [Hungarian consensus guideline for the diagnosis and treatment of B, C, and D viral hepatitis]. ( Gervain, J; Horváth, G; Hunyady, B; Makara, M; Pár, A; Szalay, F; Telegdy, L; Tornai, I; Ujhelyi, E, 2012) |
| " entecavir (ETV) monotherapy in HBeAg-positive hepatitis B patients who fail to respond to sequential treatment with LAM and ADV." | 3.78 | Lamivudine plus adefovir vs. entecavir in HBeAg-positive hepatitis B with sequential treatment failure of lamivudine and adefovir. ( Ahn, SH; Chon, CY; Han, KH; Kim, DY; Lee, JM; Lee, MH; Park, JY; Ryu, HJ; Son, CY, 2012) |
| " Genotype has been compared with treatment response in children infected perinatally with hepatitis B following treatment with oral antiviral drugs (lamivudine or adefovir) or interferon (IFN) alone and with prednisolone priming (Pred/IFN)." | 3.78 | Does genotype predict response to treatment in children infected with hepatitis B perinatally? ( Boxall, E; Kaskar, S; Kelly, D; Sira, J; Workman, J, 2012) |
| "Data on the efficacy of lamivudine (LAM)-, tenofovir (TDF)- and emtricitabine (FTC)-based antiretroviral therapy (HAART) in HBV-HIV coinfection are limited." | 3.78 | Five-year on-treatment efficacy of lamivudine-, tenofovir- and tenofovir + emtricitabine-based HAART in HBV-HIV-coinfected patients. ( Grabmeier-Pfistershammer, K; Kosi, L; Payer, BA; Peck-Radosavljevic, M; Reiberger, T; Rieger, A; Strassl, R, 2012) |
| " We report the case of a 4-month-old infant who developed fulminant hepatitis B infection and recovered concomitant with tenofovir therapy without liver transplantation." | 3.77 | Successful tenofovir treatment for fulminant hepatitis B infection in an infant. ( Alterio, A; Comparcola, D; Corsetti, T; de Ville de Goyet, J; Diamanti, A; Iacono, A; Nobili, V; Pizzichemi, G; Sartorelli, MR; Torre, G, 2011) |
| " His HBV is unresponsive to tenofovir/emtricitabine treatment demonstrated by persistent viremia despite lacking known resistance mutations and while having an undetectable HIV-1 viral load." | 3.77 | HIV-HBV vaccine escape mutant infection with loss of HBV surface antibody and persistent HBV viremia on tenofovir/emtricitabine without antiviral resistance. ( Holodniy, M; Schirmer, P; Winters, M, 2011) |
| "Combination therapy with adefovir dipivoxil (ADV) and lamivudine (LAM) is recommended for patients infected with LAM-refractory hepatitis B virus (HBV)." | 3.76 | Add-on combination therapy with adefovir dipivoxil induces renal impairment in patients with lamivudine-refractory hepatitis B virus. ( Enomoto, M; Habu, D; Imanishi, Y; Iwai, S; Kawada, N; Kobayashi, S; Morikawa, H; Sakaguchi, H; Shiomi, S; Tamori, A, 2010) |
| "Tenofovir disoproxil fumarate (TDF) has demonstrated high antiviral efficacy in treatment-naive patients with chronic hepatitis B virus (HBV) infection but experience in nucleoside/nucleotide analogue (NA)-experienced patients is limited." | 3.76 | Long-term efficacy of tenofovir monotherapy for hepatitis B virus-monoinfected patients after failure of nucleoside/nucleotide analogues. ( Berg, T; Böcher, WO; Buggisch, P; de Man, RA; Deterding, K; Erhardt, A; Feucht, HH; Hüppe, D; Möller, B; Petersen, J; Reinders, JG; Rhode, P; Sarrazin, C; Spengler, U; Stein, K; Trojan, J; van Bömmel, F; Wasmuth, HE; Wedemeyer, H; Wiedenmann, B, 2010) |
| "Pre-existing antiviral-resistant hepatitis B virus (HBV) has been associated with primary non-response to lamivudine treatment in patients with chronic hepatitis B, but little is known of the capacity for resistant HBV to cause primary infection." | 3.76 | Acute hepatitis B infection associated with drug-resistant hepatitis B virus. ( Chen, L; Liu, Y; Ren, X; Si, L; Wang, Y; Xu, D; Xu, T; Xu, Z; Zhao, J; Zhong, Y, 2010) |
| "This study analyzed the genotype distribution and frequency of lamivudine (LAM) and tenofovir (TDF) resistance mutations in a group of patients co-infected with HIV and hepatitis B virus (HBV)." | 3.76 | High frequency of lamivudine resistance mutations in Brazilian patients co-infected with HIV and hepatitis B. ( Gianini, RJ; Gomes-Gouvêa, MS; Leite, OM; Locarnini, S; Martins, LG; Mendes-Correa, MC; Pinho, JR; Santana, RA; Silva, MH; Sitnik, R; Uip, DE; Yuen, L, 2010) |
| "To investigate the resistance mutation patterns of hepatitis B virus(HBV) during adefovir dipivoxil (ADV) monotherapy or combination therapy after lamivudine(LAM) resistance." | 3.76 | [Resistance mutation patterns of hepatitis B virus in patients with suboptimal response to adefovir dipivoxil therapy after lamivudine resistance]. ( Du, Z; Gao, YT; Hang, T; Jing, L; Li, Y; Liu, L; Liu, T; Wu, ZP, 2010) |
| "To establish the efficacy and safety of entecavir (ETV) and/or tenofovir (TDF) in the treatment and prevention of hepatitis B virus (HBV) recurrence after liver transplantation." | 3.76 | Efficacy and safety of entecavir and/or tenofovir for prophylaxis and treatment of hepatitis B recurrence post-liver transplant. ( de la Cruz-Lombardo, J; Jiménez-Pérez, M; Lozano-Rey, JM; Mongil Poce, L; Rodrigo-López, JM; Sáez-Gómez, AB, 2010) |
| "To study the efficacy and safety of entecavir (ETV) as first-line therapy for hepatitis B virus (HBV) reactivation due to immunosuppression." | 3.76 | Entecavir as treatment for reactivation of hepatitis B in immunosuppressed patients. ( Brost, S; Eisenbach, C; Schnitzler, P; Stremmel, W, 2010) |
| "The aim of the study was to identify and characterize hepatitis B virus (HBV) polymerase gene mutations associated with ongoing HBV replication in HIV/HBV-coinfected individuals receiving tenofovir (TDF)." | 3.75 | Prolonged use of tenofovir in HIV/hepatitis B virus (HBV)-coinfected individuals does not lead to HBV polymerase mutations and is associated with persistence of lamivudine HBV polymerase mutations. ( Arrifin, N; Audsley, J; Ayres, A; Bartholomeusz, A; Crowe, SM; Lewin, SR; Locarnini, SA; Mijch, A; Sasadeusz, J; Yuen, LK, 2009) |
| "Tenofovir disoproxil fumarate (TDF) is active against hepatitis B virus (HBV) and HIV." | 3.75 | Long-term outcome of tenofovir disoproxil fumarate use against hepatitis B in an HIV-coinfected cohort. ( Alvarez-Uria, G; Ratcliffe, L; Vilar, J, 2009) |
| "Tenofovir is a new effective treatment option for patients with chronic hepatitis B, but could be potentially hampered by mutations in the hepatitis B virus (HBV) polymerase conferring drug resistance." | 3.75 | The rtA194T polymerase mutation impacts viral replication and susceptibility to tenofovir in hepatitis B e antigen-positive and hepatitis B e antigen-negative hepatitis B virus strains. ( Amini-Bavil-Olyaee, S; Herbers, U; Luedde, T; Sheldon, J; Tacke, F; Trautwein, C, 2009) |
| "Adefovir dipivoxil (ADV) is effective for treatment of chronic hepatitis B virus (HBV) infection, but long-time ADV therapy leads to drug resistance because of HBV reverse transcriptase mutations." | 3.75 | Detection of the rtA181V/T and rtN236T mutations associated with resistance to adefovir dipivoxil using a ligase detection reaction assay. ( Chen, M; Pu, XK; Ruan, LH; Shen, HY; Wang, YZ; Wu, GX; Xiao, JH; Zhang, HY, 2009) |
| "The aims of this study were to select the patients with a potential for progression to hepatic failure due to lamivudine-resistant HBV and to standardize the treatment for patients with lamivudine-resistant HBV." | 3.74 | Predictive factors associated with the progression to hepatic failure caused by lamivudine-resistant HBV. ( Hino, T; Hisamochi, A; Ide, T; Koga, H; Koga, Y; Kumashiro, R; Kuwahara, R; Ogata, K; Sata, M; Takao, Y; Tanaka, K, 2008) |
| "The aim of our study was to assess the efficacy and safety of entecavir in kidney- and liver-transplant recipients with chronic hepatitis B virus (HBV) infection." | 3.74 | Entecavir therapy for adefovir-resistant hepatitis B virus infection in kidney and liver allograft recipients. ( Alric, L; Cointault, O; El Kahwaji, L; Izopet, J; Kamar, N; Lavayssière, L; Milioto, O; Rostaing, L; Sauné, K, 2008) |
| "We studied the impact of hepatitis B virus (HBV) polymerase/reverse transcriptase (Pol/Rt) heterogeneity on adefovir rescue therapy in 34 consecutive chronic hepatitis B patients with viral breakthrough during lamivudine monotherapy." | 3.74 | Emergence of hepatitis B virus quasispecies with lower susceptibility to nucleos(t)ide analogues during lamivudine treatment. ( Bonino, F; Brunetto, MR; Ciccorossi, P; Coco, B; Colombatto, P; Flichman, D; Maina, AM; Moriconi, F; Oliveri, F; Sacco, R, 2007) |
| "Adefovir dipivoxil is a nucleotide prodrug approved for the treatment of chronic hepatitis B." | 3.74 | In vitro susceptibility of adefovir-associated hepatitis B virus polymerase mutations to other antiviral agents. ( Delaney, WE; Miller, M; Qi, X; Xiong, S; Yang, H, 2007) |
| "9-R-[2-(Phosphonomethoxy)propyl]-adenine (tenofovir) is an acyclic nucleoside phosphonate with antiviral activity against human immunodeficiency virus type 1 (HIV-1) and hepatitis B virus (HBV)." | 3.74 | Evaluation of hexadecyloxypropyl-9-R-[2-(Phosphonomethoxy)propyl]- adenine, CMX157, as a potential treatment for human immunodeficiency virus type 1 and hepatitis B virus infections. ( Aldern, KA; Almond, MR; Beadle, JR; De Clercq, E; Hostetler, KY; Korba, BE; Lampert, BM; Neyts, J; Painter, GR; Trost, LC, 2007) |
| "The most frequently used therapy for post-transplantation recurrence of hepatitis B virus (HBV) infection is lamivudine, but this drug is associated with a high resistance rate due to YMDD mutant." | 3.74 | Prophylaxis of hepatitis B recurrence in post-liver transplantation patients with lamivudine-resistant YMDD mutant. ( Cai, CJ; Chen, GH; Jiang, H; Jiang, N; Li, H; Li, X; Lu, MQ; Wang, GS; Xu, C; Yang, Y; Yi, HM; Yi, SH; Zhang, J; Zhang, JF; Zhang, Q; Zhang, YC, 2007) |
| "Emergence of a lamivudine (LAM)-resistant hepatitis B virus (HBV) with amino acid substitutions in the YMDD motif is a well-documented problem during long-term LAM therapy." | 3.74 | Successful treatment of an entecavir-resistant hepatitis B virus variant. ( Abe, H; Chayama, K; Fujimoto, Y; Hatakeyama, T; Hiraga, N; Imamura, M; Kumada, H; Maekawa, T; Mori, N; Ochi, H; Suzuki, F; Takahashi, S; Tsuge, M; Yatsuji, H, 2007) |
| "Treatment of post-transplantation recurrence of hepatitis B virus (HBV) infection despite prophylaxis with hepatitis B immunoglobulin (HBIG) and lamivudine combination therapy is not easy." | 3.74 | Adefovir dipivoxil therapy in liver transplant recipients for recurrence of hepatitis B virus infection despite lamivudine plus hepatitis B immunoglobulin prophylaxis. ( Akyildiz, M; Aydin, U; Karasu, Z; Kilic, M; Ozacar, T; Zeytunlu, M, 2007) |
| "The aim of this study was to assess the therapeutic effectiveness of adefovir dipivoxil (ADV), administered in combination with lamivudine (LAM) or as monotherapy, and the rate of resistance to ADV, in hepatitis B e antigen (HBeAg)-negative adult patients with chronic hepatitis B virus (HBV) infection and clinical or virologic resistance to LAM." | 3.74 | Adefovir and lamivudine in combination compared with adefovir monotherapy in HBeAg-negative adults with chronic hepatitis B virus infection and clinical or virologic resistance to lamivudine: a retrospective, multicenter, nonrandomized, open-label study. ( Armignacco, O; Barbarini, G; Barbaro, G; Barlattani, A; Camporiondo, MP; Ferri, F; Francavilla, R; Mazzoni, E; Mecenate, F; Nauri, L; Nosotti, L; Paffetti, A; Pellicelli, AM; Romano, M; Soccorsi, F; Struglia, C; Villani, R, 2008) |
| "The efficiacy of Entecavir and Adefovir for treatment of acute hepatitis B is not known." | 3.74 | [Acute hepatitis B: is antiviral therapy indicated? Two case reports]. ( Girke, J; Manns, MP; Tillmann, HL; Wedemeyer, H; Wiegand, J, 2008) |
| "Lamivudine is a safe, effective treatment for hepatitis B virus (HBV) reactivation after renal transplantation." | 3.73 | Treatment with adefovir dipivoxil in a renal transplant patient with renal insufficiency and lamivudine-resistant hepatitis B infection. ( Ceballos, M; Diaz, F; Garcia, A; Garcia, T; González, P; Mazuecos, A; Rivero, M, 2005) |
| "Antiviral treatment can be complex in decompensated hepatitis B virus (HBV) cirrhosis because of potential emergence of lamivudine-resistant mutants and worsening liver function, and to multifactorial nephrotoxicity." | 3.73 | Successful treatment with tenofovir in a child C cirrhotic patient with lamivudine-resistant hepatitis B virus awaiting liver transplantation. Post-transplant results. ( Cañas, C; Casais, LA; Casanova, A; Chahri, N; Figueras, J; Gornals, J; Lopez, C; Taltavull, TC; Verdura, B, 2005) |
| "Adefovir dipivoxil is effective in patients with lamivudine-resistant hepatitis B virus (HBV)." | 3.73 | [Efficacy and safety of adefovir dipivoxil in patients with decompensated liver cirrhosis with Lamivudine resistance compared to patients with compensated liver disease]. ( Choi, MS; Koh, KC; Lee, JH; Moon, W; Moon, YM; Paik, SW; Rhee, JC; Shim, SG; Yoo, BC, 2005) |
| "The susceptibility of adefovir-resistant hepatitis B virus (HBV) mutants is only reduced by 3-10-fold in in vitro studies, suggesting that virologic breakthrough and clinical deterioration are unlikely." | 3.73 | Adefovir-resistant hepatitis B can be associated with viral rebound and hepatic decompensation. ( Andreone, P; Cursaro, C; Fung, SK; Han, SH; Hussain, M; Keeffe, EB; Lok, AS; Marrero, JA; Rajender Reddy, K; Regev, A; Richtmyer, P, 2005) |
| "Progression of hepatitis B in patients with lamivudine-resistant strains is slowed down by adefovir dipivoxil (ADV)." | 3.73 | Adefovir rapidly suppresses hepatitis B in HBeAg-negative patients developing genotypic resistance to lamivudine. ( Colombo, M; Iavarone, M; Lampertico, P; Lunghi, G; Manenti, E; Viganò, M, 2005) |
| "Tenofovir disoproxil fumarate (TDF) has shown in vitro activity against both HIV and hepatitis B virus (HBV)." | 3.73 | Anti-hepatitis B virus efficacy of tenofovir disoproxil fumarate in HIV-infected patients. ( Benhamou, Y; Fleury, H; Katlama, C; Le Teuff, G; Pellegrin, I; Piketty, C; Rozenbaum, W; Trimoulet, P; Trylesinski, A; Urbinelli, R, 2006) |
| "Hepatitis B immunoglobulin with lamivudine prophylaxis (LAM/HBIG) is effective in preventing Hepatitis B (HBV) recurrence posttransplant but is expensive and inconvenient." | 3.73 | Prophylactic strategies for hepatitis B patients undergoing liver transplant: a cost-effectiveness analysis. ( Dan, YY; Lim, SG; Wai, CT; Yeoh, KG, 2006) |
| "Incomplete virological response to adefovir dipivoxil (ADV) has been observed in patients with lamivudine-resistant hepatitis B virus (HBV) infection and may be associated with developing resistance and disease progression." | 3.73 | Tenofovir for patients with lamivudine-resistant hepatitis B virus (HBV) infection and high HBV DNA level during adefovir therapy. ( Berg, T; Feucht, HH; Hüppe, D; Möller, B; Sarrazin, C; Spengler, U; van Bömmel, F; Wiedenmann, B; Zöllner, B, 2006) |
| "We report the treatment outcome in six post-renal transplant patients with lamivudine-resistant hepatitis B virus (LR-HBV) infection using adefovir dipivoxil and followed for 6 to 18 months." | 3.73 | Treatment of lamivudine-resistant hepatitis B infection in post-renal transplant patients with adefovir dipivoxil: preliminary results. ( Dassanayake, AS; de Silva, AP; de Silva, HJ; Manamperi, A, 2006) |
| "We report a patient whose cryoglobulinemic vasculitis recurred due to reactivation of lamivudine-resistant HBV." | 3.73 | Successful treatment with adefovir of one patient whose cryoglobulinemic vasculitis relapsed under lamivudine therapy and who was diagnosed to have HBV virologic breakthrough with YMDD mutations. ( Cakir, N; Midilli, K; Pamuk, ON; Umit, H, 2006) |
| " A 40-year-old liver transplant recipient with hepatitis B virus reinfection, resistance to lamivudine, and fibrosing cholestatic hepatitis complicated by terminal renal impairment and spontaneous bacterial peritonitis was treated with adefovir dipivoxil 10 mg after every dialysis." | 3.72 | Successful treatment of fibrosing cholestatic hepatitis using adefovir dipivoxil in a patient with cirrhosis and renal insufficiency. ( Barg-Hock, H; Becker, T; Bleck, JS; Bock, CT; Böker, KH; Flemming, P; Klempnauer, J; Manns, MP; Rosenau, J; Tillmann, HL; Trautwein, C, 2003) |
| "3%) patients developed hepatitis B virus DNA breakthrough 47 and 53 months, respectively, after transplantation, but they remained well after treatment with adefovir." | 3.72 | Live-donor liver transplantation for acute-on-chronic hepatitis B liver failure. ( Fan, ST; Lai, CL; Liu, CL; Lo, CM; Wei, WI; Wong, J; Yong, BH, 2003) |
| "Emergence of lamivudine-resistant hepatitis B virus (HBV) is a major concern in human immunodeficiency virus (HIV) and HBV coinfected patients." | 3.72 | In vitro susceptibility of lamivudine-resistant hepatitis B virus to adefovir and tenofovir. ( Benhamou, Y; Cahour, A; Katlama, C; Lada, O; Poynard, T; Thibault, V, 2004) |
| "Hepatitis B virus (HBV) recurrence following liver transplantation (LTx) has been controllable primarily with the use of hepatitis B immune globulin (HBIg) and lamivudine (LAM)." | 3.72 | Outcomes in liver transplant recipients with hepatitis B virus: resistance and recurrence patterns from a large transplant center over the last decade. ( De Medina, M; Madariaga, J; Montalbano, M; Neff, GW; Nery, C; Nery, J; O'brien, CB; Ruiz, P; Safdar, K; Schiff, ER; Shire, N; Tzakis, AG, 2004) |
| "Resistant hepatitis B virus (HBV) strains develop in 30% of liver transplant recipients treated with lamivudine within 2 years from the time of transplantation." | 3.72 | Tenofovir therapy for lamivudine resistance following liver transplantation. ( Duncan, R; Lau, DT; Madariaga, JR; Montalbano, M; Muslu, H; Neff, GW; Nery, C; Nery, J; O'Brien, CB; Ruiz, P; Safdar, K; Schiff, ER; Shire, NJ; Tzakis, AG, 2004) |
| "ADV is an effective rescue therapy for patients with lamivudine-resistant hepatitis B post-liver transplant." | 3.72 | Adefovir dipivoxil as the rescue therapy for lamivudine-resistant hepatitis B post liver transplant. ( Da Costa, M; Dan, YY; Isaac, J; Lee, HL; Lee, KH; Lee, YM; Lim, SG; Mak, K; Prabhakaran, K; Sutedja, DS; Wai, CT; Wee, A, 2004) |
| "Adefovir dipivoxil (ADV) is a nucleoside analogue that inhibits wild-type hepatitis B virus (HBV) and lamivudine-resistant HBV mutants in vitro and in vivo." | 3.72 | Adefovir dipivoxil for treatment of breakthrough hepatitis caused by lamivudine-resistant mutants of hepatitis B virus. ( Akuta, N; Arase, Y; Hosaka, T; Ikeda, K; Kobayashi, M; Kumada, H; Saitoh, S; Sezaki, H; Someya, T; Suzuki, F; Suzuki, Y; Tsubota, A, 2004) |
| "Three HIV-infected patients with chronic hepatitis B (genotype A) were switched to adefovir therapy after unsuccessful lamivudine treatment." | 3.72 | Successful therapy of hepatitis B with tenofovir in HIV-infected patients failing previous adefovir and lamivudine treatment. ( Däumer, M; Kaiser, R; Matz, B; Rockstroh, JK; Schewe, CK; Schildgen, O; Vogel, M; Weitner, L, 2004) |
| "Failure of prophylaxis for hepatitis B virus (HBV) recurrence in liver transplant patients with HBV immunoglobulin (HBIG) or lamivudine or both can be associated with rapid development of liver failure." | 3.72 | Adefovir treatment in posttransplant hepatitis B virus infection resistant to lamivudine plus hepatitis B virus immunoglobulin. ( Akay, S; Akyildiz, M; Karasu, Z; Tokat, Y, 2004) |
| " Lamivudine is safe and effective in liver transplant recipients with recurrent hepatitis B virus (HBV) infection caused by wild-type virus or failure of hepatitis B immunoglobulin therapy." | 3.71 | Treatment of recurrent hepatitis B infection in liver transplant recipients. ( Terrault, NA, 2002) |
| "Lamivudine-resistant hepatitis B virus (HBV) is found in about 15-32% of infected patients with or without co-infection with HIV-1 after 1 year of lamivudine therapy." | 3.71 | Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study. ( Benhamou, Y; Bochet, M; Brosgart, C; Calvez, V; Fievet, MH; Fry, J; Gibbs, CS; Katlama, C; Namini, H; Poynard, T; Thibault, V; Vig, P, 2001) |
| "Oral adefovir dipivoxil (ADV) reduced viral load in transgenic mice expressing hepatitis B virus (HBV)." | 3.71 | Characterizing antiviral activity of adefovir dipivoxil in transgenic mice expressing hepatitis B virus. ( Julander, JG; Morrey, JD; Sidwell, RW, 2002) |
| " Hepatitis B immunoglobulin and adefovir dipivoxil were initiated." | 3.70 | Fulminant hepatic failure resulting from lamivudine-resistant hepatitis B virus in a renal transplant recipient: durable response after orthotopic liver transplantation on adefovir dipivoxil and hepatitis B immune globulin. ( Gibbs, CS; Howard, T; Jacobsmeyer, S; Lamy, P; Murray, A; Peters, MG; Singer, G; Xiong, X, 1999) |
| "Our aim is to selectively deliver 9-(2-phosphonylmethoxyethyl)adenine (PMEA) to parenchymal liver cells, the primary site of hepatitis B virus (HBV) infection." | 3.70 | Carrier-mediated delivery of 9-(2-phosphonylmethoxyethyl)adenine to parenchymal liver cells: a novel therapeutic approach for hepatitis B. ( Balzarini, J; Biessen, EA; Bijsterbosch, MK; de Vrueh, RL; Rump, ET; van Berkel, TJ; van De Bilt, E; van Veghel, R, 2000) |
| "The therapeutic potential of the antiretroviral drug 9-(2-phosphonylmethoxyethyl)adenine (PMEA, adefovir) for the treatment of human immunodeficiency virus (HIV)- and human hepatitis B virus (HBV) infections is currently being explored in advanced clinical trials." | 3.70 | Mechanistic study on the cytostatic and tumor cell differentiation-inducing properties of 9-(2-phosphonylmethoxyethyl)adenine (PMEA, adefovir)-collected publications. ( Hatse, S, 2000) |
| "Among 3656 highly viremic mothers treated with TDF, hepatitis B virus DNA suppression to the levels <200,000 IU/mL at delivery was achieved in 34% to 100% of mothers." | 3.01 | The Use of Tenofovir Disoproxil Fumarate and Tenofovir Alafenamide for Preventing Vertical Transmission of Hepatitis B. ( Deng, Y; Pan, CQ; Park, J; Zhu, L, 2023) |
| " However, greater adverse effects on renal function were observed for TDF than ETV at 60 months compared to 12 months." | 3.01 | Renal and bone side effects of long-term use of entecavir, tenofovir disoproxil fumarate, and tenofovir alafenamide fumarate in patients with Hepatitis B: a network meta-analysis. ( Liu, S; Liu, Z; Ma, X; Xin, Y; Zhao, Z, 2023) |
| " In conclusion, a combination of LAM and ADV initiated at the time of wait listing provides safe and effective protection against recurrent HBV infection without the high costs and inconvenience associated with long-term HBIG therapy." | 2.78 | Combination of lamivudine and adefovir without hepatitis B immune globulin is safe and effective prophylaxis against hepatitis B virus recurrence in hepatitis B surface antigen-positive liver transplant candidates. ( Angus, PW; Gane, EJ; McCaughan, GW; Patterson, S; Strasser, SI, 2013) |
| " In addition, the bioavailability of tenofovir dipivoxil fumarate was evaluated in healthy male fasted subjects after a single comparatively equivalent dose." | 2.77 | Relative bioavailability study of a novel prodrug of tenofovir, tenofovir dipivoxil fumarate, in healthy male fasted volunteers. ( Ding, Y; Jia, Y; Liu, W; Lu, C; Song, Y; Sun, X; Wen, A; Yang, J, 2012) |
| "Long-term safety of treatment with hepatitis B virus (HBV) polymerase inhibitors is a concern." | 2.77 | Renal function during treatment with adefovir plus peginterferon alfa-2a vs either drug alone in hepatitis B/D co-infection. ( Bozkaya, H; Cakaloglu, Y; Chatzikyrkou, C; Dalekos, GN; Erhardt, A; Großhennig, A; Gurel, S; Manns, MP; Mederacke, I; Wedemeyer, H; Yalcin, K; Yurdaydin, C; Zachou, K; Zeuzem, S, 2012) |
| "Adefovir resistance was detected in two patients." | 2.76 | Long-term adefovir plus lamivudine therapy does not decrease creatinine clearance in HBeAg-negative chronic hepatitis B patients. ( Deutsch, M; Ketikoglou, I; Manesis, EK; Manolakopoulos, S; Mela, M; Papatheodoridis, GV; Striki, A; Tzourmakliotis, D, 2011) |
| "Following treatment of hepatitis B virus (HBV) infection with nucleos(t)ide reverse transcriptase inhibitors (NRTIs), there is a biphasic clearance of HBV, similar to that seen following treatment of human immunodeficiency virus-1 (HIV-1) and hepatitis C virus." | 2.74 | Viral dynamics of hepatitis B virus DNA in human immunodeficiency virus-1-hepatitis B virus coinfected individuals: similar effectiveness of lamivudine, tenofovir, or combination therapy. ( Avihingsanon, A; Bowden, S; Dore, GJ; Lewin, SR; Locarnini, SA; Marks, P; Matthews, G; Perelson, AS; Ribeiro, RM; Ruxrungtham, K, 2009) |
| "Adefovir dipivoxil (ADV) has shown its efficacy for treating 3TC-resistant (3TC-R) HBV in HIV-coinfected patients." | 2.73 | Efficacy and safety of adefovir dipivoxil plus pegylated interferon-alpha2a for the treatment of lamivudine-resistant hepatitis B virus infection in HIV-infected patients. ( Benhamou, Y; Dominguez, S; Duvivier, C; Ingiliz, P; Katlama, C; Poynard, T; Thibault, V; Valantin, MA, 2008) |
| "The role of hepatocellular carcinoma (HCC) in HBV recurrence remains unclear." | 2.73 | Hepatocellular carcinoma is associated with an increased risk of hepatitis B virus recurrence after liver transplantation. ( Brechot, C; Castaing, D; Dussaix, E; Fallot, G; Faria, LC; Ferrari, TC; Gigou, M; Guettier, C; Roche, B; Roque-Afonso, AM; Samuel, D; Sebagh, M, 2008) |
| " Adefovir dipivoxil (ADV) liquid suspension (GS-02-526), as a new form of oral ADV, not only has competent antiviral efficacy, but is also more convenient for patients with swallowing difficulties or patients with impaired renal function requiring dosage adjustment." | 2.50 | Liquid oral suspension adefovir dipivoxil (GS-02-526): an update on treatments for hepatitis B infection. ( Chen, EQ; Shi, Y; Tang, H; Wu, DB, 2014) |
| "Several drugs are available to treat hepatitis B." | 2.49 | Suppression of HBV by tenofovir in HBV/HIV coinfected patients: a systematic review and meta-analysis. ( Bani-Sadr, F; de Vries-Sluijs, T; Dunn, D; Gilson, R; Jain, MK; Kuzushita, N; Mauss, S; Nüesch, R; Núñez, M; Peters, M; Pillay, D; Price, H; Reiberger, T; Stephan, C; Tan, L, 2013) |
| " For patients receiving HBIG and LAM, a lower frequency of HBV recurrence was associated with a high HBIG dosage (≥10,000 IU/day) versus a low HBIG dosage (<10,000 IU/day) during the first week after LT [3." | 2.47 | Hepatitis B immunoglobulin and/or nucleos(t)ide analogues for prophylaxis against hepatitis b virus recurrence after liver transplantation: a systematic review. ( Akriviadis, E; Cholongitas, E; Goulis, J; Papatheodoridis, GV, 2011) |
| "Five lamivudine patients were switched to tenofovir and in another one adefovir dipivoxil were added." | 2.46 | Inflammatory bowel disease and hepatitis B and C in Western Balkans: a referral centre study and review of the literature. ( Christodoulou, DK; Katsanos, KH; Tsianos, EV; Tsianos, VE; Vagias, I; Zervou, E; Zioga, H; Zois, CD, 2010) |
| " The long-term administration of hepatitis B immunoglobulin (HBIG) dramatically reduced this risk." | 2.45 | Liver transplantation for hepatitis B virus. Pre-emptive and peri-operative prophylaxis. ( Mas, A, 2009) |
| "In patients not requiring HAART, treatment of hepatitis B should preferably consist of drugs without activity against HIV, such as pegylated interferon or adefovir." | 2.44 | [Hepatitis B in patients with HIV infection]. ( Barreiro, P; García-Samaniego, J; Martín-Carbonero, L, 2008) |
| "Hepatitis A is an acute disease, while patients infected by hepatitis B and hepatitis C viruses are likely to develop chronical infections and severe complications (cancer, cirrhosis)." | 2.44 | [The ABC of viral hepatitis]. ( Van Bambeke, F, 2008) |
| " In the near future the most realistic therapeutic option for the majority of patients with CHB will be long-term use of these new, more potent antiviral drugs, if they can achieve good safety profiles while maintaining low resistance rates at affordable costs." | 2.43 | Drugs in development for hepatitis B. ( Buti, M; Esteban, R, 2005) |
| "In the past, an unacceptable HBV recurrence rate with a high rate of graft loss was noted." | 2.43 | Prevention and treatment of recurrent Hepatitis B after liver transplantation: the current role of nucleoside and nucleotide analogues. ( Schiff, ER; Schreibman, IR, 2006) |
| "Hepatitis B is a major public health problem in the world today." | 2.43 | Hepatitis B: the pathway to recovery through treatment. ( Hollinger, FB; Lau, DT, 2006) |
| "In patients with liver cirrhosis (Child B and C) only nucleos(t)ides should be used." | 2.43 | [Therapy of hepatitis B virus infection]. ( Trautwein, C, 2006) |
| "Lamivudine has been widely used in the management of HBV transplant patients." | 2.42 | Prevention of and treatment for hepatitis B virus infection after liver transplantation in the nucleoside analogues era. ( Burroughs, AK; Papatheodoridis, GV; Sevastianos, V, 2003) |
| "Lamivudine appears to be a safe and effective antiviral agent, which may improve or stabilize liver disease in selected patients with advanced cirrhosis and active HBV replication." | 2.42 | Management of patients with decompensated HBV cirrhosis. ( Fontana, RJ, 2003) |
| " However, the inexorable development of drug resistance to lamivudine has been a major clinical impediment to the long-term use of such treatment." | 2.42 | Early detection of hepatitis B drug resistance: implications for patient management. ( Sablon, E; Shapiro, F; Zoulim, F, 2003) |
| "Lamivudine is a safe drug with rare and generally mild side effects." | 2.42 | Current antiviral therapy for chronic hepatitis B. ( Lim, YS; Suh, DJ, 2004) |
| " The recommended dosage of tenofovir DF in adults is 300 mg/d PO; pharmacokinetic and efficacy studies in children are ongoing." | 2.41 | Tenofovir disoproxil fumarate: a nucleotide reverse transcriptase inhibitor for the treatment of HIV infection. ( Fung, HB; Piacenti, FJ; Stone, EA, 2002) |
| "Lamivudine resistance has been found to confer cross-resistance to some of these compounds and it is likely that resistance to newer antivirals may also develop during prolonged use." | 2.41 | Resistance of hepatitis B virus to antiviral drugs: current aspects and directions for future investigation. ( Delaney, WE; Locarnini, S; Shaw, T, 2001) |
| "HIV and hepatitis B are two of the most prevalent viruses globally, and despite readily available preventive treatments unforgiving treatment regimens still exist, such as daily doses of medicine that are challenging to maintain especially in poorer countries." | 1.72 | A nanofiber based antiviral (TAF) prodrug delivery system. ( Bhave, M; Dart, A; Kingshott, P; Limqueco, E; Lowe, NM; Ratner, DM; Roy, D; Srinivasan, S; Stayton, P; Vlaskin, V, 2022) |
| "Fatal lactic acidosis has been reported while on the treatment with Nucleoside/nucleotide analogues (NA) for the treatment of hepatitis B, C and HIV." | 1.48 | Tenofovir alafenamide associated fatal lactic acidosis in an autologous hematopoietic stem cell transplant recipient. ( Alsunaid, SR; Ashraf, H; Soubani, AO, 2018) |
| "Mixed cryoglobulinemias were type II (88%) and type III (12%)." | 1.43 | Hepatitis B virus related cryoglobulinemic vasculitis: A multicentre open label study from the Gruppo Italiano di Studio delle Crioglobulinemie - GISC. ( Casarin, P; Castelnovo, L; Dal Maso, L; Gattei, V; Mauro, E; Mazzaro, C; Monti, G; Pozzato, G; Urraro, T; Zignego, AL, 2016) |
| "Hepatitis B virus recurrence within 12 months was 4." | 1.42 | Adefovir- or Lamivudine-Induced Renal Tubular Dysfunction after Liver Transplantation. ( Choi, GH; Choi, JS; Joo, DJ; Ju, MK; Kim, MS; Kim, SI; Lee, J; Lee, JG; Lee, JJ; Song, SH, 2015) |
| "This retrospective investigation carried out in Guangdong Province indicated that not only are anti-HBV drugs efficacious for blocking vertical transmission of HBV but also are safe for both mothers and infants when taken by fathers or mothers during the reproduction phases of insemination and pregnancy." | 1.40 | [Retrospective analysis of the efficacy and safety of anti-hepatitis B virus drugs taken during pregnancy in women from the Guangdong Province]. ( Chen, X; Gao, W; Li, D; Peng, J; Wen, F; Xia, J; Xu, C; Xu, M; Yao, Z, 2014) |
| "Lamivudine was initiated to treat the patient prior to transplantation." | 1.39 | Adefovir is effective to promote development of immunity to donor origin hepatitis B virus in an allogeneic transplant recipient: a case report. ( Özenirler, S; Sucak, GT; Suyanı, E; Yaşar, DG, 2013) |
| "There was no mortality due to HBV recurrence." | 1.39 | Living related liver transplantation for hepatitis B-related liver disease without hepatitis B immune globulin prophylaxis. ( Goyal, N; Gupta, S; Kumar, A; Taneja, S; Wadhawan, M, 2013) |
| "Telbivudine seemed to be a candidate for exclusive anti-HBV therapy because it exerts no significant in vitro activity against HIV." | 1.39 | In vivo antiviral activity of telbivudine against HIV-1: a case report. ( Bonadies, G; Borgia, G; Borrelli, F; Buonomo, AR; Carleo, MA; Gentile, I; Portella, G, 2013) |
| "The median time to HBV recurrence after transplantation was 31." | 1.38 | [Prognosis analysis of hepatitis B virus recurrence after liver transplantation: a single-center study of 38 cases]. ( Deng, YL; Gao, W; Jiang, WT; Qu, W; Rao, W; Shen, ZY; Sun, LY; Sun, XY; Zhang, JJ; Zhang, YM; Zhu, ZJ, 2012) |
| "Primary outcomes were major birth defects rates with exposure to all antivirals, individual classes, and drugs compared to population-based controls." | 1.38 | Hepatitis B virus and human immunodeficiency virus drugs in pregnancy: findings from the Antiretroviral Pregnancy Registry. ( Aguilar, C; Brown, RS; Buti, M; Fagan, EA; Leu, CS; Pereira, MR; Tilson, HH; Verna, EC, 2012) |
| " The lead candidates, both 1a (PBHBV-001) and 3c (PBHBV-2-15), were well-tolerated in both normal and HBV-transgenic mice and exhibited acceptable pharmacokinetics and bioavailability in Sprague-Dawley rats." | 1.37 | Design, synthesis, and biological evaluation of triazolo-pyrimidine derivatives as novel inhibitors of hepatitis B virus surface antigen (HBsAg) secretion. ( Block, TM; Clearfield, E; Cuconati, A; Goddard, C; Guo, H; Mills, C; Morrey, JD; Motter, NE; Xiao, T; Xu, X; Yu, W; Zhao, K, 2011) |
| "Hepatitis B is a DNA virus affecting hundreds of millions of individuals worldwide." | 1.36 | Viral resistance in hepatitis B: prevalence and management. ( Chee, GM; Poordad, F, 2010) |
| " Mean HBIg half-life was 21." | 1.36 | Pharmacokinetics and efficacy of intravenous or intramuscular hepatitis B immunoglobulins in prophylaxis of hepatitis B after liver transplantation. ( Andreone, P; Bacci, M; Burra, P; Canova, D; Cursaro, C; Fiorentino, B; Guazzini, S; Marengo, A; Marzano, A; Riili, A; Volpes, R, 2010) |
| " Individualized dosing intervals should be further evaluated as a cost-effective alternative to fixed dosing schemes." | 1.35 | Antibody to hepatitis B surface antigen trough levels and half-lives do not differ after intravenous and intramuscular hepatitis B immunoglobulin administration after liver transplantation. ( Hadem, J; Hooman, N; Klempnauer, J; Manns, MP; Philipp, G; Priess, A; Rifai, K; Rosenau, J; Tillmann, HL; Vaske, B, 2008) |
| "We report a case of autoimmune thrombocytopenia associated with acute reverse seroconversion of hepatitis B in a patient who was initially hepatitis B virus surface antigen negative and hepatitis B virus surface antibody positive." | 1.34 | [Autoimmune thrombopenia associated with hepatitis B reactivation (reverse seroconversion) after autologous hematopoietic stem cell transplantation]. ( Aubourg, A; Bacq, Y; d'Alteroche, L; Gaudy, C; Senecal, D, 2007) |
| "Adefovir dipivoxil (AD) is a nucleotide analogue of adenosine that has achieved significant results in virologic, biochemical, and clinical parameters in lamivudine-resistant HBV-infected patients." | 1.33 | Adefovir dipivoxil therapy in liver transplant recipients with lamivudine-resistant hepatitis B virus. ( Barrios Peinado, C; Cuervas-Mons Martínez, V; Herreros de Tejada Echanojáuregui, A; López Monclús, J; Lucena de la Poza, JL; Moreno Planas, JM; Portero Azorin, F; Revilla Negro, J; Rubio González, E; Sánchez Turrión, V, 2005) |
| "Treatment with lamivudine is initially efficient in both infections but the incidence of lamivudine-resistant HBV emergence increases over time." | 1.33 | Study on the efficacy and safety of adefovir dipivoxil treatment in post-liver transplant patients with hepatitis B virus infection and lamivudine-resistant hepatitis B virus. ( Avilés, JF; Bárcena, R; Barrios, C; Buti, M; Casanovas, T; Cuervas, V; De la Mata, M; Del Campo, S; Delgado, M; Dieguez, ML; Fraga, E; Gonzalez, A; Herrero, JI; Loinaz, C; Mas, A; Moraleda, G; Moreno, JM; Muñoz, R; Otero, A; Prieto, M; Rueda, M; Sousa, JM, 2005) |
| "We describe an acute hepatitis D virus superinfection in an HIV-1-infected patient under HAART treatment who was previously a chronic carrier of a surface negative HBV variant resistant to lamivudine." | 1.33 | Hepatitis delta virus super-infection in a co-infected patient with the human immunodeficiency virus type 1 and a surface antigen-negative hepatitis B virus variant. ( Alloui, C; Bouhassoune, K; Calboreanu, A; Dény, P; Gordien, E; Legal, F; Podevin, P; Rico-Garcia, M; Salmon-Céron, D; Sogni, P, 2006) |
| "Adefovir has been shown to be effective in the treatment of lamivudine-resistant HBV in HIV/HBV-coinfected patients." | 1.32 | Antiretroviral therapy and HIV/hepatitis B virus coinfection. ( Benhamou, Y, 2004) |
| "Adefovir dipivoxil is a prodrug of adefovir designed to enhance its oral bioavailability." | 1.31 | Antiviral efficacy and pharmacokinetics of oral adefovir dipivoxil in chronically woodchuck hepatitis virus-infected woodchucks. ( Brown, C; Cullen, JM; Cundy, KC; Eisenberg, EJ; Gibbs, C; Li, DH; Toole, J; Wolfe, J, 2001) |
| "Adefovir was administered for six consecutive days starting one day before or four days after DHBV inoculation." | 1.31 | Inhibitory effect of adefovir on viral DNA synthesis and covalently closed circular DNA formation in duck hepatitis B virus-infected hepatocytes in vivo and in vitro. ( Delmas, J; Gibbs, C; Hantz, O; Jamard, C; Schorr, O; Trépo, C; Zoulim, F, 2002) |
| Timeframe | Studies, this research(%) | All Research% |
|---|---|---|
| pre-1990 | 0 (0.00) | 18.7374 |
| 1990's | 10 (2.62) | 18.2507 |
| 2000's | 179 (46.86) | 29.6817 |
| 2010's | 169 (44.24) | 24.3611 |
| 2020's | 24 (6.28) | 2.80 |
| Authors | Studies |
|---|---|
| Yeh, ML | 1 |
| Liang, PC | 1 |
| Trinh, S | 1 |
| Huang, CI | 1 |
| Huang, CF | 1 |
| Hsieh, MY | 1 |
| Huang, JF | 1 |
| Dai, CY | 1 |
| Chuang, WL | 2 |
| Nguyen, MH | 1 |
| Yu, ML | 1 |
| Zeng, QL | 1 |
| Zhang, HX | 1 |
| Zhang, JY | 2 |
| Huang, S | 1 |
| Li, WZ | 1 |
| Li, GM | 1 |
| Pan, YJ | 1 |
| Feng, YH | 1 |
| Li, ZQ | 1 |
| Zhang, GF | 1 |
| Xu, JH | 1 |
| Lin, WB | 1 |
| Xu, GH | 1 |
| Liu, N | 1 |
| Zhang, GQ | 1 |
| Li, GT | 1 |
| Li, W | 4 |
| Zeng, YL | 1 |
| Song, N | 1 |
| Wang, M | 1 |
| Zhang, DW | 1 |
| Chen, ZM | 1 |
| Cui, GL | 1 |
| Li, J | 11 |
| Lv, J | 1 |
| Liu, YM | 1 |
| Liang, HX | 1 |
| Sun, CY | 1 |
| Zhou, YH | 1 |
| Yu, ZJ | 1 |
| Wang, FS | 1 |
| Dart, A | 1 |
| Roy, D | 1 |
| Vlaskin, V | 1 |
| Limqueco, E | 1 |
| Lowe, NM | 1 |
| Srinivasan, S | 1 |
| Ratner, DM | 1 |
| Bhave, M | 1 |
| Stayton, P | 1 |
| Kingshott, P | 1 |
| Kishimoto, M | 1 |
| Komine, M | 1 |
| Kamiya, K | 1 |
| Sugai, J | 1 |
| Kuwahara, A | 1 |
| Morimoto, N | 1 |
| Ohtsuki, M | 1 |
| Cui, H | 1 |
| Rong, W | 1 |
| Ma, J | 1 |
| Zhu, Q | 1 |
| Jiang, B | 1 |
| Zhang, L | 5 |
| Li, C | 4 |
| Zhuo, Z | 1 |
| Chen, M | 2 |
| Roediger, R | 1 |
| Smyth, EK | 1 |
| Dieterich, D | 1 |
| Kayes, T | 1 |
| Crane, H | 1 |
| Symonds, A | 1 |
| Dumond, J | 1 |
| Cottrell, M | 1 |
| Di Girolamo, J | 1 |
| Manandhar, S | 1 |
| Lim, TH | 1 |
| Gane, E | 3 |
| Kashuba, A | 2 |
| Levy, MT | 3 |
| Arnouk, S | 1 |
| Whitsett, M | 1 |
| Papadopoulos, J | 1 |
| Stewart Lewis, Z | 1 |
| Dagher, NN | 1 |
| Feldman, DM | 1 |
| Park, JS | 1 |
| Dong, H | 2 |
| Hong, X | 1 |
| He, Y | 3 |
| Bao, Z | 1 |
| Zhang, Y | 8 |
| Shen, S | 1 |
| Wang, G | 1 |
| Zhang, J | 6 |
| Mo, R | 1 |
| Kumar, M | 1 |
| Jung, CY | 1 |
| Kim, HW | 1 |
| Lee, JI | 2 |
| Lee, HW | 1 |
| Ahn, SH | 4 |
| Kim, SU | 2 |
| Kim, BS | 1 |
| Suda, G | 1 |
| Baba, M | 1 |
| Yamamoto, Y | 1 |
| Sho, T | 1 |
| Ogawa, K | 1 |
| Kimura, M | 1 |
| Hosoda, S | 1 |
| Yoshida, S | 1 |
| Kubo, A | 1 |
| Fu, Q | 1 |
| Yang, Z | 3 |
| Tokuchi, Y | 1 |
| Kitagataya, T | 1 |
| Maehara, O | 1 |
| Ohnishi, S | 1 |
| Yamada, R | 1 |
| Ohara, M | 1 |
| Kawagishi, N | 1 |
| Natsuizaka, M | 1 |
| Nakai, M | 1 |
| Morikawa, K | 1 |
| Furuya, K | 1 |
| Suzuki, K | 1 |
| Izumi, T | 1 |
| Meguro, T | 1 |
| Terashita, K | 1 |
| Ito, J | 1 |
| Kobayashi, T | 1 |
| Tsunematsu, I | 1 |
| Sakamoto, N | 1 |
| Zhu, L | 2 |
| Park, J | 1 |
| Deng, Y | 1 |
| Pan, CQ | 3 |
| Cheng, CH | 1 |
| Hung, HC | 1 |
| Lee, JC | 1 |
| Wang, YC | 1 |
| Wu, TH | 1 |
| Lee, CF | 1 |
| Wu, TJ | 1 |
| Chou, HS | 1 |
| Chan, KM | 1 |
| Lee, WC | 1 |
| Hwang, EG | 1 |
| Jung, EA | 1 |
| Yoo, JJ | 1 |
| Kim, SG | 1 |
| Kim, YS | 2 |
| Liu, Z | 4 |
| Zhao, Z | 1 |
| Ma, X | 2 |
| Liu, S | 2 |
| Xin, Y | 1 |
| Duan, YQ | 1 |
| Hu, P | 1 |
| Halim, AA | 1 |
| Alsayed, B | 1 |
| Embarak, S | 1 |
| Yaseen, T | 1 |
| Dabbous, S | 1 |
| Fontaine, O | 1 |
| Dueluzeau, R | 1 |
| Raibaud, P | 1 |
| Chabanet, C | 1 |
| Popoff, MR | 1 |
| Badoual, J | 1 |
| Gabilan, JC | 1 |
| Andremont, A | 1 |
| Gómez, L | 1 |
| Andrés, S | 1 |
| Sánchez, J | 1 |
| Alonso, JM | 1 |
| Rey, J | 1 |
| López, F | 1 |
| Jiménez, A | 1 |
| Yan, Z | 1 |
| Zhou, L | 2 |
| Zhao, Y | 3 |
| Wang, J | 6 |
| Huang, L | 2 |
| Hu, K | 1 |
| Liu, H | 4 |
| Wang, H | 3 |
| Guo, Z | 1 |
| Song, Y | 3 |
| Huang, H | 4 |
| Yang, R | 1 |
| Owen, TW | 1 |
| Al-Kaysi, RO | 1 |
| Bardeen, CJ | 1 |
| Cheng, Q | 1 |
| Wu, S | 2 |
| Cheng, T | 1 |
| Zhou, X | 1 |
| Wang, B | 4 |
| Zhang, Q | 5 |
| Wu, X | 2 |
| Yao, Y | 3 |
| Ochiai, T | 1 |
| Ishiguro, H | 2 |
| Nakano, R | 2 |
| Kubota, Y | 2 |
| Hara, M | 1 |
| Sunada, K | 1 |
| Hashimoto, K | 1 |
| Kajioka, J | 1 |
| Fujishima, A | 1 |
| Jiao, J | 3 |
| Gai, QY | 3 |
| Wang, W | 2 |
| Zang, YP | 2 |
| Niu, LL | 2 |
| Fu, YJ | 3 |
| Wang, X | 6 |
| Yao, LP | 1 |
| Qin, QP | 1 |
| Wang, ZY | 1 |
| Liu, J | 5 |
| Aleksic Sabo, V | 1 |
| Knezevic, P | 1 |
| Borges-Argáez, R | 1 |
| Chan-Balan, R | 1 |
| Cetina-Montejo, L | 1 |
| Ayora-Talavera, G | 1 |
| Sansores-Peraza, P | 1 |
| Gómez-Carballo, J | 1 |
| Cáceres-Farfán, M | 1 |
| Jang, J | 1 |
| Akin, D | 1 |
| Bashir, R | 1 |
| Yu, Z | 2 |
| Zhu, J | 2 |
| Jiang, H | 2 |
| He, C | 2 |
| Xiao, Z | 1 |
| Xu, J | 2 |
| Sun, Q | 1 |
| Han, D | 1 |
| Lei, H | 1 |
| Zhao, K | 3 |
| Li, X | 9 |
| Fu, H | 2 |
| Wilson, BK | 1 |
| Step, DL | 1 |
| Maxwell, CL | 1 |
| Gifford, CA | 1 |
| Richards, CJ | 1 |
| Krehbiel, CR | 1 |
| Warner, JM | 1 |
| Doerr, AJ | 1 |
| Erickson, GE | 1 |
| Guretzky, JA | 1 |
| Rasby, RJ | 1 |
| Watson, AK | 1 |
| Klopfenstein, TJ | 1 |
| Sun, Y | 5 |
| Pham, TD | 1 |
| Lee, BK | 1 |
| Yang, FC | 1 |
| Wu, KH | 1 |
| Lin, WP | 1 |
| Hu, MK | 1 |
| Lin, L | 4 |
| Shao, J | 1 |
| Sun, M | 1 |
| Xu, G | 1 |
| Zhang, X | 10 |
| Xu, N | 1 |
| Wang, R | 1 |
| He, H | 1 |
| Dong, X | 2 |
| Yang, M | 2 |
| Yang, Q | 1 |
| Duan, S | 1 |
| Yu, Y | 2 |
| Han, J | 2 |
| Zhang, C | 3 |
| Chen, L | 4 |
| Yang, X | 1 |
| Wang, T | 2 |
| Campbell, DA | 1 |
| Gao, K | 1 |
| Zager, RA | 1 |
| Johnson, ACM | 1 |
| Guillem, A | 1 |
| Keyser, J | 1 |
| Singh, B | 1 |
| Steubl, D | 1 |
| Schneider, MP | 1 |
| Meiselbach, H | 1 |
| Nadal, J | 1 |
| Schmid, MC | 1 |
| Saritas, T | 1 |
| Krane, V | 1 |
| Sommerer, C | 1 |
| Baid-Agrawal, S | 1 |
| Voelkl, J | 1 |
| Kotsis, F | 1 |
| Köttgen, A | 1 |
| Eckardt, KU | 1 |
| Scherberich, JE | 1 |
| Li, H | 6 |
| Yao, L | 2 |
| Sun, L | 3 |
| Zhu, Z | 2 |
| Naren, N | 1 |
| Zhang, XX | 2 |
| Gentile, GL | 1 |
| Rupert, AS | 1 |
| Carrasco, LI | 1 |
| Garcia, EM | 1 |
| Kumar, NG | 1 |
| Walsh, SW | 1 |
| Jefferson, KK | 1 |
| Guest, RL | 1 |
| Samé Guerra, D | 1 |
| Wissler, M | 1 |
| Grimm, J | 1 |
| Silhavy, TJ | 1 |
| Lee, JH | 5 |
| Yoo, JS | 1 |
| Kim, Y | 1 |
| Kim, JS | 2 |
| Lee, EJ | 1 |
| Roe, JH | 1 |
| Delorme, M | 1 |
| Bouchard, PA | 1 |
| Simon, M | 1 |
| Simard, S | 1 |
| Lellouche, F | 1 |
| D'Urzo, KA | 1 |
| Mok, F | 1 |
| D'Urzo, AD | 1 |
| Koneru, B | 1 |
| Lopez, G | 1 |
| Farooqi, A | 1 |
| Conkrite, KL | 1 |
| Nguyen, TH | 1 |
| Macha, SJ | 1 |
| Modi, A | 1 |
| Rokita, JL | 1 |
| Urias, E | 1 |
| Hindle, A | 1 |
| Davidson, H | 1 |
| Mccoy, K | 1 |
| Nance, J | 1 |
| Yazdani, V | 1 |
| Irwin, MS | 1 |
| Yang, S | 2 |
| Wheeler, DA | 1 |
| Maris, JM | 1 |
| Diskin, SJ | 1 |
| Reynolds, CP | 1 |
| Abhilash, L | 1 |
| Kalliyil, A | 1 |
| Sheeba, V | 1 |
| Hartley, AM | 2 |
| Meunier, B | 2 |
| Pinotsis, N | 1 |
| Maréchal, A | 2 |
| Xu, JY | 1 |
| Genko, N | 1 |
| Haraux, F | 1 |
| Rich, PR | 1 |
| Kamalanathan, M | 1 |
| Doyle, SM | 1 |
| Xu, C | 3 |
| Achberger, AM | 1 |
| Wade, TL | 1 |
| Schwehr, K | 1 |
| Santschi, PH | 1 |
| Sylvan, JB | 1 |
| Quigg, A | 1 |
| Leong, W | 1 |
| Xu, W | 2 |
| Gao, S | 1 |
| Zhai, X | 1 |
| Wang, C | 4 |
| Gilson, E | 1 |
| Ye, J | 1 |
| Lu, Y | 1 |
| Yan, R | 1 |
| Hu, Z | 1 |
| You, Q | 1 |
| Cai, Q | 1 |
| Yang, D | 1 |
| Gu, S | 1 |
| Dai, H | 1 |
| Zhao, X | 1 |
| Gui, C | 1 |
| Gui, J | 1 |
| Wu, PK | 1 |
| Hong, SK | 1 |
| Starenki, D | 1 |
| Oshima, K | 1 |
| Shao, H | 1 |
| Gestwicki, JE | 1 |
| Tsai, S | 1 |
| Park, JI | 1 |
| Wang, Y | 12 |
| Zhao, R | 1 |
| Gu, Z | 1 |
| Dong, C | 2 |
| Guo, G | 1 |
| Li, L | 4 |
| Barrett, HE | 1 |
| Meester, EJ | 1 |
| van Gaalen, K | 1 |
| van der Heiden, K | 1 |
| Krenning, BJ | 1 |
| Beekman, FJ | 1 |
| de Blois, E | 1 |
| de Swart, J | 1 |
| Verhagen, HJ | 1 |
| Maina, T | 1 |
| Nock, BA | 1 |
| Norenberg, JP | 1 |
| de Jong, M | 1 |
| Gijsen, FJH | 1 |
| Bernsen, MR | 1 |
| Martínez-Milla, J | 1 |
| Galán-Arriola, C | 1 |
| Carnero, M | 1 |
| Cobiella, J | 1 |
| Pérez-Camargo, D | 1 |
| Bautista-Hernández, V | 1 |
| Rigol, M | 1 |
| Solanes, N | 1 |
| Villena-Gutierrez, R | 1 |
| Lobo, M | 1 |
| Mateo, J | 1 |
| Vilchez-Tschischke, JP | 1 |
| Salinas, B | 1 |
| Cussó, L | 1 |
| López, GJ | 1 |
| Fuster, V | 1 |
| Desco, M | 1 |
| Sanchez-González, J | 1 |
| Ibanez, B | 1 |
| van den Berg, P | 1 |
| Schweitzer, DH | 1 |
| van Haard, PMM | 1 |
| Geusens, PP | 1 |
| van den Bergh, JP | 1 |
| Zhu, X | 1 |
| Huang, X | 2 |
| Xu, H | 2 |
| Yang, G | 2 |
| Lin, Z | 1 |
| Salem, HF | 1 |
| Nafady, MM | 1 |
| Kharshoum, RM | 1 |
| Abd El-Ghafar, OA | 1 |
| Farouk, HO | 1 |
| Domiciano, D | 1 |
| Nery, FC | 1 |
| de Carvalho, PA | 1 |
| Prudente, DO | 1 |
| de Souza, LB | 1 |
| Chalfun-Júnior, A | 1 |
| Paiva, R | 1 |
| Marchiori, PER | 1 |
| Lu, M | 3 |
| An, Z | 1 |
| Jiang, J | 2 |
| Du, S | 1 |
| Zhou, H | 1 |
| Cui, J | 1 |
| Wu, W | 1 |
| Liu, Y | 15 |
| Song, J | 1 |
| Lian, Q | 1 |
| Uddin Ahmad, Z | 1 |
| Gang, DD | 1 |
| Konggidinata, MI | 1 |
| Gallo, AA | 1 |
| Zappi, ME | 1 |
| Yang, TWW | 1 |
| Johari, Y | 1 |
| Burton, PR | 1 |
| Earnest, A | 1 |
| Shaw, K | 1 |
| Hare, JL | 1 |
| Brown, WA | 1 |
| Kim, GA | 1 |
| Han, S | 1 |
| Choi, GH | 2 |
| Choi, J | 1 |
| Lim, YS | 4 |
| Gallo, A | 1 |
| Cancelli, C | 1 |
| Ceron, E | 1 |
| Covino, M | 1 |
| Capoluongo, E | 1 |
| Pocino, K | 1 |
| Ianiro, G | 1 |
| Cammarota, G | 1 |
| Gasbarrini, A | 1 |
| Montalto, M | 1 |
| Somasundar, Y | 1 |
| Lu, IC | 1 |
| Mills, MR | 1 |
| Qian, LY | 1 |
| Olivares, X | 1 |
| Ryabov, AD | 1 |
| Collins, TJ | 1 |
| Zhao, L | 2 |
| Doddipatla, S | 1 |
| Thomas, AM | 1 |
| Nikolayev, AA | 1 |
| Galimova, GR | 1 |
| Azyazov, VN | 1 |
| Mebel, AM | 1 |
| Kaiser, RI | 1 |
| Guo, S | 1 |
| Yang, P | 1 |
| Yu, X | 2 |
| Wu, Y | 2 |
| Zhang, H | 1 |
| Yu, B | 2 |
| Han, B | 1 |
| George, MW | 1 |
| Moor, MB | 1 |
| Bonny, O | 1 |
| Langenberg, E | 1 |
| Paik, H | 1 |
| Smith, EH | 1 |
| Nair, HP | 1 |
| Hanke, I | 1 |
| Ganschow, S | 1 |
| Catalan, G | 1 |
| Domingo, N | 1 |
| Schlom, DG | 1 |
| Assefa, MK | 1 |
| Wu, G | 2 |
| Hayton, TW | 1 |
| Becker, B | 1 |
| Enikeev, D | 1 |
| Netsch, C | 1 |
| Gross, AJ | 1 |
| Laukhtina, E | 1 |
| Glybochko, P | 1 |
| Rapoport, L | 1 |
| Herrmann, TRW | 1 |
| Taratkin, M | 1 |
| Dai, W | 1 |
| Shi, J | 2 |
| Carreno, J | 1 |
| Kloner, RA | 1 |
| Pickersgill, NA | 1 |
| Vetter, JM | 1 |
| Kim, EH | 1 |
| Cope, SJ | 1 |
| Du, K | 1 |
| Venkatesh, R | 1 |
| Giardina, JD | 1 |
| Saad, NES | 1 |
| Bhayani, SB | 1 |
| Figenshau, RS | 1 |
| Eriksson, J | 1 |
| Landfeldt, E | 1 |
| Ireland, S | 1 |
| Jackson, C | 1 |
| Wyatt, E | 1 |
| Gaudig, M | 1 |
| Stancill, JS | 1 |
| Happ, JT | 1 |
| Broniowska, KA | 1 |
| Hogg, N | 1 |
| Corbett, JA | 1 |
| Tang, LF | 1 |
| Bi, YL | 1 |
| Fan, Y | 2 |
| Sun, YB | 1 |
| Wang, AL | 1 |
| Xiao, BH | 1 |
| Wang, LF | 1 |
| Qiu, SW | 1 |
| Guo, SW | 1 |
| Wáng, YXJ | 1 |
| Sun, J | 3 |
| Chu, S | 1 |
| Pan, Q | 1 |
| Li, D | 3 |
| Zheng, S | 3 |
| Ma, L | 1 |
| Wang, L | 5 |
| Hu, T | 1 |
| Wang, F | 1 |
| Han, Z | 2 |
| Yin, Z | 1 |
| Ge, X | 1 |
| Xie, K | 1 |
| Lei, P | 1 |
| Dias-Santagata, D | 1 |
| Lennerz, JK | 1 |
| Sadow, PM | 1 |
| Frazier, RP | 1 |
| Govinda Raju, S | 1 |
| Henry, D | 1 |
| Chung, T | 1 |
| Kherani, J | 1 |
| Rothenberg, SM | 1 |
| Wirth, LJ | 1 |
| Marti, CN | 1 |
| Choi, NG | 1 |
| Bae, SJ | 1 |
| Ni, L | 1 |
| Luo, X | 1 |
| Dai, T | 1 |
| Yang, Y | 4 |
| Lee, R | 1 |
| Fleischer, AS | 1 |
| Wemhoff, AP | 1 |
| Ford, CR | 1 |
| Kleppinger, EL | 1 |
| Helms, K | 1 |
| Bush, AA | 1 |
| Luna-Abanto, J | 1 |
| García Ruiz, L | 1 |
| Laura Martinez, J | 1 |
| Álvarez Larraondo, M | 1 |
| Villoslada Terrones, V | 1 |
| Dukic, L | 1 |
| Maric, N | 1 |
| Simundic, AM | 1 |
| Chogtu, B | 1 |
| Ommurugan, B | 1 |
| Thomson, SR | 1 |
| Kalthur, SG | 1 |
| Benidir, M | 1 |
| El Massoudi, S | 1 |
| El Ghadraoui, L | 1 |
| Lazraq, A | 1 |
| Benjelloun, M | 1 |
| Errachidi, F | 1 |
| Cassar, M | 1 |
| Law, AD | 1 |
| Chow, ES | 1 |
| Giebultowicz, JM | 1 |
| Kretzschmar, D | 1 |
| Salonurmi, T | 1 |
| Nabil, H | 1 |
| Ronkainen, J | 1 |
| Hyötyläinen, T | 1 |
| Hautajärvi, H | 1 |
| Savolainen, MJ | 1 |
| Tolonen, A | 1 |
| Orešič, M | 1 |
| Känsäkoski, P | 1 |
| Rysä, J | 1 |
| Hakkola, J | 1 |
| Hukkanen, J | 1 |
| Zhu, N | 1 |
| Li, Y | 6 |
| Du, Q | 1 |
| Hao, P | 1 |
| Cao, X | 1 |
| Li, CX | 1 |
| Zhao, S | 1 |
| Luo, XM | 2 |
| Feng, JX | 1 |
| Gonzalez-Cotto, M | 1 |
| Guo, L | 1 |
| Karwan, M | 1 |
| Sen, SK | 1 |
| Barb, J | 1 |
| Collado, CJ | 1 |
| Elloumi, F | 1 |
| Palmieri, EM | 1 |
| Boelte, K | 1 |
| Kolodgie, FD | 1 |
| Finn, AV | 1 |
| Biesecker, LG | 1 |
| McVicar, DW | 1 |
| Qu, F | 1 |
| Deng, Z | 1 |
| Xie, Y | 2 |
| Tang, J | 3 |
| Chen, Z | 2 |
| Luo, W | 1 |
| Xiong, D | 1 |
| Zhao, D | 1 |
| Fang, J | 1 |
| Zhou, Z | 1 |
| Niu, PP | 1 |
| Song, B | 1 |
| Xu, YM | 1 |
| Zhang, Z | 2 |
| Qiu, N | 1 |
| Yin, J | 1 |
| Guo, W | 1 |
| Liu, M | 2 |
| Liu, T | 6 |
| Chen, D | 5 |
| Luo, K | 1 |
| He, Z | 2 |
| Zheng, G | 1 |
| Xu, F | 1 |
| Sun, W | 1 |
| Yin, F | 1 |
| van Hest, JCM | 1 |
| Du, L | 3 |
| Shi, X | 1 |
| Kang, S | 1 |
| Duan, W | 1 |
| Zhang, S | 3 |
| Feng, J | 3 |
| Qi, N | 1 |
| Shen, G | 1 |
| Ren, H | 1 |
| Shang, Q | 1 |
| Zhao, W | 2 |
| Jiang, X | 3 |
| Alame, M | 1 |
| Cornillot, E | 1 |
| Cacheux, V | 1 |
| Tosato, G | 1 |
| Four, M | 1 |
| De Oliveira, L | 1 |
| Gofflot, S | 1 |
| Delvenne, P | 1 |
| Turtoi, E | 1 |
| Cabello-Aguilar, S | 1 |
| Nishiyama, M | 1 |
| Turtoi, A | 1 |
| Costes-Martineau, V | 1 |
| Colinge, J | 1 |
| Guo, Q | 1 |
| Quan, M | 1 |
| Dong, J | 2 |
| Bai, J | 1 |
| Han, R | 1 |
| Cai, Y | 1 |
| Lv, YQ | 1 |
| Chen, Q | 1 |
| Lyu, HD | 1 |
| Deng, L | 1 |
| Zhou, D | 1 |
| Xiao, X | 1 |
| De Langhe, S | 1 |
| Billadeau, DD | 1 |
| Lou, Z | 1 |
| Zhang, JS | 1 |
| Xue, Z | 1 |
| Shen, XD | 1 |
| Gao, F | 1 |
| Busuttil, RW | 1 |
| Kupiec-Weglinski, JW | 1 |
| Ji, H | 1 |
| Otano, I | 1 |
| Alvarez, M | 1 |
| Minute, L | 1 |
| Ochoa, MC | 1 |
| Migueliz, I | 1 |
| Molina, C | 1 |
| Azpilikueta, A | 1 |
| de Andrea, CE | 1 |
| Etxeberria, I | 1 |
| Sanmamed, MF | 1 |
| Teijeira, Á | 1 |
| Berraondo, P | 1 |
| Melero, I | 1 |
| Zhong, Z | 1 |
| Xie, X | 1 |
| Yu, Q | 1 |
| Zhou, C | 1 |
| Liu, C | 2 |
| Liu, W | 3 |
| Chen, W | 1 |
| Yin, Y | 1 |
| Li, CW | 1 |
| Hsu, JL | 1 |
| Zhou, Q | 1 |
| Hu, B | 1 |
| Fu, P | 1 |
| Atyah, M | 1 |
| Ma, Q | 2 |
| Xu, Y | 2 |
| Dong, Q | 1 |
| Hung, MC | 1 |
| Ren, N | 1 |
| Huang, P | 1 |
| Liao, R | 1 |
| Chen, X | 5 |
| Cao, Q | 1 |
| Yuan, X | 1 |
| Nie, W | 1 |
| Yang, J | 3 |
| Shao, B | 1 |
| Bi, Z | 1 |
| Liang, X | 1 |
| Tie, Y | 1 |
| Mo, F | 1 |
| Xie, D | 1 |
| Wei, Y | 1 |
| Wei, X | 2 |
| Dokla, EME | 1 |
| Fang, CS | 1 |
| Chu, PC | 1 |
| Chang, CS | 1 |
| Abouzid, KAM | 1 |
| Chen, CS | 1 |
| Blaszczyk, R | 1 |
| Brzezinska, J | 1 |
| Dymek, B | 1 |
| Stanczak, PS | 1 |
| Mazurkiewicz, M | 1 |
| Olczak, J | 1 |
| Nowicka, J | 1 |
| Dzwonek, K | 1 |
| Zagozdzon, A | 1 |
| Golab, J | 1 |
| Golebiowski, A | 1 |
| Xin, Z | 1 |
| Himmelbauer, MK | 1 |
| Jones, JH | 1 |
| Enyedy, I | 1 |
| Gilfillan, R | 1 |
| Hesson, T | 1 |
| King, K | 1 |
| Marcotte, DJ | 1 |
| Murugan, P | 1 |
| Santoro, JC | 1 |
| Gonzalez-Lopez de Turiso, F | 1 |
| Pedron, J | 1 |
| Boudot, C | 1 |
| Brossas, JY | 1 |
| Pinault, E | 1 |
| Bourgeade-Delmas, S | 1 |
| Sournia-Saquet, A | 1 |
| Boutet-Robinet, E | 1 |
| Destere, A | 1 |
| Tronnet, A | 1 |
| Bergé, J | 1 |
| Bonduelle, C | 1 |
| Deraeve, C | 1 |
| Pratviel, G | 1 |
| Stigliani, JL | 1 |
| Paris, L | 1 |
| Mazier, D | 1 |
| Corvaisier, S | 1 |
| Since, M | 1 |
| Malzert-Fréon, A | 1 |
| Wyllie, S | 1 |
| Milne, R | 1 |
| Fairlamb, AH | 1 |
| Valentin, A | 1 |
| Courtioux, B | 1 |
| Verhaeghe, P | 1 |
| Fang, X | 1 |
| Gao, M | 1 |
| Gao, H | 1 |
| Bi, W | 1 |
| Tang, H | 3 |
| Cui, Y | 1 |
| Fan, H | 1 |
| Yu, H | 1 |
| Mathison, CJN | 1 |
| Chianelli, D | 1 |
| Rucker, PV | 1 |
| Nelson, J | 1 |
| Roland, J | 1 |
| Huang, Z | 2 |
| Xie, YF | 1 |
| Epple, R | 1 |
| Bursulaya, B | 1 |
| Lee, C | 1 |
| Gao, MY | 1 |
| Shaffer, J | 1 |
| Briones, S | 1 |
| Sarkisova, Y | 1 |
| Galkin, A | 1 |
| Li, N | 1 |
| Hua, S | 1 |
| Kasibhatla, S | 1 |
| Kinyamu-Akunda, J | 1 |
| Kikkawa, R | 1 |
| Molteni, V | 1 |
| Tellew, JE | 1 |
| Jin, X | 1 |
| Pang, B | 1 |
| Liu, Q | 2 |
| Liu, X | 4 |
| Huang, Y | 4 |
| Josephine Fauci, A | 1 |
| Ma, Y | 1 |
| Soo Lee, M | 1 |
| Yuan, W | 1 |
| Gao, R | 1 |
| Qi, H | 1 |
| Zheng, W | 1 |
| Yang, F | 2 |
| Chua, H | 1 |
| Wang, K | 1 |
| Ou, Y | 2 |
| Huang, M | 3 |
| Zhu, Y | 1 |
| Yu, J | 1 |
| Tian, J | 1 |
| Zhao, M | 1 |
| Hu, J | 1 |
| Yao, C | 1 |
| Zhang, B | 1 |
| Usawachintachit, M | 1 |
| Tzou, DT | 1 |
| Washington, SL | 1 |
| Hu, W | 1 |
| Chi, T | 1 |
| Sorensen, MD | 1 |
| Bailey, MR | 1 |
| Hsi, RS | 1 |
| Cunitz, BW | 1 |
| Simon, J | 1 |
| Wang, YN | 1 |
| Dunmire, BL | 1 |
| Paun, M | 1 |
| Starr, F | 1 |
| Lu, W | 1 |
| Evan, AP | 1 |
| Harper, JD | 1 |
| Han, G | 1 |
| Rodrigues, AE | 1 |
| Fouladvand, F | 1 |
| Falahi, E | 1 |
| Asbaghi, O | 1 |
| Abbasnezhad, A | 1 |
| Anigboro, AA | 1 |
| Avwioroko, OJ | 1 |
| Cholu, CO | 1 |
| Sonei, A | 1 |
| Fazelipour, S | 1 |
| Kanaani, L | 1 |
| Jahromy, MH | 1 |
| Jo, K | 1 |
| Hong, KB | 1 |
| Suh, HJ | 1 |
| Park, JH | 1 |
| Shin, E | 1 |
| Park, E | 1 |
| Kouakou-Kouamé, CA | 1 |
| N'guessan, FK | 1 |
| Montet, D | 1 |
| Djè, MK | 1 |
| Kim, GD | 1 |
| González-Fernández, D | 1 |
| Pons, EDC | 1 |
| Rueda, D | 1 |
| Sinisterra, OT | 1 |
| Murillo, E | 1 |
| Scott, ME | 1 |
| Koski, KG | 1 |
| Shete, PB | 1 |
| Gonzales, R | 1 |
| Ackerman, S | 1 |
| Cattamanchi, A | 1 |
| Handley, MA | 1 |
| Li, XX | 1 |
| Xiao, SZ | 1 |
| Gu, FF | 1 |
| He, WP | 1 |
| Ni, YX | 1 |
| Han, LZ | 1 |
| Heffernan, JK | 1 |
| Valgepea, K | 1 |
| de Souza Pinto Lemgruber, R | 1 |
| Casini, I | 1 |
| Plan, M | 1 |
| Tappel, R | 1 |
| Simpson, SD | 1 |
| Köpke, M | 1 |
| Nielsen, LK | 1 |
| Marcellin, E | 1 |
| Cen, YK | 1 |
| Lin, JG | 1 |
| Wang, YL | 2 |
| Wang, JY | 1 |
| Liu, ZQ | 1 |
| Zheng, YG | 1 |
| Spirk, D | 1 |
| Noll, S | 1 |
| Burnier, M | 1 |
| Rimoldi, S | 1 |
| Noll, G | 1 |
| Sudano, I | 1 |
| Penzhorn, BL | 1 |
| Oosthuizen, MC | 1 |
| Kobos, LM | 1 |
| Alqatani, S | 1 |
| Ferreira, CR | 1 |
| Aryal, UK | 1 |
| Hedrick, V | 1 |
| Sobreira, TJP | 1 |
| Shannahan, JH | 1 |
| Gale, P | 1 |
| Singhroy, DN | 1 |
| MacLean, E | 1 |
| Kohli, M | 1 |
| Lessem, E | 1 |
| Branigan, D | 1 |
| England, K | 1 |
| Suleiman, K | 1 |
| Drain, PK | 1 |
| Ruhwald, M | 1 |
| Schumacher, S | 1 |
| Denkinger, CM | 1 |
| Waning, B | 1 |
| Van Gemert, W | 1 |
| Pai, M | 1 |
| Myers, RK | 1 |
| Bonsu, JM | 1 |
| Carey, ME | 1 |
| Yerys, BE | 1 |
| Mollen, CJ | 1 |
| Curry, AE | 1 |
| Douglas, TA | 1 |
| Alinezhadbalalami, N | 1 |
| Balani, N | 1 |
| Schmelz, EM | 1 |
| Davalos, RV | 1 |
| Kamaldinov, T | 1 |
| Erndt-Marino, J | 1 |
| Levin, M | 1 |
| Kaplan, DL | 1 |
| Hahn, MS | 1 |
| Heidarimoghadam, R | 1 |
| Farmany, A | 1 |
| Lee, JJ | 2 |
| Kang, J | 1 |
| Park, S | 2 |
| Cho, JH | 1 |
| Oh, S | 1 |
| Park, DJ | 1 |
| Perez-Maldonado, R | 1 |
| Cho, JY | 1 |
| Park, IH | 1 |
| Kim, HB | 1 |
| Song, M | 1 |
| Mfarrej, B | 1 |
| Jofra, T | 1 |
| Morsiani, C | 1 |
| Gagliani, N | 1 |
| Fousteri, G | 1 |
| Battaglia, M | 1 |
| Giuliano, C | 1 |
| Levinger, I | 1 |
| Vogrin, S | 1 |
| Neil, CJ | 1 |
| Allen, JD | 1 |
| Lv, Y | 1 |
| Yuan, R | 1 |
| Cai, B | 1 |
| Bahrami, B | 1 |
| Chowdhury, AH | 1 |
| Yang, C | 2 |
| Qiao, Q | 1 |
| Liu, SF | 1 |
| Zhang, WH | 1 |
| Kolano, L | 1 |
| Knappe, D | 1 |
| Volke, D | 1 |
| Sträter, N | 1 |
| Hoffmann, R | 1 |
| Coussens, M | 1 |
| Calders, P | 1 |
| Lapauw, B | 1 |
| Celie, B | 1 |
| Banica, T | 1 |
| De Wandele, I | 1 |
| Pacey, V | 1 |
| Malfait, F | 1 |
| Rombaut, L | 1 |
| Vieira, D | 1 |
| Angel, S | 1 |
| Honjol, Y | 1 |
| Gruenheid, S | 1 |
| Gbureck, U | 1 |
| Harvey, E | 1 |
| Merle, G | 1 |
| Seo, G | 1 |
| Lee, G | 1 |
| Kim, MJ | 1 |
| Baek, SH | 1 |
| Choi, M | 1 |
| Ku, KB | 1 |
| Lee, CS | 1 |
| Jun, S | 1 |
| Park, D | 1 |
| Kim, HG | 1 |
| Kim, SJ | 1 |
| Lee, JO | 1 |
| Kim, BT | 1 |
| Park, EC | 1 |
| Kim, SI | 2 |
| Ende, M | 1 |
| Kirkkala, T | 1 |
| Loitzenbauer, M | 1 |
| Talla, D | 1 |
| Wildner, M | 1 |
| Miletich, R | 1 |
| Criado, A | 1 |
| Lavela, P | 1 |
| Tirado, JL | 1 |
| Pérez-Vicente, C | 1 |
| Kang, D | 1 |
| Feng, D | 2 |
| Fang, Z | 1 |
| Wei, F | 1 |
| De Clercq, E | 4 |
| Pannecouque, C | 1 |
| Zhan, P | 1 |
| Guo, Y | 1 |
| Shen, Y | 1 |
| Wang, Q | 2 |
| Kawazoe, Y | 1 |
| Jena, P | 1 |
| Sun, Z | 1 |
| Li, Z | 3 |
| Liang, H | 1 |
| Xu, X | 2 |
| Ma, G | 1 |
| Huo, X | 1 |
| Church, JS | 1 |
| Chace-Donahue, F | 1 |
| Blum, JL | 1 |
| Ratner, JR | 1 |
| Zelikoff, JT | 1 |
| Schwartzer, JJ | 1 |
| Fiseha, T | 1 |
| Tamir, Z | 1 |
| Yao, W | 1 |
| Wang, P | 1 |
| Mi, K | 1 |
| Cheng, J | 1 |
| Gu, C | 1 |
| Huang, J | 2 |
| Sun, HB | 1 |
| Xing, WQ | 1 |
| Liu, XB | 1 |
| Zheng, Y | 1 |
| Yang, SJ | 1 |
| Wang, ZF | 1 |
| Liu, SL | 1 |
| Ba, YF | 1 |
| Zhang, RX | 1 |
| Liu, BX | 1 |
| Fan, CC | 1 |
| Chen, PN | 1 |
| Liang, GH | 1 |
| Yu, YK | 1 |
| Wang, HR | 1 |
| Li, HM | 1 |
| Li, ZX | 1 |
| Lalani, SS | 1 |
| Anasir, MI | 1 |
| Poh, CL | 1 |
| Khan, IT | 1 |
| Nadeem, M | 1 |
| Imran, M | 1 |
| Khalique, A | 1 |
| Raspini, B | 1 |
| Porri, D | 1 |
| De Giuseppe, R | 1 |
| Chieppa, M | 1 |
| Liso, M | 1 |
| Cerbo, RM | 1 |
| Civardi, E | 1 |
| Garofoli, F | 1 |
| Monti, MC | 1 |
| Vacca, M | 1 |
| De Angelis, M | 1 |
| Cena, H | 1 |
| Kong, D | 1 |
| Han, X | 1 |
| Zhou, Y | 3 |
| Xue, H | 1 |
| Zhang, W | 1 |
| Ruan, Z | 1 |
| Li, S | 2 |
| Noer, PR | 1 |
| Kjaer-Sorensen, K | 1 |
| Juhl, AK | 1 |
| Goldstein, A | 1 |
| Ke, C | 1 |
| Oxvig, C | 1 |
| Duan, C | 1 |
| Kong, F | 1 |
| Lin, S | 1 |
| Wang, Z | 2 |
| Bhattacharya, R | 1 |
| Mazumder, D | 1 |
| Yan, X | 1 |
| Ma, C | 1 |
| Tang, Y | 1 |
| Kong, X | 1 |
| Lu, J | 1 |
| Zhang, M | 1 |
| Vital-Jacome, M | 1 |
| Cazares-Granillo, M | 1 |
| Carrillo-Reyes, J | 1 |
| Buitron, G | 1 |
| Jacob, SI | 1 |
| Douair, I | 1 |
| Maron, L | 1 |
| Ménard, G | 1 |
| Rusjan, P | 1 |
| Sabioni, P | 1 |
| Di Ciano, P | 1 |
| Mansouri, E | 1 |
| Boileau, I | 1 |
| Laveillé, A | 1 |
| Capet, M | 1 |
| Duvauchelle, T | 1 |
| Schwartz, JC | 1 |
| Robert, P | 1 |
| Le Foll, B | 1 |
| Xia, Y | 1 |
| Chen, S | 1 |
| Luo, M | 2 |
| Wu, J | 1 |
| Cai, S | 1 |
| Garbacz, P | 1 |
| Misiak, M | 1 |
| Jackowski, K | 1 |
| Yuan, Q | 1 |
| Sherrell, PC | 1 |
| Chen, J | 3 |
| Bi, X | 1 |
| Nutho, B | 1 |
| Mahalapbutr, P | 1 |
| Hengphasatporn, K | 1 |
| Pattaranggoon, NC | 1 |
| Simanon, N | 1 |
| Shigeta, Y | 1 |
| Hannongbua, S | 1 |
| Rungrotmongkol, T | 1 |
| Caffrey, PJ | 1 |
| Kher, R | 1 |
| Bian, K | 1 |
| Delaney, S | 1 |
| Xue, J | 2 |
| Wu, P | 1 |
| Xu, L | 2 |
| Yuan, Y | 1 |
| Luo, J | 1 |
| Ye, S | 1 |
| Ustriyana, P | 1 |
| Wei, B | 1 |
| Raee, E | 1 |
| Hu, Y | 1 |
| Wesdemiotis, C | 1 |
| Sahai, N | 1 |
| Kaur, A | 1 |
| Nigam, K | 1 |
| Srivastava, S | 1 |
| Tyagi, A | 1 |
| Dang, S | 1 |
| Millar, JE | 1 |
| Bartnikowski, N | 1 |
| Passmore, MR | 1 |
| Obonyo, NG | 1 |
| Malfertheiner, MV | 1 |
| von Bahr, V | 1 |
| Redd, MA | 1 |
| See Hoe, L | 1 |
| Ki, KK | 1 |
| Pedersen, S | 1 |
| Boyle, AJ | 1 |
| Baillie, JK | 1 |
| Shekar, K | 1 |
| Palpant, N | 1 |
| Suen, JY | 1 |
| Matthay, MA | 1 |
| McAuley, DF | 1 |
| Fraser, JF | 1 |
| Settles, JA | 1 |
| Gerety, GF | 1 |
| Spaepen, E | 1 |
| Suico, JG | 1 |
| Child, CJ | 1 |
| Oh, BL | 1 |
| Lee, JS | 1 |
| Lee, EY | 2 |
| Lee, HY | 1 |
| Yu, HG | 1 |
| Leslie, I | 1 |
| Boos, LA | 1 |
| Larkin, J | 1 |
| Pickering, L | 1 |
| Lima, HK | 1 |
| Vogel, K | 1 |
| Hampel, D | 1 |
| Wagner-Gillespie, M | 1 |
| Fogleman, AD | 1 |
| Ferraz, SL | 1 |
| O'Connor, M | 1 |
| Mazzucchelli, TG | 1 |
| Kajiyama, H | 1 |
| Suzuki, S | 1 |
| Shimbo, A | 1 |
| Utsumi, F | 1 |
| Yoshikawa, N | 1 |
| Kikkawa, F | 1 |
| Javvaji, PK | 1 |
| Dhali, A | 1 |
| Francis, JR | 1 |
| Kolte, AP | 1 |
| Roy, SC | 1 |
| Selvaraju, S | 1 |
| Mech, A | 1 |
| Sejian, V | 1 |
| DeSilva, S | 1 |
| Vaidya, SS | 1 |
| Mao, C | 1 |
| Akhatayeva, Z | 1 |
| Cheng, H | 1 |
| Zhang, G | 1 |
| Jiang, F | 1 |
| Meng, X | 1 |
| Elnour, IE | 1 |
| Lan, X | 1 |
| Song, E | 1 |
| Rohde, S | 1 |
| Antonides, CFJ | 1 |
| Muslem, R | 1 |
| de Woestijne, PCV | 1 |
| der Meulen, MHV | 1 |
| Kraemer, US | 1 |
| Dalinghaus, M | 1 |
| Bogers, AJJC | 1 |
| Pourmand, A | 1 |
| Ghassemi, M | 1 |
| Sumon, K | 1 |
| Amini, SB | 1 |
| Hood, C | 1 |
| Sikka, N | 1 |
| Duan, H | 1 |
| Chen, WP | 1 |
| Fan, M | 1 |
| Wang, WP | 1 |
| Yu, L | 2 |
| Tan, SJ | 1 |
| Xin, S | 4 |
| Wan, LJ | 1 |
| Guo, YG | 1 |
| Tanda, S | 1 |
| Gingl, K | 1 |
| Ličbinský, R | 1 |
| Hegrová, J | 1 |
| Goessler, W | 1 |
| Li, ZL | 1 |
| Zhou, YL | 1 |
| Yan, W | 1 |
| Luo, L | 1 |
| Su, ZZ | 1 |
| Fan, MZ | 1 |
| Wang, SR | 1 |
| Zhao, WG | 1 |
| Xu, D | 5 |
| Hassan, HM | 1 |
| Jiang, Z | 1 |
| Bachmann, KF | 1 |
| Haenggi, M | 1 |
| Jakob, SM | 1 |
| Takala, J | 1 |
| Gattinoni, L | 1 |
| Berger, D | 1 |
| Bentley, RF | 1 |
| Vecchiarelli, E | 1 |
| Banks, L | 1 |
| Gonçalves, PEO | 1 |
| Thomas, SG | 1 |
| Goodman, JM | 1 |
| Mather, K | 1 |
| Boachie, R | 1 |
| Anini, Y | 1 |
| Panahi, S | 1 |
| Anderson, GH | 1 |
| Luhovyy, BL | 1 |
| Nafie, MS | 1 |
| Arafa, K | 1 |
| Sedky, NK | 1 |
| Alakhdar, AA | 1 |
| Arafa, RK | 1 |
| Fan, S | 1 |
| Hu, H | 1 |
| Liang, J | 1 |
| Hu, BC | 1 |
| Wen, Z | 1 |
| Hu, D | 1 |
| Liu, YY | 1 |
| Chu, Q | 1 |
| Wu, MC | 2 |
| Lu, X | 1 |
| Wang, D | 1 |
| Hu, M | 1 |
| Shen, H | 1 |
| Yao, M | 1 |
| Dahlgren, RA | 1 |
| Vysloužil, J | 1 |
| Kulich, P | 1 |
| Zeman, T | 1 |
| Vaculovič, T | 1 |
| Tvrdoňová, M | 1 |
| Mikuška, P | 1 |
| Večeřa, Z | 1 |
| Stráská, J | 1 |
| Moravec, P | 1 |
| Balcar, VJ | 1 |
| Šerý, O | 1 |
| Qiao, L | 1 |
| Xiong, X | 2 |
| Peng, X | 1 |
| Zheng, J | 1 |
| Duan, J | 1 |
| Xiao, W | 1 |
| Zhou, HY | 1 |
| Sui, ZY | 1 |
| Zhao, FL | 1 |
| Sun, YN | 1 |
| Wang, HY | 1 |
| Han, BH | 1 |
| Jintao, X | 1 |
| Shasha, Y | 1 |
| Jincai, W | 1 |
| Chunyan, L | 1 |
| Mengya, Y | 1 |
| Yongli, S | 1 |
| Rasoanirina, BNV | 1 |
| Lassoued, MA | 1 |
| Miladi, K | 1 |
| Razafindrakoto, Z | 1 |
| Chaâbane-Banaoues, R | 1 |
| Ramanitrahasimbola, D | 1 |
| Cornet, M | 1 |
| Sfar, S | 1 |
| Liang, C | 1 |
| Xing, Q | 1 |
| Yi, JL | 1 |
| Zhang, YQ | 1 |
| Li, CY | 1 |
| Tang, SJ | 1 |
| Gao, C | 1 |
| Sun, X | 2 |
| Peng, M | 1 |
| Sun, XF | 1 |
| Zhang, T | 1 |
| Shi, JH | 1 |
| Liao, CX | 1 |
| Gao, WJ | 1 |
| Sun, LL | 1 |
| Gao, Y | 1 |
| Cao, WH | 1 |
| Lyu, J | 1 |
| Yu, CQ | 1 |
| Wang, SF | 1 |
| Pang, ZC | 1 |
| Cong, LM | 1 |
| Dong, Z | 1 |
| Wu, F | 1 |
| Wu, XP | 1 |
| Jiang, GH | 1 |
| Wang, XJ | 1 |
| Wang, BY | 1 |
| Li, LM | 1 |
| Pan, L | 1 |
| Wan, SP | 1 |
| Yi, HWL | 1 |
| He, HJ | 1 |
| Yong, ZP | 1 |
| Shan, GL | 1 |
| Weng, TT | 1 |
| Yan, SQ | 1 |
| Gao, GP | 1 |
| Wei, C | 1 |
| Tao, FB | 1 |
| Shao, ZH | 1 |
| Yao, T | 1 |
| Dong, S | 1 |
| Shi, S | 1 |
| Feng, YL | 1 |
| Zhang, YW | 1 |
| Wang, SP | 1 |
| Shi, AX | 1 |
| Operario, D | 1 |
| Zhang, ZH | 1 |
| Zhu, XF | 1 |
| Zaller, N | 1 |
| Gao, P | 1 |
| Sun, YH | 1 |
| Zhang, HB | 1 |
| Fang, Q | 1 |
| Chen, H | 1 |
| Kim, GW | 1 |
| Imam, H | 1 |
| Khan, M | 1 |
| Siddiqui, A | 1 |
| Hui, PW | 1 |
| Ng, C | 1 |
| Cheung, KW | 1 |
| Lai, CL | 5 |
| Surial, B | 1 |
| Béguelin, C | 1 |
| Chave, JP | 1 |
| Stöckle, M | 1 |
| Boillat-Blanco, N | 1 |
| Doco-Lecompte, T | 1 |
| Bernasconi, E | 1 |
| Fehr, J | 1 |
| Günthard, HF | 1 |
| Schmid, P | 1 |
| Walti, LN | 1 |
| Furrer, H | 1 |
| Rauch, A | 1 |
| Wandeler, G | 1 |
| Kalkeri, R | 1 |
| Ptak, RG | 1 |
| Zhou, T | 1 |
| Van Mellaert, L | 1 |
| Dumbre, SG | 1 |
| Block, T | 1 |
| Groaz, E | 1 |
| De Jonghe, S | 1 |
| Herdewijn, P | 1 |
| Yoshida, K | 1 |
| Enomoto, M | 4 |
| Tamori, A | 3 |
| Nishiguchi, S | 3 |
| Kawada, N | 2 |
| Tedeschi, A | 2 |
| Frustaci, AM | 1 |
| Mazzucchelli, M | 1 |
| Cairoli, R | 1 |
| Montillo, M | 1 |
| Abdelbary, GA | 1 |
| Amin, MM | 1 |
| Zakaria, MY | 1 |
| El Awdan, SA | 1 |
| Lin, J | 1 |
| Zhuo, Y | 1 |
| Zhang, D | 2 |
| Kim, WI | 1 |
| Cho, DH | 1 |
| Kim, YJ | 1 |
| Kim, HS | 2 |
| Kim, JH | 3 |
| Cha, SK | 1 |
| Park, KS | 1 |
| Lee, SM | 1 |
| Shi, H | 2 |
| Xia, J | 2 |
| Chan, L | 1 |
| Asriel, B | 1 |
| Eaton, EF | 1 |
| Wyatt, CM | 1 |
| Molica, S | 1 |
| Levato, L | 1 |
| Mirabelli, R | 1 |
| Lentini, M | 1 |
| Hammond, SP | 1 |
| Chen, K | 1 |
| Pandit, A | 1 |
| Davids, MS | 1 |
| Issa, NC | 1 |
| Marty, FM | 1 |
| Cho, J | 1 |
| Cheung, PP | 1 |
| Agarwal, K | 1 |
| Brunetto, M | 1 |
| Seto, WK | 1 |
| Fung, S | 1 |
| Marcellin, P | 6 |
| Izumi, N | 1 |
| Bae, H | 1 |
| Sharma, M | 1 |
| Janssen, HLA | 1 |
| Çelen, MK | 2 |
| Furusyo, N | 1 |
| Shalimar, D | 1 |
| Yoon, KT | 1 |
| Trinh, H | 1 |
| Flaherty, JF | 1 |
| Gaggar, A | 1 |
| Lau, AH | 1 |
| Cathcart, AL | 1 |
| Bhardwaj, N | 1 |
| Suri, V | 1 |
| Mani Subramanian, G | 1 |
| Gane, EJ | 2 |
| Buti, M | 4 |
| Chan, HLY | 1 |
| Alsunaid, SR | 1 |
| Ashraf, H | 1 |
| Soubani, AO | 1 |
| Delgado Ramos, GM | 1 |
| Almaddah, N | 1 |
| Alsafwah, S | 1 |
| Yu, F | 1 |
| Naing, C | 1 |
| Poovorawan, Y | 1 |
| Tong, KS | 1 |
| Tsai, WC | 1 |
| Hsu, WT | 1 |
| Liu, WD | 1 |
| Sun, HY | 1 |
| Chuang, YC | 1 |
| Huang, YS | 1 |
| Cheng, A | 2 |
| Lin, KY | 1 |
| Huang, YC | 1 |
| Chen, GJ | 1 |
| Huang, SH | 1 |
| Sheng, WH | 1 |
| Hsieh, SM | 1 |
| Hung, CC | 1 |
| Chang, SC | 1 |
| Innocenti, I | 1 |
| Morelli, F | 1 |
| Autore, F | 1 |
| Corbingi, A | 1 |
| Pasquale, R | 1 |
| Sorà, F | 1 |
| Pompili, M | 1 |
| Laurenti, L | 1 |
| Li, T | 1 |
| Qu, Y | 1 |
| Lin, C | 1 |
| Yang, B | 1 |
| Kunii, T | 1 |
| Iijima, T | 1 |
| Jojima, T | 1 |
| Shimizu, M | 1 |
| Kase, M | 1 |
| Sakurai, S | 1 |
| Kogai, T | 1 |
| Usui, I | 1 |
| Aso, Y | 1 |
| Neumann-Fraune, M | 2 |
| Beggel, B | 1 |
| Pfister, H | 1 |
| Kaiser, R | 2 |
| Verheyen, J | 2 |
| Marzano, A | 2 |
| Marengo, A | 2 |
| David, E | 1 |
| Rizzetto, M | 1 |
| Patterson, S | 1 |
| Strasser, SI | 2 |
| McCaughan, GW | 2 |
| Angus, PW | 3 |
| Gatanaga, H | 2 |
| Hayashida, T | 1 |
| Tanuma, J | 1 |
| Oka, S | 3 |
| Yaşar, DG | 1 |
| Suyanı, E | 1 |
| Özenirler, S | 1 |
| Sucak, GT | 1 |
| Chang, MS | 3 |
| Olsen, SK | 3 |
| Pichardo, EM | 3 |
| Heese, S | 2 |
| Stiles, JB | 3 |
| Guarrera, JV | 3 |
| Emond, JC | 3 |
| Brown, RS | 5 |
| Rosenthal-Cogan, L | 1 |
| Brubaker, WD | 1 |
| Casals-Seoane, F | 1 |
| Arberas-Díez, B | 1 |
| García-Buey, L | 1 |
| Antonucci, G | 1 |
| Mazzotta, F | 2 |
| Angeletti, C | 1 |
| Girardi, E | 1 |
| Puoti, M | 2 |
| De Stefano, G | 1 |
| Grossi, P | 1 |
| Petrosillo, N | 1 |
| Pagano, G | 1 |
| Cassola, G | 1 |
| Orani, A | 1 |
| Sagnelli, C | 2 |
| Armignacco, O | 2 |
| Sagnelli, E | 2 |
| McGonigal, KH | 1 |
| Bajjoka, IE | 1 |
| Abouljoud, MS | 1 |
| Wadhawan, M | 1 |
| Gupta, S | 1 |
| Goyal, N | 1 |
| Taneja, S | 1 |
| Kumar, A | 1 |
| Cento, V | 1 |
| Van Hemert, F | 1 |
| Mirabelli, C | 1 |
| Di Maio, VC | 1 |
| Salpini, R | 1 |
| Bertoli, A | 1 |
| Micheli, V | 2 |
| Gubertini, G | 1 |
| Romano, S | 1 |
| Visca, M | 1 |
| De Sanctis, GM | 1 |
| Berkhout, B | 1 |
| Marino, N | 1 |
| Cappiello, G | 1 |
| Spanò, A | 1 |
| Sarrecchia, C | 1 |
| Ceccherini-Silberstein, F | 1 |
| Andreoni, M | 1 |
| Angelico, M | 1 |
| Perno, CF | 1 |
| Svicher, V | 1 |
| Lv, GC | 1 |
| Yao, JM | 1 |
| Yang, YD | 2 |
| Zheng, L | 2 |
| Sheng, JF | 1 |
| Chen, Y | 2 |
| Li, LJ | 2 |
| Jia, YY | 1 |
| Lu, CT | 1 |
| Zhao, JY | 1 |
| Wang, S | 1 |
| Wen, AD | 1 |
| Yang, ZF | 1 |
| Hang, TJ | 1 |
| Price, H | 1 |
| Dunn, D | 1 |
| Pillay, D | 1 |
| Bani-Sadr, F | 2 |
| de Vries-Sluijs, T | 1 |
| Jain, MK | 3 |
| Kuzushita, N | 1 |
| Mauss, S | 3 |
| Núñez, M | 2 |
| Nüesch, R | 1 |
| Peters, M | 1 |
| Reiberger, T | 2 |
| Stephan, C | 1 |
| Tan, L | 1 |
| Gilson, R | 2 |
| Gulland, A | 1 |
| Hamers, RL | 1 |
| Zaaijer, HL | 2 |
| Wallis, CL | 1 |
| Siwale, M | 1 |
| Ive, P | 1 |
| Botes, ME | 1 |
| Sigaloff, KC | 1 |
| Hoepelman, AI | 1 |
| Stevens, WS | 1 |
| Rinke de Wit, TF | 1 |
| Gentile, I | 1 |
| Bonadies, G | 1 |
| Carleo, MA | 1 |
| Buonomo, AR | 1 |
| Borrelli, F | 1 |
| Portella, G | 1 |
| Borgia, G | 1 |
| Su, Y | 1 |
| Min, L | 1 |
| Lian, JS | 1 |
| Zeng, LY | 1 |
| Chen, JY | 1 |
| Jia, HY | 1 |
| Zhang, YM | 2 |
| Xiang, DR | 1 |
| Hu, JH | 1 |
| Lu, YF | 1 |
| Miller, MD | 3 |
| Kitrinos, KM | 2 |
| Kim, MN | 1 |
| Lee, CK | 3 |
| Lee, S | 1 |
| Kim, DY | 3 |
| Han, KH | 3 |
| Chon, CY | 2 |
| Park, JY | 2 |
| Calvaruso, V | 1 |
| Craxì, A | 1 |
| Mert, D | 1 |
| Ay, M | 1 |
| Dal, T | 1 |
| Kaya, S | 1 |
| Yildirim, N | 1 |
| Gulsun, S | 1 |
| Barcin, T | 1 |
| Kalkanli, S | 1 |
| Dal, MS | 1 |
| Ayaz, C | 1 |
| Wright, AJ | 1 |
| Fishman, JA | 1 |
| Chung, RT | 1 |
| Shahabadi, N | 1 |
| Falsafi, M | 1 |
| Rodríguez Gil, FJ | 1 |
| Gallego Pérez, B | 1 |
| Gajownik, U | 1 |
| García Belmonte, D | 1 |
| Marín Bernabé, CM | 1 |
| Martínez Crespo, JJ | 1 |
| Hafkin, JS | 1 |
| Osborn, MK | 1 |
| Localio, AR | 1 |
| Amorosa, VK | 1 |
| Kostman, JR | 1 |
| Stern, JJ | 1 |
| De La Torre, P | 1 |
| Mounzer, K | 1 |
| Frank, I | 1 |
| Gross, R | 1 |
| Chang, KM | 1 |
| Lo Re, V | 1 |
| Hamnvik, OP | 1 |
| Becker, CB | 1 |
| Levy, BD | 1 |
| Loscalzo, J | 1 |
| Kang, M | 1 |
| Hollabaugh, K | 1 |
| Pham, V | 1 |
| Koletar, SL | 1 |
| Wu, K | 1 |
| Smurzynski, M | 1 |
| Aberg, JA | 1 |
| Xu, Z | 4 |
| Pisaturo, M | 1 |
| Martini, S | 1 |
| Filippini, P | 1 |
| Coppola, N | 1 |
| Greenup, AJ | 1 |
| Tan, PK | 1 |
| Nguyen, V | 1 |
| Glass, A | 1 |
| Davison, S | 1 |
| Chatterjee, U | 1 |
| Holdaway, S | 1 |
| Samarasinghe, D | 1 |
| Jackson, K | 1 |
| Locarnini, SA | 3 |
| Rao, W | 2 |
| Xie, M | 1 |
| Shen, Z | 1 |
| Tsai, PJ | 1 |
| Chang, A | 1 |
| Yamada, S | 1 |
| Tsai, N | 1 |
| Bartholomew, ML | 1 |
| Viganò, M | 4 |
| Mangia, G | 1 |
| Lampertico, P | 4 |
| Chen, EQ | 1 |
| Shi, Y | 1 |
| Wu, DB | 1 |
| Wu, L | 1 |
| Jin, Y | 1 |
| Jia, J | 1 |
| Li, M | 1 |
| Watanabe, T | 2 |
| Tokumoto, Y | 1 |
| Hirooka, M | 1 |
| Koizumi, Y | 1 |
| Tada, F | 1 |
| Ochi, H | 2 |
| Abe, M | 2 |
| Kumagi, T | 1 |
| Ikeda, Y | 1 |
| Matsuura, B | 1 |
| Takada, K | 1 |
| Hiasa, Y | 1 |
| Barone, M | 1 |
| Iannone, A | 1 |
| Di Leo, A | 1 |
| Woo, HY | 1 |
| Choi, JY | 1 |
| Yoon, SK | 1 |
| Suh, DJ | 3 |
| Paik, SW | 2 |
| Um, SH | 2 |
| Kim, BI | 1 |
| Lee, HJ | 1 |
| Cho, M | 1 |
| Kim, DJ | 1 |
| Hwang, JS | 1 |
| Roche, B | 2 |
| Samuel, D | 5 |
| Koskinas, JS | 1 |
| Deutsch, M | 2 |
| Adamidi, S | 1 |
| Skondra, M | 1 |
| Tampaki, M | 1 |
| Alexopoulou, A | 1 |
| Manolakopoulos, S | 2 |
| Pectasides, D | 1 |
| Huang, G | 1 |
| Lau, WY | 1 |
| Wang, ZG | 1 |
| Pan, ZY | 1 |
| Yuan, SX | 1 |
| Shen, F | 1 |
| Zhou, WP | 1 |
| Jiao, M | 1 |
| Ren, F | 1 |
| Wen, T | 1 |
| Wei, L | 2 |
| Bai, L | 1 |
| Han, Y | 1 |
| Zhao, C | 1 |
| Duan, Z | 1 |
| Peng, J | 1 |
| Xu, M | 1 |
| Yao, Z | 1 |
| Wen, F | 1 |
| Gao, W | 2 |
| James, G | 1 |
| Sidhu, P | 1 |
| Raza, M | 1 |
| Cho, YK | 1 |
| Cui, XJ | 1 |
| Jeong, SU | 1 |
| Song, BC | 1 |
| Rosenthal, P | 2 |
| Ehrhardt, S | 1 |
| Xie, C | 1 |
| Guo, N | 1 |
| Nelson, K | 1 |
| Thio, CL | 1 |
| Jiao, Z | 1 |
| Yan, L | 1 |
| Hamada-Tsutsumi, S | 1 |
| Yokomaku, Y | 1 |
| Imamura, J | 1 |
| Sugiura, W | 1 |
| Tanaka, Y | 1 |
| Hakim, GD | 1 |
| Akarsu, M | 1 |
| Karademir, S | 1 |
| Unek, T | 1 |
| Astarcıoğlu, İ | 1 |
| Utsumi, T | 1 |
| Sawada, K | 1 |
| Nakajima, S | 1 |
| Ohtake, T | 1 |
| Fujiya, M | 1 |
| Kohgo, Y | 1 |
| Choudhary, NS | 1 |
| Saraf, N | 1 |
| Saigal, S | 1 |
| Mohanka, R | 1 |
| Rastogi, A | 1 |
| Goja, S | 1 |
| Menon, PB | 1 |
| Soin, AS | 1 |
| Hong, SP | 3 |
| Jang, ES | 1 |
| Park, SJ | 1 |
| Hwang, SG | 1 |
| Kang, SK | 1 |
| Jeong, SH | 1 |
| Singer, GA | 1 |
| Zielsdorf, S | 1 |
| Fleetwood, VA | 1 |
| Alvey, N | 1 |
| Cohen, E | 1 |
| Eswaran, S | 1 |
| Shah, N | 1 |
| Chan, EY | 1 |
| Hertl, M | 1 |
| Fayek, SA | 1 |
| Jiang, W | 1 |
| Liu, LQ | 1 |
| Guan, GJ | 1 |
| Liu, XC | 1 |
| Khemichian, S | 1 |
| Hsieh, MJ | 1 |
| Zhang, SR | 1 |
| Limurti, J | 1 |
| Kim, J | 2 |
| Fong, TL | 1 |
| Wang, YW | 1 |
| Shan, X | 1 |
| Deng, H | 1 |
| Huang, WX | 1 |
| Zhang, DZ | 1 |
| Tang, N | 1 |
| Shan, YL | 1 |
| Guo, JJ | 1 |
| Huang, A | 1 |
| Su, F | 1 |
| Dai, J | 1 |
| Cui, X | 1 |
| Ning, H | 1 |
| Ye, X | 1 |
| Chen, R | 1 |
| Ye, H | 1 |
| Cheng, S | 1 |
| Soriano, V | 3 |
| Barreiro, P | 3 |
| de Mendoza, C | 1 |
| Rawal, RK | 1 |
| Konreddy, AK | 1 |
| Chu, CK | 1 |
| Lee, JG | 1 |
| Lee, J | 1 |
| Song, SH | 1 |
| Ju, MK | 1 |
| Kim, MS | 1 |
| Choi, JS | 1 |
| Joo, DJ | 1 |
| de Jésus Ngoma, P | 1 |
| Kabamba, B | 1 |
| Dahlqvist, G | 1 |
| Sempoux, C | 1 |
| Lanthier, N | 1 |
| Shindano, T | 1 |
| Van Den Neste, E | 1 |
| Horsmans, Y | 1 |
| Murray, JM | 1 |
| Stancevic, O | 1 |
| Lütgehetmann, M | 3 |
| Wursthorn, K | 2 |
| Petersen, J | 4 |
| Dandri, M | 2 |
| Wang, JH | 2 |
| Wang, XY | 1 |
| Fei, R | 1 |
| Zhang, HY | 2 |
| Mazzaro, C | 1 |
| Dal Maso, L | 1 |
| Urraro, T | 1 |
| Mauro, E | 1 |
| Castelnovo, L | 1 |
| Casarin, P | 1 |
| Monti, G | 1 |
| Gattei, V | 1 |
| Zignego, AL | 1 |
| Pozzato, G | 1 |
| Zhang, MY | 1 |
| Zhu, GQ | 1 |
| Shi, KQ | 1 |
| Zheng, JN | 1 |
| Cheng, Z | 1 |
| Zou, ZL | 1 |
| Huang, HH | 1 |
| Chen, FY | 1 |
| Zheng, MH | 1 |
| Gallant, J | 1 |
| Brunetta, J | 1 |
| Crofoot, G | 1 |
| Benson, P | 1 |
| Mills, A | 1 |
| Brinson, C | 1 |
| Garner, W | 1 |
| Fordyce, M | 1 |
| Das, M | 1 |
| McCallister, S | 1 |
| Herishanu, Y | 1 |
| Katchman, H | 1 |
| Polliack, A | 1 |
| Li, DF | 1 |
| Jin, ZJ | 1 |
| Chen, YS | 1 |
| Qiao, LM | 1 |
| Zhou, J | 1 |
| Quiros-Roldan, E | 1 |
| Calabresi, A | 1 |
| Lapadula, G | 1 |
| Tirelli, V | 1 |
| Costarelli, S | 1 |
| Cologni, G | 1 |
| Zaltron, S | 1 |
| Carosi, G | 1 |
| Torti, C | 1 |
| Yang, DH | 1 |
| Xie, SF | 1 |
| Wang, YM | 1 |
| Zhao, NF | 1 |
| Li, MW | 1 |
| Lo, YL | 1 |
| See, SJ | 1 |
| Tan, CK | 1 |
| Kuwahara, R | 2 |
| Kumashiro, R | 2 |
| Ide, T | 2 |
| Koga, Y | 2 |
| Hino, T | 2 |
| Hisamochi, A | 1 |
| Tanaka, K | 1 |
| Ogata, K | 1 |
| Koga, H | 1 |
| Takao, Y | 1 |
| Sata, M | 2 |
| Matthews, GV | 3 |
| Avihingsanon, A | 2 |
| Lewin, SR | 3 |
| Amin, J | 1 |
| Rerknimitr, R | 1 |
| Petcharapirat, P | 1 |
| Marks, P | 2 |
| Sasadeusz, J | 3 |
| Cooper, DA | 2 |
| Bowden, S | 2 |
| Locarnini, S | 6 |
| Ruxrungtham, K | 2 |
| Dore, GJ | 4 |
| Kamar, N | 1 |
| Milioto, O | 1 |
| Alric, L | 1 |
| El Kahwaji, L | 1 |
| Cointault, O | 1 |
| Lavayssière, L | 1 |
| Sauné, K | 1 |
| Izopet, J | 1 |
| Rostaing, L | 1 |
| Lacombe, K | 2 |
| Gozlan, J | 2 |
| Boyd, A | 2 |
| Boelle, PY | 1 |
| Bonnard, P | 1 |
| Molina, JM | 2 |
| Miailhes, P | 1 |
| Lascoux-Combe, C | 1 |
| Serfaty, L | 2 |
| Zoulim, F | 6 |
| Girard, PM | 2 |
| Beckebaum, S | 1 |
| Sotiropoulos, GC | 1 |
| Gerken, G | 1 |
| Cicinnati, VR | 1 |
| Patterson, SJ | 2 |
| Renou, C | 1 |
| Cadranel, JF | 1 |
| Pariente, A | 1 |
| Pénaranda, G | 1 |
| Bourlière, M | 1 |
| Halfon, P | 1 |
| Igual, JP | 1 |
| Harafa, A | 1 |
| Muller, P | 1 |
| Bertrand, JJ | 1 |
| Laugier, R | 1 |
| Degertekin, B | 2 |
| Hussain, M | 2 |
| Tan, J | 3 |
| Oberhelman, K | 2 |
| Lok, AS | 8 |
| Ingiliz, P | 2 |
| Valantin, MA | 1 |
| Thibault, V | 4 |
| Duvivier, C | 1 |
| Dominguez, S | 1 |
| Katlama, C | 4 |
| Poynard, T | 4 |
| Benhamou, Y | 6 |
| García Buey, L | 1 |
| González Mateos, F | 1 |
| Moreno Otero, R | 1 |
| Martín-Carbonero, L | 1 |
| García-Samaniego, J | 2 |
| Ribeiro, RM | 2 |
| Matthews, G | 1 |
| Perelson, AS | 2 |
| Audsley, J | 1 |
| Arrifin, N | 1 |
| Yuen, LK | 1 |
| Ayres, A | 1 |
| Crowe, SM | 1 |
| Bartholomeusz, A | 2 |
| Mijch, A | 1 |
| Kwon, HC | 1 |
| Cheong, JY | 1 |
| Cho, SW | 1 |
| Choi, JM | 1 |
| Kim, SO | 1 |
| Yoo, WD | 1 |
| Kurbegov, AC | 1 |
| Sokol, RJ | 1 |
| Alvarez-Uria, G | 1 |
| Ratcliffe, L | 1 |
| Vilar, J | 1 |
| Pastor, R | 1 |
| Habersetzer, F | 1 |
| Fafi-Kremer, S | 1 |
| Doffoel, M | 1 |
| Baumert, TF | 1 |
| Gut, JP | 1 |
| Stoll-Keller, F | 1 |
| Schvoerer, E | 1 |
| Amini-Bavil-Olyaee, S | 1 |
| Herbers, U | 1 |
| Sheldon, J | 3 |
| Luedde, T | 1 |
| Trautwein, C | 4 |
| Tacke, F | 2 |
| Jalili, A | 1 |
| Kinaciyan, T | 1 |
| Barisani, T | 1 |
| Peck-Radosavljevic, M | 2 |
| Stingl, G | 1 |
| Geusau, A | 1 |
| Wöhrl, S | 1 |
| Margeridon-Thermet, S | 2 |
| Shulman, NS | 1 |
| Ahmed, A | 1 |
| Shahriar, R | 1 |
| Holmes, SP | 2 |
| Babrzadeh, F | 1 |
| Gharizadeh, B | 1 |
| Hanczaruk, B | 1 |
| Simen, BB | 1 |
| Egholm, M | 1 |
| Shafer, RW | 2 |
| Schildgen, O | 3 |
| Moucari, R | 2 |
| Francoz, C | 1 |
| Lada, O | 3 |
| Abdel Razek, W | 1 |
| Valla, D | 1 |
| Belghiti, J | 1 |
| Durand, F | 1 |
| Tan, LK | 1 |
| Gilleece, Y | 1 |
| Mandalia, S | 1 |
| Murungi, A | 1 |
| Grover, D | 1 |
| Fisher, M | 1 |
| Atkins, M | 1 |
| Nelson, M | 2 |
| Rodríguez Dominguez, M | 1 |
| de la Loma, GA | 1 |
| Moreira Vicente, V | 2 |
| Mateos Lindemann, M | 1 |
| Mas, A | 2 |
| Terrault, NA | 3 |
| Tran, TT | 1 |
| Schiff, E | 2 |
| McGuire, BM | 1 |
| Tupper, R | 1 |
| Ramanathan, S | 1 |
| Enejosa, J | 1 |
| Zhong, L | 1 |
| Zong, J | 1 |
| Wang, YZ | 1 |
| Xiao, JH | 1 |
| Ruan, LH | 1 |
| Pu, XK | 1 |
| Shen, HY | 1 |
| Wu, GX | 1 |
| Laurent, C | 1 |
| Bourgeois, A | 1 |
| Mpoudi-Ngolé, E | 1 |
| Kouanfack, C | 1 |
| Ciaffi, L | 1 |
| Nkoué, N | 1 |
| Mougnutou, R | 1 |
| Calmy, A | 1 |
| Koulla-Shiro, S | 1 |
| Ducos, J | 1 |
| Delaporte, E | 1 |
| Kobayashi, S | 1 |
| Iwai, S | 1 |
| Morikawa, H | 1 |
| Sakaguchi, H | 1 |
| Habu, D | 1 |
| Shiomi, S | 1 |
| Imanishi, Y | 1 |
| Zhang, FK | 1 |
| Jia, JD | 1 |
| Wang, BE | 1 |
| Fujimoto, M | 1 |
| Ichikawa, T | 1 |
| Nakao, K | 1 |
| Miyaaki, H | 1 |
| Shibata, H | 1 |
| Eguchi, S | 1 |
| Takatsuki, M | 1 |
| Nagaoka, S | 1 |
| Yatsuhashi, H | 1 |
| Kanematsu, T | 1 |
| Eguchi, K | 1 |
| Taéron, C | 1 |
| Vassiliadis, TG | 1 |
| Giouleme, O | 1 |
| Koumerkeridis, G | 1 |
| Koumaras, H | 1 |
| Tziomalos, K | 1 |
| Patsiaoura, K | 1 |
| Grammatikos, N | 1 |
| Mpoumponaris, A | 1 |
| Gkisakis, D | 1 |
| Theodoropoulos, K | 1 |
| Panderi, A | 1 |
| Katsinelos, P | 1 |
| Eugenidis, N | 1 |
| Kurashige, N | 1 |
| Ohkawa, K | 1 |
| Hiramatsu, N | 1 |
| Oze, T | 1 |
| Yakushijin, T | 1 |
| Mochizuki, K | 1 |
| Hosui, A | 1 |
| Miyagi, T | 1 |
| Ishida, H | 1 |
| Tatsumi, T | 1 |
| Kanto, T | 1 |
| Takehara, T | 1 |
| Hayashi, N | 1 |
| Mansour, W | 1 |
| Ducancelle, A | 1 |
| Le Gal, F | 1 |
| Le Guillou-Guillemette, H | 1 |
| Abgueguen, P | 1 |
| Pivert, A | 1 |
| Calès, P | 1 |
| Gordien, E | 2 |
| Lunel, F | 1 |
| van Bömmel, F | 6 |
| de Man, RA | 3 |
| Wedemeyer, H | 5 |
| Deterding, K | 2 |
| Buggisch, P | 2 |
| Erhardt, A | 2 |
| Hüppe, D | 3 |
| Stein, K | 1 |
| Trojan, J | 2 |
| Sarrazin, C | 2 |
| Böcher, WO | 1 |
| Spengler, U | 2 |
| Wasmuth, HE | 2 |
| Reinders, JG | 1 |
| Möller, B | 3 |
| Rhode, P | 1 |
| Feucht, HH | 3 |
| Wiedenmann, B | 2 |
| Berg, T | 7 |
| Katz, LH | 2 |
| Paul, M | 2 |
| Guy, DG | 2 |
| Tur-Kaspa, R | 2 |
| Gervain, J | 2 |
| Horváth, G | 2 |
| Hunyady, B | 2 |
| Makara, M | 2 |
| Pár, A | 2 |
| Szalay, F | 2 |
| Tornai, I | 2 |
| Telegdy, L | 2 |
| Wei, ZW | 1 |
| Xu, QH | 1 |
| Shu, X | 1 |
| Jie, YS | 1 |
| Zhang, K | 1 |
| Xie, QF | 1 |
| Li, G | 1 |
| Genzini, T | 1 |
| Dos Santos, RG | 1 |
| Pedrosa, C | 1 |
| Curvelo, LA | 1 |
| Noujaim, HM | 1 |
| Crescentini, F | 1 |
| Mota, LT | 1 |
| Guirro, TG | 1 |
| Ferreira, FY | 1 |
| Salomão, P | 1 |
| Pereira, JR | 1 |
| de Miranda, MP | 1 |
| Poordad, F | 1 |
| Chee, GM | 1 |
| Jiang, L | 1 |
| Yan, LN | 1 |
| Jang, H | 1 |
| Choi, JJ | 1 |
| Son, Y | 1 |
| Park, H | 1 |
| Xu, T | 1 |
| Si, L | 1 |
| Ren, X | 1 |
| Zhong, Y | 2 |
| Zhao, J | 2 |
| Coffin, CS | 1 |
| Mulrooney-Cousins, PM | 1 |
| Peters, MG | 2 |
| van Marle, G | 1 |
| Roberts, JP | 1 |
| Michalak, TI | 1 |
| Mendes-Correa, MC | 1 |
| Pinho, JR | 1 |
| Yuen, L | 1 |
| Sitnik, R | 1 |
| Santana, RA | 1 |
| Gomes-Gouvêa, MS | 1 |
| Leite, OM | 1 |
| Martins, LG | 1 |
| Silva, MH | 1 |
| Gianini, RJ | 1 |
| Uip, DE | 1 |
| Wu, ZP | 1 |
| Hang, T | 1 |
| Gao, YT | 1 |
| Jing, L | 1 |
| Liu, L | 2 |
| Du, Z | 1 |
| Wong, VW | 1 |
| Li, Q | 1 |
| Reuman, EC | 1 |
| Caudill, HB | 1 |
| Borroto-Esoda, K | 4 |
| Svarovskaia, ES | 1 |
| Jiménez-Pérez, M | 1 |
| Sáez-Gómez, AB | 1 |
| Mongil Poce, L | 1 |
| Lozano-Rey, JM | 1 |
| de la Cruz-Lombardo, J | 1 |
| Rodrigo-López, JM | 1 |
| Thurairajah, P | 1 |
| Khanna, A | 1 |
| Mutimer, D | 2 |
| Brost, S | 1 |
| Schnitzler, P | 1 |
| Stremmel, W | 1 |
| Eisenbach, C | 1 |
| Katsanos, KH | 1 |
| Tsianos, VE | 1 |
| Zois, CD | 1 |
| Zioga, H | 1 |
| Vagias, I | 1 |
| Zervou, E | 1 |
| Christodoulou, DK | 1 |
| Tsianos, EV | 1 |
| Karlas, T | 1 |
| Hartmann, J | 1 |
| Weimann, A | 1 |
| Maier, M | 1 |
| Bartels, M | 1 |
| Jonas, S | 1 |
| Mössner, J | 1 |
| Tillmann, HL | 5 |
| Wiegand, J | 2 |
| Andreone, P | 2 |
| Volpes, R | 1 |
| Canova, D | 1 |
| Cursaro, C | 2 |
| Riili, A | 1 |
| Fiorentino, B | 1 |
| Bacci, M | 1 |
| Guazzini, S | 1 |
| Burra, P | 1 |
| Mallet, V | 1 |
| Vallet-Pichard, A | 1 |
| Pol, S | 3 |
| Andersen, ES | 1 |
| Weiland, O | 1 |
| Leutscher, P | 1 |
| Krarup, H | 1 |
| Westin, J | 1 |
| Moessner, B | 1 |
| Konopski, Z | 1 |
| Frigstad, SO | 1 |
| Kjær, M | 1 |
| Christensen, PB | 1 |
| Weis, N | 1 |
| Lei, J | 1 |
| Gao, Z | 1 |
| Diamanti, A | 1 |
| Sartorelli, MR | 1 |
| Alterio, A | 1 |
| Comparcola, D | 1 |
| Corsetti, T | 1 |
| Iacono, A | 1 |
| Pizzichemi, G | 1 |
| Nobili, V | 1 |
| de Ville de Goyet, J | 1 |
| Torre, G | 2 |
| Cholongitas, E | 3 |
| Goulis, J | 1 |
| Akriviadis, E | 2 |
| Papatheodoridis, GV | 4 |
| Numata, A | 1 |
| Akimoto, T | 1 |
| Toshima, M | 1 |
| Iwazu, Y | 1 |
| Otani, N | 1 |
| Miki, T | 1 |
| Sugase, T | 1 |
| Saito, O | 1 |
| Hamano, Y | 1 |
| Takemoto, F | 1 |
| Ueda, Y | 1 |
| Muto, S | 1 |
| Kusano, E | 1 |
| Milazzo, L | 1 |
| Corbellino, M | 1 |
| Foschi, A | 1 |
| Dodero, A | 1 |
| Mazzocchi, A | 1 |
| Montefusco, V | 1 |
| Zehender, G | 1 |
| Antinori, S | 1 |
| Yu, W | 1 |
| Goddard, C | 1 |
| Clearfield, E | 1 |
| Mills, C | 1 |
| Xiao, T | 1 |
| Guo, H | 1 |
| Morrey, JD | 2 |
| Motter, NE | 1 |
| Block, TM | 1 |
| Cuconati, A | 1 |
| Giles, M | 1 |
| Visvanathan, K | 1 |
| Schirmer, P | 1 |
| Winters, M | 1 |
| Holodniy, M | 1 |
| Striki, A | 1 |
| Mela, M | 1 |
| Ketikoglou, I | 1 |
| Tzourmakliotis, D | 1 |
| Manesis, EK | 1 |
| Gervais, A | 1 |
| Branger, M | 1 |
| Peytavin, G | 1 |
| Roquebert, B | 1 |
| Collin, G | 1 |
| Fraqueiro, G | 1 |
| Hamet, G | 1 |
| Martinot-Peignoux, M | 1 |
| Matheron, S | 1 |
| Zachou, K | 2 |
| Dalekos, GN | 2 |
| García-Alonso, FJ | 1 |
| Martín-Mateos, RM | 1 |
| Maylin, S | 1 |
| Delaugerre, C | 1 |
| Lavocat, F | 1 |
| Simon, F | 1 |
| Singal, AK | 1 |
| Fontana, RJ | 3 |
| Fu, XZ | 1 |
| Pei, JY | 1 |
| Zhou, W | 1 |
| Lan, YY | 1 |
| Wang, AM | 1 |
| Stravitz, RT | 1 |
| Shiffman, ML | 2 |
| Kimmel, M | 1 |
| Puri, P | 1 |
| Luketic, VA | 2 |
| Sterling, RK | 2 |
| Sanyal, AJ | 2 |
| Cotterell, AH | 1 |
| Posner, MP | 2 |
| Fisher, RA | 2 |
| Chen, CH | 1 |
| Lu, SN | 1 |
| Hu, TH | 1 |
| Hung, CH | 1 |
| Chang, MH | 1 |
| Changchien, CS | 1 |
| Lee, CM | 1 |
| Kumar, N | 1 |
| Bower, M | 1 |
| Ujhelyi, E | 1 |
| Lu, C | 1 |
| Jia, Y | 1 |
| Ding, Y | 1 |
| Wen, A | 1 |
| Abdelmessih, R | 1 |
| Verna, EC | 2 |
| Son, CY | 1 |
| Ryu, HJ | 1 |
| Lee, JM | 1 |
| Lee, MH | 1 |
| Qu, W | 1 |
| Sun, LY | 1 |
| Zhu, ZJ | 1 |
| Deng, YL | 1 |
| Sun, XY | 1 |
| Zhang, JJ | 1 |
| Jiang, WT | 1 |
| Shen, ZY | 1 |
| Mi, LJ | 1 |
| Bunchorntavakul, C | 1 |
| Karsdon, J | 1 |
| Huang, WM | 1 |
| Singhvi, G | 1 |
| Ghany, MG | 1 |
| Reddy, KR | 1 |
| Mederacke, I | 1 |
| Yurdaydin, C | 2 |
| Großhennig, A | 1 |
| Cakaloglu, Y | 1 |
| Yalcin, K | 1 |
| Gurel, S | 1 |
| Zeuzem, S | 3 |
| Chatzikyrkou, C | 1 |
| Bozkaya, H | 1 |
| Manns, MP | 5 |
| Vasiliadis, T | 1 |
| Antoniadis, N | 1 |
| Goulis, I | 1 |
| Papanikolaou, V | 1 |
| Pereira, MR | 1 |
| Tilson, HH | 1 |
| Aguilar, C | 1 |
| Leu, CS | 1 |
| Fagan, EA | 1 |
| Zoutendijk, R | 1 |
| de Vries-Sluijs, TE | 2 |
| Reijnders, JG | 2 |
| Mulder, JW | 1 |
| Kroon, FP | 2 |
| Richter, C | 1 |
| van der Eijk, AA | 3 |
| Sonneveld, MJ | 1 |
| Hansen, BE | 2 |
| van der Ende, ME | 2 |
| Janssen, HL | 2 |
| Psevdos, G | 1 |
| Sharp, V | 1 |
| Hall, AM | 1 |
| Bock, FJ | 1 |
| Dai, CL | 1 |
| Zhu, M | 1 |
| Wang, BP | 1 |
| Guo, F | 1 |
| Song, WZ | 1 |
| Zhu, TH | 1 |
| Wang, BL | 1 |
| Qiu, MC | 1 |
| Boxall, E | 1 |
| Sira, J | 1 |
| Kaskar, S | 1 |
| Workman, J | 1 |
| Kelly, D | 1 |
| Babiker, ZOE | 1 |
| Hogan, C | 1 |
| Ustianowski, A | 1 |
| Wilkins, E | 1 |
| Schinazi, RF | 2 |
| Bassit, L | 1 |
| Clayton, MM | 2 |
| Sun, B | 2 |
| Kohler, JJ | 1 |
| Obikhod, A | 1 |
| Arzumanyan, A | 1 |
| Feitelson, MA | 2 |
| Baxa, DM | 1 |
| Thekdi, AD | 1 |
| Golembieski, A | 1 |
| Krishnan, PV | 1 |
| Sharif, O | 1 |
| Kizy, A | 1 |
| Shetron-Rama, L | 1 |
| Jovanovich, J | 1 |
| Chappell, BJ | 1 |
| Snow-Lampart, A | 1 |
| Gordon, SC | 1 |
| Kosi, L | 1 |
| Payer, BA | 1 |
| Grabmeier-Pfistershammer, K | 1 |
| Strassl, R | 1 |
| Rieger, A | 1 |
| Kinai, E | 1 |
| Hosokawa, S | 1 |
| Gomibuchi, H | 1 |
| Kikuchi, Y | 1 |
| Morando, F | 1 |
| Rosi, S | 1 |
| Fasolato, S | 1 |
| Cavallin, M | 1 |
| Gola, E | 1 |
| Gatta, A | 1 |
| Angeli, P | 1 |
| Du, Y | 1 |
| Shen, QC | 1 |
| Huang, AL | 1 |
| Zheng, MY | 1 |
| Jiang, HL | 1 |
| Qin, B | 1 |
| Budeus, B | 1 |
| Cao, L | 1 |
| Wu, C | 1 |
| Rayner, S | 1 |
| Hoffmann, D | 1 |
| Yim, HJ | 1 |
| Seo, YS | 1 |
| Yoon, EL | 1 |
| Kim, CW | 1 |
| Lee, CD | 1 |
| Park, SH | 1 |
| Lee, MS | 1 |
| Park, CK | 1 |
| Chae, HB | 1 |
| Kim, MY | 1 |
| Baik, SK | 1 |
| Lee, JW | 1 |
| Feeney, SA | 1 |
| McCaughey, C | 1 |
| Watt, AP | 1 |
| Agnaf, MR | 1 |
| McDougall, N | 1 |
| Wend, UC | 1 |
| Gerlich, WH | 1 |
| Coyle, PV | 1 |
| Patrick, I | 1 |
| Krznaric, I | 1 |
| Ivanka, K | 1 |
| Obermeier, M | 1 |
| Martin, O | 1 |
| Tufano, M | 1 |
| Liccardo, D | 1 |
| Riva, S | 1 |
| Candusso, M | 1 |
| Iorio, R | 1 |
| Wünsche, T | 1 |
| Schürmann, D | 1 |
| Dieterich, DT | 1 |
| Fung, HB | 1 |
| Stone, EA | 1 |
| Piacenti, FJ | 1 |
| Tubiana, R | 1 |
| Bock, CT | 2 |
| Bleck, JS | 1 |
| Rosenau, J | 2 |
| Böker, KH | 1 |
| Barg-Hock, H | 1 |
| Becker, T | 1 |
| Klempnauer, J | 2 |
| Flemming, P | 1 |
| Schernick, A | 1 |
| Hopf, U | 1 |
| Sevastianos, V | 1 |
| Burroughs, AK | 1 |
| Castelnau, C | 1 |
| Boyer, N | 2 |
| Klein, C | 1 |
| Wüstefeld, T | 1 |
| Dienes, HP | 1 |
| Kubicka, S | 1 |
| Vere Hodge, A | 1 |
| Maier, KP | 1 |
| Sablon, E | 2 |
| Shapiro, F | 1 |
| Liu, CL | 2 |
| Fan, ST | 2 |
| Lo, CM | 2 |
| Wei, WI | 1 |
| Yong, BH | 1 |
| Wong, J | 1 |
| Buster, EH | 1 |
| Schalm, SW | 1 |
| Hochman, JA | 1 |
| Balistreri, WF | 1 |
| Ratziu, V | 1 |
| Yuen, MF | 1 |
| Perrillo, RP | 2 |
| Werle, B | 1 |
| Cinquin, K | 1 |
| Maynard, M | 1 |
| Trépo, C | 3 |
| Mao, YM | 1 |
| Zeng, MD | 1 |
| Toniutto, P | 1 |
| Fumo, E | 1 |
| Caldato, M | 1 |
| Apollonio, L | 1 |
| Perin, A | 1 |
| Pirisi, M | 1 |
| Cheung, ST | 1 |
| Ng, IO | 1 |
| Inoue, H | 1 |
| Tanabe, R | 1 |
| Tanaka, E | 1 |
| Cooksley, WG | 1 |
| Cahour, A | 1 |
| Bozdayi, AM | 1 |
| Eyigun, CP | 1 |
| Turkyilmaz, AR | 1 |
| Avci, IY | 1 |
| Pahsa, A | 1 |
| Jacob, JR | 1 |
| Korba, BE | 2 |
| Cote, PJ | 1 |
| Toshkov, I | 1 |
| Delaney, WE | 3 |
| Gerin, JL | 1 |
| Tennant, BC | 1 |
| Seki, S | 1 |
| Yamane, T | 1 |
| Hino, M | 1 |
| Kolyvanos Naumann, U | 1 |
| Käser, L | 1 |
| Vetter, W | 1 |
| Palmer, P | 1 |
| Scieux, C | 1 |
| Neff, GW | 3 |
| O'brien, CB | 2 |
| Nery, J | 2 |
| Shire, N | 1 |
| Montalbano, M | 2 |
| Ruiz, P | 2 |
| Nery, C | 2 |
| Safdar, K | 2 |
| De Medina, M | 1 |
| Tzakis, AG | 2 |
| Schiff, ER | 3 |
| Madariaga, J | 1 |
| Lau, DT | 2 |
| Duncan, R | 1 |
| Shire, NJ | 1 |
| Muslu, H | 1 |
| Madariaga, JR | 1 |
| Fernández-Botello, A | 1 |
| Holý, A | 1 |
| Moreno, V | 1 |
| Sigel, H | 1 |
| Wai, CT | 3 |
| Prabhakaran, K | 1 |
| Wee, A | 1 |
| Lee, YM | 1 |
| Dan, YY | 2 |
| Sutedja, DS | 1 |
| Mak, K | 1 |
| Isaac, J | 1 |
| Lee, KH | 1 |
| Lee, HL | 1 |
| Da Costa, M | 1 |
| Lim, SG | 2 |
| Hosaka, T | 1 |
| Suzuki, F | 3 |
| Suzuki, Y | 1 |
| Saitoh, S | 1 |
| Kobayashi, M | 1 |
| Someya, T | 1 |
| Sezaki, H | 1 |
| Akuta, N | 1 |
| Tsubota, A | 1 |
| Arase, Y | 1 |
| Ikeda, K | 1 |
| Kumada, H | 3 |
| Schewe, CK | 1 |
| Vogel, M | 1 |
| Däumer, M | 1 |
| Weitner, L | 1 |
| Matz, B | 1 |
| Rockstroh, JK | 1 |
| Akay, S | 1 |
| Karasu, Z | 2 |
| Akyildiz, M | 2 |
| Tokat, Y | 1 |
| Pérez-Roldán, F | 1 |
| González-Carro, P | 1 |
| Villafáñez-García, MC | 1 |
| Garcia, A | 1 |
| Mazuecos, A | 1 |
| González, P | 1 |
| Diaz, F | 1 |
| Garcia, T | 1 |
| Ceballos, M | 1 |
| Rivero, M | 1 |
| Herreros de Tejada Echanojáuregui, A | 1 |
| Moreno Planas, JM | 1 |
| Rubio González, E | 1 |
| Portero Azorin, F | 1 |
| López Monclús, J | 1 |
| Revilla Negro, J | 1 |
| Lucena de la Poza, JL | 1 |
| Sánchez Turrión, V | 1 |
| Barrios Peinado, C | 1 |
| Cuervas-Mons Martínez, V | 1 |
| Taltavull, TC | 1 |
| Chahri, N | 1 |
| Verdura, B | 1 |
| Gornals, J | 1 |
| Lopez, C | 1 |
| Casanova, A | 1 |
| Cañas, C | 1 |
| Figueras, J | 1 |
| Casais, LA | 1 |
| Gelinck, LB | 1 |
| Claas, EC | 1 |
| Moon, W | 1 |
| Choi, MS | 1 |
| Moon, YM | 1 |
| Koh, KC | 1 |
| Yoo, BC | 1 |
| Rhee, JC | 1 |
| Shim, SG | 1 |
| Esteban, R | 1 |
| Li, HQ | 1 |
| Li, JH | 1 |
| Dong, JQ | 1 |
| Gao, JR | 1 |
| Gou, CY | 1 |
| Fung, SK | 1 |
| Han, SH | 1 |
| Rajender Reddy, K | 1 |
| Regev, A | 1 |
| Keeffe, EB | 1 |
| Richtmyer, P | 1 |
| Marrero, JA | 1 |
| Camino, N | 1 |
| Rodés, B | 1 |
| Kuiper, M | 1 |
| Lutz, T | 1 |
| Klausen, G | 1 |
| Kim, KM | 1 |
| Choi, WB | 1 |
| Lee, HC | 1 |
| Chung, YH | 1 |
| Lee, YS | 1 |
| Chowdhury, A | 1 |
| Santra, A | 1 |
| Chakravorty, R | 1 |
| Banerji, A | 1 |
| Pal, S | 1 |
| Dhali, GK | 1 |
| Datta, S | 1 |
| Banerji, S | 1 |
| Manna, B | 1 |
| Chowdhury, SR | 1 |
| Bhattacharya, SK | 1 |
| Mazumder, DG | 1 |
| Cortelezzi, A | 1 |
| Zilioli, VR | 1 |
| Fantini, NN | 1 |
| Pasquini, MC | 1 |
| Deliliers, GL | 1 |
| Colombo, M | 4 |
| Manenti, E | 2 |
| Iavarone, M | 2 |
| Lunghi, G | 1 |
| Bárcena, R | 1 |
| Del Campo, S | 1 |
| Moraleda, G | 1 |
| Casanovas, T | 1 |
| Prieto, M | 1 |
| Moreno, JM | 1 |
| Cuervas, V | 1 |
| Fraga, E | 1 |
| De la Mata, M | 1 |
| Otero, A | 1 |
| Delgado, M | 1 |
| Loinaz, C | 1 |
| Barrios, C | 1 |
| Dieguez, ML | 1 |
| Sousa, JM | 1 |
| Herrero, JI | 1 |
| Muñoz, R | 1 |
| Avilés, JF | 1 |
| Gonzalez, A | 1 |
| Rueda, M | 1 |
| Shah, SR | 1 |
| Osterhaus, AD | 1 |
| Fouillard, L | 1 |
| Fleury, H | 1 |
| Trimoulet, P | 1 |
| Pellegrin, I | 1 |
| Urbinelli, R | 1 |
| Rozenbaum, W | 1 |
| Le Teuff, G | 1 |
| Trylesinski, A | 1 |
| Piketty, C | 1 |
| Erion, MD | 1 |
| Bullough, DA | 1 |
| Lin, CC | 1 |
| Hong, Z | 1 |
| Schreibman, IR | 1 |
| Yeoh, KG | 1 |
| Núñez-Rodríguez, MH | 1 |
| Santamaría-Martínez, A | 1 |
| Mata-Román, L | 1 |
| Caro-Patón, A | 1 |
| Nakamura, H | 1 |
| Pham, PA | 1 |
| Gallant, JE | 1 |
| Wong, SN | 3 |
| Zöllner, B | 2 |
| Hollinger, FB | 1 |
| Dumortier, J | 1 |
| Le Derf, Y | 1 |
| Guillem, P | 1 |
| Chevallier, P | 1 |
| Boillot, O | 1 |
| Levy, V | 1 |
| Grant, RM | 1 |
| Bouhassoune, K | 1 |
| Calboreanu, A | 1 |
| Alloui, C | 1 |
| Rico-Garcia, M | 1 |
| Salmon-Céron, D | 1 |
| Legal, F | 1 |
| Dény, P | 1 |
| Sogni, P | 1 |
| Podevin, P | 1 |
| Helm, M | 1 |
| Gerlich, W | 1 |
| de Silva, HJ | 1 |
| Dassanayake, AS | 1 |
| Manamperi, A | 1 |
| de Silva, AP | 1 |
| Cakir, N | 1 |
| Pamuk, ON | 1 |
| Umit, H | 1 |
| Midilli, K | 1 |
| Parekh, NK | 1 |
| Hester, J | 1 |
| Lee, WM | 2 |
| Kim, HJ | 1 |
| Suh, JH | 1 |
| Kim, DH | 1 |
| Cho, YS | 1 |
| Won, SY | 1 |
| Park, BK | 1 |
| Park, IS | 1 |
| Aubourg, A | 1 |
| d'Alteroche, L | 1 |
| Senecal, D | 1 |
| Gaudy, C | 1 |
| Bacq, Y | 1 |
| Comanor, L | 1 |
| White, C | 1 |
| Kipnis, P | 1 |
| Elkin, C | 1 |
| Leung, K | 1 |
| Ocampo, A | 1 |
| Attar, N | 1 |
| Keiser, P | 1 |
| Chu, CJ | 1 |
| Howell, T | 1 |
| Moore, C | 1 |
| Hadziyannis, S | 1 |
| Neuhaus, P | 1 |
| Terrault, N | 1 |
| Tillmann, H | 1 |
| Villeneuve, JP | 1 |
| Arterburn, S | 2 |
| Brosgart, C | 2 |
| Chuck, S | 1 |
| Kemmer, N | 1 |
| Kaiser, TE | 1 |
| Zacharias, VC | 1 |
| Alonzo, M | 1 |
| Thomas, M | 1 |
| Buell, J | 1 |
| Rouphael, NG | 1 |
| Talati, NJ | 1 |
| Rimland, D | 1 |
| Iino, S | 1 |
| Yotsuyanagi, H | 2 |
| Koike, K | 2 |
| Moriconi, F | 1 |
| Colombatto, P | 1 |
| Coco, B | 1 |
| Ciccorossi, P | 1 |
| Oliveri, F | 1 |
| Flichman, D | 1 |
| Maina, AM | 1 |
| Sacco, R | 1 |
| Bonino, F | 1 |
| Brunetto, MR | 1 |
| Qi, X | 1 |
| Xiong, S | 1 |
| Yang, H | 1 |
| Miller, M | 1 |
| Painter, GR | 1 |
| Almond, MR | 1 |
| Trost, LC | 1 |
| Lampert, BM | 1 |
| Neyts, J | 1 |
| Aldern, KA | 1 |
| Beadle, JR | 1 |
| Hostetler, KY | 1 |
| Del Poggio, P | 1 |
| Zaccanelli, M | 1 |
| Oggionni, M | 1 |
| Colombo, S | 1 |
| Jamoletti, C | 1 |
| Puhalo, V | 1 |
| Nebbia, G | 1 |
| Garcia-Diaz, A | 1 |
| Ayliffe, U | 1 |
| Smith, C | 1 |
| Dervisevic, S | 1 |
| Johnson, M | 1 |
| Tedder, R | 1 |
| Geretti, AM | 1 |
| Cai, CJ | 1 |
| Lu, MQ | 1 |
| Jiang, N | 1 |
| Wang, GS | 1 |
| Yi, SH | 1 |
| Zhang, JF | 1 |
| Yi, HM | 1 |
| Zhang, YC | 1 |
| Chen, GH | 1 |
| Niederau, C | 1 |
| Yatsuji, H | 1 |
| Hiraga, N | 1 |
| Mori, N | 1 |
| Hatakeyama, T | 1 |
| Tsuge, M | 1 |
| Imamura, M | 1 |
| Takahashi, S | 2 |
| Fujimoto, Y | 1 |
| Abe, H | 1 |
| Maekawa, T | 1 |
| Chayama, K | 2 |
| Yilmaz, N | 1 |
| Todd Stravitz, R | 1 |
| Maluf, D | 1 |
| Coterell, A | 1 |
| Zeytunlu, M | 1 |
| Aydin, U | 1 |
| Ozacar, T | 1 |
| Kilic, M | 1 |
| Husain, M | 1 |
| Chen, JJ | 1 |
| Ma, SW | 1 |
| Wang, ZH | 1 |
| Hou, JL | 1 |
| Sung, JJ | 1 |
| Lai, JY | 1 |
| Chow, WC | 1 |
| Heathcote, EJ | 1 |
| Brosgart, CL | 1 |
| Woessner, MA | 1 |
| Scott, SA | 1 |
| Gray, DF | 1 |
| Gardner, SD | 1 |
| Villet, S | 1 |
| Pichoud, C | 1 |
| Billioud, G | 1 |
| Barraud, L | 1 |
| Durantel, S | 1 |
| Pellicelli, AM | 1 |
| Barbaro, G | 1 |
| Francavilla, R | 1 |
| Romano, M | 1 |
| Barbarini, G | 1 |
| Mazzoni, E | 1 |
| Mecenate, F | 1 |
| Paffetti, A | 1 |
| Barlattani, A | 1 |
| Struglia, C | 1 |
| Villani, R | 1 |
| Nauri, L | 1 |
| Nosotti, L | 1 |
| Ferri, F | 1 |
| Camporiondo, MP | 1 |
| Soccorsi, F | 1 |
| Hooman, N | 1 |
| Rifai, K | 1 |
| Hadem, J | 1 |
| Vaske, B | 1 |
| Philipp, G | 1 |
| Priess, A | 1 |
| Volzt, T | 1 |
| Quaas, A | 1 |
| Zankel, M | 1 |
| Fischer, C | 1 |
| Weber, A | 1 |
| Carbonnel, F | 1 |
| Simon, N | 1 |
| Kantelip, B | 1 |
| Coaquette, A | 1 |
| Mantion, G | 1 |
| Miguet, JP | 1 |
| Di Martino, V | 1 |
| Faria, LC | 1 |
| Gigou, M | 1 |
| Roque-Afonso, AM | 1 |
| Sebagh, M | 1 |
| Fallot, G | 1 |
| Ferrari, TC | 1 |
| Guettier, C | 1 |
| Dussaix, E | 1 |
| Castaing, D | 1 |
| Brechot, C | 1 |
| Freshwater, DA | 1 |
| Dudley, T | 1 |
| Cane, P | 1 |
| Mutimer, DJ | 1 |
| Bottecchia, M | 1 |
| Madejón, A | 1 |
| Van Bambeke, F | 1 |
| Girke, J | 1 |
| Laskus, T | 1 |
| Persing, DH | 1 |
| Nowicki, MJ | 1 |
| Mosley, JW | 1 |
| Rakela, J | 1 |
| Kreuzfelder, E | 2 |
| Menne, S | 2 |
| Ferencik, S | 1 |
| Roggendorf, M | 2 |
| Grosse-Wilde, H | 2 |
| Günther, S | 1 |
| Sommer, G | 1 |
| Plikat, U | 1 |
| Iwanska, A | 1 |
| Wain-Hobson, S | 1 |
| Will, H | 1 |
| Meyerhans, A | 1 |
| Maschke, J | 1 |
| Tolle, T | 1 |
| Kajino, K | 1 |
| Kamiya, N | 1 |
| Yuasa, S | 1 |
| Takahara, T | 1 |
| Sakurai, J | 1 |
| Yamamura, Ki | 1 |
| Hino, O | 1 |
| Pontisso, P | 1 |
| Belluco, C | 1 |
| Bertorelle, R | 1 |
| De Moliner, L | 1 |
| Chieco-Bianchi, L | 1 |
| Nitti, D | 1 |
| Lise, M | 1 |
| Alberti, A | 1 |
| Singer, G | 1 |
| Howard, T | 1 |
| Jacobsmeyer, S | 1 |
| Gibbs, CS | 2 |
| Lamy, P | 1 |
| Murray, A | 1 |
| de Vrueh, RL | 1 |
| Rump, ET | 1 |
| van De Bilt, E | 1 |
| van Veghel, R | 1 |
| Balzarini, J | 1 |
| Biessen, EA | 1 |
| van Berkel, TJ | 1 |
| Bijsterbosch, MK | 1 |
| Warner, D | 1 |
| Hatse, S | 1 |
| Suárez García, E | 1 |
| Romero Gómez, M | 1 |
| Grande Santamaría, L | 1 |
| James, JS | 1 |
| Highleyman, L | 1 |
| Shaw, T | 1 |
| Bochet, M | 1 |
| Calvez, V | 1 |
| Fievet, MH | 1 |
| Vig, P | 1 |
| Fry, J | 1 |
| Namini, H | 1 |
| Cullen, JM | 1 |
| Li, DH | 1 |
| Brown, C | 1 |
| Eisenberg, EJ | 1 |
| Cundy, KC | 1 |
| Wolfe, J | 1 |
| Toole, J | 1 |
| Gibbs, C | 2 |
| Delmas, J | 1 |
| Schorr, O | 1 |
| Jamard, C | 1 |
| Hantz, O | 1 |
| Sponseller, CA | 1 |
| Ramrakhiani, S | 1 |
| Castelneau, C | 1 |
| Julander, JG | 1 |
| Sidwell, RW | 1 |
| Trial | Phase | Enrollment | Study Type | Start Date | Status | ||
|---|---|---|---|---|---|---|---|
| Prospective Cohort Study to Assess the Safety and Efficacy of Replacing Tenofovir Disoproxil Fumarate by Tenofovir Alafenamide in HIV/HBV-coinfected Patients With Mild or Moderate Renal Dysfunction[NCT03115736] | Phase 2 | 24 participants (Actual) | Interventional | 2017-05-23 | Completed | ||
| Regression of Liver Fibrosis by Tenofovir Alafenamide (TAF) in Treatment-Naive CHB Related Fibrosis/Cirrhosis: a 96w Open-label Multicenter Study[NCT04939441] | Phase 4 | 100 participants (Anticipated) | Interventional | 2021-04-20 | Active, not recruiting | ||
| Efficacy and Safety of Tenofovir Alafenamide in Chronic Hepatitis B Patients With Suboptimal Response Following Nucleos(t)Ide Therapy[NCT04201808] | Phase 4 | 100 participants (Anticipated) | Interventional | 2021-05-01 | Recruiting | ||
| A Real-world Study of Optimizing Nucleotide-analogues-based Treatment for Chronic Hepatitis B[NCT05937178] | 20,000 participants (Anticipated) | Observational | 2023-01-31 | Recruiting | |||
| A Phase 3, Randomized, Double-Blind Study to Evaluate the Safety and Efficacy of Tenofovir Alafenamide (TAF) 25 mg QD Versus Tenofovir Disoproxil Fumarate (TDF) 300 mg QD for the Treatment of HBeAg-Negative, Chronic Hepatitis B[NCT01940341] | Phase 3 | 426 participants (Actual) | Interventional | 2013-09-12 | Completed | ||
| A Phase 3, Randomized, Double-Blind Study to Evaluate the Safety and Efficacy of Tenofovir Alafenamide (TAF) 25 mg QD Versus Tenofovir Disoproxil Fumarate (TDF) 300 mg QD for the Treatment of HBeAg-Positive, Chronic Hepatitis B[NCT01940471] | Phase 3 | 875 participants (Actual) | Interventional | 2013-09-11 | Completed | ||
| Liver Fibrosis in Zambian HIV-HBV Co-infected Patients: a Long-term Prospective Cohort Study[NCT02344680] | 303 participants (Actual) | Observational | 2015-10-31 | Active, not recruiting | |||
| Prevention of Mother-to-child Transmission of Hepatitis B Virus: a One Arm, Open Label Intervention Study to Estimate the Optimal Timing of Tenofovir (TDF) in Pregnancy[NCT02995005] | Phase 1/Phase 2 | 98 participants (Actual) | Interventional | 2018-05-24 | Completed | ||
| Efficacy and Safety of Elvitegravir/Cobicistat/Emtricitabine/Tenofovir Alafenamide (Genvoya) as Maintenance Treatment of HIV-1/Hepatitis B Virus (HBV)-Coinfected Patients: an Observational Study[NCT03425994] | 275 participants (Actual) | Observational [Patient Registry] | 2018-02-06 | Active, not recruiting | |||
| Virological and Clinical Anti-HBV Efficacy of Tenofovir in Antiretroviral naïve Patients With HIV/HBV Co-infection[NCT00192595] | Phase 4 | 36 participants (Actual) | Interventional | 2004-01-31 | Completed | ||
| [NCT01139203] | 300 participants (Anticipated) | Interventional | 2009-08-31 | Recruiting | |||
| [NCT02019966] | 1,020 participants (Actual) | Observational | 2014-05-12 | Completed | |||
| A Phase 2, Randomized, Double-Blind Study Exploring the Efficacy, Safety and Tolerability of Tenofovir Disoproxil Fumarate (DF) Monotherapy Versus Emtricitabine Plus Tenofovir DF Fixed-Dose Combination Therapy in Subjects Currently Being Treated With Adef[NCT00307489] | Phase 2 | 106 participants (Actual) | Interventional | 2006-03-31 | Completed | ||
| Comparative Study of the Effect of Entecavir Versus Tenofovir on the Presence of HBV DNA in the Peripheral Blood Mononuclear Cells in Chronic Hepatitis B Patients[NCT05168293] | 100 participants (Anticipated) | Observational | 2022-02-01 | Not yet recruiting | |||
| Efficacy of HBV Therapeutic Vaccine in Consolidation of Nucleos(t)Ide Analogues Therapy: a Pilot Study[NCT02505009] | Phase 4 | 116 participants (Actual) | Interventional | 2015-05-01 | Completed | ||
| Entecavir Intensification for Persistent Hepatitis B Virus (HBV) Viremia in HIV-HBV Infection[NCT00662545] | Phase 4 | 10 participants (Actual) | Interventional | 2008-04-30 | Completed | ||
| A Prospective, Randomized, Multicenter, Open-label Study Evaluating HBeAg Seroconversion in HBeAg Positive CHB Patients on Treatment With NA Switched to Combined Therapy With Peginterferon Alfa-2a and NA for 48 Weeks[NCT02474316] | Phase 4 | 366 participants (Anticipated) | Interventional | 2014-08-31 | Recruiting | ||
| Safety and Efficacy of Tenofovir Alafenamide for Chronic Hepatitis B Patients With Decompensated Liver Disease[NCT04683341] | Phase 4 | 100 participants (Anticipated) | Interventional | 2020-09-01 | Recruiting | ||
| Efficacy of Adefovir and Lamivudine Combination Therapy in Patients With Entecavir Resistance[NCT01546116] | Phase 4 | 20 participants (Actual) | Interventional | 2010-02-28 | Completed | ||
| A Randomized, Phase II, Controlled Trial Comparing the Efficacy of Adefovir Dipivoxil and Tenofovir Disoproxil Fumarate for the Treatment of Lamivudine-Resistant Hepatitis B Virus in Subjects Who Are Co-Infected With HIV[NCT00033163] | Phase 2 | 90 participants | Interventional | Completed | |||
| A Phase 3b, Open-Label Program of Adefovir Dipivoxil in the Treatment of Patients With Lamivudine-Resistant Chronic Hepatitis B Who Have Limited Treatment Options[NCT00042393] | 0 participants | Expanded Access | Approved for marketing | ||||
| A Phase II Study of Adefovir Dipivoxil, Pegylated Interferon Alfa-2A, and Ribavirin Treatment in HBV and HCV Infected Subjects With HIV Disease[NCT00051077] | Phase 2 | 0 participants (Actual) | Interventional | Withdrawn | |||
| [information is prepared from clinicaltrials.gov, extracted Sep-2024] | |||||||
(NCT01940341)
Timeframe: Baseline, Week 48
| Intervention | mg/dL (Mean) |
|---|---|
| TAF 25 mg | 0.01 |
| TDF 300 mg | 0.02 |
(NCT01940341)
Timeframe: Baseline, Week 48
| Intervention | percentage change (Mean) |
|---|---|
| TAF 25 mg | -0.288 |
| TDF 300 mg | -2.156 |
(NCT01940341)
Timeframe: Baseline, Week 48
| Intervention | percentage change (Mean) |
|---|---|
| TAF 25 mg | -0.876 |
| TDF 300 mg | -2.514 |
The primary efficacy endpoint was determined by the achievement of HBV DNA < 29 IU/mL at Week 48. (NCT01940341)
Timeframe: Week 48
| Intervention | Percentage of participants (Number) |
|---|---|
| TAF 25 mg | 94.0 |
| TDF 300 mg | 92.9 |
Grades 1 (mild), 2 (moderate), and 3 (severe) were the highest treatment-emergent postbaseline grades for urine protein using the dipstick method. (NCT01940341)
Timeframe: Up to 48 weeks
| Intervention | percentage of participants (Number) | ||
|---|---|---|---|
| Grade 1 | Grade 2 | Grade 3 | |
| TAF 25 mg | 18.1 | 1.1 | 0 |
| TDF 300 mg | 16.4 | 2.1 | 0 |
(NCT01940471)
Timeframe: Baseline, Week 48
| Intervention | mg/dL (Mean) |
|---|---|
| TAF 25 mg | 0.009 |
| TDF 300 mg | 0.026 |
(NCT01940471)
Timeframe: Baseline, Week 48
| Intervention | percentage change (Mean) |
|---|---|
| TAF 25 mg | -0.100 |
| TDF 300 mg | -1.715 |
(NCT01940471)
Timeframe: Baseline, Week 48
| Intervention | percentage change (Mean) |
|---|---|
| TAF 25 mg | -0.417 |
| TDF 300 mg | -2.294 |
(NCT01940471)
Timeframe: Week 48
| Intervention | percentage of participants (Number) |
|---|---|
| TAF 25 mg | 10.3 |
| TDF 300 mg | 8.1 |
(NCT01940471)
Timeframe: Week 48
| Intervention | percentage of participants (Number) |
|---|---|
| TAF 25 mg | 63.9 |
| TDF 300 mg | 66.8 |
Grades 1 (mild), 2 (moderate), and 3 (severe) were the highest treatment-emergent postbaseline grades for urine protein using the dipstick method. (NCT01940471)
Timeframe: Up to 48 weeks
| Intervention | percentage of participants (Number) | ||
|---|---|---|---|
| Grade 1 | Grade 2 | Grade 3 | |
| TAF 25 mg | 23.9 | 3.5 | 0 |
| TDF 300 mg | 17.8 | 4.5 | 0.3 |
(NCT00307489)
Timeframe: 168 weeks
| Intervention | U/mL (Mean) |
|---|---|
| Tenofovir DF | -26.8 |
| Emtricitibine/Tenofovir DF | -54.5 |
(NCT00307489)
Timeframe: 48 Weeks
| Intervention | U/mL (Mean) |
|---|---|
| Tenofovir DF | -21.6 |
| Emtricitibine/Tenofovir DF | -41.4 |
(NCT00307489)
Timeframe: 168 weeks
| Intervention | log10 copies/mL (Mean) |
|---|---|
| Tenofovir DF | -3.79 |
| Emtricitibine/Tenofovir DF | -3.48 |
(NCT00307489)
Timeframe: 48 Weeks
| Intervention | log10 copies/mL (Mean) |
|---|---|
| Tenofovir DF | -3.58 |
| Emtricitibine/Tenofovir DF | -3.34 |
Defined as having negative serum HBeAg and positive serum antibody to HBeAg [anti-HBe] for subjects with positive serum HBeAg at baseline. (NCT00307489)
Timeframe: 48 Weeks
| Intervention | participants (Number) |
|---|---|
| Tenofovir DF | 2 |
| Emtricitibine/Tenofovir DF | 3 |
Defined as having negative serum HBsAg for subjects with positive HBsAg at baseline. (NCT00307489)
Timeframe: 168 weeks
| Intervention | Participants (Number) |
|---|---|
| Tenofovir DF | 1 |
| Emtricitibine/Tenofovir DF | 0 |
Defined as having negative serum HBsAg for subjects with positive HBsAg at baseline. (NCT00307489)
Timeframe: 48 Weeks
| Intervention | participants (Number) |
|---|---|
| Tenofovir DF | 1 |
| Emtricitibine/Tenofovir DF | 0 |
Defined as having negative serum HBeAg for subjecst with positive HBeAg at baseline. (NCT00307489)
Timeframe: 168 weeks
| Intervention | Percent of Participants (Number) |
|---|---|
| Tenofovir DF | 21.6 |
| Emtricitibine/Tenofovir DF | 24.3 |
Defined as having negative serum HBeAg for subjects with positive HBeAg at baseline. (NCT00307489)
Timeframe: 48 Weeks
| Intervention | participants (Number) |
|---|---|
| Tenofovir DF | 3 |
| Emtricitibine/Tenofovir DF | 3 |
Defined as having negative serum BHsAg and positive serum antibody to HBsAg (anti-HBs) for subject with positive serum BHsAg at baseline. (NCT00307489)
Timeframe: 168 weeks
| Intervention | Participants (Number) |
|---|---|
| Tenofovir DF | 1 |
| Emtricitibine/Tenofovir DF | 0 |
Defined as having negative serum HBsAg and positive serum antibody to HBsAg [anti-HBs] for subject with positive serum HBsAg at baseline. (NCT00307489)
Timeframe: 48 Weeks
| Intervention | participants (Number) |
|---|---|
| Tenofovir DF | 1 |
| Emtricitibine/Tenofovir DF | 0 |
ULN for males = 43 U/L; ULN for females = 34 U/L (NCT00307489)
Timeframe: 168 weeks
| Intervention | Percent of Participants (Number) |
|---|---|
| Tenofovir DF | 74.0 |
| Emtricitibine/Tenofovir DF | 74.0 |
ULN for males = 43 U/L; 34 U/L for females (NCT00307489)
Timeframe: 48 Weeks
| Intervention | percentage of participants (Number) |
|---|---|
| Tenofovir DF | 66.7 |
| Emtricitibine/Tenofovir DF | 73.1 |
Subjects with elevated ALT at baseline that return to normal by Week 48. (NCT00307489)
Timeframe: 168 weeks
| Intervention | Percent of Participants (Number) |
|---|---|
| Tenofovir DF | 68.0 |
| Emtricitibine/Tenofovir DF | 70.8 |
Subjects with elevated ALT at baseline that return to normal by Week 48. (NCT00307489)
Timeframe: 48 Weeks
| Intervention | percentage of participants (Number) |
|---|---|
| Tenofovir DF | 40.7 |
| Emtricitibine/Tenofovir DF | 61.5 |
P-values were from a Cochran-Mantel-Haenszel test, controlling for baseline HBeAg status and prior lamivudine use. (NCT00307489)
Timeframe: 168 weeks
| Intervention | Percent of Participants (Number) |
|---|---|
| Tenofovir DF | 80.4 |
| Emtricitibine/Tenofovir DF | 78.0 |
(NCT00307489)
Timeframe: 48 weeks
| Intervention | percentage of participants (Number) |
|---|---|
| Tenofovir DF | 75.5 |
| Emtricitibine/Tenofovir DF | 69.2 |
(NCT00307489)
Timeframe: 168 weeks
| Intervention | Percent of Participants (Number) |
|---|---|
| Tenofovir DF | 82.4 |
| Emtricitibine/Tenofovir DF | 84.0 |
(NCT00307489)
Timeframe: 48 Weeks
| Intervention | percentage of participants (Number) |
|---|---|
| Tenofovir DF | 81.1 |
| Emtricitibine/Tenofovir DF | 80.8 |
"HBV DNA carries the genetic blueprint of the virus. How many HBV DNA particles or copies are found in the blood indicates how rapidly the virus is reproducing in the liver." (NCT00662545)
Timeframe: week 24
| Intervention | log 10 IU/ml (Median) |
|---|---|
| Entecavir Intensification | 2.4 |
| Standard of Care | 0.8 |
(NCT00662545)
Timeframe: entry, week 12, and week 24
| Intervention | participants (Number) |
|---|---|
| Entecavir Intensification | 5 |
| Standard of Care | 5 |
ALT flare: sudden increase in blood level of alanine transaminase (ALT) (NCT00662545)
Timeframe: every 4 weeks for 24 weeks
| Intervention | participants (Number) |
|---|---|
| Entecavir Intensification | 0 |
| Standard of Care | 0 |
(NCT00662545)
Timeframe: every 4 weeks for 24 weeks
| Intervention | participants (Number) |
|---|---|
| Entecavir Intensification | 0 |
| Standard of Care | 0 |
(NCT00662545)
Timeframe: 24 weeks
| Intervention | participants (Number) |
|---|---|
| Entecavir Intensification | 0 |
| Standard of Care | 0 |
78 reviews available for adenine and Hepatitis B
| Article | Year |
|---|---|
Adefovir for lamivudine-resistant hepatitis B.
Topics: Adenine; Drug Resistance, Viral; Hepatitis B; Humans; Lamivudine; Organophosphonates | 2022 |
The Use of Tenofovir Disoproxil Fumarate and Tenofovir Alafenamide for Preventing Vertical Transmission of Hepatitis B.
Topics: Adenine; Antiviral Agents; Female; Hepatitis B; Hepatitis B, Chronic; Humans; Infant; Infectious Dis | 2023 |
Risk of dyslipidemia in chronic hepatitis B patients taking tenofovir alafenamide: a systematic review and meta-analysis.
Topics: Adenine; Alanine; Cholesterol; Cholesterol, LDL; Dyslipidemias; Hepatitis B; Hepatitis B, Chronic; H | 2023 |
Renal and bone side effects of long-term use of entecavir, tenofovir disoproxil fumarate, and tenofovir alafenamide fumarate in patients with Hepatitis B: a network meta-analysis.
Topics: Adenine; Alanine; Antiviral Agents; Bone and Bones; Creatinine; Fumarates; Hepatitis B; Hepatitis B, | 2023 |
[Research progress on the effect of tenofovir disoproxil fumarate on blood lipid profile].
Topics: Adenine; Antiviral Agents; DNA, Viral; Hepatitis B; Hepatitis B virus; Hepatitis B, Chronic; Humans; | 2023 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Combination of Entecavir or Tenofovir with Pegylated Interferon-α for Long-Term Reduction in Hepatitis B Surface Antigen Levels: Simultaneous, Sequential, or Add-on Combination Therapy.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Genotype; Guanine; Hepatitis B; He | 2021 |
Role of tenofovir alafenamide (TAF) in the treatment and prophylaxis of HIV and HBV infections.
Topics: Adenine; Alanine; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combination; Hepatitis B; | 2018 |
Potential kidney toxicity from the antiviral drug tenofovir: new indications, new formulations, and a new prodrug.
Topics: Adenine; Alanine; Antiviral Agents; Bone Density; Drug Interactions; Glomerular Filtration Rate; Hep | 2018 |
Comparative effectiveness of anti-viral drugs with dual activity for treating hepatitis B and HIV co-infected patients: a network meta-analysis.
Topics: Adenine; Adult; Aged; Antiviral Agents; Coinfection; Emtricitabine; Female; Hepatitis B; Hepatitis B | 2018 |
Suppression of HBV by tenofovir in HBV/HIV coinfected patients: a systematic review and meta-analysis.
Topics: Adenine; Anti-HIV Agents; Coinfection; Hepatitis B; Hepatitis B virus; HIV Infections; Humans; Organ | 2013 |
Regression of fibrosis after HBV antiviral therapy. Is cirrhosis reversible?
Topics: Adenine; Administration, Oral; Antiviral Agents; Carcinoma, Hepatocellular; Fibrosis; Guanine; Hepat | 2014 |
Advances in the treatment of hepatitis B virus/hepatitis C virus coinfection.
Topics: Adenine; Antiviral Agents; Coinfection; DNA, Viral; Drug Therapy, Combination; Guanine; Hepacivirus; | 2014 |
Management of patients with overt or resolved hepatitis B virus infection undergoing rituximab therapy.
Topics: Adenine; Anti-Neutrophil Cytoplasmic Antibody-Associated Vasculitis; Antibodies, Monoclonal, Murine- | 2014 |
Liquid oral suspension adefovir dipivoxil (GS-02-526): an update on treatments for hepatitis B infection.
Topics: Adenine; Administration, Oral; Antiviral Agents; Clinical Trials as Topic; DNA, Viral; Dose-Response | 2014 |
Prevention of hepatitis B virus reinfection in liver transplant recipients.
Topics: Adenine; Antiviral Agents; Guanine; Hepatitis B; Hepatitis B virus; Humans; Immunoglobulins; Liver; | 2014 |
Breastfeeding while taking lamivudine or tenofovir disoproxil fumarate: a review of the evidence.
Topics: Adenine; Anti-HIV Agents; Breast Feeding; Disease Transmission, Infectious; Female; Hepatitis B; Hum | 2015 |
Systematic review with network meta-analysis: Comparative efficacy of oral nucleos(t)ide analogues for the prevention of chemotherapy-induced hepatitis B virus reactivation.
Topics: Adenine; Antineoplastic Agents; Antiviral Agents; Controlled Clinical Trials as Topic; Guanine; Hepa | 2016 |
Tenofovir alafenamide (Vemlidy) for hepatitis B.
Topics: Adenine; Alanine; Animals; Antiviral Agents; Clinical Trials as Topic; Hepatitis B; Humans; Tenofovi | 2017 |
Hepatitis B and liver transplantation: 2008 update.
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Guanine; Hepatitis B; Hepatitis B Vaccines; Hu | 2009 |
[Interferon in hepatitis B].
Topics: Adenine; Antiviral Agents; Clinical Trials as Topic; Drug Therapy, Combination; Genotype; Guanine; H | 2008 |
[Hepatitis B in patients with HIV infection].
Topics: Adenine; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Antiviral Agents; Comorbidity; Deox | 2008 |
Hepatitis B therapy in children.
Topics: Adenine; Adolescent; Antiviral Agents; Child; Child, Preschool; Drug Therapy, Combination; Hepatitis | 2009 |
Post-liver transplant hepatitis B prophylaxis: the role of oral nucleos(t)ide analogues.
Topics: Adenine; Administration, Oral; Antiviral Agents; Drug Administration Schedule; Drug Therapy, Combina | 2009 |
The option of liver transplantation for hepatitis B: where are we?
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Hepatitis B; Humans; Immunoglobulins; Lamivudi | 2009 |
Liver transplantation for hepatitis B virus. Pre-emptive and peri-operative prophylaxis.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Administration Schedule; Drug Therapy, Combination; Hepa | 2009 |
Prevention of recurrent hepatitis B virus infection after liver transplantation: hepatitis B immunoglobulin, antiviral drugs, or both? Systematic review and meta-analysis.
Topics: Adenine; Adult; Antiviral Agents; Cohort Studies; Controlled Clinical Trials as Topic; Drug Therapy, | 2010 |
Current therapeutic strategies for recurrent hepatitis B virus infection after liver transplantation.
Topics: Adenine; Antiviral Agents; Asia; Guanine; Hepatitis B; Hepatitis B virus; Humans; Interferons; Lamiv | 2010 |
Lamivudine or adefovir dipivoxil alone or combined with immunoglobulin for preventing hepatitis B recurrence after liver transplantation.
Topics: Adenine; Antiviral Agents; Hepatitis B; Humans; Immunoglobulins; Lamivudine; Liver Transplantation; | 2010 |
Inflammatory bowel disease and hepatitis B and C in Western Balkans: a referral centre study and review of the literature.
Topics: Adenine; Adolescent; Adult; Aged; Antiviral Agents; Colitis, Ulcerative; Crohn Disease; Drug Therapy | 2010 |
The impact of human immunodeficiency virus on viral hepatitis.
Topics: Adenine; Antiviral Agents; Deoxycytidine; Disease Progression; Drug Therapy, Combination; Emtricitab | 2011 |
The clinical potential of the acyclic (and cyclic) nucleoside phosphonates: the magic of the phosphonate bond.
Topics: Adenine; Antineoplastic Agents; Antiviral Agents; Cidofovir; Cytosine; Guanosine; Hepatitis B; HIV I | 2011 |
Hepatitis B immunoglobulin and/or nucleos(t)ide analogues for prophylaxis against hepatitis b virus recurrence after liver transplantation: a systematic review.
Topics: Adenine; Antiviral Agents; Chi-Square Distribution; Drug Therapy, Combination; Evidence-Based Medici | 2011 |
Antiviral therapy for hepatitis B infection during pregnancy and breastfeeding.
Topics: Adenine; Antiviral Agents; Breast Feeding; Female; Guanine; Hepatitis B; Hepatitis B virus; Hepatiti | 2011 |
Management of severe acute to fulminant hepatitis B: to treat or not to treat or when to treat?
Topics: Adenine; Antiviral Agents; Guanine; Hepatitis B; Humans; Interferons; Lamivudine; Liver Failure, Acu | 2012 |
[Pharmacological treatment of acute hepatitis B].
Topics: Acute Disease; Adenine; Antiviral Agents; Guanine; Hepatitis B; Humans; Lamivudine; Nucleosides; Org | 2012 |
Meta-analysis: oral anti-viral agents in adults with decompensated hepatitis B virus cirrhosis.
Topics: Adenine; Administration, Oral; Adult; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combin | 2012 |
Update on tenofovir toxicity in the kidney.
Topics: Adenine; Animals; Anti-HIV Agents; Antiviral Agents; Hepatitis B; HIV Infections; Humans; Kidney; Ki | 2013 |
High genetic barrier nucleos(t)ide analogue(s) for prophylaxis from hepatitis B virus recurrence after liver transplantation: a systematic review.
Topics: Adenine; Antiviral Agents; DNA, Viral; Guanine; Hepatitis B; Hepatitis B virus; Humans; Immunoglobul | 2013 |
Prevention of recurrent hepatitis B post-liver transplantation.
Topics: Adenine; Antiviral Agents; Guanine; Hepatitis B; Humans; Immunoglobulins; Lamivudine; Liver Transpla | 2002 |
Tenofovir disoproxil fumarate: a nucleotide reverse transcriptase inhibitor for the treatment of HIV infection.
Topics: Adenine; Animals; Anti-HIV Agents; Clinical Trials as Topic; Dose-Response Relationship, Drug; Drug | 2002 |
Prevention of and treatment for hepatitis B virus infection after liver transplantation in the nucleoside analogues era.
Topics: Adenine; Antiviral Agents; Guanine; Hepatitis B; Hepatitis B virus; Humans; Lamivudine; Liver Transp | 2003 |
Management of patients with decompensated HBV cirrhosis.
Topics: Adenine; Antiviral Agents; Carcinoma, Hepatocellular; Disease Progression; Drug Resistance; Hepatiti | 2003 |
[Treatment of hepatitis B].
Topics: Adenine; Antiviral Agents; Clinical Trials, Phase III as Topic; Drug Therapy, Combination; Hepatitis | 2002 |
[Hepatitis: associated diseases. Risk groups -- prevention -- treatment].
Topics: Adenine; Adult; Antiviral Agents; Child; DNA, Viral; Female; Hepacivirus; Hepatitis B; Hepatitis B S | 2003 |
Early detection of hepatitis B drug resistance: implications for patient management.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Genotype; Hepatitis B; Hepatitis B vi | 2003 |
Doctor to patient transmission of hepatitis B virus: implications of HBV DNA levels and potential new solutions.
Topics: Adenine; Antiviral Agents; DNA, Viral; Guanine; Hepatitis B; Hepatitis B e Antigens; Hepatitis B vir | 2003 |
Chronic viral hepatitis: always be current!
Topics: Adenine; Adolescent; Adult; Antiviral Agents; Child; Female; Hepacivirus; Hepatitis B; Hepatitis B v | 2003 |
Viral hepatitis B.
Topics: Adenine; Antiviral Agents; Comorbidity; Drug Therapy, Combination; Genotype; Hepatitis B; Hepatitis | 2003 |
Management of the patient with hepatitis B virus-related cirrhosis.
Topics: Adenine; Antiviral Agents; Hepatitis B; Humans; Interferons; Lamivudine; Liver Cirrhosis; Nucleoside | 2003 |
[Adefovir dipivoxil-A new drug for hepatitis B].
Topics: Adenine; Antiviral Agents; Clinical Trials as Topic; Hepatitis B; Humans; Organophosphonates | 2004 |
Molecular virology of hepatitis B virus.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Genotype; Guanine; Hepatitis B; Hepat | 2004 |
Hepatitis B virus kinetics and mathematical modeling.
Topics: Adenine; Antiviral Agents; DNA, Viral; Hepatitis B; Hepatitis B virus; Hepatocytes; Lamivudine; Mode | 2004 |
The role of interferon therapy in hepatitis B.
Topics: Adenine; Antiviral Agents; Clinical Trials as Topic; Hepatitis B; Humans; Interferon-alpha; Lamivudi | 2004 |
Current antiviral therapy for chronic hepatitis B.
Topics: Adenine; Antiviral Agents; Hepatitis B; Humans; Interferon-alpha; Lamivudine; Organophosphonates; Re | 2004 |
[Hepatitis B (acute and chronic)].
Topics: Acute Disease; Adenine; Adolescent; Adult; Antiviral Agents; Child; Diagnosis, Differential; Drug Th | 2004 |
Adefovir-lamivudine combination therapy and hepatitis B viral kinetics.
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Hepatitis B; Hepatitis B e Antigens; Hepatitis | 2005 |
Drugs in development for hepatitis B.
Topics: Adenine; Antiviral Agents; Arabinofuranosyluracil; Deoxycytidine; Emtricitabine; Guanine; Hepatitis | 2005 |
Understanding hepatitis B.
Topics: Acute Disease; Adenine; Algorithms; Antiviral Agents; Hepatitis B; Humans; Interferon alpha-2; Inter | 2005 |
HepDirect prodrugs for targeting nucleotide-based antiviral drugs to the liver.
Topics: Adenine; Animals; Antiviral Agents; Cytochrome P-450 CYP3A; Cytochrome P-450 Enzyme System; Drug Del | 2006 |
Hepatitis B virus genotypes and response to antiviral therapy.
Topics: Adenine; Antiviral Agents; Genotype; Hepatitis B; Hepatitis B virus; Humans; Interferon-alpha; Lamiv | 2006 |
Prevention and treatment of recurrent Hepatitis B after liver transplantation: the current role of nucleoside and nucleotide analogues.
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Guanine; Hepatitis B; Humans; Immunoglobulins; | 2006 |
Tenofovir disoproxil fumarate for the treatment of HIV infection.
Topics: Adenine; Animals; Drug Administration Schedule; Drug Interactions; Drug Resistance, Viral; Drug Ther | 2006 |
Tenofovir disoproxil fumarate: role in hepatitis B treatment.
Topics: Adenine; DNA, Viral; Hepatitis B; Hepatitis B virus; Humans; Organophosphonates; Tenofovir; Treatmen | 2006 |
Hepatitis B: the pathway to recovery through treatment.
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Guanine; Hepatitis B; Hepatitis C, Chronic; Human | 2006 |
Antiretroviral therapy for hepatitis B virus-HIV-coinfected patients: promises and pitfalls.
Topics: Adenine; Antiretroviral Therapy, Highly Active; Antiviral Agents; Deoxycytidine; Drug Combinations; | 2006 |
[Therapy of hepatitis B virus infection].
Topics: Adenine; Antiviral Agents; Drug Antagonism; Drug Resistance, Viral; Drug Synergism; Drug Therapy, Co | 2006 |
[Managing lamivudine resistance in liver transplantation for hepatitis B liver disease].
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combination; Hepatitis B; Hepatitis | 2006 |
[Impact of resistance to analogue antivirals and therapeutic strategies in situations of dialysis, kidney transplantation, vasculitis, and preemptive treatments in immunosuppressed patients].
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combination; Hepatitis B; Hepatitis | 2006 |
Hepatitis B reverse seroconversion in HIV-positive patients: case series and review of the literature.
Topics: Adenine; Adult; Aged; Aged, 80 and over; Anti-HIV Agents; CD4 Lymphocyte Count; DNA, Viral; Hepatiti | 2007 |
[Drugs for hepatitis B and C infection].
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Guanine; Hepatitis B; Hepatitis B virus; Hepat | 2007 |
[Mechanisms of drug resistance in hepatitis viruses B and C].
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Gene Products, pol; Guanine; Hepacivirus; Hepatit | 2007 |
Drug resistance in antiviral treatment for infections with hepatitis B and C viruses.
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Guanine; Hepacivirus; Hepatitis B; Hepatitis B vi | 2007 |
[Attention-getting sexually transmitted diseases: Hepatitis B].
Topics: Adenine; Adenosine; Antiviral Agents; Comorbidity; Drug Therapy, Combination; Genotype; Guanine; Gua | 2007 |
[The ABC of viral hepatitis].
Topics: Adenine; Antiviral Agents; Hepatitis A; Hepatitis B; Hepatitis C; Hepatitis, Viral, Human; Humans; I | 2008 |
Resistance of hepatitis B virus to antiviral drugs: current aspects and directions for future investigation.
Topics: 2-Aminopurine; Adenine; Amino Acid Sequence; Animals; Anti-HIV Agents; Antimetabolites; Antiviral Ag | 2001 |
Treatment of hepatitis B and C following liver transplantation.
Topics: Adenine; Antiviral Agents; Clinical Trials as Topic; Disease Progression; Drug Resistance; Drug Ther | 2002 |
[New management strategies for hepatitis B].
Topics: Adenine; Antiviral Agents; Arabinofuranosyluracil; Deoxycytidine; Emtricitabine; Guanine; Hepatitis | 2002 |
43 trials available for adenine and Hepatitis B
| Article | Year |
|---|---|
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Topics: A549 Cells; Acetylmuramyl-Alanyl-Isoglutamine; Acinetobacter baumannii; Acute Lung Injury; Adaptor P | 2016 |
Risk of hepatitis B virus reactivation in patients treated with ibrutinib.
Topics: Adenine; Aged; Aged, 80 and over; Female; Follow-Up Studies; Hematologic Neoplasms; Hepatitis B; Hep | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
96 weeks treatment of tenofovir alafenamide vs. tenofovir disoproxil fumarate for hepatitis B virus infection.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Alanine; Alanine Transaminase; Bone Density; DN | 2018 |
Combination of lamivudine and adefovir without hepatitis B immune globulin is safe and effective prophylaxis against hepatitis B virus recurrence in hepatitis B surface antigen-positive liver transplant candidates.
Topics: Adenine; Adult; Aged; Antiviral Agents; Biomarkers; Disease-Free Survival; DNA, Viral; Drug Therapy, | 2013 |
Efficacy of combined therapy in patients with hepatitis B virus-related decompensated cirrhosis.
Topics: Adenine; Adult; Alanine Transaminase; Antiviral Agents; Biomarkers; Chi-Square Distribution; China; | 2013 |
Impact on L-carnitine Homeostasis of Short-term Treatment with the Pivalate Prodrug Tenofovir Dipivoxil.
Topics: Adenine; Adult; Antiviral Agents; Carnitine; Dose-Response Relationship, Drug; Female; Hepatitis B; | 2013 |
De novo combined lamivudine and adefovir dipivoxil therapy vs entecavir monotherapy for hepatitis B virus-related decompensated cirrhosis.
Topics: Adenine; Adult; Alanine Transaminase; Analysis of Variance; Antiviral Agents; Biomarkers; Chi-Square | 2013 |
Maintaining remission in lamivudine-resistant patients with a virological response to adefovir add-on lamivudine after stopping lamivudine therapy.
Topics: Adenine; Alanine Transaminase; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combination; | 2014 |
Use of tenofovir disoproxil fumarate in highly viremic, hepatitis B mono-infected pregnant women.
Topics: Adenine; Adolescent; Adult; Antiviral Agents; DNA, Viral; Female; Hepatitis B; Humans; Infant, Newbo | 2014 |
Antiviral therapy improves postoperative survival in patients with hepatocellular carcinoma: a randomized controlled trial.
Topics: Adenine; Adolescent; Adult; Aged; Antiviral Agents; Carcinoma, Hepatocellular; DNA, Viral; Hepatitis | 2015 |
Brief Report: Efficacy and Safety of Switching to a Single-Tablet Regimen of Elvitegravir/Cobicistat/Emtricitabine/Tenofovir Alafenamide in HIV-1/Hepatitis B-Coinfected Adults.
Topics: Adenine; Alanine; Anti-HIV Agents; Cobicistat; Coinfection; Drug Combinations; Drug Substitution; Em | 2016 |
[Adefovir dipivoxil treatment of hepatic cirrhosis complicated with hepatitis B virus associated glomerulonephritis].
Topics: Adenine; Adolescent; Adult; Antiviral Agents; Female; Glomerulonephritis; Hepatitis B; Hepatitis B v | 2008 |
Evidence of long-term suppression of hepatitis B virus DNA by tenofovir as rescue treatment in patients coinfected by HIV.
Topics: Adenine; Adult; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; DNA Mutational Analysis; DNA | 2008 |
[Lamivudine and adefovir dipivoxil combination treatment for liver cirrhosis patients with CHB].
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Female; Hepatitis B; | 2008 |
A randomized trial of combination hepatitis B therapy in HIV/HBV coinfected antiretroviral naïve individuals in Thailand.
Topics: Adenine; Adult; Alkynes; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Benzoxazines; Cyclo | 2008 |
Comparison of the antiviral activity of adefovir and tenofovir on hepatitis B virus in HIV-HBV-coinfected patients.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Female; Hepatitis B; Hepati | 2008 |
A randomized study of adefovir dipivoxil in place of HBIG in combination with lamivudine as post-liver transplantation hepatitis B prophylaxis.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Female; Hepatitis B; Humans; Immunization, Passi | 2008 |
Efficacy and safety of adefovir dipivoxil plus pegylated interferon-alpha2a for the treatment of lamivudine-resistant hepatitis B virus infection in HIV-infected patients.
Topics: Adenine; Adult; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combination; Female; Hepatit | 2008 |
Viral dynamics of hepatitis B virus DNA in human immunodeficiency virus-1-hepatitis B virus coinfected individuals: similar effectiveness of lamivudine, tenofovir, or combination therapy.
Topics: Adenine; Adult; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Biopsy; DNA, Viral; Drug The | 2009 |
Pharmacokinetics of tacrolimus co-administered with adefovir dipivoxil to liver transplant recipients.
Topics: Adenine; Adolescent; Adult; Aged; Antiviral Agents; Drug Interactions; Drug Therapy, Combination; Fe | 2009 |
Adefovir plus lamivudine are more effective than adefovir alone in lamivudine-resistant HBeAg- chronic hepatitis B patients: a 4-year study.
Topics: Adenine; Adult; Aged; Alanine Transaminase; Antiviral Agents; Biomarkers; DNA, Viral; Drug Resistanc | 2010 |
Long-term adefovir plus lamivudine therapy does not decrease creatinine clearance in HBeAg-negative chronic hepatitis B patients.
Topics: Adenine; Adult; Age Factors; Aged; Creatine; Drug Resistance, Viral; Drug Therapy, Combination; Fema | 2011 |
Treatment response and evolution of HBV resistance during lamivudine plus adefovir or entecavir therapy in patients with adefovir-resistant mutants.
Topics: Adenine; Adult; Aged; Antiviral Agents; Base Sequence; Cloning, Molecular; DNA, Viral; Drug Administ | 2012 |
Relative bioavailability study of a novel prodrug of tenofovir, tenofovir dipivoxil fumarate, in healthy male fasted volunteers.
Topics: Adenine; Administration, Oral; Adolescent; Adult; Area Under Curve; Biological Availability; Cross-O | 2012 |
Prevention of de novo hepatitis B with adefovir dipivoxil in recipients of liver grafts from hepatitis B core antibody-positive donors.
Topics: Adenine; Adult; Aged; Female; Hepatitis B; Hepatitis B Antibodies; Hepatitis B Core Antigens; Humans | 2012 |
Renal function during treatment with adefovir plus peginterferon alfa-2a vs either drug alone in hepatitis B/D co-infection.
Topics: Adenine; Adolescent; Adult; Aged; Aleutian Mink Disease Virus; Antiviral Agents; Drug Therapy, Combi | 2012 |
Adding adefovir vs. switching to entecavir for lamivudine-resistant chronic hepatitis B (ACE study): a 2-year follow-up randomized controlled trial.
Topics: Adenine; Adult; Analysis of Variance; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Female; | 2013 |
Evolution of hepatitis B viral load and viral genome sequence during adefovir dipivoxil therapy.
Topics: Adenine; Alanine Transaminase; Amino Acid Sequence; Antigens, Viral; Antiviral Agents; Biopsy; DNA-D | 2004 |
Ninety-six-week efficacy of combination therapy with lamivudine and tenofovir in patients coinfected with HIV-1 and wild-type hepatitis B virus.
Topics: Adenine; Adult; Anti-HIV Agents; Drug Therapy, Combination; Female; Hepatitis B; HIV Infections; Hum | 2004 |
Selection of hepatitis B virus polymerase mutations in HIV-coinfected patients treated with tenofovir.
Topics: Adenine; Adult; Antiviral Agents; DNA-Directed DNA Polymerase; DNA, Viral; Drug Resistance, Viral; H | 2005 |
Adefovir dipivoxil alone or in combination with ongoing lamivudine in patients with decompensated liver disease and lamivudine-resistant hepatitis B virus.
Topics: Adenine; Adolescent; Adult; Anti-HIV Agents; Antiviral Agents; Drug Combinations; Drug Resistance, V | 2005 |
Changes in viral loads of lamivudine-resistant mutants and evolution of HBV sequences during adefovir dipivoxil therapy.
Topics: Adenine; Adult; Antiviral Agents; Drug Administration Schedule; Drug Resistance, Viral; Evolution, M | 2006 |
Efficacy of adefovir dipivoxil in the treatment of lamivudine-resistant hepatitis B virus genotype C infection.
Topics: Adenine; Adult; Aged; Antiviral Agents; Drug Administration Schedule; Drug Resistance, Viral; Female | 2007 |
Treatment of hepatitis B with lamivudine and tenofovir in HIV/HBV-coinfected patients: factors associated with response.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Female; Genotype; Hepatitis B; | 2007 |
Low risk of hepatitis B virus recurrence after withdrawal of long-term hepatitis B immunoglobulin in patients receiving maintenance nucleos(t)ide analogue therapy.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Female; Hepatitis B; Hepatitis B Surface Antigen | 2007 |
Adefovir dipivoxil for wait-listed and post-liver transplantation patients with lamivudine-resistant hepatitis B: final long-term results.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Drug Therapy, Combination; Fem | 2007 |
Low-dose tenofovir is more potent than adefovir and is effective in controlling HBV viremia in chronic HBeAg-negative hepatitis B.
Topics: Adenine; Adult; Aged; Antiviral Agents; Dose-Response Relationship, Drug; Drug Resistance, Viral; Fe | 2007 |
Low resistance to adefovir combined with lamivudine: a 3-year study of 145 lamivudine-resistant hepatitis B patients.
Topics: Adenine; Adult; Aged; Antiviral Agents; Disease Progression; DNA, Viral; Drug Resistance, Viral; Dru | 2007 |
Tenofovir monotherapy is effective in hepatitis B patients with antiviral treatment failure to adefovir in the absence of adefovir-resistant mutations.
Topics: Adenine; Adult; Aged; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Resistance, Viral; Drug Ther | 2008 |
Tenofovir monotherapy is effective in hepatitis B patients with antiviral treatment failure to adefovir in the absence of adefovir-resistant mutations.
Topics: Adenine; Adult; Aged; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Resistance, Viral; Drug Ther | 2008 |
Tenofovir monotherapy is effective in hepatitis B patients with antiviral treatment failure to adefovir in the absence of adefovir-resistant mutations.
Topics: Adenine; Adult; Aged; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Resistance, Viral; Drug Ther | 2008 |
Tenofovir monotherapy is effective in hepatitis B patients with antiviral treatment failure to adefovir in the absence of adefovir-resistant mutations.
Topics: Adenine; Adult; Aged; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Resistance, Viral; Drug Ther | 2008 |
Lamivudine compared with lamivudine and adefovir dipivoxil for the treatment of HBeAg-positive chronic hepatitis B.
Topics: Adenine; Adolescent; Adult; Aged; Alanine Transaminase; Antiviral Agents; DNA, Viral; Drug Therapy, | 2008 |
Sequential combination therapy leads to biochemical and histological improvement despite low ongoing intrahepatic hepatitis B virus replication.
Topics: Adenine; Adult; Alanine Transaminase; Antiviral Agents; DNA, Viral; Drug Administration Schedule; Dr | 2008 |
Hepatocellular carcinoma is associated with an increased risk of hepatitis B virus recurrence after liver transplantation.
Topics: Adenine; Adolescent; Adult; Aged; Antiviral Agents; Carcinoma, Hepatocellular; DNA, Circular; DNA, V | 2008 |
Hepatitis B and adefovir depivoxil.
Topics: Adenine; AIDS-Related Opportunistic Infections; Antiviral Agents; Controlled Clinical Trials as Topi | 1997 |
262 other studies available for adenine and Hepatitis B
| Article | Year |
|---|---|
Body weight changes in treated hepatitis B patients switching to tenofovir alafenamide
Topics: Adenine; Alanine; Body Weight; Female; Hepatitis B; Hepatitis B, Chronic; Humans; Male; Middle Aged; | 2022 |
Tenofovir Alafenamide for Pregnant Chinese Women With Active Chronic Hepatitis B: A Multicenter Prospective Study.
Topics: Adenine; Adult; Antiviral Agents; China; Cleft Lip; Cleft Palate; Female; Hepatitis B; Hepatitis B S | 2022 |
A nanofiber based antiviral (TAF) prodrug delivery system.
Topics: Adenine; Antiviral Agents; Hepatitis B; Humans; Nanofibers; Polymers; Prodrugs | 2022 |
Case of psoriasis with hepatitis B virus infection during tumor necrosis factor inhibitor treatment successfully treated with ixekizumab and tenofovir alafenamide fumarate.
Topics: Adenine; Alanine; Antibodies, Monoclonal, Humanized; Antiviral Agents; Fumarates; Hepatitis B; Hepat | 2022 |
DNA N6-Adenine methylation in HBV-related hepatocellular carcinoma.
Topics: Adenine; Carcinoma, Hepatocellular; DNA Methylation; Epigenesis, Genetic; Genome-Wide Association St | 2022 |
Plasma and breast milk pharmacokinetics of tenofovir alafenamide in mothers with chronic hepatitis B infection.
Topics: Adenine; Adult; Alanine; Anti-HIV Agents; Female; Hepatitis B; Hepatitis B, Chronic; HIV Infections; | 2022 |
Successful Treatment of Tenofovir Alafenamide-Induced Lactic Acidosis: A Case Report.
Topics: Acidosis, Lactic; Adenine; Antiviral Agents; Hepatitis B; Humans; Male; Middle Aged; Tenofovir | 2023 |
A carrier-free metal-organic hybrid nanoassembly with combination anti-viral and hepato-protective activity for hepatitis B treatment.
Topics: Adenine; Animals; Antiviral Agents; DNA Replication; DNA, Viral; Hepatitis B; Hepatitis B virus; Inf | 2022 |
Tenofovir Alafenamide use in pregnant women with chronic hepatitis B virus infection: more data needed.
Topics: Adenine; Alanine; Antiviral Agents; Female; Hepatitis B; Hepatitis B virus; Hepatitis B, Chronic; Hu | 2022 |
Plasma and breast milk pharmacokinetics of tenofovir alafenamide of mothers with chronic hepatitis B infection-Authors' reply.
Topics: Adenine; Alanine; Antiviral Agents; Female; Hepatitis B; Hepatitis B, Chronic; Humans; Milk, Human; | 2022 |
Similar risk of kidney function decline between tenofovir alafenamide and besifovir dipivoxil maleate in chronic hepatitis B.
Topics: Adenine; Alanine; Antiviral Agents; Guanine; Hepatitis B; Hepatitis B, Chronic; Humans; Kidney; Long | 2022 |
Prophylactic tenofovir alafenamide for hepatitis B virus reactivation and reactivation-related hepatitis.
Topics: Adenine; Alanine; Antiviral Agents; Hepatitis A; Hepatitis B; Hepatitis B virus; Hepatitis B, Chroni | 2023 |
Converting from Tenofovir Disoproxil Fumarate to Tenofovir Alafenamide in Patients with Hepatitis B Following Liver Transplantation.
Topics: Adenine; Alanine; Antiviral Agents; Hepatitis B; Hepatitis B virus; Hepatitis B, Chronic; Humans; Li | 2023 |
The significance of m6A RNA methylation regulators in predicting the prognosis and clinical course of HBV-related hepatocellular carcinoma.
Topics: Adenine; Aged; Aged, 80 and over; Biomarkers, Tumor; Carcinoma, Hepatocellular; Female; Gene Express | 2020 |
Topics: Adenine; DEAD Box Protein 58; Hep G2 Cells; Hepatitis B; Hepatitis C; Humans; Immune Evasion; Immuni | 2020 |
Acceptance of antiviral treatment and enhanced service model for pregnant patients carrying hepatitis B.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Female; Hepatitis B; Hepatitis B Surface Antigens; Hep | 2020 |
Brief Report: Switching From TDF to TAF in HIV/HBV-Coinfected Individuals With Renal Dysfunction-A Prospective Cohort Study.
Topics: Adenine; Aged; Alanine; Anti-HIV Agents; Female; Glomerular Filtration Rate; Hepatitis B; Hepatitis | 2020 |
Scalable Synthesis, In Vitro cccDNA Reduction, and In Vivo Antihepatitis B Virus Activity of a Phosphonomethoxydeoxythreosyl Adenine Prodrug.
Topics: Adenine; Animals; Antiviral Agents; DNA, Circular; DNA, Viral; Drug Resistance, Viral; Guanine; Hepa | 2020 |
Is HBV prophylaxis required during CLL treatment with ibrutinib?
Topics: Adenine; Antineoplastic Agents; Antiviral Agents; Biomarkers; Hepatitis B; Humans; Leukemia, Lymphoc | 2017 |
Adefovir dipivoxil loaded proliposomal powders with improved hepatoprotective activity: formulation, optimization, pharmacokinetic, and biodistribution studies.
Topics: Adenine; Animals; Antiviral Agents; Biological Availability; Drug Carriers; Hepatitis B; Liposomes; | 2018 |
Nephrolithiasis and Osteomalacia associated with adefovir-induced Fanconi syndrome in a patient with hepatitis B.
Topics: Adenine; Antiviral Agents; Fanconi Syndrome; Hepatitis B; Humans; Male; Middle Aged; Nephrolithiasis | 2017 |
Adefovir-induced Fanconi syndrome associated with osteomalacia.
Topics: Adenine; Adult; Bone and Bones; Fanconi Syndrome; Female; Fibroblast Growth Factor-23; Fibroblast Gr | 2018 |
Comparing Efficacy of Lamivudine, Adefovir Dipivoxil, Telbivudine, and Entecavir in Treating Nucleoside Analogues Naïve for HBeAg-Negative Hepatitis B with Medium Hepatitis B Virus (HBV) DNA Levels.
Topics: Adenine; Adult; Alanine Transaminase; DNA, Viral; Female; Follow-Up Studies; Guanine; Hepatitis B; H | 2017 |
Feasibility and safety of therapy with ibrutinib after antiviral control of hepatitis B virus (HBV) reactivation in chronic lymphocytic leukemia patients.
Topics: Adenine; Aged; Antiviral Agents; Fatal Outcome; Feasibility Studies; Female; Hepatitis B; Hepatitis | 2018 |
Osteomalacia Due to Drug-Induced Fanconi Syndrome.
Topics: Adenine; Aged; Antiviral Agents; Fanconi Syndrome; Hepatitis B; Humans; Male; Organophosphonates; Os | 2018 |
Tenofovir alafenamide associated fatal lactic acidosis in an autologous hematopoietic stem cell transplant recipient.
Topics: Acidosis, Lactic; Adenine; Aged; Alanine; Antiviral Agents; Fatal Outcome; Hematopoietic Stem Cell T | 2018 |
Superior vena cava syndrome with concomitant upper extremity deep vein thrombosis.
Topics: Adenine; Aged; Female; Hepatitis B; Humans; Leukemia, Lymphocytic, Chronic, B-Cell; Piperidines; Pyr | 2019 |
Very late onset post-transplant diffuse large B cell lymphoma in a liver transplant recipient with hepatitis B: A case report.
Topics: Adenine; Antiviral Agents; Biopsy, Fine-Needle; Chemoradiotherapy; Guanine; Hepatitis B; Hepatitis B | 2018 |
Impact of antiretroviral therapy containing tenofovir disoproxil fumarate on the survival of patients with HBV and HIV coinfection.
Topics: Adenine; Adult; Anti-Retroviral Agents; Coinfection; Female; Hepatitis B; HIV Infections; Humans; Ma | 2019 |
HBV reactivation in CLL patients with occult HBV infection treated with ibrutinib without viral prophylaxis.
Topics: Adenine; Antineoplastic Agents; Antineoplastic Combined Chemotherapy Protocols; Antiviral Agents; He | 2019 |
Entecavir and Low Genetic Barrier Antiviral Agents for Hepatocellular Carcinoma in Hepatitis B Viral Cirrhosis: Propensity Score Matching.
Topics: Adenine; Adult; Aged; Antiviral Agents; Carcinoma, Hepatocellular; China; Female; Guanine; Hepatitis | 2019 |
Denosumab improves clinical manifestations of hypophosphatemic osteomalacia by adefovir-induced Fanconi syndrome: a case report.
Topics: Adenine; Adult; Antiviral Agents; Bone Density Conservation Agents; Denosumab; Fanconi Syndrome; Hep | 2019 |
High frequency of complex mutational patterns in lamivudine resistant hepatitis B virus isolates.
Topics: Adenine; Antiviral Agents; Codon, Nonsense; Drug Resistance, Viral; Genotype; Guanine; Hepatitis B; | 2013 |
Hepatitis B therapy, hepatocellular carcinoma and HBsAg mutants.
Topics: Adenine; Antiviral Agents; Carcinoma, Hepatocellular; DNA, Viral; Drug Therapy, Combination; Hepatit | 2013 |
Prophylactic effect of antiretroviral therapy on hepatitis B virus infection.
Topics: Adenine; Adult; Alanine Transaminase; Anti-Retroviral Agents; Antibiotic Prophylaxis; Drug Resistanc | 2013 |
Adefovir is effective to promote development of immunity to donor origin hepatitis B virus in an allogeneic transplant recipient: a case report.
Topics: Adenine; Adult; Alanine Transaminase; Anemia, Aplastic; Antiviral Agents; Aspartate Aminotransferase | 2013 |
Prevention of de novo hepatitis B with adefovir plus vaccination in recipients of liver transplants from core antibody-positive donors.
Topics: Adenine; Adult; Aged; Antiviral Agents; Biomarkers; Deoxycytidine; DNA, Viral; Drug Substitution; Em | 2013 |
Prevention of de novo hepatitis B in recipients of core antibody-positive livers with lamivudine and other nucleos(t)ides: a 12-year experience.
Topics: Adenine; Adult; Aged; Analysis of Variance; Antiviral Agents; Biomarkers; Chi-Square Distribution; D | 2013 |
Tenofovir treatment of the severe acute hepatitis B.
Topics: Acute Disease; Adenine; Antiviral Agents; Hepatitis B; Humans; Male; Middle Aged; Organophosphonates | 2013 |
Access to treatment for HBV infection and its consistency with 2008 European guidelines in a multicentre cross-sectional study of HIV/HBV co-infected patients in Italy.
Topics: Adenine; Adult; Anti-Retroviral Agents; Coinfection; Cross-Sectional Studies; Deoxycytidine; Emtrici | 2013 |
Tenofovir-emtricitabine therapy for the prevention of hepatitis B recurrence in four patients after liver transplantation.
Topics: Adenine; Adult; Antiviral Agents; Deoxycytidine; Drug Therapy, Combination; Emtricitabine; Female; H | 2013 |
Living related liver transplantation for hepatitis B-related liver disease without hepatitis B immune globulin prophylaxis.
Topics: Adenine; Adolescent; Adult; Aged; Antiviral Agents; DNA, Viral; Drug Resistance; Drug Therapy, Combi | 2013 |
Anti-HBV treatment induces novel reverse transcriptase mutations with reflective effect on HBV S antigen.
Topics: Adenine; Adult; Cell Line; Codon, Nonsense; Drug Resistance, Viral; Female; Gene Expression; Hepatit | 2013 |
WHO survey finds half of countries do not have clinical guidelines for treating hepatitis.
Topics: Adenine; Antiviral Agents; Drugs, Essential; Global Health; Guanine; Health Priorities; Hepatitis B; | 2013 |
HIV-HBV coinfection in Southern Africa and the effect of lamivudine- versus tenofovir-containing cART on HBV outcomes.
Topics: Adenine; Adult; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Cohort Studies; Coinfection; | 2013 |
In vivo antiviral activity of telbivudine against HIV-1: a case report.
Topics: Acute Disease; Adenine; Adult; Antiviral Agents; Coinfection; Drug Therapy, Combination; Hepatitis B | 2013 |
Analysis and simulation of an Adefovir anti-hepatitis B virus infection therapy immune model with alanine aminotransferase.
Topics: Adenine; Alanine Transaminase; Algorithms; Antiviral Agents; Computer Simulation; DNA, Viral; Hepati | 2013 |
HBV clinical isolates expressing adefovir resistance mutations show similar tenofovir susceptibilities across genotypes B, C and D.
Topics: Adenine; Base Sequence; Cloning, Molecular; DNA Primers; Drug Resistance, Viral; Genotype; Hepatitis | 2014 |
Efficacy and safety of tenofovir disoproxil fumarate in pregnancy for the prevention of vertical transmission of HBV infection.
Topics: Adenine; Antiviral Agents; Biomarkers; DNA, Viral; Female; Hepatitis B; Hepatitis B e Antigens; Hepa | 2013 |
Lamivudine compared with newer antivirals for prophylaxis of hepatitis B core antibody positive livers: a cost-effectiveness analysis.
Topics: Adenine; Antiviral Agents; Cohort Studies; Cost-Benefit Analysis; Decision Trees; Follow-Up Studies; | 2014 |
Experimental and molecular docking studies on DNA binding interaction of adefovir dipivoxil: advances toward treatment of hepatitis B virus infections.
Topics: Absorption; Adenine; Animals; Cattle; Circular Dichroism; DNA; Electrons; Hepatitis B; Hepatitis B v | 2014 |
[Patient with HBsAg negativization during treatment. Could it be considered a cure for hepatitis B?].
Topics: Adenine; Adult; Antiviral Agents; Hepatitis B; Hepatitis B Surface Antigens; Humans; Male; Organopho | 2014 |
Incidence and risk factors for incomplete HBV DNA suppression in HIV/HBV-co-infected patients initiating tenofovir-based therapy.
Topics: Adenine; Adult; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Cohort Studies; Coinfection; | 2014 |
Clinical problem-solving. Wasting away.
Topics: Adenine; Adult; Bone Diseases, Metabolic; Cachexia; Diagnosis, Differential; Fanconi Syndrome; Femal | 2014 |
Virologic and serologic outcomes of mono versus dual HBV therapy and characterization of HIV/HBV coinfection in a US cohort.
Topics: Adenine; Adult; Antibodies, Viral; Antiretroviral Therapy, Highly Active; Antiviral Agents; CD4 Lymp | 2014 |
Screening and identification of a novel adefovir dipivoxil resistance associated mutation, rtN236V, of HBV from a large cohort of HBV-infected patients.
Topics: Adenine; Adult; Aged; Amino Acid Substitution; Antiviral Agents; Codon; DNA, Viral; Drug Resistance, | 2014 |
Efficacy and safety of tenofovir disoproxil fumarate in pregnancy to prevent perinatal transmission of hepatitis B virus.
Topics: Adenine; Adult; Antiviral Agents; Cohort Studies; Female; Gastrointestinal Diseases; Hepatitis B; He | 2014 |
Tenofovir disoproxil fumarate rescue therapy for HBV recurrence in two liver transplant recipients with previous multiple nucleo(s/t)ide treatment failures.
Topics: Adenine; Aged; Follow-Up Studies; Graft Rejection; Graft Survival; Hepatitis B; Humans; Liver Failur | 2014 |
Self-assembled drug delivery systems. Part 7: hepatocyte-targeted nanoassemblies of an adefovir lipid derivative with cytochrome P450-triggered drug release.
Topics: Adenine; Animals; Antiviral Agents; Cytochrome P-450 Enzyme System; Drug Delivery Systems; Hepatitis | 2014 |
An HBV-HIV co-infected patient treated with tenofovir-based therapy who achieved HBs antigen/antibody seroconversion.
Topics: Adenine; Adolescent; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Coinfection; Hepatitis | 2014 |
HBsAg clearance by Peg-interferon addition to a long-term nucleos(t)ide analogue therapy.
Topics: Adenine; Adult; Antiviral Agents; Biomarkers; DNA, Viral; Drug Administration Schedule; Drug Therapy | 2014 |
Rescue therapy with adefovir in decompensated liver cirrhosis patients with lamivudine-resistant hepatitis B virus.
Topics: Adenine; Adult; Aged; Antiviral Agents; Cohort Studies; DNA, Viral; Drug Resistance, Viral; Female; | 2014 |
The role of tenofovir in preventing and treating hepatitis B virus (HBV) reactivation in immunosuppressed patients. A real life experience from a tertiary center.
Topics: Adenine; Aged; Aged, 80 and over; Antibodies, Monoclonal, Murine-Derived; Antiviral Agents; Female; | 2014 |
Peroxisome proliferator-activated receptor α activation attenuates the inflammatory response to protect the liver from acute failure by promoting the autophagy pathway.
Topics: Acute Disease; Adenine; Adult; Animals; Autophagy; Autophagy-Related Protein 7; Cells, Cultured; Che | 2014 |
[Retrospective analysis of the efficacy and safety of anti-hepatitis B virus drugs taken during pregnancy in women from the Guangdong Province].
Topics: Adenine; Antiviral Agents; Female; Guanine; Hepatitis B; Hepatitis B virus; Humans; Infant; Infant, | 2014 |
First report of successful clearance of hepatitis B and D coinfection with tenofovir monotherapy.
Topics: Adenine; Adult; Coinfection; Hepatitis B; Hepatitis D; Humans; Male; Organophosphonates; Reverse Tra | 2015 |
Different mechanism of selection of adefovir-resistant mutant viruses during adefovir monotherapy in patients with lamivudine-resistant chronic hepatitis B.
Topics: Adenine; Adult; Aged; Antiviral Agents; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B, Ch | 2014 |
Editorial commentary: the conundrum of Lamivudine and tenofovir disoproxil fumarate for hepatitis B: fetus versus infant.
Topics: Adenine; Anti-HIV Agents; Breast Feeding; Disease Transmission, Infectious; Female; Hepatitis B; Hum | 2015 |
[Clinical pathology of recurrent hepatitis B after liver transplantation].
Topics: Adenine; Antiviral Agents; Hepatitis B; Hepatitis B Core Antigens; Hepatitis B Surface Antigens; Hep | 2014 |
Postexposure prophylactic effect of hepatitis B virus (HBV)-active antiretroviral therapy against HBV infection.
Topics: Adenine; Animals; Antiviral Agents; Hepatitis B; Hepatitis B virus; Humans; Lamivudine; Mice; Organo | 2015 |
The efficacy and safety of tenofovir in the prevention of hepatitis B virus recurrence following liver transplantation.
Topics: Adenine; Antiviral Agents; End Stage Liver Disease; Female; Hepatitis B; Humans; Immunoglobulins; Li | 2014 |
[Case report; A case of Fanconi's syndrome with pathological ulnar fractures improved by dose reduction of adefovir and supplementation of oral phosphate].
Topics: Adenine; Administration, Oral; Aged; Antiviral Agents; Fanconi Syndrome; Female; Fractures, Spontane | 2014 |
Low-dose short-term hepatitis B immunoglobulin with high genetic barrier antivirals: the ideal post-transplant hepatitis B virus prophylaxis?
Topics: Adenine; Adult; Antiviral Agents; Carcinoma, Hepatocellular; Cohort Studies; Drug Resistance, Viral; | 2015 |
Analysis of HBV genotype, drug resistant mutations, and pre-core/basal core promoter mutations in Korean patients with acute hepatitis B.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Female; Genotype; Guanin | 2015 |
Limited hepatitis B immunoglobulin with potent nucleos(t)ide analogue is a cost-effective prophylaxis against hepatitis B virus after liver transplantation.
Topics: Adenine; Adult; Aged; Antiviral Agents; Cost-Benefit Analysis; Drug Costs; Female; Graft Survival; G | 2015 |
Relationship Between Serum DNA Replication, Clinicopathological Characteristics and Prognosis of Hepatitis B Virus-associated Glomerulonephritis with Severe Proteinuria by Lamivudine Plus Adefovir Dipivoxil Combination Therapy.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA Replication; DNA, Viral; Drug Therapy, Combination; Fema | 2015 |
Nucleoside-Nucleotide Analog Combination Therapy Is Effective in Preventing Recurrent Hepatitis B After Liver Transplantation.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Female; Guanine; Hepatitis | 2015 |
A novel baseline hepatitis B virus sequencing-based strategy for predicting adefovir antiviral response.
Topics: Adenine; Adult; Antiviral Agents; Biomarkers; DNA, Viral; Drug Resistance, Viral; Female; Genotype; | 2015 |
Prevalence and types of drug-resistant variants in Chinese patients with acute hepatitis B.
Topics: Adenine; Adult; Antiviral Agents; China; DNA, Viral; Drug Resistance, Viral; Female; Genetic Variati | 2015 |
Increased occurrence of mutant rtI233V of HBV in patients receiving adefovir therapy.
Topics: Adenine; Adolescent; Adult; Aged; Amino Acid Substitution; Antiviral Agents; Child; Codon; DNA, Vira | 2016 |
Tenofovir for Hepatitis Delta.
Topics: Adenine; Hepatitis B; Hepatitis D; Humans; Male; Organophosphonates; Reverse Transcriptase Inhibitor | 2016 |
Mechanism of Adefovir, Tenofovir and Entecavir Resistance: Molecular Modeling Studies of How A Novel Anti-HBV Agent (FMCA) Can Overcome the Drug Resistance.
Topics: Adenine; Adenosine; Amino Acid Sequence; Antiviral Agents; Binding Sites; Catalytic Domain; Database | 2015 |
Adefovir- or Lamivudine-Induced Renal Tubular Dysfunction after Liver Transplantation.
Topics: Adenine; Female; Hepatitis B; Humans; Incidence; Kidney Diseases; Lamivudine; Liver Transplantation; | 2015 |
Occult HBV reactivation induced by ibrutinib treatment: a case report.
Topics: Adenine; Aged, 80 and over; Hepatitis B; Humans; Leukemia, Lymphocytic, Chronic, B-Cell; Male; Piper | 2015 |
Variability in long-term hepatitis B virus dynamics under antiviral therapy.
Topics: Adenine; Antiviral Agents; DNA, Viral; Female; Follow-Up Studies; Hepatitis B; Hepatitis B virus; Hu | 2016 |
[Tetracycline-inducible replications of wild-type and an adefovir-dipivoxil-resistant hepatitis B virus in human liver cells].
Topics: Adenine; Antiviral Agents; Cell Line; Drug Resistance, Viral; Genotype; Hepatitis B; Hepatitis B vir | 2016 |
Hepatitis B virus related cryoglobulinemic vasculitis: A multicentre open label study from the Gruppo Italiano di Studio delle Crioglobulinemie - GISC.
Topics: Adenine; Aged; Antiviral Agents; Cryoglobulinemia; Female; Guanine; Hepatitis B; Hepatitis B e Antig | 2016 |
Tenofovir alafenamide demonstrates broad cross-genotype activity against wild-type HBV clinical isolates and maintains susceptibility to drug-resistant HBV isolates in vitro.
Topics: Adenine; Alanine; Antiviral Agents; Drug Resistance, Viral; Genotype; Hep G2 Cells; Hepatitis B; Hep | 2017 |
Severe hepatitis B virus reactivation related to ibrutinib monotherapy.
Topics: Adenine; Aged; Hepatitis B; Hepatitis B virus; Humans; Leukemia, Lymphocytic, Chronic, B-Cell; Male; | 2017 |
Continuous single motor unit electromyographic activity in adefovir associated myopathy.
Topics: Adenine; Antiviral Agents; Chronic Disease; Creatine Kinase; Electromyography; Hepatitis B; Humans; | 2008 |
Predictive factors associated with the progression to hepatic failure caused by lamivudine-resistant HBV.
Topics: Adenine; Adult; Antiviral Agents; Bilirubin; Disease Progression; Drug Resistance, Viral; Female; Fo | 2008 |
Entecavir therapy for adefovir-resistant hepatitis B virus infection in kidney and liver allograft recipients.
Topics: Adenine; Adult; Antiviral Agents; Drug Resistance, Viral; Guanine; Hepatitis B; Hepatitis B Surface | 2008 |
Adefovir combined with hepatitis C virus treatment may prevent hepatitis B reactivation after hepatitis C virus eradication in hepatitis B and C virus carriers.
Topics: Adenine; Adult; Antiviral Agents; Carrier State; Drug Therapy, Combination; Hepatitis B; Hepatitis B | 2008 |
Sensitivity and accuracy of an updated line probe assay (HBV DR v.3) in detecting mutations associated with hepatitis B antiviral resistance.
Topics: Adenine; Adult; Antiviral Agents; DNA Probes; DNA, Viral; Drug Resistance, Viral; Female; Guanine; H | 2009 |
Prolonged use of tenofovir in HIV/hepatitis B virus (HBV)-coinfected individuals does not lead to HBV polymerase mutations and is associated with persistence of lamivudine HBV polymerase mutations.
Topics: Adenine; Adult; Aged; Antiretroviral Therapy, Highly Active; Antiviral Agents; Cross-Sectional Studi | 2009 |
Emergence of adefovir-resistant mutants after reversion to YMDD wild-type in lamivudine-resistant patients receiving adefovir monotherapy.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Resistance, Multiple, Viral; Female; Hepatitis B; | 2009 |
Long-term outcome of tenofovir disoproxil fumarate use against hepatitis B in an HIV-coinfected cohort.
Topics: Adenine; Adult; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Resistance, Viral; Drug Therapy, C | 2009 |
Hepatitis B virus mutations potentially conferring adefovir/tenofovir resistance in treatment-naive patients.
Topics: Adenine; Adult; Amino Acid Substitution; Antiviral Agents; Drug Resistance, Viral; Genetic Variation | 2009 |
The rtA194T polymerase mutation impacts viral replication and susceptibility to tenofovir in hepatitis B e antigen-positive and hepatitis B e antigen-negative hepatitis B virus strains.
Topics: Adenine; Anti-HIV Agents; Cell Line, Tumor; DNA-Directed DNA Polymerase; Drug Resistance, Viral; Gua | 2009 |
Successful treatment of refractory Behçet's disease with the TNF-alpha blocker infliximab.
Topics: Adenine; Adult; Anti-Inflammatory Agents; Antibodies, Monoclonal; Antiviral Agents; Behcet Syndrome; | 2009 |
Ultra-deep pyrosequencing of hepatitis B virus quasispecies from nucleoside and nucleotide reverse-transcriptase inhibitor (NRTI)-treated patients and NRTI-naive patients.
Topics: Adenine; Antiviral Agents; Base Sequence; DNA Primers; DNA, Viral; Drug Resistance, Viral; Genetic V | 2009 |
Peginterferon alfa-2a and ribavirin in Latino and non-Latino whites with hepatitis C.
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Hepacivirus; Hepatitis B; Hepatitis B virus; Hepa | 2009 |
Emergency transplantation for acute reactivation of chronic hepatitis B with high viral load: role of antiviral therapy.
Topics: Adenine; Blood Chemical Analysis; DNA, Viral; Hepatitis B; Humans; Immunoglobulins; Lamivudine; Live | 2009 |
Reduced glomerular filtration rate but sustained virologic response in HIV/hepatitis B co-infected individuals on long-term tenofovir.
Topics: Adenine; Adult; Alanine Transaminase; Antiviral Agents; CD4 Lymphocyte Count; Cohort Studies; Female | 2009 |
[Failure to treat hepatitis B virus infection with adefovir due to early selection of rtA181T mutation].
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Female; Genotype; Hepatitis B; Hepatitis B Antige | 2010 |
Detection of the rtA181V/T and rtN236T mutations associated with resistance to adefovir dipivoxil using a ligase detection reaction assay.
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Hepatitis B; Hepatitis B virus; Humans; Ligases; | 2009 |
High rates of active hepatitis B and C co-infections in HIV-1 infected Cameroonian adults initiating antiretroviral therapy.
Topics: Adenine; Adult; Age Factors; Anti-HIV Agents; Anti-Retroviral Agents; Cameroon; Comorbidity; Female; | 2010 |
Add-on combination therapy with adefovir dipivoxil induces renal impairment in patients with lamivudine-refractory hepatitis B virus.
Topics: Adenine; Adult; Aged; Alanine Transaminase; Antiviral Agents; Creatinine; DNA, Viral; Drug Resistanc | 2010 |
Favorable outcome of de novo hepatitis B infection after liver transplantation with lamivudine and adefovir therapy.
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Female; Hepatitis B; Hepatitis B virus; Humans | 2009 |
The significance of enzyme immunoassay for the assessment of hepatitis B virus core-related antigen following liver transplantation.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Female; Hepatitis B; Hepatitis B Core Antigens; | 2009 |
[Tenofovir, An antiviral agent with activity against HIV infections and hepatitis B].
Topics: Adenine; Anti-HIV Agents; Antiviral Agents; Hepatitis B; Hepatitis B virus; Humans; Organophosphonat | 2009 |
Two types of drug-resistant hepatitis B viral strains emerging alternately and their susceptibility to combination therapy with entecavir and adefovir.
Topics: Adenine; Antiviral Agents; Drug Therapy, Combination; Guanine; Hepatitis B; Hepatitis B virus; Human | 2009 |
Resolution of chronic hepatitis Delta after 1 year of combined therapy with pegylated interferon, tenofovir and emtricitabine.
Topics: Adenine; Antibodies, Viral; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Therapy, Combination; | 2010 |
Long-term efficacy of tenofovir monotherapy for hepatitis B virus-monoinfected patients after failure of nucleoside/nucleotide analogues.
Topics: Adenine; Adolescent; Adult; Cohort Studies; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B | 2010 |
Long-term efficacy of tenofovir monotherapy for hepatitis B virus-monoinfected patients after failure of nucleoside/nucleotide analogues.
Topics: Adenine; Adolescent; Adult; Cohort Studies; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B | 2010 |
Long-term efficacy of tenofovir monotherapy for hepatitis B virus-monoinfected patients after failure of nucleoside/nucleotide analogues.
Topics: Adenine; Adolescent; Adult; Cohort Studies; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B | 2010 |
Long-term efficacy of tenofovir monotherapy for hepatitis B virus-monoinfected patients after failure of nucleoside/nucleotide analogues.
Topics: Adenine; Adolescent; Adult; Cohort Studies; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B | 2010 |
[Protocol for the antiviral therapy of hepatitis B and D].
Topics: Adenine; Antiviral Agents; Biopsy; Guanine; Hepatitis B; Hepatitis B e Antigens; Hepatitis B Surface | 2010 |
[The antiviral treatment impacts on clinical outcomes of renal transplantation recipients with hepatitis B virus infection].
Topics: Adenine; Adult; Aged; Antiviral Agents; Case-Control Studies; Female; Hepatitis B; Hepatitis B virus | 2009 |
Liver transplantation in bearers of hepatitis B associated or not with delta hepatitis in the age of the new antiviral drugs: is hyperimmune globulin still necessary?
Topics: Adenine; Adult; Aged; Antiviral Agents; Aspartate Aminotransferases; Female; Guanine; Hepatitis B; H | 2010 |
Viral resistance in hepatitis B: prevalence and management.
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Genetic Testing; Genotype; Guanine; Hepatitis B; | 2010 |
Peptide nucleic acid array for detection of point mutations in hepatitis B virus associated with antiviral resistance.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Guanine; Hepatitis B; Hepatitis B vir | 2010 |
Acute hepatitis B infection associated with drug-resistant hepatitis B virus.
Topics: Adenine; Adult; Amino Acid Substitution; Antiviral Agents; China; DNA, Viral; Drug Resistance, Viral | 2010 |
Drug therapy: tenofovir.
Topics: Adenine; Antiviral Agents; Female; Hepatitis B; Humans; Middle Aged; Organophosphonates; Tenofovir | 2010 |
Molecular characterization of intrahepatic and extrahepatic hepatitis B virus (HBV) reservoirs in patients on suppressive antiviral therapy.
Topics: Adenine; Adult; Aged; Antiviral Agents; Asian People; DNA, Circular; DNA, Viral; Drug Resistance; Fe | 2011 |
High frequency of lamivudine resistance mutations in Brazilian patients co-infected with HIV and hepatitis B.
Topics: Adenine; Adult; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Brazil; Comorbidity; Cross-S | 2010 |
[Resistance mutation patterns of hepatitis B virus in patients with suboptimal response to adefovir dipivoxil therapy after lamivudine resistance].
Topics: Adenine; Adult; Antiviral Agents; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B virus; Hu | 2010 |
Hepatitis B virus (HBV) subgenotypes C2 and B2 differ in lamivudine- and adefovir-resistance-associated mutational patterns in HBV-infected Chinese patients.
Topics: Adenine; Adolescent; Adult; Antiviral Agents; Asian People; China; Drug Resistance, Viral; Female; G | 2010 |
A classification model for G-to-A hypermutation in hepatitis B virus ultra-deep pyrosequencing reads.
Topics: Adenine; Algorithms; Classification; DNA Mutational Analysis; Drug Resistance, Viral; Guanine; Hepat | 2010 |
Efficacy and safety of entecavir and/or tenofovir for prophylaxis and treatment of hepatitis B recurrence post-liver transplant.
Topics: Adenine; Adult; Aged; Antiviral Agents; Combined Modality Therapy; Female; Guanine; Hepatitis B; Hum | 2010 |
Add-on combination therapy with adefovir dipivoxil induces renal impairment in patients with lamivudine-refractory hepatitis B virus (J Viral Hepat 2010 Feb 1;17(2):123-9).
Topics: Adenine; Antiviral Agents; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B virus; Humans; K | 2011 |
Entecavir as treatment for reactivation of hepatitis B in immunosuppressed patients.
Topics: Adenine; Aged; Antiviral Agents; Drug Therapy, Combination; Female; Guanine; Hepatitis B; Hepatitis | 2010 |
Prevention of lamivudine-resistant hepatitis B recurrence after liver transplantation with entecavir plus tenofovir combination therapy and perioperative hepatitis B immunoglobulin only.
Topics: Adenine; Antiviral Agents; Combined Modality Therapy; Drug Resistance, Viral; Guanine; Hepatitis B; | 2011 |
Pharmacokinetics and efficacy of intravenous or intramuscular hepatitis B immunoglobulins in prophylaxis of hepatitis B after liver transplantation.
Topics: Adenine; Adult; Aged; Antiviral Agents; Drug Administration Schedule; Female; Hepatitis B; Hepatitis | 2010 |
Low liver stiffness among cirrhotic patients with hepatitis B after prolonged treatment with nucleoside analogs.
Topics: Adenine; Adult; Elasticity Imaging Techniques; Female; Hepatitis B; Humans; Lamivudine; Liver; Liver | 2011 |
[The replication capacity and drug sensitivity of Adefovir dipivoxil-resistant HBV mutants in vivo].
Topics: Adenine; Animals; Antiviral Agents; Base Sequence; Drug Resistance, Viral; Hepatitis B; Hepatitis B | 2011 |
Successful tenofovir treatment for fulminant hepatitis B infection in an infant.
Topics: Adenine; Antiviral Agents; Female; Hepatitis B; Humans; Infant; Organophosphonates; Tenofovir; Treat | 2011 |
Membranous nephropathy in an HIV-positive patient complicated with hepatitis B virus infection.
Topics: Adenine; Adult; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Deoxycytidine; Emtricitabine | 2011 |
Late onset of hepatitis B virus reactivation following hematopoietic stem cell transplantation: successful treatment with combined entecavir plus tenofovir therapy.
Topics: Adenine; Age of Onset; Antiviral Agents; Drug Therapy, Combination; Female; Guanine; Hematopoietic S | 2012 |
Design, synthesis, and biological evaluation of triazolo-pyrimidine derivatives as novel inhibitors of hepatitis B virus surface antigen (HBsAg) secretion.
Topics: Adenine; Animals; Antiviral Agents; Biological Availability; Drug Design; Drug Resistance, Viral; Gu | 2011 |
HIV-HBV vaccine escape mutant infection with loss of HBV surface antibody and persistent HBV viremia on tenofovir/emtricitabine without antiviral resistance.
Topics: Adenine; Antiviral Agents; Coinfection; Deoxycytidine; Drug Resistance, Viral; Emtricitabine; Hepati | 2011 |
Long-term outcome of primary non-responders to tenofovir therapy in HIV/HBV-co-infected patients: impact of HBV genotype G.
Topics: Adenine; Adult; Anti-HIV Agents; Coinfection; Deoxycytidine; DNA Mutational Analysis; DNA, Viral; Dr | 2012 |
Comparison between Elecsys HBsAg II and architect HBsAg QT assays for quantification of hepatitis B surface antigen among patients coinfected with HIV and hepatitis B virus.
Topics: Adenine; Adult; Anti-HIV Agents; CD4 Lymphocyte Count; Coinfection; Female; Genotype; Hepatitis B; H | 2012 |
Synthesis, anti-HBV activity and renal cell toxicity evaluation of mixed phosphonate prodrugs of adefovir.
Topics: Adenine; Anti-Inflammatory Agents, Non-Steroidal; Antiviral Agents; Cell Line; Cell Survival; Hep G2 | 2012 |
Substitution of tenofovir/emtricitabine for Hepatitis B immune globulin prevents recurrence of Hepatitis B after liver transplantation.
Topics: Adenine; Adult; Antiviral Agents; Deoxycytidine; Emtricitabine; Female; Hepatitis B; Humans; Immunog | 2012 |
Severe vitamin D deficiency in a patient treated for hepatitis B with tenofovir.
Topics: Adenine; Hepatitis B; Humans; Hypophosphatemia; Male; Middle Aged; Organophosphonates; Reverse Trans | 2012 |
[Hungarian consensus guideline for the diagnosis and treatment of B, C, and D viral hepatitis].
Topics: Adenine; Antiviral Agents; Comorbidity; Consensus; Drug Administration Schedule; Drug Therapy, Combi | 2012 |
Lamivudine plus adefovir vs. entecavir in HBeAg-positive hepatitis B with sequential treatment failure of lamivudine and adefovir.
Topics: Adenine; Adult; Alanine Transaminase; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Femal | 2012 |
[Prognosis analysis of hepatitis B virus recurrence after liver transplantation: a single-center study of 38 cases].
Topics: Adenine; Adult; Female; Hepatitis B; Hepatitis B virus; Humans; Lamivudine; Liver Transplantation; M | 2012 |
Tenofovir disoproxil fumarate for prevention of vertical transmission of hepatitis B virus infection by highly viremic pregnant women: a case series.
Topics: Adenine; Adult; Alanine Transaminase; Antiviral Agents; Drug Administration Routes; Female; Hepatiti | 2012 |
Hepatitis B prophylaxis post liver transplantation with newer nucleos(t)ide analogues after hepatitis B immunoglobulin discontinuation.
Topics: Adenine; Adult; Aged; Antiviral Agents; Drug Administration Schedule; Drug Therapy, Combination; Fem | 2012 |
Hepatitis B virus and human immunodeficiency virus drugs in pregnancy: findings from the Antiretroviral Pregnancy Registry.
Topics: Adenine; Adult; Antiviral Agents; Congenital Abnormalities; Female; Hepatitis B; Hepatitis B virus; | 2012 |
Hepatitis B surface antigen declines and clearance during long-term tenofovir therapy in patients coinfected with HBV and HIV.
Topics: Adenine; Adult; Antiviral Agents; CD4 Lymphocyte Count; Cohort Studies; Coinfection; Drug Administra | 2012 |
Five-year review of HIV-hepatitis B virus (HBV) co-infected patients in a New York City AIDS center.
Topics: Adenine; Adult; Anti-HIV Agents; Coinfection; Female; Hepatitis B; Hepatitis B e Antigens; HIV Infec | 2012 |
Evolution of adefovir-resistant HBV polymerase gene variants after switching to tenofovir disoproxil fumarate monotherapy.
Topics: Adenine; Adult; Aged; Antiviral Agents; Cloning, Molecular; DNA, Viral; Drug Resistance, Viral; Drug | 2012 |
Prolonged adefovir therapy associated Fanconi syndrome and interstitial nephritis in hepatitis B.
Topics: Adenine; Drug Administration Schedule; Fanconi Syndrome; Hepatitis B; Humans; Male; Middle Aged; Nep | 2012 |
Does genotype predict response to treatment in children infected with hepatitis B perinatally?
Topics: Adenine; Adolescent; Anti-Inflammatory Agents; Antiviral Agents; Child; Child, Preschool; Clinical T | 2012 |
Does interferon-sparing tenofovir disoproxil fumarate-based therapy have a role in the management of severe acute hepatitis delta superinfection?
Topics: Acute Disease; Adenine; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Hepatitis B; Hepati | 2012 |
Evaluation of single and combination therapies with tenofovir disoproxil fumarate and emtricitabine in vitro and in a robust mouse model supporting high levels of hepatitis B virus replication.
Topics: Adenine; Animals; Antiviral Agents; Cell Line; Deoxycytidine; Drug Combinations; Drug Interactions; | 2012 |
Evaluation of anti-HBV drug resistant mutations among patients with acute symptomatic hepatitis B in the United States.
Topics: Acute Disease; Adenine; Adult; Antiviral Agents; Cohort Studies; Cross-Sectional Studies; Drug Resis | 2013 |
Five-year on-treatment efficacy of lamivudine-, tenofovir- and tenofovir + emtricitabine-based HAART in HBV-HIV-coinfected patients.
Topics: Adenine; Adult; Antiretroviral Therapy, Highly Active; CD4 Lymphocyte Count; Coinfection; Deoxycytid | 2012 |
Blunted fetal growth by tenofovir in late pregnancy.
Topics: Adenine; Adult; Anti-HIV Agents; Asian People; Bone Density; Female; Fetal Growth Retardation; Hepat | 2012 |
Severe acute hepatitis B in a treatment-naïve patient with antiviral drug resistant mutations in the polymerase gene.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Genotype; Hepatitis B; Hepatitis B An | 2013 |
Binding sensitivity of adefovir to the polymerase from different genotypes of HBV: molecular modeling, docking and dynamics simulation studies.
Topics: Adenine; Amino Acid Sequence; Antiviral Agents; DNA-Directed DNA Polymerase; Genotype; Hepatitis B; | 2013 |
The amino acid substitutions rtP177G and rtF249A in the reverse transcriptase domain of hepatitis B virus polymerase reduce the susceptibility to tenofovir.
Topics: Adenine; Amino Acid Substitution; Animals; Antiviral Agents; Computational Biology; Disease Models, | 2013 |
Reactivation of occult hepatitis B virus infection following cytotoxic lymphoma therapy in an anti-HBc negative patient.
Topics: Adenine; Aged; Antibodies, Monoclonal, Murine-Derived; Antineoplastic Agents; Antiviral Agents; DNA, | 2013 |
Sexually transmitted infection with an immune-escape mutant hepatitis B virus in an hepatitis B virus-vaccinated individual with acute HIV-hepatitis C virus infection.
Topics: Acute Disease; Adenine; Adult; Anti-HIV Agents; CD4 Lymphocyte Count; Darunavir; Deoxycytidine; Drug | 2013 |
Efficacy of combined antiviral therapy with lamivudine and tenofovir in a liver transplanted girl with de novo hepatitis B virus infection.
Topics: Adenine; Antiviral Agents; Child, Preschool; Drug Therapy, Combination; Female; Hepatitis B; Hepatit | 2013 |
Tenofovir treatment in patients with lamivudine-resistant hepatitis B mutants strongly affects viral replication.
Topics: Adenine; Drug Resistance, Viral; Hepatitis B; Hepatitis B virus; Humans; Lamivudine; Mutation; Organ | 2002 |
Treatment of recurrent hepatitis B infection in liver transplant recipients.
Topics: 2-Aminopurine; Adenine; Antiviral Agents; Famciclovir; Hepatitis B; Humans; Interferon-alpha; Lamivu | 2002 |
Editorial comment: a tale of two viruses.
Topics: Adenine; Drug Resistance, Viral; Drug Therapy, Combination; Hepatitis B; Hepatitis B Vaccines; HIV I | 2002 |
FDA recommends hepatitis B drug.
Topics: Adenine; Antiviral Agents; Drug Administration Schedule; Drug Approval; Hepatitis B; Humans; Kidney | 2002 |
Tenofovir disoproxil fumarate in patients with HIV and lamivudine-resistant hepatitis B virus.
Topics: Adenine; Adult; Antiviral Agents; Drug Resistance, Viral; Drug Therapy, Combination; Hepatitis B; He | 2003 |
Successful treatment of fibrosing cholestatic hepatitis using adefovir dipivoxil in a patient with cirrhosis and renal insufficiency.
Topics: Adenine; Adult; Antiviral Agents; Bacterial Infections; Cholestasis; Drug Resistance, Microbial; Fib | 2003 |
Tenofovir disoproxil fumarate exhibits strong antiviral effect in a patient with lamivudine-resistant severe hepatitis B reactivation.
Topics: Adenine; Antiviral Agents; Drug Resistance, Microbial; Hepatitis B; Hepatitis B virus; Humans; Lamiv | 2003 |
Tenofovir helps beat hepatitis B.
Topics: Adenine; Antiviral Agents; CD4 Lymphocyte Count; Hepatitis B; Hepatitis B virus; HIV; HIV Infections | 2003 |
Inhibition of hepatitis B virus replication in vivo by nucleoside analogues and siRNA.
Topics: Adenine; Animals; Capsid; Combined Modality Therapy; Disease Models, Animal; Gene Expression Regulat | 2003 |
Antiviral Research--16th Annual International Conference. Satellite symposium: clinical update on antiviral drugs. 27 April-1 May 2003, Savannah, GA, USA.
Topics: Adenine; Anti-HIV Agents; Antiviral Agents; Clinical Trials as Topic; Enfuvirtide; Ganciclovir; Hepa | 2003 |
Recent studies of adefovir dipivoxil for hepatitis B.
Topics: Adenine; Adult; Antiviral Agents; Child; Controlled Clinical Trials as Topic; Hepatitis B; Hepatitis | 2003 |
Live-donor liver transplantation for acute-on-chronic hepatitis B liver failure.
Topics: Acute Disease; Adenine; Adult; Antiviral Agents; DNA, Viral; Female; Follow-Up Studies; Graft Surviv | 2003 |
Favourable outcome of adefovir-dipivoxil treatment in acute de novo hepatitis B after liver transplantation.
Topics: Acute Disease; Adenine; Antiviral Agents; Hepatitis B; Hepatitis B Antibodies; Hepatitis B Surface A | 2004 |
Antiretroviral therapy and HIV/hepatitis B virus coinfection.
Topics: Adenine; Antiretroviral Therapy, Highly Active; Antiviral Agents; Hepatitis B; Hepatitis B virus; HI | 2004 |
[Viral hepatitis B/C and HIV. Therapy of double infections].
Topics: Acquired Immunodeficiency Syndrome; Adenine; Anti-HIV Agents; Antiviral Agents; Clinical Trials as T | 2003 |
Fibrosing cholestatic hepatitis secondary to precore/core promoter hepatitis B variant with lamivudine resistance: successful retransplantation with combination adefovir dipivoxil and hepatitis B immunoglobulin.
Topics: Adenine; Adult; Antiviral Agents; Cholestasis, Intrahepatic; Drug Resistance, Viral; Drug Therapy, C | 2004 |
Adefovir dipivoxil as a treatment for hepatic failure caused by lamivudine-resistant HBV strains.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Resistance; Hepatitis B; Hepatitis B virus; Humans; Lami | 2004 |
In vitro susceptibility of lamivudine-resistant hepatitis B virus to adefovir and tenofovir.
Topics: Adenine; Adult; Antiviral Agents; Cell Line; DNA-Directed DNA Polymerase; DNA, Viral; Dose-Response | 2004 |
A novel pattern (sW195a) in surface gene of HBV DNA due to YSDD (L180M plus M204S) mutation selected during lamivudine therapy and successful treatment with adefovir dipivoxil.
Topics: Adenine; Amino Acid Substitution; Antiviral Agents; Drug Resistance, Viral; Hepatitis B; Hepatitis B | 2004 |
Suppression of lamivudine-resistant B-domain mutants by adefovir dipivoxil in the woodchuck hepatitis virus model.
Topics: Adenine; Administration, Oral; Amino Acid Motifs; Amino Acid Substitution; Animals; Antiviral Agents | 2004 |
Adefovir dipivoxil to prevent exacerbation of lamivudine-resistant hepatitis B infection during chemotherapy for non-Hodgkin's lymphoma.
Topics: Adenine; Adult; Antiviral Agents; Carrier State; Drug Resistance; Female; Hepatitis B; Humans; Lamiv | 2004 |
Outcomes in liver transplant recipients with hepatitis B virus: resistance and recurrence patterns from a large transplant center over the last decade.
Topics: Adenine; Adult; Aged; Antiviral Agents; Drug Resistance, Viral; Female; Graft Survival; Hepatitis B; | 2004 |
Tenofovir therapy for lamivudine resistance following liver transplantation.
Topics: Adenine; Adult; Antiviral Agents; Chronic Disease; Drug Resistance, Viral; Hepatitis B; Hepatitis B, | 2004 |
Intramolecular stacking interactions in ternary copper(II) complexes formed by a heteroaromatic amine and 9-[2-(2-phosphonoethoxy)ethyl]adenine, a relative of the antiviral nucleotide analogue 9-[2-(phosphonomethoxy)ethyl]adenine.
Topics: Adenine; Amines; Anions; Antiviral Agents; Chelating Agents; Copper; Hepatitis B; Hydrogen-Ion Conce | 2004 |
Adefovir dipivoxil as the rescue therapy for lamivudine-resistant hepatitis B post liver transplant.
Topics: Adenine; Adolescent; Adult; Aged; Antiviral Agents; Child; Drug Resistance; Follow-Up Studies; Hepat | 2004 |
Adefovir dipivoxil for treatment of breakthrough hepatitis caused by lamivudine-resistant mutants of hepatitis B virus.
Topics: Adenine; Adult; Alanine Transaminase; Drug Resistance, Microbial; Female; Genotype; Hepatitis B; Hep | 2004 |
Successful therapy of hepatitis B with tenofovir in HIV-infected patients failing previous adefovir and lamivudine treatment.
Topics: Adenine; Adult; AIDS-Related Opportunistic Infections; Anti-HIV Agents; Chronic Disease; DNA-Directe | 2004 |
Adefovir treatment in posttransplant hepatitis B virus infection resistant to lamivudine plus hepatitis B virus immunoglobulin.
Topics: Adenine; Adult; Antibodies, Viral; Antiviral Agents; Drug Resistance; Female; Hepatitis B; Hepatitis | 2004 |
Adefovir dipivoxil for chemotherapy-induced activation of hepatitis B virus infection.
Topics: Acute Disease; Adenine; Aged; Antineoplastic Combined Chemotherapy Protocols; Antiviral Agents; Hepa | 2005 |
Treatment with adefovir dipivoxil in a renal transplant patient with renal insufficiency and lamivudine-resistant hepatitis B infection.
Topics: Adenine; Antiviral Agents; Creatinine; Drug Resistance, Viral; Follow-Up Studies; Hepatitis B; Human | 2005 |
Adefovir dipivoxil therapy in liver transplant recipients with lamivudine-resistant hepatitis B virus.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Hepatitis B; Hepatitis B | 2005 |
Tenofovir helpful for patients with HBV.
Topics: Adenine; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Hepatitis B; HIV Infections; Humans | 2005 |
Successful treatment with tenofovir in a child C cirrhotic patient with lamivudine-resistant hepatitis B virus awaiting liver transplantation. Post-transplant results.
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Drug Therapy, Combination; Hep | 2005 |
Reactivation of viral replication after replacement of tenofovir by adefovir.
Topics: Adenine; Adult; Antiviral Agents; Hepatitis B; Humans; Male; Middle Aged; Organophosphonates; Tenofo | 2005 |
The risk of adefovir monotherapy in human immunodeficiency virus (HIV) and hepatitis B virus (HBV) co-infected patients.
Topics: Adenine; Antiviral Agents; DNA, Viral; Hepatitis B; Hepatitis B virus; HIV; HIV Infections; Humans; | 2005 |
[Efficacy and safety of adefovir dipivoxil in patients with decompensated liver cirrhosis with Lamivudine resistance compared to patients with compensated liver disease].
Topics: Adenine; Adult; Aged; Antiviral Agents; Drug Resistance, Viral; Female; Hepatitis B; Humans; Lamivud | 2005 |
Association of polymorphism of tumor necrosis factor-alpha gene promoter region with outcome of hepatitis B virus infection.
Topics: Adenine; Adult; Case-Control Studies; Cytosine; Female; Genotype; Hepatitis B; Hepatitis B virus; He | 2005 |
Adefovir-resistant hepatitis B can be associated with viral rebound and hepatic decompensation.
Topics: Adenine; Adult; Aged; Antiviral Agents; Disease Progression; Drug Resistance, Viral; Hepatitis B; He | 2005 |
Community-based epidemiology of hepatitis B virus infection in West Bengal, India: prevalence of hepatitis B e antigen-negative infection and associated viral variants.
Topics: Adenine; Adolescent; Adult; Child; Codon, Terminator; Demography; DNA, Viral; Genetic Variation; Gen | 2005 |
Adefovir added to lamivudine for hepatitis B recurrent infection in refractory B-cell chronic lymphocytic leukemia on prolonged therapy with Campath-1H.
Topics: Adenine; Alemtuzumab; Antibodies, Monoclonal; Antibodies, Monoclonal, Humanized; Antibodies, Neoplas | 2006 |
Adefovir rapidly suppresses hepatitis B in HBeAg-negative patients developing genotypic resistance to lamivudine.
Topics: Adenine; Adult; Aged; Alanine Transaminase; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Fe | 2005 |
Study on the efficacy and safety of adefovir dipivoxil treatment in post-liver transplant patients with hepatitis B virus infection and lamivudine-resistant hepatitis B virus.
Topics: Adenine; Alanine Transaminase; Drug Resistance, Viral; Female; Hepatitis B; Hepatitis B e Antigens; | 2005 |
Wild type and YMDD variant of hepatitis B virus: no difference in viral kinetics on lamivudine/tenofovir therapy in HIV-HBV co-infected patients.
Topics: Adenine; Adult; Anti-HIV Agents; DNA, Viral; Drug Resistance, Viral; Genetic Variation; Hepatitis B; | 2006 |
Adefovir therapy for lamivudine escape and hepatitis B virus reactivation after reduced intensity conditioning allogeneic stem cell transplantation.
Topics: Adenine; Adult; Antineoplastic Agents; Combined Modality Therapy; Female; Hepatitis B; Hepatitis B v | 2006 |
Anti-hepatitis B virus efficacy of tenofovir disoproxil fumarate in HIV-infected patients.
Topics: Adenine; Adult; Antiviral Agents; Cohort Studies; DNA, Viral; Drug Resistance, Viral; Drug Therapy, | 2006 |
Prophylactic strategies for hepatitis B patients undergoing liver transplant: a cost-effectiveness analysis.
Topics: Adenine; Adult; Aged; Antiviral Agents; Cost-Benefit Analysis; Drug Therapy, Combination; Health Car | 2006 |
[Reactivation of hepatitis B treated with adefovir after infliximab administration].
Topics: Adenine; Antibodies, Monoclonal; Antiviral Agents; Hepatitis B; Humans; Immunosuppressive Agents; In | 2006 |
Tenofovir for patients with lamivudine-resistant hepatitis B virus (HBV) infection and high HBV DNA level during adefovir therapy.
Topics: Adenine; Adult; Disease Progression; DNA, Viral; Drug Resistance, Viral; Female; Follow-Up Studies; | 2006 |
Favorable outcome of liver transplantation despite a high hepatitis B virus replication: beyond the limits?
Topics: Adenine; Antiviral Agents; Contraindications; Hepatitis B; Humans; Liver Transplantation; Male; Midd | 2006 |
Hepatitis delta virus super-infection in a co-infected patient with the human immunodeficiency virus type 1 and a surface antigen-negative hepatitis B virus variant.
Topics: Adenine; Alanine Transaminase; Amino Acid Sequence; Anti-HIV Agents; Follow-Up Studies; Hepatitis B; | 2006 |
Temporary HBV resolution in an HIV-coinfected patient during HBV-directed combination therapy followed by relapse of HBV.
Topics: Adenine; Adult; Antiviral Agents; CD4 Lymphocyte Count; Drug Administration Schedule; Drug Therapy, | 2006 |
Nonresponse to adefovir: host or virus dependent?
Topics: Adenine; Adult; Antiviral Agents; Female; Hepatitis B; Hepatitis B virus; Humans; Organophosphonates | 2006 |
Treatment of lamivudine-resistant hepatitis B infection in post-renal transplant patients with adefovir dipivoxil: preliminary results.
Topics: Adenine; Alanine Transaminase; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Follow-Up Studi | 2006 |
Successful treatment with adefovir of one patient whose cryoglobulinemic vasculitis relapsed under lamivudine therapy and who was diagnosed to have HBV virologic breakthrough with YMDD mutations.
Topics: Adenine; Amino Acid Motifs; Aspartic Acid; Cryoglobulinemia; Female; Hepatitis B; Hepatitis B virus; | 2006 |
Aminotransferase elevation in HIV/hepatitis B virus co-infected patients treated with two active hepatitis B virus drugs.
Topics: Adenine; Adult; Antiretroviral Therapy, Highly Active; DNA, Viral; Female; Hepatitis B; HIV Infectio | 2006 |
[Autoimmune thrombopenia associated with hepatitis B reactivation (reverse seroconversion) after autologous hematopoietic stem cell transplantation].
Topics: Adenine; Antineoplastic Combined Chemotherapy Protocols; Antiviral Agents; Hematopoietic Stem Cell T | 2007 |
Antiviral therapy for pre- and post-liver transplantation patients with hepatitis B.
Topics: Adenine; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Drug Therapy, Combination; Guanine; H | 2007 |
Combination therapy in liver transplant recipients with hepatitis B virus without hepatitis B immune globulin.
Topics: Adenine; Adult; Aged; Antibodies, Viral; Antiviral Agents; DNA, Viral; Drug Therapy, Combination; Fe | 2007 |
Response to Schmutz et al., 'Combination of tenofovir and lamivudine versus tenofovir after lamivudine failure for therapy of hepatitis B in HIV-coinfection'.
Topics: Adenine; Drug Therapy, Combination; Hepatitis B; HIV Infections; Humans; Lamivudine; Organophosphona | 2007 |
Improvements in parameters of end-stage liver disease in patients with HIV/HBV-related cirrhosis treated with tenofovir.
Topics: Adenine; CD4 Lymphocyte Count; DNA, Viral; Follow-Up Studies; Hepatitis B; Hepatitis B e Antigens; H | 2007 |
Emergence of hepatitis B virus quasispecies with lower susceptibility to nucleos(t)ide analogues during lamivudine treatment.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA-Directed DNA Polymerase; DNA, Viral; Drug Resistance, Vi | 2007 |
In vitro susceptibility of adefovir-associated hepatitis B virus polymerase mutations to other antiviral agents.
Topics: Adenine; Antiviral Agents; Cell Line, Tumor; DNA-Directed DNA Polymerase; DNA, Viral; Drug Resistanc | 2007 |
Evaluation of hexadecyloxypropyl-9-R-[2-(Phosphonomethoxy)propyl]- adenine, CMX157, as a potential treatment for human immunodeficiency virus type 1 and hepatitis B virus infections.
Topics: Adenine; Animals; Anti-HIV Agents; Antiviral Agents; Cell Line; Female; Hepatitis B; Hepatitis B vir | 2007 |
Pooled analysis of amino acid changes in the HBV polymerase in patients from four major adefovir dipivoxil clinical trials.
Topics: Adenine; Amino Acid Substitution; Antiviral Agents; Clinical Trials as Topic; DNA Mutational Analysi | 2007 |
Predictors and kinetics of occult hepatitis B virus infection in HIV-infected persons.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiretroviral Therapy, Highly Active; Biomar | 2007 |
Prophylaxis of hepatitis B recurrence in post-liver transplantation patients with lamivudine-resistant YMDD mutant.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA-Directed DNA Polymerase; Drug Resistance, Viral; Hepatit | 2007 |
[New German and American guidelines for therapy of hepatitis B. Discrepancies and similarities].
Topics: Adenine; Alanine Transaminase; Antiviral Agents; Biopsy; DNA, Viral; Drug Resistance, Viral; Drug Th | 2007 |
Development of a novel mouse model to evaluate drug candidates against hepatitis B virus.
Topics: Adenine; Animals; Antiviral Agents; Cell Line; Disease Models, Animal; Drug Evaluation, Preclinical; | 2007 |
Successful treatment of an entecavir-resistant hepatitis B virus variant.
Topics: Adenine; Adult; Antiviral Agents; Drug Administration Schedule; Drug Resistance, Multiple, Viral; Fe | 2007 |
Prophylaxsis against recurrance of hepatitis B virus after liver transplantation: a retrospective analysis spanning 20 years.
Topics: Adenine; Adult; Antiviral Agents; Dose-Response Relationship, Drug; Female; Hepatitis B; Hepatitis B | 2008 |
Adefovir dipivoxil therapy in liver transplant recipients for recurrence of hepatitis B virus infection despite lamivudine plus hepatitis B immunoglobulin prophylaxis.
Topics: Adenine; Adult; Antiviral Agents; Drug Therapy, Combination; Female; Hepatitis B; Hepatitis B virus; | 2007 |
Potency of tenofovir in chronic hepatitis B: mono or combination therapy?
Topics: Adenine; Antiviral Agents; Deoxycytidine; DNA, Viral; Drug Therapy, Combination; Emtricitabine; Guan | 2008 |
[Kinetics of HBV mutants conferring adefovir resistance (rtn236t) and a method to detect them rapidly].
Topics: Adenine; Adult; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Hepatitis B; Hepatitis B virus | 2008 |
Impact of hepatitis B virus rtA181V/T mutants on hepatitis B treatment failure.
Topics: Adenine; Amino Acid Sequence; DNA, Viral; Drug Resistance, Viral; Hepatitis B; Hepatitis B virus; Hu | 2008 |
Adefovir and lamivudine in combination compared with adefovir monotherapy in HBeAg-negative adults with chronic hepatitis B virus infection and clinical or virologic resistance to lamivudine: a retrospective, multicenter, nonrandomized, open-label study.
Topics: Adenine; Adult; Aged; Alanine Transaminase; Antiviral Agents; DNA, Viral; Drug Resistance, Viral; Dr | 2008 |
Antibody to hepatitis B surface antigen trough levels and half-lives do not differ after intravenous and intramuscular hepatitis B immunoglobulin administration after liver transplantation.
Topics: Adenine; Adult; Aged; Antiviral Agents; DNA, Viral; Drug Administration Schedule; Female; Hepatitis | 2008 |
Severe acute pancreatitis related to the use of adefovir in a liver transplant recipient.
Topics: Acute Disease; Adenine; Aged; Antiviral Agents; Hepatitis B; Humans; Liver Transplantation; Male; Or | 2008 |
Viral persistence after liver transplantation for hepatitis B virus: a cross-sectional study.
Topics: Adenine; Adult; Aged; Cross-Sectional Studies; DNA, Viral; Female; Hepatitis B; Hepatitis B virus; H | 2008 |
Hepatitis B virus genotype A2 harbours an L217R polymorphism which may account for a lower response to adefovir.
Topics: Adenine; Adult; Amino Acid Substitution; Antiviral Agents; Drug Resistance, Viral; Female; Genotype; | 2008 |
[Acute hepatitis B: is antiviral therapy indicated? Two case reports].
Topics: Acute Disease; Adenine; Adult; Algorithms; Antiviral Agents; Bilirubin; DNA, Viral; Drug Therapy, Co | 2008 |
Nucleotide sequence analysis of the precore region in patients with fulminant hepatitis B in the United States.
Topics: Adenine; Adolescent; Adult; Aged; Aged, 80 and over; Base Sequence; DNA, Viral; Female; Gene Amplifi | 1993 |
Assessment of peripheral blood mononuclear cell proliferation by [2-3H]adenine uptake in the woodchuck model.
Topics: Adenine; Animals; Animals, Wild; Cell Division; Cells, Cultured; Disease Models, Animal; Hepatitis B | 1996 |
Naturally occurring hepatitis B virus genomes bearing the hallmarks of retroviral G-->A hypermutation.
Topics: Adenine; Base Sequence; Carrier State; Dinucleoside Phosphates; DNA Primers; DNA, Viral; Frameshift | 1997 |
Determination of peripheral blood mononuclear cell responses to mitogens and woodchuck hepatitis virus core antigen in woodchucks by 5-bromo-2'-deoxyuridine or 2[3H]adenine incorporation.
Topics: Adenine; Animals; Bromodeoxyuridine; Cell Division; Concanavalin A; DNA; Hepatitis B; Hepatitis B Co | 1997 |
Evaluation of anti-hepatitis B virus (HBV) drugs using the HBV transgenic mouse: application of the semiquantitative polymerase chain reaction (PCR) for serum HBV DNA to monitor the drug efficacy.
Topics: Adenine; Animals; Antiviral Agents; DNA Replication; DNA, Viral; Drug Monitoring; Hepatitis B; Hepat | 1997 |
Hepatitis C virus infection associated with human hepatocellular carcinoma: lack of correlation with p53 abnormalities in Caucasian patients.
Topics: Adenine; Aged; Carcinoma, Hepatocellular; Codon; Cohort Studies; DNA, Viral; Exons; Female; Genes, p | 1998 |
Fulminant hepatic failure resulting from lamivudine-resistant hepatitis B virus in a renal transplant recipient: durable response after orthotopic liver transplantation on adefovir dipivoxil and hepatitis B immune globulin.
Topics: Adenine; Adult; Antiviral Agents; Carrier State; DNA-Directed DNA Polymerase; Drug Resistance; Femal | 1999 |
Carrier-mediated delivery of 9-(2-phosphonylmethoxyethyl)adenine to parenchymal liver cells: a novel therapeutic approach for hepatitis B.
Topics: Adenine; Animals; Antiviral Agents; Chromatography; Drug Carriers; Hepatitis B; Lipoproteins, HDL; L | 2000 |
Incidental treatment of hepatitis B virus infection in an AIDS patient.
Topics: Acquired Immunodeficiency Syndrome; Adenine; Adult; Anti-HIV Agents; Antiviral Agents; Drug Therapy, | 2000 |
Mechanistic study on the cytostatic and tumor cell differentiation-inducing properties of 9-(2-phosphonylmethoxyethyl)adenine (PMEA, adefovir)-collected publications.
Topics: Adenine; Animals; Antineoplastic Agents; Antiviral Agents; Cell Differentiation; Cell Division; Cell | 2000 |
[Current treatment of hepatitis B].
Topics: 2-Aminopurine; Adenine; Anti-Inflammatory Agents; Antiviral Agents; DNA Replication; Famciclovir; Fo | 2001 |
Adefovir dipivoxil (Preveon) new results with hepatitis B, HIV.
Topics: Adenine; Anti-HIV Agents; Antiviral Agents; Clinical Trials as Topic; Drug Therapy, Combination; Dru | 1998 |
Preveon expanded access program broadened.
Topics: Adenine; Anti-HIV Agents; Antiviral Agents; Drug Therapy, Combination; Hepatitis B; HIV Infections; | 1998 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Safety and efficacy of adefovir dipivoxil in patients co-infected with HIV-1 and lamivudine-resistant hepatitis B virus: an open-label pilot study.
Topics: Adenine; Adult; Alanine Transaminase; Anti-HIV Agents; Antiviral Agents; DNA, Viral; Drug Administra | 2001 |
Antiviral efficacy and pharmacokinetics of oral adefovir dipivoxil in chronically woodchuck hepatitis virus-infected woodchucks.
Topics: Adenine; Administration, Oral; Animals; Chemistry, Clinical; Chronic Disease; Disease Models, Animal | 2001 |
Inhibitory effect of adefovir on viral DNA synthesis and covalently closed circular DNA formation in duck hepatitis B virus-infected hepatocytes in vivo and in vitro.
Topics: Adenine; Animals; Antiviral Agents; Disease Models, Animal; DNA, Circular; DNA, Viral; Ducks; Hepati | 2002 |
Characterizing antiviral activity of adefovir dipivoxil in transgenic mice expressing hepatitis B virus.
Topics: Adenine; Administration, Oral; Animals; Antiviral Agents; Disease Models, Animal; DNA, Viral; Dose-R | 2002 |